schema.json

{
    "nodes": [
        {
            "node": "SNOMEDCT US",
            "example": [
                "Metastasis from malignant tumor of colon",
                "Myoclonic seizure"
            ],
            "display": [
                {
                    "label": "SNOMEDCT US ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "SNOMEDCT_US"
            ],
            "color": "#35d71c"
        },
        {
            "node": "Nucleic Acid, Nucleoside, or Nucleotide",
            "example": [
                "acyclovir",
                "succinyl-coenzyme A"
            ],
            "display": [
                {
                    "label": "Nucleic Acid, Nucleoside, or Nucleotide ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "VANDF",
                    "text": "${VANDF}",
                    "type": "text"
                },
                {
                    "label": "GS",
                    "text": "${GS}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "DRUGBANK",
                    "text": "${DRUGBANK}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "MMSL",
                    "text": "${MMSL}",
                    "type": "text"
                },
                {
                    "label": "ATC",
                    "text": "${ATC}",
                    "type": "text"
                },
                {
                    "label": "RXNORM",
                    "text": "${RXNORM}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "USP",
                    "text": "${USP}",
                    "type": "text"
                },
                {
                    "label": "MTHSPL",
                    "text": "${MTHSPL}",
                    "type": "text"
                },
                {
                    "label": "NDDF",
                    "text": "${NDDF}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "USPMG",
                    "text": "${USPMG}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "CPM",
                    "text": "${CPM}",
                    "type": "text"
                },
                {
                    "label": "HCPCS",
                    "text": "${HCPCS}",
                    "type": "text"
                },
                {
                    "label": "CHEBI",
                    "text": "${CHEBI}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "Pharmacologic Substance",
                    "text": "${Pharmacologic Substance}",
                    "type": "text"
                },
                {
                    "label": "Antibiotic",
                    "text": "${Antibiotic}",
                    "type": "text"
                },
                {
                    "label": "Biologically Active Substance",
                    "text": "${Biologically Active Substance}",
                    "type": "text"
                },
                {
                    "label": "Vitamin",
                    "text": "${Vitamin}",
                    "type": "text"
                },
                {
                    "label": "Hazardous or Poisonous Substance",
                    "text": "${Hazardous or Poisonous Substance}",
                    "type": "text"
                },
                {
                    "label": "Immunologic Factor",
                    "text": "${Immunologic Factor}",
                    "type": "text"
                },
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid",
                    "text": "${Indicator, Reagent, or Diagnostic Aid}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "VANDF",
                "GS",
                "CHV",
                "CSP",
                "SNOMEDCT_US",
                "DRUGBANK",
                "PDQ",
                "NCI",
                "MTH",
                "LNC",
                "MMSL",
                "ATC",
                "RXNORM",
                "LCH_NW",
                "USP",
                "MTHSPL",
                "NDDF",
                "FMA",
                "MEDCIN",
                "USPMG",
                "PSY",
                "CPM",
                "HCPCS",
                "CHEBI",
                "PUBCHEM",
                "Pharmacologic Substance",
                "Antibiotic",
                "Biologically Active Substance",
                "Vitamin",
                "Hazardous or Poisonous Substance",
                "Immunologic Factor",
                "Indicator, Reagent, or Diagnostic Aid"
            ],
            "color": "#ff9600"
        },
        {
            "node": "ENCODE RBS HEPG2",
            "example": [
                "chr9.137380266.137380331.minus.b38.FAM120A",
                "chr16.89546661.89546702.plus.b38.PPIG"
            ],
            "display": [
                {
                    "label": "ENCODE RBS HEPG2 ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ENCODE.RBS.HEPG2",
                    "text": "${ENCODE.RBS.HEPG2}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "ENCODE.RBS.HEPG2"
            ],
            "color": "#ff79ff"
        },
        {
            "node": "Disease",
            "example": [
                "megacystis-microcolon-intestinal hypoperistalsis syndrome",
                "optic nerve edema-splenomegaly syndrome"
            ],
            "display": [
                {
                    "label": "Disease ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "DOID",
                "ORPHANET",
                "MONDO",
                "HP"
            ],
            "color": "#00caff"
        },
        {
            "node": "4DND",
            "example": [
                "in situ Hi-C on HCT116 cells (containing AID-tagged WAPL) auxin treated.HCT116 - perturbed",
                "Micro-C on H1-ESC cells.H1-ESC"
            ],
            "display": [
                {
                    "label": "4DND ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "4DND",
                    "text": "${4DND}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "4DND"
            ],
            "color": "#00f7ca"
        },
        {
            "node": "Cell Function",
            "example": [
                "regulation of calcium ion concentration",
                "male meiotic nuclear division"
            ],
            "display": [
                {
                    "label": "Cell Function ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "GO",
                    "text": "${GO}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "PATO",
                    "text": "${PATO}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "GO",
                "NCI",
                "CSP",
                "MTH",
                "CHV",
                "LCH_NW",
                "PATO",
                "MP"
            ],
            "color": "#aeba8e"
        },
        {
            "node": "Individual Behavior",
            "example": [
                "Nail Biting",
                "Stereotyped Behavior"
            ],
            "display": [
                {
                    "label": "Individual Behavior ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "CHV",
                "LCH_NW",
                "SNOMEDCT_US",
                "MTH",
                "PSY",
                "NCI",
                "NOC",
                "SNOMEDCT_VET",
                "MEDCIN",
                "MDR",
                "MTHICD9",
                "ICD10CM",
                "ICPC2ICD10ENG",
                "OMIM",
                "ICPC2P",
                "HPO",
                "ORPHANET",
                "MONDO",
                "HP"
            ],
            "color": "#ffaeb6"
        },
        {
            "node": "Injury or Poisoning",
            "example": [
                "Multiple small vertebral fractures",
                "Femoral Fractures"
            ],
            "display": [
                {
                    "label": "Injury or Poisoning ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "CCS",
                    "text": "${CCS}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "ICD10AMAE",
                    "text": "${ICD10AMAE}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "ICD10AE",
                    "text": "${ICD10AE}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "ICNP",
                    "text": "${ICNP}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "ICPC2EENG",
                    "text": "${ICPC2EENG}",
                    "type": "text"
                },
                {
                    "label": "AOT",
                    "text": "${AOT}",
                    "type": "text"
                },
                {
                    "label": "OMS",
                    "text": "${OMS}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "ICPC2P",
                "ICD10",
                "PSY",
                "CCS",
                "CSP",
                "ICPC2ICD10ENG",
                "NANDA-I",
                "ICD9CM",
                "OMIM",
                "CHV",
                "NCI",
                "MEDLINEPLUS",
                "ICD10CM",
                "MEDCIN",
                "SNOMEDCT_US",
                "MSH",
                "MDR",
                "HPO",
                "MTHICD9",
                "MTH",
                "LNC",
                "ICD10AM",
                "ICD10AMAE",
                "SNOMEDCT_VET",
                "ICD10AE",
                "LCH_NW",
                "ORPHANET",
                "ICNP",
                "PDQ",
                "NOC",
                "ICPC2EENG",
                "AOT",
                "OMS",
                "DOID",
                "MONDO",
                "HP",
                "EFO"
            ],
            "color": "#cac2ff"
        },
        {
            "node": "Antibiotic",
            "example": [
                "pramanicin",
                "valclavam"
            ],
            "display": [
                {
                    "label": "Antibiotic ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "Biologically Active Substance",
                    "text": "${Biologically Active Substance}",
                    "type": "text"
                },
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid",
                    "text": "${Indicator, Reagent, or Diagnostic Aid}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "PUBCHEM",
                "Biologically Active Substance",
                "Indicator, Reagent, or Diagnostic Aid"
            ],
            "color": "#e3d700"
        },
        {
            "node": "Organism Attribute",
            "example": [
                "Anticipation, Genetic"
            ],
            "display": [
                {
                    "label": "Organism Attribute ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "NCI",
                "MSH",
                "HPO"
            ],
            "color": "#aed2d7"
        },
        {
            "node": "AZ",
            "example": [
                "effector memory CD8-positive, alpha-beta T cell"
            ],
            "display": [
                {
                    "label": "AZ ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CL",
                    "text": "${CL}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                },
                {
                    "label": "AZ",
                    "text": "${AZ}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CL",
                "MP",
                "AZ"
            ],
            "color": "#9eeb92"
        },
        {
            "node": "Anatomical Abnormality",
            "example": [
                "Abnormal number of incisors",
                "Abnormal radial metaphysis morphology"
            ],
            "display": [
                {
                    "label": "Anatomical Abnormality ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "ICPC2EENG",
                    "text": "${ICPC2EENG}",
                    "type": "text"
                },
                {
                    "label": "HL7V3.0",
                    "text": "${HL7V3.0}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "CCS",
                    "text": "${CCS}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "HPO",
                "MEDCIN",
                "NCI",
                "MSH",
                "ICPC2ICD10ENG",
                "ICD10AM",
                "ICD10",
                "ICD10CM",
                "CHV",
                "MTH",
                "SNOMEDCT_US",
                "LCH_NW",
                "OMIM",
                "LNC",
                "MDR",
                "MTHICD9",
                "ICD9CM",
                "ICPC2P",
                "CSP",
                "SNOMEDCT_VET",
                "NANDA-I",
                "ICPC2EENG",
                "HL7V3.0",
                "UWDA",
                "FMA",
                "CCS",
                "ORPHANET",
                "NOC",
                "MEDLINEPLUS",
                "PDQ",
                "DOID",
                "HP",
                "MONDO",
                "EFO"
            ],
            "color": "#fbca82"
        },
        {
            "node": "Biologically Active Substance",
            "example": [
                "quercitrin",
                "Keratan"
            ],
            "display": [
                {
                    "label": "Biologically Active Substance ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "Chemical Viewed Structurally",
                    "text": "${Chemical Viewed Structurally}",
                    "type": "text"
                },
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid",
                    "text": "${Indicator, Reagent, or Diagnostic Aid}",
                    "type": "text"
                },
                {
                    "label": "Element, Ion, or Isotope",
                    "text": "${Element, Ion, or Isotope}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "FMA",
                "PUBCHEM",
                "Chemical Viewed Structurally",
                "Indicator, Reagent, or Diagnostic Aid",
                "Element, Ion, or Isotope"
            ],
            "color": "#ffbafb"
        },
        {
            "node": "Cell",
            "example": [
                "lymphoblast",
                "Cells"
            ],
            "display": [
                {
                    "label": "Cell ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "CPM",
                    "text": "${CPM}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "CL",
                    "text": "${CL}",
                    "type": "text"
                },
                {
                    "label": "CARO",
                    "text": "${CARO}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                },
                {
                    "label": "AZ",
                    "text": "${AZ}",
                    "type": "text"
                },
                {
                    "label": "Immunologic Factor",
                    "text": "${Immunologic Factor}",
                    "type": "text"
                },
                {
                    "label": "Cell Component",
                    "text": "${Cell Component}",
                    "type": "text"
                },
                {
                    "label": "Pharmacologic Substance",
                    "text": "${Pharmacologic Substance}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "SNOMEDCT_US",
                "CHV",
                "NCI",
                "FMA",
                "CSP",
                "MSH",
                "LNC",
                "MTH",
                "PSY",
                "LCH_NW",
                "UWDA",
                "OMIM",
                "CPM",
                "HPO",
                "CL",
                "CARO",
                "MP",
                "EFO",
                "AZ",
                "Immunologic Factor",
                "Cell Component",
                "Pharmacologic Substance"
            ],
            "color": "#c2aebe"
        },
        {
            "node": "Pathologic Function",
            "example": [
                "Abnormality of reproductive system physiology",
                "Recurrent intrapulmonary hemorrhage"
            ],
            "display": [
                {
                    "label": "Pathologic Function ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GO",
                    "text": "${GO}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "ICD10AE",
                    "text": "${ICD10AE}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "ICD10AMAE",
                    "text": "${ICD10AMAE}",
                    "type": "text"
                },
                {
                    "label": "HL7V2.5",
                    "text": "${HL7V2.5}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "ICPC2EENG",
                    "text": "${ICPC2EENG}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "CCS",
                    "text": "${CCS}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "OMS",
                    "text": "${OMS}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "CCSR_ICD10CM",
                    "text": "${CCSR_ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "ICNP",
                    "text": "${ICNP}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "HL7V3.0",
                    "text": "${HL7V3.0}",
                    "type": "text"
                },
                {
                    "label": "MTHICPC2EAE",
                    "text": "${MTHICPC2EAE}",
                    "type": "text"
                },
                {
                    "label": "ICF-CY",
                    "text": "${ICF-CY}",
                    "type": "text"
                },
                {
                    "label": "ICF",
                    "text": "${ICF}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "GO",
                "SNOMEDCT_US",
                "ICPC2ICD10ENG",
                "CHV",
                "ICD10CM",
                "MEDCIN",
                "MSH",
                "MDR",
                "OMIM",
                "CSP",
                "ICD10AE",
                "ICD9CM",
                "LNC",
                "ICD10AM",
                "HPO",
                "NCI",
                "ICD10",
                "MTHICD9",
                "MTH",
                "ICPC2P",
                "PDQ",
                "ICD10AMAE",
                "HL7V2.5",
                "SNOMEDCT_VET",
                "ORPHANET",
                "PSY",
                "ICPC2EENG",
                "NOC",
                "CCS",
                "MEDLINEPLUS",
                "OMS",
                "LCH_NW",
                "CCSR_ICD10CM",
                "NANDA-I",
                "ICNP",
                "UWDA",
                "HL7V3.0",
                "MTHICPC2EAE",
                "ICF-CY",
                "ICF",
                "DOID",
                "HP",
                "MONDO",
                "EFO",
                "MP"
            ],
            "color": "#18ceca"
        },
        {
            "node": "ENCODE CCRE",
            "example": [
                "ENCODE.CCRE:EH38E2216735 CUI",
                "ENCODE.CCRE:EH38E3555767 CUI"
            ],
            "display": [
                {
                    "label": "ENCODE CCRE ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ENCODE.CCRE",
                    "text": "${ENCODE.CCRE}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "ENCODE.CCRE",
                "label"
            ],
            "color": "#a2c249"
        },
        {
            "node": "Organ or Tissue Function",
            "example": [
                "central nervous system development",
                "ear morphogenesis"
            ],
            "display": [
                {
                    "label": "Organ or Tissue Function ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "GO",
                    "text": "${GO}",
                    "type": "text"
                },
                {
                    "label": "ICF-CY",
                    "text": "${ICF-CY}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "ICF",
                    "text": "${ICF}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CHV",
                "LCH_NW",
                "CSP",
                "PSY",
                "MSH",
                "MTH",
                "NCI",
                "SNOMEDCT_US",
                "GO",
                "ICF-CY",
                "NOC",
                "ICF",
                "MDR",
                "ICPC2ICD10ENG",
                "HPO",
                "MP"
            ],
            "color": "#79caa2"
        },
        {
            "node": "Finding",
            "example": [
                "Low posterior hairline",
                "Prominent joints"
            ],
            "display": [
                {
                    "label": "Finding ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "CPM",
                    "text": "${CPM}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "ICPC2EENG",
                    "text": "${ICPC2EENG}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "ICD10AE",
                    "text": "${ICD10AE}",
                    "type": "text"
                },
                {
                    "label": "HL7V3.0",
                    "text": "${HL7V3.0}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "ICNP",
                    "text": "${ICNP}",
                    "type": "text"
                },
                {
                    "label": "CCC",
                    "text": "${CCC}",
                    "type": "text"
                },
                {
                    "label": "AOT",
                    "text": "${AOT}",
                    "type": "text"
                },
                {
                    "label": "OMS",
                    "text": "${OMS}",
                    "type": "text"
                },
                {
                    "label": "PNDS",
                    "text": "${PNDS}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "ICD10AMAE",
                    "text": "${ICD10AMAE}",
                    "type": "text"
                },
                {
                    "label": "CCS",
                    "text": "${CCS}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "CCSR_ICD10CM",
                    "text": "${CCSR_ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "ICF-CY",
                    "text": "${ICF-CY}",
                    "type": "text"
                },
                {
                    "label": "ICF",
                    "text": "${ICF}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "UBERON",
                    "text": "${UBERON}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MTH",
                "SNOMEDCT_US",
                "MDR",
                "ICD10",
                "LNC",
                "ICPC2P",
                "ICPC2ICD10ENG",
                "NCI",
                "MSH",
                "LCH_NW",
                "CHV",
                "MEDCIN",
                "CPM",
                "ICD9CM",
                "HPO",
                "ICPC2EENG",
                "ICD10CM",
                "SNOMEDCT_VET",
                "OMIM",
                "MTHICD9",
                "ICD10AM",
                "ICD10AE",
                "HL7V3.0",
                "NOC",
                "MEDLINEPLUS",
                "NANDA-I",
                "PSY",
                "ICNP",
                "CCC",
                "AOT",
                "OMS",
                "PNDS",
                "PDQ",
                "CSP",
                "ICD10AMAE",
                "CCS",
                "ORPHANET",
                "CCSR_ICD10CM",
                "ICF-CY",
                "ICF",
                "FMA",
                "UBERON",
                "DOID",
                "MONDO",
                "HP",
                "EFO",
                "PUBCHEM"
            ],
            "color": "#ff9269"
        },
        {
            "node": "Organic Chemical",
            "example": [
                "gliclazide",
                "pentane"
            ],
            "display": [
                {
                    "label": "Organic Chemical ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ATC",
                    "text": "${ATC}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "VANDF",
                    "text": "${VANDF}",
                    "type": "text"
                },
                {
                    "label": "DRUGBANK",
                    "text": "${DRUGBANK}",
                    "type": "text"
                },
                {
                    "label": "RXNORM",
                    "text": "${RXNORM}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "MMSL",
                    "text": "${MMSL}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "GS",
                    "text": "${GS}",
                    "type": "text"
                },
                {
                    "label": "MTHSPL",
                    "text": "${MTHSPL}",
                    "type": "text"
                },
                {
                    "label": "USP",
                    "text": "${USP}",
                    "type": "text"
                },
                {
                    "label": "NDDF",
                    "text": "${NDDF}",
                    "type": "text"
                },
                {
                    "label": "SPN",
                    "text": "${SPN}",
                    "type": "text"
                },
                {
                    "label": "USPMG",
                    "text": "${USPMG}",
                    "type": "text"
                },
                {
                    "label": "HL7V3.0",
                    "text": "${HL7V3.0}",
                    "type": "text"
                },
                {
                    "label": "CPM",
                    "text": "${CPM}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "ALT",
                    "text": "${ALT}",
                    "type": "text"
                },
                {
                    "label": "UMD",
                    "text": "${UMD}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "HCPCS",
                    "text": "${HCPCS}",
                    "type": "text"
                },
                {
                    "label": "HL7V2.5",
                    "text": "${HL7V2.5}",
                    "type": "text"
                },
                {
                    "label": "CHEBI",
                    "text": "${CHEBI}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "HMDB",
                    "text": "${HMDB}",
                    "type": "text"
                },
                {
                    "label": "Element, Ion, or Isotope",
                    "text": "${Element, Ion, or Isotope}",
                    "type": "text"
                },
                {
                    "label": "Antibiotic",
                    "text": "${Antibiotic}",
                    "type": "text"
                },
                {
                    "label": "Chemical Viewed Functionally",
                    "text": "${Chemical Viewed Functionally}",
                    "type": "text"
                },
                {
                    "label": "Biologically Active Substance",
                    "text": "${Biologically Active Substance}",
                    "type": "text"
                },
                {
                    "label": "Hazardous or Poisonous Substance",
                    "text": "${Hazardous or Poisonous Substance}",
                    "type": "text"
                },
                {
                    "label": "Vitamin",
                    "text": "${Vitamin}",
                    "type": "text"
                },
                {
                    "label": "Biomedical or Dental Material",
                    "text": "${Biomedical or Dental Material}",
                    "type": "text"
                },
                {
                    "label": "Food",
                    "text": "${Food}",
                    "type": "text"
                },
                {
                    "label": "Drug Delivery Device",
                    "text": "${Drug Delivery Device}",
                    "type": "text"
                },
                {
                    "label": "Immunologic Factor",
                    "text": "${Immunologic Factor}",
                    "type": "text"
                },
                {
                    "label": "Pharmacologic Substance",
                    "text": "${Pharmacologic Substance}",
                    "type": "text"
                },
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid",
                    "text": "${Indicator, Reagent, or Diagnostic Aid}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "ATC",
                "CHV",
                "VANDF",
                "DRUGBANK",
                "RXNORM",
                "MSH",
                "MTH",
                "SNOMEDCT_US",
                "LNC",
                "CSP",
                "NCI",
                "LCH_NW",
                "MMSL",
                "MEDCIN",
                "PDQ",
                "GS",
                "MTHSPL",
                "USP",
                "NDDF",
                "SPN",
                "USPMG",
                "HL7V3.0",
                "CPM",
                "PSY",
                "MEDLINEPLUS",
                "ALT",
                "UMD",
                "SNOMEDCT_VET",
                "FMA",
                "UWDA",
                "HCPCS",
                "HL7V2.5",
                "CHEBI",
                "PUBCHEM",
                "HMDB",
                "Element, Ion, or Isotope",
                "Antibiotic",
                "Chemical Viewed Functionally",
                "Biologically Active Substance",
                "Hazardous or Poisonous Substance",
                "Vitamin",
                "Biomedical or Dental Material",
                "Food",
                "Drug Delivery Device",
                "Immunologic Factor",
                "Pharmacologic Substance",
                "Indicator, Reagent, or Diagnostic Aid"
            ],
            "color": "#ff86c2"
        },
        {
            "node": "GTEXEQTL",
            "example": [
                "GTEXEQTL:eQTL.chr6.42953935.AG.A.b38.Adipose.Visceral.Omentum CUI",
                "GTEXEQTL:eQTL.chr17.30581725.G.T.b38.Brain.Cerebellar.Hemisphere CUI"
            ],
            "display": [
                {
                    "label": "GTEXEQTL ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GTEXEQTL",
                    "text": "${GTEXEQTL}",
                    "type": "text"
                },
                {
                    "label": "GTEXEQTL value",
                    "text": "${GTEXEQTL value}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "GTEXEQTL",
                "label"
            ],
            "color": "#8ebaff"
        },
        {
            "node": "Diagnostic Procedure",
            "example": [
                "Intraosseous venography",
                "Tomography, Emission-Computed, Single-Photon"
            ],
            "display": [
                {
                    "label": "Diagnostic Procedure ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "CCSR_ICD10PCS",
                    "text": "${CCSR_ICD10PCS}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "CPT",
                    "text": "${CPT}",
                    "type": "text"
                },
                {
                    "label": "HCPT",
                    "text": "${HCPT}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "ICD10PCS",
                    "text": "${ICD10PCS}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "HL7V2.5",
                    "text": "${HL7V2.5}",
                    "type": "text"
                },
                {
                    "label": "CCS",
                    "text": "${CCS}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "HL7V3.0",
                    "text": "${HL7V3.0}",
                    "type": "text"
                },
                {
                    "label": "AOT",
                    "text": "${AOT}",
                    "type": "text"
                },
                {
                    "label": "Disease or Syndrome",
                    "text": "${Disease or Syndrome}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "PSY",
                "MSH",
                "ICPC2P",
                "MDR",
                "CCSR_ICD10PCS",
                "CSP",
                "SNOMEDCT_US",
                "ICD9CM",
                "MTH",
                "MTHICD9",
                "LNC",
                "MEDCIN",
                "CPT",
                "HCPT",
                "CHV",
                "ICD10AM",
                "NCI",
                "PDQ",
                "ICD10PCS",
                "LCH_NW",
                "NOC",
                "HL7V2.5",
                "CCS",
                "MEDLINEPLUS",
                "HL7V3.0",
                "AOT",
                "Disease or Syndrome"
            ],
            "color": "#a2ef00"
        },
        {
            "node": "Intellectual Product",
            "example": [
                "Universal Product Code",
                "Frequency"
            ],
            "display": [
                {
                    "label": "Intellectual Product ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "HL7V2.5",
                    "text": "${HL7V2.5}",
                    "type": "text"
                },
                {
                    "label": "HL7V3.0",
                    "text": "${HL7V3.0}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MTH",
                "HL7V2.5",
                "HL7V3.0",
                "HPO",
                "PUBCHEM"
            ],
            "color": "#d2aa92"
        },
        {
            "node": "MOTORPAC",
            "example": [
                "MOTORPAC:ENSRNOG00000016727-heart-male CUI",
                "MOTORPAC:ENSRNOG00000003979-liver-male CUI"
            ],
            "display": [
                {
                    "label": "MOTORPAC ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MOTORPAC",
                    "text": "${MOTORPAC}",
                    "type": "text"
                },
                {
                    "label": "MOTORPAC value",
                    "text": "${MOTORPAC value}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "MOTORPAC",
                "label"
            ],
            "color": "#d7ae24"
        },
        {
            "node": "GTEXEXP",
            "example": [
                "GTEXEXP:ENSG00000207981-1-Adrenal-Gland CUI",
                "GTEXEXP:ENSG00000047365-11-Kidney-Medulla CUI"
            ],
            "display": [
                {
                    "label": "GTEXEXP ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GTEXEXP",
                    "text": "${GTEXEXP}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "GTEXEXP",
                "label"
            ],
            "color": "#71ebff"
        },
        {
            "node": "Drug",
            "example": [
                "7-chloro-8-(2-methoxy-ethoxy)-3-oxo-11,17-dioxa-2,4,20,22-tetraaza-tricyclo[16.3.1.0 5,10]docosa-1(22),5(10),6,8,18,20-hexaene-19-carbonitrile",
                "alpha-Phellandrene"
            ],
            "display": [
                {
                    "label": "Drug ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CHEBI",
                    "text": "${CHEBI}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CHEBI",
                "PUBCHEM"
            ],
            "color": "#d79efb"
        },
        {
            "node": "Mental or Behavioral Dysfunction",
            "example": [
                "Depression, Bipolar",
                "INTELLECTUAL DEVELOPMENTAL DISORDER, AUTOSOMAL DOMINANT 45"
            ],
            "display": [
                {
                    "label": "Mental or Behavioral Dysfunction ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "DSM-5",
                    "text": "${DSM-5}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "ICD10AE",
                    "text": "${ICD10AE}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "ICD10AMAE",
                    "text": "${ICD10AMAE}",
                    "type": "text"
                },
                {
                    "label": "CCS",
                    "text": "${CCS}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "ICNP",
                    "text": "${ICNP}",
                    "type": "text"
                },
                {
                    "label": "CCSR_ICD10CM",
                    "text": "${CCSR_ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "ICPC2EENG",
                    "text": "${ICPC2EENG}",
                    "type": "text"
                },
                {
                    "label": "CCC",
                    "text": "${CCC}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "CPM",
                    "text": "${CPM}",
                    "type": "text"
                },
                {
                    "label": "OMS",
                    "text": "${OMS}",
                    "type": "text"
                },
                {
                    "label": "PNDS",
                    "text": "${PNDS}",
                    "type": "text"
                },
                {
                    "label": "USPMG",
                    "text": "${USPMG}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "MFOMD",
                    "text": "${MFOMD}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "ICPC2ICD10ENG",
                "CHV",
                "MEDCIN",
                "LCH_NW",
                "NOC",
                "MDR",
                "DSM-5",
                "ICD10AM",
                "PSY",
                "ICD10CM",
                "OMIM",
                "ICPC2P",
                "ICD9CM",
                "MTHICD9",
                "NCI",
                "SNOMEDCT_US",
                "MTH",
                "ICD10AE",
                "HPO",
                "LNC",
                "ORPHANET",
                "ICD10",
                "CSP",
                "ICD10AMAE",
                "CCS",
                "NANDA-I",
                "MEDLINEPLUS",
                "ICNP",
                "CCSR_ICD10CM",
                "ICPC2EENG",
                "CCC",
                "SNOMEDCT_VET",
                "PDQ",
                "CPM",
                "OMS",
                "PNDS",
                "USPMG",
                "DOID",
                "MONDO",
                "HP",
                "MFOMD",
                "EFO"
            ],
            "color": "#dbd2ba"
        },
        {
            "node": "Genetic Function",
            "example": [
                "Autosomal dominant somatic cell mutation",
                "X-linked inheritance"
            ],
            "display": [
                {
                    "label": "Genetic Function ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "GO",
                    "text": "${GO}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CSP",
                "MSH",
                "GO",
                "MTH",
                "NCI",
                "LCH_NW",
                "CHV",
                "OMIM",
                "LNC",
                "SNOMEDCT_US",
                "HPO",
                "MP",
                "HP"
            ],
            "color": "#00df7d"
        },
        {
            "node": "4DNF",
            "example": [
                "in situ Hi-C on HFFc6 cells.HFFc6.more conservative.Cremins",
                "Micro-C on HFFc6 cells.HFFc6..Dekker"
            ],
            "display": [
                {
                    "label": "4DNF ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "4DNF",
                    "text": "${4DNF}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "4DNF"
            ],
            "color": "#d2db7d"
        },
        {
            "node": "KFPT",
            "example": [
                "KFPT:PT-PBVKZCS6 CUI",
                "KFPT:PT-EZ5RMAEC CUI"
            ],
            "display": [
                {
                    "label": "KFPT ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "KFPT",
                    "text": "${KFPT}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "KFPT",
                "label"
            ],
            "color": "#d7d2e3"
        },
        {
            "node": "ENCODE RBS K562",
            "example": [
                "chr19.40614233.40614309.plus.b38.ILF3",
                "chr7.123542064.123542110.minus.b38.PABPC4"
            ],
            "display": [
                {
                    "label": "ENCODE RBS K562 ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ENCODE.RBS.K562",
                    "text": "${ENCODE.RBS.K562}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "ENCODE.RBS.K562"
            ],
            "color": "#aab6ce"
        },
        {
            "node": "UNIPROT",
            "example": [
                "Protein",
                "Glycosylation Site"
            ],
            "display": [
                {
                    "label": "UNIPROT ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "UNIPROT",
                    "text": "${UNIPROT}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "UNIPROT"
            ],
            "color": "#b6dfbe"
        },
        {
            "node": "Congenital Abnormality",
            "example": [
                "Bilateral Superior Vena Cava",
                "Dysgenesis of the hippocampus"
            ],
            "display": [
                {
                    "label": "Congenital Abnormality ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "ICD10AMAE",
                    "text": "${ICD10AMAE}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "HL7V3.0",
                    "text": "${HL7V3.0}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "CCS",
                    "text": "${CCS}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "ICD10AE",
                    "text": "${ICD10AE}",
                    "type": "text"
                },
                {
                    "label": "ICPC2EENG",
                    "text": "${ICPC2EENG}",
                    "type": "text"
                },
                {
                    "label": "CCSR_ICD10CM",
                    "text": "${CCSR_ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "MTHICPC2ICD10AE",
                    "text": "${MTHICPC2ICD10AE}",
                    "type": "text"
                },
                {
                    "label": "MTHICPC2EAE",
                    "text": "${MTHICPC2EAE}",
                    "type": "text"
                },
                {
                    "label": "UBERON",
                    "text": "${UBERON}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                },
                {
                    "label": "PATO",
                    "text": "${PATO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MDR",
                "MTH",
                "ICD10CM",
                "CHV",
                "ICPC2ICD10ENG",
                "OMIM",
                "MSH",
                "NCI",
                "MTHICD9",
                "ICD10",
                "ORPHANET",
                "SNOMEDCT_US",
                "ICD9CM",
                "MEDCIN",
                "HPO",
                "ICD10AM",
                "SNOMEDCT_VET",
                "ICPC2P",
                "ICD10AMAE",
                "CSP",
                "MEDLINEPLUS",
                "LCH_NW",
                "HL7V3.0",
                "LNC",
                "PDQ",
                "FMA",
                "CCS",
                "NANDA-I",
                "ICD10AE",
                "ICPC2EENG",
                "CCSR_ICD10CM",
                "UWDA",
                "PSY",
                "MTHICPC2ICD10AE",
                "MTHICPC2EAE",
                "UBERON",
                "DOID",
                "MP",
                "MONDO",
                "HP",
                "EFO",
                "PATO"
            ],
            "color": "#41fb61"
        },
        {
            "node": "GLYTOUCAN",
            "example": [],
            "display": [
                {
                    "label": "GLYTOUCAN ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GLYTOUCAN",
                    "text": "${GLYTOUCAN}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "GLYTOUCAN"
            ],
            "color": "#b6d7ff"
        },
        {
            "node": "Social Behavior",
            "example": [
                "Shyness"
            ],
            "display": [
                {
                    "label": "Social Behavior ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "CHV",
                "PSY",
                "MDR",
                "SNOMEDCT_VET",
                "OMIM",
                "HPO"
            ],
            "color": "#e3a65d"
        },
        {
            "node": "Element, Ion, or Isotope",
            "example": [
                "arsenite"
            ],
            "display": [
                {
                    "label": "Element, Ion, or Isotope ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid",
                    "text": "${Indicator, Reagent, or Diagnostic Aid}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "LNC",
                "PUBCHEM",
                "Indicator, Reagent, or Diagnostic Aid"
            ],
            "color": "#df9ece"
        },
        {
            "node": "HMDB",
            "example": [
                "4-Hydroxy-5-(3',5'-dihydroxyphenyl)-valeric acid-O-glucuronide",
                "1-Nitroheptane"
            ],
            "display": [
                {
                    "label": "HMDB ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "HMDB",
                    "text": "${HMDB}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "HMDB"
            ],
            "color": "#aabab2"
        },
        {
            "node": "Body Substance",
            "example": [
                "saliva",
                "Feces"
            ],
            "display": [
                {
                    "label": "Body Substance ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "HL7V2.5",
                    "text": "${HL7V2.5}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "ATC",
                    "text": "${ATC}",
                    "type": "text"
                },
                {
                    "label": "UBERON",
                    "text": "${UBERON}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "SNOMEDCT_US",
                "UWDA",
                "CSP",
                "OMIM",
                "MTH",
                "FMA",
                "NCI",
                "MSH",
                "CHV",
                "LNC",
                "LCH_NW",
                "HL7V2.5",
                "MDR",
                "MEDLINEPLUS",
                "PSY",
                "ATC",
                "UBERON"
            ],
            "color": "#86c2db"
        },
        {
            "node": "Fish",
            "example": [
                "Denticetopsis epa"
            ],
            "display": [
                {
                    "label": "Fish ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "NCBI",
                    "text": "${NCBI}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "NCBI",
                "PUBCHEM"
            ],
            "color": "#efc6db"
        },
        {
            "node": "Sign or Symptom",
            "example": [
                "Neck stiffness",
                "Gastric irritation"
            ],
            "display": [
                {
                    "label": "Sign or Symptom ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "MTHICPC2EAE",
                    "text": "${MTHICPC2EAE}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "CCSR_ICD10CM",
                    "text": "${CCSR_ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "ICNP",
                    "text": "${ICNP}",
                    "type": "text"
                },
                {
                    "label": "CCC",
                    "text": "${CCC}",
                    "type": "text"
                },
                {
                    "label": "ICF",
                    "text": "${ICF}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "ICPC2EENG",
                    "text": "${ICPC2EENG}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "ICF-CY",
                    "text": "${ICF-CY}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "ICD10AMAE",
                    "text": "${ICD10AMAE}",
                    "type": "text"
                },
                {
                    "label": "OMS",
                    "text": "${OMS}",
                    "type": "text"
                },
                {
                    "label": "CCS",
                    "text": "${CCS}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "PNDS",
                    "text": "${PNDS}",
                    "type": "text"
                },
                {
                    "label": "GO",
                    "text": "${GO}",
                    "type": "text"
                },
                {
                    "label": "CPM",
                    "text": "${CPM}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "AOT",
                    "text": "${AOT}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "ICD10AE",
                    "text": "${ICD10AE}",
                    "type": "text"
                },
                {
                    "label": "DSM-5",
                    "text": "${DSM-5}",
                    "type": "text"
                },
                {
                    "label": "HL7V3.0",
                    "text": "${HL7V3.0}",
                    "type": "text"
                },
                {
                    "label": "UBERON",
                    "text": "${UBERON}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "LNC",
                "MTHICPC2EAE",
                "ICPC2P",
                "OMIM",
                "MTH",
                "MDR",
                "ICPC2ICD10ENG",
                "NOC",
                "CHV",
                "ICD10CM",
                "NCI",
                "ICD10AM",
                "ICD10",
                "CCSR_ICD10CM",
                "PSY",
                "ICNP",
                "CCC",
                "ICF",
                "HPO",
                "NANDA-I",
                "ICD9CM",
                "MEDLINEPLUS",
                "SNOMEDCT_US",
                "MTHICD9",
                "MEDCIN",
                "MSH",
                "ICPC2EENG",
                "PDQ",
                "CSP",
                "LCH_NW",
                "ICF-CY",
                "SNOMEDCT_VET",
                "ICD10AMAE",
                "OMS",
                "CCS",
                "ORPHANET",
                "PNDS",
                "GO",
                "CPM",
                "UWDA",
                "AOT",
                "FMA",
                "ICD10AE",
                "DSM-5",
                "HL7V3.0",
                "UBERON",
                "DOID",
                "MP",
                "HP",
                "MONDO",
                "EFO"
            ],
            "color": "#ffca41"
        },
        {
            "node": "Substance",
            "example": [
                "Sunscreening Agents"
            ],
            "display": [
                {
                    "label": "Substance ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MMSL",
                    "text": "${MMSL}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "NDDF",
                    "text": "${NDDF}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CSP",
                "SNOMEDCT_US",
                "MMSL",
                "CHV",
                "NCI",
                "MEDCIN",
                "MTH",
                "MSH",
                "NDDF",
                "PDQ",
                "MEDLINEPLUS"
            ],
            "color": "#fbc6b2"
        },
        {
            "node": "Inorganic Chemical",
            "example": [
                "Carbonic Acid",
                "carbon disulfide"
            ],
            "display": [
                {
                    "label": "Inorganic Chemical ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "MTHSPL",
                    "text": "${MTHSPL}",
                    "type": "text"
                },
                {
                    "label": "DRUGBANK",
                    "text": "${DRUGBANK}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "RXNORM",
                    "text": "${RXNORM}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "VANDF",
                    "text": "${VANDF}",
                    "type": "text"
                },
                {
                    "label": "MMSL",
                    "text": "${MMSL}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "NDDF",
                    "text": "${NDDF}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "GS",
                    "text": "${GS}",
                    "type": "text"
                },
                {
                    "label": "USP",
                    "text": "${USP}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "Element, Ion, or Isotope",
                    "text": "${Element, Ion, or Isotope}",
                    "type": "text"
                },
                {
                    "label": "Biologically Active Substance",
                    "text": "${Biologically Active Substance}",
                    "type": "text"
                },
                {
                    "label": "Hazardous or Poisonous Substance",
                    "text": "${Hazardous or Poisonous Substance}",
                    "type": "text"
                },
                {
                    "label": "Biomedical or Dental Material",
                    "text": "${Biomedical or Dental Material}",
                    "type": "text"
                },
                {
                    "label": "Pharmacologic Substance",
                    "text": "${Pharmacologic Substance}",
                    "type": "text"
                },
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid",
                    "text": "${Indicator, Reagent, or Diagnostic Aid}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "LCH_NW",
                "MTHSPL",
                "DRUGBANK",
                "CSP",
                "SNOMEDCT_US",
                "RXNORM",
                "NCI",
                "MSH",
                "CHV",
                "VANDF",
                "MMSL",
                "LNC",
                "NDDF",
                "MTH",
                "GS",
                "USP",
                "PUBCHEM",
                "Element, Ion, or Isotope",
                "Biologically Active Substance",
                "Hazardous or Poisonous Substance",
                "Biomedical or Dental Material",
                "Pharmacologic Substance",
                "Indicator, Reagent, or Diagnostic Aid"
            ],
            "color": "#82e3d7"
        },
        {
            "node": "ENCODE RBS 150 NO OVERLAP",
            "example": [
                "chr19.2438531.2438532.minus.b38.G3BP1",
                "chr17.82151862.82151914.minus.b38.EWSR1"
            ],
            "display": [
                {
                    "label": "ENCODE RBS 150 NO OVERLAP ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ENCODE.RBS.150.NO.OVERLAP",
                    "text": "${ENCODE.RBS.150.NO.OVERLAP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "ENCODE.RBS.150.NO.OVERLAP"
            ],
            "color": "#82ca79"
        },
        {
            "node": "Embryonic Structure",
            "example": [
                "Placenta"
            ],
            "display": [
                {
                    "label": "Embryonic Structure ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "HL7V2.5",
                    "text": "${HL7V2.5}",
                    "type": "text"
                },
                {
                    "label": "UBERON",
                    "text": "${UBERON}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MTH",
                "SNOMEDCT_US",
                "CHV",
                "FMA",
                "NCI",
                "MSH",
                "LNC",
                "CSP",
                "LCH_NW",
                "PSY",
                "SNOMEDCT_VET",
                "HL7V2.5",
                "UBERON"
            ],
            "color": "#ff8e92"
        },
        {
            "node": "Qualitative Concept",
            "example": [
                "Moist",
                "With intensity"
            ],
            "display": [
                {
                    "label": "Qualitative Concept ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "LNC",
                "NCI",
                "SNOMEDCT_US",
                "MTH",
                "CHV",
                "HPO",
                "HP",
                "PUBCHEM"
            ],
            "color": "#86c2ba"
        },
        {
            "node": "Laboratory or Test Result",
            "example": [
                "Anti-dsDNA antibody positivity",
                "Anti-liver cytosolic antigen type 1 antibody positivity"
            ],
            "display": [
                {
                    "label": "Laboratory or Test Result ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "SNOMEDCT_US",
                "OMIM",
                "CHV",
                "SNOMEDCT_VET",
                "MDR",
                "MEDCIN",
                "MTH",
                "NCI",
                "HPO",
                "ICPC2ICD10ENG",
                "ORPHANET",
                "HP",
                "MONDO"
            ],
            "color": "#c2ba65"
        },
        {
            "node": "Biomedical or Dental Material",
            "example": [
                "glutaral"
            ],
            "display": [
                {
                    "label": "Biomedical or Dental Material ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "SPN",
                    "text": "${SPN}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "RXNORM",
                    "text": "${RXNORM}",
                    "type": "text"
                },
                {
                    "label": "NDDF",
                    "text": "${NDDF}",
                    "type": "text"
                },
                {
                    "label": "MTHSPL",
                    "text": "${MTHSPL}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "VANDF",
                    "text": "${VANDF}",
                    "type": "text"
                },
                {
                    "label": "GS",
                    "text": "${GS}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "Chemical Viewed Structurally",
                    "text": "${Chemical Viewed Structurally}",
                    "type": "text"
                },
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid",
                    "text": "${Indicator, Reagent, or Diagnostic Aid}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "SNOMEDCT_US",
                "CHV",
                "MSH",
                "LNC",
                "MTH",
                "SPN",
                "MEDCIN",
                "RXNORM",
                "NDDF",
                "MTHSPL",
                "NCI",
                "VANDF",
                "GS",
                "CSP",
                "LCH_NW",
                "PUBCHEM",
                "Chemical Viewed Structurally",
                "Indicator, Reagent, or Diagnostic Aid"
            ],
            "color": "#d7b6e3"
        },
        {
            "node": "HCOP",
            "example": [
                "zinc finger, DHHC domain containing 16",
                "phosphorylase kinase, gamma 2 (testis)"
            ],
            "display": [
                {
                    "label": "HCOP ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "HCOP",
                    "text": "${HCOP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "HCOP"
            ],
            "color": "#86df55"
        },
        {
            "node": "KFVARBIN",
            "example": [
                "KFVARBIN:chr14.47000001-48000000 CUI",
                "KFVARBIN:chr9.23500001-23600000 CUI"
            ],
            "display": [
                {
                    "label": "KFVARBIN ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "KFVARBIN",
                    "text": "${KFVARBIN}",
                    "type": "text"
                },
                {
                    "label": "KFVARBIN value",
                    "text": "${KFVARBIN value}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "KFVARBIN",
                "label"
            ],
            "color": "#bee355"
        },
        {
            "node": "Body Location or Region",
            "example": [
                "Head",
                "Set of outer region of renal pyramids"
            ],
            "display": [
                {
                    "label": "Body Location or Region ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "HL7V2.5",
                    "text": "${HL7V2.5}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "UBERON",
                    "text": "${UBERON}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "LCH_NW",
                "NCI",
                "PSY",
                "SNOMEDCT_US",
                "FMA",
                "UWDA",
                "MTH",
                "CHV",
                "MSH",
                "LNC",
                "HL7V2.5",
                "OMIM",
                "CSP",
                "UBERON"
            ],
            "color": "#8aebb6"
        },
        {
            "node": "Laboratory Procedure",
            "example": [
                "Dehydroepiandrosterone Assay",
                "Thyroxine measurement"
            ],
            "display": [
                {
                    "label": "Laboratory Procedure ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "CPT",
                    "text": "${CPT}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "HCPT",
                    "text": "${HCPT}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "LCH_NW",
                "CSP",
                "NCI",
                "MSH",
                "MTH",
                "CHV",
                "MDR",
                "LNC",
                "SNOMEDCT_US",
                "CPT",
                "MEDCIN",
                "HCPT",
                "ICPC2P",
                "PDQ",
                "MEDLINEPLUS",
                "EFO",
                "PUBCHEM"
            ],
            "color": "#08d7b2"
        },
        {
            "node": "Indicator, Reagent, or Diagnostic Aid",
            "example": [
                "Tumor imaging agent",
                "Diagnostic agents"
            ],
            "display": [
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "VANDF",
                    "text": "${VANDF}",
                    "type": "text"
                },
                {
                    "label": "ATC",
                    "text": "${ATC}",
                    "type": "text"
                },
                {
                    "label": "MED-RT",
                    "text": "${MED-RT}",
                    "type": "text"
                },
                {
                    "label": "Chemical Viewed Structurally",
                    "text": "${Chemical Viewed Structurally}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CHV",
                "MTH",
                "SNOMEDCT_US",
                "VANDF",
                "ATC",
                "MED-RT",
                "Chemical Viewed Structurally"
            ],
            "color": "#aaaeff"
        },
        {
            "node": "Neoplastic Process",
            "example": [
                "Bladder Neoplasm",
                "Uveal melanoma"
            ],
            "display": [
                {
                    "label": "Neoplastic Process ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "ICD10AMAE",
                    "text": "${ICD10AMAE}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "ICD10AE",
                    "text": "${ICD10AE}",
                    "type": "text"
                },
                {
                    "label": "ICPC2EENG",
                    "text": "${ICPC2EENG}",
                    "type": "text"
                },
                {
                    "label": "CCSR_ICD10CM",
                    "text": "${CCSR_ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "CCS",
                    "text": "${CCS}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "MTHICPC2EAE",
                    "text": "${MTHICPC2EAE}",
                    "type": "text"
                },
                {
                    "label": "UBERON",
                    "text": "${UBERON}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                },
                {
                    "label": "Experimental Model of Disease",
                    "text": "${Experimental Model of Disease}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "NCI",
                "HPO",
                "ICD9CM",
                "MSH",
                "MEDLINEPLUS",
                "CHV",
                "MDR",
                "OMIM",
                "SNOMEDCT_US",
                "ICD10AM",
                "ICD10",
                "MEDCIN",
                "ICPC2ICD10ENG",
                "ICD10CM",
                "ORPHANET",
                "CSP",
                "MTH",
                "SNOMEDCT_VET",
                "LCH_NW",
                "MTHICD9",
                "ICPC2P",
                "PDQ",
                "ICD10AMAE",
                "LNC",
                "ICD10AE",
                "ICPC2EENG",
                "CCSR_ICD10CM",
                "NANDA-I",
                "PSY",
                "CCS",
                "NOC",
                "MTHICPC2EAE",
                "UBERON",
                "DOID",
                "MONDO",
                "HP",
                "EFO",
                "Experimental Model of Disease"
            ],
            "color": "#ffb282"
        },
        {
            "node": "Quantitative Concept",
            "example": [
                "Age of Onset"
            ],
            "display": [
                {
                    "label": "Quantitative Concept ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "CHV",
                "CSP",
                "MTH",
                "NCI",
                "HPO",
                "HP"
            ],
            "color": "#aed292"
        },
        {
            "node": "Clinical Attribute",
            "example": [
                "Norcitalopram:MCnc:Pt:Ser/Plas:Qn"
            ],
            "display": [
                {
                    "label": "Clinical Attribute ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "LNC",
                "PUBCHEM"
            ],
            "color": "#d2be8e"
        },
        {
            "node": "Natural Phenomenon or Process",
            "example": [
                "Mortality/Aging"
            ],
            "display": [
                {
                    "label": "Natural Phenomenon or Process ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "HPO",
                "HP"
            ],
            "color": "#dba2b2"
        },
        {
            "node": "MEDGEN",
            "example": [
                "MEDGEN:C0017097 CUI",
                "MEDGEN:C3809719 CUI"
            ],
            "display": [
                {
                    "label": "MEDGEN ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MEDGEN",
                    "text": "${MEDGEN}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "MEDGEN",
                "label"
            ],
            "color": "#ffaed7"
        },
        {
            "node": "PVALUEBINS",
            "example": [
                "PVALUEBINS:1e-09.1e-08 CUI",
                "PVALUEBINS:1e-10.1e-09 CUI"
            ],
            "display": [
                {
                    "label": "PVALUEBINS ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "PVALUEBINS",
                    "text": "${PVALUEBINS}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "PVALUEBINS",
                "label"
            ],
            "color": "#0cfb9a"
        },
        {
            "node": "GLYCAN MOTIF",
            "example": [
                "Blood group H (type 2) - Lewis y",
                "Glucosylceramide"
            ],
            "display": [
                {
                    "label": "GLYCAN MOTIF ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GLYCAN.MOTIF",
                    "text": "${GLYCAN.MOTIF}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "GLYCAN.MOTIF"
            ],
            "color": "#ff9aef"
        },
        {
            "node": "HP",
            "example": [
                "abnormal glucose tolerance",
                "bile duct inflammation"
            ],
            "display": [
                {
                    "label": "HP ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MP",
                "HP"
            ],
            "color": "#dbbaba"
        },
        {
            "node": "GLYCOSYLTRANSFERASE REACTION",
            "example": [
                "GLYCOSYLTRANSFERASE.REACTION:RXN00000132 CUI",
                "GLYCOSYLTRANSFERASE.REACTION:RXN00000141 CUI"
            ],
            "display": [
                {
                    "label": "GLYCOSYLTRANSFERASE REACTION ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GLYCOSYLTRANSFERASE.REACTION",
                    "text": "${GLYCOSYLTRANSFERASE.REACTION}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "GLYCOSYLTRANSFERASE.REACTION",
                "label"
            ],
            "color": "#c6be00"
        },
        {
            "node": "SIO",
            "example": [
                "set",
                "entity"
            ],
            "display": [
                {
                    "label": "SIO ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "SIO",
                    "text": "${SIO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "SIO"
            ],
            "color": "#00f3ef"
        },
        {
            "node": "Physiologic Function",
            "example": [
                "Renal Reabsorption",
                "Hearing"
            ],
            "display": [
                {
                    "label": "Physiologic Function ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "GO",
                    "text": "${GO}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "ICF",
                    "text": "${ICF}",
                    "type": "text"
                },
                {
                    "label": "ICF-CY",
                    "text": "${ICF-CY}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "OMS",
                    "text": "${OMS}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "LCH_NW",
                "SNOMEDCT_US",
                "CHV",
                "LNC",
                "GO",
                "NCI",
                "ICF",
                "ICF-CY",
                "MTH",
                "MSH",
                "PSY",
                "CSP",
                "OMS",
                "MP"
            ],
            "color": "#ffb245"
        },
        {
            "node": "Cell Component",
            "example": [
                "Melanosomes",
                "Heinz bodies"
            ],
            "display": [
                {
                    "label": "Cell Component ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "GO",
                    "text": "${GO}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "SNOMEDCT_US",
                "CHV",
                "FMA",
                "MSH",
                "NCI",
                "MTH",
                "GO",
                "CSP",
                "LCH_NW",
                "LNC",
                "UWDA",
                "OMIM",
                "HPO",
                "MDR",
                "MP"
            ],
            "color": "#8aca00"
        },
        {
            "node": "EXPBINS",
            "example": [
                "EXPBINS:13.0.14.0 CUI",
                "EXPBINS:66.0.67.0 CUI"
            ],
            "display": [
                {
                    "label": "EXPBINS ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "EXPBINS",
                    "text": "${EXPBINS}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "EXPBINS",
                "label"
            ],
            "color": "#eb9e8e"
        },
        {
            "node": "Temporal Concept",
            "example": [
                "Juvenile onset",
                "Gradual onset"
            ],
            "display": [
                {
                    "label": "Temporal Concept ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "SNOMEDCT_US",
                "MTH",
                "CHV",
                "NCI",
                "LNC",
                "MSH",
                "HPO",
                "HP"
            ],
            "color": "#c2d2ca"
        },
        {
            "node": "Cell or Molecular Dysfunction",
            "example": [
                "Abnormal MHC II surface expression",
                "Abnormal telomere morphology"
            ],
            "display": [
                {
                    "label": "Cell or Molecular Dysfunction ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "GO",
                    "text": "${GO}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MDR",
                "SNOMEDCT_US",
                "OMIM",
                "NCI",
                "MSH",
                "MTH",
                "LNC",
                "CSP",
                "HPO",
                "ORPHANET",
                "CHV",
                "LCH_NW",
                "GO",
                "MONDO",
                "HP",
                "EFO"
            ],
            "color": "#51d2e7"
        },
        {
            "node": "ENCODE CCRE H3K4ME3",
            "example": [
                "ENCODE.CCRE.H3K4ME3:HIGH.ZSCORE CUI",
                "ENCODE.CCRE.H3K4ME3:LOW.ZSCORE CUI"
            ],
            "display": [
                {
                    "label": "ENCODE CCRE H3K4ME3 ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ENCODE.CCRE.H3K4ME3",
                    "text": "${ENCODE.CCRE.H3K4ME3}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "ENCODE.CCRE.H3K4ME3",
                "label"
            ],
            "color": "#beaae7"
        },
        {
            "node": "ENCODE CCRE CTCF",
            "example": [
                "ENCODE.CCRE.CTCF:HIGH.ZSCORE CUI",
                "ENCODE.CCRE.CTCF:LOW.ZSCORE CUI"
            ],
            "display": [
                {
                    "label": "ENCODE CCRE CTCF ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ENCODE.CCRE.CTCF",
                    "text": "${ENCODE.CCRE.CTCF}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "ENCODE.CCRE.CTCF",
                "label"
            ],
            "color": "#8ad7ff"
        },
        {
            "node": "Mental Process",
            "example": [
                "Euphoric mood",
                "Hostility"
            ],
            "display": [
                {
                    "label": "Mental Process ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "ICNP",
                    "text": "${ICNP}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CHV",
                "PSY",
                "MSH",
                "NCI",
                "SNOMEDCT_US",
                "ICPC2ICD10ENG",
                "MTH",
                "ICNP",
                "CSP",
                "MDR",
                "ICD10",
                "NANDA-I",
                "NOC",
                "LNC",
                "MEDCIN",
                "HPO",
                "ICD10CM",
                "OMIM",
                "ICD10AM",
                "HP"
            ],
            "color": "#cedbaa"
        },
        {
            "node": "Gene",
            "example": [
                "TPT1 gene",
                "ATP5MC1 gene"
            ],
            "display": [
                {
                    "label": "Gene ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "HGNC",
                    "text": "${HGNC}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "AOT",
                    "text": "${AOT}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                },
                {
                    "label": "CHEBI",
                    "text": "${CHEBI}",
                    "type": "text"
                },
                {
                    "label": "ENSEMBL",
                    "text": "${ENSEMBL}",
                    "type": "text"
                },
                {
                    "label": "ENSEMBL value",
                    "text": "${ENSEMBL value}",
                    "type": "text"
                },
                {
                    "label": "ENSEMBL lowerbound",
                    "text": "${ENSEMBL lowerbound}",
                    "type": "text"
                },
                {
                    "label": "ENSEMBL upperbound",
                    "text": "${ENSEMBL upperbound}",
                    "type": "text"
                },
                {
                    "label": "ENTREZ",
                    "text": "${ENTREZ}",
                    "type": "text"
                },
                {
                    "label": "ENTREZ lowerbound",
                    "text": "${ENTREZ lowerbound}",
                    "type": "text"
                },
                {
                    "label": "ENTREZ upperbound",
                    "text": "${ENTREZ upperbound}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "UNIPROTKB",
                    "text": "${UNIPROTKB}",
                    "type": "text"
                },
                {
                    "label": "EC ID",
                    "text": "${EC ID}",
                    "type": "text"
                },
                {
                    "label": "is_Enzyme",
                    "text": "${is_Enzyme}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "NCI",
                "LCH_NW",
                "MSH",
                "CSP",
                "SNOMEDCT_US",
                "HGNC",
                "MTH",
                "OMIM",
                "LNC",
                "PDQ",
                "CHV",
                "ORPHANET",
                "AOT",
                "DOID",
                "MONDO",
                "EFO",
                "CHEBI",
                "ENSEMBL",
                "ENTREZ",
                "PUBCHEM",
                "UNIPROTKB",
                "EC ID"
            ],
            "color": "#a2c6a6"
        },
        {
            "node": "GLYGEN SRC",
            "example": [
                "GLYGEN.SRC:G40702WU-SRC00003503 CUI",
                "GLYGEN.SRC:G79477YQ-SRC00010754 CUI"
            ],
            "display": [
                {
                    "label": "GLYGEN SRC ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GLYGEN.SRC",
                    "text": "${GLYGEN.SRC}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "GLYGEN.SRC",
                "label"
            ],
            "color": "#2de7a6"
        },
        {
            "node": "Tissue",
            "example": [
                "Endothelium",
                "Bone Marrow"
            ],
            "display": [
                {
                    "label": "Tissue ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "HL7V2.5",
                    "text": "${HL7V2.5}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "NEU",
                    "text": "${NEU}",
                    "type": "text"
                },
                {
                    "label": "NDDF",
                    "text": "${NDDF}",
                    "type": "text"
                },
                {
                    "label": "ICF",
                    "text": "${ICF}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "ICF-CY",
                    "text": "${ICF-CY}",
                    "type": "text"
                },
                {
                    "label": "UBERON",
                    "text": "${UBERON}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CSP",
                "NCI",
                "UWDA",
                "LCH_NW",
                "MTH",
                "CHV",
                "SNOMEDCT_US",
                "FMA",
                "HL7V2.5",
                "LNC",
                "PSY",
                "MSH",
                "NEU",
                "NDDF",
                "ICF",
                "ICPC2ICD10ENG",
                "ICF-CY",
                "UBERON",
                "MONDO",
                "EFO"
            ],
            "color": "#dbca4d"
        },
        {
            "node": "Medical Device",
            "example": [
                "Nasogastric feeding tube"
            ],
            "display": [
                {
                    "label": "Medical Device ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "UMD",
                    "text": "${UMD}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "UMD",
                "MTH",
                "SNOMEDCT_US",
                "HPO"
            ],
            "color": "#bac2ca"
        },
        {
            "node": "Health Care Activity",
            "example": [
                "Prevention of dental caries",
                "Asthma management"
            ],
            "display": [
                {
                    "label": "Health Care Activity ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "NIC",
                    "text": "${NIC}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "Biomedical Occupation or Discipline",
                    "text": "${Biomedical Occupation or Discipline}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CHV",
                "NIC",
                "SNOMEDCT_US",
                "LCH_NW",
                "Biomedical Occupation or Discipline"
            ],
            "color": "#aebeef"
        },
        {
            "node": "FOAF",
            "example": [
                "Image"
            ],
            "display": [
                {
                    "label": "FOAF ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "FOAF",
                    "text": "${FOAF}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "FOAF"
            ],
            "color": "#ff9e51"
        },
        {
            "node": "Pharmacologic Substance",
            "example": [
                "decursinol",
                "neocnidilide"
            ],
            "display": [
                {
                    "label": "Pharmacologic Substance ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "ATC",
                    "text": "${ATC}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "NDDF",
                    "text": "${NDDF}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "RXNORM",
                    "text": "${RXNORM}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "MMSL",
                    "text": "${MMSL}",
                    "type": "text"
                },
                {
                    "label": "VANDF",
                    "text": "${VANDF}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "USPMG",
                    "text": "${USPMG}",
                    "type": "text"
                },
                {
                    "label": "GS",
                    "text": "${GS}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "MTHSPL",
                    "text": "${MTHSPL}",
                    "type": "text"
                },
                {
                    "label": "MED-RT",
                    "text": "${MED-RT}",
                    "type": "text"
                },
                {
                    "label": "DRUGBANK",
                    "text": "${DRUGBANK}",
                    "type": "text"
                },
                {
                    "label": "USP",
                    "text": "${USP}",
                    "type": "text"
                },
                {
                    "label": "CHEBI",
                    "text": "${CHEBI}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "Body Substance",
                    "text": "${Body Substance}",
                    "type": "text"
                },
                {
                    "label": "Element, Ion, or Isotope",
                    "text": "${Element, Ion, or Isotope}",
                    "type": "text"
                },
                {
                    "label": "Biologically Active Substance",
                    "text": "${Biologically Active Substance}",
                    "type": "text"
                },
                {
                    "label": "Chemical Viewed Structurally",
                    "text": "${Chemical Viewed Structurally}",
                    "type": "text"
                },
                {
                    "label": "Virus",
                    "text": "${Virus}",
                    "type": "text"
                },
                {
                    "label": "Bacterium",
                    "text": "${Bacterium}",
                    "type": "text"
                },
                {
                    "label": "Vitamin",
                    "text": "${Vitamin}",
                    "type": "text"
                },
                {
                    "label": "Hazardous or Poisonous Substance",
                    "text": "${Hazardous or Poisonous Substance}",
                    "type": "text"
                },
                {
                    "label": "Food",
                    "text": "${Food}",
                    "type": "text"
                },
                {
                    "label": "Immunologic Factor",
                    "text": "${Immunologic Factor}",
                    "type": "text"
                },
                {
                    "label": "Therapeutic or Preventive Procedure",
                    "text": "${Therapeutic or Preventive Procedure}",
                    "type": "text"
                },
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid",
                    "text": "${Indicator, Reagent, or Diagnostic Aid}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "SNOMEDCT_US",
                "ATC",
                "CSP",
                "NDDF",
                "LCH_NW",
                "RXNORM",
                "CHV",
                "NCI",
                "MEDCIN",
                "MMSL",
                "VANDF",
                "LNC",
                "USPMG",
                "GS",
                "MTH",
                "PDQ",
                "MTHSPL",
                "MED-RT",
                "DRUGBANK",
                "USP",
                "CHEBI",
                "PUBCHEM",
                "Body Substance",
                "Element, Ion, or Isotope",
                "Biologically Active Substance",
                "Chemical Viewed Structurally",
                "Virus",
                "Bacterium",
                "Vitamin",
                "Hazardous or Poisonous Substance",
                "Food",
                "Immunologic Factor",
                "Therapeutic or Preventive Procedure",
                "Indicator, Reagent, or Diagnostic Aid"
            ],
            "color": "#e3ba5d"
        },
        {
            "node": "GLYGEN GLYCOSYLATION",
            "example": [
                "GLYGEN.GLYCOSYLATION:RXN00000177 CUI",
                "GLYGEN.GLYCOSYLATION:RXN00000031 CUI"
            ],
            "display": [
                {
                    "label": "GLYGEN GLYCOSYLATION ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GLYGEN.GLYCOSYLATION",
                    "text": "${GLYGEN.GLYCOSYLATION}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "GLYGEN.GLYCOSYLATION",
                "label"
            ],
            "color": "#f396b2"
        },
        {
            "node": "Amino Acid, Peptide, or Protein",
            "example": [
                "melphalan",
                "penicillamine"
            ],
            "display": [
                {
                    "label": "Amino Acid, Peptide, or Protein ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "GS",
                    "text": "${GS}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "CPM",
                    "text": "${CPM}",
                    "type": "text"
                },
                {
                    "label": "MMSL",
                    "text": "${MMSL}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "RXNORM",
                    "text": "${RXNORM}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "DRUGBANK",
                    "text": "${DRUGBANK}",
                    "type": "text"
                },
                {
                    "label": "ATC",
                    "text": "${ATC}",
                    "type": "text"
                },
                {
                    "label": "MTHSPL",
                    "text": "${MTHSPL}",
                    "type": "text"
                },
                {
                    "label": "NDDF",
                    "text": "${NDDF}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "VANDF",
                    "text": "${VANDF}",
                    "type": "text"
                },
                {
                    "label": "USPMG",
                    "text": "${USPMG}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "SPN",
                    "text": "${SPN}",
                    "type": "text"
                },
                {
                    "label": "USP",
                    "text": "${USP}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "CHEBI",
                    "text": "${CHEBI}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "Antibiotic",
                    "text": "${Antibiotic}",
                    "type": "text"
                },
                {
                    "label": "Biologically Active Substance",
                    "text": "${Biologically Active Substance}",
                    "type": "text"
                },
                {
                    "label": "Hazardous or Poisonous Substance",
                    "text": "${Hazardous or Poisonous Substance}",
                    "type": "text"
                },
                {
                    "label": "Biomedical or Dental Material",
                    "text": "${Biomedical or Dental Material}",
                    "type": "text"
                },
                {
                    "label": "Vitamin",
                    "text": "${Vitamin}",
                    "type": "text"
                },
                {
                    "label": "Nucleic Acid, Nucleoside, or Nucleotide",
                    "text": "${Nucleic Acid, Nucleoside, or Nucleotide}",
                    "type": "text"
                },
                {
                    "label": "Immunologic Factor",
                    "text": "${Immunologic Factor}",
                    "type": "text"
                },
                {
                    "label": "Pharmacologic Substance",
                    "text": "${Pharmacologic Substance}",
                    "type": "text"
                },
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid",
                    "text": "${Indicator, Reagent, or Diagnostic Aid}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MTH",
                "LCH_NW",
                "GS",
                "LNC",
                "MSH",
                "CPM",
                "MMSL",
                "NCI",
                "CHV",
                "SNOMEDCT_US",
                "FMA",
                "RXNORM",
                "MEDCIN",
                "CSP",
                "DRUGBANK",
                "ATC",
                "MTHSPL",
                "NDDF",
                "PDQ",
                "VANDF",
                "USPMG",
                "PSY",
                "SPN",
                "USP",
                "HPO",
                "CHEBI",
                "PUBCHEM",
                "Antibiotic",
                "Biologically Active Substance",
                "Hazardous or Poisonous Substance",
                "Biomedical or Dental Material",
                "Vitamin",
                "Nucleic Acid, Nucleoside, or Nucleotide",
                "Immunologic Factor",
                "Pharmacologic Substance",
                "Indicator, Reagent, or Diagnostic Aid"
            ],
            "color": "#aadff3"
        },
        {
            "node": "4DNL",
            "example": [
                "4DNL:4DNFI49A9Z1K.chr14.100710000-100720000.chr14.101230000-101240000 CUI",
                "4DNL:4DNFIY71465K.chr4.183824000-183856000.chr4.184152000-184176000 CUI"
            ],
            "display": [
                {
                    "label": "4DNL ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "4DNL",
                    "text": "${4DNL}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "4DNL",
                "label"
            ],
            "color": "#ced2f7"
        },
        {
            "node": "Biologic Function",
            "example": [
                "B cell negative selection",
                "B cell selection"
            ],
            "display": [
                {
                    "label": "Biologic Function ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GO",
                    "text": "${GO}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "GO",
                "MP"
            ],
            "color": "#b2d200"
        },
        {
            "node": "CODAO",
            "example": [
                "Compound Disease Association"
            ],
            "display": [
                {
                    "label": "CODAO ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CODAO",
                    "text": "${CODAO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CODAO"
            ],
            "color": "#beb69e"
        },
        {
            "node": "GLYCAN",
            "example": [
                "LC Chromatogram",
                "Evidence UPLC"
            ],
            "display": [
                {
                    "label": "GLYCAN ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GLYCAN",
                    "text": "${GLYCAN}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "GLYCAN"
            ],
            "color": "#c2bad7"
        },
        {
            "node": "Body Part, Organ, or Organ Component",
            "example": [
                "Structure of corpus luteum of ovary",
                "Hippocampus (Brain)"
            ],
            "display": [
                {
                    "label": "Body Part, Organ, or Organ Component ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "HL7V2.5",
                    "text": "${HL7V2.5}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "NEU",
                    "text": "${NEU}",
                    "type": "text"
                },
                {
                    "label": "ICF",
                    "text": "${ICF}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "ICF-CY",
                    "text": "${ICF-CY}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "UBERON",
                    "text": "${UBERON}",
                    "type": "text"
                },
                {
                    "label": "CL",
                    "text": "${CL}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "MA",
                    "text": "${MA}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                },
                {
                    "label": "AZ",
                    "text": "${AZ}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MTH",
                "SNOMEDCT_VET",
                "SNOMEDCT_US",
                "CHV",
                "LNC",
                "UWDA",
                "MSH",
                "LCH_NW",
                "HL7V2.5",
                "NCI",
                "PSY",
                "OMIM",
                "NEU",
                "ICF",
                "FMA",
                "HPO",
                "CSP",
                "ICF-CY",
                "ICD10AM",
                "UBERON",
                "CL",
                "MP",
                "MONDO",
                "MA",
                "EFO",
                "AZ",
                "PUBCHEM"
            ],
            "color": "#a2d2c2"
        },
        {
            "node": "ENCODE RBS HEPG2 K562",
            "example": [
                "chr1.46301759.46301893.minus.b38.CSTF2T",
                "chr21.34087834.34087949.plus.b38.HNRNPM"
            ],
            "display": [
                {
                    "label": "ENCODE RBS HEPG2 K562 ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ENCODE.RBS.HEPG2.K562",
                    "text": "${ENCODE.RBS.HEPG2.K562}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "ENCODE.RBS.HEPG2.K562"
            ],
            "color": "#59d25d"
        },
        {
            "node": "GCO",
            "example": [
                "Referenced Protein",
                "Referenced Lipid"
            ],
            "display": [
                {
                    "label": "GCO ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GCO",
                    "text": "${GCO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "GCO"
            ],
            "color": "#a2d771"
        },
        {
            "node": "ENCODE CCRE ACTIVITY",
            "example": [
                "EH38E3704420_gastrocnemius_medialis",
                "EH38E3427227_prostate_gland"
            ],
            "display": [
                {
                    "label": "ENCODE CCRE ACTIVITY ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ENCODE.CCRE.ACTIVITY",
                    "text": "${ENCODE.CCRE.ACTIVITY}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "ENCODE.CCRE.ACTIVITY"
            ],
            "color": "#69eb24"
        },
        {
            "node": "GLYGEN RESIDUE",
            "example": [
                "n-glycan_a-d-galp_50",
                "n-glycan_b-d-galp_80"
            ],
            "display": [
                {
                    "label": "GLYGEN RESIDUE ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GLYGEN.RESIDUE",
                    "text": "${GLYGEN.RESIDUE}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "GLYGEN.RESIDUE"
            ],
            "color": "#8ad7df"
        },
        {
            "node": "ENSEMBL",
            "example": [
                "ENSG00000232166",
                "ENSG00000234147"
            ],
            "display": [
                {
                    "label": "ENSEMBL ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ENSEMBL",
                    "text": "${ENSEMBL}",
                    "type": "text"
                },
                {
                    "label": "ENSEMBL value",
                    "text": "${ENSEMBL value}",
                    "type": "text"
                },
                {
                    "label": "ENSEMBL lowerbound",
                    "text": "${ENSEMBL lowerbound}",
                    "type": "text"
                },
                {
                    "label": "ENSEMBL upperbound",
                    "text": "${ENSEMBL upperbound}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "ENSEMBL"
            ],
            "color": "#69eb7d"
        },
        {
            "node": "EFO",
            "example": [
                "aortic aneurysm",
                "hemochromatosis type 1"
            ],
            "display": [
                {
                    "label": "EFO ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "DOID",
                "EFO",
                "MP",
                "MONDO"
            ],
            "color": "#9abec6"
        },
        {
            "node": "Hormone",
            "example": [
                "aldosterone 18-glucuronide",
                "thyroxine sulfate"
            ],
            "display": [
                {
                    "label": "Hormone ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "ATC",
                    "text": "${ATC}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "GS",
                    "text": "${GS}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "MMSL",
                    "text": "${MMSL}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "NDDF",
                    "text": "${NDDF}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "DRUGBANK",
                    "text": "${DRUGBANK}",
                    "type": "text"
                },
                {
                    "label": "VANDF",
                    "text": "${VANDF}",
                    "type": "text"
                },
                {
                    "label": "MTHSPL",
                    "text": "${MTHSPL}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "RXNORM",
                    "text": "${RXNORM}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "USP",
                    "text": "${USP}",
                    "type": "text"
                },
                {
                    "label": "USPMG",
                    "text": "${USPMG}",
                    "type": "text"
                },
                {
                    "label": "CPM",
                    "text": "${CPM}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "CPT",
                    "text": "${CPT}",
                    "type": "text"
                },
                {
                    "label": "CHEBI",
                    "text": "${CHEBI}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "Organic Chemical",
                    "text": "${Organic Chemical}",
                    "type": "text"
                },
                {
                    "label": "Vitamin",
                    "text": "${Vitamin}",
                    "type": "text"
                },
                {
                    "label": "Amino Acid, Peptide, or Protein",
                    "text": "${Amino Acid, Peptide, or Protein}",
                    "type": "text"
                },
                {
                    "label": "Pharmacologic Substance",
                    "text": "${Pharmacologic Substance}",
                    "type": "text"
                },
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid",
                    "text": "${Indicator, Reagent, or Diagnostic Aid}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "LNC",
                "ATC",
                "MEDLINEPLUS",
                "GS",
                "CSP",
                "MMSL",
                "CHV",
                "NDDF",
                "PSY",
                "DRUGBANK",
                "VANDF",
                "MTHSPL",
                "MTH",
                "MSH",
                "NCI",
                "PDQ",
                "SNOMEDCT_US",
                "RXNORM",
                "MEDCIN",
                "USP",
                "USPMG",
                "CPM",
                "LCH_NW",
                "FMA",
                "UWDA",
                "CPT",
                "CHEBI",
                "PUBCHEM",
                "Organic Chemical",
                "Vitamin",
                "Amino Acid, Peptide, or Protein",
                "Pharmacologic Substance",
                "Indicator, Reagent, or Diagnostic Aid"
            ],
            "color": "#c6d7e7"
        },
        {
            "node": "Body Space or Junction",
            "example": [
                "Dermoepidermal junction",
                "Temporomandibular Joint"
            ],
            "display": [
                {
                    "label": "Body Space or Junction ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "HL7V2.5",
                    "text": "${HL7V2.5}",
                    "type": "text"
                },
                {
                    "label": "UBERON",
                    "text": "${UBERON}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "CHV",
                "UWDA",
                "SNOMEDCT_US",
                "FMA",
                "MTH",
                "NCI",
                "SNOMEDCT_VET",
                "LNC",
                "CSP",
                "LCH_NW",
                "HL7V2.5",
                "UBERON",
                "MP"
            ],
            "color": "#75c2f7"
        },
        {
            "node": "GLYGEN GLYCOSEQUENCE",
            "example": [
                "CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O[C@@H]2[C@H](OC([C@@H]([C@H]2O)NC(=O)C)O)CO)CO)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO[C@@H]4[C@H]([C@H]([C@@H]([C@H](O4)CO[C@@H]5[C@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O[C@@H]6[C@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)O[C@@H]7[C@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O[C@@H]8[C@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O)O)O[C@@H]9[C@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O[C@@H]1[C@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)O)O",
                "WURCS=2.0/5,12,11/[u2122h_2*NCC/3=O][a2122h-1x_1-5_2*NCC/3=O][a1122h-1x_1-5][a2112h-1x_1-5_2*NCC/3=O][a1221m-1x_1-5]/1-2-3-3-2-4-2-3-2-4-2-5/a?-b1_a?-l1_b?-c1_c?-d1_c?-h1_d?-e1_d?-g1_e?-f1_h?-i1_h?-k1_i?-j1"
            ],
            "display": [
                {
                    "label": "GLYGEN GLYCOSEQUENCE ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "GLYGEN.GLYCOSEQUENCE",
                    "text": "${GLYGEN.GLYCOSEQUENCE}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "GLYGEN.GLYCOSEQUENCE"
            ],
            "color": "#e7a6ef"
        },
        {
            "node": "4DNQ",
            "example": [
                "4DNQ:1e-11.1e-11 CUI",
                "4DNQ:1e-12.1e-12 CUI"
            ],
            "display": [
                {
                    "label": "4DNQ ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "4DNQ",
                    "text": "${4DNQ}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "4DNQ",
                "label"
            ],
            "color": "#75db96"
        },
        {
            "node": "Hazardous or Poisonous Substance",
            "example": [
                "Insect Repellents",
                "anatoxin a"
            ],
            "display": [
                {
                    "label": "Hazardous or Poisonous Substance ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid",
                    "text": "${Indicator, Reagent, or Diagnostic Aid}",
                    "type": "text"
                },
                {
                    "label": "Biologically Active Substance",
                    "text": "${Biologically Active Substance}",
                    "type": "text"
                },
                {
                    "label": "Element, Ion, or Isotope",
                    "text": "${Element, Ion, or Isotope}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CHV",
                "SNOMEDCT_US",
                "MSH",
                "MEDLINEPLUS",
                "PUBCHEM",
                "Indicator, Reagent, or Diagnostic Aid",
                "Biologically Active Substance",
                "Element, Ion, or Isotope"
            ],
            "color": "#dbb6ff"
        },
        {
            "node": "Therapeutic or Preventive Procedure",
            "example": [
                "Procedure related to general anesthesia",
                "Anesthesia for cesarean section"
            ],
            "display": [
                {
                    "label": "Therapeutic or Preventive Procedure ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "CPT",
                    "text": "${CPT}",
                    "type": "text"
                },
                {
                    "label": "ICD10AMAE",
                    "text": "${ICD10AMAE}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "ICNP",
                    "text": "${ICNP}",
                    "type": "text"
                },
                {
                    "label": "CCS",
                    "text": "${CCS}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "CCC",
                    "text": "${CCC}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "HCPT",
                    "text": "${HCPT}",
                    "type": "text"
                },
                {
                    "label": "NIC",
                    "text": "${NIC}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "ALT",
                    "text": "${ALT}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "CCSR_ICD10PCS",
                    "text": "${CCSR_ICD10PCS}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "ICD10AE",
                    "text": "${ICD10AE}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "LCH_NW",
                "CSP",
                "MSH",
                "ICD9CM",
                "CPT",
                "ICD10AMAE",
                "MDR",
                "ICNP",
                "CCS",
                "LNC",
                "CHV",
                "NCI",
                "ICD10AM",
                "MTH",
                "CCC",
                "MEDCIN",
                "SNOMEDCT_US",
                "PDQ",
                "MTHICD9",
                "NANDA-I",
                "HCPT",
                "NIC",
                "ICD10",
                "ALT",
                "ICPC2P",
                "PSY",
                "CCSR_ICD10PCS",
                "MEDLINEPLUS",
                "ICPC2ICD10ENG",
                "ICD10AE",
                "HPO",
                "OMIM",
                "DOID",
                "MONDO",
                "EFO"
            ],
            "color": "#e3cafb"
        },
        {
            "node": "CLINGEN ALLELE REGISTRY",
            "example": [
                "chr7.128763741.A.G.b38",
                "chr20.372073.A.G.b38"
            ],
            "display": [
                {
                    "label": "CLINGEN ALLELE REGISTRY ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CLINGEN.ALLELE.REGISTRY",
                    "text": "${CLINGEN.ALLELE.REGISTRY}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CLINGEN.ALLELE.REGISTRY"
            ],
            "color": "#becaae"
        },
        {
            "node": "Disease or Syndrome",
            "example": [
                "Renal dysplasia and retinal aplasia (disorder)",
                "DEAFNESS, AUTOSOMAL DOMINANT 73"
            ],
            "display": [
                {
                    "label": "Disease or Syndrome ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "CCS",
                    "text": "${CCS}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "ICD10AMAE",
                    "text": "${ICD10AMAE}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "CCSR_ICD10CM",
                    "text": "${CCSR_ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "ICD10AE",
                    "text": "${ICD10AE}",
                    "type": "text"
                },
                {
                    "label": "ICPC2EENG",
                    "text": "${ICPC2EENG}",
                    "type": "text"
                },
                {
                    "label": "PDQ",
                    "text": "${PDQ}",
                    "type": "text"
                },
                {
                    "label": "MTHICPC2ICD10AE",
                    "text": "${MTHICPC2ICD10AE}",
                    "type": "text"
                },
                {
                    "label": "ICNP",
                    "text": "${ICNP}",
                    "type": "text"
                },
                {
                    "label": "HL7V2.5",
                    "text": "${HL7V2.5}",
                    "type": "text"
                },
                {
                    "label": "HL7V3.0",
                    "text": "${HL7V3.0}",
                    "type": "text"
                },
                {
                    "label": "OMS",
                    "text": "${OMS}",
                    "type": "text"
                },
                {
                    "label": "DSM-5",
                    "text": "${DSM-5}",
                    "type": "text"
                },
                {
                    "label": "MTHICPC2EAE",
                    "text": "${MTHICPC2EAE}",
                    "type": "text"
                },
                {
                    "label": "CPM",
                    "text": "${CPM}",
                    "type": "text"
                },
                {
                    "label": "CCC",
                    "text": "${CCC}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "UBERON",
                    "text": "${UBERON}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "Congenital Abnormality",
                    "text": "${Congenital Abnormality}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "ICD10AM",
                "MDR",
                "ICD10CM",
                "MTH",
                "ICPC2ICD10ENG",
                "ORPHANET",
                "ICD9CM",
                "ICPC2P",
                "MSH",
                "NCI",
                "OMIM",
                "MTHICD9",
                "SNOMEDCT_US",
                "LCH_NW",
                "CCS",
                "MEDLINEPLUS",
                "CSP",
                "HPO",
                "LNC",
                "NANDA-I",
                "MEDCIN",
                "CHV",
                "ICD10",
                "NOC",
                "ICD10AMAE",
                "SNOMEDCT_VET",
                "CCSR_ICD10CM",
                "PSY",
                "ICD10AE",
                "ICPC2EENG",
                "PDQ",
                "MTHICPC2ICD10AE",
                "ICNP",
                "HL7V2.5",
                "HL7V3.0",
                "OMS",
                "DSM-5",
                "MTHICPC2EAE",
                "CPM",
                "CCC",
                "UWDA",
                "UBERON",
                "DOID",
                "MONDO",
                "HP",
                "EFO",
                "PUBCHEM",
                "Congenital Abnormality"
            ],
            "color": "#e3d292"
        },
        {
            "node": "Spatial Concept",
            "example": [
                "With laterality",
                "Spatial pattern"
            ],
            "display": [
                {
                    "label": "Spatial Concept ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "SNOMEDCT_US",
                "LNC",
                "MTH",
                "CHV",
                "NCI",
                "HPO"
            ],
            "color": "#a6c6e3"
        },
        {
            "node": "Acquired Abnormality",
            "example": [
                "Nuclear cataract",
                "Cicatrix, Hypertrophic"
            ],
            "display": [
                {
                    "label": "Acquired Abnormality ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MTHICD9",
                    "text": "${MTHICD9}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "ORPHANET",
                    "text": "${ORPHANET}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "DOID",
                    "text": "${DOID}",
                    "type": "text"
                },
                {
                    "label": "MONDO",
                    "text": "${MONDO}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CHV",
                "ICPC2ICD10ENG",
                "MEDCIN",
                "MSH",
                "ICD10",
                "SNOMEDCT_US",
                "MTHICD9",
                "MDR",
                "HPO",
                "ICD9CM",
                "LCH_NW",
                "OMIM",
                "ICD10CM",
                "NCI",
                "ICD10AM",
                "MTH",
                "ICPC2P",
                "ORPHANET",
                "MEDLINEPLUS",
                "LNC",
                "CSP",
                "DOID",
                "MONDO",
                "HP",
                "EFO"
            ],
            "color": "#dfb2ce"
        },
        {
            "node": "Phenotype",
            "example": [
                "male",
                "female"
            ],
            "display": [
                {
                    "label": "Phenotype ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "PATO",
                    "text": "${PATO}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "PATO",
                "HPO",
                "OMIM"
            ],
            "color": "#a2c271"
        },
        {
            "node": "Cell Type",
            "example": [
                "endospore",
                "myotube"
            ],
            "display": [
                {
                    "label": "Cell Type ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CL",
                    "text": "${CL}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CL"
            ],
            "color": "#efa608"
        },
        {
            "node": "Body System",
            "example": [
                "Skeleton",
                "Diego blood group system"
            ],
            "display": [
                {
                    "label": "Body System ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "UWDA",
                    "text": "${UWDA}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_VET",
                    "text": "${SNOMEDCT_VET}",
                    "type": "text"
                },
                {
                    "label": "OMS",
                    "text": "${OMS}",
                    "type": "text"
                },
                {
                    "label": "UBERON",
                    "text": "${UBERON}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "CHV",
                "FMA",
                "CSP",
                "MTH",
                "SNOMEDCT_US",
                "LNC",
                "UWDA",
                "LCH_NW",
                "OMIM",
                "PSY",
                "SNOMEDCT_VET",
                "OMS",
                "UBERON"
            ],
            "color": "#69e3be"
        },
        {
            "node": "MP",
            "example": [
                "decreased spleen germinal center number",
                "abnormal nose morphology"
            ],
            "display": [
                {
                    "label": "MP ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CL",
                    "text": "${CL}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CL",
                "MP"
            ],
            "color": "#eb8eff"
        },
        {
            "node": "FALDO",
            "example": [
                "Exact position",
                "One of positions"
            ],
            "display": [
                {
                    "label": "FALDO ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "FALDO",
                    "text": "${FALDO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "FALDO"
            ],
            "color": "#00e759"
        },
        {
            "node": "Enzyme",
            "example": [
                "NT5C2 wt Allele",
                "Lys-Asn-Asp"
            ],
            "display": [
                {
                    "label": "Enzyme ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                },
                {
                    "label": "Pharmacologic Substance",
                    "text": "${Pharmacologic Substance}",
                    "type": "text"
                },
                {
                    "label": "Amino Acid, Peptide, or Protein",
                    "text": "${Amino Acid, Peptide, or Protein}",
                    "type": "text"
                },
                {
                    "label": "Hazardous or Poisonous Substance",
                    "text": "${Hazardous or Poisonous Substance}",
                    "type": "text"
                },
                {
                    "label": "Immunologic Factor",
                    "text": "${Immunologic Factor}",
                    "type": "text"
                },
                {
                    "label": "Receptor",
                    "text": "${Receptor}",
                    "type": "text"
                },
                {
                    "label": "Nucleic Acid, Nucleoside, or Nucleotide",
                    "text": "${Nucleic Acid, Nucleoside, or Nucleotide}",
                    "type": "text"
                },
                {
                    "label": "Indicator, Reagent, or Diagnostic Aid",
                    "text": "${Indicator, Reagent, or Diagnostic Aid}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSH",
                "MTH",
                "NCI",
                "PUBCHEM",
                "Pharmacologic Substance",
                "Amino Acid, Peptide, or Protein",
                "Hazardous or Poisonous Substance",
                "Immunologic Factor",
                "Receptor",
                "Nucleic Acid, Nucleoside, or Nucleotide",
                "Indicator, Reagent, or Diagnostic Aid"
            ],
            "color": "#bece59"
        },
        {
            "node": "ENCODE CCRE H3K27AC",
            "example": [
                "ENCODE.CCRE.H3K27AC:LOW.ZSCORE CUI",
                "ENCODE.CCRE.H3K27AC:HIGH.ZSCORE CUI"
            ],
            "display": [
                {
                    "label": "ENCODE CCRE H3K27AC ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "ENCODE.CCRE.H3K27AC",
                    "text": "${ENCODE.CCRE.H3K27AC}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "ENCODE.CCRE.H3K27AC",
                "label"
            ],
            "color": "#dfbea6"
        },
        {
            "node": "Bacterium",
            "example": [
                "Vancomycin-Resistant Enterococci"
            ],
            "display": [
                {
                    "label": "Bacterium ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "LNC",
                "SNOMEDCT_US",
                "MSH",
                "NCI",
                "CHV",
                "MEDLINEPLUS"
            ],
            "color": "#ebbe00"
        },
        {
            "node": "Plant",
            "example": [
                "Poison Ivy"
            ],
            "display": [
                {
                    "label": "Plant ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "NCBI",
                    "text": "${NCBI}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "Food",
                    "text": "${Food}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "SNOMEDCT_US",
                "MSH",
                "NCBI",
                "MTH",
                "LNC",
                "Food"
            ],
            "color": "#00e7ce"
        },
        {
            "node": "Molecular Function",
            "example": [
                "dihydrobiopterin reduction",
                "atp binding"
            ],
            "display": [
                {
                    "label": "Molecular Function ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "GO",
                    "text": "${GO}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                },
                {
                    "label": "PUBCHEM",
                    "text": "${PUBCHEM}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CHV",
                "MSH",
                "GO",
                "NCI",
                "SNOMEDCT_US",
                "CSP",
                "LCH_NW",
                "MP",
                "PUBCHEM"
            ],
            "color": "#ebb2a6"
        },
        {
            "node": "Organism Function",
            "example": [
                "branching involved in ureteric bud morphogenesis",
                "Pregnancy"
            ],
            "display": [
                {
                    "label": "Organism Function ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "CSP",
                    "text": "${CSP}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "GO",
                    "text": "${GO}",
                    "type": "text"
                },
                {
                    "label": "LCH_NW",
                    "text": "${LCH_NW}",
                    "type": "text"
                },
                {
                    "label": "ICF-CY",
                    "text": "${ICF-CY}",
                    "type": "text"
                },
                {
                    "label": "MEDLINEPLUS",
                    "text": "${MEDLINEPLUS}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "PSY",
                    "text": "${PSY}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "ICF",
                    "text": "${ICF}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "FMA",
                    "text": "${FMA}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "ICPC2EENG",
                    "text": "${ICPC2EENG}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "OMS",
                    "text": "${OMS}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "MP",
                    "text": "${MP}",
                    "type": "text"
                },
                {
                    "label": "EFO",
                    "text": "${EFO}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "CHV",
                "MSH",
                "CSP",
                "SNOMEDCT_US",
                "GO",
                "LCH_NW",
                "ICF-CY",
                "MEDLINEPLUS",
                "LNC",
                "ICPC2ICD10ENG",
                "PSY",
                "MTH",
                "ICF",
                "NCI",
                "NANDA-I",
                "MEDCIN",
                "FMA",
                "MDR",
                "ICPC2EENG",
                "NOC",
                "OMS",
                "HPO",
                "ICD10CM",
                "MP",
                "EFO"
            ],
            "color": "#e3b282"
        },
        {
            "node": "CHLO",
            "example": [
                "CHLO:chr4.5689001-5690000 CUI",
                "CHLO:chr8.61039001-61040000 CUI"
            ],
            "display": [
                {
                    "label": "CHLO ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "CHLO",
                    "text": "${CHLO}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "type",
                "CHLO",
                "label"
            ],
            "color": "#fbc2c6"
        },
        {
            "node": "KFCOHORT",
            "example": [
                "Kids First: Enchondromatoses",
                "Kids First: Syndromic Cranial Dysinnervation"
            ],
            "display": [
                {
                    "label": "KFCOHORT ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "KFCOHORT",
                    "text": "${KFCOHORT}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "KFCOHORT"
            ],
            "color": "#24d292"
        },
        {
            "node": "Functional Concept",
            "example": [
                "Urinary Retention"
            ],
            "display": [
                {
                    "label": "Functional Concept ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MTH",
                    "text": "${MTH}",
                    "type": "text"
                },
                {
                    "label": "MSH",
                    "text": "${MSH}",
                    "type": "text"
                },
                {
                    "label": "LNC",
                    "text": "${LNC}",
                    "type": "text"
                },
                {
                    "label": "CHV",
                    "text": "${CHV}",
                    "type": "text"
                },
                {
                    "label": "SNOMEDCT_US",
                    "text": "${SNOMEDCT_US}",
                    "type": "text"
                },
                {
                    "label": "MEDCIN",
                    "text": "${MEDCIN}",
                    "type": "text"
                },
                {
                    "label": "NCI",
                    "text": "${NCI}",
                    "type": "text"
                },
                {
                    "label": "MDR",
                    "text": "${MDR}",
                    "type": "text"
                },
                {
                    "label": "ICPC2P",
                    "text": "${ICPC2P}",
                    "type": "text"
                },
                {
                    "label": "NOC",
                    "text": "${NOC}",
                    "type": "text"
                },
                {
                    "label": "ICD10CM",
                    "text": "${ICD10CM}",
                    "type": "text"
                },
                {
                    "label": "HPO",
                    "text": "${HPO}",
                    "type": "text"
                },
                {
                    "label": "OMIM",
                    "text": "${OMIM}",
                    "type": "text"
                },
                {
                    "label": "ICD10AM",
                    "text": "${ICD10AM}",
                    "type": "text"
                },
                {
                    "label": "CCC",
                    "text": "${CCC}",
                    "type": "text"
                },
                {
                    "label": "CPM",
                    "text": "${CPM}",
                    "type": "text"
                },
                {
                    "label": "ICPC2ICD10ENG",
                    "text": "${ICPC2ICD10ENG}",
                    "type": "text"
                },
                {
                    "label": "ICNP",
                    "text": "${ICNP}",
                    "type": "text"
                },
                {
                    "label": "CCS",
                    "text": "${CCS}",
                    "type": "text"
                },
                {
                    "label": "ICD9CM",
                    "text": "${ICD9CM}",
                    "type": "text"
                },
                {
                    "label": "NANDA-I",
                    "text": "${NANDA-I}",
                    "type": "text"
                },
                {
                    "label": "ICPC2EENG",
                    "text": "${ICPC2EENG}",
                    "type": "text"
                },
                {
                    "label": "ICD10",
                    "text": "${ICD10}",
                    "type": "text"
                },
                {
                    "label": "HP",
                    "text": "${HP}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MTH",
                "MSH",
                "LNC",
                "CHV",
                "SNOMEDCT_US",
                "MEDCIN",
                "NCI",
                "MDR",
                "ICPC2P",
                "NOC",
                "ICD10CM",
                "HPO",
                "OMIM",
                "ICD10AM",
                "CCC",
                "CPM",
                "ICPC2ICD10ENG",
                "ICNP",
                "CCS",
                "ICD9CM",
                "NANDA-I",
                "ICPC2EENG",
                "ICD10",
                "HP"
            ],
            "color": "#c6ca8a"
        },
        {
            "node": "MSIGDB",
            "example": [
                "WP_RAC1PAK1P38MMP2_PATHWAY",
                "ZNF549_TARGET_GENES"
            ],
            "display": [
                {
                    "label": "MSIGDB ID",
                    "text": "${id}",
                    "type": "text"
                },
                {
                    "label": "label",
                    "text": "${label}",
                    "type": "text"
                },
                {
                    "label": "type",
                    "text": "${type}",
                    "type": "text"
                },
                {
                    "label": "MSIGDB",
                    "text": "${MSIGDB}",
                    "type": "text"
                }
            ],
            "relation": [],
            "search": [
                "id",
                "label",
                "type",
                "MSIGDB"
            ],
            "color": "#d7c2d7"
        }
    ],
    "edges": [
        {
            "match": [
                "coexpression Cervix   Endocervix",
                "attached by",
                "coexpression Brain   Amygdala",
                "coexpression Vagina",
                "coexpression Uterus",
                "coexpression Prostate",
                "coexpression Fallopian Tube",
                "correlated in",
                "coexpression Artery   Coronary",
                "correlated with condition",
                "coexpression Brain   Anterior cingulate cortex (BA24)",
                "has signal",
                "coexpression Brain   Caudate (basal ganglia)",
                "coexpression Colon   Sigmoid",
                "signature gene of",
                "refers to",
                "coexpression Brain   Spinal cord (cervical c 1)",
                "coexpression Bladder",
                "coexpression Skin   Not Sun Exposed (Suprapubic)",
                "has motif",
                "coexpression Cervix   Ectocervix",
                "coexpression Esophagus   Gastroesophageal Junction",
                "belongs to cohort",
                "coexpression Whole Blood",
                "regulates",
                "coexpression Brain   Putamen (basal ganglia)",
                "has canonical residue",
                "gene associated with disease or phenotype",
                "4DN file has loop",
                "coexpression Adrenal Gland",
                "coexpression Brain   Hippocampus",
                "4DN loop us start",
                "coexpression Colon   Transverse",
                "4DN loop ds start",
                "coexpression Heart   Atrial Appendage",
                "causally influenced by",
                "coexpression Skin   Sun Exposed (Lower leg)",
                "coexpression Adipose   Visceral (Omentum)",
                "coexpression Spleen",
                "has monosaccharide",
                "has parent",
                "produces",
                "coexpression Artery   Aorta",
                "coexpression Esophagus   Mucosa",
                "coexpression Thyroid",
                "coexpression Pituitary",
                "coexpression Testis",
                "isa",
                "4DN loop ds end",
                "gene expression targeted by",
                "is approximately equivalent to",
                "has phenotype",
                "coexpression Minor Salivary Gland",
                "in similarity relationship with",
                "is from source",
                "has subsequence",
                "overlaps",
                "coexpression Brain   Frontal Cortex (BA9)",
                "coexpression Brain   Cerebellum",
                "has enzyme protein",
                "coexpression Breast   Mammary Tissue",
                "coexpression Brain   Cerebellar Hemisphere",
                "coexpression Ovary",
                "4DN dataset has file",
                "coexpression Kidney   Cortex",
                "is subsequence of",
                "coexpression Brain   Hypothalamus",
                "not predicted in",
                "coexpression Brain   Cortex",
                "p value",
                "coexpression Heart   Left Ventricle",
                "coexpression Stomach",
                "4DN dataset involves cell type",
                "bioactivity",
                "coexpression Cells   EBV transformed lymphocytes",
                "location has variants",
                "4DN loop us end",
                "phenotype of",
                "coexpression Nerve   Tibial",
                "coexpression Kidney   Medulla",
                "indication",
                "regulated by",
                "marker gene of",
                "coexpression Pancreas",
                "synthesized by",
                "coexpression Artery   Tibial",
                "produced by",
                "gene associated with pathway",
                "coexpression Small Intestine   Terminal Ileum",
                "gender",
                "located in",
                "coexpression Lung",
                "part of",
                "expresses",
                "coexpression Cells   Cultured fibroblasts",
                "not correlated in",
                "location of",
                "associated with",
                "coexpression Esophagus   Muscularis",
                "has part",
                "coexpression Brain   Substantia nigra",
                "coexpression Adipose   Subcutaneous",
                "coexpression Muscle   Skeletal",
                "coexpression Brain   Nucleus accumbens (basal ganglia)",
                "predicted in",
                "4DN loop has qvalue bin",
                "gene located in chr band",
                "causally influences",
                "expressed in",
                "involved in",
                "molecularly interacts with",
                "has glycosequence",
                "coexpression Liver"
            ],
            "selected": true,
            "order": [
                "evidence",
                "DESC"
            ],
            "color": "#bdbdbd",
            "display": [
                {
                    "label": "source",
                    "text": "${source}",
                    "type": "text"
                },
                {
                    "label": "relation",
                    "text": "${relation}",
                    "type": "text"
                },
                {
                    "label": "target",
                    "text": "${target}",
                    "type": "text"
                },
                {
                    "label": "source label",
                    "text": "${source_label}",
                    "type": "text"
                },
                {
                    "label": "target label",
                    "text": "${target_label}",
                    "type": "text"
                },
                {
                    "label": "SAB",
                    "text": "${SAB}",
                    "type": "text"
                },
                {
                    "label": "evidence",
                    "text": "${evidence}",
                    "type": "text"
                },
                {
                    "label": "DCC",
                    "text": "${DCC}",
                    "type": "text"
                }
            ]
        },
        {
            "match": [
                "positively regulated by",
                "positively regulates"
            ],
            "selected": true,
            "order": [
                "evidence",
                "DESC"
            ],
            "color": "#90caf9",
            "display": [
                {
                    "label": "source",
                    "text": "${source}",
                    "type": "text"
                },
                {
                    "label": "relation",
                    "text": "${relation}",
                    "type": "text"
                },
                {
                    "label": "target",
                    "text": "${target}",
                    "type": "text"
                },
                {
                    "label": "source label",
                    "text": "${source_label}",
                    "type": "text"
                },
                {
                    "label": "target label",
                    "text": "${target_label}",
                    "type": "text"
                },
                {
                    "label": "SAB",
                    "text": "${SAB}",
                    "type": "text"
                },
                {
                    "label": "evidence",
                    "text": "${evidence}",
                    "type": "text"
                },
                {
                    "label": "DCC",
                    "text": "${DCC}",
                    "type": "text"
                }
            ]
        },
        {
            "match": [
                "negatively regulated by",
                "negatively regulates"
            ],
            "selected": true,
            "order": [
                "evidence",
                "ASC"
            ],
            "color": "#ef9a9a",
            "display": [
                {
                    "label": "source",
                    "text": "${source}",
                    "type": "text"
                },
                {
                    "label": "relation",
                    "text": "${relation}",
                    "type": "text"
                },
                {
                    "label": "target",
                    "text": "${target}",
                    "type": "text"
                },
                {
                    "label": "source label",
                    "text": "${source_label}",
                    "type": "text"
                },
                {
                    "label": "target label",
                    "text": "${target_label}",
                    "type": "text"
                },
                {
                    "label": "SAB",
                    "text": "${SAB}",
                    "type": "text"
                },
                {
                    "label": "evidence",
                    "text": "${evidence}",
                    "type": "text"
                },
                {
                    "label": "DCC",
                    "text": "${DCC}",
                    "type": "text"
                }
            ]
        }
    ],
    "header": {
        "title": "Data Distillery KG",
        "icon": {
            "src": "https://s3.amazonaws.com/maayan-kg/cfde-kg/assets/CFDE.png",
            "favicon": "https://s3.amazonaws.com/maayan-kg/cfde-kg/assets/favicon.png",
            "faviconTitle": "Data Distillery KG",
            "alt": "Data Distillery",
            "key": "data_distillery_logo",
            "width": 100,
            "height": 100
        },
        "tabs": [
            {
                "endpoint": "/",
                "label": "Connection Explorer",
                "type": "page",
                "component": "KnowledgeGraph",
                "position": "bottom",
                "props": {
                    "init_function": "initialize_kg",
                    "title": "ConnectionExplorer: Find connections between CFDE DD KG entities",
                    "description": "Select a CFDE DD KG entity to find other entities connected to it or explore connections between two CFDE DD KG entities.",
                    "initial_query": {
                        "start": "Gene",
                        "start_term": "MAOB gene",
                        "start_field": "label",
                        "relation": ["positively regulates"]
                    }
                }
            },
            {
                "endpoint": "/dd_apps",
                "label": "Apps",
                "type": "group",
                "component": "DistilleryLanding",
                "position": "bottom",
                "props": {
                    "title": "Data Distillery Apps",
                    "description": "Explore Data Distillery data with these apps",
                    "pages": [
                        {
                            "endpoint": "/dd_apps/tissue2drugs",
                            "label": "Tissue2Drugs",
                            "type": "page",
                            "component": "DistilleryUseCase",
                            "props": {
                                "init_function": "initialize_kg",
                                "title": "Tissue2Drugs",
                                "description": "Find all genes that are highly expressed in a GTEx tissue and may be perturbed by a specific compound based on data from the LINCS L1000 dataset, and are known drug targets based on data curated by IDG.",
                                "endpoint": "/api/distillery/tissue2drugs",
                                "type": "Tissue",
                                "options_endpoint": "/api/distillery/gtex_tissue",
                                "icon": "https://minio.dev.maayanlab.cloud/datadistillery-kg/img/apps/tissues2drugs.png",
                                "fields": [
                                    "UBERON",
                                    "id",
                                    "label"
                                ],
                                "default_term": "Subcutaneous Fat"
                            }
                        },
                        {
                            "endpoint": "/dd_apps/mw2diseases",
                            "label": "MW2Disease",
                            "type": "page",
                            "component": "DistilleryUseCase",
                            "props": {
                                "init_function": "initialize_kg",
                                "title": "MW2Disease",
                                "description": "For a specific disease in Metabolomics Workbench, find all IDG and GTEx assertions that may be related to the disease in a specific tissue type.",
                                "endpoint": "/api/distillery/mw",
                                "icon": "https://minio.dev.maayanlab.cloud/datadistillery-kg/img/apps/MW2Disease.png",
                                "type": "Disease",
                                "options_endpoint": "/api/distillery/mw_diseases",
                                "fields": [
                                    "DOID",
                                    "id",
                                    "label",
                                    "MONDO",
                                    "ORPHANET",
                                    "HP"
                                ],
                                "default_term": "glutathione synthetase deficiency"
                            }
                        },
                        {
                            "endpoint": "/dd_apps/enzymeminer",
                            "label": "EnzymeMiner",
                            "type": "page",
                            "component": "DistilleryUseCase",
                            "props": {
                                "init_function": "initialize_kg",
                                "relations": [
                                    {"name": "positively regulates", "end": "Drug"},
                                    {"name": "negatively regulates", "end": "Drug"},
                                    {"name": "expresses"}
                                ],
                                "title": "EnzymeMiner",
                                "icon": "https://minio.dev.maayanlab.cloud/datadistillery-kg/img/apps/EnzymeMiner.png",
                                "description": "Select a drug processing enzyme to view drugs that up or down regulate it from LINCS as well as tissues where it is highly expressed based on data from GTEx.",
                                "endpoint": "/api/knowledge_graph",
                                "type": "Gene",
                                "options_endpoint": "/api/knowledge_graph/node_search",
                                "fields": [
                                    "ENTREZ",
                                    "UNIPROTKB",
                                    "label",
                                    "HGNC"
                                ],
                                "default_term": "MAOB gene",
                                "checkbox_filter": {
                                    "is_Enzyme": true
                                },
                                "filter_text": "Enzyme"
                            }
                        },
                        {
                            "endpoint": "/dd_apps/disease2exrna",
                            "label": "Disease2ExRNA",
                            "type": "page",
                            "component": "DistilleryUseCase",
                            "props": {
                                "init_function": "initialize_kg",
                                "title": "Disease2ExRNA",
                                "icon": "https://minio.dev.maayanlab.cloud/datadistillery-kg/img/apps/disease2exrna.png",
                                "description": "For a given set of genes that are highly expressed in a specific disease, identify extracellular RNAs (exRNAs) that may be detected in human biofluids and thus serve as non-invasive disease biomarkers.",
                                "endpoint": "/api/distillery/disease2exrna",
                                "type": "Disease",
                                "options_endpoint": "/api/distillery/diseases_correlated_with_genes",
                                "fields": [
                                    "DOID",
                                    "id",
                                    "label",
                                    "MONDO",
                                    "ORPHANET",
                                    "HP"
                                ],
                                "default_term": "spinocerebellar ataxia 47"
                            }
                        }
                    ]
                }
            },
            {
                "endpoint": "/use_cases",
                "label": "Use Cases",
                "type": "group",
                "component": "DistilleryLanding",
                "position": "bottom",
                "props": {
                    "title": "Data Distillery Use Case",
                    "description": "Explore use cases that use distilled data from Common Fund Programs",
                    "pages": [
                        {
                            "endpoint": "/use_cases/tissue2drugs",
                            "label": "Breast Epithelium Use Case",
                            "type": "page",
                            "component": "DistilleryUseCase",
                            "props": {
                                "init_function": "initialize_kg",
                                "icon": "https://minio.dev.maayanlab.cloud/datadistillery-kg/img/apps/use-case1.png",
                                "title": "Breast Epitheliumn Use Case",
                                "description": "Find the genes that are highly expressed in breast epithelium as well as drugs that target these genes.",
                                "endpoint": "/api/distillery/tissue2drugs",
                                "type": "Tissue",
                                "options_endpoint": "/api/distillery/gtex_tissue",
                                "fields": [
                                    "UBERON",
                                    "id",
                                    "label"
                                ],
                                "default_term": "breast epithelium"
                            }
                        },
                        {
                            "endpoint": "/use_cases/mw_diseases",
                            "label": "Mild Cognitive Impairment Use Case",
                            "type": "page",
                            "component": "DistilleryUseCase",
                            "props": {
                                "init_function": "initialize_kg",
                                "title": "Mild Cognitive Impairment Use Case",
                                "icon": "https://minio.dev.maayanlab.cloud/datadistillery-kg/img/apps/use-case2.png",
                                "width": 130,
                                "height": 130,
                                "description": "Find all IDG and GTEx assertions that may be related to mild cognitive impairment and any tissue type.",
                                "endpoint": "/api/distillery/mw",
                                "type": "Disease",
                                "options_endpoint": "/api/distillery/mw_diseases",
                                "fields": [
                                    "DOID",
                                    "id",
                                    "label",
                                    "MONDO",
                                    "ORPHANET",
                                    "HP"
                                ],
                                "default_term": "mild cognitive impairment"
                            }
                        },
                        {
                            "endpoint": "/use_cases/enzyminer",
                            "label": "CES1 Use Case",
                            "type": "page",
                            "component": "DistilleryUseCase",
                            "props": {
                                "init_function": "initialize_kg",
                                "relations": [
                                    {"name": "positively regulates", "end": "Drug"},
                                    {"name": "negatively regulates", "end": "Drug"},
                                    {"name": "expresses"}
                                ],
                                "title": "CES1 Use Case",
                                "description": "Display drugs that up or down regulate the gene CES1 from LINCS as well as tissues where it is highly expressed based on assertions from GTEx.",
                                "endpoint": "/api/knowledge_graph",
                                "icon": "https://minio.dev.maayanlab.cloud/datadistillery-kg/img/apps/use-case3.png",
                                "type": "Gene",
                                "options_endpoint": "/api/knowledge_graph/node_search",
                                "fields": [
                                    "ENTREZ",
                                    "UNIPROTKB",
                                    "label",
                                    "HGNC"
                                ],
                                "default_term": "CES1 gene",
                                "checkbox_filter": {
                                    "is_Enzyme": true
                                },
                                "filter_text": "Enzyme"
                            }
                        }
                    ]
                }
            },
            {
                "endpoint": "https://info.cfde.cloud/",
                "label": "CFDE Information Portal",
                "type": "link",
                "component": "Link",
                "position": "top"
            },
            {
                "endpoint": "https://data.cfde.cloud/",
                "label": "CFDE Data Portal",
                "type": "link",
                "component": "Link",
                "position": "top"
            },
            {
                "endpoint": "/dictionary",
                "label": "Data Dictionary",
                "type": "html",
                "component": "SanitizedHTML",
                "position": "bottom",
                "props": {
                    "src": "https://minio.dev.maayanlab.cloud/datadistillery-kg/Dictionary/DataDistilleryDataDictionary0228.html"
                }
            },
            {
                "endpoint": "/downloads",
                "label": "Downloads",
                "type": "page",
                "component": "Download",
                "position": "bottom",
                "props": {
                    "src": "https://minio.dev.maayanlab.cloud/datadistillery-kg/download_detailed.json"
                }
            },
            {
                "endpoint": "/about",
                "label": "About",
                "type": "markdown",
                "component": "Markdown",
                "position": "top",
                "props": {
                    "src": "https://minio.dev.maayanlab.cloud/datadistillery-kg/about.md"
                }
            }
        ]
    },
    "footer": {
        "style": {
            "background": "#336699",
            "color": "#FFF"
        },
        "layout": [
            [
                {
                    "component": "logo",
                    "props": {
                        "src": "https://s3.amazonaws.com/maayan-kg/cfde-kg/assets/favicon.png",
                        "alt": "DDKG",
                        "title": "Data Distillery KG",
                        "color": "inherit",
                        "size": "small"
                    }
                },
                {
                    "component": "github",
                    "props": {
                        "code": "https://github.com/MaayanLab/datadistillery-kg",
                        "issues": "https://github.com/MaayanLab/data-distillery-issues/issues"
                    }
                },
                {
                    "component": "social",
                    "props": {
                        "email": "mailto:contact@cfde.info",
                        "twitter": "https://twitter.com/CFDEWorkbench",
                        "youtube": "https://www.youtube.com/channel/UCWucYIvMygAgG5t0xEGEZgg"
                        
                    }
                }
            ],
            [
                {
                    "component": "text",
                    "props": {
                        "text": "Consortium"
                    }
                },
                {
                    "component": "link",
                    "props": {
                        "text": "Information Portal",
                        "href": "https://info.cfde.cloud/"
                    }
                },
                {
                    "component": "link",
                    "props": {
                        "text": "Data Portal",
                        "href": "https://data.cfde.cloud/"
                    }
                }
            ],
            [
                {
                    "component": "text",
                    "props": {
                        "text": "Data Distillery"
                    }
                },
                {
                    "component": "link",
                    "props": {
                        "text": "Connection Explorer",
                        "href": "/"
                    }
                },
                {
                    "component": "link",
                    "props": {
                        "text": "Apps",
                        "href": "/dd_apps"
                    }
                },
                {
                    "component": "link",
                    "props": {
                        "text": "Use Cases",
                        "href": "/use_cases"
                    }
                }
            ],
            [
                {
                    "component": "text",
                    "props": {
                        "text": "Data Access"
                    }
                },
                {
                    "component": "link",
                    "props": {
                        "text": "Data Dictionary",
                        "href": "/dictionary"
                    }
                },
                {
                    "component": "link",
                    "props": {
                        "text": "Downloads",
                        "href": "/downloads"
                    }
                },
                {
                    "component": "link",
                    "props": {
                        "text": "About",
                        "href": "/about"
                    }
                }
            ]
        ]
    },
    "ui": {
        "background": "linear-gradient(180deg, #FFFFFF 26.13%, #DBE0ED 104.21%)",
        "footer_background": "#336699"
    }
}