From beba4b0a14c67b702a112aca6c573d4cc5e73ef1 Mon Sep 17 00:00:00 2001 From: Germain Date: Fri, 17 Feb 2023 10:55:15 +0000 Subject: [PATCH] Fix iOS output (#4) --- .gitignore | 2 + .../ios/swift/Compound.xcassets/Contents.json | 1 + .../colorBlue100.colorset/Contents.json | 78 ++++++ .../colorBlue1000.colorset/Contents.json | 78 ++++++ .../colorBlue1100.colorset/Contents.json | 78 ++++++ .../colorBlue1200.colorset/Contents.json | 78 ++++++ .../colorBlue1300.colorset/Contents.json | 78 ++++++ .../colorBlue1400.colorset/Contents.json | 78 ++++++ .../colorBlue200.colorset/Contents.json | 78 ++++++ .../colorBlue300.colorset/Contents.json | 78 ++++++ .../colorBlue400.colorset/Contents.json | 78 ++++++ .../colorBlue500.colorset/Contents.json | 78 ++++++ .../colorBlue600.colorset/Contents.json | 78 ++++++ .../colorBlue700.colorset/Contents.json | 78 ++++++ .../colorBlue800.colorset/Contents.json | 78 ++++++ .../colorBlue900.colorset/Contents.json | 78 ++++++ .../colorCyan100.colorset/Contents.json | 78 ++++++ .../colorCyan1000.colorset/Contents.json | 78 ++++++ .../colorCyan1100.colorset/Contents.json | 78 ++++++ .../colorCyan1200.colorset/Contents.json | 78 ++++++ .../colorCyan1300.colorset/Contents.json | 78 ++++++ .../colorCyan1400.colorset/Contents.json | 78 ++++++ .../colorCyan200.colorset/Contents.json | 78 ++++++ .../colorCyan300.colorset/Contents.json | 78 ++++++ .../colorCyan400.colorset/Contents.json | 78 ++++++ .../colorCyan500.colorset/Contents.json | 78 ++++++ .../colorCyan600.colorset/Contents.json | 78 ++++++ .../colorCyan700.colorset/Contents.json | 78 ++++++ .../colorCyan800.colorset/Contents.json | 78 ++++++ .../colorCyan900.colorset/Contents.json | 78 ++++++ .../colorFuchsia100.colorset/Contents.json | 78 ++++++ .../colorFuchsia1000.colorset/Contents.json | 78 ++++++ .../colorFuchsia1100.colorset/Contents.json | 78 ++++++ .../colorFuchsia1200.colorset/Contents.json | 78 ++++++ .../colorFuchsia1300.colorset/Contents.json | 78 ++++++ .../colorFuchsia1400.colorset/Contents.json | 78 ++++++ .../colorFuchsia200.colorset/Contents.json | 78 ++++++ .../colorFuchsia300.colorset/Contents.json | 78 ++++++ .../colorFuchsia400.colorset/Contents.json | 78 ++++++ .../colorFuchsia500.colorset/Contents.json | 78 ++++++ .../colorFuchsia600.colorset/Contents.json | 78 ++++++ .../colorFuchsia700.colorset/Contents.json | 78 ++++++ .../colorFuchsia800.colorset/Contents.json | 78 ++++++ .../colorFuchsia900.colorset/Contents.json | 78 ++++++ .../colorGray100.colorset/Contents.json | 78 ++++++ .../colorGray1000.colorset/Contents.json | 78 ++++++ .../colorGray1100.colorset/Contents.json | 78 ++++++ .../colorGray1200.colorset/Contents.json | 78 ++++++ .../colorGray1300.colorset/Contents.json | 78 ++++++ .../colorGray1400.colorset/Contents.json | 78 ++++++ .../colorGray200.colorset/Contents.json | 78 ++++++ .../colorGray300.colorset/Contents.json | 78 ++++++ .../colorGray400.colorset/Contents.json | 78 ++++++ .../colorGray500.colorset/Contents.json | 78 ++++++ .../colorGray600.colorset/Contents.json | 78 ++++++ .../colorGray700.colorset/Contents.json | 78 ++++++ .../colorGray800.colorset/Contents.json | 78 ++++++ .../colorGray900.colorset/Contents.json | 78 ++++++ .../colorGreen100.colorset/Contents.json | 78 ++++++ .../colorGreen1000.colorset/Contents.json | 78 ++++++ .../colorGreen1100.colorset/Contents.json | 78 ++++++ .../colorGreen1200.colorset/Contents.json | 78 ++++++ .../colorGreen1300.colorset/Contents.json | 78 ++++++ .../colorGreen1400.colorset/Contents.json | 78 ++++++ .../colorGreen200.colorset/Contents.json | 78 ++++++ .../colorGreen300.colorset/Contents.json | 78 ++++++ .../colorGreen400.colorset/Contents.json | 78 ++++++ .../colorGreen500.colorset/Contents.json | 78 ++++++ .../colorGreen600.colorset/Contents.json | 78 ++++++ .../colorGreen700.colorset/Contents.json | 78 ++++++ .../colorGreen800.colorset/Contents.json | 78 ++++++ .../colorGreen900.colorset/Contents.json | 78 ++++++ .../colorLime100.colorset/Contents.json | 78 ++++++ .../colorLime1000.colorset/Contents.json | 78 ++++++ .../colorLime1100.colorset/Contents.json | 78 ++++++ .../colorLime1200.colorset/Contents.json | 78 ++++++ .../colorLime1300.colorset/Contents.json | 78 ++++++ .../colorLime1400.colorset/Contents.json | 78 ++++++ .../colorLime200.colorset/Contents.json | 78 ++++++ .../colorLime300.colorset/Contents.json | 78 ++++++ .../colorLime400.colorset/Contents.json | 78 ++++++ .../colorLime500.colorset/Contents.json | 78 ++++++ .../colorLime600.colorset/Contents.json | 78 ++++++ .../colorLime700.colorset/Contents.json | 78 ++++++ .../colorLime800.colorset/Contents.json | 78 ++++++ .../colorLime900.colorset/Contents.json | 78 ++++++ .../colorOrange100.colorset/Contents.json | 78 ++++++ .../colorOrange1000.colorset/Contents.json | 78 ++++++ .../colorOrange1100.colorset/Contents.json | 78 ++++++ .../colorOrange1200.colorset/Contents.json | 78 ++++++ .../colorOrange1300.colorset/Contents.json | 78 ++++++ .../colorOrange1400.colorset/Contents.json | 78 ++++++ .../colorOrange200.colorset/Contents.json | 78 ++++++ .../colorOrange300.colorset/Contents.json | 78 ++++++ .../colorOrange400.colorset/Contents.json | 78 ++++++ .../colorOrange500.colorset/Contents.json | 78 ++++++ .../colorOrange600.colorset/Contents.json | 78 ++++++ .../colorOrange700.colorset/Contents.json | 78 ++++++ .../colorOrange800.colorset/Contents.json | 78 ++++++ .../colorOrange900.colorset/Contents.json | 78 ++++++ .../colorPink100.colorset/Contents.json | 78 ++++++ .../colorPink1000.colorset/Contents.json | 78 ++++++ .../colorPink1100.colorset/Contents.json | 78 ++++++ .../colorPink1200.colorset/Contents.json | 78 ++++++ .../colorPink1300.colorset/Contents.json | 78 ++++++ .../colorPink1400.colorset/Contents.json | 78 ++++++ .../colorPink200.colorset/Contents.json | 78 ++++++ .../colorPink300.colorset/Contents.json | 78 ++++++ .../colorPink400.colorset/Contents.json | 78 ++++++ .../colorPink500.colorset/Contents.json | 78 ++++++ .../colorPink600.colorset/Contents.json | 78 ++++++ .../colorPink700.colorset/Contents.json | 78 ++++++ .../colorPink800.colorset/Contents.json | 78 ++++++ .../colorPink900.colorset/Contents.json | 78 ++++++ .../colorPurple100.colorset/Contents.json | 78 ++++++ .../colorPurple1000.colorset/Contents.json | 78 ++++++ .../colorPurple1100.colorset/Contents.json | 78 ++++++ .../colorPurple1200.colorset/Contents.json | 78 ++++++ .../colorPurple1300.colorset/Contents.json | 78 ++++++ .../colorPurple1400.colorset/Contents.json | 78 ++++++ .../colorPurple200.colorset/Contents.json | 78 ++++++ .../colorPurple300.colorset/Contents.json | 78 ++++++ .../colorPurple400.colorset/Contents.json | 78 ++++++ .../colorPurple500.colorset/Contents.json | 78 ++++++ .../colorPurple600.colorset/Contents.json | 78 ++++++ .../colorPurple700.colorset/Contents.json | 78 ++++++ .../colorPurple800.colorset/Contents.json | 78 ++++++ .../colorPurple900.colorset/Contents.json | 78 ++++++ .../colorRed100.colorset/Contents.json | 78 ++++++ .../colorRed1000.colorset/Contents.json | 78 ++++++ .../colorRed1100.colorset/Contents.json | 78 ++++++ .../colorRed1200.colorset/Contents.json | 78 ++++++ .../colorRed1300.colorset/Contents.json | 78 ++++++ .../colorRed1400.colorset/Contents.json | 78 ++++++ .../colorRed200.colorset/Contents.json | 78 ++++++ .../colorRed300.colorset/Contents.json | 78 ++++++ .../colorRed400.colorset/Contents.json | 78 ++++++ .../colorRed500.colorset/Contents.json | 78 ++++++ .../colorRed600.colorset/Contents.json | 78 ++++++ .../colorRed700.colorset/Contents.json | 78 ++++++ .../colorRed800.colorset/Contents.json | 78 ++++++ .../colorRed900.colorset/Contents.json | 78 ++++++ .../colorYellow100.colorset/Contents.json | 78 ++++++ .../colorYellow1000.colorset/Contents.json | 78 ++++++ .../colorYellow1100.colorset/Contents.json | 78 ++++++ .../colorYellow1200.colorset/Contents.json | 78 ++++++ .../colorYellow1300.colorset/Contents.json | 78 ++++++ .../colorYellow1400.colorset/Contents.json | 78 ++++++ .../colorYellow200.colorset/Contents.json | 78 ++++++ .../colorYellow300.colorset/Contents.json | 78 ++++++ .../colorYellow400.colorset/Contents.json | 78 ++++++ .../colorYellow500.colorset/Contents.json | 78 ++++++ .../colorYellow600.colorset/Contents.json | 78 ++++++ .../colorYellow700.colorset/Contents.json | 78 ++++++ .../colorYellow800.colorset/Contents.json | 78 ++++++ .../colorYellow900.colorset/Contents.json | 78 ++++++ .../ios/swift/CompoundDarkDesignTokens.swift | 217 +++++++++++++++ .../swift/CompoundDarkHcDesignTokens.swift | 217 +++++++++++++++ .../ios/swift/CompoundLightDesignTokens.swift | 217 +++++++++++++++ .../swift/CompoundLightHcDesignTokens.swift | 217 +++++++++++++++ assets/ios/swift/CpdDark.swift | 241 ---------------- assets/ios/swift/CpdDarkHc.swift | 241 ---------------- assets/ios/swift/CpdLight.swift | 241 ---------------- assets/ios/swift/CpdLightHc.swift | 241 ---------------- package.json | 2 + src/actions/swift/colorset.ts | 176 ++++++++++++ src/configs/getIOSConfig.ts | 25 +- src/configs/getWebConfig.ts | 3 +- src/configs/index.ts | 2 - src/filters/ios/exclude.ts | 32 +++ .../utils.ts => filters/isCoreColor.ts} | 14 +- src/filters/isCoreToken.ts | 32 +++ src/setupStyleDictionary.ts | 27 ++ src/transforms/camelCaseDecimal.ts | 3 +- src/transforms/swift/coreColorSet.ts | 32 +++ src/transforms/swift/pxToCGFloat.ts | 38 +++ src/transforms/swift/toFontWeight.ts | 41 +++ tokens/platform-ios.json | 2 +- tokens/theme-dark.json | 2 +- yarn.lock | 259 ++++++++++-------- 180 files changed, 13441 insertions(+), 1096 deletions(-) create mode 100644 assets/ios/swift/Compound.xcassets/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue1000.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue1100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue1200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue1300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue1400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue500.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue600.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue700.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue800.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorBlue900.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan1000.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan1100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan1200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan1300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan1400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan500.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan600.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan700.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan800.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorCyan900.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia1000.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia1100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia1200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia1300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia1400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia500.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia600.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia700.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia800.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorFuchsia900.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray1000.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray1100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray1200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray1300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray1400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray500.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray600.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray700.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray800.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGray900.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen1000.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen1100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen1200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen1300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen1400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen500.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen600.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen700.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen800.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorGreen900.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime1000.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime1100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime1200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime1300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime1400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime500.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime600.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime700.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime800.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorLime900.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange1000.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange1100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange1200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange1300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange1400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange500.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange600.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange700.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange800.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorOrange900.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink1000.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink1100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink1200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink1300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink1400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink500.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink600.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink700.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink800.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPink900.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple1000.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple1100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple1200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple1300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple1400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple500.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple600.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple700.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple800.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorPurple900.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed1000.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed1100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed1200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed1300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed1400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed500.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed600.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed700.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed800.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorRed900.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow1000.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow1100.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow1200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow1300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow1400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow200.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow300.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow400.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow500.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow600.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow700.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow800.colorset/Contents.json create mode 100644 assets/ios/swift/Compound.xcassets/colorYellow900.colorset/Contents.json create mode 100644 assets/ios/swift/CompoundDarkDesignTokens.swift create mode 100644 assets/ios/swift/CompoundDarkHcDesignTokens.swift create mode 100644 assets/ios/swift/CompoundLightDesignTokens.swift create mode 100644 assets/ios/swift/CompoundLightHcDesignTokens.swift delete mode 100644 assets/ios/swift/CpdDark.swift delete mode 100644 assets/ios/swift/CpdDarkHc.swift delete mode 100644 assets/ios/swift/CpdLight.swift delete mode 100644 assets/ios/swift/CpdLightHc.swift create mode 100644 src/actions/swift/colorset.ts create mode 100644 src/filters/ios/exclude.ts rename src/{configs/utils.ts => filters/isCoreColor.ts} (58%) create mode 100644 src/filters/isCoreToken.ts create mode 100644 src/transforms/swift/coreColorSet.ts create mode 100644 src/transforms/swift/pxToCGFloat.ts create mode 100644 src/transforms/swift/toFontWeight.ts diff --git a/.gitignore b/.gitignore index 78d5dfc8..ad933ef8 100644 --- a/.gitignore +++ b/.gitignore @@ -3,3 +3,5 @@ node_modules .build storybook-static + +.swiftpm/ diff --git a/assets/ios/swift/Compound.xcassets/Contents.json b/assets/ios/swift/Compound.xcassets/Contents.json new file mode 100644 index 00000000..6df34f3a --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/Contents.json @@ -0,0 +1 @@ +{"info":{"author":"xcode","version":1}} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue100.colorset/Contents.json new file mode 100644 index 00000000..9d28fa20 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9765", + "green": "0.9882", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0196", + "blue": "0.3529" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9569", + "green": "0.9725", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0353", + "blue": "0.3647" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue1000.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue1000.colorset/Contents.json new file mode 100644 index 00000000..0bc4f451 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue1000.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0196", + "green": "0.3451", + "blue": "0.7804" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3686", + "green": "0.6000", + "blue": "0.9412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0196", + "green": "0.2314", + "blue": "0.6039" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6000", + "green": "0.7529", + "blue": "0.9725" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue1100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue1100.colorset/Contents.json new file mode 100644 index 00000000..10fad378 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue1100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0235", + "green": "0.2902", + "blue": "0.6941" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4784", + "green": "0.6706", + "blue": "0.9569" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0157", + "green": "0.1882", + "blue": "0.5333" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6980", + "green": "0.8118", + "blue": "0.9804" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue1200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue1200.colorset/Contents.json new file mode 100644 index 00000000..0c54468f --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue1200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0157", + "green": "0.2196", + "blue": "0.5804" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6314", + "green": "0.7686", + "blue": "0.9725" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0118", + "green": "0.1529", + "blue": "0.4824" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7686", + "green": "0.8588", + "blue": "0.9882" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue1300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue1300.colorset/Contents.json new file mode 100644 index 00000000..6d7a9aff --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue1300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0039", + "green": "0.1412", + "blue": "0.4706" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7922", + "green": "0.8706", + "blue": "0.9882" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0824", + "blue": "0.4118" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8941", + "green": "0.9333", + "blue": "0.9961" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue1400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue1400.colorset/Contents.json new file mode 100644 index 00000000..535684c2 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue1400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0549", + "blue": "0.3961" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8941", + "green": "0.9333", + "blue": "0.9961" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0471", + "blue": "0.3882" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9333", + "green": "0.9569", + "blue": "0.9961" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue200.colorset/Contents.json new file mode 100644 index 00000000..2f7d6134 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9569", + "green": "0.9725", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0353", + "blue": "0.3647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9137", + "green": "0.9490", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0627", + "blue": "0.3882" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue300.colorset/Contents.json new file mode 100644 index 00000000..f233c903 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9137", + "green": "0.9490", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0627", + "blue": "0.3882" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8471", + "green": "0.9059", + "blue": "0.9961" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1137", + "blue": "0.4314" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue400.colorset/Contents.json new file mode 100644 index 00000000..e3199ce5 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8471", + "green": "0.9059", + "blue": "0.9961" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1137", + "blue": "0.4314" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7843", + "green": "0.8667", + "blue": "0.9922" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0118", + "green": "0.1490", + "blue": "0.4667" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue500.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue500.colorset/Contents.json new file mode 100644 index 00000000..e38497ba --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue500.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7294", + "green": "0.8353", + "blue": "0.9882" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0235", + "green": "0.1765", + "blue": "0.5020" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6392", + "green": "0.7765", + "blue": "0.9804" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0314", + "green": "0.2196", + "blue": "0.5647" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue600.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue600.colorset/Contents.json new file mode 100644 index 00000000..2ae1469e --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue600.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6392", + "green": "0.7765", + "blue": "0.9804" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0314", + "green": "0.2196", + "blue": "0.5647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4941", + "green": "0.6863", + "blue": "0.9647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0431", + "green": "0.2824", + "blue": "0.6706" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue700.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue700.colorset/Contents.json new file mode 100644 index 00000000..a0541f80 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue700.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4941", + "green": "0.6863", + "blue": "0.9647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0431", + "green": "0.2824", + "blue": "0.6706" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2902", + "green": "0.5569", + "blue": "0.9412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0549", + "green": "0.3804", + "blue": "0.8196" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue800.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue800.colorset/Contents.json new file mode 100644 index 00000000..262b9fbb --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue800.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2510", + "green": "0.5333", + "blue": "0.9333" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0549", + "green": "0.4039", + "blue": "0.8471" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0157", + "green": "0.4314", + "blue": "0.9098" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1961", + "green": "0.4980", + "blue": "0.9137" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorBlue900.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorBlue900.colorset/Contents.json new file mode 100644 index 00000000..a7d190be --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorBlue900.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0157", + "green": "0.4039", + "blue": "0.8667" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2549", + "green": "0.5294", + "blue": "0.9216" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0196", + "green": "0.2627", + "blue": "0.6549" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5333", + "green": "0.7059", + "blue": "0.9647" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan100.colorset/Contents.json new file mode 100644 index 00000000..275b779c --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9725", + "green": "0.9922", + "blue": "0.9922" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0667", + "blue": "0.2667" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.9804", + "blue": "0.9843" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0784", + "blue": "0.2824" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan1000.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan1000.colorset/Contents.json new file mode 100644 index 00000000..a2ef6127 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan1000.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3843", + "blue": "0.6118" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0039", + "green": "0.6510", + "blue": "0.7765" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2667", + "blue": "0.4824" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4157", + "green": "0.8000", + "blue": "0.8510" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan1100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan1100.colorset/Contents.json new file mode 100644 index 00000000..6b482621 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan1100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3294", + "blue": "0.5490" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1294", + "green": "0.7294", + "blue": "0.8039" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2157", + "blue": "0.4314" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5725", + "green": "0.8471", + "blue": "0.8863" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan1200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan1200.colorset/Contents.json new file mode 100644 index 00000000..c4d204d3 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan1200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2510", + "blue": "0.4667" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4627", + "green": "0.8157", + "blue": "0.8588" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1804", + "blue": "0.3922" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6863", + "green": "0.8863", + "blue": "0.9137" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan1300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan1300.colorset/Contents.json new file mode 100644 index 00000000..9ba30f03 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan1300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1686", + "blue": "0.3804" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7216", + "green": "0.8980", + "blue": "0.9216" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1176", + "blue": "0.3255" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8510", + "green": "0.9490", + "blue": "0.9608" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan1400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan1400.colorset/Contents.json new file mode 100644 index 00000000..4847d287 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan1400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0980", + "blue": "0.3098" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8510", + "green": "0.9490", + "blue": "0.9608" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0902", + "blue": "0.3020" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9098", + "green": "0.9686", + "blue": "0.9765" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan200.colorset/Contents.json new file mode 100644 index 00000000..f12f2f3b --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.9804", + "blue": "0.9843" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.0784", + "blue": "0.2824" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8902", + "green": "0.9608", + "blue": "0.9725" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1059", + "blue": "0.3059" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan300.colorset/Contents.json new file mode 100644 index 00000000..589dea89 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8902", + "green": "0.9608", + "blue": "0.9725" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1059", + "blue": "0.3059" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7804", + "green": "0.9255", + "blue": "0.9412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1451", + "blue": "0.3490" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan400.colorset/Contents.json new file mode 100644 index 00000000..9a5f129b --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7804", + "green": "0.9255", + "blue": "0.9412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1451", + "blue": "0.3490" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6941", + "green": "0.8941", + "blue": "0.9216" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1765", + "blue": "0.3804" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan500.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan500.colorset/Contents.json new file mode 100644 index 00000000..2453cf7b --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan500.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6078", + "green": "0.8667", + "blue": "0.8980" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2039", + "blue": "0.4078" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4627", + "green": "0.8196", + "blue": "0.8667" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2471", + "blue": "0.4549" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan600.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan600.colorset/Contents.json new file mode 100644 index 00000000..b26e9720 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan600.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4627", + "green": "0.8196", + "blue": "0.8667" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2471", + "blue": "0.4549" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0824", + "green": "0.7451", + "blue": "0.8118" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3176", + "blue": "0.5333" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan700.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan700.colorset/Contents.json new file mode 100644 index 00000000..6d5eb23d --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan700.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0824", + "green": "0.7451", + "blue": "0.8118" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3176", + "blue": "0.5333" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.6039", + "blue": "0.7647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.4196", + "blue": "0.6431" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan800.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan800.colorset/Contents.json new file mode 100644 index 00000000..0f8b86ea --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan800.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.5804", + "blue": "0.7529" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0078", + "green": "0.4431", + "blue": "0.6667" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.4784", + "blue": "0.7020" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.5412", + "blue": "0.7294" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorCyan900.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorCyan900.colorset/Contents.json new file mode 100644 index 00000000..5f864dd5 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorCyan900.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.4471", + "blue": "0.6745" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.5765", + "blue": "0.7451" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2980", + "blue": "0.5176" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2627", + "green": "0.7647", + "blue": "0.8235" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia100.colorset/Contents.json new file mode 100644 index 00000000..f2fe9ef6 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9961", + "green": "0.9804", + "blue": "0.9961" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1569", + "green": "0.0000", + "blue": "0.2392" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9882", + "green": "0.9608", + "blue": "0.9922" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1725", + "green": "0.0000", + "blue": "0.2588" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia1000.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia1000.colorset/Contents.json new file mode 100644 index 00000000..1c72a4d8 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia1000.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5922", + "green": "0.1647", + "blue": "0.6667" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8118", + "green": "0.4706", + "blue": "0.8431" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4235", + "green": "0.0902", + "blue": "0.5216" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8902", + "green": "0.6706", + "blue": "0.9059" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia1100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia1100.colorset/Contents.json new file mode 100644 index 00000000..e37d7420 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia1100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5098", + "green": "0.1294", + "blue": "0.5961" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8510", + "green": "0.5647", + "blue": "0.8706" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3608", + "green": "0.0588", + "blue": "0.4627" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9176", + "green": "0.7490", + "blue": "0.9294" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia1200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia1200.colorset/Contents.json new file mode 100644 index 00000000..ff584a25 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia1200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4039", + "green": "0.0784", + "blue": "0.5059" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8980", + "green": "0.6941", + "blue": "0.9137" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3216", + "green": "0.0078", + "blue": "0.4235" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9412", + "green": "0.8118", + "blue": "0.9490" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia1300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia1300.colorset/Contents.json new file mode 100644 index 00000000..dbf3a777 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia1300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3059", + "green": "0.0000", + "blue": "0.4078" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.8314", + "blue": "0.9529" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2314", + "green": "0.0000", + "blue": "0.3255" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9725", + "green": "0.9098", + "blue": "0.9765" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia1400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia1400.colorset/Contents.json new file mode 100644 index 00000000..3a7029ee --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia1400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2039", + "green": "0.0000", + "blue": "0.2980" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9725", + "green": "0.9098", + "blue": "0.9765" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1961", + "green": "0.0000", + "blue": "0.2902" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9843", + "green": "0.9451", + "blue": "0.9843" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia200.colorset/Contents.json new file mode 100644 index 00000000..6c5a3b36 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9882", + "green": "0.9608", + "blue": "0.9922" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1725", + "green": "0.0000", + "blue": "0.2588" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9804", + "green": "0.9333", + "blue": "0.9843" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2157", + "green": "0.0000", + "blue": "0.3059" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia300.colorset/Contents.json new file mode 100644 index 00000000..d4eec1b9 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9804", + "green": "0.9333", + "blue": "0.9843" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2157", + "green": "0.0000", + "blue": "0.3059" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9647", + "green": "0.8745", + "blue": "0.9686" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2667", + "green": "0.0000", + "blue": "0.3608" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia400.colorset/Contents.json new file mode 100644 index 00000000..12ada67e --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9647", + "green": "0.8745", + "blue": "0.9686" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2667", + "green": "0.0000", + "blue": "0.3608" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.8235", + "blue": "0.9529" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3098", + "green": "0.0118", + "blue": "0.4078" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia500.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia500.colorset/Contents.json new file mode 100644 index 00000000..848d5f05 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia500.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9294", + "green": "0.7765", + "blue": "0.9412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3373", + "green": "0.0588", + "blue": "0.4353" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9059", + "green": "0.6980", + "blue": "0.9176" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3961", + "green": "0.0902", + "blue": "0.4902" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia600.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia600.colorset/Contents.json new file mode 100644 index 00000000..a67c0503 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia600.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9059", + "green": "0.6980", + "blue": "0.9176" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3961", + "green": "0.0902", + "blue": "0.4902" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8588", + "green": "0.5765", + "blue": "0.8824" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4902", + "green": "0.1373", + "blue": "0.5804" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia700.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia700.colorset/Contents.json new file mode 100644 index 00000000..0bb52838 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia700.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8588", + "green": "0.5765", + "blue": "0.8824" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4902", + "green": "0.1373", + "blue": "0.5804" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7961", + "green": "0.4078", + "blue": "0.8314" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6353", + "green": "0.2000", + "blue": "0.7020" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia800.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia800.colorset/Contents.json new file mode 100644 index 00000000..89af9497 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia800.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7843", + "green": "0.3686", + "blue": "0.8196" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6667", + "green": "0.2118", + "blue": "0.7294" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7255", + "green": "0.2157", + "blue": "0.7765" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7569", + "green": "0.3216", + "blue": "0.7961" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorFuchsia900.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorFuchsia900.colorset/Contents.json new file mode 100644 index 00000000..59eadde0 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorFuchsia900.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6784", + "green": "0.2000", + "blue": "0.7412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7725", + "green": "0.3725", + "blue": "0.8118" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4706", + "green": "0.1098", + "blue": "0.5647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8667", + "green": "0.6118", + "blue": "0.8863" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray100.colorset/Contents.json new file mode 100644 index 00000000..d30e2eaa --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9843", + "green": "0.9843", + "blue": "0.9882" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0314", + "green": "0.0902", + "blue": "0.1451" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9686", + "green": "0.9725", + "blue": "0.9765" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0471", + "green": "0.1059", + "blue": "0.1608" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray1000.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray1000.colorset/Contents.json new file mode 100644 index 00000000..ffa8abc2 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray1000.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3020", + "green": "0.3725", + "blue": "0.4471" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5490", + "green": "0.6039", + "blue": "0.6667" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1961", + "green": "0.2667", + "blue": "0.3373" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7098", + "green": "0.7451", + "blue": "0.7882" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray1100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray1100.colorset/Contents.json new file mode 100644 index 00000000..80adcd64 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray1100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2549", + "green": "0.3216", + "blue": "0.3961" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6235", + "green": "0.6706", + "blue": "0.7216" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1608", + "green": "0.2275", + "blue": "0.2941" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7804", + "green": "0.8078", + "blue": "0.8353" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray1200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray1200.colorset/Contents.json new file mode 100644 index 00000000..3aec10d0 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray1200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1843", + "green": "0.2549", + "blue": "0.3216" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7333", + "green": "0.7647", + "blue": "0.8039" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1294", + "green": "0.1922", + "blue": "0.2627" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8314", + "green": "0.8549", + "blue": "0.8745" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray1300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray1300.colorset/Contents.json new file mode 100644 index 00000000..bd035094 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray1300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1176", + "green": "0.1804", + "blue": "0.2471" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8510", + "green": "0.8667", + "blue": "0.8902" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0706", + "green": "0.1333", + "blue": "0.2000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9216", + "green": "0.9294", + "blue": "0.9412" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray1400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray1400.colorset/Contents.json new file mode 100644 index 00000000..90c3d994 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray1400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0588", + "green": "0.1176", + "blue": "0.1804" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9216", + "green": "0.9294", + "blue": "0.9412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0549", + "green": "0.1137", + "blue": "0.1765" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9529", + "green": "0.9569", + "blue": "0.9647" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray200.colorset/Contents.json new file mode 100644 index 00000000..f38a1b26 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9686", + "green": "0.9725", + "blue": "0.9765" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0471", + "green": "0.1059", + "blue": "0.1608" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9333", + "green": "0.9451", + "blue": "0.9529" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0667", + "green": "0.1255", + "blue": "0.1843" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray300.colorset/Contents.json new file mode 100644 index 00000000..979c436b --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9333", + "green": "0.9451", + "blue": "0.9529" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0667", + "green": "0.1255", + "blue": "0.1843" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8863", + "green": "0.9020", + "blue": "0.9176" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1020", + "green": "0.1608", + "blue": "0.2235" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray400.colorset/Contents.json new file mode 100644 index 00000000..7550bcae --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8863", + "green": "0.9020", + "blue": "0.9176" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1020", + "green": "0.1608", + "blue": "0.2235" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8471", + "green": "0.8667", + "blue": "0.8902" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1216", + "green": "0.1843", + "blue": "0.2471" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray500.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray500.colorset/Contents.json new file mode 100644 index 00000000..16c320ea --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray500.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8000", + "green": "0.8275", + "blue": "0.8549" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1490", + "green": "0.2118", + "blue": "0.2745" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7373", + "green": "0.7725", + "blue": "0.8078" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1882", + "green": "0.2510", + "blue": "0.3176" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray600.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray600.colorset/Contents.json new file mode 100644 index 00000000..9110d00b --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray600.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7373", + "green": "0.7725", + "blue": "0.8078" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1882", + "green": "0.2510", + "blue": "0.3176" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6353", + "green": "0.6824", + "blue": "0.7373" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2471", + "green": "0.3137", + "blue": "0.3843" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray700.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray700.colorset/Contents.json new file mode 100644 index 00000000..5811f7a9 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray700.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6353", + "green": "0.6824", + "blue": "0.7373" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2471", + "green": "0.3137", + "blue": "0.3843" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5020", + "green": "0.5647", + "blue": "0.6353" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3373", + "green": "0.4078", + "blue": "0.4784" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray800.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray800.colorset/Contents.json new file mode 100644 index 00000000..8d2c588e --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray800.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4745", + "green": "0.5451", + "blue": "0.6157" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3569", + "green": "0.4275", + "blue": "0.4980" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3843", + "green": "0.4588", + "blue": "0.5373" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4431", + "green": "0.5098", + "blue": "0.5843" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGray900.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGray900.colorset/Contents.json new file mode 100644 index 00000000..fa5e557e --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGray900.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3569", + "green": "0.4314", + "blue": "0.5059" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4745", + "green": "0.5373", + "blue": "0.6078" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2275", + "green": "0.2941", + "blue": "0.3686" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6627", + "green": "0.7059", + "blue": "0.7529" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen100.colorset/Contents.json new file mode 100644 index 00000000..5161a8e4 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9725", + "green": "0.9922", + "blue": "0.9843" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1098", + "blue": "0.0431" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.9843", + "blue": "0.9647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1216", + "blue": "0.0549" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen1000.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen1000.colorset/Contents.json new file mode 100644 index 00000000..48717c35 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen1000.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.4196", + "blue": "0.3216" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0902", + "green": "0.6745", + "blue": "0.5176" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3020", + "blue": "0.2118" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3804", + "green": "0.8196", + "blue": "0.6510" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen1100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen1100.colorset/Contents.json new file mode 100644 index 00000000..ea5fc42a --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen1100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3608", + "blue": "0.2706" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1216", + "green": "0.7529", + "blue": "0.5647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2510", + "blue": "0.1686" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5569", + "green": "0.8667", + "blue": "0.7373" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen1200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen1200.colorset/Contents.json new file mode 100644 index 00000000..28c19d75 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen1200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2863", + "blue": "0.2000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4392", + "green": "0.8353", + "blue": "0.6784" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2157", + "blue": "0.1373" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6706", + "green": "0.8980", + "blue": "0.7961" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen1300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen1300.colorset/Contents.json new file mode 100644 index 00000000..19e12c76 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen1300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2039", + "blue": "0.1255" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7098", + "green": "0.9098", + "blue": "0.8196" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1529", + "blue": "0.0824" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8510", + "green": "0.9529", + "blue": "0.9059" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen1400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen1400.colorset/Contents.json new file mode 100644 index 00000000..47fcf503 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen1400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1373", + "blue": "0.0667" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8510", + "green": "0.9529", + "blue": "0.9059" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1294", + "blue": "0.0588" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9098", + "green": "0.9725", + "blue": "0.9412" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen200.colorset/Contents.json new file mode 100644 index 00000000..dd551e23 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.9843", + "blue": "0.9647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1216", + "blue": "0.0549" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8902", + "green": "0.9686", + "blue": "0.9294" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1451", + "blue": "0.0745" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen300.colorset/Contents.json new file mode 100644 index 00000000..931d4667 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8902", + "green": "0.9686", + "blue": "0.9294" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1451", + "blue": "0.0745" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7765", + "green": "0.9333", + "blue": "0.8588" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1804", + "blue": "0.1059" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen400.colorset/Contents.json new file mode 100644 index 00000000..48d427d0 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7765", + "green": "0.9333", + "blue": "0.8588" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1804", + "blue": "0.1059" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6863", + "green": "0.9098", + "blue": "0.8078" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2118", + "blue": "0.1333" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen500.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen500.colorset/Contents.json new file mode 100644 index 00000000..187c71e9 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen500.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5961", + "green": "0.8824", + "blue": "0.7569" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2392", + "blue": "0.1608" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4431", + "green": "0.8431", + "blue": "0.6824" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2824", + "blue": "0.1961" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen600.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen600.colorset/Contents.json new file mode 100644 index 00000000..c13db40c --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen600.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4431", + "green": "0.8431", + "blue": "0.6824" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2824", + "blue": "0.1961" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0431", + "green": "0.7686", + "blue": "0.5686" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3529", + "blue": "0.2627" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen700.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen700.colorset/Contents.json new file mode 100644 index 00000000..8e3de7f4 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen700.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0431", + "green": "0.7686", + "blue": "0.5686" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3529", + "blue": "0.2627" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.6353", + "blue": "0.4863" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.4549", + "blue": "0.3608" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen800.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen800.colorset/Contents.json new file mode 100644 index 00000000..e7de7b57 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen800.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.6078", + "blue": "0.4706" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.4745", + "blue": "0.3804" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.5098", + "blue": "0.4078" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0627", + "green": "0.5686", + "blue": "0.4510" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorGreen900.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorGreen900.colorset/Contents.json new file mode 100644 index 00000000..53bb76ce --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorGreen900.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.4784", + "blue": "0.3804" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0706", + "green": "0.6000", + "blue": "0.4706" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3333", + "blue": "0.2392" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2157", + "green": "0.7882", + "blue": "0.5961" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime100.colorset/Contents.json new file mode 100644 index 00000000..7fed1107 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9725", + "green": "0.9922", + "blue": "0.9647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1059", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.9882", + "blue": "0.9333" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1176", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime1000.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime1000.colorset/Contents.json new file mode 100644 index 00000000..f9f8bff2 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime1000.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.4314", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2784", + "green": "0.6784", + "blue": "0.1490" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3098", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4118", + "green": "0.8353", + "blue": "0.2118" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime1100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime1100.colorset/Contents.json new file mode 100644 index 00000000..15a6ff17 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime1100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3725", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3373", + "green": "0.7529", + "blue": "0.1725" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2588", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5686", + "green": "0.8824", + "blue": "0.4510" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime1200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime1200.colorset/Contents.json new file mode 100644 index 00000000..a8909b74 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime1200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2941", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4627", + "green": "0.8510", + "blue": "0.3020" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2235", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6784", + "green": "0.9137", + "blue": "0.5961" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime1300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime1300.colorset/Contents.json new file mode 100644 index 00000000..5655112b --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime1300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2118", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7137", + "green": "0.9216", + "blue": "0.6392" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1608", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8549", + "green": "0.9647", + "blue": "0.8157" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime1400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime1400.colorset/Contents.json new file mode 100644 index 00000000..e498c6a5 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime1400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1412", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8549", + "green": "0.9647", + "blue": "0.8157" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1333", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9098", + "green": "0.9765", + "blue": "0.8902" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime200.colorset/Contents.json new file mode 100644 index 00000000..52a67740 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.9882", + "blue": "0.9333" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1176", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8784", + "green": "0.9725", + "blue": "0.8510" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1451", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime300.colorset/Contents.json new file mode 100644 index 00000000..5af2527a --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8784", + "green": "0.9725", + "blue": "0.8510" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1451", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7843", + "green": "0.9451", + "blue": "0.7294" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1843", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime400.colorset/Contents.json new file mode 100644 index 00000000..e3f72b26 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7843", + "green": "0.9451", + "blue": "0.7294" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.1843", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6863", + "green": "0.9216", + "blue": "0.6078" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2157", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime500.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime500.colorset/Contents.json new file mode 100644 index 00000000..59a1ff5f --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime500.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6000", + "green": "0.8980", + "blue": "0.4941" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2431", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4627", + "green": "0.8588", + "blue": "0.2980" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2902", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime600.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime600.colorset/Contents.json new file mode 100644 index 00000000..ca30d0ce --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime600.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4627", + "green": "0.8588", + "blue": "0.2980" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.2902", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3294", + "green": "0.7686", + "blue": "0.1412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3608", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime700.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime700.colorset/Contents.json new file mode 100644 index 00000000..daccdf14 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime700.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3294", + "green": "0.7686", + "blue": "0.1412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3608", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2275", + "green": "0.6392", + "blue": "0.1020" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0941", + "green": "0.4627", + "blue": "0.0667" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime800.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime800.colorset/Contents.json new file mode 100644 index 00000000..783d7534 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime800.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2078", + "green": "0.6157", + "blue": "0.0941" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1137", + "green": "0.4863", + "blue": "0.0745" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1216", + "green": "0.5216", + "blue": "0.0588" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1922", + "green": "0.5804", + "blue": "0.1137" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorLime900.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorLime900.colorset/Contents.json new file mode 100644 index 00000000..511637f7 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorLime900.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0980", + "green": "0.4902", + "blue": "0.0471" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2196", + "green": "0.6078", + "blue": "0.1255" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0000", + "green": "0.3412", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3686", + "green": "0.7922", + "blue": "0.1843" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange100.colorset/Contents.json new file mode 100644 index 00000000..d87d5ac0 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9804", + "blue": "0.9686" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2196", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9647", + "blue": "0.9373" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2353", + "green": "0.0000", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange1000.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange1000.colorset/Contents.json new file mode 100644 index 00000000..3e14367e --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange1000.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6745", + "green": "0.2000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9176", + "green": "0.4784", + "blue": "0.0706" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5373", + "green": "0.0314", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9804", + "green": "0.6745", + "blue": "0.4510" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange1100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange1100.colorset/Contents.json new file mode 100644 index 00000000..1a44b66b --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange1100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6078", + "green": "0.1333", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9647", + "green": "0.5686", + "blue": "0.2392" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4667", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9922", + "green": "0.7529", + "blue": "0.5882" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange1200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange1200.colorset/Contents.json new file mode 100644 index 00000000..edef5cd3 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange1200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5216", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9843", + "green": "0.6980", + "blue": "0.4941" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4039", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9961", + "green": "0.8157", + "blue": "0.6941" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange1300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange1300.colorset/Contents.json new file mode 100644 index 00000000..dbea4073 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange1300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3843", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8353", + "blue": "0.7216" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2980", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9137", + "blue": "0.8588" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange1400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange1400.colorset/Contents.json new file mode 100644 index 00000000..01fffaeb --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange1400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2706", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9137", + "blue": "0.8588" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2588", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9490", + "blue": "0.9098" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange200.colorset/Contents.json new file mode 100644 index 00000000..3f47a0a8 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9647", + "blue": "0.9373" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2353", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9373", + "blue": "0.8941" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2784", + "green": "0.0000", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange300.colorset/Contents.json new file mode 100644 index 00000000..0e063b8d --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9373", + "blue": "0.8941" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2784", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8745", + "blue": "0.7843" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3451", + "green": "0.0000", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange400.colorset/Contents.json new file mode 100644 index 00000000..87681dd2 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8745", + "blue": "0.7843" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3451", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8314", + "blue": "0.7098" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3961", + "green": "0.0000", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange500.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange500.colorset/Contents.json new file mode 100644 index 00000000..2ff7697e --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange500.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.7843", + "blue": "0.6314" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4431", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9922", + "green": "0.7020", + "blue": "0.4863" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5098", + "green": "0.0118", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange600.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange600.colorset/Contents.json new file mode 100644 index 00000000..3952ef2e --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange600.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9922", + "green": "0.7020", + "blue": "0.4863" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5098", + "green": "0.0118", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9725", + "green": "0.5804", + "blue": "0.2510" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5922", + "green": "0.1294", + "blue": "0.0196" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange700.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange700.colorset/Contents.json new file mode 100644 index 00000000..0771602e --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange700.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9725", + "green": "0.5804", + "blue": "0.2510" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5922", + "green": "0.1294", + "blue": "0.0196" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8863", + "green": "0.4314", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7020", + "green": "0.2510", + "blue": "0.0275" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange800.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange800.colorset/Contents.json new file mode 100644 index 00000000..ad622058 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange800.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8627", + "green": "0.4039", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7255", + "green": "0.2745", + "blue": "0.0275" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7686", + "green": "0.3020", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8196", + "green": "0.3725", + "blue": "0.0431" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorOrange900.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorOrange900.colorset/Contents.json new file mode 100644 index 00000000..14f062b9 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorOrange900.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7373", + "green": "0.2706", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8510", + "green": "0.4039", + "blue": "0.0510" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5765", + "green": "0.0902", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9725", + "green": "0.6157", + "blue": "0.3451" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink100.colorset/Contents.json new file mode 100644 index 00000000..c3ffc25f --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9804", + "blue": "0.9843" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2157", + "green": "0.0000", + "blue": "0.0588" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9608", + "blue": "0.9686" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2353", + "green": "0.0000", + "blue": "0.0706" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink1000.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink1000.colorset/Contents.json new file mode 100644 index 00000000..a013fd85 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink1000.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7216", + "green": "0.0392", + "blue": "0.3569" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9804", + "green": "0.3922", + "blue": "0.5608" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5176", + "green": "0.0275", + "blue": "0.2706" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.6431", + "blue": "0.7216" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink1100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink1100.colorset/Contents.json new file mode 100644 index 00000000..bd16ab87 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink1100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6235", + "green": "0.0314", + "blue": "0.3137" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9961", + "green": "0.5176", + "blue": "0.6353" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4471", + "green": "0.0000", + "blue": "0.2275" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.7333", + "blue": "0.7882" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink1200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink1200.colorset/Contents.json new file mode 100644 index 00000000..47ed3305 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink1200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4941", + "green": "0.0235", + "blue": "0.2588" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.6706", + "blue": "0.7412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3922", + "green": "0.0000", + "blue": "0.1843" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8000", + "blue": "0.8431" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink1300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink1300.colorset/Contents.json new file mode 100644 index 00000000..2a285f1e --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink1300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3725", + "green": "0.0000", + "blue": "0.1686" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8196", + "blue": "0.8588" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2902", + "green": "0.0000", + "blue": "0.1098" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9059", + "blue": "0.9255" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink1400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink1400.colorset/Contents.json new file mode 100644 index 00000000..45f1cc34 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink1400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2627", + "green": "0.0000", + "blue": "0.0902" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9059", + "blue": "0.9255" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2549", + "green": "0.0000", + "blue": "0.0824" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9412", + "blue": "0.9529" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink200.colorset/Contents.json new file mode 100644 index 00000000..a90bb1be --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9608", + "blue": "0.9686" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2353", + "green": "0.0000", + "blue": "0.0706" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9255", + "blue": "0.9412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2706", + "green": "0.0000", + "blue": "0.0941" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink300.colorset/Contents.json new file mode 100644 index 00000000..f30aef1f --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9255", + "blue": "0.9412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2706", + "green": "0.0000", + "blue": "0.0941" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8706", + "blue": "0.8980" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3333", + "green": "0.0000", + "blue": "0.1412" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink400.colorset/Contents.json new file mode 100644 index 00000000..a7f14668 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8706", + "blue": "0.8980" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3333", + "green": "0.0000", + "blue": "0.1412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8157", + "blue": "0.8549" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3804", + "green": "0.0000", + "blue": "0.1765" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink500.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink500.colorset/Contents.json new file mode 100644 index 00000000..03dd1828 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink500.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.7608", + "blue": "0.8118" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4235", + "green": "0.0000", + "blue": "0.2078" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.6784", + "blue": "0.7529" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4824", + "green": "0.0471", + "blue": "0.2549" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink600.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink600.colorset/Contents.json new file mode 100644 index 00000000..e98d538c --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink600.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.6784", + "blue": "0.7529" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4824", + "green": "0.0471", + "blue": "0.2549" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.5333", + "blue": "0.6510" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5961", + "green": "0.0667", + "blue": "0.3098" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink700.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink700.colorset/Contents.json new file mode 100644 index 00000000..846f323e --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink700.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.5333", + "blue": "0.6510" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5961", + "green": "0.0667", + "blue": "0.3098" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9765", + "green": "0.3059", + "blue": "0.5176" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7725", + "green": "0.0902", + "blue": "0.3804" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink800.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink800.colorset/Contents.json new file mode 100644 index 00000000..ce036d20 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink800.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9686", + "green": "0.2510", + "blue": "0.4902" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8078", + "green": "0.0941", + "blue": "0.3961" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8784", + "green": "0.0471", + "blue": "0.4157" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.1686", + "blue": "0.4588" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPink900.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPink900.colorset/Contents.json new file mode 100644 index 00000000..81217e7d --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPink900.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8235", + "green": "0.0471", + "blue": "0.3961" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9569", + "green": "0.2549", + "blue": "0.4902" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5725", + "green": "0.0314", + "blue": "0.2941" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.5725", + "blue": "0.6745" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple100.colorset/Contents.json new file mode 100644 index 00000000..64d1e22f --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9843", + "green": "0.9843", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.0941", + "green": "0.0000", + "blue": "0.3137" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9725", + "green": "0.9686", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1098", + "green": "0.0000", + "blue": "0.3529" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple1000.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple1000.colorset/Contents.json new file mode 100644 index 00000000..62a55d13 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple1000.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4196", + "green": "0.2157", + "blue": "0.8706" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6196", + "green": "0.5255", + "blue": "0.9882" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3098", + "green": "0.0510", + "blue": "0.7294" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7529", + "green": "0.7098", + "blue": "1.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple1100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple1100.colorset/Contents.json new file mode 100644 index 00000000..fe041e66 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple1100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3647", + "green": "0.1490", + "blue": "0.8039" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6784", + "green": "0.6118", + "blue": "0.9961" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2588", + "green": "0.0000", + "blue": "0.6510" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8078", + "green": "0.7765", + "blue": "1.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple1200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple1200.colorset/Contents.json new file mode 100644 index 00000000..32469c5c --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple1200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2980", + "green": "0.0196", + "blue": "0.7098" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7686", + "green": "0.7294", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2118", + "green": "0.0000", + "blue": "0.5804" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8549", + "green": "0.8314", + "blue": "1.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple1300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple1300.colorset/Contents.json new file mode 100644 index 00000000..a5eefd74 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple1300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2000", + "green": "0.0000", + "blue": "0.5529" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8706", + "green": "0.8510", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1412", + "green": "0.0000", + "blue": "0.4392" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9333", + "green": "0.9216", + "blue": "1.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple1400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple1400.colorset/Contents.json new file mode 100644 index 00000000..960faf16 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple1400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1255", + "green": "0.0000", + "blue": "0.4000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9333", + "green": "0.9216", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1216", + "green": "0.0000", + "blue": "0.3843" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9569", + "green": "0.9529", + "blue": "1.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple200.colorset/Contents.json new file mode 100644 index 00000000..07eb080a --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9725", + "green": "0.9686", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1098", + "green": "0.0000", + "blue": "0.3529" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.9373", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1294", + "green": "0.0000", + "blue": "0.4078" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple300.colorset/Contents.json new file mode 100644 index 00000000..806aa60b --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.9373", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1294", + "green": "0.0000", + "blue": "0.4078" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9020", + "green": "0.8863", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1725", + "green": "0.0000", + "blue": "0.5020" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple400.colorset/Contents.json new file mode 100644 index 00000000..da6101f0 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9020", + "green": "0.8863", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.1725", + "green": "0.0000", + "blue": "0.5020" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8667", + "green": "0.8471", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2078", + "green": "0.0000", + "blue": "0.5647" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple500.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple500.colorset/Contents.json new file mode 100644 index 00000000..c42ff664 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple500.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8314", + "green": "0.8039", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2392", + "green": "0.0000", + "blue": "0.6196" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7725", + "green": "0.7333", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2863", + "green": "0.0431", + "blue": "0.6941" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple600.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple600.colorset/Contents.json new file mode 100644 index 00000000..9ad578fd --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple600.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7725", + "green": "0.7333", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2863", + "green": "0.0431", + "blue": "0.6941" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6941", + "green": "0.6275", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3529", + "green": "0.1529", + "blue": "0.7765" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple700.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple700.colorset/Contents.json new file mode 100644 index 00000000..59e02179 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple700.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6941", + "green": "0.6275", + "blue": "1.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3529", + "green": "0.1529", + "blue": "0.7765" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5922", + "green": "0.4706", + "blue": "0.9961" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4510", + "green": "0.2627", + "blue": "0.8980" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple800.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple800.colorset/Contents.json new file mode 100644 index 00000000..01db9f04 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple800.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5725", + "green": "0.4431", + "blue": "0.9922" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4706", + "green": "0.2824", + "blue": "0.9255" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5098", + "green": "0.3059", + "blue": "0.9765" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5451", + "green": "0.4000", + "blue": "0.9725" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorPurple900.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorPurple900.colorset/Contents.json new file mode 100644 index 00000000..d9112837 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorPurple900.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4784", + "green": "0.2784", + "blue": "0.9451" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5686", + "green": "0.4392", + "blue": "0.9765" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3412", + "green": "0.1098", + "blue": "0.7686" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7137", + "green": "0.6549", + "blue": "1.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed100.colorset/Contents.json new file mode 100644 index 00000000..f726df0d --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9804", + "blue": "0.9765" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2157", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9686", + "blue": "0.9647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2314", + "green": "0.0000", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed1000.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed1000.colorset/Contents.json new file mode 100644 index 00000000..693f9d69 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed1000.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7373", + "green": "0.0588", + "blue": "0.1333" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.4000", + "blue": "0.3647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5451", + "green": "0.0000", + "blue": "0.0471" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.6549", + "blue": "0.6118" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed1100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed1100.colorset/Contents.json new file mode 100644 index 00000000..50c320e8 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed1100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6431", + "green": "0.0157", + "blue": "0.1137" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.5294", + "blue": "0.4824" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4667", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.7412", + "blue": "0.7098" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed1200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed1200.colorset/Contents.json new file mode 100644 index 00000000..980f4ecf --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed1200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5216", + "green": "0.0000", + "blue": "0.0235" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.6824", + "blue": "0.6431" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4039", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8078", + "blue": "0.7804" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed1300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed1300.colorset/Contents.json new file mode 100644 index 00000000..37e13e2f --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed1300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3843", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8275", + "blue": "0.8039" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2980", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9098", + "blue": "0.8980" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed1400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed1400.colorset/Contents.json new file mode 100644 index 00000000..2a0d6a03 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed1400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2706", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9098", + "blue": "0.8980" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2588", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9490", + "blue": "0.9373" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed200.colorset/Contents.json new file mode 100644 index 00000000..61d1926e --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9686", + "blue": "0.9647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2314", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9373", + "blue": "0.9255" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2784", + "green": "0.0000", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed300.colorset/Contents.json new file mode 100644 index 00000000..57ec9b94 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9373", + "blue": "0.9255" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2784", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8745", + "blue": "0.8549" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3412", + "green": "0.0000", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed400.colorset/Contents.json new file mode 100644 index 00000000..ff0c6be4 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8745", + "blue": "0.8549" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3412", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8196", + "blue": "0.7922" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3922", + "green": "0.0000", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed500.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed500.colorset/Contents.json new file mode 100644 index 00000000..cc65a79d --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed500.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.7725", + "blue": "0.7373" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4431", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.6863", + "blue": "0.6471" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5137", + "green": "0.0000", + "blue": "0.0353" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed600.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed600.colorset/Contents.json new file mode 100644 index 00000000..b5fe4193 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed600.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.6863", + "blue": "0.6471" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5137", + "green": "0.0000", + "blue": "0.0353" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.5490", + "blue": "0.5059" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6196", + "green": "0.0471", + "blue": "0.1176" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed700.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed700.colorset/Contents.json new file mode 100644 index 00000000..fbc3934b --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed700.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.5490", + "blue": "0.5059" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6196", + "green": "0.0471", + "blue": "0.1176" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.3059", + "blue": "0.2863" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7843", + "green": "0.1137", + "blue": "0.1569" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed800.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed800.colorset/Contents.json new file mode 100644 index 00000000..987e351c --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed800.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.2392", + "blue": "0.2392" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8157", + "green": "0.1294", + "blue": "0.1647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8824", + "green": "0.1176", + "blue": "0.1647" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9608", + "green": "0.1843", + "blue": "0.2000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorRed900.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorRed900.colorset/Contents.json new file mode 100644 index 00000000..1c8c3602 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorRed900.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8353", + "green": "0.0980", + "blue": "0.1569" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9922", + "green": "0.2392", + "blue": "0.2353" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6000", + "green": "0.0000", + "blue": "0.1020" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.5843", + "blue": "0.5412" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow100.colorset/Contents.json new file mode 100644 index 00000000..76c885ea --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9882", + "blue": "0.9412" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2118", + "green": "0.0000", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9725", + "blue": "0.8784" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2275", + "green": "0.0118", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow1000.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow1000.colorset/Contents.json new file mode 100644 index 00000000..1ade6925 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow1000.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5608", + "green": "0.3020", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8000", + "green": "0.5490", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4314", + "green": "0.1922", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9216", + "green": "0.7137", + "blue": "0.0275" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow1100.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow1100.colorset/Contents.json new file mode 100644 index 00000000..4e85b982 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow1100.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5020", + "green": "0.2471", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8588", + "green": "0.6235", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3804", + "green": "0.1490", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9647", + "green": "0.7843", + "blue": "0.0863" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow1200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow1200.colorset/Contents.json new file mode 100644 index 00000000..c6386a50 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow1200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4118", + "green": "0.1804", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9373", + "green": "0.7333", + "blue": "0.0431" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3412", + "green": "0.1137", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9961", + "green": "0.8392", + "blue": "0.1961" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow1300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow1300.colorset/Contents.json new file mode 100644 index 00000000..d0eb60a4 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow1300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3294", + "green": "0.1020", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9961", + "green": "0.8588", + "blue": "0.3216" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2706", + "green": "0.0471", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9294", + "blue": "0.6902" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow1400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow1400.colorset/Contents.json new file mode 100644 index 00000000..ace6fb22 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow1400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2549", + "green": "0.0235", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9294", + "blue": "0.6902" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2471", + "green": "0.0196", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9569", + "blue": "0.8157" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow200.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow200.colorset/Contents.json new file mode 100644 index 00000000..b443ce4d --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow200.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9725", + "blue": "0.8784" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2275", + "green": "0.0118", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9490", + "blue": "0.7569" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2549", + "green": "0.0353", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow300.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow300.colorset/Contents.json new file mode 100644 index 00000000..550d6a53 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow300.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.9490", + "blue": "0.7569" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2549", + "green": "0.0353", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8941", + "blue": "0.5176" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2980", + "green": "0.0784", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow400.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow400.colorset/Contents.json new file mode 100644 index 00000000..e04b72e8 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow400.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8941", + "blue": "0.5176" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.2980", + "green": "0.0784", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "1.0000", + "green": "0.8549", + "blue": "0.2863" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3294", + "green": "0.1137", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow500.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow500.colorset/Contents.json new file mode 100644 index 00000000..3c6e2183 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow500.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9843", + "green": "0.8078", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.3569", + "green": "0.1373", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.7412", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4078", + "green": "0.1804", + "blue": "0.0118" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow600.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow600.colorset/Contents.json new file mode 100644 index 00000000..855c8c49 --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow600.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.9451", + "green": "0.7412", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4078", + "green": "0.1804", + "blue": "0.0118" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8706", + "green": "0.6353", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4824", + "green": "0.2431", + "blue": "0.0118" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow700.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow700.colorset/Contents.json new file mode 100644 index 00000000..56c82e8b --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow700.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8706", + "green": "0.6353", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4824", + "green": "0.2431", + "blue": "0.0118" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7647", + "green": "0.5059", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.5922", + "green": "0.3373", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow800.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow800.colorset/Contents.json new file mode 100644 index 00000000..6f5c2b2a --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow800.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7451", + "green": "0.4784", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6157", + "green": "0.3569", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6549", + "green": "0.3882", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7059", + "green": "0.4471", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/Compound.xcassets/colorYellow900.colorset/Contents.json b/assets/ios/swift/Compound.xcassets/colorYellow900.colorset/Contents.json new file mode 100644 index 00000000..5e20e77c --- /dev/null +++ b/assets/ios/swift/Compound.xcassets/colorYellow900.colorset/Contents.json @@ -0,0 +1,78 @@ +{ + "colors": [ + { + "idiom": "universal", + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.6235", + "green": "0.3569", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.7333", + "green": "0.4784", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.4667", + "green": "0.2196", + "blue": "0.0000" + } + } + }, + { + "idiom": "universal", + "appearances": [ + { + "appearance": "luminosity", + "value": "dark" + }, + { + "appearance": "contrast", + "value": "high" + } + ], + "color": { + "color-space": "srgb", + "components": { + "alpha": "0.0039", + "red": "0.8863", + "green": "0.6667", + "blue": "0.0000" + } + } + } + ], + "info": { + "author": "xcode", + "version": 1 + } +} \ No newline at end of file diff --git a/assets/ios/swift/CompoundDarkDesignTokens.swift b/assets/ios/swift/CompoundDarkDesignTokens.swift new file mode 100644 index 00000000..e17c257b --- /dev/null +++ b/assets/ios/swift/CompoundDarkDesignTokens.swift @@ -0,0 +1,217 @@ + +// +// CompoundDarkDesignTokens.swift +// + +import UIKit + +public class CompoundDarkDesignTokens { + public static let colorPink1400 = Color("colorPink1400") + public static let colorPink1300 = Color("colorPink1300") + public static let colorPink1200 = Color("colorPink1200") + public static let colorPink1100 = Color("colorPink1100") + public static let colorPink1000 = Color("colorPink1000") + public static let colorPink900 = Color("colorPink900") + public static let colorPink800 = Color("colorPink800") + public static let colorPink700 = Color("colorPink700") + public static let colorPink600 = Color("colorPink600") + public static let colorPink500 = Color("colorPink500") + public static let colorPink400 = Color("colorPink400") + public static let colorPink300 = Color("colorPink300") + public static let colorPink200 = Color("colorPink200") + public static let colorPink100 = Color("colorPink100") + public static let colorFuchsia1400 = Color("colorFuchsia1400") + public static let colorFuchsia1300 = Color("colorFuchsia1300") + public static let colorFuchsia1200 = Color("colorFuchsia1200") + public static let colorFuchsia1100 = Color("colorFuchsia1100") + public static let colorFuchsia1000 = Color("colorFuchsia1000") + public static let colorFuchsia900 = Color("colorFuchsia900") + public static let colorFuchsia800 = Color("colorFuchsia800") + public static let colorFuchsia700 = Color("colorFuchsia700") + public static let colorFuchsia600 = Color("colorFuchsia600") + public static let colorFuchsia500 = Color("colorFuchsia500") + public static let colorFuchsia400 = Color("colorFuchsia400") + public static let colorFuchsia300 = Color("colorFuchsia300") + public static let colorFuchsia200 = Color("colorFuchsia200") + public static let colorFuchsia100 = Color("colorFuchsia100") + public static let colorPurple1400 = Color("colorPurple1400") + public static let colorPurple1300 = Color("colorPurple1300") + public static let colorPurple1200 = Color("colorPurple1200") + public static let colorPurple1100 = Color("colorPurple1100") + public static let colorPurple1000 = Color("colorPurple1000") + public static let colorPurple900 = Color("colorPurple900") + public static let colorPurple800 = Color("colorPurple800") + public static let colorPurple700 = Color("colorPurple700") + public static let colorPurple600 = Color("colorPurple600") + public static let colorPurple500 = Color("colorPurple500") + public static let colorPurple400 = Color("colorPurple400") + public static let colorPurple300 = Color("colorPurple300") + public static let colorPurple200 = Color("colorPurple200") + public static let colorPurple100 = Color("colorPurple100") + public static let colorBlue1400 = Color("colorBlue1400") + public static let colorBlue1300 = Color("colorBlue1300") + public static let colorBlue1200 = Color("colorBlue1200") + public static let colorBlue1100 = Color("colorBlue1100") + public static let colorBlue1000 = Color("colorBlue1000") + public static let colorBlue900 = Color("colorBlue900") + public static let colorBlue800 = Color("colorBlue800") + public static let colorBlue700 = Color("colorBlue700") + public static let colorBlue600 = Color("colorBlue600") + public static let colorBlue500 = Color("colorBlue500") + public static let colorBlue400 = Color("colorBlue400") + public static let colorBlue300 = Color("colorBlue300") + public static let colorBlue200 = Color("colorBlue200") + public static let colorBlue100 = Color("colorBlue100") + public static let colorCyan1400 = Color("colorCyan1400") + public static let colorCyan1300 = Color("colorCyan1300") + public static let colorCyan1200 = Color("colorCyan1200") + public static let colorCyan1100 = Color("colorCyan1100") + public static let colorCyan1000 = Color("colorCyan1000") + public static let colorCyan900 = Color("colorCyan900") + public static let colorCyan800 = Color("colorCyan800") + public static let colorCyan700 = Color("colorCyan700") + public static let colorCyan600 = Color("colorCyan600") + public static let colorCyan500 = Color("colorCyan500") + public static let colorCyan400 = Color("colorCyan400") + public static let colorCyan300 = Color("colorCyan300") + public static let colorCyan200 = Color("colorCyan200") + public static let colorCyan100 = Color("colorCyan100") + public static let colorGreen1400 = Color("colorGreen1400") + public static let colorGreen1300 = Color("colorGreen1300") + public static let colorGreen1200 = Color("colorGreen1200") + public static let colorGreen1100 = Color("colorGreen1100") + public static let colorGreen1000 = Color("colorGreen1000") + public static let colorGreen900 = Color("colorGreen900") + public static let colorGreen800 = Color("colorGreen800") + public static let colorGreen700 = Color("colorGreen700") + public static let colorGreen600 = Color("colorGreen600") + public static let colorGreen500 = Color("colorGreen500") + public static let colorGreen400 = Color("colorGreen400") + public static let colorGreen300 = Color("colorGreen300") + public static let colorGreen200 = Color("colorGreen200") + public static let colorGreen100 = Color("colorGreen100") + public static let colorLime1400 = Color("colorLime1400") + public static let colorLime1300 = Color("colorLime1300") + public static let colorLime1200 = Color("colorLime1200") + public static let colorLime1100 = Color("colorLime1100") + public static let colorLime1000 = Color("colorLime1000") + public static let colorLime900 = Color("colorLime900") + public static let colorLime800 = Color("colorLime800") + public static let colorLime700 = Color("colorLime700") + public static let colorLime600 = Color("colorLime600") + public static let colorLime500 = Color("colorLime500") + public static let colorLime400 = Color("colorLime400") + public static let colorLime300 = Color("colorLime300") + public static let colorLime200 = Color("colorLime200") + public static let colorLime100 = Color("colorLime100") + public static let colorYellow1400 = Color("colorYellow1400") + public static let colorYellow1300 = Color("colorYellow1300") + public static let colorYellow1200 = Color("colorYellow1200") + public static let colorYellow1100 = Color("colorYellow1100") + public static let colorYellow1000 = Color("colorYellow1000") + public static let colorYellow900 = Color("colorYellow900") + public static let colorYellow800 = Color("colorYellow800") + public static let colorYellow700 = Color("colorYellow700") + public static let colorYellow600 = Color("colorYellow600") + public static let colorYellow500 = Color("colorYellow500") + public static let colorYellow400 = Color("colorYellow400") + public static let colorYellow300 = Color("colorYellow300") + public static let colorYellow200 = Color("colorYellow200") + public static let colorYellow100 = Color("colorYellow100") + public static let colorOrange1400 = Color("colorOrange1400") + public static let colorOrange1300 = Color("colorOrange1300") + public static let colorOrange1200 = Color("colorOrange1200") + public static let colorOrange1100 = Color("colorOrange1100") + public static let colorOrange1000 = Color("colorOrange1000") + public static let colorOrange900 = Color("colorOrange900") + public static let colorOrange800 = Color("colorOrange800") + public static let colorOrange700 = Color("colorOrange700") + public static let colorOrange600 = Color("colorOrange600") + public static let colorOrange500 = Color("colorOrange500") + public static let colorOrange400 = Color("colorOrange400") + public static let colorOrange300 = Color("colorOrange300") + public static let colorOrange200 = Color("colorOrange200") + public static let colorOrange100 = Color("colorOrange100") + public static let colorRed1400 = Color("colorRed1400") + public static let colorRed1300 = Color("colorRed1300") + public static let colorRed1200 = Color("colorRed1200") + public static let colorRed1100 = Color("colorRed1100") + public static let colorRed1000 = Color("colorRed1000") + public static let colorRed900 = Color("colorRed900") + public static let colorRed800 = Color("colorRed800") + public static let colorRed700 = Color("colorRed700") + public static let colorRed600 = Color("colorRed600") + public static let colorRed500 = Color("colorRed500") + public static let colorRed400 = Color("colorRed400") + public static let colorRed300 = Color("colorRed300") + public static let colorRed200 = Color("colorRed200") + public static let colorRed100 = Color("colorRed100") + public static let colorGray1400 = Color("colorGray1400") + public static let colorGray1300 = Color("colorGray1300") + public static let colorGray1200 = Color("colorGray1200") + public static let colorGray1100 = Color("colorGray1100") + public static let colorGray1000 = Color("colorGray1000") + public static let colorGray900 = Color("colorGray900") + public static let colorGray800 = Color("colorGray800") + public static let colorGray700 = Color("colorGray700") + public static let colorGray600 = Color("colorGray600") + public static let colorGray500 = Color("colorGray500") + public static let colorGray400 = Color("colorGray400") + public static let colorGray300 = Color("colorGray300") + public static let colorGray200 = Color("colorGray200") + public static let colorGray100 = Color("colorGray100") + public static let fontSizeHeadingXl = CGFloat(34) + public static let fontSizeHeadingLg = CGFloat(28) + public static let fontSizeHeadingMd = CGFloat(22) + public static let fontSizeHeadingSm = CGFloat(20) + public static let fontSizeBodyLg = CGFloat(17) + public static let fontSizeBodyMd = CGFloat(15) + public static let fontSizeBodySm = CGFloat(13) + public static let fontSizeBodyXs = CGFloat(12) + public static let fontLineHeightHeadingXlRegular = CGFloat(41) + public static let fontLineHeightHeadingLgRegular = CGFloat(34) + public static let fontLineHeightHeadingMdRegular = CGFloat(28) + public static let fontLineHeightHeadingSmRegular = CGFloat(25) + public static let fontLineHeightBodyLgRegular = CGFloat(22) + public static let fontLineHeightBodyMdRegular = CGFloat(20) + public static let fontLineHeightBodySmRegular = CGFloat(18) + public static let fontLineHeightBodyXsRegular = CGFloat(16) + public static let fontWeightBold = Font.Weight.regular + public static let fontWeightSemibold = Font.Weight.regular + public static let fontWeightRegular = Font.Weight.regular + public static let fontFamilyMono = "SF Mono" + public static let fontFamilySans = "SF Pro" + public static let borderWidth0_5 = CGFloat(0.5) + public static let borderWidth4 = CGFloat(4) + public static let borderWidth2 = CGFloat(2) + public static let borderWidth1 = CGFloat(1) + public static let space56X = CGFloat(224) + public static let space36X = CGFloat(144) + public static let space16X = CGFloat(64) + public static let space12X = CGFloat(48) + public static let space11X = CGFloat(44) + public static let space10X = CGFloat(40) + public static let space6X = CGFloat(24) + public static let space0X = CGFloat(0) + public static let spaceScale = CGFloat(4) + public static let space64X = spaceScale * 64 + public static let space48X = spaceScale * 48 + public static let space40X = spaceScale * 40 + public static let space32X = spaceScale * 32 + public static let space28X = spaceScale * 28 + public static let space24X = spaceScale * 24 + public static let space20X = spaceScale * 20 + public static let space15X = spaceScale * 15 + public static let space14X = spaceScale * 14 + public static let space13X = spaceScale * 13 + public static let space9X = spaceScale * 9 + public static let space8X = spaceScale * 8 + public static let space7X = spaceScale * 7 + public static let space5X = spaceScale * 5 + public static let space4X = spaceScale * 4 + public static let space3X = spaceScale * 3 + public static let space2X = spaceScale * 2 + public static let space1_5X = spaceScale * 1.5 + public static let space1X = spaceScale + public static let space0_5X = spaceScale * 0.5 +} diff --git a/assets/ios/swift/CompoundDarkHcDesignTokens.swift b/assets/ios/swift/CompoundDarkHcDesignTokens.swift new file mode 100644 index 00000000..f00cd0d2 --- /dev/null +++ b/assets/ios/swift/CompoundDarkHcDesignTokens.swift @@ -0,0 +1,217 @@ + +// +// CompoundDarkHcDesignTokens.swift +// + +import UIKit + +public class CompoundDarkHcDesignTokens { + public static let colorPink1400 = Color("colorPink1400") + public static let colorPink1300 = Color("colorPink1300") + public static let colorPink1200 = Color("colorPink1200") + public static let colorPink1100 = Color("colorPink1100") + public static let colorPink1000 = Color("colorPink1000") + public static let colorPink900 = Color("colorPink900") + public static let colorPink800 = Color("colorPink800") + public static let colorPink700 = Color("colorPink700") + public static let colorPink600 = Color("colorPink600") + public static let colorPink500 = Color("colorPink500") + public static let colorPink400 = Color("colorPink400") + public static let colorPink300 = Color("colorPink300") + public static let colorPink200 = Color("colorPink200") + public static let colorPink100 = Color("colorPink100") + public static let colorFuchsia1400 = Color("colorFuchsia1400") + public static let colorFuchsia1300 = Color("colorFuchsia1300") + public static let colorFuchsia1200 = Color("colorFuchsia1200") + public static let colorFuchsia1100 = Color("colorFuchsia1100") + public static let colorFuchsia1000 = Color("colorFuchsia1000") + public static let colorFuchsia900 = Color("colorFuchsia900") + public static let colorFuchsia800 = Color("colorFuchsia800") + public static let colorFuchsia700 = Color("colorFuchsia700") + public static let colorFuchsia600 = Color("colorFuchsia600") + public static let colorFuchsia500 = Color("colorFuchsia500") + public static let colorFuchsia400 = Color("colorFuchsia400") + public static let colorFuchsia300 = Color("colorFuchsia300") + public static let colorFuchsia200 = Color("colorFuchsia200") + public static let colorFuchsia100 = Color("colorFuchsia100") + public static let colorPurple1400 = Color("colorPurple1400") + public static let colorPurple1300 = Color("colorPurple1300") + public static let colorPurple1200 = Color("colorPurple1200") + public static let colorPurple1100 = Color("colorPurple1100") + public static let colorPurple1000 = Color("colorPurple1000") + public static let colorPurple900 = Color("colorPurple900") + public static let colorPurple800 = Color("colorPurple800") + public static let colorPurple700 = Color("colorPurple700") + public static let colorPurple600 = Color("colorPurple600") + public static let colorPurple500 = Color("colorPurple500") + public static let colorPurple400 = Color("colorPurple400") + public static let colorPurple300 = Color("colorPurple300") + public static let colorPurple200 = Color("colorPurple200") + public static let colorPurple100 = Color("colorPurple100") + public static let colorBlue1400 = Color("colorBlue1400") + public static let colorBlue1300 = Color("colorBlue1300") + public static let colorBlue1200 = Color("colorBlue1200") + public static let colorBlue1100 = Color("colorBlue1100") + public static let colorBlue1000 = Color("colorBlue1000") + public static let colorBlue900 = Color("colorBlue900") + public static let colorBlue800 = Color("colorBlue800") + public static let colorBlue700 = Color("colorBlue700") + public static let colorBlue600 = Color("colorBlue600") + public static let colorBlue500 = Color("colorBlue500") + public static let colorBlue400 = Color("colorBlue400") + public static let colorBlue300 = Color("colorBlue300") + public static let colorBlue200 = Color("colorBlue200") + public static let colorBlue100 = Color("colorBlue100") + public static let colorCyan1400 = Color("colorCyan1400") + public static let colorCyan1300 = Color("colorCyan1300") + public static let colorCyan1200 = Color("colorCyan1200") + public static let colorCyan1100 = Color("colorCyan1100") + public static let colorCyan1000 = Color("colorCyan1000") + public static let colorCyan900 = Color("colorCyan900") + public static let colorCyan800 = Color("colorCyan800") + public static let colorCyan700 = Color("colorCyan700") + public static let colorCyan600 = Color("colorCyan600") + public static let colorCyan500 = Color("colorCyan500") + public static let colorCyan400 = Color("colorCyan400") + public static let colorCyan300 = Color("colorCyan300") + public static let colorCyan200 = Color("colorCyan200") + public static let colorCyan100 = Color("colorCyan100") + public static let colorGreen1400 = Color("colorGreen1400") + public static let colorGreen1300 = Color("colorGreen1300") + public static let colorGreen1200 = Color("colorGreen1200") + public static let colorGreen1100 = Color("colorGreen1100") + public static let colorGreen1000 = Color("colorGreen1000") + public static let colorGreen900 = Color("colorGreen900") + public static let colorGreen800 = Color("colorGreen800") + public static let colorGreen700 = Color("colorGreen700") + public static let colorGreen600 = Color("colorGreen600") + public static let colorGreen500 = Color("colorGreen500") + public static let colorGreen400 = Color("colorGreen400") + public static let colorGreen300 = Color("colorGreen300") + public static let colorGreen200 = Color("colorGreen200") + public static let colorGreen100 = Color("colorGreen100") + public static let colorLime1400 = Color("colorLime1400") + public static let colorLime1300 = Color("colorLime1300") + public static let colorLime1200 = Color("colorLime1200") + public static let colorLime1100 = Color("colorLime1100") + public static let colorLime1000 = Color("colorLime1000") + public static let colorLime900 = Color("colorLime900") + public static let colorLime800 = Color("colorLime800") + public static let colorLime700 = Color("colorLime700") + public static let colorLime600 = Color("colorLime600") + public static let colorLime500 = Color("colorLime500") + public static let colorLime400 = Color("colorLime400") + public static let colorLime300 = Color("colorLime300") + public static let colorLime200 = Color("colorLime200") + public static let colorLime100 = Color("colorLime100") + public static let colorYellow1400 = Color("colorYellow1400") + public static let colorYellow1300 = Color("colorYellow1300") + public static let colorYellow1200 = Color("colorYellow1200") + public static let colorYellow1100 = Color("colorYellow1100") + public static let colorYellow1000 = Color("colorYellow1000") + public static let colorYellow900 = Color("colorYellow900") + public static let colorYellow800 = Color("colorYellow800") + public static let colorYellow700 = Color("colorYellow700") + public static let colorYellow600 = Color("colorYellow600") + public static let colorYellow500 = Color("colorYellow500") + public static let colorYellow400 = Color("colorYellow400") + public static let colorYellow300 = Color("colorYellow300") + public static let colorYellow200 = Color("colorYellow200") + public static let colorYellow100 = Color("colorYellow100") + public static let colorOrange1400 = Color("colorOrange1400") + public static let colorOrange1300 = Color("colorOrange1300") + public static let colorOrange1200 = Color("colorOrange1200") + public static let colorOrange1100 = Color("colorOrange1100") + public static let colorOrange1000 = Color("colorOrange1000") + public static let colorOrange900 = Color("colorOrange900") + public static let colorOrange800 = Color("colorOrange800") + public static let colorOrange700 = Color("colorOrange700") + public static let colorOrange600 = Color("colorOrange600") + public static let colorOrange500 = Color("colorOrange500") + public static let colorOrange400 = Color("colorOrange400") + public static let colorOrange300 = Color("colorOrange300") + public static let colorOrange200 = Color("colorOrange200") + public static let colorOrange100 = Color("colorOrange100") + public static let colorRed1400 = Color("colorRed1400") + public static let colorRed1300 = Color("colorRed1300") + public static let colorRed1200 = Color("colorRed1200") + public static let colorRed1100 = Color("colorRed1100") + public static let colorRed1000 = Color("colorRed1000") + public static let colorRed900 = Color("colorRed900") + public static let colorRed800 = Color("colorRed800") + public static let colorRed700 = Color("colorRed700") + public static let colorRed600 = Color("colorRed600") + public static let colorRed500 = Color("colorRed500") + public static let colorRed400 = Color("colorRed400") + public static let colorRed300 = Color("colorRed300") + public static let colorRed200 = Color("colorRed200") + public static let colorRed100 = Color("colorRed100") + public static let colorGray1400 = Color("colorGray1400") + public static let colorGray1300 = Color("colorGray1300") + public static let colorGray1200 = Color("colorGray1200") + public static let colorGray1100 = Color("colorGray1100") + public static let colorGray1000 = Color("colorGray1000") + public static let colorGray900 = Color("colorGray900") + public static let colorGray800 = Color("colorGray800") + public static let colorGray700 = Color("colorGray700") + public static let colorGray600 = Color("colorGray600") + public static let colorGray500 = Color("colorGray500") + public static let colorGray400 = Color("colorGray400") + public static let colorGray300 = Color("colorGray300") + public static let colorGray200 = Color("colorGray200") + public static let colorGray100 = Color("colorGray100") + public static let fontSizeHeadingXl = CGFloat(34) + public static let fontSizeHeadingLg = CGFloat(28) + public static let fontSizeHeadingMd = CGFloat(22) + public static let fontSizeHeadingSm = CGFloat(20) + public static let fontSizeBodyLg = CGFloat(17) + public static let fontSizeBodyMd = CGFloat(15) + public static let fontSizeBodySm = CGFloat(13) + public static let fontSizeBodyXs = CGFloat(12) + public static let fontLineHeightHeadingXlRegular = CGFloat(41) + public static let fontLineHeightHeadingLgRegular = CGFloat(34) + public static let fontLineHeightHeadingMdRegular = CGFloat(28) + public static let fontLineHeightHeadingSmRegular = CGFloat(25) + public static let fontLineHeightBodyLgRegular = CGFloat(22) + public static let fontLineHeightBodyMdRegular = CGFloat(20) + public static let fontLineHeightBodySmRegular = CGFloat(18) + public static let fontLineHeightBodyXsRegular = CGFloat(16) + public static let fontWeightBold = Font.Weight.regular + public static let fontWeightSemibold = Font.Weight.regular + public static let fontWeightRegular = Font.Weight.regular + public static let fontFamilyMono = "SF Mono" + public static let fontFamilySans = "SF Pro" + public static let borderWidth0_5 = CGFloat(0.5) + public static let borderWidth4 = CGFloat(4) + public static let borderWidth2 = CGFloat(2) + public static let borderWidth1 = CGFloat(1) + public static let space56X = CGFloat(224) + public static let space36X = CGFloat(144) + public static let space16X = CGFloat(64) + public static let space12X = CGFloat(48) + public static let space11X = CGFloat(44) + public static let space10X = CGFloat(40) + public static let space6X = CGFloat(24) + public static let space0X = CGFloat(0) + public static let spaceScale = CGFloat(4) + public static let space64X = spaceScale * 64 + public static let space48X = spaceScale * 48 + public static let space40X = spaceScale * 40 + public static let space32X = spaceScale * 32 + public static let space28X = spaceScale * 28 + public static let space24X = spaceScale * 24 + public static let space20X = spaceScale * 20 + public static let space15X = spaceScale * 15 + public static let space14X = spaceScale * 14 + public static let space13X = spaceScale * 13 + public static let space9X = spaceScale * 9 + public static let space8X = spaceScale * 8 + public static let space7X = spaceScale * 7 + public static let space5X = spaceScale * 5 + public static let space4X = spaceScale * 4 + public static let space3X = spaceScale * 3 + public static let space2X = spaceScale * 2 + public static let space1_5X = spaceScale * 1.5 + public static let space1X = spaceScale + public static let space0_5X = spaceScale * 0.5 +} diff --git a/assets/ios/swift/CompoundLightDesignTokens.swift b/assets/ios/swift/CompoundLightDesignTokens.swift new file mode 100644 index 00000000..400e47d2 --- /dev/null +++ b/assets/ios/swift/CompoundLightDesignTokens.swift @@ -0,0 +1,217 @@ + +// +// CompoundLightDesignTokens.swift +// + +import UIKit + +public class CompoundLightDesignTokens { + public static let colorPink1400 = Color("colorPink1400") + public static let colorPink1300 = Color("colorPink1300") + public static let colorPink1200 = Color("colorPink1200") + public static let colorPink1100 = Color("colorPink1100") + public static let colorPink1000 = Color("colorPink1000") + public static let colorPink900 = Color("colorPink900") + public static let colorPink800 = Color("colorPink800") + public static let colorPink700 = Color("colorPink700") + public static let colorPink600 = Color("colorPink600") + public static let colorPink500 = Color("colorPink500") + public static let colorPink400 = Color("colorPink400") + public static let colorPink300 = Color("colorPink300") + public static let colorPink200 = Color("colorPink200") + public static let colorPink100 = Color("colorPink100") + public static let colorFuchsia1400 = Color("colorFuchsia1400") + public static let colorFuchsia1300 = Color("colorFuchsia1300") + public static let colorFuchsia1200 = Color("colorFuchsia1200") + public static let colorFuchsia1100 = Color("colorFuchsia1100") + public static let colorFuchsia1000 = Color("colorFuchsia1000") + public static let colorFuchsia900 = Color("colorFuchsia900") + public static let colorFuchsia800 = Color("colorFuchsia800") + public static let colorFuchsia700 = Color("colorFuchsia700") + public static let colorFuchsia600 = Color("colorFuchsia600") + public static let colorFuchsia500 = Color("colorFuchsia500") + public static let colorFuchsia400 = Color("colorFuchsia400") + public static let colorFuchsia300 = Color("colorFuchsia300") + public static let colorFuchsia200 = Color("colorFuchsia200") + public static let colorFuchsia100 = Color("colorFuchsia100") + public static let colorPurple1400 = Color("colorPurple1400") + public static let colorPurple1300 = Color("colorPurple1300") + public static let colorPurple1200 = Color("colorPurple1200") + public static let colorPurple1100 = Color("colorPurple1100") + public static let colorPurple1000 = Color("colorPurple1000") + public static let colorPurple900 = Color("colorPurple900") + public static let colorPurple800 = Color("colorPurple800") + public static let colorPurple700 = Color("colorPurple700") + public static let colorPurple600 = Color("colorPurple600") + public static let colorPurple500 = Color("colorPurple500") + public static let colorPurple400 = Color("colorPurple400") + public static let colorPurple300 = Color("colorPurple300") + public static let colorPurple200 = Color("colorPurple200") + public static let colorPurple100 = Color("colorPurple100") + public static let colorBlue1400 = Color("colorBlue1400") + public static let colorBlue1300 = Color("colorBlue1300") + public static let colorBlue1200 = Color("colorBlue1200") + public static let colorBlue1100 = Color("colorBlue1100") + public static let colorBlue1000 = Color("colorBlue1000") + public static let colorBlue900 = Color("colorBlue900") + public static let colorBlue800 = Color("colorBlue800") + public static let colorBlue700 = Color("colorBlue700") + public static let colorBlue600 = Color("colorBlue600") + public static let colorBlue500 = Color("colorBlue500") + public static let colorBlue400 = Color("colorBlue400") + public static let colorBlue300 = Color("colorBlue300") + public static let colorBlue200 = Color("colorBlue200") + public static let colorBlue100 = Color("colorBlue100") + public static let colorCyan1400 = Color("colorCyan1400") + public static let colorCyan1300 = Color("colorCyan1300") + public static let colorCyan1200 = Color("colorCyan1200") + public static let colorCyan1100 = Color("colorCyan1100") + public static let colorCyan1000 = Color("colorCyan1000") + public static let colorCyan900 = Color("colorCyan900") + public static let colorCyan800 = Color("colorCyan800") + public static let colorCyan700 = Color("colorCyan700") + public static let colorCyan600 = Color("colorCyan600") + public static let colorCyan500 = Color("colorCyan500") + public static let colorCyan400 = Color("colorCyan400") + public static let colorCyan300 = Color("colorCyan300") + public static let colorCyan200 = Color("colorCyan200") + public static let colorCyan100 = Color("colorCyan100") + public static let colorGreen1400 = Color("colorGreen1400") + public static let colorGreen1300 = Color("colorGreen1300") + public static let colorGreen1200 = Color("colorGreen1200") + public static let colorGreen1100 = Color("colorGreen1100") + public static let colorGreen1000 = Color("colorGreen1000") + public static let colorGreen900 = Color("colorGreen900") + public static let colorGreen800 = Color("colorGreen800") + public static let colorGreen700 = Color("colorGreen700") + public static let colorGreen600 = Color("colorGreen600") + public static let colorGreen500 = Color("colorGreen500") + public static let colorGreen400 = Color("colorGreen400") + public static let colorGreen300 = Color("colorGreen300") + public static let colorGreen200 = Color("colorGreen200") + public static let colorGreen100 = Color("colorGreen100") + public static let colorLime1400 = Color("colorLime1400") + public static let colorLime1300 = Color("colorLime1300") + public static let colorLime1200 = Color("colorLime1200") + public static let colorLime1100 = Color("colorLime1100") + public static let colorLime1000 = Color("colorLime1000") + public static let colorLime900 = Color("colorLime900") + public static let colorLime800 = Color("colorLime800") + public static let colorLime700 = Color("colorLime700") + public static let colorLime600 = Color("colorLime600") + public static let colorLime500 = Color("colorLime500") + public static let colorLime400 = Color("colorLime400") + public static let colorLime300 = Color("colorLime300") + public static let colorLime200 = Color("colorLime200") + public static let colorLime100 = Color("colorLime100") + public static let colorYellow1400 = Color("colorYellow1400") + public static let colorYellow1300 = Color("colorYellow1300") + public static let colorYellow1200 = Color("colorYellow1200") + public static let colorYellow1100 = Color("colorYellow1100") + public static let colorYellow1000 = Color("colorYellow1000") + public static let colorYellow900 = Color("colorYellow900") + public static let colorYellow800 = Color("colorYellow800") + public static let colorYellow700 = Color("colorYellow700") + public static let colorYellow600 = Color("colorYellow600") + public static let colorYellow500 = Color("colorYellow500") + public static let colorYellow400 = Color("colorYellow400") + public static let colorYellow300 = Color("colorYellow300") + public static let colorYellow200 = Color("colorYellow200") + public static let colorYellow100 = Color("colorYellow100") + public static let colorOrange1400 = Color("colorOrange1400") + public static let colorOrange1300 = Color("colorOrange1300") + public static let colorOrange1200 = Color("colorOrange1200") + public static let colorOrange1100 = Color("colorOrange1100") + public static let colorOrange1000 = Color("colorOrange1000") + public static let colorOrange900 = Color("colorOrange900") + public static let colorOrange800 = Color("colorOrange800") + public static let colorOrange700 = Color("colorOrange700") + public static let colorOrange600 = Color("colorOrange600") + public static let colorOrange500 = Color("colorOrange500") + public static let colorOrange400 = Color("colorOrange400") + public static let colorOrange300 = Color("colorOrange300") + public static let colorOrange200 = Color("colorOrange200") + public static let colorOrange100 = Color("colorOrange100") + public static let colorRed1400 = Color("colorRed1400") + public static let colorRed1300 = Color("colorRed1300") + public static let colorRed1200 = Color("colorRed1200") + public static let colorRed1100 = Color("colorRed1100") + public static let colorRed1000 = Color("colorRed1000") + public static let colorRed900 = Color("colorRed900") + public static let colorRed800 = Color("colorRed800") + public static let colorRed700 = Color("colorRed700") + public static let colorRed600 = Color("colorRed600") + public static let colorRed500 = Color("colorRed500") + public static let colorRed400 = Color("colorRed400") + public static let colorRed300 = Color("colorRed300") + public static let colorRed200 = Color("colorRed200") + public static let colorRed100 = Color("colorRed100") + public static let colorGray1400 = Color("colorGray1400") + public static let colorGray1300 = Color("colorGray1300") + public static let colorGray1200 = Color("colorGray1200") + public static let colorGray1100 = Color("colorGray1100") + public static let colorGray1000 = Color("colorGray1000") + public static let colorGray900 = Color("colorGray900") + public static let colorGray800 = Color("colorGray800") + public static let colorGray700 = Color("colorGray700") + public static let colorGray600 = Color("colorGray600") + public static let colorGray500 = Color("colorGray500") + public static let colorGray400 = Color("colorGray400") + public static let colorGray300 = Color("colorGray300") + public static let colorGray200 = Color("colorGray200") + public static let colorGray100 = Color("colorGray100") + public static let fontSizeHeadingXl = CGFloat(34) + public static let fontSizeHeadingLg = CGFloat(28) + public static let fontSizeHeadingMd = CGFloat(22) + public static let fontSizeHeadingSm = CGFloat(20) + public static let fontSizeBodyLg = CGFloat(17) + public static let fontSizeBodyMd = CGFloat(15) + public static let fontSizeBodySm = CGFloat(13) + public static let fontSizeBodyXs = CGFloat(12) + public static let fontLineHeightHeadingXlRegular = CGFloat(41) + public static let fontLineHeightHeadingLgRegular = CGFloat(34) + public static let fontLineHeightHeadingMdRegular = CGFloat(28) + public static let fontLineHeightHeadingSmRegular = CGFloat(25) + public static let fontLineHeightBodyLgRegular = CGFloat(22) + public static let fontLineHeightBodyMdRegular = CGFloat(20) + public static let fontLineHeightBodySmRegular = CGFloat(18) + public static let fontLineHeightBodyXsRegular = CGFloat(16) + public static let fontWeightBold = Font.Weight.regular + public static let fontWeightSemibold = Font.Weight.regular + public static let fontWeightRegular = Font.Weight.regular + public static let fontFamilyMono = "SF Mono" + public static let fontFamilySans = "SF Pro" + public static let borderWidth0_5 = CGFloat(0.5) + public static let borderWidth4 = CGFloat(4) + public static let borderWidth2 = CGFloat(2) + public static let borderWidth1 = CGFloat(1) + public static let space56X = CGFloat(224) + public static let space36X = CGFloat(144) + public static let space16X = CGFloat(64) + public static let space12X = CGFloat(48) + public static let space11X = CGFloat(44) + public static let space10X = CGFloat(40) + public static let space6X = CGFloat(24) + public static let space0X = CGFloat(0) + public static let spaceScale = CGFloat(4) + public static let space64X = spaceScale * 64 + public static let space48X = spaceScale * 48 + public static let space40X = spaceScale * 40 + public static let space32X = spaceScale * 32 + public static let space28X = spaceScale * 28 + public static let space24X = spaceScale * 24 + public static let space20X = spaceScale * 20 + public static let space15X = spaceScale * 15 + public static let space14X = spaceScale * 14 + public static let space13X = spaceScale * 13 + public static let space9X = spaceScale * 9 + public static let space8X = spaceScale * 8 + public static let space7X = spaceScale * 7 + public static let space5X = spaceScale * 5 + public static let space4X = spaceScale * 4 + public static let space3X = spaceScale * 3 + public static let space2X = spaceScale * 2 + public static let space1_5X = spaceScale * 1.5 + public static let space1X = spaceScale + public static let space0_5X = spaceScale * 0.5 +} diff --git a/assets/ios/swift/CompoundLightHcDesignTokens.swift b/assets/ios/swift/CompoundLightHcDesignTokens.swift new file mode 100644 index 00000000..d574d8f3 --- /dev/null +++ b/assets/ios/swift/CompoundLightHcDesignTokens.swift @@ -0,0 +1,217 @@ + +// +// CompoundLightHcDesignTokens.swift +// + +import UIKit + +public class CompoundLightHcDesignTokens { + public static let colorPink1400 = Color("colorPink1400") + public static let colorPink1300 = Color("colorPink1300") + public static let colorPink1200 = Color("colorPink1200") + public static let colorPink1100 = Color("colorPink1100") + public static let colorPink1000 = Color("colorPink1000") + public static let colorPink900 = Color("colorPink900") + public static let colorPink800 = Color("colorPink800") + public static let colorPink700 = Color("colorPink700") + public static let colorPink600 = Color("colorPink600") + public static let colorPink500 = Color("colorPink500") + public static let colorPink400 = Color("colorPink400") + public static let colorPink300 = Color("colorPink300") + public static let colorPink200 = Color("colorPink200") + public static let colorPink100 = Color("colorPink100") + public static let colorFuchsia1400 = Color("colorFuchsia1400") + public static let colorFuchsia1300 = Color("colorFuchsia1300") + public static let colorFuchsia1200 = Color("colorFuchsia1200") + public static let colorFuchsia1100 = Color("colorFuchsia1100") + public static let colorFuchsia1000 = Color("colorFuchsia1000") + public static let colorFuchsia900 = Color("colorFuchsia900") + public static let colorFuchsia800 = Color("colorFuchsia800") + public static let colorFuchsia700 = Color("colorFuchsia700") + public static let colorFuchsia600 = Color("colorFuchsia600") + public static let colorFuchsia500 = Color("colorFuchsia500") + public static let colorFuchsia400 = Color("colorFuchsia400") + public static let colorFuchsia300 = Color("colorFuchsia300") + public static let colorFuchsia200 = Color("colorFuchsia200") + public static let colorFuchsia100 = Color("colorFuchsia100") + public static let colorPurple1400 = Color("colorPurple1400") + public static let colorPurple1300 = Color("colorPurple1300") + public static let colorPurple1200 = Color("colorPurple1200") + public static let colorPurple1100 = Color("colorPurple1100") + public static let colorPurple1000 = Color("colorPurple1000") + public static let colorPurple900 = Color("colorPurple900") + public static let colorPurple800 = Color("colorPurple800") + public static let colorPurple700 = Color("colorPurple700") + public static let colorPurple600 = Color("colorPurple600") + public static let colorPurple500 = Color("colorPurple500") + public static let colorPurple400 = Color("colorPurple400") + public static let colorPurple300 = Color("colorPurple300") + public static let colorPurple200 = Color("colorPurple200") + public static let colorPurple100 = Color("colorPurple100") + public static let colorBlue1400 = Color("colorBlue1400") + public static let colorBlue1300 = Color("colorBlue1300") + public static let colorBlue1200 = Color("colorBlue1200") + public static let colorBlue1100 = Color("colorBlue1100") + public static let colorBlue1000 = Color("colorBlue1000") + public static let colorBlue900 = Color("colorBlue900") + public static let colorBlue800 = Color("colorBlue800") + public static let colorBlue700 = Color("colorBlue700") + public static let colorBlue600 = Color("colorBlue600") + public static let colorBlue500 = Color("colorBlue500") + public static let colorBlue400 = Color("colorBlue400") + public static let colorBlue300 = Color("colorBlue300") + public static let colorBlue200 = Color("colorBlue200") + public static let colorBlue100 = Color("colorBlue100") + public static let colorCyan1400 = Color("colorCyan1400") + public static let colorCyan1300 = Color("colorCyan1300") + public static let colorCyan1200 = Color("colorCyan1200") + public static let colorCyan1100 = Color("colorCyan1100") + public static let colorCyan1000 = Color("colorCyan1000") + public static let colorCyan900 = Color("colorCyan900") + public static let colorCyan800 = Color("colorCyan800") + public static let colorCyan700 = Color("colorCyan700") + public static let colorCyan600 = Color("colorCyan600") + public static let colorCyan500 = Color("colorCyan500") + public static let colorCyan400 = Color("colorCyan400") + public static let colorCyan300 = Color("colorCyan300") + public static let colorCyan200 = Color("colorCyan200") + public static let colorCyan100 = Color("colorCyan100") + public static let colorGreen1400 = Color("colorGreen1400") + public static let colorGreen1300 = Color("colorGreen1300") + public static let colorGreen1200 = Color("colorGreen1200") + public static let colorGreen1100 = Color("colorGreen1100") + public static let colorGreen1000 = Color("colorGreen1000") + public static let colorGreen900 = Color("colorGreen900") + public static let colorGreen800 = Color("colorGreen800") + public static let colorGreen700 = Color("colorGreen700") + public static let colorGreen600 = Color("colorGreen600") + public static let colorGreen500 = Color("colorGreen500") + public static let colorGreen400 = Color("colorGreen400") + public static let colorGreen300 = Color("colorGreen300") + public static let colorGreen200 = Color("colorGreen200") + public static let colorGreen100 = Color("colorGreen100") + public static let colorLime1400 = Color("colorLime1400") + public static let colorLime1300 = Color("colorLime1300") + public static let colorLime1200 = Color("colorLime1200") + public static let colorLime1100 = Color("colorLime1100") + public static let colorLime1000 = Color("colorLime1000") + public static let colorLime900 = Color("colorLime900") + public static let colorLime800 = Color("colorLime800") + public static let colorLime700 = Color("colorLime700") + public static let colorLime600 = Color("colorLime600") + public static let colorLime500 = Color("colorLime500") + public static let colorLime400 = Color("colorLime400") + public static let colorLime300 = Color("colorLime300") + public static let colorLime200 = Color("colorLime200") + public static let colorLime100 = Color("colorLime100") + public static let colorYellow1400 = Color("colorYellow1400") + public static let colorYellow1300 = Color("colorYellow1300") + public static let colorYellow1200 = Color("colorYellow1200") + public static let colorYellow1100 = Color("colorYellow1100") + public static let colorYellow1000 = Color("colorYellow1000") + public static let colorYellow900 = Color("colorYellow900") + public static let colorYellow800 = Color("colorYellow800") + public static let colorYellow700 = Color("colorYellow700") + public static let colorYellow600 = Color("colorYellow600") + public static let colorYellow500 = Color("colorYellow500") + public static let colorYellow400 = Color("colorYellow400") + public static let colorYellow300 = Color("colorYellow300") + public static let colorYellow200 = Color("colorYellow200") + public static let colorYellow100 = Color("colorYellow100") + public static let colorOrange1400 = Color("colorOrange1400") + public static let colorOrange1300 = Color("colorOrange1300") + public static let colorOrange1200 = Color("colorOrange1200") + public static let colorOrange1100 = Color("colorOrange1100") + public static let colorOrange1000 = Color("colorOrange1000") + public static let colorOrange900 = Color("colorOrange900") + public static let colorOrange800 = Color("colorOrange800") + public static let colorOrange700 = Color("colorOrange700") + public static let colorOrange600 = Color("colorOrange600") + public static let colorOrange500 = Color("colorOrange500") + public static let colorOrange400 = Color("colorOrange400") + public static let colorOrange300 = Color("colorOrange300") + public static let colorOrange200 = Color("colorOrange200") + public static let colorOrange100 = Color("colorOrange100") + public static let colorRed1400 = Color("colorRed1400") + public static let colorRed1300 = Color("colorRed1300") + public static let colorRed1200 = Color("colorRed1200") + public static let colorRed1100 = Color("colorRed1100") + public static let colorRed1000 = Color("colorRed1000") + public static let colorRed900 = Color("colorRed900") + public static let colorRed800 = Color("colorRed800") + public static let colorRed700 = Color("colorRed700") + public static let colorRed600 = Color("colorRed600") + public static let colorRed500 = Color("colorRed500") + public static let colorRed400 = Color("colorRed400") + public static let colorRed300 = Color("colorRed300") + public static let colorRed200 = Color("colorRed200") + public static let colorRed100 = Color("colorRed100") + public static let colorGray1400 = Color("colorGray1400") + public static let colorGray1300 = Color("colorGray1300") + public static let colorGray1200 = Color("colorGray1200") + public static let colorGray1100 = Color("colorGray1100") + public static let colorGray1000 = Color("colorGray1000") + public static let colorGray900 = Color("colorGray900") + public static let colorGray800 = Color("colorGray800") + public static let colorGray700 = Color("colorGray700") + public static let colorGray600 = Color("colorGray600") + public static let colorGray500 = Color("colorGray500") + public static let colorGray400 = Color("colorGray400") + public static let colorGray300 = Color("colorGray300") + public static let colorGray200 = Color("colorGray200") + public static let colorGray100 = Color("colorGray100") + public static let fontSizeHeadingXl = CGFloat(34) + public static let fontSizeHeadingLg = CGFloat(28) + public static let fontSizeHeadingMd = CGFloat(22) + public static let fontSizeHeadingSm = CGFloat(20) + public static let fontSizeBodyLg = CGFloat(17) + public static let fontSizeBodyMd = CGFloat(15) + public static let fontSizeBodySm = CGFloat(13) + public static let fontSizeBodyXs = CGFloat(12) + public static let fontLineHeightHeadingXlRegular = CGFloat(41) + public static let fontLineHeightHeadingLgRegular = CGFloat(34) + public static let fontLineHeightHeadingMdRegular = CGFloat(28) + public static let fontLineHeightHeadingSmRegular = CGFloat(25) + public static let fontLineHeightBodyLgRegular = CGFloat(22) + public static let fontLineHeightBodyMdRegular = CGFloat(20) + public static let fontLineHeightBodySmRegular = CGFloat(18) + public static let fontLineHeightBodyXsRegular = CGFloat(16) + public static let fontWeightBold = Font.Weight.regular + public static let fontWeightSemibold = Font.Weight.regular + public static let fontWeightRegular = Font.Weight.regular + public static let fontFamilyMono = "SF Mono" + public static let fontFamilySans = "SF Pro" + public static let borderWidth0_5 = CGFloat(0.5) + public static let borderWidth4 = CGFloat(4) + public static let borderWidth2 = CGFloat(2) + public static let borderWidth1 = CGFloat(1) + public static let space56X = CGFloat(224) + public static let space36X = CGFloat(144) + public static let space16X = CGFloat(64) + public static let space12X = CGFloat(48) + public static let space11X = CGFloat(44) + public static let space10X = CGFloat(40) + public static let space6X = CGFloat(24) + public static let space0X = CGFloat(0) + public static let spaceScale = CGFloat(4) + public static let space64X = spaceScale * 64 + public static let space48X = spaceScale * 48 + public static let space40X = spaceScale * 40 + public static let space32X = spaceScale * 32 + public static let space28X = spaceScale * 28 + public static let space24X = spaceScale * 24 + public static let space20X = spaceScale * 20 + public static let space15X = spaceScale * 15 + public static let space14X = spaceScale * 14 + public static let space13X = spaceScale * 13 + public static let space9X = spaceScale * 9 + public static let space8X = spaceScale * 8 + public static let space7X = spaceScale * 7 + public static let space5X = spaceScale * 5 + public static let space4X = spaceScale * 4 + public static let space3X = spaceScale * 3 + public static let space2X = spaceScale * 2 + public static let space1_5X = spaceScale * 1.5 + public static let space1X = spaceScale + public static let space0_5X = spaceScale * 0.5 +} diff --git a/assets/ios/swift/CpdDark.swift b/assets/ios/swift/CpdDark.swift deleted file mode 100644 index 3d98db34..00000000 --- a/assets/ios/swift/CpdDark.swift +++ /dev/null @@ -1,241 +0,0 @@ - -// -// CpdDark.swift -// - -import UIKit - -public class CpdDarkDesignTokens { - public static let cpdColorPink1400 = UIColor(red: 0.255, green: 0.000, blue: 0.082, alpha: 1) - public static let cpdColorPink1300 = UIColor(red: 0.290, green: 0.000, blue: 0.110, alpha: 1) - public static let cpdColorPink1200 = UIColor(red: 0.392, green: 0.000, blue: 0.184, alpha: 1) - public static let cpdColorPink1100 = UIColor(red: 0.447, green: 0.000, blue: 0.227, alpha: 1) - public static let cpdColorPink1000 = UIColor(red: 0.518, green: 0.027, blue: 0.271, alpha: 1) - public static let cpdColorPink900 = UIColor(red: 0.573, green: 0.031, blue: 0.294, alpha: 1) - public static let cpdColorPink800 = UIColor(red: 0.878, green: 0.047, blue: 0.416, alpha: 1) - public static let cpdColorPink700 = UIColor(red: 0.976, green: 0.306, blue: 0.518, alpha: 1) - public static let cpdColorPink600 = UIColor(red: 1.000, green: 0.533, blue: 0.651, alpha: 1) - public static let cpdColorPink500 = UIColor(red: 1.000, green: 0.678, blue: 0.753, alpha: 1) - public static let cpdColorPink400 = UIColor(red: 1.000, green: 0.816, blue: 0.855, alpha: 1) - public static let cpdColorPink300 = UIColor(red: 1.000, green: 0.871, blue: 0.898, alpha: 1) - public static let cpdColorPink200 = UIColor(red: 1.000, green: 0.925, blue: 0.941, alpha: 1) - public static let cpdColorPink100 = UIColor(red: 1.000, green: 0.961, blue: 0.969, alpha: 1) - public static let cpdColorFuchsia1400 = UIColor(red: 0.196, green: 0.000, blue: 0.290, alpha: 1) - public static let cpdColorFuchsia1300 = UIColor(red: 0.231, green: 0.000, blue: 0.325, alpha: 1) - public static let cpdColorFuchsia1200 = UIColor(red: 0.322, green: 0.008, blue: 0.424, alpha: 1) - public static let cpdColorFuchsia1100 = UIColor(red: 0.361, green: 0.059, blue: 0.463, alpha: 1) - public static let cpdColorFuchsia1000 = UIColor(red: 0.424, green: 0.090, blue: 0.522, alpha: 1) - public static let cpdColorFuchsia900 = UIColor(red: 0.471, green: 0.110, blue: 0.565, alpha: 1) - public static let cpdColorFuchsia800 = UIColor(red: 0.725, green: 0.216, blue: 0.776, alpha: 1) - public static let cpdColorFuchsia700 = UIColor(red: 0.796, green: 0.408, blue: 0.831, alpha: 1) - public static let cpdColorFuchsia600 = UIColor(red: 0.859, green: 0.576, blue: 0.882, alpha: 1) - public static let cpdColorFuchsia500 = UIColor(red: 0.906, green: 0.698, blue: 0.918, alpha: 1) - public static let cpdColorFuchsia400 = UIColor(red: 0.945, green: 0.824, blue: 0.953, alpha: 1) - public static let cpdColorFuchsia300 = UIColor(red: 0.965, green: 0.875, blue: 0.969, alpha: 1) - public static let cpdColorFuchsia200 = UIColor(red: 0.980, green: 0.933, blue: 0.984, alpha: 1) - public static let cpdColorFuchsia100 = UIColor(red: 0.988, green: 0.961, blue: 0.992, alpha: 1) - public static let cpdColorPurple1400 = UIColor(red: 0.122, green: 0.000, blue: 0.384, alpha: 1) - public static let cpdColorPurple1300 = UIColor(red: 0.141, green: 0.000, blue: 0.439, alpha: 1) - public static let cpdColorPurple1200 = UIColor(red: 0.212, green: 0.000, blue: 0.580, alpha: 1) - public static let cpdColorPurple1100 = UIColor(red: 0.259, green: 0.000, blue: 0.651, alpha: 1) - public static let cpdColorPurple1000 = UIColor(red: 0.310, green: 0.051, blue: 0.729, alpha: 1) - public static let cpdColorPurple900 = UIColor(red: 0.341, green: 0.110, blue: 0.769, alpha: 1) - public static let cpdColorPurple800 = UIColor(red: 0.510, green: 0.306, blue: 0.976, alpha: 1) - public static let cpdColorPurple700 = UIColor(red: 0.592, green: 0.471, blue: 0.996, alpha: 1) - public static let cpdColorPurple600 = UIColor(red: 0.694, green: 0.627, blue: 1.000, alpha: 1) - public static let cpdColorPurple500 = UIColor(red: 0.773, green: 0.733, blue: 1.000, alpha: 1) - public static let cpdColorPurple400 = UIColor(red: 0.867, green: 0.847, blue: 1.000, alpha: 1) - public static let cpdColorPurple300 = UIColor(red: 0.902, green: 0.886, blue: 1.000, alpha: 1) - public static let cpdColorPurple200 = UIColor(red: 0.945, green: 0.937, blue: 1.000, alpha: 1) - public static let cpdColorPurple100 = UIColor(red: 0.973, green: 0.969, blue: 1.000, alpha: 1) - public static let cpdColorBlue1400 = UIColor(red: 0.000, green: 0.047, blue: 0.388, alpha: 1) - public static let cpdColorBlue1300 = UIColor(red: 0.000, green: 0.082, blue: 0.412, alpha: 1) - public static let cpdColorBlue1200 = UIColor(red: 0.012, green: 0.153, blue: 0.482, alpha: 1) - public static let cpdColorBlue1100 = UIColor(red: 0.016, green: 0.188, blue: 0.533, alpha: 1) - public static let cpdColorBlue1000 = UIColor(red: 0.020, green: 0.231, blue: 0.604, alpha: 1) - public static let cpdColorBlue900 = UIColor(red: 0.020, green: 0.263, blue: 0.655, alpha: 1) - public static let cpdColorBlue800 = UIColor(red: 0.016, green: 0.431, blue: 0.910, alpha: 1) - public static let cpdColorBlue700 = UIColor(red: 0.290, green: 0.557, blue: 0.941, alpha: 1) - public static let cpdColorBlue600 = UIColor(red: 0.494, green: 0.686, blue: 0.965, alpha: 1) - public static let cpdColorBlue500 = UIColor(red: 0.639, green: 0.776, blue: 0.980, alpha: 1) - public static let cpdColorBlue400 = UIColor(red: 0.784, green: 0.867, blue: 0.992, alpha: 1) - public static let cpdColorBlue300 = UIColor(red: 0.847, green: 0.906, blue: 0.996, alpha: 1) - public static let cpdColorBlue200 = UIColor(red: 0.914, green: 0.949, blue: 1.000, alpha: 1) - public static let cpdColorBlue100 = UIColor(red: 0.957, green: 0.973, blue: 1.000, alpha: 1) - public static let cpdColorCyan1400 = UIColor(red: 0.000, green: 0.090, blue: 0.302, alpha: 1) - public static let cpdColorCyan1300 = UIColor(red: 0.000, green: 0.118, blue: 0.325, alpha: 1) - public static let cpdColorCyan1200 = UIColor(red: 0.000, green: 0.180, blue: 0.392, alpha: 1) - public static let cpdColorCyan1100 = UIColor(red: 0.000, green: 0.216, blue: 0.431, alpha: 1) - public static let cpdColorCyan1000 = UIColor(red: 0.000, green: 0.267, blue: 0.482, alpha: 1) - public static let cpdColorCyan900 = UIColor(red: 0.000, green: 0.298, blue: 0.518, alpha: 1) - public static let cpdColorCyan800 = UIColor(red: 0.000, green: 0.478, blue: 0.702, alpha: 1) - public static let cpdColorCyan700 = UIColor(red: 0.000, green: 0.604, blue: 0.765, alpha: 1) - public static let cpdColorCyan600 = UIColor(red: 0.082, green: 0.745, blue: 0.812, alpha: 1) - public static let cpdColorCyan500 = UIColor(red: 0.463, green: 0.820, blue: 0.867, alpha: 1) - public static let cpdColorCyan400 = UIColor(red: 0.694, green: 0.894, blue: 0.922, alpha: 1) - public static let cpdColorCyan300 = UIColor(red: 0.780, green: 0.925, blue: 0.941, alpha: 1) - public static let cpdColorCyan200 = UIColor(red: 0.890, green: 0.961, blue: 0.973, alpha: 1) - public static let cpdColorCyan100 = UIColor(red: 0.945, green: 0.980, blue: 0.984, alpha: 1) - public static let cpdColorGreen1400 = UIColor(red: 0.000, green: 0.129, blue: 0.059, alpha: 1) - public static let cpdColorGreen1300 = UIColor(red: 0.000, green: 0.153, blue: 0.082, alpha: 1) - public static let cpdColorGreen1200 = UIColor(red: 0.000, green: 0.216, blue: 0.137, alpha: 1) - public static let cpdColorGreen1100 = UIColor(red: 0.000, green: 0.251, blue: 0.169, alpha: 1) - public static let cpdColorGreen1000 = UIColor(red: 0.000, green: 0.302, blue: 0.212, alpha: 1) - public static let cpdColorGreen900 = UIColor(red: 0.000, green: 0.333, blue: 0.239, alpha: 1) - public static let cpdColorGreen800 = UIColor(red: 0.000, green: 0.510, blue: 0.408, alpha: 1) - public static let cpdColorGreen700 = UIColor(red: 0.000, green: 0.635, blue: 0.486, alpha: 1) - public static let cpdColorGreen600 = UIColor(red: 0.043, green: 0.769, blue: 0.569, alpha: 1) - public static let cpdColorGreen500 = UIColor(red: 0.443, green: 0.843, blue: 0.682, alpha: 1) - public static let cpdColorGreen400 = UIColor(red: 0.686, green: 0.910, blue: 0.808, alpha: 1) - public static let cpdColorGreen300 = UIColor(red: 0.776, green: 0.933, blue: 0.859, alpha: 1) - public static let cpdColorGreen200 = UIColor(red: 0.890, green: 0.969, blue: 0.929, alpha: 1) - public static let cpdColorGreen100 = UIColor(red: 0.945, green: 0.984, blue: 0.965, alpha: 1) - public static let cpdColorLime1400 = UIColor(red: 0.000, green: 0.133, blue: 0.000, alpha: 1) - public static let cpdColorLime1300 = UIColor(red: 0.000, green: 0.161, blue: 0.000, alpha: 1) - public static let cpdColorLime1200 = UIColor(red: 0.000, green: 0.224, blue: 0.000, alpha: 1) - public static let cpdColorLime1100 = UIColor(red: 0.000, green: 0.259, blue: 0.000, alpha: 1) - public static let cpdColorLime1000 = UIColor(red: 0.000, green: 0.310, blue: 0.000, alpha: 1) - public static let cpdColorLime900 = UIColor(red: 0.000, green: 0.341, blue: 0.000, alpha: 1) - public static let cpdColorLime800 = UIColor(red: 0.122, green: 0.522, blue: 0.059, alpha: 1) - public static let cpdColorLime700 = UIColor(red: 0.227, green: 0.639, blue: 0.102, alpha: 1) - public static let cpdColorLime600 = UIColor(red: 0.329, green: 0.769, blue: 0.141, alpha: 1) - public static let cpdColorLime500 = UIColor(red: 0.463, green: 0.859, blue: 0.298, alpha: 1) - public static let cpdColorLime400 = UIColor(red: 0.686, green: 0.922, blue: 0.608, alpha: 1) - public static let cpdColorLime300 = UIColor(red: 0.784, green: 0.945, blue: 0.729, alpha: 1) - public static let cpdColorLime200 = UIColor(red: 0.878, green: 0.973, blue: 0.851, alpha: 1) - public static let cpdColorLime100 = UIColor(red: 0.945, green: 0.988, blue: 0.933, alpha: 1) - public static let cpdColorYellow1400 = UIColor(red: 0.247, green: 0.020, blue: 0.000, alpha: 1) - public static let cpdColorYellow1300 = UIColor(red: 0.271, green: 0.047, blue: 0.000, alpha: 1) - public static let cpdColorYellow1200 = UIColor(red: 0.341, green: 0.114, blue: 0.000, alpha: 1) - public static let cpdColorYellow1100 = UIColor(red: 0.380, green: 0.149, blue: 0.000, alpha: 1) - public static let cpdColorYellow1000 = UIColor(red: 0.431, green: 0.192, blue: 0.000, alpha: 1) - public static let cpdColorYellow900 = UIColor(red: 0.467, green: 0.220, blue: 0.000, alpha: 1) - public static let cpdColorYellow800 = UIColor(red: 0.655, green: 0.388, blue: 0.000, alpha: 1) - public static let cpdColorYellow700 = UIColor(red: 0.765, green: 0.506, blue: 0.000, alpha: 1) - public static let cpdColorYellow600 = UIColor(red: 0.871, green: 0.635, blue: 0.000, alpha: 1) - public static let cpdColorYellow500 = UIColor(red: 0.945, green: 0.741, blue: 0.000, alpha: 1) - public static let cpdColorYellow400 = UIColor(red: 1.000, green: 0.855, blue: 0.286, alpha: 1) - public static let cpdColorYellow300 = UIColor(red: 1.000, green: 0.894, blue: 0.518, alpha: 1) - public static let cpdColorYellow200 = UIColor(red: 1.000, green: 0.949, blue: 0.757, alpha: 1) - public static let cpdColorYellow100 = UIColor(red: 1.000, green: 0.973, blue: 0.878, alpha: 1) - public static let cpdColorOrange1400 = UIColor(red: 0.259, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange1300 = UIColor(red: 0.298, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange1200 = UIColor(red: 0.404, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange1100 = UIColor(red: 0.467, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange1000 = UIColor(red: 0.537, green: 0.031, blue: 0.000, alpha: 1) - public static let cpdColorOrange900 = UIColor(red: 0.576, green: 0.090, blue: 0.000, alpha: 1) - public static let cpdColorOrange800 = UIColor(red: 0.769, green: 0.302, blue: 0.000, alpha: 1) - public static let cpdColorOrange700 = UIColor(red: 0.886, green: 0.431, blue: 0.000, alpha: 1) - public static let cpdColorOrange600 = UIColor(red: 0.973, green: 0.580, blue: 0.251, alpha: 1) - public static let cpdColorOrange500 = UIColor(red: 0.992, green: 0.702, blue: 0.486, alpha: 1) - public static let cpdColorOrange400 = UIColor(red: 1.000, green: 0.831, blue: 0.710, alpha: 1) - public static let cpdColorOrange300 = UIColor(red: 1.000, green: 0.875, blue: 0.784, alpha: 1) - public static let cpdColorOrange200 = UIColor(red: 1.000, green: 0.937, blue: 0.894, alpha: 1) - public static let cpdColorOrange100 = UIColor(red: 1.000, green: 0.965, blue: 0.937, alpha: 1) - public static let cpdColorRed1400 = UIColor(red: 0.259, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed1300 = UIColor(red: 0.298, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed1200 = UIColor(red: 0.404, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed1100 = UIColor(red: 0.467, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed1000 = UIColor(red: 0.545, green: 0.000, blue: 0.047, alpha: 1) - public static let cpdColorRed900 = UIColor(red: 0.600, green: 0.000, blue: 0.102, alpha: 1) - public static let cpdColorRed800 = UIColor(red: 0.882, green: 0.118, blue: 0.165, alpha: 1) - public static let cpdColorRed700 = UIColor(red: 1.000, green: 0.306, blue: 0.286, alpha: 1) - public static let cpdColorRed600 = UIColor(red: 1.000, green: 0.549, blue: 0.506, alpha: 1) - public static let cpdColorRed500 = UIColor(red: 1.000, green: 0.686, blue: 0.647, alpha: 1) - public static let cpdColorRed400 = UIColor(red: 1.000, green: 0.820, blue: 0.792, alpha: 1) - public static let cpdColorRed300 = UIColor(red: 1.000, green: 0.875, blue: 0.855, alpha: 1) - public static let cpdColorRed200 = UIColor(red: 1.000, green: 0.937, blue: 0.925, alpha: 1) - public static let cpdColorRed100 = UIColor(red: 1.000, green: 0.969, blue: 0.965, alpha: 1) - public static let cpdColorGray1400 = UIColor(red: 0.055, green: 0.114, blue: 0.176, alpha: 1) - public static let cpdColorGray1300 = UIColor(red: 0.071, green: 0.133, blue: 0.200, alpha: 1) - public static let cpdColorGray1200 = UIColor(red: 0.129, green: 0.192, blue: 0.263, alpha: 1) - public static let cpdColorGray1100 = UIColor(red: 0.161, green: 0.227, blue: 0.294, alpha: 1) - public static let cpdColorGray1000 = UIColor(red: 0.196, green: 0.267, blue: 0.337, alpha: 1) - public static let cpdColorGray900 = UIColor(red: 0.227, green: 0.294, blue: 0.369, alpha: 1) - public static let cpdColorGray800 = UIColor(red: 0.384, green: 0.459, blue: 0.537, alpha: 1) - public static let cpdColorGray700 = UIColor(red: 0.502, green: 0.565, blue: 0.635, alpha: 1) - public static let cpdColorGray600 = UIColor(red: 0.635, green: 0.682, blue: 0.737, alpha: 1) - public static let cpdColorGray500 = UIColor(red: 0.737, green: 0.773, blue: 0.808, alpha: 1) - public static let cpdColorGray400 = UIColor(red: 0.847, green: 0.867, blue: 0.890, alpha: 1) - public static let cpdColorGray300 = UIColor(red: 0.886, green: 0.902, blue: 0.918, alpha: 1) - public static let cpdColorGray200 = UIColor(red: 0.933, green: 0.945, blue: 0.953, alpha: 1) - public static let cpdColorGray100 = UIColor(red: 0.969, green: 0.973, blue: 0.976, alpha: 1) - public static let cpdFontLetterSpacingHeadingXl = 1.2% - public static let cpdFontLetterSpacingHeadingLg = 1.4% - public static let cpdFontLetterSpacingHeadingMd = -1.2% - public static let cpdFontLetterSpacingHeadingSm = -2.3% - public static let cpdFontLetterSpacingBodyLg = -2.6% - public static let cpdFontLetterSpacingBodyMd = -1.6% - public static let cpdFontLetterSpacingBodySm = -0.6% - public static let cpdFontLetterSpacingBodyXs = 0 - public static let cpdFontSizeHeadingXl = 34 - public static let cpdFontSizeHeadingLg = 28 - public static let cpdFontSizeHeadingMd = 22 - public static let cpdFontSizeHeadingSm = 20 - public static let cpdFontSizeBodyLg = 17 - public static let cpdFontSizeBodyMd = 15 - public static let cpdFontSizeBodySm = 13 - public static let cpdFontSizeBodyXs = 12 - public static let cpdFontLineHeightHeadingXlRegular = 41 - public static let cpdFontLineHeightHeadingLgRegular = 34 - public static let cpdFontLineHeightHeadingMdRegular = 28 - public static let cpdFontLineHeightHeadingSmRegular = 25 - public static let cpdFontLineHeightBodyLgRegular = 22 - public static let cpdFontLineHeightBodyMdRegular = 20 - public static let cpdFontLineHeightBodySmRegular = 18 - public static let cpdFontLineHeightBodyXsRegular = 16 - public static let cpdFontWeightBold = 700 - public static let cpdFontWeightSemibold = 600 - public static let cpdFontWeightRegular = 400 - public static let cpdFontFamilyMono = SF Mono - public static let cpdFontFamilySans = SF Pro - public static let cpdBorderWidth0_5 = 0.5 - public static let cpdBorderWidth4 = 4 - public static let cpdBorderWidth2 = 2 - public static let cpdBorderWidth1 = 1 - public static let cpdSpace56X = 224 - public static let cpdSpace36X = 144 - public static let cpdSpace16X = 64 - public static let cpdSpace12X = 48 - public static let cpdSpace11X = 44 - public static let cpdSpace10X = 40 - public static let cpdSpace6X = 24 - public static let cpdSpace0X = 0 - public static let cpdSpaceScale = 4 - public static let cpdFontHeadingXlBold = [object Object] - public static let cpdFontHeadingXlRegular = [object Object] - public static let cpdFontHeadingLgBold = [object Object] - public static let cpdFontHeadingLgRegular = [object Object] - public static let cpdFontHeadingMdBold = [object Object] - public static let cpdFontHeadingMdRegular = [object Object] - public static let cpdFontHeadingSmSemibold = [object Object] - public static let cpdFontHeadingSmRegular = [object Object] - public static let cpdFontBodyLgSemibold = [object Object] - public static let cpdFontBodyLgRegular = [object Object] - public static let cpdFontBodyMdSemibold = [object Object] - public static let cpdFontBodyMdRegular = [object Object] - public static let cpdFontBodySmSemibold = [object Object] - public static let cpdFontBodySmRegular = [object Object] - public static let cpdFontBodyXsSemibold = [object Object] - public static let cpdFontBodyXsRegular = [object Object] - public static let cpdSpace64X = cpdSpaceScale * 64 - public static let cpdSpace48X = cpdSpaceScale * 48 - public static let cpdSpace40X = cpdSpaceScale * 40 - public static let cpdSpace32X = cpdSpaceScale * 32 - public static let cpdSpace28X = cpdSpaceScale * 28 - public static let cpdSpace24X = cpdSpaceScale * 24 - public static let cpdSpace20X = cpdSpaceScale * 20 - public static let cpdSpace15X = cpdSpaceScale * 15 - public static let cpdSpace14X = cpdSpaceScale * 14 - public static let cpdSpace13X = cpdSpaceScale * 13 - public static let cpdSpace9X = cpdSpaceScale * 9 - public static let cpdSpace8X = cpdSpaceScale * 8 - public static let cpdSpace7X = cpdSpaceScale * 7 - public static let cpdSpace5X = cpdSpaceScale * 5 - public static let cpdSpace4X = cpdSpaceScale * 4 - public static let cpdSpace3X = cpdSpaceScale * 3 - public static let cpdSpace2X = cpdSpaceScale * 2 - public static let cpdSpace1_5X = cpdSpaceScale * 1.5 - public static let cpdSpace1X = cpdSpaceScale - public static let cpdSpace0_5X = cpdSpaceScale * 0.5 -} diff --git a/assets/ios/swift/CpdDarkHc.swift b/assets/ios/swift/CpdDarkHc.swift deleted file mode 100644 index 8ac0d866..00000000 --- a/assets/ios/swift/CpdDarkHc.swift +++ /dev/null @@ -1,241 +0,0 @@ - -// -// CpdDarkHc.swift -// - -import UIKit - -public class CpdDarkHcDesignTokens { - public static let cpdColorPink1400 = UIColor(red: 1.000, green: 0.941, blue: 0.953, alpha: 1) - public static let cpdColorPink1300 = UIColor(red: 1.000, green: 0.906, blue: 0.925, alpha: 1) - public static let cpdColorPink1200 = UIColor(red: 1.000, green: 0.800, blue: 0.843, alpha: 1) - public static let cpdColorPink1100 = UIColor(red: 1.000, green: 0.733, blue: 0.788, alpha: 1) - public static let cpdColorPink1000 = UIColor(red: 1.000, green: 0.643, blue: 0.722, alpha: 1) - public static let cpdColorPink900 = UIColor(red: 1.000, green: 0.573, blue: 0.675, alpha: 1) - public static let cpdColorPink800 = UIColor(red: 0.945, green: 0.169, blue: 0.459, alpha: 1) - public static let cpdColorPink700 = UIColor(red: 0.773, green: 0.090, blue: 0.380, alpha: 1) - public static let cpdColorPink600 = UIColor(red: 0.596, green: 0.067, blue: 0.310, alpha: 1) - public static let cpdColorPink500 = UIColor(red: 0.482, green: 0.047, blue: 0.255, alpha: 1) - public static let cpdColorPink400 = UIColor(red: 0.380, green: 0.000, blue: 0.176, alpha: 1) - public static let cpdColorPink300 = UIColor(red: 0.333, green: 0.000, blue: 0.141, alpha: 1) - public static let cpdColorPink200 = UIColor(red: 0.271, green: 0.000, blue: 0.094, alpha: 1) - public static let cpdColorPink100 = UIColor(red: 0.235, green: 0.000, blue: 0.071, alpha: 1) - public static let cpdColorFuchsia1400 = UIColor(red: 0.984, green: 0.945, blue: 0.984, alpha: 1) - public static let cpdColorFuchsia1300 = UIColor(red: 0.973, green: 0.910, blue: 0.976, alpha: 1) - public static let cpdColorFuchsia1200 = UIColor(red: 0.941, green: 0.812, blue: 0.949, alpha: 1) - public static let cpdColorFuchsia1100 = UIColor(red: 0.918, green: 0.749, blue: 0.929, alpha: 1) - public static let cpdColorFuchsia1000 = UIColor(red: 0.890, green: 0.671, blue: 0.906, alpha: 1) - public static let cpdColorFuchsia900 = UIColor(red: 0.867, green: 0.612, blue: 0.886, alpha: 1) - public static let cpdColorFuchsia800 = UIColor(red: 0.757, green: 0.322, blue: 0.796, alpha: 1) - public static let cpdColorFuchsia700 = UIColor(red: 0.635, green: 0.200, blue: 0.702, alpha: 1) - public static let cpdColorFuchsia600 = UIColor(red: 0.490, green: 0.137, blue: 0.580, alpha: 1) - public static let cpdColorFuchsia500 = UIColor(red: 0.396, green: 0.090, blue: 0.490, alpha: 1) - public static let cpdColorFuchsia400 = UIColor(red: 0.310, green: 0.012, blue: 0.408, alpha: 1) - public static let cpdColorFuchsia300 = UIColor(red: 0.267, green: 0.000, blue: 0.361, alpha: 1) - public static let cpdColorFuchsia200 = UIColor(red: 0.216, green: 0.000, blue: 0.306, alpha: 1) - public static let cpdColorFuchsia100 = UIColor(red: 0.173, green: 0.000, blue: 0.259, alpha: 1) - public static let cpdColorPurple1400 = UIColor(red: 0.957, green: 0.953, blue: 1.000, alpha: 1) - public static let cpdColorPurple1300 = UIColor(red: 0.933, green: 0.922, blue: 1.000, alpha: 1) - public static let cpdColorPurple1200 = UIColor(red: 0.855, green: 0.831, blue: 1.000, alpha: 1) - public static let cpdColorPurple1100 = UIColor(red: 0.808, green: 0.776, blue: 1.000, alpha: 1) - public static let cpdColorPurple1000 = UIColor(red: 0.753, green: 0.710, blue: 1.000, alpha: 1) - public static let cpdColorPurple900 = UIColor(red: 0.714, green: 0.655, blue: 1.000, alpha: 1) - public static let cpdColorPurple800 = UIColor(red: 0.545, green: 0.400, blue: 0.973, alpha: 1) - public static let cpdColorPurple700 = UIColor(red: 0.451, green: 0.263, blue: 0.898, alpha: 1) - public static let cpdColorPurple600 = UIColor(red: 0.353, green: 0.153, blue: 0.776, alpha: 1) - public static let cpdColorPurple500 = UIColor(red: 0.286, green: 0.043, blue: 0.694, alpha: 1) - public static let cpdColorPurple400 = UIColor(red: 0.208, green: 0.000, blue: 0.565, alpha: 1) - public static let cpdColorPurple300 = UIColor(red: 0.173, green: 0.000, blue: 0.502, alpha: 1) - public static let cpdColorPurple200 = UIColor(red: 0.129, green: 0.000, blue: 0.408, alpha: 1) - public static let cpdColorPurple100 = UIColor(red: 0.110, green: 0.000, blue: 0.353, alpha: 1) - public static let cpdColorBlue1400 = UIColor(red: 0.933, green: 0.957, blue: 0.996, alpha: 1) - public static let cpdColorBlue1300 = UIColor(red: 0.894, green: 0.933, blue: 0.996, alpha: 1) - public static let cpdColorBlue1200 = UIColor(red: 0.769, green: 0.859, blue: 0.988, alpha: 1) - public static let cpdColorBlue1100 = UIColor(red: 0.698, green: 0.812, blue: 0.980, alpha: 1) - public static let cpdColorBlue1000 = UIColor(red: 0.600, green: 0.753, blue: 0.973, alpha: 1) - public static let cpdColorBlue900 = UIColor(red: 0.533, green: 0.706, blue: 0.965, alpha: 1) - public static let cpdColorBlue800 = UIColor(red: 0.196, green: 0.498, blue: 0.914, alpha: 1) - public static let cpdColorBlue700 = UIColor(red: 0.055, green: 0.380, blue: 0.820, alpha: 1) - public static let cpdColorBlue600 = UIColor(red: 0.043, green: 0.282, blue: 0.671, alpha: 1) - public static let cpdColorBlue500 = UIColor(red: 0.031, green: 0.220, blue: 0.565, alpha: 1) - public static let cpdColorBlue400 = UIColor(red: 0.012, green: 0.149, blue: 0.467, alpha: 1) - public static let cpdColorBlue300 = UIColor(red: 0.000, green: 0.114, blue: 0.431, alpha: 1) - public static let cpdColorBlue200 = UIColor(red: 0.000, green: 0.063, blue: 0.388, alpha: 1) - public static let cpdColorBlue100 = UIColor(red: 0.000, green: 0.035, blue: 0.365, alpha: 1) - public static let cpdColorCyan1400 = UIColor(red: 0.910, green: 0.969, blue: 0.976, alpha: 1) - public static let cpdColorCyan1300 = UIColor(red: 0.851, green: 0.949, blue: 0.961, alpha: 1) - public static let cpdColorCyan1200 = UIColor(red: 0.686, green: 0.886, blue: 0.914, alpha: 1) - public static let cpdColorCyan1100 = UIColor(red: 0.573, green: 0.847, blue: 0.886, alpha: 1) - public static let cpdColorCyan1000 = UIColor(red: 0.416, green: 0.800, blue: 0.851, alpha: 1) - public static let cpdColorCyan900 = UIColor(red: 0.263, green: 0.765, blue: 0.824, alpha: 1) - public static let cpdColorCyan800 = UIColor(red: 0.000, green: 0.541, blue: 0.729, alpha: 1) - public static let cpdColorCyan700 = UIColor(red: 0.000, green: 0.420, blue: 0.643, alpha: 1) - public static let cpdColorCyan600 = UIColor(red: 0.000, green: 0.318, blue: 0.533, alpha: 1) - public static let cpdColorCyan500 = UIColor(red: 0.000, green: 0.247, blue: 0.455, alpha: 1) - public static let cpdColorCyan400 = UIColor(red: 0.000, green: 0.176, blue: 0.380, alpha: 1) - public static let cpdColorCyan300 = UIColor(red: 0.000, green: 0.145, blue: 0.349, alpha: 1) - public static let cpdColorCyan200 = UIColor(red: 0.000, green: 0.106, blue: 0.306, alpha: 1) - public static let cpdColorCyan100 = UIColor(red: 0.000, green: 0.078, blue: 0.282, alpha: 1) - public static let cpdColorGreen1400 = UIColor(red: 0.910, green: 0.973, blue: 0.941, alpha: 1) - public static let cpdColorGreen1300 = UIColor(red: 0.851, green: 0.953, blue: 0.906, alpha: 1) - public static let cpdColorGreen1200 = UIColor(red: 0.671, green: 0.898, blue: 0.796, alpha: 1) - public static let cpdColorGreen1100 = UIColor(red: 0.557, green: 0.867, blue: 0.737, alpha: 1) - public static let cpdColorGreen1000 = UIColor(red: 0.380, green: 0.820, blue: 0.651, alpha: 1) - public static let cpdColorGreen900 = UIColor(red: 0.216, green: 0.788, blue: 0.596, alpha: 1) - public static let cpdColorGreen800 = UIColor(red: 0.063, green: 0.569, blue: 0.451, alpha: 1) - public static let cpdColorGreen700 = UIColor(red: 0.000, green: 0.455, blue: 0.361, alpha: 1) - public static let cpdColorGreen600 = UIColor(red: 0.000, green: 0.353, blue: 0.263, alpha: 1) - public static let cpdColorGreen500 = UIColor(red: 0.000, green: 0.282, blue: 0.196, alpha: 1) - public static let cpdColorGreen400 = UIColor(red: 0.000, green: 0.212, blue: 0.133, alpha: 1) - public static let cpdColorGreen300 = UIColor(red: 0.000, green: 0.180, blue: 0.106, alpha: 1) - public static let cpdColorGreen200 = UIColor(red: 0.000, green: 0.145, blue: 0.075, alpha: 1) - public static let cpdColorGreen100 = UIColor(red: 0.000, green: 0.122, blue: 0.055, alpha: 1) - public static let cpdColorLime1400 = UIColor(red: 0.910, green: 0.976, blue: 0.890, alpha: 1) - public static let cpdColorLime1300 = UIColor(red: 0.855, green: 0.965, blue: 0.816, alpha: 1) - public static let cpdColorLime1200 = UIColor(red: 0.678, green: 0.914, blue: 0.596, alpha: 1) - public static let cpdColorLime1100 = UIColor(red: 0.569, green: 0.882, blue: 0.451, alpha: 1) - public static let cpdColorLime1000 = UIColor(red: 0.412, green: 0.835, blue: 0.212, alpha: 1) - public static let cpdColorLime900 = UIColor(red: 0.369, green: 0.792, blue: 0.184, alpha: 1) - public static let cpdColorLime800 = UIColor(red: 0.192, green: 0.580, blue: 0.114, alpha: 1) - public static let cpdColorLime700 = UIColor(red: 0.094, green: 0.463, blue: 0.067, alpha: 1) - public static let cpdColorLime600 = UIColor(red: 0.000, green: 0.361, blue: 0.000, alpha: 1) - public static let cpdColorLime500 = UIColor(red: 0.000, green: 0.290, blue: 0.000, alpha: 1) - public static let cpdColorLime400 = UIColor(red: 0.000, green: 0.216, blue: 0.000, alpha: 1) - public static let cpdColorLime300 = UIColor(red: 0.000, green: 0.184, blue: 0.000, alpha: 1) - public static let cpdColorLime200 = UIColor(red: 0.000, green: 0.145, blue: 0.000, alpha: 1) - public static let cpdColorLime100 = UIColor(red: 0.000, green: 0.118, blue: 0.000, alpha: 1) - public static let cpdColorYellow1400 = UIColor(red: 1.000, green: 0.957, blue: 0.816, alpha: 1) - public static let cpdColorYellow1300 = UIColor(red: 1.000, green: 0.929, blue: 0.690, alpha: 1) - public static let cpdColorYellow1200 = UIColor(red: 0.996, green: 0.839, blue: 0.196, alpha: 1) - public static let cpdColorYellow1100 = UIColor(red: 0.965, green: 0.784, blue: 0.086, alpha: 1) - public static let cpdColorYellow1000 = UIColor(red: 0.922, green: 0.714, blue: 0.027, alpha: 1) - public static let cpdColorYellow900 = UIColor(red: 0.886, green: 0.667, blue: 0.000, alpha: 1) - public static let cpdColorYellow800 = UIColor(red: 0.706, green: 0.447, blue: 0.000, alpha: 1) - public static let cpdColorYellow700 = UIColor(red: 0.592, green: 0.337, blue: 0.000, alpha: 1) - public static let cpdColorYellow600 = UIColor(red: 0.482, green: 0.243, blue: 0.012, alpha: 1) - public static let cpdColorYellow500 = UIColor(red: 0.408, green: 0.180, blue: 0.012, alpha: 1) - public static let cpdColorYellow400 = UIColor(red: 0.329, green: 0.114, blue: 0.000, alpha: 1) - public static let cpdColorYellow300 = UIColor(red: 0.298, green: 0.078, blue: 0.000, alpha: 1) - public static let cpdColorYellow200 = UIColor(red: 0.255, green: 0.035, blue: 0.000, alpha: 1) - public static let cpdColorYellow100 = UIColor(red: 0.227, green: 0.012, blue: 0.000, alpha: 1) - public static let cpdColorOrange1400 = UIColor(red: 1.000, green: 0.949, blue: 0.910, alpha: 1) - public static let cpdColorOrange1300 = UIColor(red: 1.000, green: 0.914, blue: 0.859, alpha: 1) - public static let cpdColorOrange1200 = UIColor(red: 0.996, green: 0.816, blue: 0.694, alpha: 1) - public static let cpdColorOrange1100 = UIColor(red: 0.992, green: 0.753, blue: 0.588, alpha: 1) - public static let cpdColorOrange1000 = UIColor(red: 0.980, green: 0.675, blue: 0.451, alpha: 1) - public static let cpdColorOrange900 = UIColor(red: 0.973, green: 0.616, blue: 0.345, alpha: 1) - public static let cpdColorOrange800 = UIColor(red: 0.820, green: 0.373, blue: 0.043, alpha: 1) - public static let cpdColorOrange700 = UIColor(red: 0.702, green: 0.251, blue: 0.027, alpha: 1) - public static let cpdColorOrange600 = UIColor(red: 0.592, green: 0.129, blue: 0.020, alpha: 1) - public static let cpdColorOrange500 = UIColor(red: 0.510, green: 0.012, blue: 0.000, alpha: 1) - public static let cpdColorOrange400 = UIColor(red: 0.396, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange300 = UIColor(red: 0.345, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange200 = UIColor(red: 0.278, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange100 = UIColor(red: 0.235, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed1400 = UIColor(red: 1.000, green: 0.949, blue: 0.937, alpha: 1) - public static let cpdColorRed1300 = UIColor(red: 1.000, green: 0.910, blue: 0.898, alpha: 1) - public static let cpdColorRed1200 = UIColor(red: 1.000, green: 0.808, blue: 0.780, alpha: 1) - public static let cpdColorRed1100 = UIColor(red: 1.000, green: 0.741, blue: 0.710, alpha: 1) - public static let cpdColorRed1000 = UIColor(red: 1.000, green: 0.655, blue: 0.612, alpha: 1) - public static let cpdColorRed900 = UIColor(red: 1.000, green: 0.584, blue: 0.541, alpha: 1) - public static let cpdColorRed800 = UIColor(red: 0.961, green: 0.184, blue: 0.200, alpha: 1) - public static let cpdColorRed700 = UIColor(red: 0.784, green: 0.114, blue: 0.157, alpha: 1) - public static let cpdColorRed600 = UIColor(red: 0.620, green: 0.047, blue: 0.118, alpha: 1) - public static let cpdColorRed500 = UIColor(red: 0.514, green: 0.000, blue: 0.035, alpha: 1) - public static let cpdColorRed400 = UIColor(red: 0.392, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed300 = UIColor(red: 0.341, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed200 = UIColor(red: 0.278, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed100 = UIColor(red: 0.231, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorGray1400 = UIColor(red: 0.953, green: 0.957, blue: 0.965, alpha: 1) - public static let cpdColorGray1300 = UIColor(red: 0.922, green: 0.929, blue: 0.941, alpha: 1) - public static let cpdColorGray1200 = UIColor(red: 0.831, green: 0.855, blue: 0.875, alpha: 1) - public static let cpdColorGray1100 = UIColor(red: 0.780, green: 0.808, blue: 0.835, alpha: 1) - public static let cpdColorGray1000 = UIColor(red: 0.710, green: 0.745, blue: 0.788, alpha: 1) - public static let cpdColorGray900 = UIColor(red: 0.663, green: 0.706, blue: 0.753, alpha: 1) - public static let cpdColorGray800 = UIColor(red: 0.443, green: 0.510, blue: 0.584, alpha: 1) - public static let cpdColorGray700 = UIColor(red: 0.337, green: 0.408, blue: 0.478, alpha: 1) - public static let cpdColorGray600 = UIColor(red: 0.247, green: 0.314, blue: 0.384, alpha: 1) - public static let cpdColorGray500 = UIColor(red: 0.188, green: 0.251, blue: 0.318, alpha: 1) - public static let cpdColorGray400 = UIColor(red: 0.122, green: 0.184, blue: 0.247, alpha: 1) - public static let cpdColorGray300 = UIColor(red: 0.102, green: 0.161, blue: 0.224, alpha: 1) - public static let cpdColorGray200 = UIColor(red: 0.067, green: 0.125, blue: 0.184, alpha: 1) - public static let cpdColorGray100 = UIColor(red: 0.047, green: 0.106, blue: 0.161, alpha: 1) - public static let cpdFontLetterSpacingHeadingXl = 1.2% - public static let cpdFontLetterSpacingHeadingLg = 1.4% - public static let cpdFontLetterSpacingHeadingMd = -1.2% - public static let cpdFontLetterSpacingHeadingSm = -2.3% - public static let cpdFontLetterSpacingBodyLg = -2.6% - public static let cpdFontLetterSpacingBodyMd = -1.6% - public static let cpdFontLetterSpacingBodySm = -0.6% - public static let cpdFontLetterSpacingBodyXs = 0 - public static let cpdFontSizeHeadingXl = 34 - public static let cpdFontSizeHeadingLg = 28 - public static let cpdFontSizeHeadingMd = 22 - public static let cpdFontSizeHeadingSm = 20 - public static let cpdFontSizeBodyLg = 17 - public static let cpdFontSizeBodyMd = 15 - public static let cpdFontSizeBodySm = 13 - public static let cpdFontSizeBodyXs = 12 - public static let cpdFontLineHeightHeadingXlRegular = 41 - public static let cpdFontLineHeightHeadingLgRegular = 34 - public static let cpdFontLineHeightHeadingMdRegular = 28 - public static let cpdFontLineHeightHeadingSmRegular = 25 - public static let cpdFontLineHeightBodyLgRegular = 22 - public static let cpdFontLineHeightBodyMdRegular = 20 - public static let cpdFontLineHeightBodySmRegular = 18 - public static let cpdFontLineHeightBodyXsRegular = 16 - public static let cpdFontWeightBold = 700 - public static let cpdFontWeightSemibold = 600 - public static let cpdFontWeightRegular = 400 - public static let cpdFontFamilyMono = SF Mono - public static let cpdFontFamilySans = SF Pro - public static let cpdBorderWidth0_5 = 0.5 - public static let cpdBorderWidth4 = 4 - public static let cpdBorderWidth2 = 2 - public static let cpdBorderWidth1 = 1 - public static let cpdSpace56X = 224 - public static let cpdSpace36X = 144 - public static let cpdSpace16X = 64 - public static let cpdSpace12X = 48 - public static let cpdSpace11X = 44 - public static let cpdSpace10X = 40 - public static let cpdSpace6X = 24 - public static let cpdSpace0X = 0 - public static let cpdSpaceScale = 4 - public static let cpdFontHeadingXlBold = [object Object] - public static let cpdFontHeadingXlRegular = [object Object] - public static let cpdFontHeadingLgBold = [object Object] - public static let cpdFontHeadingLgRegular = [object Object] - public static let cpdFontHeadingMdBold = [object Object] - public static let cpdFontHeadingMdRegular = [object Object] - public static let cpdFontHeadingSmSemibold = [object Object] - public static let cpdFontHeadingSmRegular = [object Object] - public static let cpdFontBodyLgSemibold = [object Object] - public static let cpdFontBodyLgRegular = [object Object] - public static let cpdFontBodyMdSemibold = [object Object] - public static let cpdFontBodyMdRegular = [object Object] - public static let cpdFontBodySmSemibold = [object Object] - public static let cpdFontBodySmRegular = [object Object] - public static let cpdFontBodyXsSemibold = [object Object] - public static let cpdFontBodyXsRegular = [object Object] - public static let cpdSpace64X = cpdSpaceScale * 64 - public static let cpdSpace48X = cpdSpaceScale * 48 - public static let cpdSpace40X = cpdSpaceScale * 40 - public static let cpdSpace32X = cpdSpaceScale * 32 - public static let cpdSpace28X = cpdSpaceScale * 28 - public static let cpdSpace24X = cpdSpaceScale * 24 - public static let cpdSpace20X = cpdSpaceScale * 20 - public static let cpdSpace15X = cpdSpaceScale * 15 - public static let cpdSpace14X = cpdSpaceScale * 14 - public static let cpdSpace13X = cpdSpaceScale * 13 - public static let cpdSpace9X = cpdSpaceScale * 9 - public static let cpdSpace8X = cpdSpaceScale * 8 - public static let cpdSpace7X = cpdSpaceScale * 7 - public static let cpdSpace5X = cpdSpaceScale * 5 - public static let cpdSpace4X = cpdSpaceScale * 4 - public static let cpdSpace3X = cpdSpaceScale * 3 - public static let cpdSpace2X = cpdSpaceScale * 2 - public static let cpdSpace1_5X = cpdSpaceScale * 1.5 - public static let cpdSpace1X = cpdSpaceScale - public static let cpdSpace0_5X = cpdSpaceScale * 0.5 -} diff --git a/assets/ios/swift/CpdLight.swift b/assets/ios/swift/CpdLight.swift deleted file mode 100644 index d1d669c8..00000000 --- a/assets/ios/swift/CpdLight.swift +++ /dev/null @@ -1,241 +0,0 @@ - -// -// CpdLight.swift -// - -import UIKit - -public class CpdLightDesignTokens { - public static let cpdColorPink1400 = UIColor(red: 0.263, green: 0.000, blue: 0.090, alpha: 1) - public static let cpdColorPink1300 = UIColor(red: 0.373, green: 0.000, blue: 0.169, alpha: 1) - public static let cpdColorPink1200 = UIColor(red: 0.494, green: 0.024, blue: 0.259, alpha: 1) - public static let cpdColorPink1100 = UIColor(red: 0.624, green: 0.031, blue: 0.314, alpha: 1) - public static let cpdColorPink1000 = UIColor(red: 0.722, green: 0.039, blue: 0.357, alpha: 1) - public static let cpdColorPink900 = UIColor(red: 0.824, green: 0.047, blue: 0.396, alpha: 1) - public static let cpdColorPink800 = UIColor(red: 0.969, green: 0.251, blue: 0.490, alpha: 1) - public static let cpdColorPink700 = UIColor(red: 1.000, green: 0.533, blue: 0.651, alpha: 1) - public static let cpdColorPink600 = UIColor(red: 1.000, green: 0.678, blue: 0.753, alpha: 1) - public static let cpdColorPink500 = UIColor(red: 1.000, green: 0.761, blue: 0.812, alpha: 1) - public static let cpdColorPink400 = UIColor(red: 1.000, green: 0.871, blue: 0.898, alpha: 1) - public static let cpdColorPink300 = UIColor(red: 1.000, green: 0.925, blue: 0.941, alpha: 1) - public static let cpdColorPink200 = UIColor(red: 1.000, green: 0.961, blue: 0.969, alpha: 1) - public static let cpdColorPink100 = UIColor(red: 1.000, green: 0.980, blue: 0.984, alpha: 1) - public static let cpdColorFuchsia1400 = UIColor(red: 0.204, green: 0.000, blue: 0.298, alpha: 1) - public static let cpdColorFuchsia1300 = UIColor(red: 0.306, green: 0.000, blue: 0.408, alpha: 1) - public static let cpdColorFuchsia1200 = UIColor(red: 0.404, green: 0.078, blue: 0.506, alpha: 1) - public static let cpdColorFuchsia1100 = UIColor(red: 0.510, green: 0.129, blue: 0.596, alpha: 1) - public static let cpdColorFuchsia1000 = UIColor(red: 0.592, green: 0.165, blue: 0.667, alpha: 1) - public static let cpdColorFuchsia900 = UIColor(red: 0.678, green: 0.200, blue: 0.741, alpha: 1) - public static let cpdColorFuchsia800 = UIColor(red: 0.784, green: 0.369, blue: 0.820, alpha: 1) - public static let cpdColorFuchsia700 = UIColor(red: 0.859, green: 0.576, blue: 0.882, alpha: 1) - public static let cpdColorFuchsia600 = UIColor(red: 0.906, green: 0.698, blue: 0.918, alpha: 1) - public static let cpdColorFuchsia500 = UIColor(red: 0.929, green: 0.776, blue: 0.941, alpha: 1) - public static let cpdColorFuchsia400 = UIColor(red: 0.965, green: 0.875, blue: 0.969, alpha: 1) - public static let cpdColorFuchsia300 = UIColor(red: 0.980, green: 0.933, blue: 0.984, alpha: 1) - public static let cpdColorFuchsia200 = UIColor(red: 0.988, green: 0.961, blue: 0.992, alpha: 1) - public static let cpdColorFuchsia100 = UIColor(red: 0.996, green: 0.980, blue: 0.996, alpha: 1) - public static let cpdColorPurple1400 = UIColor(red: 0.125, green: 0.000, blue: 0.400, alpha: 1) - public static let cpdColorPurple1300 = UIColor(red: 0.200, green: 0.000, blue: 0.553, alpha: 1) - public static let cpdColorPurple1200 = UIColor(red: 0.298, green: 0.020, blue: 0.710, alpha: 1) - public static let cpdColorPurple1100 = UIColor(red: 0.365, green: 0.149, blue: 0.804, alpha: 1) - public static let cpdColorPurple1000 = UIColor(red: 0.420, green: 0.216, blue: 0.871, alpha: 1) - public static let cpdColorPurple900 = UIColor(red: 0.478, green: 0.278, blue: 0.945, alpha: 1) - public static let cpdColorPurple800 = UIColor(red: 0.573, green: 0.443, blue: 0.992, alpha: 1) - public static let cpdColorPurple700 = UIColor(red: 0.694, green: 0.627, blue: 1.000, alpha: 1) - public static let cpdColorPurple600 = UIColor(red: 0.773, green: 0.733, blue: 1.000, alpha: 1) - public static let cpdColorPurple500 = UIColor(red: 0.831, green: 0.804, blue: 1.000, alpha: 1) - public static let cpdColorPurple400 = UIColor(red: 0.902, green: 0.886, blue: 1.000, alpha: 1) - public static let cpdColorPurple300 = UIColor(red: 0.945, green: 0.937, blue: 1.000, alpha: 1) - public static let cpdColorPurple200 = UIColor(red: 0.973, green: 0.969, blue: 1.000, alpha: 1) - public static let cpdColorPurple100 = UIColor(red: 0.984, green: 0.984, blue: 1.000, alpha: 1) - public static let cpdColorBlue1400 = UIColor(red: 0.000, green: 0.055, blue: 0.396, alpha: 1) - public static let cpdColorBlue1300 = UIColor(red: 0.004, green: 0.141, blue: 0.471, alpha: 1) - public static let cpdColorBlue1200 = UIColor(red: 0.016, green: 0.220, blue: 0.580, alpha: 1) - public static let cpdColorBlue1100 = UIColor(red: 0.024, green: 0.290, blue: 0.694, alpha: 1) - public static let cpdColorBlue1000 = UIColor(red: 0.020, green: 0.345, blue: 0.780, alpha: 1) - public static let cpdColorBlue900 = UIColor(red: 0.016, green: 0.404, blue: 0.867, alpha: 1) - public static let cpdColorBlue800 = UIColor(red: 0.251, green: 0.533, blue: 0.933, alpha: 1) - public static let cpdColorBlue700 = UIColor(red: 0.494, green: 0.686, blue: 0.965, alpha: 1) - public static let cpdColorBlue600 = UIColor(red: 0.639, green: 0.776, blue: 0.980, alpha: 1) - public static let cpdColorBlue500 = UIColor(red: 0.729, green: 0.835, blue: 0.988, alpha: 1) - public static let cpdColorBlue400 = UIColor(red: 0.847, green: 0.906, blue: 0.996, alpha: 1) - public static let cpdColorBlue300 = UIColor(red: 0.914, green: 0.949, blue: 1.000, alpha: 1) - public static let cpdColorBlue200 = UIColor(red: 0.957, green: 0.973, blue: 1.000, alpha: 1) - public static let cpdColorBlue100 = UIColor(red: 0.976, green: 0.988, blue: 1.000, alpha: 1) - public static let cpdColorCyan1400 = UIColor(red: 0.000, green: 0.098, blue: 0.310, alpha: 1) - public static let cpdColorCyan1300 = UIColor(red: 0.000, green: 0.169, blue: 0.380, alpha: 1) - public static let cpdColorCyan1200 = UIColor(red: 0.000, green: 0.251, blue: 0.467, alpha: 1) - public static let cpdColorCyan1100 = UIColor(red: 0.000, green: 0.329, blue: 0.549, alpha: 1) - public static let cpdColorCyan1000 = UIColor(red: 0.000, green: 0.384, blue: 0.612, alpha: 1) - public static let cpdColorCyan900 = UIColor(red: 0.000, green: 0.447, blue: 0.675, alpha: 1) - public static let cpdColorCyan800 = UIColor(red: 0.000, green: 0.580, blue: 0.753, alpha: 1) - public static let cpdColorCyan700 = UIColor(red: 0.082, green: 0.745, blue: 0.812, alpha: 1) - public static let cpdColorCyan600 = UIColor(red: 0.463, green: 0.820, blue: 0.867, alpha: 1) - public static let cpdColorCyan500 = UIColor(red: 0.608, green: 0.867, blue: 0.898, alpha: 1) - public static let cpdColorCyan400 = UIColor(red: 0.780, green: 0.925, blue: 0.941, alpha: 1) - public static let cpdColorCyan300 = UIColor(red: 0.890, green: 0.961, blue: 0.973, alpha: 1) - public static let cpdColorCyan200 = UIColor(red: 0.945, green: 0.980, blue: 0.984, alpha: 1) - public static let cpdColorCyan100 = UIColor(red: 0.973, green: 0.992, blue: 0.992, alpha: 1) - public static let cpdColorGreen1400 = UIColor(red: 0.000, green: 0.137, blue: 0.067, alpha: 1) - public static let cpdColorGreen1300 = UIColor(red: 0.000, green: 0.204, blue: 0.125, alpha: 1) - public static let cpdColorGreen1200 = UIColor(red: 0.000, green: 0.286, blue: 0.200, alpha: 1) - public static let cpdColorGreen1100 = UIColor(red: 0.000, green: 0.361, blue: 0.271, alpha: 1) - public static let cpdColorGreen1000 = UIColor(red: 0.000, green: 0.420, blue: 0.322, alpha: 1) - public static let cpdColorGreen900 = UIColor(red: 0.000, green: 0.478, blue: 0.380, alpha: 1) - public static let cpdColorGreen800 = UIColor(red: 0.000, green: 0.608, blue: 0.471, alpha: 1) - public static let cpdColorGreen700 = UIColor(red: 0.043, green: 0.769, blue: 0.569, alpha: 1) - public static let cpdColorGreen600 = UIColor(red: 0.443, green: 0.843, blue: 0.682, alpha: 1) - public static let cpdColorGreen500 = UIColor(red: 0.596, green: 0.882, blue: 0.757, alpha: 1) - public static let cpdColorGreen400 = UIColor(red: 0.776, green: 0.933, blue: 0.859, alpha: 1) - public static let cpdColorGreen300 = UIColor(red: 0.890, green: 0.969, blue: 0.929, alpha: 1) - public static let cpdColorGreen200 = UIColor(red: 0.945, green: 0.984, blue: 0.965, alpha: 1) - public static let cpdColorGreen100 = UIColor(red: 0.973, green: 0.992, blue: 0.984, alpha: 1) - public static let cpdColorLime1400 = UIColor(red: 0.000, green: 0.141, blue: 0.000, alpha: 1) - public static let cpdColorLime1300 = UIColor(red: 0.000, green: 0.212, blue: 0.000, alpha: 1) - public static let cpdColorLime1200 = UIColor(red: 0.000, green: 0.294, blue: 0.000, alpha: 1) - public static let cpdColorLime1100 = UIColor(red: 0.000, green: 0.373, blue: 0.000, alpha: 1) - public static let cpdColorLime1000 = UIColor(red: 0.000, green: 0.431, blue: 0.000, alpha: 1) - public static let cpdColorLime900 = UIColor(red: 0.098, green: 0.490, blue: 0.047, alpha: 1) - public static let cpdColorLime800 = UIColor(red: 0.208, green: 0.616, blue: 0.094, alpha: 1) - public static let cpdColorLime700 = UIColor(red: 0.329, green: 0.769, blue: 0.141, alpha: 1) - public static let cpdColorLime600 = UIColor(red: 0.463, green: 0.859, blue: 0.298, alpha: 1) - public static let cpdColorLime500 = UIColor(red: 0.600, green: 0.898, blue: 0.494, alpha: 1) - public static let cpdColorLime400 = UIColor(red: 0.784, green: 0.945, blue: 0.729, alpha: 1) - public static let cpdColorLime300 = UIColor(red: 0.878, green: 0.973, blue: 0.851, alpha: 1) - public static let cpdColorLime200 = UIColor(red: 0.945, green: 0.988, blue: 0.933, alpha: 1) - public static let cpdColorLime100 = UIColor(red: 0.973, green: 0.992, blue: 0.965, alpha: 1) - public static let cpdColorYellow1400 = UIColor(red: 0.255, green: 0.024, blue: 0.000, alpha: 1) - public static let cpdColorYellow1300 = UIColor(red: 0.329, green: 0.102, blue: 0.000, alpha: 1) - public static let cpdColorYellow1200 = UIColor(red: 0.412, green: 0.180, blue: 0.000, alpha: 1) - public static let cpdColorYellow1100 = UIColor(red: 0.502, green: 0.247, blue: 0.000, alpha: 1) - public static let cpdColorYellow1000 = UIColor(red: 0.561, green: 0.302, blue: 0.000, alpha: 1) - public static let cpdColorYellow900 = UIColor(red: 0.624, green: 0.357, blue: 0.000, alpha: 1) - public static let cpdColorYellow800 = UIColor(red: 0.745, green: 0.478, blue: 0.000, alpha: 1) - public static let cpdColorYellow700 = UIColor(red: 0.871, green: 0.635, blue: 0.000, alpha: 1) - public static let cpdColorYellow600 = UIColor(red: 0.945, green: 0.741, blue: 0.000, alpha: 1) - public static let cpdColorYellow500 = UIColor(red: 0.984, green: 0.808, blue: 0.000, alpha: 1) - public static let cpdColorYellow400 = UIColor(red: 1.000, green: 0.894, blue: 0.518, alpha: 1) - public static let cpdColorYellow300 = UIColor(red: 1.000, green: 0.949, blue: 0.757, alpha: 1) - public static let cpdColorYellow200 = UIColor(red: 1.000, green: 0.973, blue: 0.878, alpha: 1) - public static let cpdColorYellow100 = UIColor(red: 1.000, green: 0.988, blue: 0.941, alpha: 1) - public static let cpdColorOrange1400 = UIColor(red: 0.271, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange1300 = UIColor(red: 0.384, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange1200 = UIColor(red: 0.522, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange1100 = UIColor(red: 0.608, green: 0.133, blue: 0.000, alpha: 1) - public static let cpdColorOrange1000 = UIColor(red: 0.675, green: 0.200, blue: 0.000, alpha: 1) - public static let cpdColorOrange900 = UIColor(red: 0.737, green: 0.271, blue: 0.000, alpha: 1) - public static let cpdColorOrange800 = UIColor(red: 0.863, green: 0.404, blue: 0.000, alpha: 1) - public static let cpdColorOrange700 = UIColor(red: 0.973, green: 0.580, blue: 0.251, alpha: 1) - public static let cpdColorOrange600 = UIColor(red: 0.992, green: 0.702, blue: 0.486, alpha: 1) - public static let cpdColorOrange500 = UIColor(red: 1.000, green: 0.784, blue: 0.631, alpha: 1) - public static let cpdColorOrange400 = UIColor(red: 1.000, green: 0.875, blue: 0.784, alpha: 1) - public static let cpdColorOrange300 = UIColor(red: 1.000, green: 0.937, blue: 0.894, alpha: 1) - public static let cpdColorOrange200 = UIColor(red: 1.000, green: 0.965, blue: 0.937, alpha: 1) - public static let cpdColorOrange100 = UIColor(red: 1.000, green: 0.980, blue: 0.969, alpha: 1) - public static let cpdColorRed1400 = UIColor(red: 0.271, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed1300 = UIColor(red: 0.384, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed1200 = UIColor(red: 0.522, green: 0.000, blue: 0.024, alpha: 1) - public static let cpdColorRed1100 = UIColor(red: 0.643, green: 0.016, blue: 0.114, alpha: 1) - public static let cpdColorRed1000 = UIColor(red: 0.737, green: 0.059, blue: 0.133, alpha: 1) - public static let cpdColorRed900 = UIColor(red: 0.835, green: 0.098, blue: 0.157, alpha: 1) - public static let cpdColorRed800 = UIColor(red: 1.000, green: 0.239, blue: 0.239, alpha: 1) - public static let cpdColorRed700 = UIColor(red: 1.000, green: 0.549, blue: 0.506, alpha: 1) - public static let cpdColorRed600 = UIColor(red: 1.000, green: 0.686, blue: 0.647, alpha: 1) - public static let cpdColorRed500 = UIColor(red: 1.000, green: 0.773, blue: 0.737, alpha: 1) - public static let cpdColorRed400 = UIColor(red: 1.000, green: 0.875, blue: 0.855, alpha: 1) - public static let cpdColorRed300 = UIColor(red: 1.000, green: 0.937, blue: 0.925, alpha: 1) - public static let cpdColorRed200 = UIColor(red: 1.000, green: 0.969, blue: 0.965, alpha: 1) - public static let cpdColorRed100 = UIColor(red: 1.000, green: 0.980, blue: 0.976, alpha: 1) - public static let cpdColorGray1400 = UIColor(red: 0.059, green: 0.118, blue: 0.180, alpha: 1) - public static let cpdColorGray1300 = UIColor(red: 0.118, green: 0.180, blue: 0.247, alpha: 1) - public static let cpdColorGray1200 = UIColor(red: 0.184, green: 0.255, blue: 0.322, alpha: 1) - public static let cpdColorGray1100 = UIColor(red: 0.255, green: 0.322, blue: 0.396, alpha: 1) - public static let cpdColorGray1000 = UIColor(red: 0.302, green: 0.373, blue: 0.447, alpha: 1) - public static let cpdColorGray900 = UIColor(red: 0.357, green: 0.431, blue: 0.506, alpha: 1) - public static let cpdColorGray800 = UIColor(red: 0.475, green: 0.545, blue: 0.616, alpha: 1) - public static let cpdColorGray700 = UIColor(red: 0.635, green: 0.682, blue: 0.737, alpha: 1) - public static let cpdColorGray600 = UIColor(red: 0.737, green: 0.773, blue: 0.808, alpha: 1) - public static let cpdColorGray500 = UIColor(red: 0.800, green: 0.827, blue: 0.855, alpha: 1) - public static let cpdColorGray400 = UIColor(red: 0.886, green: 0.902, blue: 0.918, alpha: 1) - public static let cpdColorGray300 = UIColor(red: 0.933, green: 0.945, blue: 0.953, alpha: 1) - public static let cpdColorGray200 = UIColor(red: 0.969, green: 0.973, blue: 0.976, alpha: 1) - public static let cpdColorGray100 = UIColor(red: 0.984, green: 0.984, blue: 0.988, alpha: 1) - public static let cpdFontLetterSpacingHeadingXl = 1.2% - public static let cpdFontLetterSpacingHeadingLg = 1.4% - public static let cpdFontLetterSpacingHeadingMd = -1.2% - public static let cpdFontLetterSpacingHeadingSm = -2.3% - public static let cpdFontLetterSpacingBodyLg = -2.6% - public static let cpdFontLetterSpacingBodyMd = -1.6% - public static let cpdFontLetterSpacingBodySm = -0.6% - public static let cpdFontLetterSpacingBodyXs = 0 - public static let cpdFontSizeHeadingXl = 34 - public static let cpdFontSizeHeadingLg = 28 - public static let cpdFontSizeHeadingMd = 22 - public static let cpdFontSizeHeadingSm = 20 - public static let cpdFontSizeBodyLg = 17 - public static let cpdFontSizeBodyMd = 15 - public static let cpdFontSizeBodySm = 13 - public static let cpdFontSizeBodyXs = 12 - public static let cpdFontLineHeightHeadingXlRegular = 41 - public static let cpdFontLineHeightHeadingLgRegular = 34 - public static let cpdFontLineHeightHeadingMdRegular = 28 - public static let cpdFontLineHeightHeadingSmRegular = 25 - public static let cpdFontLineHeightBodyLgRegular = 22 - public static let cpdFontLineHeightBodyMdRegular = 20 - public static let cpdFontLineHeightBodySmRegular = 18 - public static let cpdFontLineHeightBodyXsRegular = 16 - public static let cpdFontWeightBold = 700 - public static let cpdFontWeightSemibold = 600 - public static let cpdFontWeightRegular = 400 - public static let cpdFontFamilyMono = SF Mono - public static let cpdFontFamilySans = SF Pro - public static let cpdBorderWidth0_5 = 0.5 - public static let cpdBorderWidth4 = 4 - public static let cpdBorderWidth2 = 2 - public static let cpdBorderWidth1 = 1 - public static let cpdSpace56X = 224 - public static let cpdSpace36X = 144 - public static let cpdSpace16X = 64 - public static let cpdSpace12X = 48 - public static let cpdSpace11X = 44 - public static let cpdSpace10X = 40 - public static let cpdSpace6X = 24 - public static let cpdSpace0X = 0 - public static let cpdSpaceScale = 4 - public static let cpdFontHeadingXlBold = [object Object] - public static let cpdFontHeadingXlRegular = [object Object] - public static let cpdFontHeadingLgBold = [object Object] - public static let cpdFontHeadingLgRegular = [object Object] - public static let cpdFontHeadingMdBold = [object Object] - public static let cpdFontHeadingMdRegular = [object Object] - public static let cpdFontHeadingSmSemibold = [object Object] - public static let cpdFontHeadingSmRegular = [object Object] - public static let cpdFontBodyLgSemibold = [object Object] - public static let cpdFontBodyLgRegular = [object Object] - public static let cpdFontBodyMdSemibold = [object Object] - public static let cpdFontBodyMdRegular = [object Object] - public static let cpdFontBodySmSemibold = [object Object] - public static let cpdFontBodySmRegular = [object Object] - public static let cpdFontBodyXsSemibold = [object Object] - public static let cpdFontBodyXsRegular = [object Object] - public static let cpdSpace64X = cpdSpaceScale * 64 - public static let cpdSpace48X = cpdSpaceScale * 48 - public static let cpdSpace40X = cpdSpaceScale * 40 - public static let cpdSpace32X = cpdSpaceScale * 32 - public static let cpdSpace28X = cpdSpaceScale * 28 - public static let cpdSpace24X = cpdSpaceScale * 24 - public static let cpdSpace20X = cpdSpaceScale * 20 - public static let cpdSpace15X = cpdSpaceScale * 15 - public static let cpdSpace14X = cpdSpaceScale * 14 - public static let cpdSpace13X = cpdSpaceScale * 13 - public static let cpdSpace9X = cpdSpaceScale * 9 - public static let cpdSpace8X = cpdSpaceScale * 8 - public static let cpdSpace7X = cpdSpaceScale * 7 - public static let cpdSpace5X = cpdSpaceScale * 5 - public static let cpdSpace4X = cpdSpaceScale * 4 - public static let cpdSpace3X = cpdSpaceScale * 3 - public static let cpdSpace2X = cpdSpaceScale * 2 - public static let cpdSpace1_5X = cpdSpaceScale * 1.5 - public static let cpdSpace1X = cpdSpaceScale - public static let cpdSpace0_5X = cpdSpaceScale * 0.5 -} diff --git a/assets/ios/swift/CpdLightHc.swift b/assets/ios/swift/CpdLightHc.swift deleted file mode 100644 index e2c0ea23..00000000 --- a/assets/ios/swift/CpdLightHc.swift +++ /dev/null @@ -1,241 +0,0 @@ - -// -// CpdLightHc.swift -// - -import UIKit - -public class CpdLightHcDesignTokens { - public static let cpdColorPink1400 = UIColor(red: 1.000, green: 0.906, blue: 0.925, alpha: 1) - public static let cpdColorPink1300 = UIColor(red: 1.000, green: 0.820, blue: 0.859, alpha: 1) - public static let cpdColorPink1200 = UIColor(red: 1.000, green: 0.671, blue: 0.741, alpha: 1) - public static let cpdColorPink1100 = UIColor(red: 0.996, green: 0.518, blue: 0.635, alpha: 1) - public static let cpdColorPink1000 = UIColor(red: 0.980, green: 0.392, blue: 0.561, alpha: 1) - public static let cpdColorPink900 = UIColor(red: 0.957, green: 0.255, blue: 0.490, alpha: 1) - public static let cpdColorPink800 = UIColor(red: 0.808, green: 0.094, blue: 0.396, alpha: 1) - public static let cpdColorPink700 = UIColor(red: 0.596, green: 0.067, blue: 0.310, alpha: 1) - public static let cpdColorPink600 = UIColor(red: 0.482, green: 0.047, blue: 0.255, alpha: 1) - public static let cpdColorPink500 = UIColor(red: 0.424, green: 0.000, blue: 0.208, alpha: 1) - public static let cpdColorPink400 = UIColor(red: 0.333, green: 0.000, blue: 0.141, alpha: 1) - public static let cpdColorPink300 = UIColor(red: 0.271, green: 0.000, blue: 0.094, alpha: 1) - public static let cpdColorPink200 = UIColor(red: 0.235, green: 0.000, blue: 0.071, alpha: 1) - public static let cpdColorPink100 = UIColor(red: 0.216, green: 0.000, blue: 0.059, alpha: 1) - public static let cpdColorFuchsia1400 = UIColor(red: 0.973, green: 0.910, blue: 0.976, alpha: 1) - public static let cpdColorFuchsia1300 = UIColor(red: 0.945, green: 0.831, blue: 0.953, alpha: 1) - public static let cpdColorFuchsia1200 = UIColor(red: 0.898, green: 0.694, blue: 0.914, alpha: 1) - public static let cpdColorFuchsia1100 = UIColor(red: 0.851, green: 0.565, blue: 0.871, alpha: 1) - public static let cpdColorFuchsia1000 = UIColor(red: 0.812, green: 0.471, blue: 0.843, alpha: 1) - public static let cpdColorFuchsia900 = UIColor(red: 0.773, green: 0.373, blue: 0.812, alpha: 1) - public static let cpdColorFuchsia800 = UIColor(red: 0.667, green: 0.212, blue: 0.729, alpha: 1) - public static let cpdColorFuchsia700 = UIColor(red: 0.490, green: 0.137, blue: 0.580, alpha: 1) - public static let cpdColorFuchsia600 = UIColor(red: 0.396, green: 0.090, blue: 0.490, alpha: 1) - public static let cpdColorFuchsia500 = UIColor(red: 0.337, green: 0.059, blue: 0.435, alpha: 1) - public static let cpdColorFuchsia400 = UIColor(red: 0.267, green: 0.000, blue: 0.361, alpha: 1) - public static let cpdColorFuchsia300 = UIColor(red: 0.216, green: 0.000, blue: 0.306, alpha: 1) - public static let cpdColorFuchsia200 = UIColor(red: 0.173, green: 0.000, blue: 0.259, alpha: 1) - public static let cpdColorFuchsia100 = UIColor(red: 0.157, green: 0.000, blue: 0.239, alpha: 1) - public static let cpdColorPurple1400 = UIColor(red: 0.933, green: 0.922, blue: 1.000, alpha: 1) - public static let cpdColorPurple1300 = UIColor(red: 0.871, green: 0.851, blue: 1.000, alpha: 1) - public static let cpdColorPurple1200 = UIColor(red: 0.769, green: 0.729, blue: 1.000, alpha: 1) - public static let cpdColorPurple1100 = UIColor(red: 0.678, green: 0.612, blue: 0.996, alpha: 1) - public static let cpdColorPurple1000 = UIColor(red: 0.620, green: 0.525, blue: 0.988, alpha: 1) - public static let cpdColorPurple900 = UIColor(red: 0.569, green: 0.439, blue: 0.976, alpha: 1) - public static let cpdColorPurple800 = UIColor(red: 0.471, green: 0.282, blue: 0.925, alpha: 1) - public static let cpdColorPurple700 = UIColor(red: 0.353, green: 0.153, blue: 0.776, alpha: 1) - public static let cpdColorPurple600 = UIColor(red: 0.286, green: 0.043, blue: 0.694, alpha: 1) - public static let cpdColorPurple500 = UIColor(red: 0.239, green: 0.000, blue: 0.620, alpha: 1) - public static let cpdColorPurple400 = UIColor(red: 0.173, green: 0.000, blue: 0.502, alpha: 1) - public static let cpdColorPurple300 = UIColor(red: 0.129, green: 0.000, blue: 0.408, alpha: 1) - public static let cpdColorPurple200 = UIColor(red: 0.110, green: 0.000, blue: 0.353, alpha: 1) - public static let cpdColorPurple100 = UIColor(red: 0.094, green: 0.000, blue: 0.314, alpha: 1) - public static let cpdColorBlue1400 = UIColor(red: 0.894, green: 0.933, blue: 0.996, alpha: 1) - public static let cpdColorBlue1300 = UIColor(red: 0.792, green: 0.871, blue: 0.988, alpha: 1) - public static let cpdColorBlue1200 = UIColor(red: 0.631, green: 0.769, blue: 0.973, alpha: 1) - public static let cpdColorBlue1100 = UIColor(red: 0.478, green: 0.671, blue: 0.957, alpha: 1) - public static let cpdColorBlue1000 = UIColor(red: 0.369, green: 0.600, blue: 0.941, alpha: 1) - public static let cpdColorBlue900 = UIColor(red: 0.255, green: 0.529, blue: 0.922, alpha: 1) - public static let cpdColorBlue800 = UIColor(red: 0.055, green: 0.404, blue: 0.847, alpha: 1) - public static let cpdColorBlue700 = UIColor(red: 0.043, green: 0.282, blue: 0.671, alpha: 1) - public static let cpdColorBlue600 = UIColor(red: 0.031, green: 0.220, blue: 0.565, alpha: 1) - public static let cpdColorBlue500 = UIColor(red: 0.024, green: 0.176, blue: 0.502, alpha: 1) - public static let cpdColorBlue400 = UIColor(red: 0.000, green: 0.114, blue: 0.431, alpha: 1) - public static let cpdColorBlue300 = UIColor(red: 0.000, green: 0.063, blue: 0.388, alpha: 1) - public static let cpdColorBlue200 = UIColor(red: 0.000, green: 0.035, blue: 0.365, alpha: 1) - public static let cpdColorBlue100 = UIColor(red: 0.000, green: 0.020, blue: 0.353, alpha: 1) - public static let cpdColorCyan1400 = UIColor(red: 0.851, green: 0.949, blue: 0.961, alpha: 1) - public static let cpdColorCyan1300 = UIColor(red: 0.722, green: 0.898, blue: 0.922, alpha: 1) - public static let cpdColorCyan1200 = UIColor(red: 0.463, green: 0.816, blue: 0.859, alpha: 1) - public static let cpdColorCyan1100 = UIColor(red: 0.129, green: 0.729, blue: 0.804, alpha: 1) - public static let cpdColorCyan1000 = UIColor(red: 0.004, green: 0.651, blue: 0.776, alpha: 1) - public static let cpdColorCyan900 = UIColor(red: 0.000, green: 0.576, blue: 0.745, alpha: 1) - public static let cpdColorCyan800 = UIColor(red: 0.008, green: 0.443, blue: 0.667, alpha: 1) - public static let cpdColorCyan700 = UIColor(red: 0.000, green: 0.318, blue: 0.533, alpha: 1) - public static let cpdColorCyan600 = UIColor(red: 0.000, green: 0.247, blue: 0.455, alpha: 1) - public static let cpdColorCyan500 = UIColor(red: 0.000, green: 0.204, blue: 0.408, alpha: 1) - public static let cpdColorCyan400 = UIColor(red: 0.000, green: 0.145, blue: 0.349, alpha: 1) - public static let cpdColorCyan300 = UIColor(red: 0.000, green: 0.106, blue: 0.306, alpha: 1) - public static let cpdColorCyan200 = UIColor(red: 0.000, green: 0.078, blue: 0.282, alpha: 1) - public static let cpdColorCyan100 = UIColor(red: 0.000, green: 0.067, blue: 0.267, alpha: 1) - public static let cpdColorGreen1400 = UIColor(red: 0.851, green: 0.953, blue: 0.906, alpha: 1) - public static let cpdColorGreen1300 = UIColor(red: 0.710, green: 0.910, blue: 0.820, alpha: 1) - public static let cpdColorGreen1200 = UIColor(red: 0.439, green: 0.835, blue: 0.678, alpha: 1) - public static let cpdColorGreen1100 = UIColor(red: 0.122, green: 0.753, blue: 0.565, alpha: 1) - public static let cpdColorGreen1000 = UIColor(red: 0.090, green: 0.675, blue: 0.518, alpha: 1) - public static let cpdColorGreen900 = UIColor(red: 0.071, green: 0.600, blue: 0.471, alpha: 1) - public static let cpdColorGreen800 = UIColor(red: 0.000, green: 0.475, blue: 0.380, alpha: 1) - public static let cpdColorGreen700 = UIColor(red: 0.000, green: 0.353, blue: 0.263, alpha: 1) - public static let cpdColorGreen600 = UIColor(red: 0.000, green: 0.282, blue: 0.196, alpha: 1) - public static let cpdColorGreen500 = UIColor(red: 0.000, green: 0.239, blue: 0.161, alpha: 1) - public static let cpdColorGreen400 = UIColor(red: 0.000, green: 0.180, blue: 0.106, alpha: 1) - public static let cpdColorGreen300 = UIColor(red: 0.000, green: 0.145, blue: 0.075, alpha: 1) - public static let cpdColorGreen200 = UIColor(red: 0.000, green: 0.122, blue: 0.055, alpha: 1) - public static let cpdColorGreen100 = UIColor(red: 0.000, green: 0.110, blue: 0.043, alpha: 1) - public static let cpdColorLime1400 = UIColor(red: 0.855, green: 0.965, blue: 0.816, alpha: 1) - public static let cpdColorLime1300 = UIColor(red: 0.714, green: 0.922, blue: 0.639, alpha: 1) - public static let cpdColorLime1200 = UIColor(red: 0.463, green: 0.851, blue: 0.302, alpha: 1) - public static let cpdColorLime1100 = UIColor(red: 0.337, green: 0.753, blue: 0.173, alpha: 1) - public static let cpdColorLime1000 = UIColor(red: 0.278, green: 0.678, blue: 0.149, alpha: 1) - public static let cpdColorLime900 = UIColor(red: 0.220, green: 0.608, blue: 0.125, alpha: 1) - public static let cpdColorLime800 = UIColor(red: 0.114, green: 0.486, blue: 0.075, alpha: 1) - public static let cpdColorLime700 = UIColor(red: 0.000, green: 0.361, blue: 0.000, alpha: 1) - public static let cpdColorLime600 = UIColor(red: 0.000, green: 0.290, blue: 0.000, alpha: 1) - public static let cpdColorLime500 = UIColor(red: 0.000, green: 0.243, blue: 0.000, alpha: 1) - public static let cpdColorLime400 = UIColor(red: 0.000, green: 0.184, blue: 0.000, alpha: 1) - public static let cpdColorLime300 = UIColor(red: 0.000, green: 0.145, blue: 0.000, alpha: 1) - public static let cpdColorLime200 = UIColor(red: 0.000, green: 0.118, blue: 0.000, alpha: 1) - public static let cpdColorLime100 = UIColor(red: 0.000, green: 0.106, blue: 0.000, alpha: 1) - public static let cpdColorYellow1400 = UIColor(red: 1.000, green: 0.929, blue: 0.690, alpha: 1) - public static let cpdColorYellow1300 = UIColor(red: 0.996, green: 0.859, blue: 0.322, alpha: 1) - public static let cpdColorYellow1200 = UIColor(red: 0.937, green: 0.733, blue: 0.043, alpha: 1) - public static let cpdColorYellow1100 = UIColor(red: 0.859, green: 0.624, blue: 0.000, alpha: 1) - public static let cpdColorYellow1000 = UIColor(red: 0.800, green: 0.549, blue: 0.000, alpha: 1) - public static let cpdColorYellow900 = UIColor(red: 0.733, green: 0.478, blue: 0.000, alpha: 1) - public static let cpdColorYellow800 = UIColor(red: 0.616, green: 0.357, blue: 0.000, alpha: 1) - public static let cpdColorYellow700 = UIColor(red: 0.482, green: 0.243, blue: 0.012, alpha: 1) - public static let cpdColorYellow600 = UIColor(red: 0.408, green: 0.180, blue: 0.012, alpha: 1) - public static let cpdColorYellow500 = UIColor(red: 0.357, green: 0.137, blue: 0.000, alpha: 1) - public static let cpdColorYellow400 = UIColor(red: 0.298, green: 0.078, blue: 0.000, alpha: 1) - public static let cpdColorYellow300 = UIColor(red: 0.255, green: 0.035, blue: 0.000, alpha: 1) - public static let cpdColorYellow200 = UIColor(red: 0.227, green: 0.012, blue: 0.000, alpha: 1) - public static let cpdColorYellow100 = UIColor(red: 0.212, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange1400 = UIColor(red: 1.000, green: 0.914, blue: 0.859, alpha: 1) - public static let cpdColorOrange1300 = UIColor(red: 1.000, green: 0.835, blue: 0.722, alpha: 1) - public static let cpdColorOrange1200 = UIColor(red: 0.984, green: 0.698, blue: 0.494, alpha: 1) - public static let cpdColorOrange1100 = UIColor(red: 0.965, green: 0.569, blue: 0.239, alpha: 1) - public static let cpdColorOrange1000 = UIColor(red: 0.918, green: 0.478, blue: 0.071, alpha: 1) - public static let cpdColorOrange900 = UIColor(red: 0.851, green: 0.404, blue: 0.051, alpha: 1) - public static let cpdColorOrange800 = UIColor(red: 0.725, green: 0.275, blue: 0.027, alpha: 1) - public static let cpdColorOrange700 = UIColor(red: 0.592, green: 0.129, blue: 0.020, alpha: 1) - public static let cpdColorOrange600 = UIColor(red: 0.510, green: 0.012, blue: 0.000, alpha: 1) - public static let cpdColorOrange500 = UIColor(red: 0.443, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange400 = UIColor(red: 0.345, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange300 = UIColor(red: 0.278, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange200 = UIColor(red: 0.235, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorOrange100 = UIColor(red: 0.220, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed1400 = UIColor(red: 1.000, green: 0.910, blue: 0.898, alpha: 1) - public static let cpdColorRed1300 = UIColor(red: 1.000, green: 0.827, blue: 0.804, alpha: 1) - public static let cpdColorRed1200 = UIColor(red: 1.000, green: 0.682, blue: 0.643, alpha: 1) - public static let cpdColorRed1100 = UIColor(red: 1.000, green: 0.529, blue: 0.482, alpha: 1) - public static let cpdColorRed1000 = UIColor(red: 1.000, green: 0.400, blue: 0.365, alpha: 1) - public static let cpdColorRed900 = UIColor(red: 0.992, green: 0.239, blue: 0.235, alpha: 1) - public static let cpdColorRed800 = UIColor(red: 0.816, green: 0.129, blue: 0.165, alpha: 1) - public static let cpdColorRed700 = UIColor(red: 0.620, green: 0.047, blue: 0.118, alpha: 1) - public static let cpdColorRed600 = UIColor(red: 0.514, green: 0.000, blue: 0.035, alpha: 1) - public static let cpdColorRed500 = UIColor(red: 0.443, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed400 = UIColor(red: 0.341, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed300 = UIColor(red: 0.278, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed200 = UIColor(red: 0.231, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorRed100 = UIColor(red: 0.216, green: 0.000, blue: 0.000, alpha: 1) - public static let cpdColorGray1400 = UIColor(red: 0.922, green: 0.929, blue: 0.941, alpha: 1) - public static let cpdColorGray1300 = UIColor(red: 0.851, green: 0.867, blue: 0.890, alpha: 1) - public static let cpdColorGray1200 = UIColor(red: 0.733, green: 0.765, blue: 0.804, alpha: 1) - public static let cpdColorGray1100 = UIColor(red: 0.624, green: 0.671, blue: 0.722, alpha: 1) - public static let cpdColorGray1000 = UIColor(red: 0.549, green: 0.604, blue: 0.667, alpha: 1) - public static let cpdColorGray900 = UIColor(red: 0.475, green: 0.537, blue: 0.608, alpha: 1) - public static let cpdColorGray800 = UIColor(red: 0.357, green: 0.427, blue: 0.498, alpha: 1) - public static let cpdColorGray700 = UIColor(red: 0.247, green: 0.314, blue: 0.384, alpha: 1) - public static let cpdColorGray600 = UIColor(red: 0.188, green: 0.251, blue: 0.318, alpha: 1) - public static let cpdColorGray500 = UIColor(red: 0.149, green: 0.212, blue: 0.275, alpha: 1) - public static let cpdColorGray400 = UIColor(red: 0.102, green: 0.161, blue: 0.224, alpha: 1) - public static let cpdColorGray300 = UIColor(red: 0.067, green: 0.125, blue: 0.184, alpha: 1) - public static let cpdColorGray200 = UIColor(red: 0.047, green: 0.106, blue: 0.161, alpha: 1) - public static let cpdColorGray100 = UIColor(red: 0.031, green: 0.090, blue: 0.145, alpha: 1) - public static let cpdFontLetterSpacingHeadingXl = 1.2% - public static let cpdFontLetterSpacingHeadingLg = 1.4% - public static let cpdFontLetterSpacingHeadingMd = -1.2% - public static let cpdFontLetterSpacingHeadingSm = -2.3% - public static let cpdFontLetterSpacingBodyLg = -2.6% - public static let cpdFontLetterSpacingBodyMd = -1.6% - public static let cpdFontLetterSpacingBodySm = -0.6% - public static let cpdFontLetterSpacingBodyXs = 0 - public static let cpdFontSizeHeadingXl = 34 - public static let cpdFontSizeHeadingLg = 28 - public static let cpdFontSizeHeadingMd = 22 - public static let cpdFontSizeHeadingSm = 20 - public static let cpdFontSizeBodyLg = 17 - public static let cpdFontSizeBodyMd = 15 - public static let cpdFontSizeBodySm = 13 - public static let cpdFontSizeBodyXs = 12 - public static let cpdFontLineHeightHeadingXlRegular = 41 - public static let cpdFontLineHeightHeadingLgRegular = 34 - public static let cpdFontLineHeightHeadingMdRegular = 28 - public static let cpdFontLineHeightHeadingSmRegular = 25 - public static let cpdFontLineHeightBodyLgRegular = 22 - public static let cpdFontLineHeightBodyMdRegular = 20 - public static let cpdFontLineHeightBodySmRegular = 18 - public static let cpdFontLineHeightBodyXsRegular = 16 - public static let cpdFontWeightBold = 700 - public static let cpdFontWeightSemibold = 600 - public static let cpdFontWeightRegular = 400 - public static let cpdFontFamilyMono = SF Mono - public static let cpdFontFamilySans = SF Pro - public static let cpdBorderWidth0_5 = 0.5 - public static let cpdBorderWidth4 = 4 - public static let cpdBorderWidth2 = 2 - public static let cpdBorderWidth1 = 1 - public static let cpdSpace56X = 224 - public static let cpdSpace36X = 144 - public static let cpdSpace16X = 64 - public static let cpdSpace12X = 48 - public static let cpdSpace11X = 44 - public static let cpdSpace10X = 40 - public static let cpdSpace6X = 24 - public static let cpdSpace0X = 0 - public static let cpdSpaceScale = 4 - public static let cpdFontHeadingXlBold = [object Object] - public static let cpdFontHeadingXlRegular = [object Object] - public static let cpdFontHeadingLgBold = [object Object] - public static let cpdFontHeadingLgRegular = [object Object] - public static let cpdFontHeadingMdBold = [object Object] - public static let cpdFontHeadingMdRegular = [object Object] - public static let cpdFontHeadingSmSemibold = [object Object] - public static let cpdFontHeadingSmRegular = [object Object] - public static let cpdFontBodyLgSemibold = [object Object] - public static let cpdFontBodyLgRegular = [object Object] - public static let cpdFontBodyMdSemibold = [object Object] - public static let cpdFontBodyMdRegular = [object Object] - public static let cpdFontBodySmSemibold = [object Object] - public static let cpdFontBodySmRegular = [object Object] - public static let cpdFontBodyXsSemibold = [object Object] - public static let cpdFontBodyXsRegular = [object Object] - public static let cpdSpace64X = cpdSpaceScale * 64 - public static let cpdSpace48X = cpdSpaceScale * 48 - public static let cpdSpace40X = cpdSpaceScale * 40 - public static let cpdSpace32X = cpdSpaceScale * 32 - public static let cpdSpace28X = cpdSpaceScale * 28 - public static let cpdSpace24X = cpdSpaceScale * 24 - public static let cpdSpace20X = cpdSpaceScale * 20 - public static let cpdSpace15X = cpdSpaceScale * 15 - public static let cpdSpace14X = cpdSpaceScale * 14 - public static let cpdSpace13X = cpdSpaceScale * 13 - public static let cpdSpace9X = cpdSpaceScale * 9 - public static let cpdSpace8X = cpdSpaceScale * 8 - public static let cpdSpace7X = cpdSpaceScale * 7 - public static let cpdSpace5X = cpdSpaceScale * 5 - public static let cpdSpace4X = cpdSpaceScale * 4 - public static let cpdSpace3X = cpdSpaceScale * 3 - public static let cpdSpace2X = cpdSpaceScale * 2 - public static let cpdSpace1_5X = cpdSpaceScale * 1.5 - public static let cpdSpace1X = cpdSpaceScale - public static let cpdSpace0_5X = cpdSpaceScale * 0.5 -} diff --git a/package.json b/package.json index 9161b158..6037a853 100644 --- a/package.json +++ b/package.json @@ -28,7 +28,9 @@ }, "devDependencies": { "@tokens-studio/sd-transforms": "^0.3.1", + "@types/fs-extra": "^11.0.1", "@types/lodash": "^4.14.191", + "@types/node": "^18.13.0", "fast-glob": "^3.2.12", "http-server": "^14.1.1", "style-dictionary": "^3.7.2", diff --git a/src/actions/swift/colorset.ts b/src/actions/swift/colorset.ts new file mode 100644 index 00000000..f7d1b18d --- /dev/null +++ b/src/actions/swift/colorset.ts @@ -0,0 +1,176 @@ +/* +Copyright 2023 The Matrix.org Foundation C.I.C. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +import StyleDictionary from "style-dictionary"; +import fs from "fs-extra"; +import { Theme } from "../../@types"; +import { TransformedToken } from "style-dictionary/types/TransformedToken"; +import isCoreColor from "../../filters/isCoreColor"; + +/** + * Filter the core color + */ +export default { + do(dictionary, platform): void { + const assetPath = `${platform.buildPath}/Compound.xcassets`; + // TODO: Find a better way to do this. We rely on the `light` theme being + // the first one in the list... + if (platform.options!.theme === "light") { + fs.rmSync(assetPath, { recursive: true }); + fs.ensureDirSync(assetPath); + // We need an empty `Contents.json` file at the root of the xcassets folder + // and another one in each colorset folder too + fs.writeFileSync( + assetPath + "/Contents.json", + JSON.stringify(contents), + "utf8" + ); + } else { + fs.ensureDirSync(assetPath); + } + + /** + * We're only interested in creating colorset for the core tokens. All the + * other tokens will be defined on a more semantic layer and will reference + * the values from the colorset + */ + const coreColorTokens = dictionary.allProperties.filter( + (token: TransformedToken) => { + return ( + isCoreColor.matcher(token) && + !dictionary.usesReference(token.original.value) + ); + } + ); + + for (const coreColor of coreColorTokens) { + const colorsetPath = `${assetPath}/${coreColor.name}.colorset`; + fs.ensureDirSync(colorsetPath); + + const colorset = getOrCreateColorset(colorsetPath + "/Contents.json"); + + const color: { + idiom: string; + appearances?: ColorSetAppearance[]; + color: SRGBColor; + } = { + idiom: "universal", + appearances: getAppearances(platform.options!.theme), + color: { + "color-space": `srgb`, + components: getSRGBComponent(coreColor.attributes!.rgb), + /** + * The `theme` is not a `style-dictionary` value, but an option we pass + * on the iOS config. They refer to the compound themes + */ + }, + }; + if (color.appearances!.length === 0) { + delete color.appearances; + } + + colorset.colors.push(color); + + fs.writeFileSync( + `${colorsetPath}/Contents.json`, + JSON.stringify(colorset, null, 2) + ); + } + }, + undo(dictionary, platform): void { + const assetPath = `${platform.buildPath}/Compound.xcassets`; + // TODO: Find a better way to do this. We rely on the `light` theme being + // the first one in the list... + if (platform.options!.theme === "light") { + fs.rmSync(assetPath, { recursive: true }); + } + }, +} as StyleDictionary.Action; + +type ColorSetAppearance = { + appearance: string; + value: string; +}; + +type SRGBColor = { + "color-space": "srgb"; + components: { + alpha: string; + red: string; + green: string; + blue: string; + }; +}; + +function getAppearances(theme: Theme): ColorSetAppearance[] { + const appearances: ColorSetAppearance[] = []; + + if (theme.startsWith("dark")) { + appearances.push({ + appearance: "luminosity", + value: "dark", + }); + } + + if (theme.endsWith("-hc")) { + appearances.push({ + appearance: "contrast", + value: "high", + }); + } + + return appearances; +} + +function getOrCreateColorset(path: string): any { + let colorset; + try { + colorset = JSON.parse(fs.readFileSync(path, "utf8")); + } catch (e) {} + + return ( + colorset ?? { + colors: [], + ...contents, + } + ); +} + +const contents = { + info: { + author: "xcode", + version: 1, + }, +}; + +const getSRGBComponent = ({ + a, + r, + g, + b, +}: { + a: number; + r: number; + g: number; + b: number; +}): SRGBColor["components"] => { + return { + alpha: (a / 255).toFixed(4).toString(), + red: (r / 255).toFixed(4).toString(), + green: (g / 255).toFixed(4).toString(), + blue: (b / 255).toFixed(4).toString(), + }; +}; diff --git a/src/configs/getIOSConfig.ts b/src/configs/getIOSConfig.ts index c160cff7..086d6b1e 100644 --- a/src/configs/getIOSConfig.ts +++ b/src/configs/getIOSConfig.ts @@ -15,29 +15,38 @@ limitations under the License. */ import { Platform } from "style-dictionary/types/Platform"; -import { COMPOUND_TOKENS_NAMESPACE } from "./utils"; import { Theme } from "../@types"; import _ from "lodash"; export default function getIOSConfig(theme: Theme): Platform { return { - prefix: COMPOUND_TOKENS_NAMESPACE, - transforms: ["attribute/cti", "color/UIColorSwift", "camelCaseDecimal"], + transforms: [ + "attribute/cti", + "attribute/color", + "font/swift/literal", + "swift/pxToCGFloat", + "swift/toFontWeight", + "swift/coreColorSet", + "camelCaseDecimal", + "ts/resolveMath", + ], + options: { + theme, + }, + actions: ["ios/colorset"], buildPath: `assets/ios/swift/`, files: [ { + filter: "ios/exclude", destination: `${_.upperFirst( - _.camelCase(COMPOUND_TOKENS_NAMESPACE + " " + theme) + _.camelCase(`Compound ${theme} DesignTokens`) )}.swift`, format: "ios-swift/class.swift", options: { showFileHeader: false, outputReferences: true, }, - className: - _.upperFirst(COMPOUND_TOKENS_NAMESPACE) + - _.upperFirst(_.camelCase(theme)) + - "DesignTokens", + className: `Compound${_.upperFirst(_.camelCase(theme))}DesignTokens`, }, ], }; diff --git a/src/configs/getWebConfig.ts b/src/configs/getWebConfig.ts index aa3d1f2a..78441e5c 100644 --- a/src/configs/getWebConfig.ts +++ b/src/configs/getWebConfig.ts @@ -15,11 +15,12 @@ limitations under the License. */ import { Platform } from "style-dictionary/types/Platform"; -import { COMPOUND_TOKENS_NAMESPACE } from "./utils"; import { Theme } from "../@types"; import { File } from "style-dictionary/types/File"; import _ from "lodash"; +const COMPOUND_TOKENS_NAMESPACE = "cpd"; + export default function (target: "js" | "css", theme: Theme): Platform { if (target !== "css" && target !== "js") { throw `Unsupport web platform: ${target}`; diff --git a/src/configs/index.ts b/src/configs/index.ts index 704754db..a108a8ac 100644 --- a/src/configs/index.ts +++ b/src/configs/index.ts @@ -22,8 +22,6 @@ import getAndroidConfig from "./getAndroidConfig"; import getIOSConfig from "./getIOSConfig"; import getWebConfig from "./getWebConfig"; -export const COMPOUND_TOKENS_NAMESPACE = "cpd"; - export function getStyleDictionaryConfig( theme: Theme, platform: Platform diff --git a/src/filters/ios/exclude.ts b/src/filters/ios/exclude.ts new file mode 100644 index 00000000..b6c3086b --- /dev/null +++ b/src/filters/ios/exclude.ts @@ -0,0 +1,32 @@ +/* +Copyright 2023 The Matrix.org Foundation C.I.C. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +import StyleDictionary from "style-dictionary"; +import { TransformedToken } from "style-dictionary/types/TransformedToken"; + +/** + * Excluded tokens in the iOS bundle + */ +export default { + name: "ios/exclude", + matcher: function (token: TransformedToken): boolean { + const attrs = token.attributes ?? {}; + const isTypography = token.type === "typography"; + const isLetterSpacing = + attrs.category === "font" && attrs.type === "letter-spacing"; + return !isTypography && !isLetterSpacing; + }, +} as StyleDictionary.Filter; diff --git a/src/configs/utils.ts b/src/filters/isCoreColor.ts similarity index 58% rename from src/configs/utils.ts rename to src/filters/isCoreColor.ts index 1f9e0803..1d8732c1 100644 --- a/src/configs/utils.ts +++ b/src/filters/isCoreColor.ts @@ -14,4 +14,16 @@ See the License for the specific language governing permissions and limitations under the License. */ -export const COMPOUND_TOKENS_NAMESPACE = "cpd"; +import StyleDictionary from "style-dictionary"; +import { TransformedToken } from "style-dictionary/types/TransformedToken"; +import isCoreToken from "./isCoreToken"; + +/** + * Filter the core color + */ +export default { + name: "isCoreColor", + matcher: function (token: TransformedToken): boolean { + return isCoreToken.matcher(token) && token.attributes?.category === "color"; + }, +} as StyleDictionary.Filter; diff --git a/src/filters/isCoreToken.ts b/src/filters/isCoreToken.ts new file mode 100644 index 00000000..62c2b8e8 --- /dev/null +++ b/src/filters/isCoreToken.ts @@ -0,0 +1,32 @@ +/* +Copyright 2023 The Matrix.org Foundation C.I.C. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +import StyleDictionary from "style-dictionary"; +import { TransformedToken } from "style-dictionary/types/TransformedToken"; + +/** + * Filter the core tokens + */ +export default { + name: "isCoreToken", + matcher: function (token: TransformedToken): boolean { + /** + * all tokens that are not in the semantics files are "core" and should + * only be used directly under rare occasions + */ + return token.filePath.indexOf("theme-semantics") < 0; + }, +} as StyleDictionary.Filter; diff --git a/src/setupStyleDictionary.ts b/src/setupStyleDictionary.ts index 9fad223b..f7d95517 100644 --- a/src/setupStyleDictionary.ts +++ b/src/setupStyleDictionary.ts @@ -20,14 +20,20 @@ import { Transform } from "style-dictionary/types/Transform"; import { registerTransforms } from "@tokens-studio/sd-transforms"; import camelCaseDecimal from "./transforms/camelCaseDecimal"; +import pxToCGFloat from "./transforms/swift/pxToCGFloat"; +import toFontWeight from "./transforms/swift/toFontWeight"; import { getStyleDictionaryConfig } from "./configs"; import { Platform, Theme } from "./@types"; +import colorset from "./actions/swift/colorset"; +import { Action } from "style-dictionary/types/Action"; import fontWeight from "./transforms/kotlin/fontWeight"; import literal from "./transforms/kotlin/literal"; import typography from "./transforms/kotlin/typography"; import pxToDp from "./transforms/kotlin/pxToDp"; import pxToSp from "./transforms/kotlin/pxToSp"; import percentageToEm from "./transforms/kotlin/percentageToEm"; +import coreColorSet from "./transforms/swift/coreColorSet"; +import iosExclude from "./filters/ios/exclude"; export default async function (theme: Theme, platform: Platform) { const sb = StyleDictionary.extend(getStyleDictionaryConfig(theme, platform)); @@ -36,6 +42,24 @@ export default async function (theme: Theme, platform: Platform) { name: "camelCaseDecimal", ...camelCaseDecimal, } as Named); + sb.registerTransform({ + name: "swift/pxToCGFloat", + ...pxToCGFloat, + } as Named); + sb.registerTransform({ + name: "swift/toFontWeight", + ...toFontWeight, + } as Named); + sb.registerTransform({ + name: "swift/coreColorSet", + ...coreColorSet, + } as Named); + + sb.registerAction({ + name: "ios/colorset", + ...colorset, + } as Named); + sb.registerTransform({ name: "kotlin/fontWeight", ...fontWeight, @@ -60,5 +84,8 @@ export default async function (theme: Theme, platform: Platform) { name: "kotlin/typography/shorthand", ...typography, } as Named); + + sb.registerFilter(iosExclude); + return sb; } diff --git a/src/transforms/camelCaseDecimal.ts b/src/transforms/camelCaseDecimal.ts index e5ebefae..a8387131 100644 --- a/src/transforms/camelCaseDecimal.ts +++ b/src/transforms/camelCaseDecimal.ts @@ -17,6 +17,7 @@ limitations under the License. import { Platform } from "style-dictionary/types/Platform"; import { TransformedToken } from "style-dictionary/types/TransformedToken"; import { camelCase } from "lodash"; +import { Transform } from "style-dictionary/types/Transform"; /** * A transformer to change tokens.0_5x and keep the underscore @@ -29,4 +30,4 @@ export default { const name = [options.prefix].concat(token.path).join(" "); return camelCase(name.replaceAll("_", underscore)).replace(underscore, "_"); }, -}; +} as Transform; diff --git a/src/transforms/swift/coreColorSet.ts b/src/transforms/swift/coreColorSet.ts new file mode 100644 index 00000000..cfb67583 --- /dev/null +++ b/src/transforms/swift/coreColorSet.ts @@ -0,0 +1,32 @@ +/* +Copyright 2023 The Matrix.org Foundation C.I.C. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +import _ from "lodash"; +import { Transform } from "style-dictionary/types/Transform"; +import { TransformedToken } from "style-dictionary/types/TransformedToken"; +import isCoreColor from "../../filters/isCoreColor"; + +/** + * A transformer to change tokens.0_5x and keep the underscore + * after a camel case operation + */ +export default { + type: "value", + matcher: isCoreColor.matcher, + transformer: function (token: TransformedToken) { + return `Color("${_.camelCase(token.path.join(" "))}")`; + }, +} as Transform; diff --git a/src/transforms/swift/pxToCGFloat.ts b/src/transforms/swift/pxToCGFloat.ts new file mode 100644 index 00000000..931487c2 --- /dev/null +++ b/src/transforms/swift/pxToCGFloat.ts @@ -0,0 +1,38 @@ +/* +Copyright 2023 The Matrix.org Foundation C.I.C. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +import { Transform } from "style-dictionary/types/Transform"; +import { TransformedToken } from "style-dictionary/types/TransformedToken"; + +/** + * A transformer to change tokens.0_5x and keep the underscore + * after a camel case operation + */ +export default { + type: "value", + matcher: (token: TransformedToken) => { + const attrs = token.attributes ?? {}; + return ( + attrs.category === "space" || + (attrs.category === "border" && attrs.type === "width") || + (attrs.category === "font" && attrs.type === "line-height") || + (attrs.category === "font" && attrs.type === "size") + ); + }, + transformer: function (token: TransformedToken): string { + return `CGFloat(${token.value.replaceAll('"', "")})`; + }, +} as Transform; diff --git a/src/transforms/swift/toFontWeight.ts b/src/transforms/swift/toFontWeight.ts new file mode 100644 index 00000000..b734665a --- /dev/null +++ b/src/transforms/swift/toFontWeight.ts @@ -0,0 +1,41 @@ +/* +Copyright 2023 The Matrix.org Foundation C.I.C. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +import { Transform } from "style-dictionary/types/Transform"; +import { TransformedToken } from "style-dictionary/types/TransformedToken"; + +/** + * A transformer to weight values to UIKit `Font.Weight` + * https://developer.apple.com/documentation/swiftui/font/weight + */ +export default { + type: "value", + matcher: (token: TransformedToken) => { + const attrs = token.attributes ?? {}; + return attrs.category === "font" && attrs.type === "weight"; + }, + transformer: function (token: TransformedToken): string { + switch (token.value) { + case "700": + return "Font.Weight.bold"; + case "600": + return "Font.Weight.semibold"; + case "400": + default: + return "Font.Weight.regular"; + } + }, +} as Transform; diff --git a/tokens/platform-ios.json b/tokens/platform-ios.json index f47173c9..ed583379 100644 --- a/tokens/platform-ios.json +++ b/tokens/platform-ios.json @@ -335,4 +335,4 @@ } } } -} \ No newline at end of file +} diff --git a/tokens/theme-dark.json b/tokens/theme-dark.json index e7081c90..edb00ee9 100644 --- a/tokens/theme-dark.json +++ b/tokens/theme-dark.json @@ -793,4 +793,4 @@ } } } -} \ No newline at end of file +} diff --git a/yarn.lock b/yarn.lock index 67f71bc4..01275c73 100644 --- a/yarn.lock +++ b/yarn.lock @@ -4,24 +4,24 @@ "@cspotcode/source-map-support@^0.8.0": version "0.8.1" - resolved "https://registry.yarnpkg.com/@cspotcode/source-map-support/-/source-map-support-0.8.1.tgz#00629c35a688e05a88b1cda684fb9d5e73f000a1" + resolved "https://registry.npmjs.org/@cspotcode/source-map-support/-/source-map-support-0.8.1.tgz" integrity sha512-IchNf6dN4tHoMFIn/7OE8LWZ19Y6q/67Bmf6vnGREv8RSbBVb9LPJxEcnwrcwX6ixSvaiGoomAUvu4YSxXrVgw== dependencies: "@jridgewell/trace-mapping" "0.3.9" "@jridgewell/resolve-uri@^3.0.3": version "3.1.0" - resolved "https://registry.yarnpkg.com/@jridgewell/resolve-uri/-/resolve-uri-3.1.0.tgz#2203b118c157721addfe69d47b70465463066d78" + resolved "https://registry.npmjs.org/@jridgewell/resolve-uri/-/resolve-uri-3.1.0.tgz" integrity sha512-F2msla3tad+Mfht5cJq7LSXcdudKTWCVYUgw6pLFOOHSTtZlj6SWNYAp+AhuqLmWdBO2X5hPrLcu8cVP8fy28w== "@jridgewell/sourcemap-codec@^1.4.10": version "1.4.14" - resolved "https://registry.yarnpkg.com/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.4.14.tgz#add4c98d341472a289190b424efbdb096991bb24" + resolved "https://registry.npmjs.org/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.4.14.tgz" integrity sha512-XPSJHWmi394fuUuzDnGz1wiKqWfo1yXecHQMRf2l6hztTO+nPru658AyDngaBe7isIxEkRsPR3FZh+s7iVa4Uw== "@jridgewell/trace-mapping@0.3.9": version "0.3.9" - resolved "https://registry.yarnpkg.com/@jridgewell/trace-mapping/-/trace-mapping-0.3.9.tgz#6534fd5933a53ba7cbf3a17615e273a0d1273ff9" + resolved "https://registry.npmjs.org/@jridgewell/trace-mapping/-/trace-mapping-0.3.9.tgz" integrity sha512-3Belt6tdc8bPgAtbcmdtNJlirVoTmEb5e2gC94PnkwEW9jI6CAHUeoG85tjWP5WquqfavoMtMwiG4P926ZKKuQ== dependencies: "@jridgewell/resolve-uri" "^3.0.3" @@ -29,7 +29,7 @@ "@nodelib/fs.scandir@2.1.5": version "2.1.5" - resolved "https://registry.yarnpkg.com/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz#7619c2eb21b25483f6d167548b4cfd5a7488c3d5" + resolved "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz" integrity sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g== dependencies: "@nodelib/fs.stat" "2.0.5" @@ -37,12 +37,12 @@ "@nodelib/fs.stat@2.0.5", "@nodelib/fs.stat@^2.0.2": version "2.0.5" - resolved "https://registry.yarnpkg.com/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz#5bd262af94e9d25bd1e71b05deed44876a222e8b" + resolved "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz" integrity sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A== "@nodelib/fs.walk@^1.2.3": version "1.2.8" - resolved "https://registry.yarnpkg.com/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz#e95737e8bb6746ddedf69c556953494f196fe69a" + resolved "https://registry.npmjs.org/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz" integrity sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg== dependencies: "@nodelib/fs.scandir" "2.1.5" @@ -50,7 +50,7 @@ "@tokens-studio/sd-transforms@^0.3.1": version "0.3.1" - resolved "https://registry.yarnpkg.com/@tokens-studio/sd-transforms/-/sd-transforms-0.3.1.tgz#71b2cb4a71f97bd6088fa43da25921e8d58a7bd8" + resolved "https://registry.npmjs.org/@tokens-studio/sd-transforms/-/sd-transforms-0.3.1.tgz" integrity sha512-F5l/gjDr8km/Tuvk98rXyakJg/8p9R3slLSGB74fjYzGEuMtozRJyGWyeI0+kFgzwUj/mdB4Rb856Zr2LATvLw== dependencies: color2k "^2.0.1" @@ -60,73 +60,98 @@ "@tsconfig/node10@^1.0.7": version "1.0.9" - resolved "https://registry.yarnpkg.com/@tsconfig/node10/-/node10-1.0.9.tgz#df4907fc07a886922637b15e02d4cebc4c0021b2" + resolved "https://registry.npmjs.org/@tsconfig/node10/-/node10-1.0.9.tgz" integrity sha512-jNsYVVxU8v5g43Erja32laIDHXeoNvFEpX33OK4d6hljo3jDhCBDhx5dhCCTMWUojscpAagGiRkBKxpdl9fxqA== "@tsconfig/node12@^1.0.7": version "1.0.11" - resolved "https://registry.yarnpkg.com/@tsconfig/node12/-/node12-1.0.11.tgz#ee3def1f27d9ed66dac6e46a295cffb0152e058d" + resolved "https://registry.npmjs.org/@tsconfig/node12/-/node12-1.0.11.tgz" integrity sha512-cqefuRsh12pWyGsIoBKJA9luFu3mRxCA+ORZvA4ktLSzIuCUtWVxGIuXigEwO5/ywWFMZ2QEGKWvkZG1zDMTag== "@tsconfig/node14@^1.0.0": version "1.0.3" - resolved "https://registry.yarnpkg.com/@tsconfig/node14/-/node14-1.0.3.tgz#e4386316284f00b98435bf40f72f75a09dabf6c1" + resolved "https://registry.npmjs.org/@tsconfig/node14/-/node14-1.0.3.tgz" integrity sha512-ysT8mhdixWK6Hw3i1V2AeRqZ5WfXg1G43mqoYlM2nc6388Fq5jcXyr5mRsqViLx/GJYdoL0bfXD8nmF+Zn/Iow== "@tsconfig/node16@^1.0.2": version "1.0.3" - resolved "https://registry.yarnpkg.com/@tsconfig/node16/-/node16-1.0.3.tgz#472eaab5f15c1ffdd7f8628bd4c4f753995ec79e" + resolved "https://registry.npmjs.org/@tsconfig/node16/-/node16-1.0.3.tgz" integrity sha512-yOlFc+7UtL/89t2ZhjPvvB/DeAr3r+Dq58IgzsFkOAvVC6NMJXmCGjbptdXdR9qsX7pKcTL+s87FtYREi2dEEQ== +"@types/fs-extra@^11.0.1": + version "11.0.1" + resolved "https://registry.yarnpkg.com/@types/fs-extra/-/fs-extra-11.0.1.tgz#f542ec47810532a8a252127e6e105f487e0a6ea5" + integrity sha512-MxObHvNl4A69ofaTRU8DFqvgzzv8s9yRtaPPm5gud9HDNvpB3GPQFvNuTWAI59B9huVGV5jXYJwbCsmBsOGYWA== + dependencies: + "@types/jsonfile" "*" + "@types/node" "*" + +"@types/jsonfile@*": + version "6.1.1" + resolved "https://registry.npmjs.org/@types/jsonfile/-/jsonfile-6.1.1.tgz" + integrity sha512-GSgiRCVeapDN+3pqA35IkQwasaCh/0YFH5dEF6S88iDvEn901DjOeH3/QPY+XYP1DFzDZPvIvfeEgk+7br5png== + dependencies: + "@types/node" "*" + "@types/lodash@^4.14.191": version "4.14.191" - resolved "https://registry.yarnpkg.com/@types/lodash/-/lodash-4.14.191.tgz#09511e7f7cba275acd8b419ddac8da9a6a79e2fa" + resolved "https://registry.npmjs.org/@types/lodash/-/lodash-4.14.191.tgz" integrity sha512-BdZ5BCCvho3EIXw6wUCXHe7rS53AIDPLE+JzwgT+OsJk53oBfbSmZZ7CX4VaRoN78N+TJpFi9QPlfIVNmJYWxQ== +"@types/node@*": + version "18.13.0" + resolved "https://registry.npmjs.org/@types/node/-/node-18.13.0.tgz" + integrity sha512-gC3TazRzGoOnoKAhUx+Q0t8S9Tzs74z7m0ipwGpSqQrleP14hKxP4/JUeEQcD3W1/aIpnWl8pHowI7WokuZpXg== + +"@types/node@^18.13.0": + version "18.13.0" + resolved "https://registry.yarnpkg.com/@types/node/-/node-18.13.0.tgz#0400d1e6ce87e9d3032c19eb6c58205b0d3f7850" + integrity sha512-gC3TazRzGoOnoKAhUx+Q0t8S9Tzs74z7m0ipwGpSqQrleP14hKxP4/JUeEQcD3W1/aIpnWl8pHowI7WokuZpXg== + acorn-walk@^8.1.1: version "8.2.0" - resolved "https://registry.yarnpkg.com/acorn-walk/-/acorn-walk-8.2.0.tgz#741210f2e2426454508853a2f44d0ab83b7f69c1" + resolved "https://registry.npmjs.org/acorn-walk/-/acorn-walk-8.2.0.tgz" integrity sha512-k+iyHEuPgSw6SbuDpGQM+06HQUa04DZ3o+F6CSzXMvvI5KMvnaEqXe+YVe555R9nn6GPt404fos4wcgpw12SDA== acorn@^8.4.1: version "8.8.2" - resolved "https://registry.yarnpkg.com/acorn/-/acorn-8.8.2.tgz#1b2f25db02af965399b9776b0c2c391276d37c4a" + resolved "https://registry.npmjs.org/acorn/-/acorn-8.8.2.tgz" integrity sha512-xjIYgE8HBrkpd/sJqOGNspf8uHG+NOHGOw6a/Urj8taM2EXfdNAH2oFcPeIFfsv3+kz/mJrS5VuMqbNLjCa2vw== ansi-styles@^4.1.0: version "4.3.0" - resolved "https://registry.yarnpkg.com/ansi-styles/-/ansi-styles-4.3.0.tgz#edd803628ae71c04c85ae7a0906edad34b648937" + resolved "https://registry.npmjs.org/ansi-styles/-/ansi-styles-4.3.0.tgz" integrity sha512-zbB9rCJAT1rbjiVDb2hqKFHNYLxgtk8NURxZ3IZwD3F6NtxbXZQCnnSi1Lkx+IDohdPlFp222wVALIheZJQSEg== dependencies: color-convert "^2.0.1" arg@^4.1.0: version "4.1.3" - resolved "https://registry.yarnpkg.com/arg/-/arg-4.1.3.tgz#269fc7ad5b8e42cb63c896d5666017261c144089" + resolved "https://registry.npmjs.org/arg/-/arg-4.1.3.tgz" integrity sha512-58S9QDqG0Xx27YwPSt9fJxivjYl432YCwfDMfZ+71RAqUrZef7LrKQZ3LHLOwCS4FLNBplP533Zx895SeOCHvA== async@^2.6.4: version "2.6.4" - resolved "https://registry.yarnpkg.com/async/-/async-2.6.4.tgz#706b7ff6084664cd7eae713f6f965433b5504221" + resolved "https://registry.npmjs.org/async/-/async-2.6.4.tgz" integrity sha512-mzo5dfJYwAn29PeiJ0zvwTo04zj8HDJj0Mn8TD7sno7q12prdbnasKJHhkm2c1LgrhlJ0teaea8860oxi51mGA== dependencies: lodash "^4.17.14" balanced-match@^1.0.0: version "1.0.2" - resolved "https://registry.yarnpkg.com/balanced-match/-/balanced-match-1.0.2.tgz#e83e3a7e3f300b34cb9d87f615fa0cbf357690ee" + resolved "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz" integrity sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw== basic-auth@^2.0.1: version "2.0.1" - resolved "https://registry.yarnpkg.com/basic-auth/-/basic-auth-2.0.1.tgz#b998279bf47ce38344b4f3cf916d4679bbf51e3a" + resolved "https://registry.npmjs.org/basic-auth/-/basic-auth-2.0.1.tgz" integrity sha512-NF+epuEdnUYVlGuhaxbbq+dvJttwLnGY+YixlXlME5KpQ5W3CnXA5cVTneY3SPbPDRkcjMbifrwmFYcClgOZeg== dependencies: safe-buffer "5.1.2" brace-expansion@^1.1.7: version "1.1.11" - resolved "https://registry.yarnpkg.com/brace-expansion/-/brace-expansion-1.1.11.tgz#3c7fcbf529d87226f3d2f52b966ff5271eb441dd" + resolved "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz" integrity sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA== dependencies: balanced-match "^1.0.0" @@ -134,14 +159,14 @@ brace-expansion@^1.1.7: braces@^3.0.2: version "3.0.2" - resolved "https://registry.yarnpkg.com/braces/-/braces-3.0.2.tgz#3454e1a462ee8d599e236df336cd9ea4f8afe107" + resolved "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz" integrity sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A== dependencies: fill-range "^7.0.1" call-bind@^1.0.0: version "1.0.2" - resolved "https://registry.yarnpkg.com/call-bind/-/call-bind-1.0.2.tgz#b1d4e89e688119c3c9a903ad30abb2f6a919be3c" + resolved "https://registry.npmjs.org/call-bind/-/call-bind-1.0.2.tgz" integrity sha512-7O+FbCihrB5WGbFYesctwmTKae6rOiIzmz1icreWJ+0aA7LJfuqhEso2T9ncpcFtzMQtzXf2QGGueWJGTYsqrA== dependencies: function-bind "^1.1.1" @@ -149,7 +174,7 @@ call-bind@^1.0.0: camel-case@^4.1.2: version "4.1.2" - resolved "https://registry.yarnpkg.com/camel-case/-/camel-case-4.1.2.tgz#9728072a954f805228225a6deea6b38461e1bd5a" + resolved "https://registry.npmjs.org/camel-case/-/camel-case-4.1.2.tgz" integrity sha512-gxGWBrTT1JuMx6R+o5PTXMmUnhnVzLQ9SNutD4YqKtI6ap897t3tKECYla6gCWEkplXnlNybEkZg9GEGxKFCgw== dependencies: pascal-case "^3.1.2" @@ -157,7 +182,7 @@ camel-case@^4.1.2: capital-case@^1.0.4: version "1.0.4" - resolved "https://registry.yarnpkg.com/capital-case/-/capital-case-1.0.4.tgz#9d130292353c9249f6b00fa5852bee38a717e669" + resolved "https://registry.npmjs.org/capital-case/-/capital-case-1.0.4.tgz" integrity sha512-ds37W8CytHgwnhGGTi88pcPyR15qoNkOpYwmMMfnWqqWgESapLqvDx6huFjQ5vqWSn2Z06173XNA7LtMOeUh1A== dependencies: no-case "^3.0.4" @@ -166,7 +191,7 @@ capital-case@^1.0.4: chalk@^4.0.0, chalk@^4.1.2: version "4.1.2" - resolved "https://registry.yarnpkg.com/chalk/-/chalk-4.1.2.tgz#aac4e2b7734a740867aeb16bf02aad556a1e7a01" + resolved "https://registry.npmjs.org/chalk/-/chalk-4.1.2.tgz" integrity sha512-oKnbhFyRIXpUuez8iBMmyEa4nbj4IOQyuhc/wy9kY7/WVPcwIO9VA668Pu8RkO7+0G76SLROeyw9CpQ061i4mA== dependencies: ansi-styles "^4.1.0" @@ -174,7 +199,7 @@ chalk@^4.0.0, chalk@^4.1.2: change-case@^4.1.2: version "4.1.2" - resolved "https://registry.yarnpkg.com/change-case/-/change-case-4.1.2.tgz#fedfc5f136045e2398c0410ee441f95704641e12" + resolved "https://registry.npmjs.org/change-case/-/change-case-4.1.2.tgz" integrity sha512-bSxY2ws9OtviILG1EiY5K7NNxkqg/JnRnFxLtKQ96JaviiIxi7djMrSd0ECT9AC+lttClmYwKw53BWpOMblo7A== dependencies: camel-case "^4.1.2" @@ -192,34 +217,34 @@ change-case@^4.1.2: color-convert@^2.0.1: version "2.0.1" - resolved "https://registry.yarnpkg.com/color-convert/-/color-convert-2.0.1.tgz#72d3a68d598c9bdb3af2ad1e84f21d896abd4de3" + resolved "https://registry.npmjs.org/color-convert/-/color-convert-2.0.1.tgz" integrity sha512-RRECPsj7iu/xb5oKYcsFHSppFNnsj/52OVTRKb4zP5onXwVF3zVmmToNcOfGC+CRDpfK/U584fMg38ZHCaElKQ== dependencies: color-name "~1.1.4" color-name@~1.1.4: version "1.1.4" - resolved "https://registry.yarnpkg.com/color-name/-/color-name-1.1.4.tgz#c2a09a87acbde69543de6f63fa3995c826c536a2" + resolved "https://registry.npmjs.org/color-name/-/color-name-1.1.4.tgz" integrity sha512-dOy+3AuW3a2wNbZHIuMZpTcgjGuLU/uBL/ubcZF9OXbDo8ff4O8yVp5Bf0efS8uEoYo5q4Fx7dY9OgQGXgAsQA== color2k@^2.0.1: version "2.0.1" - resolved "https://registry.yarnpkg.com/color2k/-/color2k-2.0.1.tgz#bea59670b323265cc13a745f239c6bd6a89d9a89" + resolved "https://registry.npmjs.org/color2k/-/color2k-2.0.1.tgz" integrity sha512-iCg+xrEqtYISsSJZN1z44fyhv4EfX8lSkcDhodt6VnMf1+iMwZxAtmGXchTCeMUnTbXunGvUVK6E3skkApPnZw== commander@^8.3.0: version "8.3.0" - resolved "https://registry.yarnpkg.com/commander/-/commander-8.3.0.tgz#4837ea1b2da67b9c616a67afbb0fafee567bca66" + resolved "https://registry.npmjs.org/commander/-/commander-8.3.0.tgz" integrity sha512-OkTL9umf+He2DZkUq8f8J9of7yL6RJKI24dVITBmNfZBmri9zYZQrKkuXiKhyfPSu8tUhnVBB1iKXevvnlR4Ww== concat-map@0.0.1: version "0.0.1" - resolved "https://registry.yarnpkg.com/concat-map/-/concat-map-0.0.1.tgz#d8a96bd77fd68df7793a73036a3ba0d5405d477b" + resolved "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz" integrity sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg== constant-case@^3.0.4: version "3.0.4" - resolved "https://registry.yarnpkg.com/constant-case/-/constant-case-3.0.4.tgz#3b84a9aeaf4cf31ec45e6bf5de91bdfb0589faf1" + resolved "https://registry.npmjs.org/constant-case/-/constant-case-3.0.4.tgz" integrity sha512-I2hSBi7Vvs7BEuJDr5dDHfzb/Ruj3FyvFyh7KLilAjNQw3Be+xgqUBA2W6scVEcL0hL1dwPRtIqEPVUCKkSsyQ== dependencies: no-case "^3.0.4" @@ -228,29 +253,29 @@ constant-case@^3.0.4: corser@^2.0.1: version "2.0.1" - resolved "https://registry.yarnpkg.com/corser/-/corser-2.0.1.tgz#8eda252ecaab5840dcd975ceb90d9370c819ff87" + resolved "https://registry.npmjs.org/corser/-/corser-2.0.1.tgz" integrity sha512-utCYNzRSQIZNPIcGZdQc92UVJYAhtGAteCFg0yRaFm8f0P+CPtyGyHXJcGXnffjCybUCEx3FQ2G7U3/o9eIkVQ== create-require@^1.1.0: version "1.1.1" - resolved "https://registry.yarnpkg.com/create-require/-/create-require-1.1.1.tgz#c1d7e8f1e5f6cfc9ff65f9cd352d37348756c333" + resolved "https://registry.npmjs.org/create-require/-/create-require-1.1.1.tgz" integrity sha512-dcKFX3jn0MpIaXjisoRvexIJVEKzaq7z2rZKxf+MSr9TkdmHmsU4m2lcLojrj/FHl8mk5VxMmYA+ftRkP/3oKQ== debug@^3.2.7: version "3.2.7" - resolved "https://registry.yarnpkg.com/debug/-/debug-3.2.7.tgz#72580b7e9145fb39b6676f9c5e5fb100b934179a" + resolved "https://registry.npmjs.org/debug/-/debug-3.2.7.tgz" integrity sha512-CFjzYYAi4ThfiQvizrFQevTTXHtnCqWfe7x1AhgEscTz6ZbLbfoLRLPugTQyBth6f8ZERVUSyWHFD/7Wu4t1XQ== dependencies: ms "^2.1.1" diff@^4.0.1: version "4.0.2" - resolved "https://registry.yarnpkg.com/diff/-/diff-4.0.2.tgz#60f3aecb89d5fae520c11aa19efc2bb982aade7d" + resolved "https://registry.npmjs.org/diff/-/diff-4.0.2.tgz" integrity sha512-58lmxKSA4BNyLz+HHMUzlOEpg09FV+ev6ZMe3vJihgdxzgcwZ8VoEEPmALCZG9LmqfVoNMMKpttIYTVG6uDY7A== dot-case@^3.0.4: version "3.0.4" - resolved "https://registry.yarnpkg.com/dot-case/-/dot-case-3.0.4.tgz#9b2b670d00a431667a8a75ba29cd1b98809ce751" + resolved "https://registry.npmjs.org/dot-case/-/dot-case-3.0.4.tgz" integrity sha512-Kv5nKlh6yRrdrGvxeJ2e5y2eRUpkUosIW4A2AS38zwSz27zu7ufDwQPi5Jhs3XAlGNetl3bmnGhQsMtkKJnj3w== dependencies: no-case "^3.0.4" @@ -258,17 +283,17 @@ dot-case@^3.0.4: eventemitter3@^4.0.0: version "4.0.7" - resolved "https://registry.yarnpkg.com/eventemitter3/-/eventemitter3-4.0.7.tgz#2de9b68f6528d5644ef5c59526a1b4a07306169f" + resolved "https://registry.npmjs.org/eventemitter3/-/eventemitter3-4.0.7.tgz" integrity sha512-8guHBZCwKnFhYdHr2ysuRWErTwhoN2X8XELRlrRwpmfeY2jjuUN4taQMsULKUVo1K4DvZl+0pgfyoysHxvmvEw== expr-eval@^2.0.2: version "2.0.2" - resolved "https://registry.yarnpkg.com/expr-eval/-/expr-eval-2.0.2.tgz#fa6f044a7b0c93fde830954eb9c5b0f7fbc7e201" + resolved "https://registry.npmjs.org/expr-eval/-/expr-eval-2.0.2.tgz" integrity sha512-4EMSHGOPSwAfBiibw3ndnP0AvjDWLsMvGOvWEZ2F96IGk0bIVdjQisOHxReSkE13mHcfbuCiXw+G4y0zv6N8Eg== fast-glob@^3.2.12: version "3.2.12" - resolved "https://registry.yarnpkg.com/fast-glob/-/fast-glob-3.2.12.tgz#7f39ec99c2e6ab030337142da9e0c18f37afae80" + resolved "https://registry.npmjs.org/fast-glob/-/fast-glob-3.2.12.tgz" integrity sha512-DVj4CQIYYow0BlaelwK1pHl5n5cRSJfM60UA0zK891sVInoPri2Ekj7+e1CT3/3qxXenpI+nBBmQAcJPJgaj4w== dependencies: "@nodelib/fs.stat" "^2.0.2" @@ -279,26 +304,26 @@ fast-glob@^3.2.12: fastq@^1.6.0: version "1.15.0" - resolved "https://registry.yarnpkg.com/fastq/-/fastq-1.15.0.tgz#d04d07c6a2a68fe4599fea8d2e103a937fae6b3a" + resolved "https://registry.npmjs.org/fastq/-/fastq-1.15.0.tgz" integrity sha512-wBrocU2LCXXa+lWBt8RoIRD89Fi8OdABODa/kEnyeyjS5aZO5/GNvI5sEINADqP/h8M29UHTHUb53sUu5Ihqdw== dependencies: reusify "^1.0.4" fill-range@^7.0.1: version "7.0.1" - resolved "https://registry.yarnpkg.com/fill-range/-/fill-range-7.0.1.tgz#1919a6a7c75fe38b2c7c77e5198535da9acdda40" + resolved "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz" integrity sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ== dependencies: to-regex-range "^5.0.1" follow-redirects@^1.0.0: version "1.15.2" - resolved "https://registry.yarnpkg.com/follow-redirects/-/follow-redirects-1.15.2.tgz#b460864144ba63f2681096f274c4e57026da2c13" + resolved "https://registry.npmjs.org/follow-redirects/-/follow-redirects-1.15.2.tgz" integrity sha512-VQLG33o04KaQ8uYi2tVNbdrWp1QWxNNea+nmIB4EVM28v0hmP17z7aG1+wAkNzVq4KeXTq3221ye5qTJP91JwA== fs-extra@^10.0.0: version "10.1.0" - resolved "https://registry.yarnpkg.com/fs-extra/-/fs-extra-10.1.0.tgz#02873cfbc4084dde127eaa5f9905eef2325d1abf" + resolved "https://registry.npmjs.org/fs-extra/-/fs-extra-10.1.0.tgz" integrity sha512-oRXApq54ETRj4eMiFzGnHWGy+zo5raudjuxN0b8H7s/RU2oW0Wvsx9O0ACRN/kRq9E8Vu/ReskGB5o3ji+FzHQ== dependencies: graceful-fs "^4.2.0" @@ -307,17 +332,17 @@ fs-extra@^10.0.0: fs.realpath@^1.0.0: version "1.0.0" - resolved "https://registry.yarnpkg.com/fs.realpath/-/fs.realpath-1.0.0.tgz#1504ad2523158caa40db4a2787cb01411994ea4f" + resolved "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz" integrity sha512-OO0pH2lK6a0hZnAdau5ItzHPI6pUlvI7jMVnxUQRtw4owF2wk8lOSabtGDCTP4Ggrg2MbGnWO9X8K1t4+fGMDw== function-bind@^1.1.1: version "1.1.1" - resolved "https://registry.yarnpkg.com/function-bind/-/function-bind-1.1.1.tgz#a56899d3ea3c9bab874bb9773b7c5ede92f4895d" + resolved "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz" integrity sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A== get-intrinsic@^1.0.2: version "1.2.0" - resolved "https://registry.yarnpkg.com/get-intrinsic/-/get-intrinsic-1.2.0.tgz#7ad1dc0535f3a2904bba075772763e5051f6d05f" + resolved "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.0.tgz" integrity sha512-L049y6nFOuom5wGyRc3/gdTLO94dySVKRACj1RmJZBQXlbTMhtNIgkWkUHq+jYmZvKf14EW1EoJnnjbmoHij0Q== dependencies: function-bind "^1.1.1" @@ -326,14 +351,14 @@ get-intrinsic@^1.0.2: glob-parent@^5.1.2: version "5.1.2" - resolved "https://registry.yarnpkg.com/glob-parent/-/glob-parent-5.1.2.tgz#869832c58034fe68a4093c17dc15e8340d8401c4" + resolved "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz" integrity sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow== dependencies: is-glob "^4.0.1" glob@^7.2.0: version "7.2.3" - resolved "https://registry.yarnpkg.com/glob/-/glob-7.2.3.tgz#b8df0fb802bbfa8e89bd1d938b4e16578ed44f2b" + resolved "https://registry.npmjs.org/glob/-/glob-7.2.3.tgz" integrity sha512-nFR0zLpU2YCaRxwoCJvL6UvCH2JFyFVIvwTLsIf21AuHlMskA1hhTdk+LlYJtOlYt9v6dvszD2BGRqBL+iQK9Q== dependencies: fs.realpath "^1.0.0" @@ -345,34 +370,34 @@ glob@^7.2.0: graceful-fs@^4.1.6, graceful-fs@^4.2.0: version "4.2.10" - resolved "https://registry.yarnpkg.com/graceful-fs/-/graceful-fs-4.2.10.tgz#147d3a006da4ca3ce14728c7aefc287c367d7a6c" + resolved "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.10.tgz" integrity sha512-9ByhssR2fPVsNZj478qUUbKfmL0+t5BDVyjShtyZZLiK7ZDAArFFfopyOTj0M05wE2tJPisA4iTnnXl2YoPvOA== has-flag@^4.0.0: version "4.0.0" - resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-4.0.0.tgz#944771fd9c81c81265c4d6941860da06bb59479b" + resolved "https://registry.npmjs.org/has-flag/-/has-flag-4.0.0.tgz" integrity sha512-EykJT/Q1KjTWctppgIAgfSO0tKVuZUjhgMr17kqTumMl6Afv3EISleU7qZUzoXDFTAHTDC4NOoG/ZxU3EvlMPQ== has-symbols@^1.0.3: version "1.0.3" - resolved "https://registry.yarnpkg.com/has-symbols/-/has-symbols-1.0.3.tgz#bb7b2c4349251dce87b125f7bdf874aa7c8b39f8" + resolved "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.3.tgz" integrity sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A== has@^1.0.3: version "1.0.3" - resolved "https://registry.yarnpkg.com/has/-/has-1.0.3.tgz#722d7cbfc1f6aa8241f16dd814e011e1f41e8796" + resolved "https://registry.npmjs.org/has/-/has-1.0.3.tgz" integrity sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw== dependencies: function-bind "^1.1.1" he@^1.2.0: version "1.2.0" - resolved "https://registry.yarnpkg.com/he/-/he-1.2.0.tgz#84ae65fa7eafb165fddb61566ae14baf05664f0f" + resolved "https://registry.npmjs.org/he/-/he-1.2.0.tgz" integrity sha512-F/1DnUGPopORZi0ni+CvrCgHQ5FyEAHRLSApuYWMmrbSwoN2Mn/7k+Gl38gJnR7yyDZk6WLXwiGod1JOWNDKGw== header-case@^2.0.4: version "2.0.4" - resolved "https://registry.yarnpkg.com/header-case/-/header-case-2.0.4.tgz#5a42e63b55177349cf405beb8d775acabb92c063" + resolved "https://registry.npmjs.org/header-case/-/header-case-2.0.4.tgz" integrity sha512-H/vuk5TEEVZwrR0lp2zed9OCo1uAILMlx0JEMgC26rzyJJ3N1v6XkwHHXJQdR2doSjcGPM6OKPYoJgf0plJ11Q== dependencies: capital-case "^1.0.4" @@ -380,14 +405,14 @@ header-case@^2.0.4: html-encoding-sniffer@^3.0.0: version "3.0.0" - resolved "https://registry.yarnpkg.com/html-encoding-sniffer/-/html-encoding-sniffer-3.0.0.tgz#2cb1a8cf0db52414776e5b2a7a04d5dd98158de9" + resolved "https://registry.npmjs.org/html-encoding-sniffer/-/html-encoding-sniffer-3.0.0.tgz" integrity sha512-oWv4T4yJ52iKrufjnyZPkrN0CH3QnrUqdB6In1g5Fe1mia8GmF36gnfNySxoZtxD5+NmYw1EElVXiBk93UeskA== dependencies: whatwg-encoding "^2.0.0" http-proxy@^1.18.1: version "1.18.1" - resolved "https://registry.yarnpkg.com/http-proxy/-/http-proxy-1.18.1.tgz#401541f0534884bbf95260334e72f88ee3976549" + resolved "https://registry.npmjs.org/http-proxy/-/http-proxy-1.18.1.tgz" integrity sha512-7mz/721AbnJwIVbnaSv1Cz3Am0ZLT/UBwkC92VlxhXv/k/BBQfM2fXElQNC27BVGr0uwUpplYPQM9LnaBMR5NQ== dependencies: eventemitter3 "^4.0.0" @@ -396,7 +421,7 @@ http-proxy@^1.18.1: http-server@^14.1.1: version "14.1.1" - resolved "https://registry.yarnpkg.com/http-server/-/http-server-14.1.1.tgz#d60fbb37d7c2fdff0f0fbff0d0ee6670bd285e2e" + resolved "https://registry.npmjs.org/http-server/-/http-server-14.1.1.tgz" integrity sha512-+cbxadF40UXd9T01zUHgA+rlo2Bg1Srer4+B4NwIHdaGxAGGv59nYRnGGDJ9LBk7alpS0US+J+bLLdQOOkJq4A== dependencies: basic-auth "^2.0.1" @@ -415,14 +440,14 @@ http-server@^14.1.1: iconv-lite@0.6.3: version "0.6.3" - resolved "https://registry.yarnpkg.com/iconv-lite/-/iconv-lite-0.6.3.tgz#a52f80bf38da1952eb5c681790719871a1a72501" + resolved "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.6.3.tgz" integrity sha512-4fCk79wshMdzMp2rH06qWrJE4iolqLhCUH+OiuIgU++RB0+94NlDL81atO7GX55uUKueo0txHNtvEyI6D7WdMw== dependencies: safer-buffer ">= 2.1.2 < 3.0.0" inflight@^1.0.4: version "1.0.6" - resolved "https://registry.yarnpkg.com/inflight/-/inflight-1.0.6.tgz#49bd6331d7d02d0c09bc910a1075ba8165b56df9" + resolved "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz" integrity sha512-k92I/b08q4wvFscXCLvqfsHCrjrF7yiXsQuIVvVE7N82W3+aqpzuUdBbfhWcy/FZR3/4IgflMgKLOsvPDrGCJA== dependencies: once "^1.3.0" @@ -430,39 +455,39 @@ inflight@^1.0.4: inherits@2: version "2.0.4" - resolved "https://registry.yarnpkg.com/inherits/-/inherits-2.0.4.tgz#0fa2c64f932917c3433a0ded55363aae37416b7c" + resolved "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz" integrity sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ== is-extglob@^2.1.1: version "2.1.1" - resolved "https://registry.yarnpkg.com/is-extglob/-/is-extglob-2.1.1.tgz#a88c02535791f02ed37c76a1b9ea9773c833f8c2" + resolved "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz" integrity sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ== is-glob@^4.0.1: version "4.0.3" - resolved "https://registry.yarnpkg.com/is-glob/-/is-glob-4.0.3.tgz#64f61e42cbbb2eec2071a9dac0b28ba1e65d5084" + resolved "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz" integrity sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg== dependencies: is-extglob "^2.1.1" is-number@^7.0.0: version "7.0.0" - resolved "https://registry.yarnpkg.com/is-number/-/is-number-7.0.0.tgz#7535345b896734d5f80c4d06c50955527a14f12b" + resolved "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz" integrity sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng== json5@^2.2.0: version "2.2.3" - resolved "https://registry.yarnpkg.com/json5/-/json5-2.2.3.tgz#78cd6f1a19bdc12b73db5ad0c61efd66c1e29283" + resolved "https://registry.npmjs.org/json5/-/json5-2.2.3.tgz" integrity sha512-XmOWe7eyHYH14cLdVPoyg+GOH3rYX++KpzrylJwSW98t3Nk+U8XOl8FWKOgwtzdb8lXGf6zYwDUzeHMWfxasyg== jsonc-parser@^3.0.0: version "3.2.0" - resolved "https://registry.yarnpkg.com/jsonc-parser/-/jsonc-parser-3.2.0.tgz#31ff3f4c2b9793f89c67212627c51c6394f88e76" + resolved "https://registry.npmjs.org/jsonc-parser/-/jsonc-parser-3.2.0.tgz" integrity sha512-gfFQZrcTc8CnKXp6Y4/CBT3fTc0OVuDofpre4aEeEpSBPV5X5v4+Vmx+8snU7RLPrNHPKSgLxGo9YuQzz20o+w== jsonfile@^6.0.1: version "6.1.0" - resolved "https://registry.yarnpkg.com/jsonfile/-/jsonfile-6.1.0.tgz#bc55b2634793c679ec6403094eb13698a6ec0aae" + resolved "https://registry.npmjs.org/jsonfile/-/jsonfile-6.1.0.tgz" integrity sha512-5dgndWOriYSm5cnYaJNhalLNDKOqFwyDB/rr1E9ZsGciGvKPs8R2xYGCacuf3z6K1YKDz182fd+fY3cn3pMqXQ== dependencies: universalify "^2.0.0" @@ -471,29 +496,29 @@ jsonfile@^6.0.1: lodash@^4.17.14, lodash@^4.17.15: version "4.17.21" - resolved "https://registry.yarnpkg.com/lodash/-/lodash-4.17.21.tgz#679591c564c3bffaae8454cf0b3df370c3d6911c" + resolved "https://registry.npmjs.org/lodash/-/lodash-4.17.21.tgz" integrity sha512-v2kDEe57lecTulaDIuNTPy3Ry4gLGJ6Z1O3vE1krgXZNrsQ+LFTGHVxVjcXPs17LhbZVGedAJv8XZ1tvj5FvSg== lower-case@^2.0.2: version "2.0.2" - resolved "https://registry.yarnpkg.com/lower-case/-/lower-case-2.0.2.tgz#6fa237c63dbdc4a82ca0fd882e4722dc5e634e28" + resolved "https://registry.npmjs.org/lower-case/-/lower-case-2.0.2.tgz" integrity sha512-7fm3l3NAF9WfN6W3JOmf5drwpVqX78JtoGJ3A6W0a6ZnldM41w2fV5D490psKFTpMds8TJse/eHLFFsNHHjHgg== dependencies: tslib "^2.0.3" make-error@^1.1.1: version "1.3.6" - resolved "https://registry.yarnpkg.com/make-error/-/make-error-1.3.6.tgz#2eb2e37ea9b67c4891f684a1394799af484cf7a2" + resolved "https://registry.npmjs.org/make-error/-/make-error-1.3.6.tgz" integrity sha512-s8UhlNe7vPKomQhC1qFelMokr/Sc3AgNbso3n74mVPA5LTZwkB9NlXf4XPamLxJE8h0gh73rM94xvwRT2CVInw== merge2@^1.3.0: version "1.4.1" - resolved "https://registry.yarnpkg.com/merge2/-/merge2-1.4.1.tgz#4368892f885e907455a6fd7dc55c0c9d404990ae" + resolved "https://registry.npmjs.org/merge2/-/merge2-1.4.1.tgz" integrity sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg== micromatch@^4.0.4: version "4.0.5" - resolved "https://registry.yarnpkg.com/micromatch/-/micromatch-4.0.5.tgz#bc8999a7cbbf77cdc89f132f6e467051b49090c6" + resolved "https://registry.npmjs.org/micromatch/-/micromatch-4.0.5.tgz" integrity sha512-DMy+ERcEW2q8Z2Po+WNXuw3c5YaUSFjAO5GsJqfEl7UjvtIuFKO6ZrKvcItdy98dwFI2N1tg3zNIdKaQT+aNdA== dependencies: braces "^3.0.2" @@ -501,36 +526,36 @@ micromatch@^4.0.4: mime@^1.6.0: version "1.6.0" - resolved "https://registry.yarnpkg.com/mime/-/mime-1.6.0.tgz#32cd9e5c64553bd58d19a568af452acff04981b1" + resolved "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz" integrity sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg== minimatch@^3.1.1: version "3.1.2" - resolved "https://registry.yarnpkg.com/minimatch/-/minimatch-3.1.2.tgz#19cd194bfd3e428f049a70817c038d89ab4be35b" + resolved "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz" integrity sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw== dependencies: brace-expansion "^1.1.7" minimist@^1.2.6: version "1.2.7" - resolved "https://registry.yarnpkg.com/minimist/-/minimist-1.2.7.tgz#daa1c4d91f507390437c6a8bc01078e7000c4d18" + resolved "https://registry.npmjs.org/minimist/-/minimist-1.2.7.tgz" integrity sha512-bzfL1YUZsP41gmu/qjrEk0Q6i2ix/cVeAhbCbqH9u3zYutS1cLg00qhrD0M2MVdCcx4Sc0UpP2eBWo9rotpq6g== mkdirp@^0.5.6: version "0.5.6" - resolved "https://registry.yarnpkg.com/mkdirp/-/mkdirp-0.5.6.tgz#7def03d2432dcae4ba1d611445c48396062255f6" + resolved "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.6.tgz" integrity sha512-FP+p8RB8OWpF3YZBCrP5gtADmtXApB5AMLn+vdyA+PyxCjrCs00mjyUozssO33cwDeT3wNGdLxJ5M//YqtHAJw== dependencies: minimist "^1.2.6" ms@^2.1.1: version "2.1.3" - resolved "https://registry.yarnpkg.com/ms/-/ms-2.1.3.tgz#574c8138ce1d2b5861f0b44579dbadd60c6615b2" + resolved "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz" integrity sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA== no-case@^3.0.4: version "3.0.4" - resolved "https://registry.yarnpkg.com/no-case/-/no-case-3.0.4.tgz#d361fd5c9800f558551a8369fc0dcd4662b6124d" + resolved "https://registry.npmjs.org/no-case/-/no-case-3.0.4.tgz" integrity sha512-fgAN3jGAh+RoxUGZHTSOLJIqUc2wmoBwGR4tbpNAKmmovFoWq0OdRkb0VkldReO2a2iBT/OEulG9XSUc10r3zg== dependencies: lower-case "^2.0.2" @@ -538,24 +563,24 @@ no-case@^3.0.4: object-inspect@^1.9.0: version "1.12.3" - resolved "https://registry.yarnpkg.com/object-inspect/-/object-inspect-1.12.3.tgz#ba62dffd67ee256c8c086dfae69e016cd1f198b9" + resolved "https://registry.npmjs.org/object-inspect/-/object-inspect-1.12.3.tgz" integrity sha512-geUvdk7c+eizMNUDkRpW1wJwgfOiOeHbxBR/hLXK1aT6zmVSO0jsQcs7fj6MGw89jC/cjGfLcNOrtMYtGqm81g== once@^1.3.0: version "1.4.0" - resolved "https://registry.yarnpkg.com/once/-/once-1.4.0.tgz#583b1aa775961d4b113ac17d9c50baef9dd76bd1" + resolved "https://registry.npmjs.org/once/-/once-1.4.0.tgz" integrity sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w== dependencies: wrappy "1" opener@^1.5.1: version "1.5.2" - resolved "https://registry.yarnpkg.com/opener/-/opener-1.5.2.tgz#5d37e1f35077b9dcac4301372271afdeb2a13598" + resolved "https://registry.npmjs.org/opener/-/opener-1.5.2.tgz" integrity sha512-ur5UIdyw5Y7yEj9wLzhqXiy6GZ3Mwx0yGI+5sMn2r0N0v3cKJvUmFH5yPP+WXh9e0xfyzyJX95D8l088DNFj7A== param-case@^3.0.4: version "3.0.4" - resolved "https://registry.yarnpkg.com/param-case/-/param-case-3.0.4.tgz#7d17fe4aa12bde34d4a77d91acfb6219caad01c5" + resolved "https://registry.npmjs.org/param-case/-/param-case-3.0.4.tgz" integrity sha512-RXlj7zCYokReqWpOPH9oYivUzLYZ5vAPIfEmCTNViosC78F8F0H9y7T7gG2M39ymgutxF5gcFEsyZQSph9Bp3A== dependencies: dot-case "^3.0.4" @@ -563,7 +588,7 @@ param-case@^3.0.4: pascal-case@^3.1.2: version "3.1.2" - resolved "https://registry.yarnpkg.com/pascal-case/-/pascal-case-3.1.2.tgz#b48e0ef2b98e205e7c1dae747d0b1508237660eb" + resolved "https://registry.npmjs.org/pascal-case/-/pascal-case-3.1.2.tgz" integrity sha512-uWlGT3YSnK9x3BQJaOdcZwrnV6hPpd8jFH1/ucpiLRPh/2zCVJKS19E4GvYHvaCcACn3foXZ0cLB9Wrx1KGe5g== dependencies: no-case "^3.0.4" @@ -571,7 +596,7 @@ pascal-case@^3.1.2: path-case@^3.0.4: version "3.0.4" - resolved "https://registry.yarnpkg.com/path-case/-/path-case-3.0.4.tgz#9168645334eb942658375c56f80b4c0cb5f82c6f" + resolved "https://registry.npmjs.org/path-case/-/path-case-3.0.4.tgz" integrity sha512-qO4qCFjXqVTrcbPt/hQfhTQ+VhFsqNKOPtytgNKkKxSoEp3XPUQ8ObFuePylOIok5gjn69ry8XiULxCwot3Wfg== dependencies: dot-case "^3.0.4" @@ -579,17 +604,17 @@ path-case@^3.0.4: path-is-absolute@^1.0.0: version "1.0.1" - resolved "https://registry.yarnpkg.com/path-is-absolute/-/path-is-absolute-1.0.1.tgz#174b9268735534ffbc7ace6bf53a5a9e1b5c5f5f" + resolved "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz" integrity sha512-AVbw3UJ2e9bq64vSaS9Am0fje1Pa8pbGqTTsmXfaIiMpnr5DlDhfJOuLj9Sf95ZPVDAUerDfEk88MPmPe7UCQg== picomatch@^2.3.1: version "2.3.1" - resolved "https://registry.yarnpkg.com/picomatch/-/picomatch-2.3.1.tgz#3ba3833733646d9d3e4995946c1365a67fb07a42" + resolved "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz" integrity sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA== portfinder@^1.0.28: version "1.0.32" - resolved "https://registry.yarnpkg.com/portfinder/-/portfinder-1.0.32.tgz#2fe1b9e58389712429dc2bea5beb2146146c7f81" + resolved "https://registry.npmjs.org/portfinder/-/portfinder-1.0.32.tgz" integrity sha512-on2ZJVVDXRADWE6jnQaX0ioEylzgBpQk8r55NE4wjXW1ZxO+BgDlY6DXwj20i0V8eB4SenDQ00WEaxfiIQPcxg== dependencies: async "^2.6.4" @@ -598,63 +623,63 @@ portfinder@^1.0.28: postcss-calc-ast-parser@^0.1.4: version "0.1.4" - resolved "https://registry.yarnpkg.com/postcss-calc-ast-parser/-/postcss-calc-ast-parser-0.1.4.tgz#9aeee3650a91c0b2902789689bc044c9f83bc447" + resolved "https://registry.npmjs.org/postcss-calc-ast-parser/-/postcss-calc-ast-parser-0.1.4.tgz" integrity sha512-CebpbHc96zgFjGgdQ6BqBy6XIUgRx1xXWCAAk6oke02RZ5nxwo9KQejTg8y7uYEeI9kv8jKQPYjoe6REsY23vw== dependencies: postcss-value-parser "^3.3.1" postcss-value-parser@^3.3.1: version "3.3.1" - resolved "https://registry.yarnpkg.com/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz#9ff822547e2893213cf1c30efa51ac5fd1ba8281" + resolved "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-3.3.1.tgz" integrity sha512-pISE66AbVkp4fDQ7VHBwRNXzAAKJjw4Vw7nWI/+Q3vuly7SNfgYXvm6i5IgFylHGK5sP/xHAbB7N49OS4gWNyQ== qs@^6.4.0: version "6.11.0" - resolved "https://registry.yarnpkg.com/qs/-/qs-6.11.0.tgz#fd0d963446f7a65e1367e01abd85429453f0c37a" + resolved "https://registry.npmjs.org/qs/-/qs-6.11.0.tgz" integrity sha512-MvjoMCJwEarSbUYk5O+nmoSzSutSsTwF85zcHPQ9OrlFoZOYIjaqBAJIqIXjptyD5vThxGq52Xu/MaJzRkIk4Q== dependencies: side-channel "^1.0.4" queue-microtask@^1.2.2: version "1.2.3" - resolved "https://registry.yarnpkg.com/queue-microtask/-/queue-microtask-1.2.3.tgz#4929228bbc724dfac43e0efb058caf7b6cfb6243" + resolved "https://registry.npmjs.org/queue-microtask/-/queue-microtask-1.2.3.tgz" integrity sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A== requires-port@^1.0.0: version "1.0.0" - resolved "https://registry.yarnpkg.com/requires-port/-/requires-port-1.0.0.tgz#925d2601d39ac485e091cf0da5c6e694dc3dcaff" + resolved "https://registry.npmjs.org/requires-port/-/requires-port-1.0.0.tgz" integrity sha512-KigOCHcocU3XODJxsu8i/j8T9tzT4adHiecwORRQ0ZZFcp7ahwXuRU1m+yuO90C5ZUyGeGfocHDI14M3L3yDAQ== reusify@^1.0.4: version "1.0.4" - resolved "https://registry.yarnpkg.com/reusify/-/reusify-1.0.4.tgz#90da382b1e126efc02146e90845a88db12925d76" + resolved "https://registry.npmjs.org/reusify/-/reusify-1.0.4.tgz" integrity sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw== run-parallel@^1.1.9: version "1.2.0" - resolved "https://registry.yarnpkg.com/run-parallel/-/run-parallel-1.2.0.tgz#66d1368da7bdf921eb9d95bd1a9229e7f21a43ee" + resolved "https://registry.npmjs.org/run-parallel/-/run-parallel-1.2.0.tgz" integrity sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA== dependencies: queue-microtask "^1.2.2" safe-buffer@5.1.2: version "5.1.2" - resolved "https://registry.yarnpkg.com/safe-buffer/-/safe-buffer-5.1.2.tgz#991ec69d296e0313747d59bdfd2b745c35f8828d" + resolved "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.1.2.tgz" integrity sha512-Gd2UZBJDkXlY7GbJxfsE8/nvKkUEU1G38c1siN6QP6a9PT9MmHB8GnpscSmMJSoF8LOIrt8ud/wPtojys4G6+g== "safer-buffer@>= 2.1.2 < 3.0.0": version "2.1.2" - resolved "https://registry.yarnpkg.com/safer-buffer/-/safer-buffer-2.1.2.tgz#44fa161b0187b9549dd84bb91802f9bd8385cd6a" + resolved "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz" integrity sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg== secure-compare@3.0.1: version "3.0.1" - resolved "https://registry.yarnpkg.com/secure-compare/-/secure-compare-3.0.1.tgz#f1a0329b308b221fae37b9974f3d578d0ca999e3" + resolved "https://registry.npmjs.org/secure-compare/-/secure-compare-3.0.1.tgz" integrity sha512-AckIIV90rPDcBcglUwXPF3kg0P0qmPsPXAj6BBEENQE1p5yA1xfmDJzfi1Tappj37Pv2mVbKpL3Z1T+Nn7k1Qw== sentence-case@^3.0.4: version "3.0.4" - resolved "https://registry.yarnpkg.com/sentence-case/-/sentence-case-3.0.4.tgz#3645a7b8c117c787fde8702056225bb62a45131f" + resolved "https://registry.npmjs.org/sentence-case/-/sentence-case-3.0.4.tgz" integrity sha512-8LS0JInaQMCRoQ7YUytAo/xUu5W2XnQxV2HI/6uM6U7CITS1RqPElr30V6uIqyMKM9lJGRVFy5/4CuzcixNYSg== dependencies: no-case "^3.0.4" @@ -663,7 +688,7 @@ sentence-case@^3.0.4: side-channel@^1.0.4: version "1.0.4" - resolved "https://registry.yarnpkg.com/side-channel/-/side-channel-1.0.4.tgz#efce5c8fdc104ee751b25c58d4290011fa5ea2cf" + resolved "https://registry.npmjs.org/side-channel/-/side-channel-1.0.4.tgz" integrity sha512-q5XPytqFEIKHkGdiMIrY10mvLRvnQh42/+GoBlFW3b2LXLE2xxJpZFdm94we0BaoV3RwJyGqg5wS7epxTv0Zvw== dependencies: call-bind "^1.0.0" @@ -672,7 +697,7 @@ side-channel@^1.0.4: snake-case@^3.0.4: version "3.0.4" - resolved "https://registry.yarnpkg.com/snake-case/-/snake-case-3.0.4.tgz#4f2bbd568e9935abdfd593f34c691dadb49c452c" + resolved "https://registry.npmjs.org/snake-case/-/snake-case-3.0.4.tgz" integrity sha512-LAOh4z89bGQvl9pFfNF8V146i7o7/CqFPbqzYgP+yYzDIDeS9HaNFtXABamRW+AQzEVODcvE79ljJ+8a9YSdMg== dependencies: dot-case "^3.0.4" @@ -680,7 +705,7 @@ snake-case@^3.0.4: style-dictionary@^3.7.2: version "3.7.2" - resolved "https://registry.yarnpkg.com/style-dictionary/-/style-dictionary-3.7.2.tgz#bb4e70b2c2020dfa3ea81f22adda252aaf31e0a4" + resolved "https://registry.npmjs.org/style-dictionary/-/style-dictionary-3.7.2.tgz" integrity sha512-Nd/qrPj1ikYX+sL/8PofMgfaJLRvGgT96Ty3dJLGNqtZmecVr3Xs+OZivMQEYmSCTiap/UyeV5SqwmAgn3/KKA== dependencies: chalk "^4.0.0" @@ -695,26 +720,26 @@ style-dictionary@^3.7.2: supports-color@^7.1.0: version "7.2.0" - resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-7.2.0.tgz#1b7dcdcb32b8138801b3e478ba6a51caa89648da" + resolved "https://registry.npmjs.org/supports-color/-/supports-color-7.2.0.tgz" integrity sha512-qpCAvRl9stuOHveKsn7HncJRvv501qIacKzQlO/+Lwxc9+0q2wLyv4Dfvt80/DPn2pqOBsJdDiogXGR9+OvwRw== dependencies: has-flag "^4.0.0" tinycolor2@^1.4.1: version "1.5.2" - resolved "https://registry.yarnpkg.com/tinycolor2/-/tinycolor2-1.5.2.tgz#7d30b4584d8b7d62b9a94dacc505614a6516a95f" + resolved "https://registry.npmjs.org/tinycolor2/-/tinycolor2-1.5.2.tgz" integrity sha512-h80m9GPFGbcLzZByXlNSEhp1gf8Dy+VX/2JCGUZsWLo7lV1mnE/XlxGYgRBoMLJh1lIDXP0EMC4RPTjlRaV+Bg== to-regex-range@^5.0.1: version "5.0.1" - resolved "https://registry.yarnpkg.com/to-regex-range/-/to-regex-range-5.0.1.tgz#1648c44aae7c8d988a326018ed72f5b4dd0392e4" + resolved "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz" integrity sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ== dependencies: is-number "^7.0.0" ts-node@^10.9.1: version "10.9.1" - resolved "https://registry.yarnpkg.com/ts-node/-/ts-node-10.9.1.tgz#e73de9102958af9e1f0b168a6ff320e25adcff4b" + resolved "https://registry.npmjs.org/ts-node/-/ts-node-10.9.1.tgz" integrity sha512-NtVysVPkxxrwFGUUxGYhfux8k78pQB3JqYBXlLRZgdGUqTO5wU/UyHop5p70iEbGhB7q5KmiZiU0Y3KlJrScEw== dependencies: "@cspotcode/source-map-support" "^0.8.0" @@ -733,63 +758,63 @@ ts-node@^10.9.1: tslib@^2.0.3: version "2.4.1" - resolved "https://registry.yarnpkg.com/tslib/-/tslib-2.4.1.tgz#0d0bfbaac2880b91e22df0768e55be9753a5b17e" + resolved "https://registry.npmjs.org/tslib/-/tslib-2.4.1.tgz" integrity sha512-tGyy4dAjRIEwI7BzsB0lynWgOpfqjUdq91XXAlIWD2OwKBH7oCl/GZG/HT4BOHrTlPMOASlMQ7veyTqpmRcrNA== typescript@^4.9.5: version "4.9.5" - resolved "https://registry.yarnpkg.com/typescript/-/typescript-4.9.5.tgz#095979f9bcc0d09da324d58d03ce8f8374cbe65a" + resolved "https://registry.npmjs.org/typescript/-/typescript-4.9.5.tgz" integrity sha512-1FXk9E2Hm+QzZQ7z+McJiHL4NW1F2EzMu9Nq9i3zAaGqibafqYwCVU6WyWAuyQRRzOlxou8xZSyXLEN8oKj24g== union@~0.5.0: version "0.5.0" - resolved "https://registry.yarnpkg.com/union/-/union-0.5.0.tgz#b2c11be84f60538537b846edb9ba266ba0090075" + resolved "https://registry.npmjs.org/union/-/union-0.5.0.tgz" integrity sha512-N6uOhuW6zO95P3Mel2I2zMsbsanvvtgn6jVqJv4vbVcz/JN0OkL9suomjQGmWtxJQXOCqUJvquc1sMeNz/IwlA== dependencies: qs "^6.4.0" universalify@^2.0.0: version "2.0.0" - resolved "https://registry.yarnpkg.com/universalify/-/universalify-2.0.0.tgz#75a4984efedc4b08975c5aeb73f530d02df25717" + resolved "https://registry.npmjs.org/universalify/-/universalify-2.0.0.tgz" integrity sha512-hAZsKq7Yy11Zu1DE0OzWjw7nnLZmJZYTDZZyEFHZdUhV8FkH5MCfoU1XMaxXovpyW5nq5scPqq0ZDP9Zyl04oQ== upper-case-first@^2.0.2: version "2.0.2" - resolved "https://registry.yarnpkg.com/upper-case-first/-/upper-case-first-2.0.2.tgz#992c3273f882abd19d1e02894cc147117f844324" + resolved "https://registry.npmjs.org/upper-case-first/-/upper-case-first-2.0.2.tgz" integrity sha512-514ppYHBaKwfJRK/pNC6c/OxfGa0obSnAl106u97Ed0I625Nin96KAjttZF6ZL3e1XLtphxnqrOi9iWgm+u+bg== dependencies: tslib "^2.0.3" upper-case@^2.0.2: version "2.0.2" - resolved "https://registry.yarnpkg.com/upper-case/-/upper-case-2.0.2.tgz#d89810823faab1df1549b7d97a76f8662bae6f7a" + resolved "https://registry.npmjs.org/upper-case/-/upper-case-2.0.2.tgz" integrity sha512-KgdgDGJt2TpuwBUIjgG6lzw2GWFRCW9Qkfkiv0DxqHHLYJHmtmdUIKcZd8rHgFSjopVTlw6ggzCm1b8MFQwikg== dependencies: tslib "^2.0.3" url-join@^4.0.1: version "4.0.1" - resolved "https://registry.yarnpkg.com/url-join/-/url-join-4.0.1.tgz#b642e21a2646808ffa178c4c5fda39844e12cde7" + resolved "https://registry.npmjs.org/url-join/-/url-join-4.0.1.tgz" integrity sha512-jk1+QP6ZJqyOiuEI9AEWQfju/nB2Pw466kbA0LEZljHwKeMgd9WrAEgEGxjPDD2+TNbbb37rTyhEfrCXfuKXnA== v8-compile-cache-lib@^3.0.1: version "3.0.1" - resolved "https://registry.yarnpkg.com/v8-compile-cache-lib/-/v8-compile-cache-lib-3.0.1.tgz#6336e8d71965cb3d35a1bbb7868445a7c05264bf" + resolved "https://registry.npmjs.org/v8-compile-cache-lib/-/v8-compile-cache-lib-3.0.1.tgz" integrity sha512-wa7YjyUGfNZngI/vtK0UHAN+lgDCxBPCylVXGp0zu59Fz5aiGtNXaq3DhIov063MorB+VfufLh3JlF2KdTK3xg== whatwg-encoding@^2.0.0: version "2.0.0" - resolved "https://registry.yarnpkg.com/whatwg-encoding/-/whatwg-encoding-2.0.0.tgz#e7635f597fd87020858626805a2729fa7698ac53" + resolved "https://registry.npmjs.org/whatwg-encoding/-/whatwg-encoding-2.0.0.tgz" integrity sha512-p41ogyeMUrw3jWclHWTQg1k05DSVXPLcVxRTYsXUk+ZooOCZLcoYgPZ/HL/D/N+uQPOtcp1me1WhBEaX02mhWg== dependencies: iconv-lite "0.6.3" wrappy@1: version "1.0.2" - resolved "https://registry.yarnpkg.com/wrappy/-/wrappy-1.0.2.tgz#b5243d8f3ec1aa35f1364605bc0d1036e30ab69f" + resolved "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz" integrity sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ== yn@3.1.1: version "3.1.1" - resolved "https://registry.yarnpkg.com/yn/-/yn-3.1.1.tgz#1e87401a09d767c1d5eab26a6e4c185182d2eb50" + resolved "https://registry.npmjs.org/yn/-/yn-3.1.1.tgz" integrity sha512-Ux4ygGWsu2c7isFWe8Yu1YluJmqVhxqK2cLXNQA5AcC3QfbGNpM7fu0Y8b/z16pXLnFxZYvWhd3fhBY9DLmC6Q==