diff --git a/vendor.conf b/vendor.conf index 8a4ded7e8b..ed19fe5915 100644 --- a/vendor.conf +++ b/vendor.conf @@ -1,51 +1,50 @@ -github.com/Azure/go-ansiterm d6e3b3328b783f23731bc4d058875b0371ff8109 -github.com/BurntSushi/toml a368813c5e648fee92e5f6c30e3944ff9d5e8895 -github.com/Microsoft/go-winio v0.4.7 -github.com/Microsoft/hcsshim v0.6.11 -github.com/armon/go-metrics eb0af217e5e9747e41dd5303755356b62d28e3ec -github.com/armon/go-radix e39d623f12e8e41c7b5529e9a9dd67a1e2261f80 -github.com/boltdb/bolt fff57c100f4dea1905678da7e90d92429dff2904 -github.com/codegangsta/cli a65b733b303f0055f8d324d805f393cd3e7a7904 -github.com/containerd/continuity d3c23511c1bf5851696cba83143d9cbcd666869b -github.com/coreos/etcd v3.2.1 -github.com/coreos/go-semver v0.2.0 -github.com/deckarep/golang-set ef32fa3046d9f249d399f98ebaf9be944430fd1d +github.com/Azure/go-ansiterm d6e3b3328b783f23731bc4d058875b0371ff8109 +github.com/BurntSushi/toml a368813c5e648fee92e5f6c30e3944ff9d5e8895 +github.com/Microsoft/go-winio 97e4973ce50b2ff5f09635a57e2b88a037aae829 # v0.4.11 +github.com/Microsoft/hcsshim 5b3eff572681588b6ce3df295d3d23b72f053f32 # v0.7.12 +github.com/armon/go-metrics eb0af217e5e9747e41dd5303755356b62d28e3ec +github.com/armon/go-radix e39d623f12e8e41c7b5529e9a9dd67a1e2261f80 +github.com/codegangsta/cli a65b733b303f0055f8d324d805f393cd3e7a7904 +github.com/containerd/continuity 004b46473808b3e7a4a3049c20e4376c91eb966d +github.com/coreos/etcd 61fc123e7a8b14a0a258aa3f5c4159861b1ec2e7 # v3.2.1 +github.com/coreos/go-semver 8ab6407b697782a06568d4b7f1db25550ec2e4c6 # v0.2.0 +github.com/deckarep/golang-set ef32fa3046d9f249d399f98ebaf9be944430fd1d +go.etcd.io/bbolt 7ee3ded59d4835e10f3e7d0f7603c42aa5e83820 # v1.3.1-etcd.8 -github.com/docker/docker 162ba6016def672690ee4a1f3978368853a1e149 -github.com/docker/go-connections 7beb39f0b969b075d1325fecb092faf27fd357b6 -github.com/docker/go-events 9461782956ad83b30282bf90e31fa6a70c255ba9 -github.com/docker/go-units 9e638d38cf6977a37a8ea0078f3ee75a7cdb2dd1 -github.com/docker/libkv 1d8431073ae03cdaedb198a89722f3aab6d418ef +github.com/docker/docker 1046c6371132875d80f287950bb9e9e5cefa8a85 https://github.com/docker/engine.git # 18.09 branch +github.com/docker/go-connections 7395e3f8aa162843a74ed6d48e79627d9792ac55 # v0.4.0 +github.com/docker/go-events 9461782956ad83b30282bf90e31fa6a70c255ba9 +github.com/docker/go-units 47565b4f722fb6ceae66b95f853feed578a4a51c # v0.3.3 +github.com/docker/libkv 458977154600b9f23984d9f4b82e79570b5ae12b -github.com/godbus/dbus v4.0.0 -github.com/gogo/protobuf v1.0.0 -github.com/gorilla/context v1.1 -github.com/gorilla/mux v1.1 -github.com/hashicorp/consul v0.5.2 -github.com/hashicorp/go-msgpack 71c2886f5a673a35f909803f38ece5810165097b -github.com/hashicorp/go-multierror fcdddc395df1ddf4247c69bd436e84cfa0733f7e -github.com/hashicorp/memberlist 3d8438da9589e7b608a83ffac1ef8211486bcb7c -github.com/sean-/seed e2103e2c35297fb7e17febb81e49b312087a2372 -github.com/hashicorp/go-sockaddr 6d291a969b86c4b633730bfc6b8b9d64c3aafed9 -github.com/hashicorp/serf 598c54895cc5a7b1a24a398d635e8c0ea0959870 -github.com/mattn/go-shellwords v1.0.3 -github.com/miekg/dns v1.0.7 -github.com/opencontainers/go-digest v1.0.0-rc1 -github.com/opencontainers/image-spec v1.0.1 -github.com/opencontainers/runc 96ec2177ae841256168fcf76954f7177af9446eb -github.com/opencontainers/runtime-spec v1.0.1 -github.com/samuel/go-zookeeper d0e0d8e11f318e000a8cc434616d69e329edc374 -github.com/sirupsen/logrus v1.0.3 -github.com/syndtr/gocapability 33e07d32887e1e06b7c025f27ce52f62c7990bc0 -github.com/ugorji/go f1f1a805ed361a0e078bb537e4ea78cd37dcf065 -github.com/vishvananda/netlink b2de5d10e38ecce8607e6b438b6d174f389a004e -github.com/vishvananda/netns 604eaf189ee867d8c147fafc28def2394e878d25 -golang.org/x/crypto 1a580b3eff7814fc9b40602fd35256c63b50f491 -golang.org/x/net 0ed95abb35c445290478a5348a7b38bb154135fd -golang.org/x/sys 37707fdb30a5b38865cfb95e5aab41707daec7fd -golang.org/x/sync fd80eb99c8f653c847d294a001bdf2a3a6f768f5 -github.com/pkg/errors 839d9e913e063e28dfd0e6c7b7512793e0a48be9 -github.com/ishidawataru/sctp 07191f837fedd2f13d1ec7b5f885f0f3ec54b1cb +github.com/godbus/dbus 5f6efc7ef2759c81b7ba876593971bfce311eab3 # v4.0.0 +github.com/gogo/protobuf 1adfc126b41513cc696b209667c8656ea7aac67c # v1.0.0 +github.com/gorilla/context 1ea25387ff6f684839d82767c1733ff4d4d15d0a # v1.1 +github.com/gorilla/mux 0eeaf8392f5b04950925b8a69fe70f110fa7cbfc # v1.1 +github.com/hashicorp/consul 9a9cc9341bb487651a0399e3fc5e1e8a42e62dd9 # v0.5.2 +github.com/hashicorp/go-msgpack 71c2886f5a673a35f909803f38ece5810165097b +github.com/hashicorp/go-multierror fcdddc395df1ddf4247c69bd436e84cfa0733f7e +github.com/hashicorp/memberlist 3d8438da9589e7b608a83ffac1ef8211486bcb7c +github.com/sean-/seed e2103e2c35297fb7e17febb81e49b312087a2372 +github.com/hashicorp/go-sockaddr 6d291a969b86c4b633730bfc6b8b9d64c3aafed9 +github.com/hashicorp/serf 598c54895cc5a7b1a24a398d635e8c0ea0959870 +github.com/mattn/go-shellwords 02e3cf038dcea8290e44424da473dd12be796a8a # v1.0.3 +github.com/miekg/dns e57bf427e68187a27e22adceac868350d7a7079b # v1.0.7 +github.com/opencontainers/go-digest 279bed98673dd5bef374d3b6e4b09e2af76183bf # v1.0.0-rc1 +github.com/opencontainers/image-spec d60099175f88c47cd379c4738d158884749ed235 # v1.0.1 +github.com/opencontainers/runc 96ec2177ae841256168fcf76954f7177af9446eb +github.com/opencontainers/runtime-spec 5684b8af48c1ac3b1451fa499724e30e3c20a294 # v1.0.1-49-g5684b8a +github.com/samuel/go-zookeeper d0e0d8e11f318e000a8cc434616d69e329edc374 +github.com/sirupsen/logrus f006c2ac4710855cf0f916dd6b77acf6b048dc6e # v1.0.3 +github.com/ugorji/go f1f1a805ed361a0e078bb537e4ea78cd37dcf065 +github.com/vishvananda/netlink b2de5d10e38ecce8607e6b438b6d174f389a004e +github.com/vishvananda/netns 604eaf189ee867d8c147fafc28def2394e878d25 +golang.org/x/crypto 0709b304e793a5edb4a2c0145f281ecdc20838a4 +golang.org/x/net a680a1efc54dd51c040b3b5ce4939ea3cf2ea0d1 +golang.org/x/sys ac767d655b305d4e9612f5f6e33120b9176c4ad4 +golang.org/x/sync 1d60e4601c6fd243af51cc01ddf169918a5407ca +github.com/pkg/errors 645ef00459ed84a119197bfb8d8205042c6df63d # v0.8.0 +github.com/ishidawataru/sctp 07191f837fedd2f13d1ec7b5f885f0f3ec54b1cb -gotest.tools v2.1.0 -github.com/google/go-cmp v0.2.0 +gotest.tools b6e20af1ed078cd01a6413b734051a292450b4cb # v2.1.0 +github.com/google/go-cmp 3af367b6b30c263d47e8895973edcca9a49cf029 # v0.2.0 diff --git a/vendor/github.com/Microsoft/go-winio/ea.go b/vendor/github.com/Microsoft/go-winio/ea.go index b37e930d6a..4051c1b33b 100644 --- a/vendor/github.com/Microsoft/go-winio/ea.go +++ b/vendor/github.com/Microsoft/go-winio/ea.go @@ -1,137 +1,137 @@ -package winio - -import ( - "bytes" - "encoding/binary" - "errors" -) - -type fileFullEaInformation struct { - NextEntryOffset uint32 - Flags uint8 - NameLength uint8 - ValueLength uint16 -} - -var ( - fileFullEaInformationSize = binary.Size(&fileFullEaInformation{}) - - errInvalidEaBuffer = errors.New("invalid extended attribute buffer") - errEaNameTooLarge = errors.New("extended attribute name too large") - errEaValueTooLarge = errors.New("extended attribute value too large") -) - -// ExtendedAttribute represents a single Windows EA. -type ExtendedAttribute struct { - Name string - Value []byte - Flags uint8 -} - -func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) { - var info fileFullEaInformation - err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info) - if err != nil { - err = errInvalidEaBuffer - return - } - - nameOffset := fileFullEaInformationSize - nameLen := int(info.NameLength) - valueOffset := nameOffset + int(info.NameLength) + 1 - valueLen := int(info.ValueLength) - nextOffset := int(info.NextEntryOffset) - if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) { - err = errInvalidEaBuffer - return - } - - ea.Name = string(b[nameOffset : nameOffset+nameLen]) - ea.Value = b[valueOffset : valueOffset+valueLen] - ea.Flags = info.Flags - if info.NextEntryOffset != 0 { - nb = b[info.NextEntryOffset:] - } - return -} - -// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION -// buffer retrieved from BackupRead, ZwQueryEaFile, etc. -func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) { - for len(b) != 0 { - ea, nb, err := parseEa(b) - if err != nil { - return nil, err - } - - eas = append(eas, ea) - b = nb - } - return -} - -func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error { - if int(uint8(len(ea.Name))) != len(ea.Name) { - return errEaNameTooLarge - } - if int(uint16(len(ea.Value))) != len(ea.Value) { - return errEaValueTooLarge - } - entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value)) - withPadding := (entrySize + 3) &^ 3 - nextOffset := uint32(0) - if !last { - nextOffset = withPadding - } - info := fileFullEaInformation{ - NextEntryOffset: nextOffset, - Flags: ea.Flags, - NameLength: uint8(len(ea.Name)), - ValueLength: uint16(len(ea.Value)), - } - - err := binary.Write(buf, binary.LittleEndian, &info) - if err != nil { - return err - } - - _, err = buf.Write([]byte(ea.Name)) - if err != nil { - return err - } - - err = buf.WriteByte(0) - if err != nil { - return err - } - - _, err = buf.Write(ea.Value) - if err != nil { - return err - } - - _, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize]) - if err != nil { - return err - } - - return nil -} - -// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION -// buffer for use with BackupWrite, ZwSetEaFile, etc. -func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) { - var buf bytes.Buffer - for i := range eas { - last := false - if i == len(eas)-1 { - last = true - } - - err := writeEa(&buf, &eas[i], last) - if err != nil { - return nil, err - } - } - return buf.Bytes(), nil -} +package winio + +import ( + "bytes" + "encoding/binary" + "errors" +) + +type fileFullEaInformation struct { + NextEntryOffset uint32 + Flags uint8 + NameLength uint8 + ValueLength uint16 +} + +var ( + fileFullEaInformationSize = binary.Size(&fileFullEaInformation{}) + + errInvalidEaBuffer = errors.New("invalid extended attribute buffer") + errEaNameTooLarge = errors.New("extended attribute name too large") + errEaValueTooLarge = errors.New("extended attribute value too large") +) + +// ExtendedAttribute represents a single Windows EA. +type ExtendedAttribute struct { + Name string + Value []byte + Flags uint8 +} + +func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) { + var info fileFullEaInformation + err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info) + if err != nil { + err = errInvalidEaBuffer + return + } + + nameOffset := fileFullEaInformationSize + nameLen := int(info.NameLength) + valueOffset := nameOffset + int(info.NameLength) + 1 + valueLen := int(info.ValueLength) + nextOffset := int(info.NextEntryOffset) + if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) { + err = errInvalidEaBuffer + return + } + + ea.Name = string(b[nameOffset : nameOffset+nameLen]) + ea.Value = b[valueOffset : valueOffset+valueLen] + ea.Flags = info.Flags + if info.NextEntryOffset != 0 { + nb = b[info.NextEntryOffset:] + } + return +} + +// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION +// buffer retrieved from BackupRead, ZwQueryEaFile, etc. +func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) { + for len(b) != 0 { + ea, nb, err := parseEa(b) + if err != nil { + return nil, err + } + + eas = append(eas, ea) + b = nb + } + return +} + +func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error { + if int(uint8(len(ea.Name))) != len(ea.Name) { + return errEaNameTooLarge + } + if int(uint16(len(ea.Value))) != len(ea.Value) { + return errEaValueTooLarge + } + entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value)) + withPadding := (entrySize + 3) &^ 3 + nextOffset := uint32(0) + if !last { + nextOffset = withPadding + } + info := fileFullEaInformation{ + NextEntryOffset: nextOffset, + Flags: ea.Flags, + NameLength: uint8(len(ea.Name)), + ValueLength: uint16(len(ea.Value)), + } + + err := binary.Write(buf, binary.LittleEndian, &info) + if err != nil { + return err + } + + _, err = buf.Write([]byte(ea.Name)) + if err != nil { + return err + } + + err = buf.WriteByte(0) + if err != nil { + return err + } + + _, err = buf.Write(ea.Value) + if err != nil { + return err + } + + _, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize]) + if err != nil { + return err + } + + return nil +} + +// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION +// buffer for use with BackupWrite, ZwSetEaFile, etc. +func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) { + var buf bytes.Buffer + for i := range eas { + last := false + if i == len(eas)-1 { + last = true + } + + err := writeEa(&buf, &eas[i], last) + if err != nil { + return nil, err + } + } + return buf.Bytes(), nil +} diff --git a/vendor/github.com/Microsoft/go-winio/fileinfo.go b/vendor/github.com/Microsoft/go-winio/fileinfo.go index b1d60abb83..ada2fbab63 100644 --- a/vendor/github.com/Microsoft/go-winio/fileinfo.go +++ b/vendor/github.com/Microsoft/go-winio/fileinfo.go @@ -20,7 +20,8 @@ const ( // FileBasicInfo contains file access time and file attributes information. type FileBasicInfo struct { CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime - FileAttributes uintptr // includes padding + FileAttributes uint32 + pad uint32 // padding } // GetFileBasicInfo retrieves times and attributes for a file. diff --git a/vendor/github.com/Microsoft/go-winio/pipe.go b/vendor/github.com/Microsoft/go-winio/pipe.go index 82cbe7af45..d99eedb648 100644 --- a/vendor/github.com/Microsoft/go-winio/pipe.go +++ b/vendor/github.com/Microsoft/go-winio/pipe.go @@ -15,7 +15,6 @@ import ( //sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe //sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateNamedPipeW //sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW -//sys waitNamedPipe(name string, timeout uint32) (err error) = WaitNamedPipeW //sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo //sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW //sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc @@ -121,6 +120,11 @@ func (f *win32MessageBytePipe) Read(b []byte) (int, error) { // zero-byte message, ensure that all future Read() calls // also return EOF. f.readEOF = true + } else if err == syscall.ERROR_MORE_DATA { + // ERROR_MORE_DATA indicates that the pipe's read mode is message mode + // and the message still has more bytes. Treat this as a success, since + // this package presents all named pipes as byte streams. + err = nil } return n, err } @@ -134,12 +138,14 @@ func (s pipeAddress) String() string { } // DialPipe connects to a named pipe by path, timing out if the connection -// takes longer than the specified duration. If timeout is nil, then the timeout -// is the default timeout established by the pipe server. +// takes longer than the specified duration. If timeout is nil, then we use +// a default timeout of 5 seconds. (We do not use WaitNamedPipe.) func DialPipe(path string, timeout *time.Duration) (net.Conn, error) { var absTimeout time.Time if timeout != nil { absTimeout = time.Now().Add(*timeout) + } else { + absTimeout = time.Now().Add(time.Second * 2) } var err error var h syscall.Handle @@ -148,22 +154,13 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) { if err != cERROR_PIPE_BUSY { break } - now := time.Now() - var ms uint32 - if absTimeout.IsZero() { - ms = cNMPWAIT_USE_DEFAULT_WAIT - } else if now.After(absTimeout) { - ms = cNMPWAIT_NOWAIT - } else { - ms = uint32(absTimeout.Sub(now).Nanoseconds() / 1000 / 1000) - } - err = waitNamedPipe(path, ms) - if err != nil { - if err == cERROR_SEM_TIMEOUT { - return nil, ErrTimeout - } - break + if time.Now().After(absTimeout) { + return nil, ErrTimeout } + + // Wait 10 msec and try again. This is a rather simplistic + // view, as we always try each 10 milliseconds. + time.Sleep(time.Millisecond * 10) } if err != nil { return nil, &os.PathError{Op: "open", Path: path, Err: err} @@ -175,16 +172,6 @@ func DialPipe(path string, timeout *time.Duration) (net.Conn, error) { return nil, err } - var state uint32 - err = getNamedPipeHandleState(h, &state, nil, nil, nil, nil, 0) - if err != nil { - return nil, err - } - - if state&cPIPE_READMODE_MESSAGE != 0 { - return nil, &os.PathError{Op: "open", Path: path, Err: errors.New("message readmode pipes not supported")} - } - f, err := makeWin32File(h) if err != nil { syscall.Close(h) @@ -354,13 +341,23 @@ func ListenPipe(path string, c *PipeConfig) (net.Listener, error) { if err != nil { return nil, err } - // Immediately open and then close a client handle so that the named pipe is - // created but not currently accepting connections. + // Create a client handle and connect it. This results in the pipe + // instance always existing, so that clients see ERROR_PIPE_BUSY + // rather than ERROR_FILE_NOT_FOUND. This ties the first instance + // up so that no other instances can be used. This would have been + // cleaner if the Win32 API matched CreateFile with ConnectNamedPipe + // instead of CreateNamedPipe. (Apparently created named pipes are + // considered to be in listening state regardless of whether any + // active calls to ConnectNamedPipe are outstanding.) h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0) if err != nil { syscall.Close(h) return nil, err } + // Close the client handle. The server side of the instance will + // still be busy, leading to ERROR_PIPE_BUSY instead of + // ERROR_NOT_FOUND, as long as we don't close the server handle, + // or disconnect the client with DisconnectNamedPipe. syscall.Close(h2) l := &win32PipeListener{ firstHandle: h, diff --git a/vendor/github.com/Microsoft/hcsshim/README.md b/vendor/github.com/Microsoft/hcsshim/README.md index deca9a97e3..15b39181a5 100644 --- a/vendor/github.com/Microsoft/hcsshim/README.md +++ b/vendor/github.com/Microsoft/hcsshim/README.md @@ -1,12 +1,13 @@ # hcsshim -This package supports launching Windows Server containers from Go. It is -primarily used in the [Docker Engine](https://github.com/docker/docker) project, -but it can be freely used by other projects as well. +[![Build status](https://ci.appveyor.com/api/projects/status/nbcw28mnkqml0loa/branch/master?svg=true)](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master) +This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS). + +It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well. ## Contributing ---------------- + This project welcomes contributions and suggestions. Most contributions require you to agree to a Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us the rights to use your contribution. For details, visit https://cla.microsoft.com. @@ -19,6 +20,11 @@ This project has adopted the [Microsoft Open Source Code of Conduct](https://ope For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments. +## Dependencies + +This project requires Golang 1.9 or newer to build. + +For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements). ## Reporting Security Issues @@ -29,5 +35,7 @@ email to ensure we received your original message. Further information, includin [MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in the [Security TechCenter](https://technet.microsoft.com/en-us/security/default). -------------------------------------------- +For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet + +--------------- Copyright (c) 2018 Microsoft Corp. All rights reserved. diff --git a/vendor/github.com/Microsoft/hcsshim/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/activatelayer.go deleted file mode 100644 index 6d824d7a79..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/activatelayer.go +++ /dev/null @@ -1,28 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// ActivateLayer will find the layer with the given id and mount it's filesystem. -// For a read/write layer, the mounted filesystem will appear as a volume on the -// host, while a read-only layer is generally expected to be a no-op. -// An activated layer must later be deactivated via DeactivateLayer. -func ActivateLayer(info DriverInfo, id string) error { - title := "hcsshim::ActivateLayer " - logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) - - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = activateLayer(&infop, id) - if err != nil { - err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) - logrus.Error(err) - return err - } - - logrus.Debugf(title+" - succeeded id=%s flavour=%d", id, info.Flavour) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/container.go b/vendor/github.com/Microsoft/hcsshim/container.go index 3354f70efc..e142c31544 100644 --- a/vendor/github.com/Microsoft/hcsshim/container.go +++ b/vendor/github.com/Microsoft/hcsshim/container.go @@ -1,800 +1,192 @@ package hcsshim import ( - "encoding/json" "fmt" "os" - "sync" - "syscall" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/hcs" + "github.com/Microsoft/hcsshim/internal/mergemaps" + "github.com/Microsoft/hcsshim/internal/schema1" ) -var ( - defaultTimeout = time.Minute * 4 -) - -const ( - pendingUpdatesQuery = `{ "PropertyTypes" : ["PendingUpdates"]}` - statisticsQuery = `{ "PropertyTypes" : ["Statistics"]}` - processListQuery = `{ "PropertyTypes" : ["ProcessList"]}` - mappedVirtualDiskQuery = `{ "PropertyTypes" : ["MappedVirtualDisk"]}` -) - -type container struct { - handleLock sync.RWMutex - handle hcsSystem - id string - callbackNumber uintptr -} - // ContainerProperties holds the properties for a container and the processes running in that container -type ContainerProperties struct { - ID string `json:"Id"` - Name string - SystemType string - Owner string - SiloGUID string `json:"SiloGuid,omitempty"` - RuntimeID string `json:"RuntimeId,omitempty"` - IsRuntimeTemplate bool `json:",omitempty"` - RuntimeImagePath string `json:",omitempty"` - Stopped bool `json:",omitempty"` - ExitType string `json:",omitempty"` - AreUpdatesPending bool `json:",omitempty"` - ObRoot string `json:",omitempty"` - Statistics Statistics `json:",omitempty"` - ProcessList []ProcessListItem `json:",omitempty"` - MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"` -} +type ContainerProperties = schema1.ContainerProperties // MemoryStats holds the memory statistics for a container -type MemoryStats struct { - UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` - UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` - UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` -} +type MemoryStats = schema1.MemoryStats // ProcessorStats holds the processor statistics for a container -type ProcessorStats struct { - TotalRuntime100ns uint64 `json:",omitempty"` - RuntimeUser100ns uint64 `json:",omitempty"` - RuntimeKernel100ns uint64 `json:",omitempty"` -} +type ProcessorStats = schema1.ProcessorStats // StorageStats holds the storage statistics for a container -type StorageStats struct { - ReadCountNormalized uint64 `json:",omitempty"` - ReadSizeBytes uint64 `json:",omitempty"` - WriteCountNormalized uint64 `json:",omitempty"` - WriteSizeBytes uint64 `json:",omitempty"` -} +type StorageStats = schema1.StorageStats // NetworkStats holds the network statistics for a container -type NetworkStats struct { - BytesReceived uint64 `json:",omitempty"` - BytesSent uint64 `json:",omitempty"` - PacketsReceived uint64 `json:",omitempty"` - PacketsSent uint64 `json:",omitempty"` - DroppedPacketsIncoming uint64 `json:",omitempty"` - DroppedPacketsOutgoing uint64 `json:",omitempty"` - EndpointId string `json:",omitempty"` - InstanceId string `json:",omitempty"` -} +type NetworkStats = schema1.NetworkStats // Statistics is the structure returned by a statistics call on a container -type Statistics struct { - Timestamp time.Time `json:",omitempty"` - ContainerStartTime time.Time `json:",omitempty"` - Uptime100ns uint64 `json:",omitempty"` - Memory MemoryStats `json:",omitempty"` - Processor ProcessorStats `json:",omitempty"` - Storage StorageStats `json:",omitempty"` - Network []NetworkStats `json:",omitempty"` -} +type Statistics = schema1.Statistics // ProcessList is the structure of an item returned by a ProcessList call on a container -type ProcessListItem struct { - CreateTimestamp time.Time `json:",omitempty"` - ImageName string `json:",omitempty"` - KernelTime100ns uint64 `json:",omitempty"` - MemoryCommitBytes uint64 `json:",omitempty"` - MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"` - MemoryWorkingSetSharedBytes uint64 `json:",omitempty"` - ProcessId uint32 `json:",omitempty"` - UserTime100ns uint64 `json:",omitempty"` -} +type ProcessListItem = schema1.ProcessListItem // MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container -type MappedVirtualDiskController struct { - MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"` -} +type MappedVirtualDiskController = schema1.MappedVirtualDiskController // Type of Request Support in ModifySystem -type RequestType string +type RequestType = schema1.RequestType // Type of Resource Support in ModifySystem -type ResourceType string +type ResourceType = schema1.ResourceType // RequestType const const ( - Add RequestType = "Add" - Remove RequestType = "Remove" - Network ResourceType = "Network" + Add = schema1.Add + Remove = schema1.Remove + Network = schema1.Network ) // ResourceModificationRequestResponse is the structure used to send request to the container to modify the system // Supported resource types are Network and Request Types are Add/Remove -type ResourceModificationRequestResponse struct { - Resource ResourceType `json:"ResourceType"` - Data interface{} `json:"Settings"` - Request RequestType `json:"RequestType,omitempty"` +type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse + +type container struct { + system *hcs.System } -// createContainerAdditionalJSON is read from the environment at initialisation +// createComputeSystemAdditionalJSON is read from the environment at initialisation // time. It allows an environment variable to define additional JSON which -// is merged in the CreateContainer call to HCS. -var createContainerAdditionalJSON string +// is merged in the CreateComputeSystem call to HCS. +var createContainerAdditionalJSON []byte func init() { - createContainerAdditionalJSON = os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON") + createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON")) } // CreateContainer creates a new container with the given configuration but does not start it. func CreateContainer(id string, c *ContainerConfig) (Container, error) { - return createContainerWithJSON(id, c, "") -} - -// CreateContainerWithJSON creates a new container with the given configuration but does not start it. -// It is identical to CreateContainer except that optional additional JSON can be merged before passing to HCS. -func CreateContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) { - return createContainerWithJSON(id, c, additionalJSON) -} - -func createContainerWithJSON(id string, c *ContainerConfig, additionalJSON string) (Container, error) { - operation := "CreateContainer" - title := "HCSShim::" + operation - - container := &container{ - id: id, - } - - configurationb, err := json.Marshal(c) + fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON) if err != nil { - return nil, err + return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) } - configuration := string(configurationb) - logrus.Debugf(title+" id=%s config=%s", id, configuration) - - // Merge any additional JSON. Priority is given to what is passed in explicitly, - // falling back to what's set in the environment. - if additionalJSON == "" && createContainerAdditionalJSON != "" { - additionalJSON = createContainerAdditionalJSON - } - if additionalJSON != "" { - configurationMap := map[string]interface{}{} - if err := json.Unmarshal([]byte(configuration), &configurationMap); err != nil { - return nil, fmt.Errorf("failed to unmarshal %s: %s", configuration, err) - } - - additionalMap := map[string]interface{}{} - if err := json.Unmarshal([]byte(additionalJSON), &additionalMap); err != nil { - return nil, fmt.Errorf("failed to unmarshal %s: %s", additionalJSON, err) - } - - mergedMap := mergeMaps(additionalMap, configurationMap) - mergedJSON, err := json.Marshal(mergedMap) - if err != nil { - return nil, fmt.Errorf("failed to marshal merged configuration map %+v: %s", mergedMap, err) - } - - configuration = string(mergedJSON) - logrus.Debugf(title+" id=%s merged config=%s", id, configuration) - } - - var ( - resultp *uint16 - identity syscall.Handle - ) - createError := hcsCreateComputeSystem(id, configuration, identity, &container.handle, &resultp) - - if createError == nil || IsPending(createError) { - if err := container.registerCallback(); err != nil { - // Terminate the container if it still exists. We're okay to ignore a failure here. - container.Terminate() - return nil, makeContainerError(container, operation, "", err) - } - } - - err = processAsyncHcsResult(createError, resultp, container.callbackNumber, hcsNotificationSystemCreateCompleted, &defaultTimeout) + system, err := hcs.CreateComputeSystem(id, fullConfig) if err != nil { - if err == ErrTimeout { - // Terminate the container if it still exists. We're okay to ignore a failure here. - container.Terminate() - } - return nil, makeContainerError(container, operation, configuration, err) - } - - logrus.Debugf(title+" succeeded id=%s handle=%d", id, container.handle) - return container, nil -} - -// mergeMaps recursively merges map `fromMap` into map `ToMap`. Any pre-existing values -// in ToMap are overwritten. Values in fromMap are added to ToMap. -// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang -func mergeMaps(fromMap, ToMap interface{}) interface{} { - switch fromMap := fromMap.(type) { - case map[string]interface{}: - ToMap, ok := ToMap.(map[string]interface{}) - if !ok { - return fromMap - } - for keyToMap, valueToMap := range ToMap { - if valueFromMap, ok := fromMap[keyToMap]; ok { - fromMap[keyToMap] = mergeMaps(valueFromMap, valueToMap) - } else { - fromMap[keyToMap] = valueToMap - } - } - case nil: - // merge(nil, map[string]interface{...}) -> map[string]interface{...} - ToMap, ok := ToMap.(map[string]interface{}) - if ok { - return ToMap - } + return nil, err } - return fromMap + return &container{system}, err } // OpenContainer opens an existing container by ID. func OpenContainer(id string) (Container, error) { - operation := "OpenContainer" - title := "HCSShim::" + operation - logrus.Debugf(title+" id=%s", id) - - container := &container{ - id: id, - } - - var ( - handle hcsSystem - resultp *uint16 - ) - err := hcsOpenComputeSystem(id, &handle, &resultp) - err = processHcsResult(err, resultp) + system, err := hcs.OpenComputeSystem(id) if err != nil { - return nil, makeContainerError(container, operation, "", err) - } - - container.handle = handle - - if err := container.registerCallback(); err != nil { - return nil, makeContainerError(container, operation, "", err) + return nil, err } - - logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle) - return container, nil + return &container{system}, err } // GetContainers gets a list of the containers on the system that match the query func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { - operation := "GetContainers" - title := "HCSShim::" + operation - - queryb, err := json.Marshal(q) - if err != nil { - return nil, err - } - - query := string(queryb) - logrus.Debugf(title+" query=%s", query) - - var ( - resultp *uint16 - computeSystemsp *uint16 - ) - err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return nil, err - } - - if computeSystemsp == nil { - return nil, ErrUnexpectedValue - } - computeSystemsRaw := convertAndFreeCoTaskMemBytes(computeSystemsp) - computeSystems := []ContainerProperties{} - if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { - return nil, err - } - - logrus.Debugf(title + " succeeded") - return computeSystems, nil + return hcs.GetComputeSystems(q) } // Start synchronously starts the container. func (container *container) Start() error { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Start" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - var resultp *uint16 - err := hcsStartComputeSystem(container.handle, "", &resultp) - err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemStartCompleted, &defaultTimeout) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil + return convertSystemError(container.system.Start(), container) } -// Shutdown requests a container shutdown, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. +// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. func (container *container) Shutdown() error { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Shutdown" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - var resultp *uint16 - err := hcsShutdownComputeSystem(container.handle, "", &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil + return convertSystemError(container.system.Shutdown(), container) } -// Terminate requests a container terminate, if IsPending() on the error returned is true, -// it may not actually be shut down until Wait() succeeds. +// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. func (container *container) Terminate() error { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Terminate" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - var resultp *uint16 - err := hcsTerminateComputeSystem(container.handle, "", &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil + return convertSystemError(container.system.Terminate(), container) } -// Wait synchronously waits for the container to shutdown or terminate. +// Waits synchronously waits for the container to shutdown or terminate. func (container *container) Wait() error { - operation := "Wait" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, nil) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil + return convertSystemError(container.system.Wait(), container) } -// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. -// If the timeout expires, IsTimeout(err) == true -func (container *container) WaitTimeout(timeout time.Duration) error { - operation := "WaitTimeout" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - err := waitForNotification(container.callbackNumber, hcsNotificationSystemExited, &timeout) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil +// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It +// returns false if timeout occurs. +func (container *container) WaitTimeout(t time.Duration) error { + return convertSystemError(container.system.WaitTimeout(t), container) } -func (container *container) properties(query string) (*ContainerProperties, error) { - var ( - resultp *uint16 - propertiesp *uint16 - ) - err := hcsGetComputeSystemProperties(container.handle, query, &propertiesp, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return nil, err - } +// Pause pauses the execution of a container. +func (container *container) Pause() error { + return convertSystemError(container.system.Pause(), container) +} - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp) - properties := &ContainerProperties{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, err - } - return properties, nil +// Resume resumes the execution of a container. +func (container *container) Resume() error { + return convertSystemError(container.system.Resume(), container) } // HasPendingUpdates returns true if the container has updates pending to install func (container *container) HasPendingUpdates() (bool, error) { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "HasPendingUpdates" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return false, makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - properties, err := container.properties(pendingUpdatesQuery) - if err != nil { - return false, makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return properties.AreUpdatesPending, nil + return false, nil } -// Statistics returns statistics for the container +// Statistics returns statistics for the container. This is a legacy v1 call func (container *container) Statistics() (Statistics, error) { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Statistics" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return Statistics{}, makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - properties, err := container.properties(statisticsQuery) + properties, err := container.system.Properties(schema1.PropertyTypeStatistics) if err != nil { - return Statistics{}, makeContainerError(container, operation, "", err) + return Statistics{}, convertSystemError(err, container) } - logrus.Debugf(title+" succeeded id=%s", container.id) return properties.Statistics, nil } -// ProcessList returns an array of ProcessListItems for the container +// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call func (container *container) ProcessList() ([]ProcessListItem, error) { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "ProcessList" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - properties, err := container.properties(processListQuery) + properties, err := container.system.Properties(schema1.PropertyTypeProcessList) if err != nil { - return nil, makeContainerError(container, operation, "", err) + return nil, convertSystemError(err, container) } - logrus.Debugf(title+" succeeded id=%s", container.id) return properties.ProcessList, nil } -// MappedVirtualDisks returns a map of the controllers and the disks mapped -// to a container. -// -// Example of JSON returned by the query. -//{ -// "Id":"1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3_svm", -// "SystemType":"Container", -// "RuntimeOsType":"Linux", -// "RuntimeId":"00000000-0000-0000-0000-000000000000", -// "State":"Running", -// "MappedVirtualDiskControllers":{ -// "0":{ -// "MappedVirtualDisks":{ -// "2":{ -// "HostPath":"C:\\lcow\\lcow\\scratch\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3.vhdx", -// "ContainerPath":"/mnt/gcs/LinuxServiceVM/scratch", -// "Lun":2, -// "CreateInUtilityVM":true -// }, -// "3":{ -// "HostPath":"C:\\lcow\\lcow\\1126e8d7d279c707a666972a15976371d365eaf622c02cea2c442b84f6f550a3\\sandbox.vhdx", -// "Lun":3, -// "CreateInUtilityVM":true, -// "AttachOnly":true -// } -// } -// } -// } -//} +// This is a legacy v1 call func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "MappedVirtualDiskList" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - properties, err := container.properties(mappedVirtualDiskQuery) + properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk) if err != nil { - return nil, makeContainerError(container, operation, "", err) + return nil, convertSystemError(err, container) } - logrus.Debugf(title+" succeeded id=%s", container.id) return properties.MappedVirtualDiskControllers, nil } -// Pause pauses the execution of the container. This feature is not enabled in TP5. -func (container *container) Pause() error { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Pause" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - var resultp *uint16 - err := hcsPauseComputeSystem(container.handle, "", &resultp) - err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemPauseCompleted, &defaultTimeout) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil -} - -// Resume resumes the execution of the container. This feature is not enabled in TP5. -func (container *container) Resume() error { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Resume" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - if container.handle == 0 { - return makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - var resultp *uint16 - err := hcsResumeComputeSystem(container.handle, "", &resultp) - err = processAsyncHcsResult(err, resultp, container.callbackNumber, hcsNotificationSystemResumeCompleted, &defaultTimeout) - if err != nil { - return makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil -} - // CreateProcess launches a new process within the container. func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "CreateProcess" - title := "HCSShim::Container::" + operation - var ( - processInfo hcsProcessInformation - processHandle hcsProcess - resultp *uint16 - ) - - if container.handle == 0 { - return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - // If we are not emulating a console, ignore any console size passed to us - if !c.EmulateConsole { - c.ConsoleSize[0] = 0 - c.ConsoleSize[1] = 0 - } - - configurationb, err := json.Marshal(c) + p, err := container.system.CreateProcess(c) if err != nil { - return nil, makeContainerError(container, operation, "", err) + return nil, convertSystemError(err, container) } - - configuration := string(configurationb) - logrus.Debugf(title+" id=%s config=%s", container.id, configuration) - - err = hcsCreateProcess(container.handle, configuration, &processInfo, &processHandle, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return nil, makeContainerError(container, operation, configuration, err) - } - - process := &process{ - handle: processHandle, - processID: int(processInfo.ProcessId), - container: container, - cachedPipes: &cachedPipes{ - stdIn: processInfo.StdInput, - stdOut: processInfo.StdOutput, - stdErr: processInfo.StdError, - }, - } - - if err := process.registerCallback(); err != nil { - return nil, makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s processid=%d", container.id, process.processID) - return process, nil + return &process{p}, nil } // OpenProcess gets an interface to an existing process within the container. func (container *container) OpenProcess(pid int) (Process, error) { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "OpenProcess" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s, processid=%d", container.id, pid) - var ( - processHandle hcsProcess - resultp *uint16 - ) - - if container.handle == 0 { - return nil, makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - err := hcsOpenProcess(container.handle, uint32(pid), &processHandle, &resultp) - err = processHcsResult(err, resultp) + p, err := container.system.OpenProcess(pid) if err != nil { - return nil, makeContainerError(container, operation, "", err) + return nil, convertSystemError(err, container) } - - process := &process{ - handle: processHandle, - processID: pid, - container: container, - } - - if err := process.registerCallback(); err != nil { - return nil, makeContainerError(container, operation, "", err) - } - - logrus.Debugf(title+" succeeded id=%s processid=%s", container.id, process.processID) - return process, nil + return &process{p}, nil } // Close cleans up any state associated with the container but does not terminate or wait for it. func (container *container) Close() error { - container.handleLock.Lock() - defer container.handleLock.Unlock() - operation := "Close" - title := "HCSShim::Container::" + operation - logrus.Debugf(title+" id=%s", container.id) - - // Don't double free this - if container.handle == 0 { - return nil - } - - if err := container.unregisterCallback(); err != nil { - return makeContainerError(container, operation, "", err) - } - - if err := hcsCloseComputeSystem(container.handle); err != nil { - return makeContainerError(container, operation, "", err) - } - - container.handle = 0 - - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil -} - -func (container *container) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), - } - - callbackMapLock.Lock() - callbackNumber := nextCallback - nextCallback++ - callbackMap[callbackNumber] = context - callbackMapLock.Unlock() - - var callbackHandle hcsCallback - err := hcsRegisterComputeSystemCallback(container.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) - if err != nil { - return err - } - context.handle = callbackHandle - container.callbackNumber = callbackNumber - - return nil -} - -func (container *container) unregisterCallback() error { - callbackNumber := container.callbackNumber - - callbackMapLock.RLock() - context := callbackMap[callbackNumber] - callbackMapLock.RUnlock() - - if context == nil { - return nil - } - - handle := context.handle - - if handle == 0 { - return nil - } - - // hcsUnregisterComputeSystemCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterComputeSystemCallback(handle) - if err != nil { - return err - } - - closeChannels(context.channels) - - callbackMapLock.Lock() - callbackMap[callbackNumber] = nil - callbackMapLock.Unlock() - - handle = 0 - - return nil + return convertSystemError(container.system.Close(), container) } -// Modifies the System by sending a request to HCS +// Modify the System func (container *container) Modify(config *ResourceModificationRequestResponse) error { - container.handleLock.RLock() - defer container.handleLock.RUnlock() - operation := "Modify" - title := "HCSShim::Container::" + operation - - if container.handle == 0 { - return makeContainerError(container, operation, "", ErrAlreadyClosed) - } - - requestJSON, err := json.Marshal(config) - if err != nil { - return err - } - - requestString := string(requestJSON) - logrus.Debugf(title+" id=%s request=%s", container.id, requestString) - - var resultp *uint16 - err = hcsModifyComputeSystem(container.handle, requestString, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return makeContainerError(container, operation, "", err) - } - logrus.Debugf(title+" succeeded id=%s", container.id) - return nil + return convertSystemError(container.system.Modify(config), container) } diff --git a/vendor/github.com/Microsoft/hcsshim/createlayer.go b/vendor/github.com/Microsoft/hcsshim/createlayer.go deleted file mode 100644 index 035d9c3947..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/createlayer.go +++ /dev/null @@ -1,27 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// CreateLayer creates a new, empty, read-only layer on the filesystem based on -// the parent layer provided. -func CreateLayer(info DriverInfo, id, parent string) error { - title := "hcsshim::CreateLayer " - logrus.Debugf(title+"Flavour %d ID %s parent %s", info.Flavour, id, parent) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = createLayer(&infop, id, parent) - if err != nil { - err = makeErrorf(err, title, "id=%s parent=%s flavour=%d", id, parent, info.Flavour) - logrus.Error(err) - return err - } - - logrus.Debugf(title+" - succeeded id=%s parent=%s flavour=%d", id, parent, info.Flavour) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go b/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go deleted file mode 100644 index 7a6a8854cf..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/createsandboxlayer.go +++ /dev/null @@ -1,35 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// CreateSandboxLayer creates and populates new read-write layer for use by a container. -// This requires both the id of the direct parent layer, as well as the full list -// of paths to all parent layers up to the base (and including the direct parent -// whose id was provided). -func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { - title := "hcsshim::CreateSandboxLayer " - logrus.Debugf(title+"layerId %s parentId %s", layerId, parentId) - - // Generate layer descriptors - layers, err := layerPathsToDescriptors(parentLayerPaths) - if err != nil { - return err - } - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = createSandboxLayer(&infop, layerId, parentId, layers) - if err != nil { - err = makeErrorf(err, title, "layerId=%s parentId=%s", layerId, parentId) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"- succeeded layerId=%s parentId=%s", layerId, parentId) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go deleted file mode 100644 index fd785030fb..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/deactivatelayer.go +++ /dev/null @@ -1,26 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// DeactivateLayer will dismount a layer that was mounted via ActivateLayer. -func DeactivateLayer(info DriverInfo, id string) error { - title := "hcsshim::DeactivateLayer " - logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = deactivateLayer(&infop, id) - if err != nil { - err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/destroylayer.go deleted file mode 100644 index b1e3b89fc7..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/destroylayer.go +++ /dev/null @@ -1,27 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// DestroyLayer will remove the on-disk files representing the layer with the given -// id, including that layer's containing folder, if any. -func DestroyLayer(info DriverInfo, id string) error { - title := "hcsshim::DestroyLayer " - logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = destroyLayer(&infop, id) - if err != nil { - err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"succeeded flavour=%d id=%s", info.Flavour, id) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/errors.go b/vendor/github.com/Microsoft/hcsshim/errors.go index c0c6cac87c..63efa23c7a 100644 --- a/vendor/github.com/Microsoft/hcsshim/errors.go +++ b/vendor/github.com/Microsoft/hcsshim/errors.go @@ -1,92 +1,83 @@ package hcsshim import ( - "errors" "fmt" "syscall" + + "github.com/Microsoft/hcsshim/internal/hns" + + "github.com/Microsoft/hcsshim/internal/hcs" + "github.com/Microsoft/hcsshim/internal/hcserror" ) var ( - // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists - ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e) + // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist + ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist // ErrElementNotFound is an error encountered when the object being referenced does not exist - ErrElementNotFound = syscall.Errno(0x490) + ErrElementNotFound = hcs.ErrElementNotFound // ErrElementNotFound is an error encountered when the object being referenced does not exist - ErrNotSupported = syscall.Errno(0x32) + ErrNotSupported = hcs.ErrNotSupported // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported // decimal -2147024883 / hex 0x8007000d - ErrInvalidData = syscall.Errno(0xd) + ErrInvalidData = hcs.ErrInvalidData // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed - ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed") + ErrHandleClose = hcs.ErrHandleClose // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method - ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed") + ErrAlreadyClosed = hcs.ErrAlreadyClosed // ErrInvalidNotificationType is an error encountered when an invalid notification type is used - ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type") + ErrInvalidNotificationType = hcs.ErrInvalidNotificationType // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation - ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation") + ErrInvalidProcessState = hcs.ErrInvalidProcessState // ErrTimeout is an error encountered when waiting on a notification times out - ErrTimeout = errors.New("hcsshim: timeout waiting for notification") + ErrTimeout = hcs.ErrTimeout // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for // a different expected notification - ErrUnexpectedContainerExit = errors.New("unexpected container exit") + ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service // is lost while waiting for a notification - ErrUnexpectedProcessAbort = errors.New("lost communication with compute service") + ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort // ErrUnexpectedValue is an error encountered when hcs returns an invalid value - ErrUnexpectedValue = errors.New("unexpected value returned from hcs") + ErrUnexpectedValue = hcs.ErrUnexpectedValue // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container - ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) + ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously - ErrVmcomputeOperationPending = syscall.Errno(0xC0370103) + ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation - ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105) + ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState // ErrProcNotFound is an error encountered when the the process cannot be found - ErrProcNotFound = syscall.Errno(0x7f) + ErrProcNotFound = hcs.ErrProcNotFound // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. - ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5) + ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management - ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d) + ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message - ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b) + ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage // ErrNotSupported is an error encountered when hcs doesn't support the request - ErrPlatformNotSupported = errors.New("unsupported platform request") + ErrPlatformNotSupported = hcs.ErrPlatformNotSupported ) -type EndpointNotFoundError struct { - EndpointName string -} - -func (e EndpointNotFoundError) Error() string { - return fmt.Sprintf("Endpoint %s not found", e.EndpointName) -} - -type NetworkNotFoundError struct { - NetworkName string -} - -func (e NetworkNotFoundError) Error() string { - return fmt.Sprintf("Network %s not found", e.NetworkName) -} +type EndpointNotFoundError = hns.EndpointNotFoundError +type NetworkNotFoundError = hns.NetworkNotFoundError // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { @@ -94,6 +85,7 @@ type ProcessError struct { Operation string ExtraInfo string Err error + Events []hcs.ErrorEvent } // ContainerError is an error encountered in HCS during an operation on a Container object @@ -102,6 +94,7 @@ type ContainerError struct { Operation string ExtraInfo string Err error + Events []hcs.ErrorEvent } func (e *ContainerError) Error() string { @@ -113,7 +106,7 @@ func (e *ContainerError) Error() string { return "unexpected nil container for error: " + e.Err.Error() } - s := "container " + e.Container.id + s := "container " + e.Container.system.ID() if e.Operation != "" { s += " encountered an error during " + e.Operation @@ -123,11 +116,15 @@ func (e *ContainerError) Error() string { case nil: break case syscall.Errno: - s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err)) + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err)) default: s += fmt.Sprintf(": %s", e.Err.Error()) } + for _, ev := range e.Events { + s += "\n" + ev.String() + } + if e.ExtraInfo != "" { s += " extra info: " + e.ExtraInfo } @@ -153,12 +150,7 @@ func (e *ProcessError) Error() string { return "Unexpected nil process for error: " + e.Err.Error() } - s := fmt.Sprintf("process %d", e.Process.processID) - - if e.Process.container != nil { - s += " in container " + e.Process.container.id - } - + s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID()) if e.Operation != "" { s += " encountered an error during " + e.Operation } @@ -167,11 +159,15 @@ func (e *ProcessError) Error() string { case nil: break case syscall.Errno: - s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, win32FromError(e.Err)) + s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err)) default: s += fmt.Sprintf(": %s", e.Err.Error()) } + for _, ev := range e.Events { + s += "\n" + ev.String() + } + return s } @@ -189,37 +185,31 @@ func makeProcessError(process *process, operation string, extraInfo string, err // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // will currently return true when the error is ErrElementNotFound or ErrProcNotFound. func IsNotExist(err error) bool { - err = getInnerError(err) if _, ok := err.(EndpointNotFoundError); ok { return true } if _, ok := err.(NetworkNotFoundError); ok { return true } - return err == ErrComputeSystemDoesNotExist || - err == ErrElementNotFound || - err == ErrProcNotFound + return hcs.IsNotExist(getInnerError(err)) } // IsAlreadyClosed checks if an error is caused by the Container or Process having been // already closed by a call to the Close() method. func IsAlreadyClosed(err error) bool { - err = getInnerError(err) - return err == ErrAlreadyClosed + return hcs.IsAlreadyClosed(getInnerError(err)) } // IsPending returns a boolean indicating whether the error is that // the requested operation is being completed in the background. func IsPending(err error) bool { - err = getInnerError(err) - return err == ErrVmcomputeOperationPending + return hcs.IsPending(getInnerError(err)) } // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { - err = getInnerError(err) - return err == ErrTimeout + return hcs.IsTimeout(getInnerError(err)) } // IsAlreadyStopped returns a boolean indicating whether the error is caused by @@ -228,10 +218,7 @@ func IsTimeout(err error) bool { // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // will currently return true when the error is ErrElementNotFound or ErrProcNotFound. func IsAlreadyStopped(err error) bool { - err = getInnerError(err) - return err == ErrVmcomputeAlreadyStopped || - err == ErrElementNotFound || - err == ErrProcNotFound + return hcs.IsAlreadyStopped(getInnerError(err)) } // IsNotSupported returns a boolean indicating whether the error is caused by @@ -240,12 +227,7 @@ func IsAlreadyStopped(err error) bool { // ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage // is thrown from the Platform func IsNotSupported(err error) bool { - err = getInnerError(err) - // If Platform doesn't recognize or support the request sent, below errors are seen - return err == ErrVmcomputeInvalidJSON || - err == ErrInvalidData || - err == ErrNotSupported || - err == ErrVmcomputeUnknownMessage + return hcs.IsNotSupported(getInnerError(err)) } func getInnerError(err error) error { @@ -259,3 +241,17 @@ func getInnerError(err error) error { } return err } + +func convertSystemError(err error, c *container) error { + if serr, ok := err.(*hcs.SystemError); ok { + return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events} + } + return err +} + +func convertProcessError(err error, p *process) error { + if perr, ok := err.(*hcs.ProcessError); ok { + return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events} + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go b/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go deleted file mode 100644 index 6946c6a84f..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/expandsandboxsize.go +++ /dev/null @@ -1,26 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// ExpandSandboxSize expands the size of a layer to at least size bytes. -func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error { - title := "hcsshim::ExpandSandboxSize " - logrus.Debugf(title+"layerId=%s size=%d", layerId, size) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = expandSandboxSize(&infop, layerId, size) - if err != nil { - err = makeErrorf(err, title, "layerId=%s size=%d", layerId, size) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"- succeeded layerId=%s size=%d", layerId, size) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/guid.go b/vendor/github.com/Microsoft/hcsshim/guid.go deleted file mode 100644 index 620aba123c..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/guid.go +++ /dev/null @@ -1,19 +0,0 @@ -package hcsshim - -import ( - "crypto/sha1" - "fmt" -) - -type GUID [16]byte - -func NewGUID(source string) *GUID { - h := sha1.Sum([]byte(source)) - var g GUID - copy(g[0:], h[0:16]) - return &g -} - -func (g *GUID) ToString() string { - return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) -} diff --git a/vendor/github.com/Microsoft/hcsshim/hcsshim.go b/vendor/github.com/Microsoft/hcsshim/hcsshim.go index b65953191c..ceb3ac85ee 100644 --- a/vendor/github.com/Microsoft/hcsshim/hcsshim.go +++ b/vendor/github.com/Microsoft/hcsshim/hcsshim.go @@ -4,80 +4,20 @@ package hcsshim import ( - "fmt" "syscall" - "unsafe" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/hcserror" ) -//go:generate go run mksyscall_windows.go -output zhcsshim.go hcsshim.go safeopen.go +//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go -//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree //sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId -//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? -//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? -//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer? -//sys createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer? -//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize? -//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer? -//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer? -//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer? -//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath? -//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages? -//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer? -//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists? -//sys nameToGuid(name string, guid *GUID) (hr error) = vmcompute.NameToGuid? -//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer? -//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer? -//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage? -//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage? - -//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin? -//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext? -//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite? -//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd? - -//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin? -//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext? -//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead? -//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd? - -//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? -//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? -//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? -//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? -//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? -//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? -//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? -//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? -//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? -//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? -//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? -//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? -//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? - -//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? -//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? -//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? -//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? -//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? -//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? -//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? -//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? -//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? -//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? - -//sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings? - -//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? - const ( // Specific user-visible exit codes WaitErrExecFailed = 32767 - ERROR_GEN_FAILURE = syscall.Errno(31) + ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115) WSAEINVAL = syscall.Errno(10022) @@ -85,82 +25,4 @@ const ( TimeoutInfinite = 0xFFFFFFFF ) -type HcsError struct { - title string - rest string - Err error -} - -type hcsSystem syscall.Handle -type hcsProcess syscall.Handle -type hcsCallback syscall.Handle - -type hcsProcessInformation struct { - ProcessId uint32 - Reserved uint32 - StdInput syscall.Handle - StdOutput syscall.Handle - StdError syscall.Handle -} - -func makeError(err error, title, rest string) error { - // Pass through DLL errors directly since they do not originate from HCS. - if _, ok := err.(*syscall.DLLError); ok { - return err - } - return &HcsError{title, rest, err} -} - -func makeErrorf(err error, title, format string, a ...interface{}) error { - return makeError(err, title, fmt.Sprintf(format, a...)) -} - -func win32FromError(err error) uint32 { - if herr, ok := err.(*HcsError); ok { - return win32FromError(herr.Err) - } - if code, ok := err.(syscall.Errno); ok { - return uint32(code) - } - return uint32(ERROR_GEN_FAILURE) -} - -func win32FromHresult(hr uintptr) uintptr { - if hr&0x1fff0000 == 0x00070000 { - return hr & 0xffff - } - return hr -} - -func (e *HcsError) Error() string { - s := e.title - if len(s) > 0 && s[len(s)-1] != ' ' { - s += " " - } - s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, win32FromError(e.Err)) - if e.rest != "" { - if e.rest[0] != ' ' { - s += " " - } - s += e.rest - } - return s -} - -func convertAndFreeCoTaskMemString(buffer *uint16) string { - str := syscall.UTF16ToString((*[1 << 30]uint16)(unsafe.Pointer(buffer))[:]) - coTaskMemFree(unsafe.Pointer(buffer)) - return str -} - -func convertAndFreeCoTaskMemBytes(buffer *uint16) []byte { - return []byte(convertAndFreeCoTaskMemString(buffer)) -} - -func processHcsResult(err error, resultp *uint16) error { - if resultp != nil { - result := convertAndFreeCoTaskMemString(resultp) - logrus.Debugf("Result: %s", result) - } - return err -} +type HcsError = hcserror.HcsError diff --git a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go index 90689cb1ee..eb013d2c42 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go @@ -1,29 +1,14 @@ package hcsshim import ( - "encoding/json" - "net" - - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/hns" ) // HNSEndpoint represents a network endpoint in HNS -type HNSEndpoint struct { - Id string `json:"ID,omitempty"` - Name string `json:",omitempty"` - VirtualNetwork string `json:",omitempty"` - VirtualNetworkName string `json:",omitempty"` - Policies []json.RawMessage `json:",omitempty"` - MacAddress string `json:",omitempty"` - IPAddress net.IP `json:",omitempty"` - DNSSuffix string `json:",omitempty"` - DNSServerList string `json:",omitempty"` - GatewayAddress string `json:",omitempty"` - EnableInternalDNS bool `json:",omitempty"` - DisableICC bool `json:",omitempty"` - PrefixLength uint8 `json:",omitempty"` - IsRemoteEndpoint bool `json:",omitempty"` -} +type HNSEndpoint = hns.HNSEndpoint + +// Namespace represents a Compartment. +type Namespace = hns.Namespace //SystemType represents the type of the system on which actions are done type SystemType string @@ -37,39 +22,19 @@ const ( // EndpointAttachDetachRequest is the structure used to send request to the container to modify the system // Supported resource types are Network and Request Types are Add/Remove -type EndpointAttachDetachRequest struct { - ContainerID string `json:"ContainerId,omitempty"` - SystemType SystemType `json:"SystemType"` - CompartmentID uint16 `json:"CompartmentId,omitempty"` - VirtualNICName string `json:"VirtualNicName,omitempty"` -} +type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest // EndpointResquestResponse is object to get the endpoint request response -type EndpointResquestResponse struct { - Success bool - Error string -} +type EndpointResquestResponse = hns.EndpointResquestResponse // HNSEndpointRequest makes a HNS call to modify/query a network endpoint func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { - endpoint := &HNSEndpoint{} - err := hnsCall(method, "/endpoints/"+path, request, &endpoint) - if err != nil { - return nil, err - } - - return endpoint, nil + return hns.HNSEndpointRequest(method, path, request) } // HNSListEndpointRequest makes a HNS call to query the list of available endpoints func HNSListEndpointRequest() ([]HNSEndpoint, error) { - var endpoint []HNSEndpoint - err := hnsCall("GET", "/endpoints/", "", &endpoint) - if err != nil { - return nil, err - } - - return endpoint, nil + return hns.HNSListEndpointRequest() } // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container @@ -120,204 +85,10 @@ func modifyNetworkEndpoint(containerID string, endpointID string, request Reques // GetHNSEndpointByID get the Endpoint by ID func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { - return HNSEndpointRequest("GET", endpointID, "") + return hns.GetHNSEndpointByID(endpointID) } // GetHNSEndpointByName gets the endpoint filtered by Name func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { - hnsResponse, err := HNSListEndpointRequest() - if err != nil { - return nil, err - } - for _, hnsEndpoint := range hnsResponse { - if hnsEndpoint.Name == endpointName { - return &hnsEndpoint, nil - } - } - return nil, EndpointNotFoundError{EndpointName: endpointName} -} - -// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods -func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { - operation := "Create" - title := "HCSShim::HNSEndpoint::" + operation - logrus.Debugf(title+" id=%s", endpoint.Id) - - jsonString, err := json.Marshal(endpoint) - if err != nil { - return nil, err - } - return HNSEndpointRequest("POST", "", string(jsonString)) -} - -// Delete Endpoint by sending EndpointRequest to HNS -func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) { - operation := "Delete" - title := "HCSShim::HNSEndpoint::" + operation - logrus.Debugf(title+" id=%s", endpoint.Id) - - return HNSEndpointRequest("DELETE", endpoint.Id, "") -} - -// Update Endpoint -func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) { - operation := "Update" - title := "HCSShim::HNSEndpoint::" + operation - logrus.Debugf(title+" id=%s", endpoint.Id) - jsonString, err := json.Marshal(endpoint) - if err != nil { - return nil, err - } - err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint) - - return endpoint, err -} - -// ContainerHotAttach attaches an endpoint to a running container -func (endpoint *HNSEndpoint) ContainerHotAttach(containerID string) error { - operation := "ContainerHotAttach" - title := "HCSShim::HNSEndpoint::" + operation - logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID) - - return modifyNetworkEndpoint(containerID, endpoint.Id, Add) -} - -// ContainerHotDetach detaches an endpoint from a running container -func (endpoint *HNSEndpoint) ContainerHotDetach(containerID string) error { - operation := "ContainerHotDetach" - title := "HCSShim::HNSEndpoint::" + operation - logrus.Debugf(title+" id=%s, containerId=%s", endpoint.Id, containerID) - - return modifyNetworkEndpoint(containerID, endpoint.Id, Remove) -} - -// ApplyACLPolicy applies a set of ACL Policies on the Endpoint -func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error { - operation := "ApplyACLPolicy" - title := "HCSShim::HNSEndpoint::" + operation - logrus.Debugf(title+" id=%s", endpoint.Id) - - for _, policy := range policies { - if policy == nil { - continue - } - jsonString, err := json.Marshal(policy) - if err != nil { - return err - } - endpoint.Policies = append(endpoint.Policies, jsonString) - } - - _, err := endpoint.Update() - return err -} - -// ContainerAttach attaches an endpoint to container -func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error { - operation := "ContainerAttach" - title := "HCSShim::HNSEndpoint::" + operation - logrus.Debugf(title+" id=%s", endpoint.Id) - - requestMessage := &EndpointAttachDetachRequest{ - ContainerID: containerID, - CompartmentID: compartmentID, - SystemType: ContainerType, - } - response := &EndpointResquestResponse{} - jsonString, err := json.Marshal(requestMessage) - if err != nil { - return err - } - return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) -} - -// ContainerDetach detaches an endpoint from container -func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error { - operation := "ContainerDetach" - title := "HCSShim::HNSEndpoint::" + operation - logrus.Debugf(title+" id=%s", endpoint.Id) - - requestMessage := &EndpointAttachDetachRequest{ - ContainerID: containerID, - SystemType: ContainerType, - } - response := &EndpointResquestResponse{} - - jsonString, err := json.Marshal(requestMessage) - if err != nil { - return err - } - return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) -} - -// HostAttach attaches a nic on the host -func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error { - operation := "HostAttach" - title := "HCSShim::HNSEndpoint::" + operation - logrus.Debugf(title+" id=%s", endpoint.Id) - requestMessage := &EndpointAttachDetachRequest{ - CompartmentID: compartmentID, - SystemType: HostType, - } - response := &EndpointResquestResponse{} - - jsonString, err := json.Marshal(requestMessage) - if err != nil { - return err - } - return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) - -} - -// HostDetach detaches a nic on the host -func (endpoint *HNSEndpoint) HostDetach() error { - operation := "HostDetach" - title := "HCSShim::HNSEndpoint::" + operation - logrus.Debugf(title+" id=%s", endpoint.Id) - requestMessage := &EndpointAttachDetachRequest{ - SystemType: HostType, - } - response := &EndpointResquestResponse{} - - jsonString, err := json.Marshal(requestMessage) - if err != nil { - return err - } - return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) -} - -// VirtualMachineNICAttach attaches a endpoint to a virtual machine -func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error { - operation := "VirtualMachineNicAttach" - title := "HCSShim::HNSEndpoint::" + operation - logrus.Debugf(title+" id=%s", endpoint.Id) - requestMessage := &EndpointAttachDetachRequest{ - VirtualNICName: virtualMachineNICName, - SystemType: VirtualMachineType, - } - response := &EndpointResquestResponse{} - - jsonString, err := json.Marshal(requestMessage) - if err != nil { - return err - } - return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) -} - -// VirtualMachineNICDetach detaches a endpoint from a virtual machine -func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error { - operation := "VirtualMachineNicDetach" - title := "HCSShim::HNSEndpoint::" + operation - logrus.Debugf(title+" id=%s", endpoint.Id) - - requestMessage := &EndpointAttachDetachRequest{ - SystemType: VirtualMachineType, - } - response := &EndpointResquestResponse{} - - jsonString, err := json.Marshal(requestMessage) - if err != nil { - return err - } - return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) + return hns.GetHNSEndpointByName(endpointName) } diff --git a/vendor/github.com/Microsoft/hcsshim/hnsglobals.go b/vendor/github.com/Microsoft/hcsshim/hnsglobals.go new file mode 100644 index 0000000000..2b53819047 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnsglobals.go @@ -0,0 +1,16 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +type HNSGlobals = hns.HNSGlobals +type HNSVersion = hns.HNSVersion + +var ( + HNSVersion1803 = hns.HNSVersion1803 +) + +func GetHNSGlobals() (*HNSGlobals, error) { + return hns.GetHNSGlobals() +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go index 398583a4e4..f775fa1d07 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go +++ b/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go @@ -1,141 +1,36 @@ package hcsshim import ( - "encoding/json" - "net" - - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/hns" ) // Subnet is assoicated with a network and represents a list // of subnets available to the network -type Subnet struct { - AddressPrefix string `json:",omitempty"` - GatewayAddress string `json:",omitempty"` - Policies []json.RawMessage `json:",omitempty"` -} +type Subnet = hns.Subnet // MacPool is assoicated with a network and represents a list // of macaddresses available to the network -type MacPool struct { - StartMacAddress string `json:",omitempty"` - EndMacAddress string `json:",omitempty"` -} +type MacPool = hns.MacPool // HNSNetwork represents a network in HNS -type HNSNetwork struct { - Id string `json:"ID,omitempty"` - Name string `json:",omitempty"` - Type string `json:",omitempty"` - NetworkAdapterName string `json:",omitempty"` - SourceMac string `json:",omitempty"` - Policies []json.RawMessage `json:",omitempty"` - MacPools []MacPool `json:",omitempty"` - Subnets []Subnet `json:",omitempty"` - DNSSuffix string `json:",omitempty"` - DNSServerList string `json:",omitempty"` - DNSServerCompartment uint32 `json:",omitempty"` - ManagementIP string `json:",omitempty"` - AutomaticDNS bool `json:",omitempty"` -} - -type hnsNetworkResponse struct { - Success bool - Error string - Output HNSNetwork -} - -type hnsResponse struct { - Success bool - Error string - Output json.RawMessage -} +type HNSNetwork = hns.HNSNetwork // HNSNetworkRequest makes a call into HNS to update/query a single network func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { - var network HNSNetwork - err := hnsCall(method, "/networks/"+path, request, &network) - if err != nil { - return nil, err - } - - return &network, nil + return hns.HNSNetworkRequest(method, path, request) } // HNSListNetworkRequest makes a HNS call to query the list of available networks func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { - var network []HNSNetwork - err := hnsCall(method, "/networks/"+path, request, &network) - if err != nil { - return nil, err - } - - return network, nil + return hns.HNSListNetworkRequest(method, path, request) } // GetHNSNetworkByID func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { - return HNSNetworkRequest("GET", networkID, "") + return hns.GetHNSNetworkByID(networkID) } // GetHNSNetworkName filtered by Name func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { - hsnnetworks, err := HNSListNetworkRequest("GET", "", "") - if err != nil { - return nil, err - } - for _, hnsnetwork := range hsnnetworks { - if hnsnetwork.Name == networkName { - return &hnsnetwork, nil - } - } - return nil, NetworkNotFoundError{NetworkName: networkName} -} - -// Create Network by sending NetworkRequest to HNS. -func (network *HNSNetwork) Create() (*HNSNetwork, error) { - operation := "Create" - title := "HCSShim::HNSNetwork::" + operation - logrus.Debugf(title+" id=%s", network.Id) - - jsonString, err := json.Marshal(network) - if err != nil { - return nil, err - } - return HNSNetworkRequest("POST", "", string(jsonString)) -} - -// Delete Network by sending NetworkRequest to HNS -func (network *HNSNetwork) Delete() (*HNSNetwork, error) { - operation := "Delete" - title := "HCSShim::HNSNetwork::" + operation - logrus.Debugf(title+" id=%s", network.Id) - - return HNSNetworkRequest("DELETE", network.Id, "") -} - -// Creates an endpoint on the Network. -func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint { - return &HNSEndpoint{ - VirtualNetwork: network.Id, - IPAddress: ipAddress, - MacAddress: string(macAddress), - } -} - -func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { - operation := "CreateEndpoint" - title := "HCSShim::HNSNetwork::" + operation - logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id) - - endpoint.VirtualNetwork = network.Id - return endpoint.Create() -} - -func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { - operation := "CreateRemoteEndpoint" - title := "HCSShim::HNSNetwork::" + operation - logrus.Debugf(title+" id=%s", network.Id) - endpoint.IsRemoteEndpoint = true - return network.CreateEndpoint(endpoint) + return hns.GetHNSNetworkByName(networkName) } diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go index bf860e9387..a3e03ff8fc 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnspolicy.go +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicy.go @@ -1,94 +1,57 @@ package hcsshim +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + // Type of Request Support in ModifySystem -type PolicyType string +type PolicyType = hns.PolicyType // RequestType const const ( - Nat PolicyType = "NAT" - ACL PolicyType = "ACL" - PA PolicyType = "PA" - VLAN PolicyType = "VLAN" - VSID PolicyType = "VSID" - VNet PolicyType = "VNET" - L2Driver PolicyType = "L2Driver" - Isolation PolicyType = "Isolation" - QOS PolicyType = "QOS" - OutboundNat PolicyType = "OutBoundNAT" - ExternalLoadBalancer PolicyType = "ELB" - Route PolicyType = "ROUTE" + Nat = hns.Nat + ACL = hns.ACL + PA = hns.PA + VLAN = hns.VLAN + VSID = hns.VSID + VNet = hns.VNet + L2Driver = hns.L2Driver + Isolation = hns.Isolation + QOS = hns.QOS + OutboundNat = hns.OutboundNat + ExternalLoadBalancer = hns.ExternalLoadBalancer + Route = hns.Route ) -type NatPolicy struct { - Type PolicyType `json:"Type"` - Protocol string - InternalPort uint16 - ExternalPort uint16 -} - -type QosPolicy struct { - Type PolicyType `json:"Type"` - MaximumOutgoingBandwidthInBytes uint64 -} - -type IsolationPolicy struct { - Type PolicyType `json:"Type"` - VLAN uint - VSID uint - InDefaultIsolation bool -} - -type VlanPolicy struct { - Type PolicyType `json:"Type"` - VLAN uint -} - -type VsidPolicy struct { - Type PolicyType `json:"Type"` - VSID uint -} - -type PaPolicy struct { - Type PolicyType `json:"Type"` - PA string `json:"PA"` -} - -type OutboundNatPolicy struct { - Policy - VIP string `json:"VIP,omitempty"` - Exceptions []string `json:"ExceptionList,omitempty"` -} - -type ActionType string -type DirectionType string -type RuleType string +type NatPolicy = hns.NatPolicy + +type QosPolicy = hns.QosPolicy + +type IsolationPolicy = hns.IsolationPolicy + +type VlanPolicy = hns.VlanPolicy + +type VsidPolicy = hns.VsidPolicy + +type PaPolicy = hns.PaPolicy + +type OutboundNatPolicy = hns.OutboundNatPolicy + +type ActionType = hns.ActionType +type DirectionType = hns.DirectionType +type RuleType = hns.RuleType const ( - Allow ActionType = "Allow" - Block ActionType = "Block" + Allow = hns.Allow + Block = hns.Block - In DirectionType = "In" - Out DirectionType = "Out" + In = hns.In + Out = hns.Out - Host RuleType = "Host" - Switch RuleType = "Switch" + Host = hns.Host + Switch = hns.Switch ) -type ACLPolicy struct { - Type PolicyType `json:"Type"` - Protocol uint16 - InternalPort uint16 - Action ActionType - Direction DirectionType - LocalAddresses string - RemoteAddresses string - LocalPort uint16 - RemotePort uint16 - RuleType RuleType `json:"RuleType,omitempty"` - Priority uint16 - ServiceName string -} - -type Policy struct { - Type PolicyType `json:"Type"` -} +type ACLPolicy = hns.ACLPolicy + +type Policy = hns.Policy diff --git a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go index ef1ccab16e..55aaa4a50e 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go +++ b/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go @@ -1,200 +1,47 @@ package hcsshim import ( - "encoding/json" - - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/hns" ) // RoutePolicy is a structure defining schema for Route based Policy -type RoutePolicy struct { - Policy - DestinationPrefix string `json:"DestinationPrefix,omitempty"` - NextHop string `json:"NextHop,omitempty"` - EncapEnabled bool `json:"NeedEncap,omitempty"` -} +type RoutePolicy = hns.RoutePolicy // ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy -type ELBPolicy struct { - LBPolicy - SourceVIP string `json:"SourceVIP,omitempty"` - VIPs []string `json:"VIPs,omitempty"` - ILB bool `json:"ILB,omitempty"` -} +type ELBPolicy = hns.ELBPolicy // LBPolicy is a structure defining schema for LoadBalancing based Policy -type LBPolicy struct { - Policy - Protocol uint16 `json:"Protocol,omitempty"` - InternalPort uint16 - ExternalPort uint16 -} +type LBPolicy = hns.LBPolicy // PolicyList is a structure defining schema for Policy list request -type PolicyList struct { - ID string `json:"ID,omitempty"` - EndpointReferences []string `json:"References,omitempty"` - Policies []json.RawMessage `json:"Policies,omitempty"` -} +type PolicyList = hns.PolicyList // HNSPolicyListRequest makes a call into HNS to update/query a single network func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { - var policy PolicyList - err := hnsCall(method, "/policylists/"+path, request, &policy) - if err != nil { - return nil, err - } - - return &policy, nil + return hns.HNSPolicyListRequest(method, path, request) } // HNSListPolicyListRequest gets all the policy list func HNSListPolicyListRequest() ([]PolicyList, error) { - var plist []PolicyList - err := hnsCall("GET", "/policylists/", "", &plist) - if err != nil { - return nil, err - } - - return plist, nil + return hns.HNSListPolicyListRequest() } // PolicyListRequest makes a HNS call to modify/query a network policy list func PolicyListRequest(method, path, request string) (*PolicyList, error) { - policylist := &PolicyList{} - err := hnsCall(method, "/policylists/"+path, request, &policylist) - if err != nil { - return nil, err - } - - return policylist, nil + return hns.PolicyListRequest(method, path, request) } // GetPolicyListByID get the policy list by ID func GetPolicyListByID(policyListID string) (*PolicyList, error) { - return PolicyListRequest("GET", policyListID, "") -} - -// Create PolicyList by sending PolicyListRequest to HNS. -func (policylist *PolicyList) Create() (*PolicyList, error) { - operation := "Create" - title := "HCSShim::PolicyList::" + operation - logrus.Debugf(title+" id=%s", policylist.ID) - jsonString, err := json.Marshal(policylist) - if err != nil { - return nil, err - } - return PolicyListRequest("POST", "", string(jsonString)) -} - -// Delete deletes PolicyList -func (policylist *PolicyList) Delete() (*PolicyList, error) { - operation := "Delete" - title := "HCSShim::PolicyList::" + operation - logrus.Debugf(title+" id=%s", policylist.ID) - - return PolicyListRequest("DELETE", policylist.ID, "") -} - -// AddEndpoint add an endpoint to a Policy List -func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { - operation := "AddEndpoint" - title := "HCSShim::PolicyList::" + operation - logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) - - _, err := policylist.Delete() - if err != nil { - return nil, err - } - - // Add Endpoint to the Existing List - policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) - - return policylist.Create() -} - -// RemoveEndpoint removes an endpoint from the Policy List -func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { - operation := "RemoveEndpoint" - title := "HCSShim::PolicyList::" + operation - logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) - - _, err := policylist.Delete() - if err != nil { - return nil, err - } - - elementToRemove := "/endpoints/" + endpoint.Id - - var references []string - - for _, endpointReference := range policylist.EndpointReferences { - if endpointReference == elementToRemove { - continue - } - references = append(references, endpointReference) - } - policylist.EndpointReferences = references - return policylist.Create() + return hns.GetPolicyListByID(policyListID) } // AddLoadBalancer policy list for the specified endpoints func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { - operation := "AddLoadBalancer" - title := "HCSShim::PolicyList::" + operation - logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort) - - policylist := &PolicyList{} - - elbPolicy := &ELBPolicy{ - SourceVIP: sourceVIP, - ILB: isILB, - } - - if len(vip) > 0 { - elbPolicy.VIPs = []string{vip} - } - elbPolicy.Type = ExternalLoadBalancer - elbPolicy.Protocol = protocol - elbPolicy.InternalPort = internalPort - elbPolicy.ExternalPort = externalPort - - for _, endpoint := range endpoints { - policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) - } - - jsonString, err := json.Marshal(elbPolicy) - if err != nil { - return nil, err - } - policylist.Policies = append(policylist.Policies, jsonString) - return policylist.Create() + return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort) } // AddRoute adds route policy list for the specified endpoints func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { - operation := "AddRoute" - title := "HCSShim::PolicyList::" + operation - logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix) - - policylist := &PolicyList{} - - rPolicy := &RoutePolicy{ - DestinationPrefix: destinationPrefix, - NextHop: nextHop, - EncapEnabled: encapEnabled, - } - rPolicy.Type = Route - - for _, endpoint := range endpoints { - policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) - } - - jsonString, err := json.Marshal(rPolicy) - if err != nil { - return nil, err - } - - policylist.Policies = append(policylist.Policies, jsonString) - return policylist.Create() + return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled) } diff --git a/vendor/github.com/Microsoft/hcsshim/hnssupport.go b/vendor/github.com/Microsoft/hcsshim/hnssupport.go new file mode 100644 index 0000000000..69405244b6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/hnssupport.go @@ -0,0 +1,13 @@ +package hcsshim + +import ( + "github.com/Microsoft/hcsshim/internal/hns" +) + +type HNSSupportedFeatures = hns.HNSSupportedFeatures + +type HNSAclFeatures = hns.HNSAclFeatures + +func GetHNSSupportedFeatures() HNSSupportedFeatures { + return hns.GetHNSSupportedFeatures() +} diff --git a/vendor/github.com/Microsoft/hcsshim/interface.go b/vendor/github.com/Microsoft/hcsshim/interface.go index e21f30025a..2724624fd5 100644 --- a/vendor/github.com/Microsoft/hcsshim/interface.go +++ b/vendor/github.com/Microsoft/hcsshim/interface.go @@ -1,106 +1,27 @@ package hcsshim import ( - "encoding/json" "io" "time" + + "github.com/Microsoft/hcsshim/internal/schema1" ) // ProcessConfig is used as both the input of Container.CreateProcess // and to convert the parameters to JSON for passing onto the HCS -type ProcessConfig struct { - ApplicationName string `json:",omitempty"` - CommandLine string `json:",omitempty"` - CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows - User string `json:",omitempty"` - WorkingDirectory string `json:",omitempty"` - Environment map[string]string `json:",omitempty"` - EmulateConsole bool `json:",omitempty"` - CreateStdInPipe bool `json:",omitempty"` - CreateStdOutPipe bool `json:",omitempty"` - CreateStdErrPipe bool `json:",omitempty"` - ConsoleSize [2]uint `json:",omitempty"` - CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows - OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows -} - -type Layer struct { - ID string - Path string -} +type ProcessConfig = schema1.ProcessConfig -type MappedDir struct { - HostPath string - ContainerPath string - ReadOnly bool - BandwidthMaximum uint64 - IOPSMaximum uint64 - CreateInUtilityVM bool -} - -type MappedPipe struct { - HostPath string - ContainerPipeName string -} - -type HvRuntime struct { - ImagePath string `json:",omitempty"` - SkipTemplate bool `json:",omitempty"` - LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM - LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM - LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode - BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD - WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD -} - -type MappedVirtualDisk struct { - HostPath string `json:",omitempty"` // Path to VHD on the host - ContainerPath string // Platform-specific mount point path in the container - CreateInUtilityVM bool `json:",omitempty"` - ReadOnly bool `json:",omitempty"` - Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" - AttachOnly bool `json:",omitempty:` -} +type Layer = schema1.Layer +type MappedDir = schema1.MappedDir +type MappedPipe = schema1.MappedPipe +type HvRuntime = schema1.HvRuntime +type MappedVirtualDisk = schema1.MappedVirtualDisk // ContainerConfig is used as both the input of CreateContainer // and to convert the parameters to JSON for passing onto the HCS -type ContainerConfig struct { - SystemType string // HCS requires this to be hard-coded to "Container" - Name string // Name of the container. We use the docker ID. - Owner string `json:",omitempty"` // The management platform that created this container - VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID} - IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows - LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID - Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID - Credentials string `json:",omitempty"` // Credentials information - ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container. - ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares. - ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit. - StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS - StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second - StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller - MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes - HostName string `json:",omitempty"` // Hostname - MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts) - MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes - HvPartition bool // True if it a Hyper-V Container - NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with. - EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container - HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM - Servicing bool `json:",omitempty"` // True if this container is for servicing - AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution - DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution - ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise. - TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed - MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start -} +type ContainerConfig = schema1.ContainerConfig -type ComputeSystemQuery struct { - IDs []string `json:"Ids,omitempty"` - Types []string `json:",omitempty"` - Names []string `json:",omitempty"` - Owners []string `json:",omitempty"` -} +type ComputeSystemQuery = schema1.ComputeSystemQuery // Container represents a created (but not necessarily running) container. type Container interface { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go new file mode 100644 index 0000000000..9f926c6be7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go @@ -0,0 +1,85 @@ +package guestrequest + +import "github.com/Microsoft/hcsshim/internal/schema2" + +// Arguably, many of these (at least CombinedLayers) should have been generated +// by swagger. +// +// This will also change package name due to an inbound breaking change. + +// This class is used by a modify request to add or remove a combined layers +// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath +// using the specified layers as the parent content. Ignores property ScratchPath +// since the container path is already the scratch path. For linux, the GCS unions +// the specified layers and ScratchPath together, placing the resulting union +// filesystem at ContainerRootPath. +type CombinedLayers struct { + ContainerRootPath string `json:"ContainerRootPath,omitempty"` + Layers []hcsschema.Layer `json:"Layers,omitempty"` + ScratchPath string `json:"ScratchPath,omitempty"` +} + +// Defines the schema for hosted settings passed to GCS and/or OpenGCS + +// SCSI. Scratch space for remote file-system commands, or R/W layer for containers +type LCOWMappedVirtualDisk struct { + MountPath string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM + Lun uint8 `json:"Lun,omitempty"` + Controller uint8 `json:"Controller,omitempty"` + ReadOnly bool `json:"ReadOnly,omitempty"` +} + +type WCOWMappedVirtualDisk struct { + ContainerPath string `json:"ContainerPath,omitempty"` + Lun int32 `json:"Lun,omitempty"` +} + +type LCOWMappedDirectory struct { + MountPath string `json:"MountPath,omitempty"` + Port int32 `json:"Port,omitempty"` + ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported) + ReadOnly bool `json:"ReadOnly,omitempty"` +} + +// Read-only layers over VPMem +type LCOWMappedVPMemDevice struct { + DeviceNumber uint32 `json:"DeviceNumber,omitempty"` + MountPath string `json:"MountPath,omitempty"` // /tmp/pN +} + +type ResourceType string + +const ( + // These are constants for v2 schema modify guest requests. + ResourceTypeMappedDirectory ResourceType = "MappedDirectory" + ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk" + ResourceTypeNetwork ResourceType = "Network" + ResourceTypeNetworkNamespace ResourceType = "NetworkNamespace" + ResourceTypeCombinedLayers ResourceType = "CombinedLayers" + ResourceTypeVPMemDevice ResourceType = "VPMemDevice" +) + +// GuestRequest is for modify commands passed to the guest. +type GuestRequest struct { + RequestType string `json:"RequestType,omitempty"` + ResourceType ResourceType `json:"ResourceType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +type NetworkModifyRequest struct { + AdapterId string `json:"AdapterId,omitempty"` + RequestType string `json:"RequestType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +type RS4NetworkModifyRequest struct { + AdapterInstanceId string `json:"AdapterInstanceId,omitempty"` + RequestType string `json:"RequestType,omitempty"` + Settings interface{} `json:"Settings,omitempty"` +} + +// SignalProcessOptions is the options passed to either WCOW or LCOW +// to signal a given process. +type SignalProcessOptions struct { + Signal int `json:,omitempty` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go new file mode 100644 index 0000000000..e9e45c0306 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go @@ -0,0 +1,69 @@ +package guid + +import ( + "crypto/rand" + "encoding/json" + "fmt" + "io" + "strconv" + "strings" +) + +var _ = (json.Marshaler)(&GUID{}) +var _ = (json.Unmarshaler)(&GUID{}) + +type GUID [16]byte + +func New() GUID { + g := GUID{} + _, err := io.ReadFull(rand.Reader, g[:]) + if err != nil { + panic(err) + } + return g +} + +func (g GUID) String() string { + return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:]) +} + +func FromString(s string) GUID { + if len(s) != 36 { + panic(fmt.Sprintf("invalid GUID length: %d", len(s))) + } + if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' { + panic("invalid GUID format") + } + indexOrder := [16]int{ + 0, 2, 4, 6, + 9, 11, + 14, 16, + 19, 21, + 24, 26, 28, 30, 32, 34, + } + byteOrder := [16]int{ + 3, 2, 1, 0, + 5, 4, + 7, 6, + 8, 9, + 10, 11, 12, 13, 14, 15, + } + var g GUID + for i, x := range indexOrder { + b, err := strconv.ParseInt(s[x:x+2], 16, 16) + if err != nil { + panic(err) + } + g[byteOrder[i]] = byte(b) + } + return g +} + +func (g GUID) MarshalJSON() ([]byte, error) { + return json.Marshal(g.String()) +} + +func (g *GUID) UnmarshalJSON(data []byte) error { + *g = FromString(strings.Trim(string(data), "\"")) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/callback.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go similarity index 95% rename from vendor/github.com/Microsoft/hcsshim/callback.go rename to vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go index e8c2b00c8a..e41c40ec8f 100644 --- a/vendor/github.com/Microsoft/hcsshim/callback.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go @@ -1,8 +1,10 @@ -package hcsshim +package hcs import ( "sync" "syscall" + + "github.com/Microsoft/hcsshim/internal/interop" ) var ( @@ -62,7 +64,7 @@ func closeChannels(channels notificationChannels) { func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr { var result error if int32(notificationStatus) < 0 { - result = syscall.Errno(win32FromHresult(notificationStatus)) + result = interop.Win32FromHresult(notificationStatus) } callbackMapLock.RLock() diff --git a/vendor/github.com/Microsoft/hcsshim/cgo.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go similarity index 94% rename from vendor/github.com/Microsoft/hcsshim/cgo.go rename to vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go index 2003332330..3669c34aa2 100644 --- a/vendor/github.com/Microsoft/hcsshim/cgo.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go @@ -1,4 +1,4 @@ -package hcsshim +package hcs import "C" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go new file mode 100644 index 0000000000..7471f5cc13 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go @@ -0,0 +1,279 @@ +package hcs + +import ( + "encoding/json" + "errors" + "fmt" + "syscall" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +var ( + // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists + ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrElementNotFound = syscall.Errno(0x490) + + // ErrElementNotFound is an error encountered when the object being referenced does not exist + ErrNotSupported = syscall.Errno(0x32) + + // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported + // decimal -2147024883 / hex 0x8007000d + ErrInvalidData = syscall.Errno(0xd) + + // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed + ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed") + + // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method + ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed") + + // ErrInvalidNotificationType is an error encountered when an invalid notification type is used + ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type") + + // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation + ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation") + + // ErrTimeout is an error encountered when waiting on a notification times out + ErrTimeout = errors.New("hcsshim: timeout waiting for notification") + + // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for + // a different expected notification + ErrUnexpectedContainerExit = errors.New("unexpected container exit") + + // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service + // is lost while waiting for a notification + ErrUnexpectedProcessAbort = errors.New("lost communication with compute service") + + // ErrUnexpectedValue is an error encountered when hcs returns an invalid value + ErrUnexpectedValue = errors.New("unexpected value returned from hcs") + + // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container + ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) + + // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously + ErrVmcomputeOperationPending = syscall.Errno(0xC0370103) + + // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation + ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105) + + // ErrProcNotFound is an error encountered when the the process cannot be found + ErrProcNotFound = syscall.Errno(0x7f) + + // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 + // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. + ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5) + + // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management + ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d) + + // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message + ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b) + + // ErrNotSupported is an error encountered when hcs doesn't support the request + ErrPlatformNotSupported = errors.New("unsupported platform request") +) + +type ErrorEvent struct { + Message string `json:"Message,omitempty"` // Fully formated error message + StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form + Provider string `json:"Provider,omitempty"` + EventID uint16 `json:"EventId,omitempty"` + Flags uint32 `json:"Flags,omitempty"` + Source string `json:"Source,omitempty"` + //Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function) +} + +type hcsResult struct { + Error int32 + ErrorMessage string + ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"` +} + +func (ev *ErrorEvent) String() string { + evs := "[Event Detail: " + ev.Message + if ev.StackTrace != "" { + evs += " Stack Trace: " + ev.StackTrace + } + if ev.Provider != "" { + evs += " Provider: " + ev.Provider + } + if ev.EventID != 0 { + evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID) + } + if ev.Flags != 0 { + evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags) + } + if ev.Source != "" { + evs += " Source: " + ev.Source + } + evs += "]" + return evs +} + +func processHcsResult(resultp *uint16) []ErrorEvent { + if resultp != nil { + resultj := interop.ConvertAndFreeCoTaskMemString(resultp) + logrus.Debugf("Result: %s", resultj) + result := &hcsResult{} + if err := json.Unmarshal([]byte(resultj), result); err != nil { + logrus.Warnf("Could not unmarshal HCS result %s: %s", resultj, err) + return nil + } + return result.ErrorEvents + } + return nil +} + +type HcsError struct { + Op string + Err error + Events []ErrorEvent +} + +func (e *HcsError) Error() string { + s := e.Op + ": " + e.Err.Error() + for _, ev := range e.Events { + s += "\n" + ev.String() + } + return s +} + +// ProcessError is an error encountered in HCS during an operation on a Process object +type ProcessError struct { + SystemID string + Pid int + Op string + Err error + Events []ErrorEvent +} + +// SystemError is an error encountered in HCS during an operation on a Container object +type SystemError struct { + ID string + Op string + Err error + Extra string + Events []ErrorEvent +} + +func (e *SystemError) Error() string { + s := e.Op + " " + e.ID + ": " + e.Err.Error() + for _, ev := range e.Events { + s += "\n" + ev.String() + } + if e.Extra != "" { + s += "\n(extra info: " + e.Extra + ")" + } + return s +} + +func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { + // Don't double wrap errors + if _, ok := err.(*SystemError); ok { + return err + } + return &SystemError{ + ID: system.ID(), + Op: op, + Extra: extra, + Err: err, + Events: events, + } +} + +func (e *ProcessError) Error() string { + s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error()) + for _, ev := range e.Events { + s += "\n" + ev.String() + } + return s +} + +func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { + // Don't double wrap errors + if _, ok := err.(*ProcessError); ok { + return err + } + return &ProcessError{ + Pid: process.Pid(), + SystemID: process.SystemID(), + Op: op, + Err: err, + Events: events, + } +} + +// IsNotExist checks if an error is caused by the Container or Process not existing. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsNotExist(err error) bool { + err = getInnerError(err) + return err == ErrComputeSystemDoesNotExist || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsAlreadyClosed checks if an error is caused by the Container or Process having been +// already closed by a call to the Close() method. +func IsAlreadyClosed(err error) bool { + err = getInnerError(err) + return err == ErrAlreadyClosed +} + +// IsPending returns a boolean indicating whether the error is that +// the requested operation is being completed in the background. +func IsPending(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeOperationPending +} + +// IsTimeout returns a boolean indicating whether the error is caused by +// a timeout waiting for the operation to complete. +func IsTimeout(err error) bool { + err = getInnerError(err) + return err == ErrTimeout +} + +// IsAlreadyStopped returns a boolean indicating whether the error is caused by +// a Container or Process being already stopped. +// Note: Currently, ErrElementNotFound can mean that a Process has either +// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist +// will currently return true when the error is ErrElementNotFound or ErrProcNotFound. +func IsAlreadyStopped(err error) bool { + err = getInnerError(err) + return err == ErrVmcomputeAlreadyStopped || + err == ErrElementNotFound || + err == ErrProcNotFound +} + +// IsNotSupported returns a boolean indicating whether the error is caused by +// unsupported platform requests +// Note: Currently Unsupported platform requests can be mean either +// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage +// is thrown from the Platform +func IsNotSupported(err error) bool { + err = getInnerError(err) + // If Platform doesn't recognize or support the request sent, below errors are seen + return err == ErrVmcomputeInvalidJSON || + err == ErrInvalidData || + err == ErrNotSupported || + err == ErrVmcomputeUnknownMessage +} + +func getInnerError(err error) error { + switch pe := err.(type) { + case nil: + return nil + case *HcsError: + err = pe.Err + case *SystemError: + err = pe.Err + case *ProcessError: + err = pe.Err + } + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go new file mode 100644 index 0000000000..b0d49cbcf1 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go @@ -0,0 +1,48 @@ +// Shim for the Host Compute Service (HCS) to manage Windows Server +// containers and Hyper-V containers. + +package hcs + +import ( + "syscall" +) + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go + +//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? +//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? +//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? +//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? +//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? +//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? +//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? +//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? +//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? +//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? +//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? +//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? +//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? + +//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? +//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? +//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess? +//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? +//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? +//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? +//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? +//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? +//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? +//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? + +type hcsSystem syscall.Handle +type hcsProcess syscall.Handle +type hcsCallback syscall.Handle + +type hcsProcessInformation struct { + ProcessId uint32 + Reserved uint32 + StdInput syscall.Handle + StdOutput syscall.Handle + StdError syscall.Handle +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go new file mode 100644 index 0000000000..d356cdc4d6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go @@ -0,0 +1,427 @@ +package hcs + +import ( + "encoding/json" + "fmt" + "io" + "sync" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/guestrequest" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) + +// ContainerError is an error encountered in HCS +type Process struct { + handleLock sync.RWMutex + handle hcsProcess + processID int + system *System + cachedPipes *cachedPipes + callbackNumber uintptr +} + +type cachedPipes struct { + stdIn syscall.Handle + stdOut syscall.Handle + stdErr syscall.Handle +} + +type processModifyRequest struct { + Operation string + ConsoleSize *consoleSize `json:",omitempty"` + CloseHandle *closeHandle `json:",omitempty"` +} + +type consoleSize struct { + Height uint16 + Width uint16 +} + +type closeHandle struct { + Handle string +} + +type ProcessStatus struct { + ProcessID uint32 + Exited bool + ExitCode uint32 + LastWaitResult int32 +} + +const ( + stdIn string = "StdIn" + stdOut string = "StdOut" + stdErr string = "StdErr" +) + +const ( + modifyConsoleSize string = "ConsoleSize" + modifyCloseHandle string = "CloseHandle" +) + +// Pid returns the process ID of the process within the container. +func (process *Process) Pid() int { + return process.processID +} + +// SystemID returns the ID of the process's compute system. +func (process *Process) SystemID() string { + return process.system.ID() +} + +// Signal signals the process with `options`. +func (process *Process) Signal(options guestrequest.SignalProcessOptions) error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Signal" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + optionsb, err := json.Marshal(options) + if err != nil { + return err + } + + optionsStr := string(optionsb) + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("SignalProcess %s: %d", process.SystemID(), process.Pid()), &completed) + err = hcsSignalProcess(process.handle, optionsStr, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Kill signals the process to terminate but does not wait for it to finish terminating. +func (process *Process) Kill() error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Kill" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("TerminateProcess %s: %d", process.SystemID(), process.Pid()), &completed) + err := hcsTerminateProcess(process.handle, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Wait waits for the process to exit. +func (process *Process) Wait() error { + operation := "Wait" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) + if err != nil { + return makeProcessError(process, operation, err, nil) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// WaitTimeout waits for the process to exit or the duration to elapse. It returns +// false if timeout occurs. +func (process *Process) WaitTimeout(timeout time.Duration) error { + operation := "WaitTimeout" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) + if err != nil { + return makeProcessError(process, operation, err, nil) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// ResizeConsole resizes the console of the process. +func (process *Process) ResizeConsole(width, height uint16) error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "ResizeConsole" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + modifyRequest := processModifyRequest{ + Operation: modifyConsoleSize, + ConsoleSize: &consoleSize{ + Height: height, + Width: width, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + events := processHcsResult(resultp) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +func (process *Process) Properties() (*ProcessStatus, error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Properties" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + var ( + resultp *uint16 + propertiesp *uint16 + ) + completed := false + go syscallWatcher(fmt.Sprintf("GetProcessProperties %s: %d", process.SystemID(), process.Pid()), &completed) + err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, makeProcessError(process, operation, err, events) + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) + + properties := &ProcessStatus{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, makeProcessError(process, operation, err, nil) + } + + logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw) + return properties, nil +} + +// ExitCode returns the exit code of the process. The process must have +// already terminated. +func (process *Process) ExitCode() (int, error) { + operation := "ExitCode" + properties, err := process.Properties() + if err != nil { + return 0, makeProcessError(process, operation, err, nil) + } + + if properties.Exited == false { + return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil) + } + + if properties.LastWaitResult != 0 { + return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil) + } + + return int(properties.ExitCode), nil +} + +// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing +// these pipes does not close the underlying pipes; it should be possible to +// call this multiple times to get multiple interfaces. +func (process *Process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "Stdio" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + var stdIn, stdOut, stdErr syscall.Handle + + if process.cachedPipes == nil { + var ( + processInfo hcsProcessInformation + resultp *uint16 + ) + err := hcsGetProcessInfo(process.handle, &processInfo, &resultp) + events := processHcsResult(resultp) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, events) + } + + stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError + } else { + // Use cached pipes + stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr + + // Invalidate the cache + process.cachedPipes = nil + } + + pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + if err != nil { + return nil, nil, nil, makeProcessError(process, operation, err, nil) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return pipes[0], pipes[1], pipes[2], nil +} + +// CloseStdin closes the write side of the stdin pipe so that the process is +// notified on the read side that there is no more data in stdin. +func (process *Process) CloseStdin() error { + process.handleLock.RLock() + defer process.handleLock.RUnlock() + operation := "CloseStdin" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + if process.handle == 0 { + return makeProcessError(process, operation, ErrAlreadyClosed, nil) + } + + modifyRequest := processModifyRequest{ + Operation: modifyCloseHandle, + CloseHandle: &closeHandle{ + Handle: stdIn, + }, + } + + modifyRequestb, err := json.Marshal(modifyRequest) + if err != nil { + return err + } + + modifyRequestStr := string(modifyRequestb) + + var resultp *uint16 + err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) + events := processHcsResult(resultp) + if err != nil { + return makeProcessError(process, operation, err, events) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +// Close cleans up any state associated with the process but does not kill +// or wait on it. +func (process *Process) Close() error { + process.handleLock.Lock() + defer process.handleLock.Unlock() + operation := "Close" + title := "hcsshim::Process::" + operation + logrus.Debugf(title+" processid=%d", process.processID) + + // Don't double free this + if process.handle == 0 { + return nil + } + + if err := process.unregisterCallback(); err != nil { + return makeProcessError(process, operation, err, nil) + } + + if err := hcsCloseProcess(process.handle); err != nil { + return makeProcessError(process, operation, err, nil) + } + + process.handle = 0 + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return nil +} + +func (process *Process) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + process.callbackNumber = callbackNumber + + return nil +} + +func (process *Process) unregisterCallback() error { + callbackNumber := process.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterProcessCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterProcessCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go new file mode 100644 index 0000000000..57afd5ec6b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go @@ -0,0 +1,585 @@ +package hcs + +import ( + "encoding/json" + "fmt" + "os" + "strconv" + "sync" + "syscall" + "time" + + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/Microsoft/hcsshim/internal/schema1" + "github.com/Microsoft/hcsshim/internal/timeout" + "github.com/sirupsen/logrus" +) + +// currentContainerStarts is used to limit the number of concurrent container +// starts. +var currentContainerStarts containerStarts + +type containerStarts struct { + maxParallel int + inProgress int + sync.Mutex +} + +func init() { + mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START") + if len(mpsS) > 0 { + mpsI, err := strconv.Atoi(mpsS) + if err != nil || mpsI < 0 { + return + } + currentContainerStarts.maxParallel = mpsI + } +} + +type System struct { + handleLock sync.RWMutex + handle hcsSystem + id string + callbackNumber uintptr +} + +// CreateComputeSystem creates a new compute system with the given configuration but does not start it. +func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (*System, error) { + operation := "CreateComputeSystem" + title := "hcsshim::" + operation + + computeSystem := &System{ + id: id, + } + + hcsDocumentB, err := json.Marshal(hcsDocumentInterface) + if err != nil { + return nil, err + } + + hcsDocument := string(hcsDocumentB) + logrus.Debugf(title+" ID=%s config=%s", id, hcsDocument) + + var ( + resultp *uint16 + identity syscall.Handle + ) + completed := false + go syscallWatcher(fmt.Sprintf("CreateCompleteSystem %s: %s", id, hcsDocument), &completed) + createError := hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp) + completed = true + + if createError == nil || IsPending(createError) { + if err := computeSystem.registerCallback(); err != nil { + // Terminate the compute system if it still exists. We're okay to + // ignore a failure here. + computeSystem.Terminate() + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + } + + events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) + if err != nil { + if err == ErrTimeout { + // Terminate the compute system if it still exists. We're okay to + // ignore a failure here. + computeSystem.Terminate() + } + return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) + } + + logrus.Debugf(title+" succeeded id=%s handle=%d", id, computeSystem.handle) + return computeSystem, nil +} + +// OpenComputeSystem opens an existing compute system by ID. +func OpenComputeSystem(id string) (*System, error) { + operation := "OpenComputeSystem" + title := "hcsshim::" + operation + logrus.Debugf(title+" ID=%s", id) + + computeSystem := &System{ + id: id, + } + + var ( + handle hcsSystem + resultp *uint16 + ) + err := hcsOpenComputeSystem(id, &handle, &resultp) + events := processHcsResult(resultp) + if err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, events) + } + + computeSystem.handle = handle + + if err := computeSystem.registerCallback(); err != nil { + return nil, makeSystemError(computeSystem, operation, "", err, nil) + } + + logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle) + return computeSystem, nil +} + +// GetComputeSystems gets a list of the compute systems on the system that match the query +func GetComputeSystems(q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { + operation := "GetComputeSystems" + title := "hcsshim::" + operation + + queryb, err := json.Marshal(q) + if err != nil { + return nil, err + } + + query := string(queryb) + logrus.Debugf(title+" query=%s", query) + + var ( + resultp *uint16 + computeSystemsp *uint16 + ) + completed := false + go syscallWatcher(fmt.Sprintf("GetComputeSystems %s:", query), &completed) + err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, &HcsError{Op: operation, Err: err, Events: events} + } + + if computeSystemsp == nil { + return nil, ErrUnexpectedValue + } + computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp) + computeSystems := []schema1.ContainerProperties{} + if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil { + return nil, err + } + + logrus.Debugf(title + " succeeded") + return computeSystems, nil +} + +// Start synchronously starts the computeSystem. +func (computeSystem *System) Start() error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::Start ID=" + computeSystem.ID() + logrus.Debugf(title) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil) + } + + // This is a very simple backoff-retry loop to limit the number + // of parallel container starts if environment variable + // HCSSHIM_MAX_PARALLEL_START is set to a positive integer. + // It should generally only be used as a workaround to various + // platform issues that exist between RS1 and RS4 as of Aug 2018 + if currentContainerStarts.maxParallel > 0 { + for { + currentContainerStarts.Lock() + if currentContainerStarts.inProgress < currentContainerStarts.maxParallel { + currentContainerStarts.inProgress++ + currentContainerStarts.Unlock() + break + } + if currentContainerStarts.inProgress == currentContainerStarts.maxParallel { + currentContainerStarts.Unlock() + time.Sleep(100 * time.Millisecond) + } + } + // Make sure we decrement the count when we are done. + defer func() { + currentContainerStarts.Lock() + currentContainerStarts.inProgress-- + currentContainerStarts.Unlock() + }() + } + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("StartComputeSystem %s:", computeSystem.ID()), &completed) + err := hcsStartComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) + if err != nil { + return makeSystemError(computeSystem, "Start", "", err, events) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +// ID returns the compute system's identifier. +func (computeSystem *System) ID() string { + return computeSystem.id +} + +// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (computeSystem *System) Shutdown() error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::Shutdown" + logrus.Debugf(title) + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("ShutdownComputeSystem %s:", computeSystem.ID()), &completed) + err := hcsShutdownComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeSystemError(computeSystem, "Shutdown", "", err, events) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +// Terminate requests a compute system terminate, if IsPending() on the error returned is true, +// it may not actually be shut down until Wait() succeeds. +func (computeSystem *System) Terminate() error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::Terminate ID=" + computeSystem.ID() + logrus.Debugf(title) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("TerminateComputeSystem %s:", computeSystem.ID()), &completed) + err := hcsTerminateComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeSystemError(computeSystem, "Terminate", "", err, events) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +// Wait synchronously waits for the compute system to shutdown or terminate. +func (computeSystem *System) Wait() error { + title := "hcsshim::ComputeSystem::Wait ID=" + computeSystem.ID() + logrus.Debugf(title) + + err := waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil) + if err != nil { + return makeSystemError(computeSystem, "Wait", "", err, nil) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse. +// If the timeout expires, IsTimeout(err) == true +func (computeSystem *System) WaitTimeout(timeout time.Duration) error { + title := "hcsshim::ComputeSystem::WaitTimeout ID=" + computeSystem.ID() + logrus.Debugf(title) + + err := waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout) + if err != nil { + return makeSystemError(computeSystem, "WaitTimeout", "", err, nil) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +func (computeSystem *System) Properties(types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + + queryj, err := json.Marshal(schema1.PropertyQuery{types}) + if err != nil { + return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + } + + var resultp, propertiesp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("GetComputeSystemProperties %s:", computeSystem.ID()), &completed) + err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, makeSystemError(computeSystem, "Properties", "", err, events) + } + + if propertiesp == nil { + return nil, ErrUnexpectedValue + } + propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp) + properties := &schema1.ContainerProperties{} + if err := json.Unmarshal(propertiesRaw, properties); err != nil { + return nil, makeSystemError(computeSystem, "Properties", "", err, nil) + } + return properties, nil +} + +// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. +func (computeSystem *System) Pause() error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::Pause ID=" + computeSystem.ID() + logrus.Debugf(title) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("PauseComputeSystem %s:", computeSystem.ID()), &completed) + err := hcsPauseComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) + if err != nil { + return makeSystemError(computeSystem, "Pause", "", err, events) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. +func (computeSystem *System) Resume() error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::Resume ID=" + computeSystem.ID() + logrus.Debugf(title) + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil) + } + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("ResumeComputeSystem %s:", computeSystem.ID()), &completed) + err := hcsResumeComputeSystem(computeSystem.handle, "", &resultp) + completed = true + events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) + if err != nil { + return makeSystemError(computeSystem, "Resume", "", err, events) + } + + logrus.Debugf(title + " succeeded") + return nil +} + +// CreateProcess launches a new process within the computeSystem. +func (computeSystem *System) CreateProcess(c interface{}) (*Process, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::CreateProcess ID=" + computeSystem.ID() + var ( + processInfo hcsProcessInformation + processHandle hcsProcess + resultp *uint16 + ) + + if computeSystem.handle == 0 { + return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil) + } + + configurationb, err := json.Marshal(c) + if err != nil { + return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + } + + configuration := string(configurationb) + logrus.Debugf(title+" config=%s", configuration) + + completed := false + go syscallWatcher(fmt.Sprintf("CreateProcess %s: %s", computeSystem.ID(), configuration), &completed) + err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events) + } + + process := &Process{ + handle: processHandle, + processID: int(processInfo.ProcessId), + system: computeSystem, + cachedPipes: &cachedPipes{ + stdIn: processInfo.StdInput, + stdOut: processInfo.StdOutput, + stdErr: processInfo.StdError, + }, + } + + if err := process.registerCallback(); err != nil { + return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil) + } + + logrus.Debugf(title+" succeeded processid=%d", process.processID) + return process, nil +} + +// OpenProcess gets an interface to an existing process within the computeSystem. +func (computeSystem *System) OpenProcess(pid int) (*Process, error) { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::ComputeSystem::OpenProcess ID=" + computeSystem.ID() + logrus.Debugf(title+" processid=%d", pid) + var ( + processHandle hcsProcess + resultp *uint16 + ) + + if computeSystem.handle == 0 { + return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil) + } + + completed := false + go syscallWatcher(fmt.Sprintf("OpenProcess %s: %d", computeSystem.ID(), pid), &completed) + err := hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events) + } + + process := &Process{ + handle: processHandle, + processID: pid, + system: computeSystem, + } + + if err := process.registerCallback(); err != nil { + return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil) + } + + logrus.Debugf(title+" succeeded processid=%s", process.processID) + return process, nil +} + +// Close cleans up any state associated with the compute system but does not terminate or wait for it. +func (computeSystem *System) Close() error { + computeSystem.handleLock.Lock() + defer computeSystem.handleLock.Unlock() + title := "hcsshim::ComputeSystem::Close ID=" + computeSystem.ID() + logrus.Debugf(title) + + // Don't double free this + if computeSystem.handle == 0 { + return nil + } + + if err := computeSystem.unregisterCallback(); err != nil { + return makeSystemError(computeSystem, "Close", "", err, nil) + } + + completed := false + go syscallWatcher(fmt.Sprintf("CloseComputeSystem %s:", computeSystem.ID()), &completed) + err := hcsCloseComputeSystem(computeSystem.handle) + completed = true + if err != nil { + return makeSystemError(computeSystem, "Close", "", err, nil) + } + + computeSystem.handle = 0 + + logrus.Debugf(title + " succeeded") + return nil +} + +func (computeSystem *System) registerCallback() error { + context := ¬ifcationWatcherContext{ + channels: newChannels(), + } + + callbackMapLock.Lock() + callbackNumber := nextCallback + nextCallback++ + callbackMap[callbackNumber] = context + callbackMapLock.Unlock() + + var callbackHandle hcsCallback + err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) + if err != nil { + return err + } + context.handle = callbackHandle + computeSystem.callbackNumber = callbackNumber + + return nil +} + +func (computeSystem *System) unregisterCallback() error { + callbackNumber := computeSystem.callbackNumber + + callbackMapLock.RLock() + context := callbackMap[callbackNumber] + callbackMapLock.RUnlock() + + if context == nil { + return nil + } + + handle := context.handle + + if handle == 0 { + return nil + } + + // hcsUnregisterComputeSystemCallback has its own syncronization + // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. + err := hcsUnregisterComputeSystemCallback(handle) + if err != nil { + return err + } + + closeChannels(context.channels) + + callbackMapLock.Lock() + callbackMap[callbackNumber] = nil + callbackMapLock.Unlock() + + handle = 0 + + return nil +} + +// Modifies the System by sending a request to HCS +func (computeSystem *System) Modify(config interface{}) error { + computeSystem.handleLock.RLock() + defer computeSystem.handleLock.RUnlock() + title := "hcsshim::Modify ID=" + computeSystem.id + + if computeSystem.handle == 0 { + return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil) + } + + requestJSON, err := json.Marshal(config) + if err != nil { + return err + } + + requestString := string(requestJSON) + logrus.Debugf(title + " " + requestString) + + var resultp *uint16 + completed := false + go syscallWatcher(fmt.Sprintf("ModifyComputeSystem %s: %s", computeSystem.ID(), requestString), &completed) + err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp) + completed = true + events := processHcsResult(resultp) + if err != nil { + return makeSystemError(computeSystem, "Modify", requestString, err, events) + } + logrus.Debugf(title + " succeeded ") + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/utils.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go similarity index 97% rename from vendor/github.com/Microsoft/hcsshim/utils.go rename to vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go index bd6e2d94ab..a638677ed5 100644 --- a/vendor/github.com/Microsoft/hcsshim/utils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go @@ -1,4 +1,4 @@ -package hcsshim +package hcs import ( "io" diff --git a/vendor/github.com/Microsoft/hcsshim/waithelper.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go similarity index 89% rename from vendor/github.com/Microsoft/hcsshim/waithelper.go rename to vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go index b7be20ea0c..91e212c574 100644 --- a/vendor/github.com/Microsoft/hcsshim/waithelper.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go @@ -1,4 +1,4 @@ -package hcsshim +package hcs import ( "time" @@ -6,13 +6,13 @@ import ( "github.com/sirupsen/logrus" ) -func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { - err = processHcsResult(err, resultp) +func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { + events := processHcsResult(resultp) if IsPending(err) { - return waitForNotification(callbackNumber, expectedNotification, timeout) + return nil, waitForNotification(callbackNumber, expectedNotification, timeout) } - return err + return events, err } func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go new file mode 100644 index 0000000000..6b94bc9ff8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go @@ -0,0 +1,30 @@ +package hcs + +import ( + "time" + + "github.com/Microsoft/hcsshim/internal/timeout" + "github.com/sirupsen/logrus" +) + +// syscallWatcher is used as a very simple goroutine around calls into +// the platform. In some cases, we have seen HCS APIs not returning due to +// various bugs, and the goroutine making the syscall ends up not returning, +// prior to its async callback. By spinning up a syscallWatcher, it allows +// us to at least log a warning if a syscall doesn't complete in a reasonable +// amount of time. +// +// Usage is: +// +// completed := false +// go syscallWatcher("some description", &completed) +// +// completed = true +// +func syscallWatcher(description string, syscallCompleted *bool) { + time.Sleep(timeout.SyscallWatcher) + if *syscallCompleted { + return + } + logrus.Warnf("%s: Did not complete within %s. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see is there is a syscall stuck in the platform API for a significant length of time.", description, timeout.SyscallWatcher) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go new file mode 100644 index 0000000000..925c65e28d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go @@ -0,0 +1,462 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package hcs + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/interop" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") + procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") + procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") + procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") + procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") + procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") + procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") + procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") + procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") + procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") + procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") + procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") + procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") + procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") + procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") + procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") + procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") + + procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") + procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") + procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") + procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") + procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") + procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") +) + +func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(query) + if hr != nil { + return + } + return _hcsEnumerateComputeSystems(_p0, computeSystems, result) +} + +func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { + if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) +} + +func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsCreateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _hcsOpenComputeSystem(_p0, computeSystem, result) +} + +func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { + if hr = procHcsOpenComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { + if hr = procHcsCloseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsStartComputeSystem(computeSystem, _p0, result) +} + +func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsStartComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsShutdownComputeSystem(computeSystem, _p0, result) +} + +func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsShutdownComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsTerminateComputeSystem(computeSystem, _p0, result) +} + +func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsTerminateComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsPauseComputeSystem(computeSystem, _p0, result) +} + +func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsPauseComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsResumeComputeSystem(computeSystem, _p0, result) +} + +func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { + if hr = procHcsResumeComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) +} + +func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(configuration) + if hr != nil { + return + } + return _hcsModifyComputeSystem(computeSystem, _p0, result) +} + +func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { + if hr = procHcsModifyComputeSystem.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(processParameters) + if hr != nil { + return + } + return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) +} + +func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsCreateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { + if hr = procHcsOpenProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsCloseProcess(process hcsProcess) (hr error) { + if hr = procHcsCloseProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { + if hr = procHcsTerminateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(options) + if hr != nil { + return + } + return _hcsSignalProcess(process, _p0, result) +} + +func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) { + if hr = procHcsTerminateProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { + if hr = procHcsGetProcessInfo.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { + if hr = procHcsGetProcessProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(settings) + if hr != nil { + return + } + return _hcsModifyProcess(process, _p0, result) +} + +func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { + if hr = procHcsModifyProcess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(propertyQuery) + if hr != nil { + return + } + return _hcsGetServiceProperties(_p0, properties, result) +} + +func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { + if hr = procHcsGetServiceProperties.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { + if hr = procHcsRegisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { + if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go new file mode 100644 index 0000000000..c8d362c66c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go @@ -0,0 +1,51 @@ +package hcserror + +import ( + "fmt" + "syscall" +) + +const ERROR_GEN_FAILURE = syscall.Errno(31) + +type HcsError struct { + title string + rest string + Err error +} + +func (e *HcsError) Error() string { + s := e.title + if len(s) > 0 && s[len(s)-1] != ' ' { + s += " " + } + s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err)) + if e.rest != "" { + if e.rest[0] != ' ' { + s += " " + } + s += e.rest + } + return s +} + +func New(err error, title, rest string) error { + // Pass through DLL errors directly since they do not originate from HCS. + if _, ok := err.(*syscall.DLLError); ok { + return err + } + return &HcsError{title, rest, err} +} + +func Errorf(err error, title, format string, a ...interface{}) error { + return New(err, title, fmt.Sprintf(format, a...)) +} + +func Win32FromError(err error) uint32 { + if herr, ok := err.(*HcsError); ok { + return Win32FromError(herr.Err) + } + if code, ok := err.(syscall.Errno); ok { + return uint32(code) + } + return uint32(ERROR_GEN_FAILURE) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go new file mode 100644 index 0000000000..b2e475f53c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go @@ -0,0 +1,23 @@ +package hns + +import "fmt" + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go + +//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall? + +type EndpointNotFoundError struct { + EndpointName string +} + +func (e EndpointNotFoundError) Error() string { + return fmt.Sprintf("Endpoint %s not found", e.EndpointName) +} + +type NetworkNotFoundError struct { + NetworkName string +} + +func (e NetworkNotFoundError) Error() string { + return fmt.Sprintf("Network %s not found", e.NetworkName) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go new file mode 100644 index 0000000000..ce636458c0 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go @@ -0,0 +1,260 @@ +package hns + +import ( + "encoding/json" + "net" + + "github.com/sirupsen/logrus" +) + +// HNSEndpoint represents a network endpoint in HNS +type HNSEndpoint struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + VirtualNetwork string `json:",omitempty"` + VirtualNetworkName string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacAddress string `json:",omitempty"` + IPAddress net.IP `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + EnableInternalDNS bool `json:",omitempty"` + DisableICC bool `json:",omitempty"` + PrefixLength uint8 `json:",omitempty"` + IsRemoteEndpoint bool `json:",omitempty"` + Namespace *Namespace `json:",omitempty"` +} + +//SystemType represents the type of the system on which actions are done +type SystemType string + +// SystemType const +const ( + ContainerType SystemType = "Container" + VirtualMachineType SystemType = "VirtualMachine" + HostType SystemType = "Host" +) + +// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type EndpointAttachDetachRequest struct { + ContainerID string `json:"ContainerId,omitempty"` + SystemType SystemType `json:"SystemType"` + CompartmentID uint16 `json:"CompartmentId,omitempty"` + VirtualNICName string `json:"VirtualNicName,omitempty"` +} + +// EndpointResquestResponse is object to get the endpoint request response +type EndpointResquestResponse struct { + Success bool + Error string +} + +// HNSEndpointRequest makes a HNS call to modify/query a network endpoint +func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { + endpoint := &HNSEndpoint{} + err := hnsCall(method, "/endpoints/"+path, request, &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// HNSListEndpointRequest makes a HNS call to query the list of available endpoints +func HNSListEndpointRequest() ([]HNSEndpoint, error) { + var endpoint []HNSEndpoint + err := hnsCall("GET", "/endpoints/", "", &endpoint) + if err != nil { + return nil, err + } + + return endpoint, nil +} + +// GetHNSEndpointByID get the Endpoint by ID +func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { + return HNSEndpointRequest("GET", endpointID, "") +} + +// GetHNSEndpointByName gets the endpoint filtered by Name +func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { + hnsResponse, err := HNSListEndpointRequest() + if err != nil { + return nil, err + } + for _, hnsEndpoint := range hnsResponse { + if hnsEndpoint.Name == endpointName { + return &hnsEndpoint, nil + } + } + return nil, EndpointNotFoundError{EndpointName: endpointName} +} + +// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods +func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) { + operation := "Create" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + return HNSEndpointRequest("POST", "", string(jsonString)) +} + +// Delete Endpoint by sending EndpointRequest to HNS +func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) { + operation := "Delete" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + return HNSEndpointRequest("DELETE", endpoint.Id, "") +} + +// Update Endpoint +func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) { + operation := "Update" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + jsonString, err := json.Marshal(endpoint) + if err != nil { + return nil, err + } + err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint) + + return endpoint, err +} + +// ApplyACLPolicy applies a set of ACL Policies on the Endpoint +func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error { + operation := "ApplyACLPolicy" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + for _, policy := range policies { + if policy == nil { + continue + } + jsonString, err := json.Marshal(policy) + if err != nil { + return err + } + endpoint.Policies = append(endpoint.Policies, jsonString) + } + + _, err := endpoint.Update() + return err +} + +// ContainerAttach attaches an endpoint to container +func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error { + operation := "ContainerAttach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + CompartmentID: compartmentID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// ContainerDetach detaches an endpoint from container +func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error { + operation := "ContainerDetach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + ContainerID: containerID, + SystemType: ContainerType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// HostAttach attaches a nic on the host +func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error { + operation := "HostAttach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + CompartmentID: compartmentID, + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) + +} + +// HostDetach detaches a nic on the host +func (endpoint *HNSEndpoint) HostDetach() error { + operation := "HostDetach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + SystemType: HostType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} + +// VirtualMachineNICAttach attaches a endpoint to a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error { + operation := "VirtualMachineNicAttach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + requestMessage := &EndpointAttachDetachRequest{ + VirtualNICName: virtualMachineNICName, + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response) +} + +// VirtualMachineNICDetach detaches a endpoint from a virtual machine +func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error { + operation := "VirtualMachineNicDetach" + title := "hcsshim::HNSEndpoint::" + operation + logrus.Debugf(title+" id=%s", endpoint.Id) + + requestMessage := &EndpointAttachDetachRequest{ + SystemType: VirtualMachineType, + } + response := &EndpointResquestResponse{} + + jsonString, err := json.Marshal(requestMessage) + if err != nil { + return err + } + return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response) +} diff --git a/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go similarity index 77% rename from vendor/github.com/Microsoft/hcsshim/hnsfuncs.go rename to vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go index 2c1b979ae8..969d1b263b 100644 --- a/vendor/github.com/Microsoft/hcsshim/hnsfuncs.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go @@ -1,9 +1,11 @@ -package hcsshim +package hns import ( "encoding/json" "fmt" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/interop" "github.com/sirupsen/logrus" ) @@ -13,9 +15,9 @@ func hnsCall(method, path, request string, returnResponse interface{}) error { err := _hnsCall(method, path, request, &responseBuffer) if err != nil { - return makeError(err, "hnsCall ", "") + return hcserror.New(err, "hnsCall ", "") } - response := convertAndFreeCoTaskMemString(responseBuffer) + response := interop.ConvertAndFreeCoTaskMemString(responseBuffer) hnsresponse := &hnsResponse{} if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil { diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go new file mode 100644 index 0000000000..a8d8cc56ae --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go @@ -0,0 +1,28 @@ +package hns + +type HNSGlobals struct { + Version HNSVersion `json:"Version"` +} + +type HNSVersion struct { + Major int `json:"Major"` + Minor int `json:"Minor"` +} + +var ( + HNSVersion1803 = HNSVersion{Major: 7, Minor: 2} +) + +func GetHNSGlobals() (*HNSGlobals, error) { + var version HNSVersion + err := hnsCall("GET", "/globals/version", "", &version) + if err != nil { + return nil, err + } + + globals := &HNSGlobals{ + Version: version, + } + + return globals, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go new file mode 100644 index 0000000000..7e859de912 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go @@ -0,0 +1,141 @@ +package hns + +import ( + "encoding/json" + "net" + + "github.com/sirupsen/logrus" +) + +// Subnet is assoicated with a network and represents a list +// of subnets available to the network +type Subnet struct { + AddressPrefix string `json:",omitempty"` + GatewayAddress string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` +} + +// MacPool is assoicated with a network and represents a list +// of macaddresses available to the network +type MacPool struct { + StartMacAddress string `json:",omitempty"` + EndMacAddress string `json:",omitempty"` +} + +// HNSNetwork represents a network in HNS +type HNSNetwork struct { + Id string `json:"ID,omitempty"` + Name string `json:",omitempty"` + Type string `json:",omitempty"` + NetworkAdapterName string `json:",omitempty"` + SourceMac string `json:",omitempty"` + Policies []json.RawMessage `json:",omitempty"` + MacPools []MacPool `json:",omitempty"` + Subnets []Subnet `json:",omitempty"` + DNSSuffix string `json:",omitempty"` + DNSServerList string `json:",omitempty"` + DNSServerCompartment uint32 `json:",omitempty"` + ManagementIP string `json:",omitempty"` + AutomaticDNS bool `json:",omitempty"` +} + +type hnsNetworkResponse struct { + Success bool + Error string + Output HNSNetwork +} + +type hnsResponse struct { + Success bool + Error string + Output json.RawMessage +} + +// HNSNetworkRequest makes a call into HNS to update/query a single network +func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { + var network HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return &network, nil +} + +// HNSListNetworkRequest makes a HNS call to query the list of available networks +func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { + var network []HNSNetwork + err := hnsCall(method, "/networks/"+path, request, &network) + if err != nil { + return nil, err + } + + return network, nil +} + +// GetHNSNetworkByID +func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { + return HNSNetworkRequest("GET", networkID, "") +} + +// GetHNSNetworkName filtered by Name +func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { + hsnnetworks, err := HNSListNetworkRequest("GET", "", "") + if err != nil { + return nil, err + } + for _, hnsnetwork := range hsnnetworks { + if hnsnetwork.Name == networkName { + return &hnsnetwork, nil + } + } + return nil, NetworkNotFoundError{NetworkName: networkName} +} + +// Create Network by sending NetworkRequest to HNS. +func (network *HNSNetwork) Create() (*HNSNetwork, error) { + operation := "Create" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + jsonString, err := json.Marshal(network) + if err != nil { + return nil, err + } + return HNSNetworkRequest("POST", "", string(jsonString)) +} + +// Delete Network by sending NetworkRequest to HNS +func (network *HNSNetwork) Delete() (*HNSNetwork, error) { + operation := "Delete" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + + return HNSNetworkRequest("DELETE", network.Id, "") +} + +// Creates an endpoint on the Network. +func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint { + return &HNSEndpoint{ + VirtualNetwork: network.Id, + IPAddress: ipAddress, + MacAddress: string(macAddress), + } +} + +func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateEndpoint" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id) + + endpoint.VirtualNetwork = network.Id + return endpoint.Create() +} + +func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) { + operation := "CreateRemoteEndpoint" + title := "hcsshim::HNSNetwork::" + operation + logrus.Debugf(title+" id=%s", network.Id) + endpoint.IsRemoteEndpoint = true + return network.CreateEndpoint(endpoint) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go new file mode 100644 index 0000000000..2318a4fce2 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go @@ -0,0 +1,98 @@ +package hns + +// Type of Request Support in ModifySystem +type PolicyType string + +// RequestType const +const ( + Nat PolicyType = "NAT" + ACL PolicyType = "ACL" + PA PolicyType = "PA" + VLAN PolicyType = "VLAN" + VSID PolicyType = "VSID" + VNet PolicyType = "VNET" + L2Driver PolicyType = "L2Driver" + Isolation PolicyType = "Isolation" + QOS PolicyType = "QOS" + OutboundNat PolicyType = "OutBoundNAT" + ExternalLoadBalancer PolicyType = "ELB" + Route PolicyType = "ROUTE" +) + +type NatPolicy struct { + Type PolicyType `json:"Type"` + Protocol string + InternalPort uint16 + ExternalPort uint16 +} + +type QosPolicy struct { + Type PolicyType `json:"Type"` + MaximumOutgoingBandwidthInBytes uint64 +} + +type IsolationPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint + VSID uint + InDefaultIsolation bool +} + +type VlanPolicy struct { + Type PolicyType `json:"Type"` + VLAN uint +} + +type VsidPolicy struct { + Type PolicyType `json:"Type"` + VSID uint +} + +type PaPolicy struct { + Type PolicyType `json:"Type"` + PA string `json:"PA"` +} + +type OutboundNatPolicy struct { + Policy + VIP string `json:"VIP,omitempty"` + Exceptions []string `json:"ExceptionList,omitempty"` +} + +type ActionType string +type DirectionType string +type RuleType string + +const ( + Allow ActionType = "Allow" + Block ActionType = "Block" + + In DirectionType = "In" + Out DirectionType = "Out" + + Host RuleType = "Host" + Switch RuleType = "Switch" +) + +type ACLPolicy struct { + Type PolicyType `json:"Type"` + Id string `json:"Id,omitempty"` + Protocol uint16 + Protocols string `json:"Protocols,omitempty"` + InternalPort uint16 + Action ActionType + Direction DirectionType + LocalAddresses string + RemoteAddresses string + LocalPorts string `json:"LocalPorts,omitempty"` + LocalPort uint16 + RemotePorts string `json:"RemotePorts,omitempty"` + RemotePort uint16 + RuleType RuleType `json:"RuleType,omitempty"` + Priority uint16 + ServiceName string +} + +type Policy struct { + Type PolicyType `json:"Type"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go new file mode 100644 index 0000000000..ff7369e6ff --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go @@ -0,0 +1,200 @@ +package hns + +import ( + "encoding/json" + + "github.com/sirupsen/logrus" +) + +// RoutePolicy is a structure defining schema for Route based Policy +type RoutePolicy struct { + Policy + DestinationPrefix string `json:"DestinationPrefix,omitempty"` + NextHop string `json:"NextHop,omitempty"` + EncapEnabled bool `json:"NeedEncap,omitempty"` +} + +// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy +type ELBPolicy struct { + LBPolicy + SourceVIP string `json:"SourceVIP,omitempty"` + VIPs []string `json:"VIPs,omitempty"` + ILB bool `json:"ILB,omitempty"` +} + +// LBPolicy is a structure defining schema for LoadBalancing based Policy +type LBPolicy struct { + Policy + Protocol uint16 `json:"Protocol,omitempty"` + InternalPort uint16 + ExternalPort uint16 +} + +// PolicyList is a structure defining schema for Policy list request +type PolicyList struct { + ID string `json:"ID,omitempty"` + EndpointReferences []string `json:"References,omitempty"` + Policies []json.RawMessage `json:"Policies,omitempty"` +} + +// HNSPolicyListRequest makes a call into HNS to update/query a single network +func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { + var policy PolicyList + err := hnsCall(method, "/policylists/"+path, request, &policy) + if err != nil { + return nil, err + } + + return &policy, nil +} + +// HNSListPolicyListRequest gets all the policy list +func HNSListPolicyListRequest() ([]PolicyList, error) { + var plist []PolicyList + err := hnsCall("GET", "/policylists/", "", &plist) + if err != nil { + return nil, err + } + + return plist, nil +} + +// PolicyListRequest makes a HNS call to modify/query a network policy list +func PolicyListRequest(method, path, request string) (*PolicyList, error) { + policylist := &PolicyList{} + err := hnsCall(method, "/policylists/"+path, request, &policylist) + if err != nil { + return nil, err + } + + return policylist, nil +} + +// GetPolicyListByID get the policy list by ID +func GetPolicyListByID(policyListID string) (*PolicyList, error) { + return PolicyListRequest("GET", policyListID, "") +} + +// Create PolicyList by sending PolicyListRequest to HNS. +func (policylist *PolicyList) Create() (*PolicyList, error) { + operation := "Create" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + jsonString, err := json.Marshal(policylist) + if err != nil { + return nil, err + } + return PolicyListRequest("POST", "", string(jsonString)) +} + +// Delete deletes PolicyList +func (policylist *PolicyList) Delete() (*PolicyList, error) { + operation := "Delete" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s", policylist.ID) + + return PolicyListRequest("DELETE", policylist.ID, "") +} + +// AddEndpoint add an endpoint to a Policy List +func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "AddEndpoint" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + // Add Endpoint to the Existing List + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + + return policylist.Create() +} + +// RemoveEndpoint removes an endpoint from the Policy List +func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) { + operation := "RemoveEndpoint" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id) + + _, err := policylist.Delete() + if err != nil { + return nil, err + } + + elementToRemove := "/endpoints/" + endpoint.Id + + var references []string + + for _, endpointReference := range policylist.EndpointReferences { + if endpointReference == elementToRemove { + continue + } + references = append(references, endpointReference) + } + policylist.EndpointReferences = references + return policylist.Create() +} + +// AddLoadBalancer policy list for the specified endpoints +func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { + operation := "AddLoadBalancer" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort) + + policylist := &PolicyList{} + + elbPolicy := &ELBPolicy{ + SourceVIP: sourceVIP, + ILB: isILB, + } + + if len(vip) > 0 { + elbPolicy.VIPs = []string{vip} + } + elbPolicy.Type = ExternalLoadBalancer + elbPolicy.Protocol = protocol + elbPolicy.InternalPort = internalPort + elbPolicy.ExternalPort = externalPort + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(elbPolicy) + if err != nil { + return nil, err + } + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} + +// AddRoute adds route policy list for the specified endpoints +func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { + operation := "AddRoute" + title := "hcsshim::PolicyList::" + operation + logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix) + + policylist := &PolicyList{} + + rPolicy := &RoutePolicy{ + DestinationPrefix: destinationPrefix, + NextHop: nextHop, + EncapEnabled: encapEnabled, + } + rPolicy.Type = Route + + for _, endpoint := range endpoints { + policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id) + } + + jsonString, err := json.Marshal(rPolicy) + if err != nil { + return nil, err + } + + policylist.Policies = append(policylist.Policies, jsonString) + return policylist.Create() +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go new file mode 100644 index 0000000000..d5efba7f28 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go @@ -0,0 +1,49 @@ +package hns + +import ( + "github.com/sirupsen/logrus" +) + +type HNSSupportedFeatures struct { + Acl HNSAclFeatures `json:"ACL"` +} + +type HNSAclFeatures struct { + AclAddressLists bool `json:"AclAddressLists"` + AclNoHostRulePriority bool `json:"AclHostRulePriority"` + AclPortRanges bool `json:"AclPortRanges"` + AclRuleId bool `json:"AclRuleId"` +} + +func GetHNSSupportedFeatures() HNSSupportedFeatures { + var hnsFeatures HNSSupportedFeatures + + globals, err := GetHNSGlobals() + if err != nil { + // Expected on pre-1803 builds, all features will be false/unsupported + logrus.Debugf("Unable to obtain HNS globals: %s", err) + return hnsFeatures + } + + hnsFeatures.Acl = HNSAclFeatures{ + AclAddressLists: isHNSFeatureSupported(globals.Version, HNSVersion1803), + AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803), + AclPortRanges: isHNSFeatureSupported(globals.Version, HNSVersion1803), + AclRuleId: isHNSFeatureSupported(globals.Version, HNSVersion1803), + } + + return hnsFeatures +} + +func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool { + if currentVersion.Major < minVersionSupported.Major { + return false + } + if currentVersion.Major > minVersionSupported.Major { + return true + } + if currentVersion.Minor < minVersionSupported.Minor { + return false + } + return true +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go new file mode 100644 index 0000000000..45e2281b07 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go @@ -0,0 +1,110 @@ +package hns + +import ( + "encoding/json" + "fmt" + "os" + "path" + "strings" +) + +type namespaceRequest struct { + IsDefault bool `json:",omitempty"` +} + +type namespaceEndpointRequest struct { + ID string `json:"Id"` +} + +type NamespaceResource struct { + Type string + Data json.RawMessage +} + +type namespaceResourceRequest struct { + Type string + Data interface{} +} + +type Namespace struct { + ID string + IsDefault bool `json:",omitempty"` + ResourceList []NamespaceResource `json:",omitempty"` +} + +func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) { + var err error + hnspath := "/namespaces/" + if id != nil { + hnspath = path.Join(hnspath, *id) + } + if subpath != "" { + hnspath = path.Join(hnspath, subpath) + } + var reqJSON []byte + if request != nil { + if reqJSON, err = json.Marshal(request); err != nil { + return nil, err + } + } + var ns Namespace + err = hnsCall(method, hnspath, string(reqJSON), &ns) + if err != nil { + if strings.Contains(err.Error(), "Element not found.") { + return nil, os.ErrNotExist + } + return nil, fmt.Errorf("%s %s: %s", method, hnspath, err) + } + return &ns, err +} + +func CreateNamespace() (string, error) { + req := namespaceRequest{} + ns, err := issueNamespaceRequest(nil, "POST", "", &req) + if err != nil { + return "", err + } + return ns.ID, nil +} + +func RemoveNamespace(id string) error { + _, err := issueNamespaceRequest(&id, "DELETE", "", nil) + return err +} + +func GetNamespaceEndpoints(id string) ([]string, error) { + ns, err := issueNamespaceRequest(&id, "GET", "", nil) + if err != nil { + return nil, err + } + var endpoints []string + for _, rsrc := range ns.ResourceList { + if rsrc.Type == "Endpoint" { + var endpoint namespaceEndpointRequest + err = json.Unmarshal(rsrc.Data, &endpoint) + if err != nil { + return nil, fmt.Errorf("unmarshal endpoint: %s", err) + } + endpoints = append(endpoints, endpoint.ID) + } + } + return endpoints, nil +} + +func AddNamespaceEndpoint(id string, endpointID string) error { + resource := namespaceResourceRequest{ + Type: "Endpoint", + Data: namespaceEndpointRequest{endpointID}, + } + _, err := issueNamespaceRequest(&id, "POST", "addresource", &resource) + return err +} + +func RemoveNamespaceEndpoint(id string, endpointID string) error { + resource := namespaceResourceRequest{ + Type: "Endpoint", + Data: namespaceEndpointRequest{endpointID}, + } + _, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource) + return err +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go new file mode 100644 index 0000000000..863e3429c7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go @@ -0,0 +1,74 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package hns + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/interop" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procHNSCall = modvmcompute.NewProc("HNSCall") +) + +func _hnsCall(method string, path string, object string, response **uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(method) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + var _p2 *uint16 + _p2, hr = syscall.UTF16PtrFromString(object) + if hr != nil { + return + } + return __hnsCall(_p0, _p1, _p2, response) +} + +func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { + if hr = procHNSCall.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go new file mode 100644 index 0000000000..f10c88d08c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go @@ -0,0 +1,27 @@ +package interop + +import ( + "syscall" + "unsafe" +) + +//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go interop.go + +//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree + +func ConvertAndFreeCoTaskMemString(buffer *uint16) string { + str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:]) + coTaskMemFree(unsafe.Pointer(buffer)) + return str +} + +func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte { + return []byte(ConvertAndFreeCoTaskMemString(buffer)) +} + +func Win32FromHresult(hr uintptr) syscall.Errno { + if hr&0x1fff0000 == 0x00070000 { + return syscall.Errno(hr & 0xffff) + } + return syscall.Errno(hr) +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go new file mode 100644 index 0000000000..2f5bf8f555 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go @@ -0,0 +1,48 @@ +// Code generated by 'go generate'; DO NOT EDIT. + +package interop + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modole32 = windows.NewLazySystemDLL("ole32.dll") + + procCoTaskMemFree = modole32.NewProc("CoTaskMemFree") +) + +func coTaskMemFree(buffer unsafe.Pointer) { + syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go b/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go new file mode 100644 index 0000000000..e5b8b85e09 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go @@ -0,0 +1,24 @@ +package longpath + +import ( + "path/filepath" + "strings" +) + +// LongAbs makes a path absolute and returns it in NT long path form. +func LongAbs(path string) (string, error) { + if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) { + return path, nil + } + if !filepath.IsAbs(path) { + absPath, err := filepath.Abs(path) + if err != nil { + return "", err + } + path = absPath + } + if strings.HasPrefix(path, `\\`) { + return `\\?\UNC\` + path[2:], nil + } + return `\\?\` + path, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go b/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go new file mode 100644 index 0000000000..7e95efb30d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go @@ -0,0 +1,52 @@ +package mergemaps + +import "encoding/json" + +// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values +// in ToMap are overwritten. Values in fromMap are added to ToMap. +// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang +func Merge(fromMap, ToMap interface{}) interface{} { + switch fromMap := fromMap.(type) { + case map[string]interface{}: + ToMap, ok := ToMap.(map[string]interface{}) + if !ok { + return fromMap + } + for keyToMap, valueToMap := range ToMap { + if valueFromMap, ok := fromMap[keyToMap]; ok { + fromMap[keyToMap] = Merge(valueFromMap, valueToMap) + } else { + fromMap[keyToMap] = valueToMap + } + } + case nil: + // merge(nil, map[string]interface{...}) -> map[string]interface{...} + ToMap, ok := ToMap.(map[string]interface{}) + if ok { + return ToMap + } + } + return fromMap +} + +// MergeJSON merges the contents of a JSON string into an object representation, +// returning a new object suitable for translating to JSON. +func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) { + if len(additionalJSON) == 0 { + return object, nil + } + objectJSON, err := json.Marshal(object) + if err != nil { + return nil, err + } + var objectMap, newMap map[string]interface{} + err = json.Unmarshal(objectJSON, &objectMap) + if err != nil { + return nil, err + } + err = json.Unmarshal(additionalJSON, &newMap) + if err != nil { + return nil, err + } + return Merge(newMap, objectMap), nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/safeopen.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go similarity index 81% rename from vendor/github.com/Microsoft/hcsshim/safeopen.go rename to vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go index 5356456b90..0c0b1159f2 100644 --- a/vendor/github.com/Microsoft/hcsshim/safeopen.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go @@ -1,4 +1,4 @@ -package hcsshim +package safefile import ( "errors" @@ -10,9 +10,13 @@ import ( "unicode/utf16" "unsafe" + "github.com/Microsoft/hcsshim/internal/longpath" + winio "github.com/Microsoft/go-winio" ) +//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go + //sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile //sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile //sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb @@ -53,28 +57,28 @@ const ( _FileLinkInformation = 11 _FileDispositionInformationEx = 64 - _FILE_READ_ATTRIBUTES = 0x0080 - _FILE_WRITE_ATTRIBUTES = 0x0100 - _DELETE = 0x10000 + FILE_READ_ATTRIBUTES = 0x0080 + FILE_WRITE_ATTRIBUTES = 0x0100 + DELETE = 0x10000 - _FILE_OPEN = 1 - _FILE_CREATE = 2 + FILE_OPEN = 1 + FILE_CREATE = 2 - _FILE_DIRECTORY_FILE = 0x00000001 - _FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020 - _FILE_DELETE_ON_CLOSE = 0x00001000 - _FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000 - _FILE_OPEN_REPARSE_POINT = 0x00200000 + FILE_DIRECTORY_FILE = 0x00000001 + FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020 + FILE_DELETE_ON_CLOSE = 0x00001000 + FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000 + FILE_OPEN_REPARSE_POINT = 0x00200000 - _FILE_DISPOSITION_DELETE = 0x00000001 + FILE_DISPOSITION_DELETE = 0x00000001 _OBJ_DONT_REPARSE = 0x1000 _STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B ) -func openRoot(path string) (*os.File, error) { - longpath, err := makeLongAbsPath(path) +func OpenRoot(path string) (*os.File, error) { + longpath, err := longpath.LongAbs(path) if err != nil { return nil, err } @@ -141,7 +145,7 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl 0, shareFlags, createDisposition, - _FILE_OPEN_FOR_BACKUP_INTENT|_FILE_SYNCHRONOUS_IO_NONALERT|flags, + FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags, nil, 0, ) @@ -149,7 +153,7 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl return nil, rtlNtStatusToDosError(status) } - fullPath, err := makeLongAbsPath(filepath.Join(root.Name(), path)) + fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path)) if err != nil { syscall.Close(syscall.Handle(h)) return nil, err @@ -158,9 +162,9 @@ func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFl return os.NewFile(h, fullPath), nil } -// openRelative opens a relative path from the given root, failing if +// OpenRelative opens a relative path from the given root, failing if // any of the intermediate path components are reparse points. -func openRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) { +func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) { f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags) if err != nil { err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err} @@ -168,17 +172,17 @@ func openRelative(path string, root *os.File, accessMask uint32, shareFlags uint return f, err } -// linkRelative creates a hard link from oldname to newname (relative to oldroot +// LinkRelative creates a hard link from oldname to newname (relative to oldroot // and newroot), failing if any of the intermediate path components are reparse // points. -func linkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error { +func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error { // Open the old file. oldf, err := openRelativeInternal( oldname, oldroot, syscall.FILE_WRITE_ATTRIBUTES, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, - _FILE_OPEN, + FILE_OPEN, 0, ) if err != nil { @@ -195,8 +199,8 @@ func linkRelative(oldname string, oldroot *os.File, newname string, newroot *os. newroot, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, - _FILE_OPEN, - _FILE_DIRECTORY_FILE) + FILE_OPEN, + FILE_DIRECTORY_FILE) if err != nil { return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err} } @@ -248,7 +252,7 @@ func linkRelative(oldname string, oldroot *os.File, newname string, newroot *os. // deleteOnClose marks a file to be deleted when the handle is closed. func deleteOnClose(f *os.File) error { - disposition := fileDispositionInformationEx{Flags: _FILE_DISPOSITION_DELETE} + disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE} var iosb ioStatusBlock status := ntSetInformationFile( f.Fd(), @@ -281,16 +285,16 @@ func clearReadOnly(f *os.File) error { return winio.SetFileBasicInfo(f, &sbi) } -// removeRelative removes a file or directory relative to a root, failing if any +// RemoveRelative removes a file or directory relative to a root, failing if any // intermediate path components are reparse points. -func removeRelative(path string, root *os.File) error { +func RemoveRelative(path string, root *os.File) error { f, err := openRelativeInternal( path, root, - _FILE_READ_ATTRIBUTES|_FILE_WRITE_ATTRIBUTES|_DELETE, + FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, - _FILE_OPEN, - _FILE_OPEN_REPARSE_POINT) + FILE_OPEN, + FILE_OPEN_REPARSE_POINT) if err == nil { defer f.Close() err = deleteOnClose(f) @@ -306,10 +310,10 @@ func removeRelative(path string, root *os.File) error { return nil } -// removeAllRelative removes a directory tree relative to a root, failing if any +// RemoveAllRelative removes a directory tree relative to a root, failing if any // intermediate path components are reparse points. -func removeAllRelative(path string, root *os.File) error { - fi, err := lstatRelative(path, root) +func RemoveAllRelative(path string, root *os.File) error { + fi, err := LstatRelative(path, root) if err != nil { if os.IsNotExist(err) { return nil @@ -319,7 +323,7 @@ func removeAllRelative(path string, root *os.File) error { fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 { // If this is a reparse point, it can't have children. Simple remove will do. - err := removeRelative(path, root) + err := RemoveRelative(path, root) if err == nil || os.IsNotExist(err) { return nil } @@ -327,7 +331,7 @@ func removeAllRelative(path string, root *os.File) error { } // It is necessary to use os.Open as Readdirnames does not work with - // openRelative. This is safe because the above lstatrelative fails + // OpenRelative. This is safe because the above lstatrelative fails // if the target is outside the root, and we know this is not a // symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check. fd, err := os.Open(filepath.Join(root.Name(), path)) @@ -344,7 +348,7 @@ func removeAllRelative(path string, root *os.File) error { for { names, err1 := fd.Readdirnames(100) for _, name := range names { - err1 := removeAllRelative(path+string(os.PathSeparator)+name, root) + err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root) if err == nil { err = err1 } @@ -363,7 +367,7 @@ func removeAllRelative(path string, root *os.File) error { fd.Close() // Remove directory. - err1 := removeRelative(path, root) + err1 := RemoveRelative(path, root) if err1 == nil || os.IsNotExist(err1) { return nil } @@ -373,16 +377,16 @@ func removeAllRelative(path string, root *os.File) error { return err } -// mkdirRelative creates a directory relative to a root, failing if any +// MkdirRelative creates a directory relative to a root, failing if any // intermediate path components are reparse points. -func mkdirRelative(path string, root *os.File) error { +func MkdirRelative(path string, root *os.File) error { f, err := openRelativeInternal( path, root, 0, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, - _FILE_CREATE, - _FILE_DIRECTORY_FILE) + FILE_CREATE, + FILE_DIRECTORY_FILE) if err == nil { f.Close() } else { @@ -391,16 +395,16 @@ func mkdirRelative(path string, root *os.File) error { return err } -// lstatRelative performs a stat operation on a file relative to a root, failing +// LstatRelative performs a stat operation on a file relative to a root, failing // if any intermediate path components are reparse points. -func lstatRelative(path string, root *os.File) (os.FileInfo, error) { +func LstatRelative(path string, root *os.File) (os.FileInfo, error) { f, err := openRelativeInternal( path, root, - _FILE_READ_ATTRIBUTES, + FILE_READ_ATTRIBUTES, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, - _FILE_OPEN, - _FILE_OPEN_REPARSE_POINT) + FILE_OPEN, + FILE_OPEN_REPARSE_POINT) if err != nil { return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err} } @@ -408,16 +412,16 @@ func lstatRelative(path string, root *os.File) (os.FileInfo, error) { return f.Stat() } -// ensureNotReparsePointRelative validates that a given file (relative to a +// EnsureNotReparsePointRelative validates that a given file (relative to a // root) and all intermediate path components are not a reparse points. -func ensureNotReparsePointRelative(path string, root *os.File) error { +func EnsureNotReparsePointRelative(path string, root *os.File) error { // Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT. - f, err := openRelative( + f, err := OpenRelative( path, root, 0, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, - _FILE_OPEN, + FILE_OPEN, 0) if err != nil { return err diff --git a/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go new file mode 100644 index 0000000000..709b9d3475 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go @@ -0,0 +1,79 @@ +// Code generated by 'go generate'; DO NOT EDIT. + +package safefile + +import ( + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modntdll = windows.NewLazySystemDLL("ntdll.dll") + modkernel32 = windows.NewLazySystemDLL("kernel32.dll") + + procNtCreateFile = modntdll.NewProc("NtCreateFile") + procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") + procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb") + procLocalAlloc = modkernel32.NewProc("LocalAlloc") + procLocalFree = modkernel32.NewProc("LocalFree") +) + +func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) { + r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0) + status = uint32(r0) + return +} + +func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { + r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) + status = uint32(r0) + return +} + +func rtlNtStatusToDosError(status uint32) (winerr error) { + r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0) + if r0 != 0 { + winerr = syscall.Errno(r0) + } + return +} + +func localAlloc(flags uint32, size int) (ptr uintptr) { + r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0) + ptr = uintptr(r0) + return +} + +func localFree(ptr uintptr) { + syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go new file mode 100644 index 0000000000..995433ace6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go @@ -0,0 +1,245 @@ +package schema1 + +import ( + "encoding/json" + "time" + + "github.com/Microsoft/hcsshim/internal/schema2" +) + +// ProcessConfig is used as both the input of Container.CreateProcess +// and to convert the parameters to JSON for passing onto the HCS +type ProcessConfig struct { + ApplicationName string `json:",omitempty"` + CommandLine string `json:",omitempty"` + CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows + User string `json:",omitempty"` + WorkingDirectory string `json:",omitempty"` + Environment map[string]string `json:",omitempty"` + EmulateConsole bool `json:",omitempty"` + CreateStdInPipe bool `json:",omitempty"` + CreateStdOutPipe bool `json:",omitempty"` + CreateStdErrPipe bool `json:",omitempty"` + ConsoleSize [2]uint `json:",omitempty"` + CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows + OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows +} + +type Layer struct { + ID string + Path string +} + +type MappedDir struct { + HostPath string + ContainerPath string + ReadOnly bool + BandwidthMaximum uint64 + IOPSMaximum uint64 + CreateInUtilityVM bool + // LinuxMetadata - Support added in 1803/RS4+. + LinuxMetadata bool `json:",omitempty"` +} + +type MappedPipe struct { + HostPath string + ContainerPipeName string +} + +type HvRuntime struct { + ImagePath string `json:",omitempty"` + SkipTemplate bool `json:",omitempty"` + LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM + LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM + LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode + BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD + WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD +} + +type MappedVirtualDisk struct { + HostPath string `json:",omitempty"` // Path to VHD on the host + ContainerPath string // Platform-specific mount point path in the container + CreateInUtilityVM bool `json:",omitempty"` + ReadOnly bool `json:",omitempty"` + Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing" + AttachOnly bool `json:",omitempty:` +} + +// AssignedDevice represents a device that has been directly assigned to a container +// +// NOTE: Support added in RS5 +type AssignedDevice struct { + // InterfaceClassGUID of the device to assign to container. + InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"` +} + +// ContainerConfig is used as both the input of CreateContainer +// and to convert the parameters to JSON for passing onto the HCS +type ContainerConfig struct { + SystemType string // HCS requires this to be hard-coded to "Container" + Name string // Name of the container. We use the docker ID. + Owner string `json:",omitempty"` // The management platform that created this container + VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID} + IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows + LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID + Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID + Credentials string `json:",omitempty"` // Credentials information + ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container. + ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares. + ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit. + StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS + StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second + StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller + MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes + HostName string `json:",omitempty"` // Hostname + MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts) + MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes + HvPartition bool // True if it a Hyper-V Container + NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with. + EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container + HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM + Servicing bool `json:",omitempty"` // True if this container is for servicing + AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution + DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution + ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise. + TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed + MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start + AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5 +} + +type ComputeSystemQuery struct { + IDs []string `json:"Ids,omitempty"` + Types []string `json:",omitempty"` + Names []string `json:",omitempty"` + Owners []string `json:",omitempty"` +} + +type PropertyType string + +const ( + PropertyTypeStatistics PropertyType = "Statistics" // V1 and V2 + PropertyTypeProcessList = "ProcessList" // V1 and V2 + PropertyTypeMappedVirtualDisk = "MappedVirtualDisk" // Not supported in V2 schema call + PropertyTypeGuestConnection = "GuestConnection" // V1 and V2. Nil return from HCS before RS5 +) + +type PropertyQuery struct { + PropertyTypes []PropertyType `json:",omitempty"` +} + +// ContainerProperties holds the properties for a container and the processes running in that container +type ContainerProperties struct { + ID string `json:"Id"` + State string + Name string + SystemType string + Owner string + SiloGUID string `json:"SiloGuid,omitempty"` + RuntimeID string `json:"RuntimeId,omitempty"` + IsRuntimeTemplate bool `json:",omitempty"` + RuntimeImagePath string `json:",omitempty"` + Stopped bool `json:",omitempty"` + ExitType string `json:",omitempty"` + AreUpdatesPending bool `json:",omitempty"` + ObRoot string `json:",omitempty"` + Statistics Statistics `json:",omitempty"` + ProcessList []ProcessListItem `json:",omitempty"` + MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"` + GuestConnectionInfo GuestConnectionInfo `json:",omitempty"` +} + +// MemoryStats holds the memory statistics for a container +type MemoryStats struct { + UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"` + UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"` + UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` +} + +// ProcessorStats holds the processor statistics for a container +type ProcessorStats struct { + TotalRuntime100ns uint64 `json:",omitempty"` + RuntimeUser100ns uint64 `json:",omitempty"` + RuntimeKernel100ns uint64 `json:",omitempty"` +} + +// StorageStats holds the storage statistics for a container +type StorageStats struct { + ReadCountNormalized uint64 `json:",omitempty"` + ReadSizeBytes uint64 `json:",omitempty"` + WriteCountNormalized uint64 `json:",omitempty"` + WriteSizeBytes uint64 `json:",omitempty"` +} + +// NetworkStats holds the network statistics for a container +type NetworkStats struct { + BytesReceived uint64 `json:",omitempty"` + BytesSent uint64 `json:",omitempty"` + PacketsReceived uint64 `json:",omitempty"` + PacketsSent uint64 `json:",omitempty"` + DroppedPacketsIncoming uint64 `json:",omitempty"` + DroppedPacketsOutgoing uint64 `json:",omitempty"` + EndpointId string `json:",omitempty"` + InstanceId string `json:",omitempty"` +} + +// Statistics is the structure returned by a statistics call on a container +type Statistics struct { + Timestamp time.Time `json:",omitempty"` + ContainerStartTime time.Time `json:",omitempty"` + Uptime100ns uint64 `json:",omitempty"` + Memory MemoryStats `json:",omitempty"` + Processor ProcessorStats `json:",omitempty"` + Storage StorageStats `json:",omitempty"` + Network []NetworkStats `json:",omitempty"` +} + +// ProcessList is the structure of an item returned by a ProcessList call on a container +type ProcessListItem struct { + CreateTimestamp time.Time `json:",omitempty"` + ImageName string `json:",omitempty"` + KernelTime100ns uint64 `json:",omitempty"` + MemoryCommitBytes uint64 `json:",omitempty"` + MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"` + MemoryWorkingSetSharedBytes uint64 `json:",omitempty"` + ProcessId uint32 `json:",omitempty"` + UserTime100ns uint64 `json:",omitempty"` +} + +// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container +type MappedVirtualDiskController struct { + MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"` +} + +// GuestDefinedCapabilities is part of the GuestConnectionInfo returned by a GuestConnection call on a utility VM +type GuestDefinedCapabilities struct { + NamespaceAddRequestSupported bool `json:",omitempty"` + SignalProcessSupported bool `json:",omitempty"` +} + +// GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM +type GuestConnectionInfo struct { + SupportedSchemaVersions []hcsschema.Version `json:",omitempty"` + ProtocolVersion uint32 `json:",omitempty"` + GuestDefinedCapabilities GuestDefinedCapabilities `json:",omitempty"` +} + +// Type of Request Support in ModifySystem +type RequestType string + +// Type of Resource Support in ModifySystem +type ResourceType string + +// RequestType const +const ( + Add RequestType = "Add" + Remove RequestType = "Remove" + Network ResourceType = "Network" +) + +// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system +// Supported resource types are Network and Request Types are Add/Remove +type ResourceModificationRequestResponse struct { + Resource ResourceType `json:"ResourceType"` + Data interface{} `json:"Settings"` + Request RequestType `json:"RequestType,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go new file mode 100644 index 0000000000..09456cbc21 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go @@ -0,0 +1,31 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Attachment struct { + + Type_ string `json:"Type,omitempty"` + + Path string `json:"Path,omitempty"` + + IgnoreFlushes bool `json:"IgnoreFlushes,omitempty"` + + CachingMode string `json:"CachingMode,omitempty"` + + NoWriteHardening bool `json:"NoWriteHardening,omitempty"` + + DisableExpansionOptimization bool `json:"DisableExpansionOptimization,omitempty"` + + IgnoreRelativeLocator bool `json:"IgnoreRelativeLocator,omitempty"` + + CaptureIoAttributionContext bool `json:"CaptureIoAttributionContext,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go new file mode 100644 index 0000000000..ecbbed4c23 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go @@ -0,0 +1,13 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Battery struct { +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go new file mode 100644 index 0000000000..243779eab6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CacheQueryStatsResponse struct { + + L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"` + + L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"` + + L3LocalBwBytes int32 `json:"L3LocalBwBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go new file mode 100644 index 0000000000..3fb24e2505 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go @@ -0,0 +1,25 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Chipset struct { + + Uefi *Uefi `json:"Uefi,omitempty"` + + IsNumLockDisabled bool `json:"IsNumLockDisabled,omitempty"` + + BaseBoardSerialNumber string `json:"BaseBoardSerialNumber,omitempty"` + + ChassisSerialNumber string `json:"ChassisSerialNumber,omitempty"` + + ChassisAssetTag string `json:"ChassisAssetTag,omitempty"` + + UseUtc bool `json:"UseUtc,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go new file mode 100644 index 0000000000..88f01707a7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type CloseHandle struct { + + Handle string `json:"Handle,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go new file mode 100644 index 0000000000..c665be3d5a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port. +type ComPort struct { + + NamedPipe string `json:"NamedPipe,omitempty"` + + OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go new file mode 100644 index 0000000000..85785d2858 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go @@ -0,0 +1,27 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ComputeSystem struct { + + Owner string `json:"Owner,omitempty"` + + SchemaVersion *Version `json:"SchemaVersion,omitempty"` + + HostingSystemId string `json:"HostingSystemId,omitempty"` + + HostedSystem *HostedSystem `json:"HostedSystem,omitempty"` + + Container *Container `json:"Container,omitempty"` + + VirtualMachine *VirtualMachine `json:"VirtualMachine,omitempty"` + + ShouldTerminateOnLastHandleClosed bool `json:"ShouldTerminateOnLastHandleClosed,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go new file mode 100644 index 0000000000..1a47db7d95 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go @@ -0,0 +1,72 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + "net/http" +) + +// contextKeys are used to identify the type of value in the context. +// Since these are string, it is possible to get a short description of the +// context key for logging and debugging using key.String(). + +type contextKey string + +func (c contextKey) String() string { + return "auth " + string(c) +} + +var ( + // ContextOAuth2 takes a oauth2.TokenSource as authentication for the request. + ContextOAuth2 = contextKey("token") + + // ContextBasicAuth takes BasicAuth as authentication for the request. + ContextBasicAuth = contextKey("basic") + + // ContextAccessToken takes a string oauth2 access token as authentication for the request. + ContextAccessToken = contextKey("accesstoken") + + // ContextAPIKey takes an APIKey as authentication for the request + ContextAPIKey = contextKey("apikey") +) + +// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth +type BasicAuth struct { + UserName string `json:"userName,omitempty"` + Password string `json:"password,omitempty"` +} + +// APIKey provides API key based authentication to a request passed via context using ContextAPIKey +type APIKey struct { + Key string + Prefix string +} + +type Configuration struct { + BasePath string `json:"basePath,omitempty"` + Host string `json:"host,omitempty"` + Scheme string `json:"scheme,omitempty"` + DefaultHeader map[string]string `json:"defaultHeader,omitempty"` + UserAgent string `json:"userAgent,omitempty"` + HTTPClient *http.Client +} + +func NewConfiguration() *Configuration { + cfg := &Configuration{ + BasePath: "https://localhost", + DefaultHeader: make(map[string]string), + UserAgent: "Swagger-Codegen/2.1.0/go", + } + return cfg +} + +func (c *Configuration) AddDefaultHeader(key string, value string) { + c.DefaultHeader[key] = value +} \ No newline at end of file diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go new file mode 100644 index 0000000000..adbe07fe55 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ConsoleSize struct { + + Height int32 `json:"Height,omitempty"` + + Width int32 `json:"Width,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go new file mode 100644 index 0000000000..17dce28bc7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go @@ -0,0 +1,35 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Container struct { + + GuestOs *GuestOs `json:"GuestOs,omitempty"` + + Storage *Storage `json:"Storage,omitempty"` + + MappedDirectories []MappedDirectory `json:"MappedDirectories,omitempty"` + + MappedPipes []MappedPipe `json:"MappedPipes,omitempty"` + + Memory *Memory `json:"Memory,omitempty"` + + Processor *Processor `json:"Processor,omitempty"` + + Networking *Networking `json:"Networking,omitempty"` + + HvSocket *HvSocket `json:"HvSocket,omitempty"` + + ContainerCredentialGuard *ContainerCredentialGuardState `json:"ContainerCredentialGuard,omitempty"` + + RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"` + + AssignedDevices []Device `json:"AssignedDevices,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go new file mode 100644 index 0000000000..0f8f644379 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go @@ -0,0 +1,25 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ContainerCredentialGuardState struct { + + // Authentication cookie for calls to a Container Credential Guard instance. + Cookie string `json:"Cookie,omitempty"` + + // Name of the RPC endpoint of the Container Credential Guard instance. + RpcEndpoint string `json:"RpcEndpoint,omitempty"` + + // Transport used for the configured Container Credential Guard instance. + Transport string `json:"Transport,omitempty"` + + // Credential spec used for the configured Container Credential Guard instance. + CredentialSpec string `json:"CredentialSpec,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go new file mode 100644 index 0000000000..754797e213 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go @@ -0,0 +1,26 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// memory usage as viewed from within the container +type ContainerMemoryInformation struct { + + TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"` + + TotalUsage int32 `json:"TotalUsage,omitempty"` + + CommittedBytes int32 `json:"CommittedBytes,omitempty"` + + SharedCommittedBytes int32 `json:"SharedCommittedBytes,omitempty"` + + CommitLimitBytes int32 `json:"CommitLimitBytes,omitempty"` + + PeakCommitmentBytes int32 `json:"PeakCommitmentBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go new file mode 100644 index 0000000000..ca319bbbce --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Device struct { + + // The interface class guid of the device to assign to container. + InterfaceClassGuid string `json:"InterfaceClassGuid,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go new file mode 100644 index 0000000000..b2191c571d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go @@ -0,0 +1,43 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Devices struct { + + ComPorts map[string]ComPort `json:"ComPorts,omitempty"` + + Scsi map[string]Scsi `json:"Scsi,omitempty"` + + VirtualPMem *VirtualPMemController `json:"VirtualPMem,omitempty"` + + NetworkAdapters map[string]NetworkAdapter `json:"NetworkAdapters,omitempty"` + + VideoMonitor *VideoMonitor `json:"VideoMonitor,omitempty"` + + Keyboard *Keyboard `json:"Keyboard,omitempty"` + + Mouse *Mouse `json:"Mouse,omitempty"` + + HvSocket *HvSocket2 `json:"HvSocket,omitempty"` + + EnhancedModeVideo *EnhancedModeVideo `json:"EnhancedModeVideo,omitempty"` + + GuestCrashReporting *GuestCrashReporting `json:"GuestCrashReporting,omitempty"` + + VirtualSmb *VirtualSmb `json:"VirtualSmb,omitempty"` + + Plan9 *Plan9 `json:"Plan9,omitempty"` + + Battery *Battery `json:"Battery,omitempty"` + + FlexibleIov map[string]FlexibleIoDevice `json:"FlexibleIov,omitempty"` + + SharedMemory *SharedMemoryConfiguration `json:"SharedMemory,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go new file mode 100644 index 0000000000..4fe592f711 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type EnhancedModeVideo struct { + + ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go new file mode 100644 index 0000000000..51011afe40 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type FlexibleIoDevice struct { + + EmulatorId string `json:"EmulatorId,omitempty"` + + HostingModel string `json:"HostingModel,omitempty"` + + Configuration []string `json:"Configuration,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go new file mode 100644 index 0000000000..7db29495b3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestConnection struct { + + // Use Vsock rather than Hyper-V sockets to communicate with the guest service. + UseVsock bool `json:"UseVsock,omitempty"` + + // Don't disconnect the guest connection when pausing the virtual machine. + UseConnectedSuspend bool `json:"UseConnectedSuspend,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go new file mode 100644 index 0000000000..8a369bab71 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Information about the guest. +type GuestConnectionInfo struct { + + // Each schema version x.y stands for the range of versions a.b where a==x and b<=y. This list comes from the SupportedSchemaVersions field in GcsCapabilities. + SupportedSchemaVersions []Version `json:"SupportedSchemaVersions,omitempty"` + + ProtocolVersion int32 `json:"ProtocolVersion,omitempty"` + + GuestDefinedCapabilities *interface{} `json:"GuestDefinedCapabilities,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go new file mode 100644 index 0000000000..c5fa767352 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestCrashReporting struct { + + WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go new file mode 100644 index 0000000000..c708fc7c3f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestOs struct { + + HostName string `json:"HostName,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go new file mode 100644 index 0000000000..ef1eec8865 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type GuestState struct { + + // The path to an existing file uses for persistent guest state storage. An empty string indicates the system should initialize new transient, in-memory guest state. + GuestStateFilePath string `json:"GuestStateFilePath,omitempty"` + + // The path to an existing file for persistent runtime state storage. An empty string indicates the system should initialize new transient, in-memory runtime state. + RuntimeStateFilePath string `json:"RuntimeStateFilePath,omitempty"` + + // If true, the guest state and runtime state files will be used as templates to populate transient, in-memory state instead of using the files as persistent backing store. + ForceTransientState bool `json:"ForceTransientState,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go new file mode 100644 index 0000000000..0797584c51 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type HostedSystem struct { + + SchemaVersion *Version `json:"SchemaVersion,omitempty"` + + Container *Container `json:"Container,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go new file mode 100644 index 0000000000..ef9ffb8dd9 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type HvSocket struct { + + Config *HvSocketSystemConfig `json:"Config,omitempty"` + + EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go new file mode 100644 index 0000000000..a19ba15c15 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// HvSocket configuration for a VM +type HvSocket2 struct { + + HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go new file mode 100644 index 0000000000..a848e91e69 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type HvSocketServiceConfig struct { + + // SDDL string that HvSocket will check before allowing a host process to bind to this specific service. If not specified, defaults to the system DefaultBindSecurityDescriptor, defined in HvSocketSystemWpConfig in V1. + BindSecurityDescriptor string `json:"BindSecurityDescriptor,omitempty"` + + // SDDL string that HvSocket will check before allowing a host process to connect to this specific service. If not specified, defaults to the system DefaultConnectSecurityDescriptor, defined in HvSocketSystemWpConfig in V1. + ConnectSecurityDescriptor string `json:"ConnectSecurityDescriptor,omitempty"` + + // If true, HvSocket will process wildcard binds for this service/system combination. Wildcard binds are secured in the registry at SOFTWARE/Microsoft/Windows NT/CurrentVersion/Virtualization/HvSocket/WildcardDescriptors + AllowWildcardBinds bool `json:"AllowWildcardBinds,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go new file mode 100644 index 0000000000..69f4f9d39b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// This is the HCS Schema version of the HvSocket configuration. The VMWP version is located in Config.Devices.IC in V1. +type HvSocketSystemConfig struct { + + // SDDL string that HvSocket will check before allowing a host process to bind to an unlisted service for this specific container/VM (not wildcard binds). + DefaultBindSecurityDescriptor string `json:"DefaultBindSecurityDescriptor,omitempty"` + + // SDDL string that HvSocket will check before allowing a host process to connect to an unlisted service in the VM/container. + DefaultConnectSecurityDescriptor string `json:"DefaultConnectSecurityDescriptor,omitempty"` + + ServiceTable map[string]HvSocketServiceConfig `json:"ServiceTable,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go new file mode 100644 index 0000000000..3d3fa3b1c7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go @@ -0,0 +1,13 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Keyboard struct { +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go new file mode 100644 index 0000000000..b63b8ef12c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Layer struct { + + Id string `json:"Id,omitempty"` + + Path string `json:"Path,omitempty"` + + PathType string `json:"PathType,omitempty"` + + // Unspecified defaults to Enabled + Cache string `json:"Cache,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go new file mode 100644 index 0000000000..a823a6d3b8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type MappedDirectory struct { + + HostPath string `json:"HostPath,omitempty"` + + HostPathType string `json:"HostPathType,omitempty"` + + ContainerPath string `json:"ContainerPath,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go new file mode 100644 index 0000000000..2d1d2604a9 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type MappedPipe struct { + + ContainerPipeName string `json:"ContainerPipeName,omitempty"` + + HostPath string `json:"HostPath,omitempty"` + + HostPathType string `json:"HostPathType,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go new file mode 100644 index 0000000000..e1d135a3a4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Memory struct { + + SizeInMB int32 `json:"SizeInMB,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go new file mode 100644 index 0000000000..fd766f41a3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Memory2 struct { + + SizeInMB int32 `json:"SizeInMB,omitempty"` + + AllowOvercommit bool `json:"AllowOvercommit,omitempty"` + + EnableHotHint bool `json:"EnableHotHint,omitempty"` + + EnableColdHint bool `json:"EnableColdHint,omitempty"` + + EnableEpf bool `json:"EnableEpf,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go new file mode 100644 index 0000000000..bdd87dffd8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type MemoryInformationForVm struct { + + VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"` + + VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"` + + VirtualNodes []VirtualNodeInfo `json:"VirtualNodes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go new file mode 100644 index 0000000000..6214970f69 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Memory runtime statistics +type MemoryStats struct { + + MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"` + + MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"` + + MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go new file mode 100644 index 0000000000..d29455a3e4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ModifySettingRequest struct { + ResourcePath string `json:"ResourcePath,omitempty"` + + RequestType string `json:"RequestType,omitempty"` + + Settings interface{} `json:"Settings,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated + + GuestRequest interface{} `json:"GuestRequest,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go new file mode 100644 index 0000000000..ccf8b938f3 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go @@ -0,0 +1,13 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Mouse struct { +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go new file mode 100644 index 0000000000..c586f66c25 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type NetworkAdapter struct { + + EndpointId string `json:"EndpointId,omitempty"` + + MacAddress string `json:"MacAddress,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go new file mode 100644 index 0000000000..12c47827c5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go @@ -0,0 +1,24 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Networking struct { + + AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"` + + DnsSearchList string `json:"DnsSearchList,omitempty"` + + NetworkSharedContainerName string `json:"NetworkSharedContainerName,omitempty"` + + // Guid in windows; string in linux + Namespace string `json:"Namespace,omitempty"` + + NetworkAdapters []string `json:"NetworkAdapters,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go new file mode 100644 index 0000000000..1cd70d1790 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Notification data that is indicated to components running in the Virtual Machine. +type PauseNotification struct { + + Reason string `json:"Reason,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go new file mode 100644 index 0000000000..780a5cae2c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Options for HcsPauseComputeSystem +type PauseOptions struct { + + SuspensionLevel string `json:"SuspensionLevel,omitempty"` + + HostedNotification *PauseNotification `json:"HostedNotification,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go new file mode 100644 index 0000000000..705c677e1f --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Plan9 struct { + + Shares []Plan9Share `json:"Shares,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go new file mode 100644 index 0000000000..b2bc58b83c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go @@ -0,0 +1,26 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Plan9Share struct { + + Name string `json:"Name,omitempty"` + + // The name by which the guest operation system can access this share, via the aname parameter in the Plan9 protocol. + AccessName string `json:"AccessName,omitempty"` + + Path string `json:"Path,omitempty"` + + Port int32 `json:"Port,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` + + UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go new file mode 100644 index 0000000000..63e0b7f8fe --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go @@ -0,0 +1,34 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + "time" +) + +// Information about a process running in a container +type ProcessDetails struct { + + ProcessId int32 `json:"ProcessId,omitempty"` + + ImageName string `json:"ImageName,omitempty"` + + CreateTimestamp time.Time `json:"CreateTimestamp,omitempty"` + + UserTime100ns int32 `json:"UserTime100ns,omitempty"` + + KernelTime100ns int32 `json:"KernelTime100ns,omitempty"` + + MemoryCommitBytes int32 `json:"MemoryCommitBytes,omitempty"` + + MemoryWorkingSetPrivateBytes int32 `json:"MemoryWorkingSetPrivateBytes,omitempty"` + + MemoryWorkingSetSharedBytes int32 `json:"MemoryWorkingSetSharedBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go new file mode 100644 index 0000000000..29bc2e3d00 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Passed to HcsRpc_ModifyProcess +type ProcessModifyRequest struct { + + Operation string `json:"Operation,omitempty"` + + ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` + + CloseHandle *CloseHandle `json:"CloseHandle,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go new file mode 100644 index 0000000000..470c55734e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go @@ -0,0 +1,47 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type ProcessParameters struct { + + ApplicationName string `json:"ApplicationName,omitempty"` + + CommandLine string `json:"CommandLine,omitempty"` + + // optional alternative to CommandLine, currently only supported by Linux GCS + CommandArgs []string `json:"CommandArgs,omitempty"` + + User string `json:"User,omitempty"` + + WorkingDirectory string `json:"WorkingDirectory,omitempty"` + + Environment map[string]string `json:"Environment,omitempty"` + + // if set, will run as low-privilege process + RestrictedToken bool `json:"RestrictedToken,omitempty"` + + // if set, ignore StdErrPipe + EmulateConsole bool `json:"EmulateConsole,omitempty"` + + CreateStdInPipe bool `json:"CreateStdInPipe,omitempty"` + + CreateStdOutPipe bool `json:"CreateStdOutPipe,omitempty"` + + CreateStdErrPipe bool `json:"CreateStdErrPipe,omitempty"` + + // height then width + ConsoleSize []int32 `json:"ConsoleSize,omitempty"` + + // if set, find an existing session for the user and create the process in it + UseExistingLogin bool `json:"UseExistingLogin,omitempty"` + + // if set, use the legacy console instead of conhost + UseLegacyConsole bool `json:"UseLegacyConsole,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go new file mode 100644 index 0000000000..20793d1503 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Status of a process running in a container +type ProcessStatus struct { + + ProcessId int32 `json:"ProcessId,omitempty"` + + Exited bool `json:"Exited,omitempty"` + + ExitCode int32 `json:"ExitCode,omitempty"` + + LastWaitResult int32 `json:"LastWaitResult,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go new file mode 100644 index 0000000000..7a60b0245a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Processor struct { + + Count int32 `json:"Count,omitempty"` + + Maximum int32 `json:"Maximum,omitempty"` + + Weight int32 `json:"Weight,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go new file mode 100644 index 0000000000..40d3e7356d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Processor2 struct { + + Count int32 `json:"Count,omitempty"` + + Limit int32 `json:"Limit,omitempty"` + + Weight int32 `json:"Weight,omitempty"` + + ExposeVirtualizationExtensions bool `json:"ExposeVirtualizationExtensions,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go new file mode 100644 index 0000000000..9d3b77e572 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go @@ -0,0 +1,20 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// CPU runtime statistics +type ProcessorStats struct { + + TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"` + + RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"` + + RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go new file mode 100644 index 0000000000..6db2a48f66 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go @@ -0,0 +1,47 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Properties struct { + + Id string `json:"Id,omitempty"` + + SystemType string `json:"SystemType,omitempty"` + + RuntimeOsType string `json:"RuntimeOsType,omitempty"` + + Name string `json:"Name,omitempty"` + + Owner string `json:"Owner,omitempty"` + + RuntimeId string `json:"RuntimeId,omitempty"` + + RuntimeTemplateId string `json:"RuntimeTemplateId,omitempty"` + + State string `json:"State,omitempty"` + + Stopped bool `json:"Stopped,omitempty"` + + ExitType string `json:"ExitType,omitempty"` + + Memory *MemoryInformationForVm `json:"Memory,omitempty"` + + Statistics *Statistics `json:"Statistics,omitempty"` + + ProcessList []ProcessDetails `json:"ProcessList,omitempty"` + + TerminateOnLastHandleClosed bool `json:"TerminateOnLastHandleClosed,omitempty"` + + HostingSystemId string `json:"HostingSystemId,omitempty"` + + SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"` + + GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go new file mode 100644 index 0000000000..22b92ffdfd --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// By default the basic properties will be returned. This query provides a way to request specific properties. +type PropertyQuery struct { + + PropertyTypes []string `json:"PropertyTypes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go new file mode 100644 index 0000000000..97e4531283 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RdpConnectionOptions struct { + + AccessSids []string `json:"AccessSids,omitempty"` + + NamedPipe string `json:"NamedPipe,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go new file mode 100644 index 0000000000..fa574ccc80 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RegistryChanges struct { + + AddValues []RegistryValue `json:"AddValues,omitempty"` + + DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go new file mode 100644 index 0000000000..fab03bc60b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RegistryKey struct { + + Hive string `json:"Hive,omitempty"` + + Name string `json:"Name,omitempty"` + + Volatile bool `json:"Volatile,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go new file mode 100644 index 0000000000..1589f48413 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go @@ -0,0 +1,31 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RegistryValue struct { + + Key *RegistryKey `json:"Key,omitempty"` + + Name string `json:"Name,omitempty"` + + Type_ string `json:"Type,omitempty"` + + // One and only one value type must be set. + StringValue string `json:"StringValue,omitempty"` + + BinaryValue string `json:"BinaryValue,omitempty"` + + DWordValue int32 `json:"DWordValue,omitempty"` + + QWordValue int32 `json:"QWordValue,omitempty"` + + // Only used if RegistryValueType is CustomType The data is in BinaryValue + CustomType int32 `json:"CustomType,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go new file mode 100644 index 0000000000..778ff58735 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type RestoreState struct { + + // The path to the save state file to restore the system from. + SaveStateFilePath string `json:"SaveStateFilePath,omitempty"` + + // The ID of the template system to clone this new system off of. An empty string indicates the system should not be cloned from a template. + TemplateSystemId string `json:"TemplateSystemId,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go new file mode 100644 index 0000000000..e55fa1d98a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SaveOptions struct { + + // The type of save operation to be performed. + SaveType string `json:"SaveType,omitempty"` + + // The path to the file that will container the saved state. + SaveStateFilePath string `json:"SaveStateFilePath,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go new file mode 100644 index 0000000000..bf253a470b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go @@ -0,0 +1,16 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Scsi struct { + + // Map of attachments, where the key is the integer LUN number on the controller. + Attachments map[string]Attachment `json:"Attachments,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go new file mode 100644 index 0000000000..bd573f6cd4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go @@ -0,0 +1,15 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SharedMemoryConfiguration struct { + + Regions []SharedMemoryRegion `json:"Regions,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go new file mode 100644 index 0000000000..a57b2cba73 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SharedMemoryRegion struct { + + SectionName string `json:"SectionName,omitempty"` + + StartOffset int32 `json:"StartOffset,omitempty"` + + Length int32 `json:"Length,omitempty"` + + AllowGuestWrite bool `json:"AllowGuestWrite,omitempty"` + + HiddenFromGuest bool `json:"HiddenFromGuest,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go new file mode 100644 index 0000000000..d9a50cc7da --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type SharedMemoryRegionInfo struct { + + SectionName string `json:"SectionName,omitempty"` + + GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go new file mode 100644 index 0000000000..599c06e8aa --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go @@ -0,0 +1,18 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Silo job information +type SiloProperties struct { + + Enabled bool `json:"Enabled,omitempty"` + + JobName string `json:"JobName,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go new file mode 100644 index 0000000000..5cb3ed93b5 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go @@ -0,0 +1,30 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +import ( + "time" +) + +// Runtime statistics for a container +type Statistics struct { + + Timestamp time.Time `json:"Timestamp,omitempty"` + + ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"` + + Uptime100ns int32 `json:"Uptime100ns,omitempty"` + + Processor *ProcessorStats `json:"Processor,omitempty"` + + Memory *MemoryStats `json:"Memory,omitempty"` + + Storage *StorageStats `json:"Storage,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go new file mode 100644 index 0000000000..2627af9132 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Storage struct { + + // List of layers that describe the parent hierarchy for a container's storage. These layers combined together, presented as a disposable and/or committable working storage, are used by the container to record all changes done to the parent layers. + Layers []Layer `json:"Layers,omitempty"` + + // Path that points to the scratch space of a container, where parent layers are combined together to present a new disposable and/or committable layer with the changes done during its runtime. + Path string `json:"Path,omitempty"` + + QoS *StorageQoS `json:"QoS,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go new file mode 100644 index 0000000000..8c5255df1e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type StorageQoS struct { + + IopsMaximum int32 `json:"IopsMaximum,omitempty"` + + BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go new file mode 100644 index 0000000000..198ea57d75 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go @@ -0,0 +1,22 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +// Storage runtime statistics +type StorageStats struct { + + ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"` + + ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"` + + WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"` + + WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go new file mode 100644 index 0000000000..af2e3c8234 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Topology struct { + + Memory *Memory2 `json:"Memory,omitempty"` + + Processor *Processor2 `json:"Processor,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go new file mode 100644 index 0000000000..ba91178f96 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Uefi struct { + + EnableDebugger bool `json:"EnableDebugger,omitempty"` + + SecureBootTemplateId string `json:"SecureBootTemplateId,omitempty"` + + BootThis *UefiBootEntry `json:"BootThis,omitempty"` + + Console string `json:"Console,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go new file mode 100644 index 0000000000..6620fb2bcf --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/uefi_boot_entry.go @@ -0,0 +1,23 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type UefiBootEntry struct { + + DeviceType string `json:"DeviceType,omitempty"` + + DevicePath string `json:"DevicePath,omitempty"` + + DiskNumber int32 `json:"DiskNumber,omitempty"` + + OptionalData string `json:"OptionalData,omitempty"` + + VmbFsRootPath string `json:"VmbFsRootPath,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go new file mode 100644 index 0000000000..62c0e4d12a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/version.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type Version struct { + + Major int32 `json:"Major,omitempty"` + + Minor int32 `json:"Minor,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go new file mode 100644 index 0000000000..0958e56062 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/video_monitor.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VideoMonitor struct { + + HorizontalResolution int32 `json:"HorizontalResolution,omitempty"` + + VerticalResolution int32 `json:"VerticalResolution,omitempty"` + + ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go new file mode 100644 index 0000000000..11f39eea7b --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_machine.go @@ -0,0 +1,29 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualMachine struct { + + Chipset *Chipset `json:"Chipset,omitempty"` + + ComputeTopology *Topology `json:"ComputeTopology,omitempty"` + + Devices *Devices `json:"Devices,omitempty"` + + GuestState *GuestState `json:"GuestState,omitempty"` + + RestoreState *RestoreState `json:"RestoreState,omitempty"` + + RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"` + + StorageQoS *StorageQoS `json:"StorageQoS,omitempty"` + + GuestConnection *GuestConnection `json:"GuestConnection,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go new file mode 100644 index 0000000000..48402d8ecb --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_node_info.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualNodeInfo struct { + + VirtualNodeIndex int32 `json:"VirtualNodeIndex,omitempty"` + + PhysicalNodeNumber int32 `json:"PhysicalNodeNumber,omitempty"` + + VirtualProcessorCount int32 `json:"VirtualProcessorCount,omitempty"` + + MemoryUsageInPages int32 `json:"MemoryUsageInPages,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go new file mode 100644 index 0000000000..2ef1a47979 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_controller.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualPMemController struct { + + Devices map[string]VirtualPMemDevice `json:"Devices,omitempty"` + + MaximumCount int32 `json:"MaximumCount,omitempty"` + + MaximumSizeBytes int32 `json:"MaximumSizeBytes,omitempty"` + + Backing string `json:"Backing,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go new file mode 100644 index 0000000000..47714444aa --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_p_mem_device.go @@ -0,0 +1,19 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualPMemDevice struct { + + HostPath string `json:"HostPath,omitempty"` + + ReadOnly bool `json:"ReadOnly,omitempty"` + + ImageFormat string `json:"ImageFormat,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go new file mode 100644 index 0000000000..76131b3a71 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualSmb struct { + + Shares []VirtualSmbShare `json:"Shares,omitempty"` + + DirectFileMappingInMB int64 `json:"DirectFileMappingInMB,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go new file mode 100644 index 0000000000..b50098a423 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share.go @@ -0,0 +1,21 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualSmbShare struct { + + Name string `json:"Name,omitempty"` + + Path string `json:"Path,omitempty"` + + AllowedFiles []string `json:"AllowedFiles,omitempty"` + + Options *VirtualSmbShareOptions `json:"Options,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go new file mode 100644 index 0000000000..c1894279dc --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/virtual_smb_share_options.go @@ -0,0 +1,63 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VirtualSmbShareOptions struct { + + ReadOnly bool `json:"ReadOnly,omitempty"` + + // convert exclusive access to shared read access + ShareRead bool `json:"ShareRead,omitempty"` + + // all opens will use cached I/O + CacheIo bool `json:"CacheIo,omitempty"` + + // disable oplock support + NoOplocks bool `json:"NoOplocks,omitempty"` + + // Acquire the backup privilege when attempting to open + TakeBackupPrivilege bool `json:"TakeBackupPrivilege,omitempty"` + + // Use the identity of the share root when opening + UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"` + + // disable Direct Mapping + NoDirectmap bool `json:"NoDirectmap,omitempty"` + + // disable Byterange locks + NoLocks bool `json:"NoLocks,omitempty"` + + // disable Directory CHange Notifications + NoDirnotify bool `json:"NoDirnotify,omitempty"` + + // share is use for VM shared memory + VmSharedMemory bool `json:"VmSharedMemory,omitempty"` + + // allow access only to the files specified in AllowedFiles + RestrictFileAccess bool `json:"RestrictFileAccess,omitempty"` + + // disable all oplocks except Level II + ForceLevelIIOplocks bool `json:"ForceLevelIIOplocks,omitempty"` + + // Allow the host to reparse this base layer + ReparseBaseLayer bool `json:"ReparseBaseLayer,omitempty"` + + // Enable pseudo-oplocks + PseudoOplocks bool `json:"PseudoOplocks,omitempty"` + + // All opens will use non-cached IO + NonCacheIo bool `json:"NonCacheIo,omitempty"` + + // Enable pseudo directory change notifications + PseudoDirnotify bool `json:"PseudoDirnotify,omitempty"` + + // Block directory enumeration, renames, and deletes. + SingleFileMapping bool `json:"SingleFileMapping,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go new file mode 100644 index 0000000000..39f628667c --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/vm_memory.go @@ -0,0 +1,27 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type VmMemory struct { + + AvailableMemory int32 `json:"AvailableMemory,omitempty"` + + AvailableMemoryBuffer int32 `json:"AvailableMemoryBuffer,omitempty"` + + ReservedMemory int32 `json:"ReservedMemory,omitempty"` + + AssignedMemory int32 `json:"AssignedMemory,omitempty"` + + SlpActive bool `json:"SlpActive,omitempty"` + + BalancingEnabled bool `json:"BalancingEnabled,omitempty"` + + DmOperationInProgress bool `json:"DmOperationInProgress,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go new file mode 100644 index 0000000000..cf632bbc83 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/schema2/windows_crash_reporting.go @@ -0,0 +1,17 @@ +/* + * HCS API + * + * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) + * + * API version: 2.1 + * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) + */ + +package hcsschema + +type WindowsCrashReporting struct { + + DumpFileName string `json:"DumpFileName,omitempty"` + + MaxDumpSize int64 `json:"MaxDumpSize,omitempty"` +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go b/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go new file mode 100644 index 0000000000..ff3b6572e6 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go @@ -0,0 +1,70 @@ +package timeout + +import ( + "os" + "strconv" + "time" +) + +var ( + // defaultTimeout is the timeout for most operations that is not overridden. + defaultTimeout = 4 * time.Minute + + // defaultTimeoutTestdRetry is the retry loop timeout for testd to respond + // for a disk to come online in LCOW. + defaultTimeoutTestdRetry = 5 * time.Second +) + +// External variables for HCSShim consumers to use. +var ( + // SystemCreate is the timeout for creating a compute system + SystemCreate time.Duration = defaultTimeout + + // SystemStart is the timeout for starting a compute system + SystemStart time.Duration = defaultTimeout + + // SystemPause is the timeout for pausing a compute system + SystemPause time.Duration = defaultTimeout + + // SystemResume is the timeout for resuming a compute system + SystemResume time.Duration = defaultTimeout + + // SyscallWatcher is the timeout before warning of a potential stuck platform syscall. + SyscallWatcher time.Duration = defaultTimeout + + // Tar2VHD is the timeout for the tar2vhd operation to complete + Tar2VHD time.Duration = defaultTimeout + + // ExternalCommandToStart is the timeout for external commands to start + ExternalCommandToStart = defaultTimeout + + // ExternalCommandToComplete is the timeout for external commands to complete. + // Generally this means copying data from their stdio pipes. + ExternalCommandToComplete = defaultTimeout + + // TestDRetryLoop is the timeout for testd retry loop when onlining a SCSI disk in LCOW + TestDRetryLoop = defaultTimeoutTestdRetry +) + +func init() { + SystemCreate = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMCREATE", SystemCreate) + SystemStart = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMSTART", SystemStart) + SystemPause = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMPAUSE", SystemPause) + SystemResume = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMRESUME", SystemResume) + SyscallWatcher = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSCALLWATCHER", SyscallWatcher) + Tar2VHD = durationFromEnvironment("HCSSHIM_TIMEOUT_TAR2VHD", Tar2VHD) + ExternalCommandToStart = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDSTART", ExternalCommandToStart) + ExternalCommandToComplete = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDCOMPLETE", ExternalCommandToComplete) + TestDRetryLoop = durationFromEnvironment("HCSSHIM_TIMEOUT_TESTDRETRYLOOP", TestDRetryLoop) +} + +func durationFromEnvironment(env string, defaultValue time.Duration) time.Duration { + envTimeout := os.Getenv(env) + if len(envTimeout) > 0 { + e, err := strconv.Atoi(envTimeout) + if err == nil && e > 0 { + return time.Second * time.Duration(e) + } + } + return defaultValue +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go new file mode 100644 index 0000000000..3a0d4bc58e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go @@ -0,0 +1,25 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// ActivateLayer will find the layer with the given id and mount it's filesystem. +// For a read/write layer, the mounted filesystem will appear as a volume on the +// host, while a read-only layer is generally expected to be a no-op. +// An activated layer must later be deactivated via DeactivateLayer. +func ActivateLayer(path string) error { + title := "hcsshim::ActivateLayer " + logrus.Debugf(title+"path %s", path) + + err := activateLayer(&stdDriverInfo, path) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+" - succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/baselayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go similarity index 81% rename from vendor/github.com/Microsoft/hcsshim/baselayer.go rename to vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go index 860185c357..5784241dfa 100644 --- a/vendor/github.com/Microsoft/hcsshim/baselayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go @@ -1,4 +1,4 @@ -package hcsshim +package wclayer import ( "errors" @@ -7,6 +7,8 @@ import ( "syscall" "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/safefile" ) type baseLayerWriter struct { @@ -29,7 +31,7 @@ type dirInfo struct { func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error { for i := range dis { di := &dis[len(dis)-i-1] // reverse order: process child directories first - f, err := openRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, _FILE_OPEN, _FILE_DIRECTORY_FILE) + f, err := safefile.OpenRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_OPEN, safefile.FILE_DIRECTORY_FILE) if err != nil { return err } @@ -84,21 +86,21 @@ func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err e extraFlags := uint32(0) if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 { - extraFlags |= _FILE_DIRECTORY_FILE + extraFlags |= safefile.FILE_DIRECTORY_FILE if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 { w.dirInfo = append(w.dirInfo, dirInfo{name, *fileInfo}) } } mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY) - f, err = openRelative(name, w.root, mode, syscall.FILE_SHARE_READ, _FILE_CREATE, extraFlags) + f, err = safefile.OpenRelative(name, w.root, mode, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, extraFlags) if err != nil { - return makeError(err, "Failed to openRelative", name) + return hcserror.New(err, "Failed to safefile.OpenRelative", name) } err = winio.SetFileBasicInfo(f, fileInfo) if err != nil { - return makeError(err, "Failed to SetFileBasicInfo", name) + return hcserror.New(err, "Failed to SetFileBasicInfo", name) } w.f = f @@ -119,7 +121,7 @@ func (w *baseLayerWriter) AddLink(name string, target string) (err error) { return err } - return linkRelative(target, w.root, name, w.root) + return safefile.LinkRelative(target, w.root, name, w.root) } func (w *baseLayerWriter) Remove(name string) error { @@ -157,7 +159,7 @@ func (w *baseLayerWriter) Close() error { } if w.hasUtilityVM { - err := ensureNotReparsePointRelative("UtilityVM", w.root) + err := safefile.EnsureNotReparsePointRelative("UtilityVM", w.root) if err != nil { return err } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go new file mode 100644 index 0000000000..d158177308 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go @@ -0,0 +1,23 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// CreateLayer creates a new, empty, read-only layer on the filesystem based on +// the parent layer provided. +func CreateLayer(path, parent string) error { + title := "hcsshim::CreateLayer " + logrus.Debugf(title+"ID %s parent %s", path, parent) + + err := createLayer(&stdDriverInfo, path, parent) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s parent=%s", path, parent) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded path=%s parent=%s", path, parent) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go new file mode 100644 index 0000000000..bf2fece198 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go @@ -0,0 +1,31 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// CreateScratchLayer creates and populates new read-write layer for use by a container. +// This requires both the id of the direct parent layer, as well as the full list +// of paths to all parent layers up to the base (and including the direct parent +// whose id was provided). +func CreateScratchLayer(path string, parentLayerPaths []string) error { + title := "hcsshim::CreateScratchLayer " + logrus.Debugf(title+"path %s", path) + + // Generate layer descriptors + layers, err := layerPathsToDescriptors(parentLayerPaths) + if err != nil { + return err + } + + err = createSandboxLayer(&stdDriverInfo, path, 0, layers) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go new file mode 100644 index 0000000000..b998f8a193 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go @@ -0,0 +1,22 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// DeactivateLayer will dismount a layer that was mounted via ActivateLayer. +func DeactivateLayer(path string) error { + title := "hcsshim::DeactivateLayer " + logrus.Debugf(title+"path %s", path) + + err := deactivateLayer(&stdDriverInfo, path) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go new file mode 100644 index 0000000000..dc14cecc47 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go @@ -0,0 +1,23 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// DestroyLayer will remove the on-disk files representing the layer with the given +// path, including that layer's containing folder, if any. +func DestroyLayer(path string) error { + title := "hcsshim::DestroyLayer " + logrus.Debugf(title+"path %s", path) + + err := destroyLayer(&stdDriverInfo, path) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go new file mode 100644 index 0000000000..7832bb452e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go @@ -0,0 +1,22 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// ExpandScratchSize expands the size of a layer to at least size bytes. +func ExpandScratchSize(path string, size uint64) error { + title := "hcsshim::ExpandScratchSize " + logrus.Debugf(title+"path=%s size=%d", path, size) + + err := expandSandboxSize(&stdDriverInfo, path, size) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s size=%d", path, size) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"- succeeded path=%s size=%d", path, size) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/exportlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go similarity index 70% rename from vendor/github.com/Microsoft/hcsshim/exportlayer.go rename to vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go index d7025f20ba..c6b3480ce7 100644 --- a/vendor/github.com/Microsoft/hcsshim/exportlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go @@ -1,4 +1,4 @@ -package hcsshim +package wclayer import ( "io" @@ -7,6 +7,8 @@ import ( "syscall" "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/interop" "github.com/sirupsen/logrus" ) @@ -15,9 +17,9 @@ import ( // format includes any metadata required for later importing the layer (using // ImportLayer), and requires the full list of parent layer paths in order to // perform the export. -func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { +func ExportLayer(path string, exportFolderPath string, parentLayerPaths []string) error { title := "hcsshim::ExportLayer " - logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerId, exportFolderPath) + logrus.Debugf(title+"path %s folder %s", path, exportFolderPath) // Generate layer descriptors layers, err := layerPathsToDescriptors(parentLayerPaths) @@ -25,21 +27,14 @@ func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, paren return err } - // Convert info to API calling convention - infop, err := convertDriverInfo(info) + err = exportLayer(&stdDriverInfo, path, exportFolderPath, layers) if err != nil { + err = hcserror.Errorf(err, title, "path=%s folder=%s", path, exportFolderPath) logrus.Error(err) return err } - err = exportLayer(&infop, layerId, exportFolderPath, layers) - if err != nil { - err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerId, info.Flavour, exportFolderPath) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerId, exportFolderPath) + logrus.Debugf(title+"succeeded path=%s folder=%s", path, exportFolderPath) return nil } @@ -69,11 +64,11 @@ func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) if err == syscall.ERROR_NO_MORE_FILES { err = io.EOF } else { - err = makeError(err, "ExportLayerNext", "") + err = hcserror.New(err, "ExportLayerNext", "") } return "", 0, nil, err } - fileName := convertAndFreeCoTaskMemString(fileNamep) + fileName := interop.ConvertAndFreeCoTaskMemString(fileNamep) if deleted != 0 { fileInfo = nil } @@ -88,7 +83,7 @@ func (r *FilterLayerReader) Read(b []byte) (int, error) { var bytesRead uint32 err := exportLayerRead(r.context, b, &bytesRead) if err != nil { - return 0, makeError(err, "ExportLayerRead", "") + return 0, hcserror.New(err, "ExportLayerRead", "") } if bytesRead == 0 { return 0, io.EOF @@ -103,7 +98,7 @@ func (r *FilterLayerReader) Close() (err error) { if r.context != 0 { err = exportLayerEnd(r.context) if err != nil { - err = makeError(err, "ExportLayerEnd", "") + err = hcserror.New(err, "ExportLayerEnd", "") } r.context = 0 } @@ -113,34 +108,30 @@ func (r *FilterLayerReader) Close() (err error) { // NewLayerReader returns a new layer reader for reading the contents of an on-disk layer. // The caller must have taken the SeBackupPrivilege privilege // to call this and any methods on the resulting LayerReader. -func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { +func NewLayerReader(path string, parentLayerPaths []string) (LayerReader, error) { if procExportLayerBegin.Find() != nil { // The new layer reader is not available on this Windows build. Fall back to the // legacy export code path. - path, err := ioutil.TempDir("", "hcs") + exportPath, err := ioutil.TempDir("", "hcs") if err != nil { return nil, err } - err = ExportLayer(info, layerID, path, parentLayerPaths) + err = ExportLayer(path, exportPath, parentLayerPaths) if err != nil { - os.RemoveAll(path) + os.RemoveAll(exportPath) return nil, err } - return &legacyLayerReaderWrapper{newLegacyLayerReader(path)}, nil + return &legacyLayerReaderWrapper{newLegacyLayerReader(exportPath)}, nil } layers, err := layerPathsToDescriptors(parentLayerPaths) if err != nil { return nil, err } - infop, err := convertDriverInfo(info) - if err != nil { - return nil, err - } r := &FilterLayerReader{} - err = exportLayerBegin(&infop, layerID, layers, &r.context) + err = exportLayerBegin(&stdDriverInfo, path, layers, &r.context) if err != nil { - return nil, makeError(err, "ExportLayerBegin", "") + return nil, hcserror.New(err, "ExportLayerBegin", "") } return r, err } diff --git a/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go similarity index 52% rename from vendor/github.com/Microsoft/hcsshim/getlayermountpath.go rename to vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go index 89f8079d0f..8c37549a0e 100644 --- a/vendor/github.com/Microsoft/hcsshim/getlayermountpath.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go @@ -1,34 +1,28 @@ -package hcsshim +package wclayer import ( "syscall" + "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/sirupsen/logrus" ) -// GetLayerMountPath will look for a mounted layer with the given id and return +// GetLayerMountPath will look for a mounted layer with the given path and return // the path at which that layer can be accessed. This path may be a volume path // if the layer is a mounted read-write layer, otherwise it is expected to be the // folder path at which the layer is stored. -func GetLayerMountPath(info DriverInfo, id string) (string, error) { +func GetLayerMountPath(path string) (string, error) { title := "hcsshim::GetLayerMountPath " - logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return "", err - } + logrus.Debugf(title+"path %s", path) var mountPathLength uintptr mountPathLength = 0 // Call the procedure itself. logrus.Debugf("Calling proc (1)") - err = getLayerMountPath(&infop, id, &mountPathLength, nil) + err := getLayerMountPath(&stdDriverInfo, path, &mountPathLength, nil) if err != nil { - err = makeErrorf(err, title, "(first call) id=%s flavour=%d", id, info.Flavour) + err = hcserror.Errorf(err, title, "(first call) path=%s", path) logrus.Error(err) return "", err } @@ -42,14 +36,14 @@ func GetLayerMountPath(info DriverInfo, id string) (string, error) { // Call the procedure again logrus.Debugf("Calling proc (2)") - err = getLayerMountPath(&infop, id, &mountPathLength, &mountPathp[0]) + err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, &mountPathp[0]) if err != nil { - err = makeErrorf(err, title, "(second call) id=%s flavour=%d", id, info.Flavour) + err = hcserror.Errorf(err, title, "(second call) path=%s", path) logrus.Error(err) return "", err } - path := syscall.UTF16ToString(mountPathp[0:]) - logrus.Debugf(title+"succeeded flavour=%d id=%s path=%s", info.Flavour, id, path) - return path, nil + mountPath := syscall.UTF16ToString(mountPathp[0:]) + logrus.Debugf(title+"succeeded path=%s mountPath=%s", path, mountPath) + return mountPath, nil } diff --git a/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go similarity index 67% rename from vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go rename to vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go index 05d3d9532a..10899c68af 100644 --- a/vendor/github.com/Microsoft/hcsshim/getsharedbaseimages.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go @@ -1,6 +1,10 @@ -package hcsshim +package wclayer -import "github.com/sirupsen/logrus" +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/interop" + "github.com/sirupsen/logrus" +) // GetSharedBaseImages will enumerate the images stored in the common central // image store and return descriptive info about those images for the purpose @@ -12,11 +16,11 @@ func GetSharedBaseImages() (imageData string, err error) { var buffer *uint16 err = getBaseImages(&buffer) if err != nil { - err = makeError(err, title, "") + err = hcserror.New(err, title, "") logrus.Error(err) return } - imageData = convertAndFreeCoTaskMemString(buffer) + imageData = interop.ConvertAndFreeCoTaskMemString(buffer) logrus.Debugf(title+" - succeeded output=%s", imageData) return } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go new file mode 100644 index 0000000000..d86e678275 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go @@ -0,0 +1,24 @@ +package wclayer + +import ( + "fmt" + + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// GrantVmAccess adds access to a file for a given VM +func GrantVmAccess(vmid string, filepath string) error { + title := fmt.Sprintf("hcsshim::GrantVmAccess id:%s path:%s ", vmid, filepath) + logrus.Debugf(title) + + err := grantVmAccess(vmid, filepath) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", filepath) + logrus.Error(err) + return err + } + + logrus.Debugf(title + " - succeeded") + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/importlayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go similarity index 71% rename from vendor/github.com/Microsoft/hcsshim/importlayer.go rename to vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go index 2742b9f750..c978450f82 100644 --- a/vendor/github.com/Microsoft/hcsshim/importlayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go @@ -1,4 +1,4 @@ -package hcsshim +package wclayer import ( "errors" @@ -7,6 +7,8 @@ import ( "path/filepath" "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/Microsoft/hcsshim/internal/safefile" "github.com/sirupsen/logrus" ) @@ -14,9 +16,9 @@ import ( // that into a layer with the id layerId. Note that in order to correctly populate // the layer and interperet the transport format, all parent layers must already // be present on the system at the paths provided in parentLayerPaths. -func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { +func ImportLayer(path string, importFolderPath string, parentLayerPaths []string) error { title := "hcsshim::ImportLayer " - logrus.Debugf(title+"flavour %d layerId %s folder %s", info.Flavour, layerID, importFolderPath) + logrus.Debugf(title+"path %s folder %s", path, importFolderPath) // Generate layer descriptors layers, err := layerPathsToDescriptors(parentLayerPaths) @@ -24,21 +26,14 @@ func ImportLayer(info DriverInfo, layerID string, importFolderPath string, paren return err } - // Convert info to API calling convention - infop, err := convertDriverInfo(info) + err = importLayer(&stdDriverInfo, path, importFolderPath, layers) if err != nil { + err = hcserror.Errorf(err, title, "path=%s folder=%s", path, importFolderPath) logrus.Error(err) return err } - err = importLayer(&infop, layerID, importFolderPath, layers) - if err != nil { - err = makeErrorf(err, title, "layerId=%s flavour=%d folder=%s", layerID, info.Flavour, importFolderPath) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"succeeded flavour=%d layerId=%s folder=%s", info.Flavour, layerID, importFolderPath) + logrus.Debugf(title+"succeeded path=%s folder=%s", path, importFolderPath) return nil } @@ -73,7 +68,7 @@ func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro } err := importLayerNext(w.context, name, fileInfo) if err != nil { - return makeError(err, "ImportLayerNext", "") + return hcserror.New(err, "ImportLayerNext", "") } return nil } @@ -92,7 +87,7 @@ func (w *FilterLayerWriter) Remove(name string) error { } err := importLayerNext(w.context, name, nil) if err != nil { - return makeError(err, "ImportLayerNext", "") + return hcserror.New(err, "ImportLayerNext", "") } return nil } @@ -101,7 +96,7 @@ func (w *FilterLayerWriter) Remove(name string) error { func (w *FilterLayerWriter) Write(b []byte) (int, error) { err := importLayerWrite(w.context, b) if err != nil { - err = makeError(err, "ImportLayerWrite", "") + err = hcserror.New(err, "ImportLayerWrite", "") return 0, err } return len(b), err @@ -113,7 +108,7 @@ func (w *FilterLayerWriter) Close() (err error) { if w.context != 0 { err = importLayerEnd(w.context) if err != nil { - err = makeError(err, "ImportLayerEnd", "") + err = hcserror.New(err, "ImportLayerEnd", "") } w.context = 0 } @@ -122,8 +117,6 @@ func (w *FilterLayerWriter) Close() (err error) { type legacyLayerWriterWrapper struct { *legacyLayerWriter - info DriverInfo - layerID string path string parentLayerPaths []string } @@ -136,28 +129,26 @@ func (r *legacyLayerWriterWrapper) Close() error { return err } - info := r.info - info.HomeDir = "" - if err = ImportLayer(info, r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil { + if err = ImportLayer(r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil { return err } for _, name := range r.Tombstones { - if err = removeRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) { + if err = safefile.RemoveRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) { return err } } // Add any hard links that were collected. for _, lnk := range r.PendingLinks { - if err = removeRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) { + if err = safefile.RemoveRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) { return err } - if err = linkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil { + if err = safefile.LinkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil { return err } } // Prepare the utility VM for use if one is present in the layer. if r.HasUtilityVM { - err := ensureNotReparsePointRelative("UtilityVM", r.destRoot) + err := safefile.EnsureNotReparsePointRelative("UtilityVM", r.destRoot) if err != nil { return err } @@ -172,10 +163,10 @@ func (r *legacyLayerWriterWrapper) Close() error { // NewLayerWriter returns a new layer writer for creating a layer on disk. // The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges // to call this and any methods on the resulting LayerWriter. -func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { +func NewLayerWriter(path string, parentLayerPaths []string) (LayerWriter, error) { if len(parentLayerPaths) == 0 { // This is a base layer. It gets imported differently. - f, err := openRoot(filepath.Join(info.HomeDir, layerID)) + f, err := safefile.OpenRoot(path) if err != nil { return nil, err } @@ -187,19 +178,17 @@ func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) if procImportLayerBegin.Find() != nil { // The new layer reader is not available on this Windows build. Fall back to the // legacy export code path. - path, err := ioutil.TempDir("", "hcs") + importPath, err := ioutil.TempDir("", "hcs") if err != nil { return nil, err } - w, err := newLegacyLayerWriter(path, parentLayerPaths, filepath.Join(info.HomeDir, layerID)) + w, err := newLegacyLayerWriter(importPath, parentLayerPaths, path) if err != nil { return nil, err } return &legacyLayerWriterWrapper{ legacyLayerWriter: w, - info: info, - layerID: layerID, - path: path, + path: importPath, parentLayerPaths: parentLayerPaths, }, nil } @@ -208,15 +197,10 @@ func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) return nil, err } - infop, err := convertDriverInfo(info) - if err != nil { - return nil, err - } - w := &FilterLayerWriter{} - err = importLayerBegin(&infop, layerID, layers, &w.context) + err = importLayerBegin(&stdDriverInfo, path, layers, &w.context) if err != nil { - return nil, makeError(err, "ImportLayerStart", "") + return nil, hcserror.New(err, "ImportLayerStart", "") } return w, nil } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go new file mode 100644 index 0000000000..71287ff8a7 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go @@ -0,0 +1,25 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// LayerExists will return true if a layer with the given id exists and is known +// to the system. +func LayerExists(path string) (bool, error) { + title := "hcsshim::LayerExists " + logrus.Debugf(title+"path %s", path) + + // Call the procedure itself. + var exists uint32 + err := layerExists(&stdDriverInfo, path, &exists) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return false, err + } + + logrus.Debugf(title+"succeeded path=%s exists=%d", path, exists) + return exists != 0, nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go new file mode 100644 index 0000000000..90df3bedce --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go @@ -0,0 +1,13 @@ +package wclayer + +import ( + "path/filepath" + + "github.com/Microsoft/hcsshim/internal/guid" +) + +// LayerID returns the layer ID of a layer on disk. +func LayerID(path string) (guid.GUID, error) { + _, file := filepath.Split(path) + return NameToGuid(file) +} diff --git a/vendor/github.com/Microsoft/hcsshim/layerutils.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go similarity index 72% rename from vendor/github.com/Microsoft/hcsshim/layerutils.go rename to vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go index c0e5503773..a1b8b98826 100644 --- a/vendor/github.com/Microsoft/hcsshim/layerutils.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go @@ -1,12 +1,12 @@ -package hcsshim +package wclayer // This file contains utility functions to support storage (graph) related // functionality. import ( - "path/filepath" "syscall" + "github.com/Microsoft/hcsshim/internal/guid" "github.com/sirupsen/logrus" ) @@ -22,28 +22,16 @@ struct DriverInfo { LPCWSTR HomeDir; }; */ -type DriverInfo struct { - Flavour int - HomeDir string -} type driverInfo struct { Flavour int HomeDirp *uint16 } -func convertDriverInfo(info DriverInfo) (driverInfo, error) { - homedirp, err := syscall.UTF16PtrFromString(info.HomeDir) - if err != nil { - logrus.Debugf("Failed conversion of home to pointer for driver info: %s", err.Error()) - return driverInfo{}, err - } - - return driverInfo{ - Flavour: info.Flavour, - HomeDirp: homedirp, - }, nil -} +var ( + utf16EmptyString uint16 + stdDriverInfo = driverInfo{1, &utf16EmptyString} +) /* To pass into syscall, we need a struct matching the following: typedef struct _WC_LAYER_DESCRIPTOR { @@ -75,7 +63,7 @@ typedef struct _WC_LAYER_DESCRIPTOR { } WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR; */ type WC_LAYER_DESCRIPTOR struct { - LayerId GUID + LayerId guid.GUID Flags uint32 Pathp *uint16 } @@ -85,10 +73,7 @@ func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, var layers []WC_LAYER_DESCRIPTOR for i := 0; i < len(parentLayerPaths); i++ { - // Create a layer descriptor, using the folder name - // as the source for a GUID LayerId - _, folderName := filepath.Split(parentLayerPaths[i]) - g, err := NameToGuid(folderName) + g, err := LayerID(parentLayerPaths[i]) if err != nil { logrus.Debugf("Failed to convert name to guid %s", err) return nil, err diff --git a/vendor/github.com/Microsoft/hcsshim/legacy.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go similarity index 88% rename from vendor/github.com/Microsoft/hcsshim/legacy.go rename to vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go index 0b23b6c4d0..b8ea5d2632 100644 --- a/vendor/github.com/Microsoft/hcsshim/legacy.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go @@ -1,4 +1,4 @@ -package hcsshim +package wclayer import ( "bufio" @@ -6,12 +6,15 @@ import ( "errors" "fmt" "io" + "io/ioutil" "os" "path/filepath" "strings" "syscall" "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/longpath" + "github.com/Microsoft/hcsshim/internal/safefile" ) var errorIterationCanceled = errors.New("") @@ -34,23 +37,6 @@ func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition) } -func makeLongAbsPath(path string) (string, error) { - if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) { - return path, nil - } - if !filepath.IsAbs(path) { - absPath, err := filepath.Abs(path) - if err != nil { - return "", err - } - path = absPath - } - if strings.HasPrefix(path, `\\`) { - return `\\?\UNC\` + path[2:], nil - } - return `\\?\` + path, nil -} - func hasPathPrefix(p, prefix string) bool { return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\' } @@ -106,7 +92,7 @@ func readTombstones(path string) (map[string]([]string), error) { } func (r *legacyLayerReader) walkUntilCancelled() error { - root, err := makeLongAbsPath(r.root) + root, err := longpath.LongAbs(r.root) if err != nil { return err } @@ -283,7 +269,7 @@ func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.Fil if err != nil { return } - fileInfo.FileAttributes = uintptr(attr) + fileInfo.FileAttributes = attr beginning := int64(4) // Find the accurate file size. @@ -349,6 +335,7 @@ type legacyLayerWriter struct { destRoot *os.File parentRoots []*os.File currentFile *os.File + bufWriter *bufio.Writer currentFileName string currentFileRoot *os.File backupWriter *winio.BackupFileWriter @@ -373,21 +360,22 @@ func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w w = nil } }() - w.root, err = openRoot(root) + w.root, err = safefile.OpenRoot(root) if err != nil { return } - w.destRoot, err = openRoot(destRoot) + w.destRoot, err = safefile.OpenRoot(destRoot) if err != nil { return } for _, r := range parentRoots { - f, err := openRoot(r) + f, err := safefile.OpenRoot(r) if err != nil { return w, err } w.parentRoots = append(w.parentRoots, f) } + w.bufWriter = bufio.NewWriterSize(ioutil.Discard, 65536) return } @@ -408,7 +396,7 @@ func (w *legacyLayerWriter) CloseRoots() { func (w *legacyLayerWriter) initUtilityVM() error { if !w.HasUtilityVM { - err := mkdirRelative(utilityVMPath, w.destRoot) + err := safefile.MkdirRelative(utilityVMPath, w.destRoot) if err != nil { return err } @@ -426,6 +414,11 @@ func (w *legacyLayerWriter) initUtilityVM() error { } func (w *legacyLayerWriter) reset() error { + err := w.bufWriter.Flush() + if err != nil { + return err + } + w.bufWriter.Reset(ioutil.Discard) if w.currentIsDir { r := w.currentFile br := winio.NewBackupStreamReader(r) @@ -449,7 +442,7 @@ func (w *legacyLayerWriter) reset() error { // describes a directory reparse point. Delete the placeholder // directory to prevent future files being added into the // destination of the reparse point during the ImportLayer call - if err := removeRelative(w.currentFileName, w.currentFileRoot); err != nil { + if err := safefile.RemoveRelative(w.currentFileName, w.currentFileRoot); err != nil { return err } w.pendingDirs = append(w.pendingDirs, pendingDir{Path: w.currentFileName, Root: w.currentFileRoot}) @@ -474,13 +467,13 @@ func (w *legacyLayerWriter) reset() error { // copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) { - src, err := openRelative( + src, err := safefile.OpenRelative( subPath, srcRoot, syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY, syscall.FILE_SHARE_READ, - _FILE_OPEN, - _FILE_OPEN_REPARSE_POINT) + safefile.FILE_OPEN, + safefile.FILE_OPEN_REPARSE_POINT) if err != nil { return nil, err } @@ -495,14 +488,14 @@ func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool extraFlags := uint32(0) if isDir { - extraFlags |= _FILE_DIRECTORY_FILE + extraFlags |= safefile.FILE_DIRECTORY_FILE } - dest, err := openRelative( + dest, err := safefile.OpenRelative( subPath, destRoot, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, syscall.FILE_SHARE_READ, - _FILE_CREATE, + safefile.FILE_CREATE, extraFlags) if err != nil { return nil, err @@ -534,7 +527,7 @@ func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool // the file names in the provided map and just copies those files. func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles map[string]bool) error { var di []dirInfo - err := ensureNotReparsePointRelative(subPath, srcRoot) + err := safefile.EnsureNotReparsePointRelative(subPath, srcRoot) if err != nil { return err } @@ -566,18 +559,12 @@ func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles di = append(di, dirInfo{path: relPath, fileInfo: *fi}) } } else { - err = linkRelative(relPath, srcRoot, relPath, destRoot) + err = safefile.LinkRelative(relPath, srcRoot, relPath, destRoot) if err != nil { return err } } - // Don't recurse on reparse points in go1.8 and older. Filepath.Walk - // handles this in go1.9 and newer. - if isDir && isReparsePoint && shouldSkipDirectoryReparse { - return filepath.SkipDir - } - return nil }) if err != nil { @@ -604,9 +591,9 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath { return errors.New("invalid UtilityVM layer") } - createDisposition := uint32(_FILE_OPEN) + createDisposition := uint32(safefile.FILE_OPEN) if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { - st, err := lstatRelative(name, w.destRoot) + st, err := safefile.LstatRelative(name, w.destRoot) if err != nil && !os.IsNotExist(err) { return err } @@ -614,14 +601,14 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro // Delete the existing file/directory if it is not the same type as this directory. existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { - if err = removeAllRelative(name, w.destRoot); err != nil { + if err = safefile.RemoveAllRelative(name, w.destRoot); err != nil { return err } st = nil } } if st == nil { - if err = mkdirRelative(name, w.destRoot); err != nil { + if err = safefile.MkdirRelative(name, w.destRoot); err != nil { return err } } @@ -630,20 +617,20 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro } } else { // Overwrite any existing hard link. - err := removeRelative(name, w.destRoot) + err := safefile.RemoveRelative(name, w.destRoot) if err != nil && !os.IsNotExist(err) { return err } - createDisposition = _FILE_CREATE + createDisposition = safefile.FILE_CREATE } - f, err := openRelative( + f, err := safefile.OpenRelative( name, w.destRoot, syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY, syscall.FILE_SHARE_READ, createDisposition, - _FILE_OPEN_REPARSE_POINT, + safefile.FILE_OPEN_REPARSE_POINT, ) if err != nil { return err @@ -651,7 +638,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro defer func() { if f != nil { f.Close() - removeRelative(name, w.destRoot) + safefile.RemoveRelative(name, w.destRoot) } }() @@ -661,6 +648,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro } w.backupWriter = winio.NewBackupFileWriter(f, true) + w.bufWriter.Reset(w.backupWriter) w.currentFile = f w.currentFileName = name w.currentFileRoot = w.destRoot @@ -671,7 +659,7 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro fname := name if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 { - err := mkdirRelative(name, w.root) + err := safefile.MkdirRelative(name, w.root) if err != nil { return err } @@ -679,14 +667,14 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro w.currentIsDir = true } - f, err := openRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, _FILE_CREATE, 0) + f, err := safefile.OpenRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, 0) if err != nil { return err } defer func() { if f != nil { f.Close() - removeRelative(fname, w.root) + safefile.RemoveRelative(fname, w.root) } }() @@ -699,10 +687,13 @@ func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) erro if hasPathPrefix(name, hivesPath) { w.backupWriter = winio.NewBackupFileWriter(f, false) + w.bufWriter.Reset(w.backupWriter) } else { + w.bufWriter.Reset(f) // The file attributes are written before the stream. - err = binary.Write(f, binary.LittleEndian, uint32(fileInfo.FileAttributes)) + err = binary.Write(w.bufWriter, binary.LittleEndian, uint32(fileInfo.FileAttributes)) if err != nil { + w.bufWriter.Reset(ioutil.Discard) return err } } @@ -744,7 +735,7 @@ func (w *legacyLayerWriter) AddLink(name string, target string) error { selectedRoot = w.destRoot } else { for _, r := range roots { - if _, err := lstatRelative(target, r); err != nil { + if _, err := safefile.LstatRelative(target, r); err != nil { if !os.IsNotExist(err) { return err } @@ -780,10 +771,10 @@ func (w *legacyLayerWriter) Remove(name string) error { // Make sure the path exists; os.RemoveAll will not fail if the file is // already gone, and this needs to be a fatal error for diagnostics // purposes. - if _, err := lstatRelative(name, w.destRoot); err != nil { + if _, err := safefile.LstatRelative(name, w.destRoot); err != nil { return err } - err = removeAllRelative(name, w.destRoot) + err = safefile.RemoveAllRelative(name, w.destRoot) if err != nil { return err } @@ -795,24 +786,21 @@ func (w *legacyLayerWriter) Remove(name string) error { } func (w *legacyLayerWriter) Write(b []byte) (int, error) { - if w.backupWriter == nil { - if w.currentFile == nil { - return 0, errors.New("closed") - } - return w.currentFile.Write(b) + if w.backupWriter == nil && w.currentFile == nil { + return 0, errors.New("closed") } - return w.backupWriter.Write(b) + return w.bufWriter.Write(b) } func (w *legacyLayerWriter) Close() error { if err := w.reset(); err != nil { return err } - if err := removeRelative("tombstones.txt", w.root); err != nil && !os.IsNotExist(err) { + if err := safefile.RemoveRelative("tombstones.txt", w.root); err != nil && !os.IsNotExist(err) { return err } for _, pd := range w.pendingDirs { - err := mkdirRelative(pd.Path, pd.Root) + err := safefile.MkdirRelative(pd.Path, pd.Root) if err != nil { return err } diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go new file mode 100644 index 0000000000..741994ba4d --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go @@ -0,0 +1,24 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/guid" + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// NameToGuid converts the given string into a GUID using the algorithm in the +// Host Compute Service, ensuring GUIDs generated with the same string are common +// across all clients. +func NameToGuid(name string) (id guid.GUID, err error) { + title := "hcsshim::NameToGuid " + + err = nameToGuid(name, &id) + if err != nil { + err = hcserror.Errorf(err, title, "name=%s", name) + logrus.Error(err) + return + } + + logrus.Debugf(title+"name:%s guid:%s", name, id.String()) + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/preparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go similarity index 58% rename from vendor/github.com/Microsoft/hcsshim/preparelayer.go rename to vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go index 5c5b618411..bd4005dc4f 100644 --- a/vendor/github.com/Microsoft/hcsshim/preparelayer.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go @@ -1,21 +1,22 @@ -package hcsshim +package wclayer import ( "sync" + "github.com/Microsoft/hcsshim/internal/hcserror" "github.com/sirupsen/logrus" ) var prepareLayerLock sync.Mutex -// PrepareLayer finds a mounted read-write layer matching layerId and enables the +// PrepareLayer finds a mounted read-write layer matching path and enables the // the filesystem filter for use on that layer. This requires the paths to all // parent layers, and is necessary in order to view or interact with the layer // as an actual filesystem (reading and writing files, creating directories, etc). // Disabling the filter must be done via UnprepareLayer. -func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { +func PrepareLayer(path string, parentLayerPaths []string) error { title := "hcsshim::PrepareLayer " - logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) + logrus.Debugf(title+"path %s", path) // Generate layer descriptors layers, err := layerPathsToDescriptors(parentLayerPaths) @@ -23,24 +24,17 @@ func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) er return err } - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - // This lock is a temporary workaround for a Windows bug. Only allowing one // call to prepareLayer at a time vastly reduces the chance of a timeout. prepareLayerLock.Lock() defer prepareLayerLock.Unlock() - err = prepareLayer(&infop, layerId, layers) + err = prepareLayer(&stdDriverInfo, path, layers) if err != nil { - err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) + err = hcserror.Errorf(err, title, "path=%s", path) logrus.Error(err) return err } - logrus.Debugf(title+"succeeded flavour=%d layerId=%s", info.Flavour, layerId) + logrus.Debugf(title+"succeeded path=%s", path) return nil } diff --git a/vendor/github.com/Microsoft/hcsshim/processimage.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go similarity index 97% rename from vendor/github.com/Microsoft/hcsshim/processimage.go rename to vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go index fadb1b92c5..884207c3ed 100644 --- a/vendor/github.com/Microsoft/hcsshim/processimage.go +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/processimage.go @@ -1,4 +1,4 @@ -package hcsshim +package wclayer import "os" diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go new file mode 100644 index 0000000000..5f1b4f4f4e --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/unpreparelayer.go @@ -0,0 +1,23 @@ +package wclayer + +import ( + "github.com/Microsoft/hcsshim/internal/hcserror" + "github.com/sirupsen/logrus" +) + +// UnprepareLayer disables the filesystem filter for the read-write layer with +// the given id. +func UnprepareLayer(path string) error { + title := "hcsshim::UnprepareLayer " + logrus.Debugf(title+"path %s", path) + + err := unprepareLayer(&stdDriverInfo, path) + if err != nil { + err = hcserror.Errorf(err, title, "path=%s", path) + logrus.Error(err) + return err + } + + logrus.Debugf(title+"succeeded path=%s", path) + return nil +} diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go new file mode 100644 index 0000000000..768a6f2f16 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/wclayer.go @@ -0,0 +1,37 @@ +package wclayer + +import "github.com/Microsoft/hcsshim/internal/guid" + +//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go -winio wclayer.go + +//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer? +//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer? +//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer? +//sys createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer? +//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize? +//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer? +//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer? +//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer? +//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath? +//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages? +//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer? +//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists? +//sys nameToGuid(name string, guid *_guid) (hr error) = vmcompute.NameToGuid? +//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer? +//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer? +//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage? +//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage? + +//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin? +//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext? +//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite? +//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd? + +//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin? +//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext? +//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead? +//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd? + +//sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess? + +type _guid = guid.GUID diff --git a/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go new file mode 100644 index 0000000000..cb813aa3d4 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/internal/wclayer/zsyscall_windows.go @@ -0,0 +1,597 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package wclayer + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/go-winio" + "github.com/Microsoft/hcsshim/internal/interop" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") + + procActivateLayer = modvmcompute.NewProc("ActivateLayer") + procCopyLayer = modvmcompute.NewProc("CopyLayer") + procCreateLayer = modvmcompute.NewProc("CreateLayer") + procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") + procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") + procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") + procDestroyLayer = modvmcompute.NewProc("DestroyLayer") + procExportLayer = modvmcompute.NewProc("ExportLayer") + procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") + procGetBaseImages = modvmcompute.NewProc("GetBaseImages") + procImportLayer = modvmcompute.NewProc("ImportLayer") + procLayerExists = modvmcompute.NewProc("LayerExists") + procNameToGuid = modvmcompute.NewProc("NameToGuid") + procPrepareLayer = modvmcompute.NewProc("PrepareLayer") + procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") + procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") + procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") + procImportLayerBegin = modvmcompute.NewProc("ImportLayerBegin") + procImportLayerNext = modvmcompute.NewProc("ImportLayerNext") + procImportLayerWrite = modvmcompute.NewProc("ImportLayerWrite") + procImportLayerEnd = modvmcompute.NewProc("ImportLayerEnd") + procExportLayerBegin = modvmcompute.NewProc("ExportLayerBegin") + procExportLayerNext = modvmcompute.NewProc("ExportLayerNext") + procExportLayerRead = modvmcompute.NewProc("ExportLayerRead") + procExportLayerEnd = modvmcompute.NewProc("ExportLayerEnd") + procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess") +) + +func activateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _activateLayer(info, _p0) +} + +func _activateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procActivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(srcId) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(dstId) + if hr != nil { + return + } + return _copyLayer(info, _p0, _p1, descriptors) +} + +func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procCopyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func createLayer(info *driverInfo, id string, parent string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(parent) + if hr != nil { + return + } + return _createLayer(info, _p0, _p1) +} + +func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { + if hr = procCreateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _createSandboxLayer(info, _p0, parent, descriptors) +} + +func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procCreateSandboxLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(parent), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _expandSandboxSize(info, _p0, size) +} + +func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { + if hr = procExpandSandboxSize.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func deactivateLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _deactivateLayer(info, _p0) +} + +func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDeactivateLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func destroyLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _destroyLayer(info, _p0) +} + +func _destroyLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procDestroyLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _exportLayer(info, _p0, _p1, descriptors) +} + +func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procExportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _getLayerMountPath(info, _p0, length, buffer) +} + +func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { + if hr = procGetLayerMountPath.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func getBaseImages(buffer **uint16) (hr error) { + if hr = procGetBaseImages.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _importLayer(info, _p0, _p1, descriptors) +} + +func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p2 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p2 = &descriptors[0] + } + if hr = procImportLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _layerExists(info, _p0, exists) +} + +func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { + if hr = procLayerExists.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func nameToGuid(name string, guid *_guid) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(name) + if hr != nil { + return + } + return _nameToGuid(_p0, guid) +} + +func _nameToGuid(name *uint16, guid *_guid) (hr error) { + if hr = procNameToGuid.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _prepareLayer(info, _p0, descriptors) +} + +func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procPrepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func unprepareLayer(info *driverInfo, id string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _unprepareLayer(info, _p0) +} + +func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { + if hr = procUnprepareLayer.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func processBaseImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processBaseImage(_p0) +} + +func _processBaseImage(path *uint16) (hr error) { + if hr = procProcessBaseImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func processUtilityImage(path string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(path) + if hr != nil { + return + } + return _processUtilityImage(_p0) +} + +func _processUtilityImage(path *uint16) (hr error) { + if hr = procProcessUtilityImage.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _importLayerBegin(info, _p0, descriptors, context) +} + +func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procImportLayerBegin.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(fileName) + if hr != nil { + return + } + return _importLayerNext(context, _p0, fileInfo) +} + +func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) { + if hr = procImportLayerNext.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func importLayerWrite(context uintptr, buffer []byte) (hr error) { + var _p0 *byte + if len(buffer) > 0 { + _p0 = &buffer[0] + } + if hr = procImportLayerWrite.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer))) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func importLayerEnd(context uintptr) (hr error) { + if hr = procImportLayerEnd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(id) + if hr != nil { + return + } + return _exportLayerBegin(info, _p0, descriptors, context) +} + +func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { + var _p1 *WC_LAYER_DESCRIPTOR + if len(descriptors) > 0 { + _p1 = &descriptors[0] + } + if hr = procExportLayerBegin.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) { + if hr = procExportLayerNext.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) { + var _p0 *byte + if len(buffer) > 0 { + _p0 = &buffer[0] + } + if hr = procExportLayerRead.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func exportLayerEnd(context uintptr) (hr error) { + if hr = procExportLayerEnd.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} + +func grantVmAccess(vmid string, filepath string) (hr error) { + var _p0 *uint16 + _p0, hr = syscall.UTF16PtrFromString(vmid) + if hr != nil { + return + } + var _p1 *uint16 + _p1, hr = syscall.UTF16PtrFromString(filepath) + if hr != nil { + return + } + return _grantVmAccess(_p0, _p1) +} + +func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) { + if hr = procGrantVmAccess.Find(); hr != nil { + return + } + r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} diff --git a/vendor/github.com/Microsoft/hcsshim/layer.go b/vendor/github.com/Microsoft/hcsshim/layer.go new file mode 100644 index 0000000000..d143efc49a --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/layer.go @@ -0,0 +1,110 @@ +package hcsshim + +import ( + "crypto/sha1" + "path/filepath" + + "github.com/Microsoft/hcsshim/internal/guid" + + "github.com/Microsoft/hcsshim/internal/wclayer" +) + +func layerPath(info *DriverInfo, id string) string { + return filepath.Join(info.HomeDir, id) +} + +func ActivateLayer(info DriverInfo, id string) error { + return wclayer.ActivateLayer(layerPath(&info, id)) +} +func CreateLayer(info DriverInfo, id, parent string) error { + return wclayer.CreateLayer(layerPath(&info, id), parent) +} + +// New clients should use CreateScratchLayer instead. Kept in to preserve API compatibility. +func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { + return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths) +} +func CreateScratchLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { + return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths) +} +func DeactivateLayer(info DriverInfo, id string) error { + return wclayer.DeactivateLayer(layerPath(&info, id)) +} +func DestroyLayer(info DriverInfo, id string) error { + return wclayer.DestroyLayer(layerPath(&info, id)) +} + +// New clients should use ExpandScratchSize instead. Kept in to preserve API compatibility. +func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error { + return wclayer.ExpandScratchSize(layerPath(&info, layerId), size) +} +func ExpandScratchSize(info DriverInfo, layerId string, size uint64) error { + return wclayer.ExpandScratchSize(layerPath(&info, layerId), size) +} +func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { + return wclayer.ExportLayer(layerPath(&info, layerId), exportFolderPath, parentLayerPaths) +} +func GetLayerMountPath(info DriverInfo, id string) (string, error) { + return wclayer.GetLayerMountPath(layerPath(&info, id)) +} +func GetSharedBaseImages() (imageData string, err error) { + return wclayer.GetSharedBaseImages() +} +func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { + return wclayer.ImportLayer(layerPath(&info, layerID), importFolderPath, parentLayerPaths) +} +func LayerExists(info DriverInfo, id string) (bool, error) { + return wclayer.LayerExists(layerPath(&info, id)) +} +func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { + return wclayer.PrepareLayer(layerPath(&info, layerId), parentLayerPaths) +} +func ProcessBaseLayer(path string) error { + return wclayer.ProcessBaseLayer(path) +} +func ProcessUtilityVMImage(path string) error { + return wclayer.ProcessUtilityVMImage(path) +} +func UnprepareLayer(info DriverInfo, layerId string) error { + return wclayer.UnprepareLayer(layerPath(&info, layerId)) +} + +type DriverInfo struct { + Flavour int + HomeDir string +} + +type FilterLayerReader = wclayer.FilterLayerReader +type FilterLayerWriter = wclayer.FilterLayerWriter + +type GUID [16]byte + +func NameToGuid(name string) (id GUID, err error) { + g, err := wclayer.NameToGuid(name) + return GUID(g), err +} + +func NewGUID(source string) *GUID { + h := sha1.Sum([]byte(source)) + var g GUID + copy(g[0:], h[0:16]) + return &g +} + +func (g *GUID) ToString() string { + return (guid.GUID)(*g).String() +} + +type LayerReader = wclayer.LayerReader + +func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { + return wclayer.NewLayerReader(layerPath(&info, layerID), parentLayerPaths) +} + +type LayerWriter = wclayer.LayerWriter + +func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { + return wclayer.NewLayerWriter(layerPath(&info, layerID), parentLayerPaths) +} + +type WC_LAYER_DESCRIPTOR = wclayer.WC_LAYER_DESCRIPTOR diff --git a/vendor/github.com/Microsoft/hcsshim/layerexists.go b/vendor/github.com/Microsoft/hcsshim/layerexists.go deleted file mode 100644 index fe46f404c3..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/layerexists.go +++ /dev/null @@ -1,30 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// LayerExists will return true if a layer with the given id exists and is known -// to the system. -func LayerExists(info DriverInfo, id string) (bool, error) { - title := "hcsshim::LayerExists " - logrus.Debugf(title+"Flavour %d ID %s", info.Flavour, id) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return false, err - } - - // Call the procedure itself. - var exists uint32 - - err = layerExists(&infop, id, &exists) - if err != nil { - err = makeErrorf(err, title, "id=%s flavour=%d", id, info.Flavour) - logrus.Error(err) - return false, err - } - - logrus.Debugf(title+"succeeded flavour=%d id=%s exists=%d", info.Flavour, id, exists) - return exists != 0, nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/legacy18.go b/vendor/github.com/Microsoft/hcsshim/legacy18.go deleted file mode 100644 index 0f593e8aba..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/legacy18.go +++ /dev/null @@ -1,7 +0,0 @@ -// +build !go1.9 - -package hcsshim - -// Due to a bug in go1.8 and before, directory reparse points need to be skipped -// during filepath.Walk. This is fixed in go1.9 -var shouldSkipDirectoryReparse = true diff --git a/vendor/github.com/Microsoft/hcsshim/legacy19.go b/vendor/github.com/Microsoft/hcsshim/legacy19.go deleted file mode 100644 index fb0b7644fb..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/legacy19.go +++ /dev/null @@ -1,7 +0,0 @@ -// +build go1.9 - -package hcsshim - -// Due to a bug in go1.8 and before, directory reparse points need to be skipped -// during filepath.Walk. This is fixed in go1.9 -var shouldSkipDirectoryReparse = false diff --git a/vendor/github.com/Microsoft/hcsshim/nametoguid.go b/vendor/github.com/Microsoft/hcsshim/nametoguid.go deleted file mode 100644 index b7c6d020c6..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/nametoguid.go +++ /dev/null @@ -1,20 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// NameToGuid converts the given string into a GUID using the algorithm in the -// Host Compute Service, ensuring GUIDs generated with the same string are common -// across all clients. -func NameToGuid(name string) (id GUID, err error) { - title := "hcsshim::NameToGuid " - logrus.Debugf(title+"Name %s", name) - - err = nameToGuid(name, &id) - if err != nil { - err = makeErrorf(err, title, "name=%s", name) - logrus.Error(err) - return - } - - return -} diff --git a/vendor/github.com/Microsoft/hcsshim/process.go b/vendor/github.com/Microsoft/hcsshim/process.go index faee2cfeeb..ca8acbb7c2 100644 --- a/vendor/github.com/Microsoft/hcsshim/process.go +++ b/vendor/github.com/Microsoft/hcsshim/process.go @@ -1,384 +1,72 @@ package hcsshim import ( - "encoding/json" "io" - "sync" - "syscall" "time" - "github.com/sirupsen/logrus" + "github.com/Microsoft/hcsshim/internal/hcs" ) // ContainerError is an error encountered in HCS type process struct { - handleLock sync.RWMutex - handle hcsProcess - processID int - container *container - cachedPipes *cachedPipes - callbackNumber uintptr + p *hcs.Process } -type cachedPipes struct { - stdIn syscall.Handle - stdOut syscall.Handle - stdErr syscall.Handle -} - -type processModifyRequest struct { - Operation string - ConsoleSize *consoleSize `json:",omitempty"` - CloseHandle *closeHandle `json:",omitempty"` -} - -type consoleSize struct { - Height uint16 - Width uint16 -} - -type closeHandle struct { - Handle string -} - -type processStatus struct { - ProcessID uint32 - Exited bool - ExitCode uint32 - LastWaitResult int32 -} - -const ( - stdIn string = "StdIn" - stdOut string = "StdOut" - stdErr string = "StdErr" -) - -const ( - modifyConsoleSize string = "ConsoleSize" - modifyCloseHandle string = "CloseHandle" -) - // Pid returns the process ID of the process within the container. func (process *process) Pid() int { - return process.processID + return process.p.Pid() } // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *process) Kill() error { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - operation := "Kill" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - if process.handle == 0 { - return makeProcessError(process, operation, "", ErrAlreadyClosed) - } - - var resultp *uint16 - err := hcsTerminateProcess(process.handle, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return makeProcessError(process, operation, "", err) - } - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return nil + return convertProcessError(process.p.Kill(), process) } // Wait waits for the process to exit. func (process *process) Wait() error { - operation := "Wait" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil) - if err != nil { - return makeProcessError(process, operation, "", err) - } - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return nil + return convertProcessError(process.p.Wait(), process) } // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. func (process *process) WaitTimeout(timeout time.Duration) error { - operation := "WaitTimeout" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout) - if err != nil { - return makeProcessError(process, operation, "", err) - } - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return nil + return convertProcessError(process.p.WaitTimeout(timeout), process) } // ExitCode returns the exit code of the process. The process must have // already terminated. func (process *process) ExitCode() (int, error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - operation := "ExitCode" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - if process.handle == 0 { - return 0, makeProcessError(process, operation, "", ErrAlreadyClosed) - } - - properties, err := process.properties() + code, err := process.p.ExitCode() if err != nil { - return 0, makeProcessError(process, operation, "", err) - } - - if properties.Exited == false { - return 0, makeProcessError(process, operation, "", ErrInvalidProcessState) - } - - if properties.LastWaitResult != 0 { - return 0, makeProcessError(process, operation, "", syscall.Errno(properties.LastWaitResult)) + err = convertProcessError(err, process) } - - logrus.Debugf(title+" succeeded processid=%d exitCode=%d", process.processID, properties.ExitCode) - return int(properties.ExitCode), nil + return code, err } // ResizeConsole resizes the console of the process. func (process *process) ResizeConsole(width, height uint16) error { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - operation := "ResizeConsole" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - if process.handle == 0 { - return makeProcessError(process, operation, "", ErrAlreadyClosed) - } - - modifyRequest := processModifyRequest{ - Operation: modifyConsoleSize, - ConsoleSize: &consoleSize{ - Height: height, - Width: width, - }, - } - - modifyRequestb, err := json.Marshal(modifyRequest) - if err != nil { - return err - } - - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return makeProcessError(process, operation, "", err) - } - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return nil -} - -func (process *process) properties() (*processStatus, error) { - operation := "properties" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - var ( - resultp *uint16 - propertiesp *uint16 - ) - err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return nil, err - } - - if propertiesp == nil { - return nil, ErrUnexpectedValue - } - propertiesRaw := convertAndFreeCoTaskMemBytes(propertiesp) - - properties := &processStatus{} - if err := json.Unmarshal(propertiesRaw, properties); err != nil { - return nil, err - } - - logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw) - return properties, nil + return convertProcessError(process.p.ResizeConsole(width, height), process) } // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - operation := "Stdio" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - if process.handle == 0 { - return nil, nil, nil, makeProcessError(process, operation, "", ErrAlreadyClosed) - } - - var stdIn, stdOut, stdErr syscall.Handle - - if process.cachedPipes == nil { - var ( - processInfo hcsProcessInformation - resultp *uint16 - ) - err := hcsGetProcessInfo(process.handle, &processInfo, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return nil, nil, nil, makeProcessError(process, operation, "", err) - } - - stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError - } else { - // Use cached pipes - stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr - - // Invalidate the cache - process.cachedPipes = nil - } - - pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr}) + stdin, stdout, stderr, err := process.p.Stdio() if err != nil { - return nil, nil, nil, makeProcessError(process, operation, "", err) + err = convertProcessError(err, process) } - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return pipes[0], pipes[1], pipes[2], nil + return stdin, stdout, stderr, err } // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *process) CloseStdin() error { - process.handleLock.RLock() - defer process.handleLock.RUnlock() - operation := "CloseStdin" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - if process.handle == 0 { - return makeProcessError(process, operation, "", ErrAlreadyClosed) - } - - modifyRequest := processModifyRequest{ - Operation: modifyCloseHandle, - CloseHandle: &closeHandle{ - Handle: stdIn, - }, - } - - modifyRequestb, err := json.Marshal(modifyRequest) - if err != nil { - return err - } - - modifyRequestStr := string(modifyRequestb) - - var resultp *uint16 - err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp) - err = processHcsResult(err, resultp) - if err != nil { - return makeProcessError(process, operation, "", err) - } - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return nil + return convertProcessError(process.p.CloseStdin(), process) } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *process) Close() error { - process.handleLock.Lock() - defer process.handleLock.Unlock() - operation := "Close" - title := "HCSShim::Process::" + operation - logrus.Debugf(title+" processid=%d", process.processID) - - // Don't double free this - if process.handle == 0 { - return nil - } - - if err := process.unregisterCallback(); err != nil { - return makeProcessError(process, operation, "", err) - } - - if err := hcsCloseProcess(process.handle); err != nil { - return makeProcessError(process, operation, "", err) - } - - process.handle = 0 - - logrus.Debugf(title+" succeeded processid=%d", process.processID) - return nil -} - -func (process *process) registerCallback() error { - context := ¬ifcationWatcherContext{ - channels: newChannels(), - } - - callbackMapLock.Lock() - callbackNumber := nextCallback - nextCallback++ - callbackMap[callbackNumber] = context - callbackMapLock.Unlock() - - var callbackHandle hcsCallback - err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle) - if err != nil { - return err - } - context.handle = callbackHandle - process.callbackNumber = callbackNumber - - return nil -} - -func (process *process) unregisterCallback() error { - callbackNumber := process.callbackNumber - - callbackMapLock.RLock() - context := callbackMap[callbackNumber] - callbackMapLock.RUnlock() - - if context == nil { - return nil - } - - handle := context.handle - - if handle == 0 { - return nil - } - - // hcsUnregisterProcessCallback has its own syncronization - // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. - err := hcsUnregisterProcessCallback(handle) - if err != nil { - return err - } - - closeChannels(context.channels) - - callbackMapLock.Lock() - callbackMap[callbackNumber] = nil - callbackMapLock.Unlock() - - handle = 0 - - return nil + return convertProcessError(process.p.Close(), process) } diff --git a/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go b/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go deleted file mode 100644 index e8a3b507bf..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/unpreparelayer.go +++ /dev/null @@ -1,27 +0,0 @@ -package hcsshim - -import "github.com/sirupsen/logrus" - -// UnprepareLayer disables the filesystem filter for the read-write layer with -// the given id. -func UnprepareLayer(info DriverInfo, layerId string) error { - title := "hcsshim::UnprepareLayer " - logrus.Debugf(title+"flavour %d layerId %s", info.Flavour, layerId) - - // Convert info to API calling convention - infop, err := convertDriverInfo(info) - if err != nil { - logrus.Error(err) - return err - } - - err = unprepareLayer(&infop, layerId) - if err != nil { - err = makeErrorf(err, title, "layerId=%s flavour=%d", layerId, info.Flavour) - logrus.Error(err) - return err - } - - logrus.Debugf(title+"succeeded flavour %d layerId=%s", info.Flavour, layerId) - return nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/version.go b/vendor/github.com/Microsoft/hcsshim/version.go deleted file mode 100644 index ae10c23d42..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/version.go +++ /dev/null @@ -1,7 +0,0 @@ -package hcsshim - -// IsTP4 returns whether the currently running Windows build is at least TP4. -func IsTP4() bool { - // HNSCall was not present in TP4 - return procHNSCall.Find() != nil -} diff --git a/vendor/github.com/Microsoft/hcsshim/zhcsshim.go b/vendor/github.com/Microsoft/hcsshim/zhcsshim.go deleted file mode 100644 index 5123e8d8e8..0000000000 --- a/vendor/github.com/Microsoft/hcsshim/zhcsshim.go +++ /dev/null @@ -1,1080 +0,0 @@ -// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT - -package hcsshim - -import ( - "syscall" - "unsafe" - - "github.com/Microsoft/go-winio" - "golang.org/x/sys/windows" -) - -var _ unsafe.Pointer - -// Do the interface allocations only once for common -// Errno values. -const ( - errnoERROR_IO_PENDING = 997 -) - -var ( - errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) -) - -// errnoErr returns common boxed Errno values, to prevent -// allocations at runtime. -func errnoErr(e syscall.Errno) error { - switch e { - case 0: - return nil - case errnoERROR_IO_PENDING: - return errERROR_IO_PENDING - } - // TODO: add more here, after collecting data on the common - // error values see on Windows. (perhaps when running - // all.bat?) - return e -} - -var ( - modole32 = windows.NewLazySystemDLL("ole32.dll") - modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") - modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") - modntdll = windows.NewLazySystemDLL("ntdll.dll") - modkernel32 = windows.NewLazySystemDLL("kernel32.dll") - - procCoTaskMemFree = modole32.NewProc("CoTaskMemFree") - procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") - procActivateLayer = modvmcompute.NewProc("ActivateLayer") - procCopyLayer = modvmcompute.NewProc("CopyLayer") - procCreateLayer = modvmcompute.NewProc("CreateLayer") - procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer") - procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize") - procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer") - procDestroyLayer = modvmcompute.NewProc("DestroyLayer") - procExportLayer = modvmcompute.NewProc("ExportLayer") - procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath") - procGetBaseImages = modvmcompute.NewProc("GetBaseImages") - procImportLayer = modvmcompute.NewProc("ImportLayer") - procLayerExists = modvmcompute.NewProc("LayerExists") - procNameToGuid = modvmcompute.NewProc("NameToGuid") - procPrepareLayer = modvmcompute.NewProc("PrepareLayer") - procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer") - procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage") - procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage") - procImportLayerBegin = modvmcompute.NewProc("ImportLayerBegin") - procImportLayerNext = modvmcompute.NewProc("ImportLayerNext") - procImportLayerWrite = modvmcompute.NewProc("ImportLayerWrite") - procImportLayerEnd = modvmcompute.NewProc("ImportLayerEnd") - procExportLayerBegin = modvmcompute.NewProc("ExportLayerBegin") - procExportLayerNext = modvmcompute.NewProc("ExportLayerNext") - procExportLayerRead = modvmcompute.NewProc("ExportLayerRead") - procExportLayerEnd = modvmcompute.NewProc("ExportLayerEnd") - procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") - procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") - procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") - procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") - procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") - procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") - procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") - procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") - procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") - procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") - procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") - procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") - procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") - procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") - procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") - procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") - procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") - procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") - procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") - procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") - procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") - procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") - procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") - procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") - procHNSCall = modvmcompute.NewProc("HNSCall") - procNtCreateFile = modntdll.NewProc("NtCreateFile") - procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile") - procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb") - procLocalAlloc = modkernel32.NewProc("LocalAlloc") - procLocalFree = modkernel32.NewProc("LocalFree") -) - -func coTaskMemFree(buffer unsafe.Pointer) { - syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0) - return -} - -func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { - r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func activateLayer(info *driverInfo, id string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _activateLayer(info, _p0) -} - -func _activateLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procActivateLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(srcId) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(dstId) - if hr != nil { - return - } - return _copyLayer(info, _p0, _p1, descriptors) -} - -func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p2 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p2 = &descriptors[0] - } - if hr = procCopyLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func createLayer(info *driverInfo, id string, parent string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(parent) - if hr != nil { - return - } - return _createLayer(info, _p0, _p1) -} - -func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) { - if hr = procCreateLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func createSandboxLayer(info *driverInfo, id string, parent string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(parent) - if hr != nil { - return - } - return _createSandboxLayer(info, _p0, _p1, descriptors) -} - -func _createSandboxLayer(info *driverInfo, id *uint16, parent *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p2 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p2 = &descriptors[0] - } - if hr = procCreateSandboxLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _expandSandboxSize(info, _p0, size) -} - -func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) { - if hr = procExpandSandboxSize.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size)) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func deactivateLayer(info *driverInfo, id string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _deactivateLayer(info, _p0) -} - -func _deactivateLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procDeactivateLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func destroyLayer(info *driverInfo, id string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _destroyLayer(info, _p0) -} - -func _destroyLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procDestroyLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - return _exportLayer(info, _p0, _p1, descriptors) -} - -func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p2 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p2 = &descriptors[0] - } - if hr = procExportLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _getLayerMountPath(info, _p0, length, buffer) -} - -func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) { - if hr = procGetLayerMountPath.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func getBaseImages(buffer **uint16) (hr error) { - if hr = procGetBaseImages.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - return _importLayer(info, _p0, _p1, descriptors) -} - -func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p2 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p2 = &descriptors[0] - } - if hr = procImportLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func layerExists(info *driverInfo, id string, exists *uint32) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _layerExists(info, _p0, exists) -} - -func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) { - if hr = procLayerExists.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func nameToGuid(name string, guid *GUID) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(name) - if hr != nil { - return - } - return _nameToGuid(_p0, guid) -} - -func _nameToGuid(name *uint16, guid *GUID) (hr error) { - if hr = procNameToGuid.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _prepareLayer(info, _p0, descriptors) -} - -func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) { - var _p1 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p1 = &descriptors[0] - } - if hr = procPrepareLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func unprepareLayer(info *driverInfo, id string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _unprepareLayer(info, _p0) -} - -func _unprepareLayer(info *driverInfo, id *uint16) (hr error) { - if hr = procUnprepareLayer.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func processBaseImage(path string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - return _processBaseImage(_p0) -} - -func _processBaseImage(path *uint16) (hr error) { - if hr = procProcessBaseImage.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func processUtilityImage(path string) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - return _processUtilityImage(_p0) -} - -func _processUtilityImage(path *uint16) (hr error) { - if hr = procProcessUtilityImage.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _importLayerBegin(info, _p0, descriptors, context) -} - -func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { - var _p1 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p1 = &descriptors[0] - } - if hr = procImportLayerBegin.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(fileName) - if hr != nil { - return - } - return _importLayerNext(context, _p0, fileInfo) -} - -func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) { - if hr = procImportLayerNext.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func importLayerWrite(context uintptr, buffer []byte) (hr error) { - var _p0 *byte - if len(buffer) > 0 { - _p0 = &buffer[0] - } - if hr = procImportLayerWrite.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func importLayerEnd(context uintptr) (hr error) { - if hr = procImportLayerEnd.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _exportLayerBegin(info, _p0, descriptors, context) -} - -func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) { - var _p1 *WC_LAYER_DESCRIPTOR - if len(descriptors) > 0 { - _p1 = &descriptors[0] - } - if hr = procExportLayerBegin.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) { - if hr = procExportLayerNext.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) { - var _p0 *byte - if len(buffer) > 0 { - _p0 = &buffer[0] - } - if hr = procExportLayerRead.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func exportLayerEnd(context uintptr) (hr error) { - if hr = procExportLayerEnd.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(query) - if hr != nil { - return - } - return _hcsEnumerateComputeSystems(_p0, computeSystems, result) -} - -func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { - if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(configuration) - if hr != nil { - return - } - return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) -} - -func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) { - if hr = procHcsCreateComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(id) - if hr != nil { - return - } - return _hcsOpenComputeSystem(_p0, computeSystem, result) -} - -func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) { - if hr = procHcsOpenComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) { - if hr = procHcsCloseComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsStartComputeSystem(computeSystem, _p0, result) -} - -func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsStartComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsShutdownComputeSystem(computeSystem, _p0, result) -} - -func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsShutdownComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsTerminateComputeSystem(computeSystem, _p0, result) -} - -func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsTerminateComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsPauseComputeSystem(computeSystem, _p0, result) -} - -func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsPauseComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(options) - if hr != nil { - return - } - return _hcsResumeComputeSystem(computeSystem, _p0, result) -} - -func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) { - if hr = procHcsResumeComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(propertyQuery) - if hr != nil { - return - } - return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) -} - -func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(configuration) - if hr != nil { - return - } - return _hcsModifyComputeSystem(computeSystem, _p0, result) -} - -func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) { - if hr = procHcsModifyComputeSystem.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { - if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) { - if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(processParameters) - if hr != nil { - return - } - return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) -} - -func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) { - if hr = procHcsCreateProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) { - if hr = procHcsOpenProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsCloseProcess(process hcsProcess) (hr error) { - if hr = procHcsCloseProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) { - if hr = procHcsTerminateProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) { - if hr = procHcsGetProcessInfo.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) { - if hr = procHcsGetProcessProperties.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) - if hr != nil { - return - } - return _hcsModifyProcess(process, _p0, result) -} - -func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) { - if hr = procHcsModifyProcess.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(propertyQuery) - if hr != nil { - return - } - return _hcsGetServiceProperties(_p0, properties, result) -} - -func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { - if hr = procHcsGetServiceProperties.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) { - if hr = procHcsRegisterProcessCallback.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) { - if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(settings) - if hr != nil { - return - } - return _hcsModifyServiceSettings(_p0, result) -} - -func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { - if hr = procHcsModifyServiceSettings.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func _hnsCall(method string, path string, object string, response **uint16) (hr error) { - var _p0 *uint16 - _p0, hr = syscall.UTF16PtrFromString(method) - if hr != nil { - return - } - var _p1 *uint16 - _p1, hr = syscall.UTF16PtrFromString(path) - if hr != nil { - return - } - var _p2 *uint16 - _p2, hr = syscall.UTF16PtrFromString(object) - if hr != nil { - return - } - return __hnsCall(_p0, _p1, _p2, response) -} - -func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) { - if hr = procHNSCall.Find(); hr != nil { - return - } - r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0) - if int32(r0) < 0 { - hr = syscall.Errno(win32FromHresult(r0)) - } - return -} - -func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) { - r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0) - status = uint32(r0) - return -} - -func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) { - r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0) - status = uint32(r0) - return -} - -func rtlNtStatusToDosError(status uint32) (winerr error) { - r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0) - if r0 != 0 { - winerr = syscall.Errno(r0) - } - return -} - -func localAlloc(flags uint32, size int) (ptr uintptr) { - r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0) - ptr = uintptr(r0) - return -} - -func localFree(ptr uintptr) { - syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0) - return -} diff --git a/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go b/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go new file mode 100644 index 0000000000..cd471295b8 --- /dev/null +++ b/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go @@ -0,0 +1,52 @@ +// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT + +package hcsshim + +import ( + "syscall" + "unsafe" + + "github.com/Microsoft/hcsshim/internal/interop" + "golang.org/x/sys/windows" +) + +var _ unsafe.Pointer + +// Do the interface allocations only once for common +// Errno values. +const ( + errnoERROR_IO_PENDING = 997 +) + +var ( + errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) +) + +// errnoErr returns common boxed Errno values, to prevent +// allocations at runtime. +func errnoErr(e syscall.Errno) error { + switch e { + case 0: + return nil + case errnoERROR_IO_PENDING: + return errERROR_IO_PENDING + } + // TODO: add more here, after collecting data on the common + // error values see on Windows. (perhaps when running + // all.bat?) + return e +} + +var ( + modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") + + procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") +) + +func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { + r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) + if int32(r0) < 0 { + hr = interop.Win32FromHresult(r0) + } + return +} diff --git a/vendor/github.com/containerd/continuity/LICENSE b/vendor/github.com/containerd/continuity/LICENSE index 8f71f43fee..584149b6ee 100644 --- a/vendor/github.com/containerd/continuity/LICENSE +++ b/vendor/github.com/containerd/continuity/LICENSE @@ -1,6 +1,7 @@ + Apache License Version 2.0, January 2004 - http://www.apache.org/licenses/ + https://www.apache.org/licenses/ TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION @@ -175,28 +176,16 @@ END OF TERMS AND CONDITIONS - APPENDIX: How to apply the Apache License to your work. - - To apply the Apache License to your work, attach the following - boilerplate notice, with the fields enclosed by brackets "{}" - replaced with your own identifying information. (Don't include - the brackets!) The text should be enclosed in the appropriate - comment syntax for the file format. We also recommend that a - file or class name and description of purpose be included on the - same "printed page" as the copyright notice for easier - identification within third-party archives. - - Copyright {yyyy} {name of copyright owner} + Copyright The containerd Authors Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at - http://www.apache.org/licenses/LICENSE-2.0 + https://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. - diff --git a/vendor/github.com/containerd/continuity/README.md b/vendor/github.com/containerd/continuity/README.md index 0e91ce07b5..f9f9ef0f96 100644 --- a/vendor/github.com/containerd/continuity/README.md +++ b/vendor/github.com/containerd/continuity/README.md @@ -72,3 +72,13 @@ If you change the proto file you will need to rebuild the generated Go with `go ```console $ go generate ./proto ``` + +## Project details + +continuity is a containerd sub-project, licensed under the [Apache 2.0 license](./LICENSE). +As a containerd sub-project, you will find the: + * [Project governance](https://github.com/containerd/project/blob/master/GOVERNANCE.md), + * [Maintainers](https://github.com/containerd/project/blob/master/MAINTAINERS), + * and [Contributing guidelines](https://github.com/containerd/project/blob/master/CONTRIBUTING.md) + +information in our [`containerd/project`](https://github.com/containerd/project) repository. diff --git a/vendor/github.com/containerd/continuity/pathdriver/path_driver.go b/vendor/github.com/containerd/continuity/pathdriver/path_driver.go index b43d55fe95..b0d5a6b567 100644 --- a/vendor/github.com/containerd/continuity/pathdriver/path_driver.go +++ b/vendor/github.com/containerd/continuity/pathdriver/path_driver.go @@ -1,3 +1,19 @@ +/* + Copyright The containerd Authors. + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. +*/ + package pathdriver import ( diff --git a/vendor/github.com/containerd/continuity/vendor.conf b/vendor/github.com/containerd/continuity/vendor.conf index 7c80deec58..5bd88d5fd7 100644 --- a/vendor/github.com/containerd/continuity/vendor.conf +++ b/vendor/github.com/containerd/continuity/vendor.conf @@ -10,4 +10,4 @@ github.com/spf13/pflag 4c012f6dcd9546820e378d0bdda4d8fc772cdfea golang.org/x/crypto 9f005a07e0d31d45e6656d241bb5c0f2efd4bc94 golang.org/x/net a337091b0525af65de94df2eb7e98bd9962dcbe2 golang.org/x/sync 450f422ab23cf9881c94e2db30cac0eb1b7cf80c -golang.org/x/sys 665f6529cca930e27b831a0d1dafffbe1c172924 +golang.org/x/sys 77b0e4315053a57ed2962443614bdb28db152054 diff --git a/vendor/github.com/docker/docker/api/types/client.go b/vendor/github.com/docker/docker/api/types/client.go index 3d2e057c9a..3b698c2c24 100644 --- a/vendor/github.com/docker/docker/api/types/client.go +++ b/vendor/github.com/docker/docker/api/types/client.go @@ -7,7 +7,7 @@ import ( "github.com/docker/docker/api/types/container" "github.com/docker/docker/api/types/filters" - "github.com/docker/go-units" + units "github.com/docker/go-units" ) // CheckpointCreateOptions holds parameters to create a checkpoint from a container @@ -181,8 +181,24 @@ type ImageBuildOptions struct { Target string SessionID string Platform string + // Version specifies the version of the unerlying builder to use + Version BuilderVersion + // BuildID is an optional identifier that can be passed together with the + // build request. The same identifier can be used to gracefully cancel the + // build with the cancel request. + BuildID string } +// BuilderVersion sets the version of underlying builder to use +type BuilderVersion string + +const ( + // BuilderV1 is the first generation builder in docker daemon + BuilderV1 BuilderVersion = "1" + // BuilderBuildKit is builder based on moby/buildkit project + BuilderBuildKit = "2" +) + // ImageBuildResponse holds information // returned by a server after building // an image. diff --git a/vendor/github.com/docker/docker/api/types/configs.go b/vendor/github.com/docker/docker/api/types/configs.go index f6537a27f2..178e911a7a 100644 --- a/vendor/github.com/docker/docker/api/types/configs.go +++ b/vendor/github.com/docker/docker/api/types/configs.go @@ -55,3 +55,10 @@ type PluginEnableConfig struct { type PluginDisableConfig struct { ForceDisable bool } + +// NetworkListConfig stores the options available for listing networks +type NetworkListConfig struct { + // TODO(@cpuguy83): naming is hard, this is pulled from what was being used in the router before moving here + Detailed bool + Verbose bool +} diff --git a/vendor/github.com/docker/docker/api/types/network/network.go b/vendor/github.com/docker/docker/api/types/network/network.go index 761d0b34f2..ccb448f23a 100644 --- a/vendor/github.com/docker/docker/api/types/network/network.go +++ b/vendor/github.com/docker/docker/api/types/network/network.go @@ -1,4 +1,8 @@ package network // import "github.com/docker/docker/api/types/network" +import ( + "github.com/docker/docker/api/types/filters" + "github.com/docker/docker/errdefs" +) // Address represents an IP address type Address struct { @@ -106,3 +110,17 @@ type NetworkingConfig struct { type ConfigReference struct { Network string } + +var acceptedFilters = map[string]bool{ + "driver": true, + "type": true, + "name": true, + "id": true, + "label": true, + "scope": true, +} + +// ValidateFilters validates the list of filter args with the available filters. +func ValidateFilters(filter filters.Args) error { + return errdefs.InvalidParameter(filter.Validate(acceptedFilters)) +} diff --git a/vendor/github.com/docker/docker/api/types/swarm/swarm.go b/vendor/github.com/docker/docker/api/types/swarm/swarm.go index 1b111d725b..b742cf1bfb 100644 --- a/vendor/github.com/docker/docker/api/types/swarm/swarm.go +++ b/vendor/github.com/docker/docker/api/types/swarm/swarm.go @@ -1,6 +1,8 @@ package swarm // import "github.com/docker/docker/api/types/swarm" -import "time" +import ( + "time" +) // ClusterInfo represents info about the cluster for outputting in "info" // it contains the same information as "Swarm", but without the JoinTokens @@ -10,6 +12,8 @@ type ClusterInfo struct { Spec Spec TLSInfo TLSInfo RootRotationInProgress bool + DefaultAddrPool []string + SubnetSize uint32 } // Swarm represents a swarm. @@ -153,6 +157,8 @@ type InitRequest struct { Spec Spec AutoLockManagers bool Availability NodeAvailability + DefaultAddrPool []string + SubnetSize uint32 } // JoinRequest is the request used to join a swarm. diff --git a/vendor/github.com/docker/docker/api/types/types.go b/vendor/github.com/docker/docker/api/types/types.go index 729f4eb6c4..a8fae3ba32 100644 --- a/vendor/github.com/docker/docker/api/types/types.go +++ b/vendor/github.com/docker/docker/api/types/types.go @@ -102,9 +102,10 @@ type ContainerStats struct { // Ping contains response of Engine API: // GET "/_ping" type Ping struct { - APIVersion string - OSType string - Experimental bool + APIVersion string + OSType string + Experimental bool + BuilderVersion BuilderVersion } // ComponentVersion describes the version information for a specific component. @@ -204,6 +205,8 @@ type Info struct { RuncCommit Commit InitCommit Commit SecurityOptions []string + ProductLicense string `json:",omitempty"` + Warnings []string } // KeyValue holds a key/value pair @@ -512,7 +515,8 @@ type DiskUsage struct { Images []*ImageSummary Containers []*Container Volumes []*Volume - BuilderSize int64 + BuildCache []*BuildCache + BuilderSize int64 // deprecated } // ContainersPruneReport contains the response for Engine API: @@ -539,6 +543,7 @@ type ImagesPruneReport struct { // BuildCachePruneReport contains the response for Engine API: // POST "/build/prune" type BuildCachePruneReport struct { + CachesDeleted []string SpaceReclaimed uint64 } @@ -585,3 +590,24 @@ type PushResult struct { type BuildResult struct { ID string } + +// BuildCache contains information about a build cache record +type BuildCache struct { + ID string + Parent string + Type string + Description string + InUse bool + Shared bool + Size int64 + CreatedAt time.Time + LastUsedAt *time.Time + UsageCount int +} + +// BuildCachePruneOptions hold parameters to prune the build cache +type BuildCachePruneOptions struct { + All bool + KeepStorage int64 + Filters filters.Args +} diff --git a/vendor/github.com/docker/docker/contrib/README.md b/vendor/github.com/docker/docker/contrib/README.md new file mode 100644 index 0000000000..92b1d94433 --- /dev/null +++ b/vendor/github.com/docker/docker/contrib/README.md @@ -0,0 +1,4 @@ +The `contrib` directory contains scripts, images, and other helpful things +which are not part of the core docker distribution. Please note that they +could be out of date, since they do not receive the same attention as the +rest of the repository. diff --git a/vendor/github.com/docker/docker/contrib/nnp-test/nnp-test.c b/vendor/github.com/docker/docker/contrib/nnp-test/nnp-test.c new file mode 100644 index 0000000000..b767da7e1a --- /dev/null +++ b/vendor/github.com/docker/docker/contrib/nnp-test/nnp-test.c @@ -0,0 +1,10 @@ +#include +#include +#include + +int main(int argc, char *argv[]) +{ + printf("EUID=%d\n", geteuid()); + return 0; +} + diff --git a/vendor/github.com/docker/docker/contrib/syscall-test/acct.c b/vendor/github.com/docker/docker/contrib/syscall-test/acct.c new file mode 100644 index 0000000000..88ac287966 --- /dev/null +++ b/vendor/github.com/docker/docker/contrib/syscall-test/acct.c @@ -0,0 +1,16 @@ +#define _GNU_SOURCE +#include +#include +#include +#include +#include + +int main(int argc, char **argv) +{ + int err = acct("/tmp/t"); + if (err == -1) { + fprintf(stderr, "acct failed: %s\n", strerror(errno)); + exit(EXIT_FAILURE); + } + exit(EXIT_SUCCESS); +} diff --git a/vendor/github.com/docker/docker/contrib/syscall-test/exit32.s b/vendor/github.com/docker/docker/contrib/syscall-test/exit32.s new file mode 100644 index 0000000000..8bbb5c58b3 --- /dev/null +++ b/vendor/github.com/docker/docker/contrib/syscall-test/exit32.s @@ -0,0 +1,7 @@ +.globl _start +.text +_start: + xorl %eax, %eax + incl %eax + movb $0, %bl + int $0x80 diff --git a/vendor/github.com/docker/docker/contrib/syscall-test/ns.c b/vendor/github.com/docker/docker/contrib/syscall-test/ns.c new file mode 100644 index 0000000000..624388630a --- /dev/null +++ b/vendor/github.com/docker/docker/contrib/syscall-test/ns.c @@ -0,0 +1,63 @@ +#define _GNU_SOURCE +#include +#include +#include +#include +#include +#include +#include +#include +#include + +#define STACK_SIZE (1024 * 1024) /* Stack size for cloned child */ + +struct clone_args { + char **argv; +}; + +// child_exec is the func that will be executed as the result of clone +static int child_exec(void *stuff) +{ + struct clone_args *args = (struct clone_args *)stuff; + if (execvp(args->argv[0], args->argv) != 0) { + fprintf(stderr, "failed to execvp arguments %s\n", + strerror(errno)); + exit(-1); + } + // we should never reach here! + exit(EXIT_FAILURE); +} + +int main(int argc, char **argv) +{ + struct clone_args args; + args.argv = &argv[1]; + + int clone_flags = CLONE_NEWNS | CLONE_NEWPID | SIGCHLD; + + // allocate stack for child + char *stack; /* Start of stack buffer */ + char *child_stack; /* End of stack buffer */ + stack = + mmap(NULL, STACK_SIZE, PROT_READ | PROT_WRITE, + MAP_SHARED | MAP_ANON | MAP_STACK, -1, 0); + if (stack == MAP_FAILED) { + fprintf(stderr, "mmap failed: %s\n", strerror(errno)); + exit(EXIT_FAILURE); + } + child_stack = stack + STACK_SIZE; /* Assume stack grows downward */ + + // the result of this call is that our child_exec will be run in another + // process returning its pid + pid_t pid = clone(child_exec, child_stack, clone_flags, &args); + if (pid < 0) { + fprintf(stderr, "clone failed: %s\n", strerror(errno)); + exit(EXIT_FAILURE); + } + // lets wait on our child process here before we, the parent, exits + if (waitpid(pid, NULL, 0) == -1) { + fprintf(stderr, "failed to wait pid %d\n", pid); + exit(EXIT_FAILURE); + } + exit(EXIT_SUCCESS); +} diff --git a/vendor/github.com/docker/docker/contrib/syscall-test/raw.c b/vendor/github.com/docker/docker/contrib/syscall-test/raw.c new file mode 100644 index 0000000000..7995a0d3a5 --- /dev/null +++ b/vendor/github.com/docker/docker/contrib/syscall-test/raw.c @@ -0,0 +1,14 @@ +#include +#include +#include +#include +#include + +int main() { + if (socket(PF_INET, SOCK_RAW, IPPROTO_UDP) == -1) { + perror("socket"); + return 1; + } + + return 0; +} diff --git a/vendor/github.com/docker/docker/contrib/syscall-test/setgid.c b/vendor/github.com/docker/docker/contrib/syscall-test/setgid.c new file mode 100644 index 0000000000..df9680c869 --- /dev/null +++ b/vendor/github.com/docker/docker/contrib/syscall-test/setgid.c @@ -0,0 +1,11 @@ +#include +#include +#include + +int main() { + if (setgid(1) == -1) { + perror("setgid"); + return 1; + } + return 0; +} diff --git a/vendor/github.com/docker/docker/contrib/syscall-test/setuid.c b/vendor/github.com/docker/docker/contrib/syscall-test/setuid.c new file mode 100644 index 0000000000..5b939677e9 --- /dev/null +++ b/vendor/github.com/docker/docker/contrib/syscall-test/setuid.c @@ -0,0 +1,11 @@ +#include +#include +#include + +int main() { + if (setuid(1) == -1) { + perror("setuid"); + return 1; + } + return 0; +} diff --git a/vendor/github.com/docker/docker/contrib/syscall-test/socket.c b/vendor/github.com/docker/docker/contrib/syscall-test/socket.c new file mode 100644 index 0000000000..d26c82f00f --- /dev/null +++ b/vendor/github.com/docker/docker/contrib/syscall-test/socket.c @@ -0,0 +1,30 @@ +#include +#include +#include +#include +#include +#include + +int main() { + int s; + struct sockaddr_in sin; + + s = socket(AF_INET, SOCK_STREAM, 0); + if (s == -1) { + perror("socket"); + return 1; + } + + sin.sin_family = AF_INET; + sin.sin_addr.s_addr = INADDR_ANY; + sin.sin_port = htons(80); + + if (bind(s, (struct sockaddr *)&sin, sizeof(sin)) == -1) { + perror("bind"); + return 1; + } + + close(s); + + return 0; +} diff --git a/vendor/github.com/docker/docker/contrib/syscall-test/userns.c b/vendor/github.com/docker/docker/contrib/syscall-test/userns.c new file mode 100644 index 0000000000..4c5c8d304e --- /dev/null +++ b/vendor/github.com/docker/docker/contrib/syscall-test/userns.c @@ -0,0 +1,63 @@ +#define _GNU_SOURCE +#include +#include +#include +#include +#include +#include +#include +#include +#include + +#define STACK_SIZE (1024 * 1024) /* Stack size for cloned child */ + +struct clone_args { + char **argv; +}; + +// child_exec is the func that will be executed as the result of clone +static int child_exec(void *stuff) +{ + struct clone_args *args = (struct clone_args *)stuff; + if (execvp(args->argv[0], args->argv) != 0) { + fprintf(stderr, "failed to execvp arguments %s\n", + strerror(errno)); + exit(-1); + } + // we should never reach here! + exit(EXIT_FAILURE); +} + +int main(int argc, char **argv) +{ + struct clone_args args; + args.argv = &argv[1]; + + int clone_flags = CLONE_NEWUSER | SIGCHLD; + + // allocate stack for child + char *stack; /* Start of stack buffer */ + char *child_stack; /* End of stack buffer */ + stack = + mmap(NULL, STACK_SIZE, PROT_READ | PROT_WRITE, + MAP_SHARED | MAP_ANON | MAP_STACK, -1, 0); + if (stack == MAP_FAILED) { + fprintf(stderr, "mmap failed: %s\n", strerror(errno)); + exit(EXIT_FAILURE); + } + child_stack = stack + STACK_SIZE; /* Assume stack grows downward */ + + // the result of this call is that our child_exec will be run in another + // process returning its pid + pid_t pid = clone(child_exec, child_stack, clone_flags, &args); + if (pid < 0) { + fprintf(stderr, "clone failed: %s\n", strerror(errno)); + exit(EXIT_FAILURE); + } + // lets wait on our child process here before we, the parent, exits + if (waitpid(pid, NULL, 0) == -1) { + fprintf(stderr, "failed to wait pid %d\n", pid); + exit(EXIT_FAILURE); + } + exit(EXIT_SUCCESS); +} diff --git a/vendor/github.com/docker/docker/pkg/idtools/idtools.go b/vendor/github.com/docker/docker/pkg/idtools/idtools.go index d1f173a311..230422eac8 100644 --- a/vendor/github.com/docker/docker/pkg/idtools/idtools.go +++ b/vendor/github.com/docker/docker/pkg/idtools/idtools.go @@ -37,23 +37,23 @@ const ( // MkdirAllAndChown creates a directory (include any along the path) and then modifies // ownership to the requested uid/gid. If the directory already exists, this // function will still change ownership to the requested uid/gid pair. -func MkdirAllAndChown(path string, mode os.FileMode, owner IDPair) error { - return mkdirAs(path, mode, owner.UID, owner.GID, true, true) +func MkdirAllAndChown(path string, mode os.FileMode, owner Identity) error { + return mkdirAs(path, mode, owner, true, true) } // MkdirAndChown creates a directory and then modifies ownership to the requested uid/gid. // If the directory already exists, this function still changes ownership. // Note that unlike os.Mkdir(), this function does not return IsExist error // in case path already exists. -func MkdirAndChown(path string, mode os.FileMode, owner IDPair) error { - return mkdirAs(path, mode, owner.UID, owner.GID, false, true) +func MkdirAndChown(path string, mode os.FileMode, owner Identity) error { + return mkdirAs(path, mode, owner, false, true) } // MkdirAllAndChownNew creates a directory (include any along the path) and then modifies // ownership ONLY of newly created directories to the requested uid/gid. If the // directories along the path exist, no change of ownership will be performed -func MkdirAllAndChownNew(path string, mode os.FileMode, owner IDPair) error { - return mkdirAs(path, mode, owner.UID, owner.GID, true, false) +func MkdirAllAndChownNew(path string, mode os.FileMode, owner Identity) error { + return mkdirAs(path, mode, owner, true, false) } // GetRootUIDGID retrieves the remapped root uid/gid pair from the set of maps. @@ -102,22 +102,23 @@ func toHost(contID int, idMap []IDMap) (int, error) { return -1, fmt.Errorf("Container ID %d cannot be mapped to a host ID", contID) } -// IDPair is a UID and GID pair -type IDPair struct { +// Identity is either a UID and GID pair or a SID (but not both) +type Identity struct { UID int GID int + SID string } -// IDMappings contains a mappings of UIDs and GIDs -type IDMappings struct { +// IdentityMapping contains a mappings of UIDs and GIDs +type IdentityMapping struct { uids []IDMap gids []IDMap } -// NewIDMappings takes a requested user and group name and +// NewIdentityMapping takes a requested user and group name and // using the data from /etc/sub{uid,gid} ranges, creates the // proper uid and gid remapping ranges for that user/group pair -func NewIDMappings(username, groupname string) (*IDMappings, error) { +func NewIdentityMapping(username, groupname string) (*IdentityMapping, error) { subuidRanges, err := parseSubuid(username) if err != nil { return nil, err @@ -133,7 +134,7 @@ func NewIDMappings(username, groupname string) (*IDMappings, error) { return nil, fmt.Errorf("No subgid ranges found for group %q", groupname) } - return &IDMappings{ + return &IdentityMapping{ uids: createIDMap(subuidRanges), gids: createIDMap(subgidRanges), }, nil @@ -141,21 +142,21 @@ func NewIDMappings(username, groupname string) (*IDMappings, error) { // NewIDMappingsFromMaps creates a new mapping from two slices // Deprecated: this is a temporary shim while transitioning to IDMapping -func NewIDMappingsFromMaps(uids []IDMap, gids []IDMap) *IDMappings { - return &IDMappings{uids: uids, gids: gids} +func NewIDMappingsFromMaps(uids []IDMap, gids []IDMap) *IdentityMapping { + return &IdentityMapping{uids: uids, gids: gids} } // RootPair returns a uid and gid pair for the root user. The error is ignored // because a root user always exists, and the defaults are correct when the uid // and gid maps are empty. -func (i *IDMappings) RootPair() IDPair { +func (i *IdentityMapping) RootPair() Identity { uid, gid, _ := GetRootUIDGID(i.uids, i.gids) - return IDPair{UID: uid, GID: gid} + return Identity{UID: uid, GID: gid} } // ToHost returns the host UID and GID for the container uid, gid. // Remapping is only performed if the ids aren't already the remapped root ids -func (i *IDMappings) ToHost(pair IDPair) (IDPair, error) { +func (i *IdentityMapping) ToHost(pair Identity) (Identity, error) { var err error target := i.RootPair() @@ -173,7 +174,7 @@ func (i *IDMappings) ToHost(pair IDPair) (IDPair, error) { } // ToContainer returns the container UID and GID for the host uid and gid -func (i *IDMappings) ToContainer(pair IDPair) (int, int, error) { +func (i *IdentityMapping) ToContainer(pair Identity) (int, int, error) { uid, err := toContainer(pair.UID, i.uids) if err != nil { return -1, -1, err @@ -183,19 +184,19 @@ func (i *IDMappings) ToContainer(pair IDPair) (int, int, error) { } // Empty returns true if there are no id mappings -func (i *IDMappings) Empty() bool { +func (i *IdentityMapping) Empty() bool { return len(i.uids) == 0 && len(i.gids) == 0 } // UIDs return the UID mapping // TODO: remove this once everything has been refactored to use pairs -func (i *IDMappings) UIDs() []IDMap { +func (i *IdentityMapping) UIDs() []IDMap { return i.uids } // GIDs return the UID mapping // TODO: remove this once everything has been refactored to use pairs -func (i *IDMappings) GIDs() []IDMap { +func (i *IdentityMapping) GIDs() []IDMap { return i.gids } diff --git a/vendor/github.com/docker/docker/pkg/idtools/idtools_unix.go b/vendor/github.com/docker/docker/pkg/idtools/idtools_unix.go index 1d87ea3bcb..fb239743a0 100644 --- a/vendor/github.com/docker/docker/pkg/idtools/idtools_unix.go +++ b/vendor/github.com/docker/docker/pkg/idtools/idtools_unix.go @@ -21,11 +21,12 @@ var ( getentCmd string ) -func mkdirAs(path string, mode os.FileMode, ownerUID, ownerGID int, mkAll, chownExisting bool) error { +func mkdirAs(path string, mode os.FileMode, owner Identity, mkAll, chownExisting bool) error { // make an array containing the original path asked for, plus (for mkAll == true) // all path components leading up to the complete path that don't exist before we MkdirAll // so that we can chown all of them properly at the end. If chownExisting is false, we won't // chown the full directory path if it exists + var paths []string stat, err := system.Stat(path) @@ -38,7 +39,7 @@ func mkdirAs(path string, mode os.FileMode, ownerUID, ownerGID int, mkAll, chown } // short-circuit--we were called with an existing directory and chown was requested - return lazyChown(path, ownerUID, ownerGID, stat) + return lazyChown(path, owner.UID, owner.GID, stat) } if os.IsNotExist(err) { @@ -69,7 +70,7 @@ func mkdirAs(path string, mode os.FileMode, ownerUID, ownerGID int, mkAll, chown // even if it existed, we will chown the requested path + any subpaths that // didn't exist when we called MkdirAll for _, pathComponent := range paths { - if err := lazyChown(pathComponent, ownerUID, ownerGID, nil); err != nil { + if err := lazyChown(pathComponent, owner.UID, owner.GID, nil); err != nil { return err } } @@ -78,7 +79,7 @@ func mkdirAs(path string, mode os.FileMode, ownerUID, ownerGID int, mkAll, chown // CanAccess takes a valid (existing) directory and a uid, gid pair and determines // if that uid, gid pair has access (execute bit) to the directory -func CanAccess(path string, pair IDPair) bool { +func CanAccess(path string, pair Identity) bool { statInfo, err := system.Stat(path) if err != nil { return false diff --git a/vendor/github.com/docker/docker/pkg/idtools/idtools_windows.go b/vendor/github.com/docker/docker/pkg/idtools/idtools_windows.go index d72cc28929..4ae38a1b17 100644 --- a/vendor/github.com/docker/docker/pkg/idtools/idtools_windows.go +++ b/vendor/github.com/docker/docker/pkg/idtools/idtools_windows.go @@ -6,9 +6,11 @@ import ( "github.com/docker/docker/pkg/system" ) -// Platforms such as Windows do not support the UID/GID concept. So make this -// just a wrapper around system.MkdirAll. -func mkdirAs(path string, mode os.FileMode, ownerUID, ownerGID int, mkAll, chownExisting bool) error { +// This is currently a wrapper around MkdirAll, however, since currently +// permissions aren't set through this path, the identity isn't utilized. +// Ownership is handled elsewhere, but in the future could be support here +// too. +func mkdirAs(path string, mode os.FileMode, owner Identity, mkAll, chownExisting bool) error { if err := system.MkdirAll(path, mode, ""); err != nil { return err } @@ -18,6 +20,6 @@ func mkdirAs(path string, mode os.FileMode, ownerUID, ownerGID int, mkAll, chown // CanAccess takes a valid (existing) directory and a uid, gid pair and determines // if that uid, gid pair has access (execute bit) to the directory // Windows does not require/support this function, so always return true -func CanAccess(path string, pair IDPair) bool { +func CanAccess(path string, identity Identity) bool { return true } diff --git a/vendor/github.com/docker/docker/pkg/mount/sharedsubtree_linux.go b/vendor/github.com/docker/docker/pkg/mount/sharedsubtree_linux.go index 538f6637a0..8a100f0bc8 100644 --- a/vendor/github.com/docker/docker/pkg/mount/sharedsubtree_linux.go +++ b/vendor/github.com/docker/docker/pkg/mount/sharedsubtree_linux.go @@ -48,18 +48,22 @@ func MakeRUnbindable(mountPoint string) error { return ensureMountedAs(mountPoint, "runbindable") } -func ensureMountedAs(mountPoint, options string) error { - mounted, err := Mounted(mountPoint) +// MakeMount ensures that the file or directory given is a mount point, +// bind mounting it to itself it case it is not. +func MakeMount(mnt string) error { + mounted, err := Mounted(mnt) if err != nil { return err } - - if !mounted { - if err := Mount(mountPoint, mountPoint, "none", "bind,rw"); err != nil { - return err - } + if mounted { + return nil } - if _, err = Mounted(mountPoint); err != nil { + + return Mount(mnt, mnt, "none", "bind") +} + +func ensureMountedAs(mountPoint, options string) error { + if err := MakeMount(mountPoint); err != nil { return err } diff --git a/vendor/github.com/docker/docker/pkg/reexec/command_unsupported.go b/vendor/github.com/docker/docker/pkg/reexec/command_unsupported.go index 09fb4b2d29..e7eed24240 100644 --- a/vendor/github.com/docker/docker/pkg/reexec/command_unsupported.go +++ b/vendor/github.com/docker/docker/pkg/reexec/command_unsupported.go @@ -6,6 +6,10 @@ import ( "os/exec" ) +func Self() string { + return "" +} + // Command is unsupported on operating systems apart from Linux, Windows, and Darwin. func Command(args ...string) *exec.Cmd { return nil diff --git a/vendor/github.com/docker/docker/pkg/system/lcow.go b/vendor/github.com/docker/docker/pkg/system/lcow.go index 5c3fbfe6f4..5be3e2182b 100644 --- a/vendor/github.com/docker/docker/pkg/system/lcow.go +++ b/vendor/github.com/docker/docker/pkg/system/lcow.go @@ -1,69 +1,32 @@ package system // import "github.com/docker/docker/pkg/system" import ( - "fmt" "runtime" "strings" specs "github.com/opencontainers/image-spec/specs-go/v1" + "github.com/pkg/errors" ) -// ValidatePlatform determines if a platform structure is valid. -// TODO This is a temporary function - can be replaced by parsing from -// https://github.com/containerd/containerd/pull/1403/files at a later date. -// @jhowardmsft -func ValidatePlatform(platform *specs.Platform) error { - platform.Architecture = strings.ToLower(platform.Architecture) - platform.OS = strings.ToLower(platform.OS) - // Based on https://github.com/moby/moby/pull/34642#issuecomment-330375350, do - // not support anything except operating system. - if platform.Architecture != "" { - return fmt.Errorf("invalid platform architecture %q", platform.Architecture) - } - if platform.OS != "" { - if !(platform.OS == runtime.GOOS || (LCOWSupported() && platform.OS == "linux")) { - return fmt.Errorf("invalid platform os %q", platform.OS) - } - } - if len(platform.OSFeatures) != 0 { - return fmt.Errorf("invalid platform osfeatures %q", platform.OSFeatures) - } - if platform.OSVersion != "" { - return fmt.Errorf("invalid platform osversion %q", platform.OSVersion) - } - if platform.Variant != "" { - return fmt.Errorf("invalid platform variant %q", platform.Variant) - } - return nil -} - -// ParsePlatform parses a platform string in the format os[/arch[/variant] -// into an OCI image-spec platform structure. -// TODO This is a temporary function - can be replaced by parsing from -// https://github.com/containerd/containerd/pull/1403/files at a later date. -// @jhowardmsft -func ParsePlatform(in string) *specs.Platform { - p := &specs.Platform{} - elements := strings.SplitN(strings.ToLower(in), "/", 3) - if len(elements) == 3 { - p.Variant = elements[2] - } - if len(elements) >= 2 { - p.Architecture = elements[1] - } - if len(elements) >= 1 { - p.OS = elements[0] - } - return p -} - // IsOSSupported determines if an operating system is supported by the host func IsOSSupported(os string) bool { - if runtime.GOOS == os { + if strings.EqualFold(runtime.GOOS, os) { return true } - if LCOWSupported() && os == "linux" { + if LCOWSupported() && strings.EqualFold(os, "linux") { return true } return false } + +// ValidatePlatform determines if a platform structure is valid. +// TODO This is a temporary windows-only function, should be replaced by +// comparison of worker capabilities +func ValidatePlatform(platform specs.Platform) error { + if runtime.GOOS == "windows" { + if !(platform.OS == runtime.GOOS || (LCOWSupported() && platform.OS == "linux")) { + return errors.Errorf("unsupported os %s", platform.OS) + } + } + return nil +} diff --git a/vendor/github.com/docker/docker/pkg/system/rm.go b/vendor/github.com/docker/docker/pkg/system/rm.go index 02e4d26221..b310991800 100644 --- a/vendor/github.com/docker/docker/pkg/system/rm.go +++ b/vendor/github.com/docker/docker/pkg/system/rm.go @@ -34,7 +34,7 @@ func EnsureRemoveAll(dir string) error { for { err := os.RemoveAll(dir) if err == nil { - return err + return nil } pe, ok := err.(*os.PathError) diff --git a/vendor/github.com/docker/docker/pkg/system/syscall_windows.go b/vendor/github.com/docker/docker/pkg/system/syscall_windows.go index ee7e0256f3..4ae92fa6c7 100644 --- a/vendor/github.com/docker/docker/pkg/system/syscall_windows.go +++ b/vendor/github.com/docker/docker/pkg/system/syscall_windows.go @@ -2,16 +2,62 @@ package system // import "github.com/docker/docker/pkg/system" import ( "fmt" + "syscall" "unsafe" "github.com/sirupsen/logrus" "golang.org/x/sys/windows" ) +const ( + OWNER_SECURITY_INFORMATION = 0x00000001 + GROUP_SECURITY_INFORMATION = 0x00000002 + DACL_SECURITY_INFORMATION = 0x00000004 + SACL_SECURITY_INFORMATION = 0x00000008 + LABEL_SECURITY_INFORMATION = 0x00000010 + ATTRIBUTE_SECURITY_INFORMATION = 0x00000020 + SCOPE_SECURITY_INFORMATION = 0x00000040 + PROCESS_TRUST_LABEL_SECURITY_INFORMATION = 0x00000080 + ACCESS_FILTER_SECURITY_INFORMATION = 0x00000100 + BACKUP_SECURITY_INFORMATION = 0x00010000 + PROTECTED_DACL_SECURITY_INFORMATION = 0x80000000 + PROTECTED_SACL_SECURITY_INFORMATION = 0x40000000 + UNPROTECTED_DACL_SECURITY_INFORMATION = 0x20000000 + UNPROTECTED_SACL_SECURITY_INFORMATION = 0x10000000 +) + +const ( + SE_UNKNOWN_OBJECT_TYPE = iota + SE_FILE_OBJECT + SE_SERVICE + SE_PRINTER + SE_REGISTRY_KEY + SE_LMSHARE + SE_KERNEL_OBJECT + SE_WINDOW_OBJECT + SE_DS_OBJECT + SE_DS_OBJECT_ALL + SE_PROVIDER_DEFINED_OBJECT + SE_WMIGUID_OBJECT + SE_REGISTRY_WOW64_32KEY +) + +const ( + SeTakeOwnershipPrivilege = "SeTakeOwnershipPrivilege" +) + +const ( + ContainerAdministratorSidString = "S-1-5-93-2-1" + ContainerUserSidString = "S-1-5-93-2-2" +) + var ( - ntuserApiset = windows.NewLazyDLL("ext-ms-win-ntuser-window-l1-1-0") - procGetVersionExW = modkernel32.NewProc("GetVersionExW") - procGetProductInfo = modkernel32.NewProc("GetProductInfo") + ntuserApiset = windows.NewLazyDLL("ext-ms-win-ntuser-window-l1-1-0") + modadvapi32 = windows.NewLazySystemDLL("advapi32.dll") + procGetVersionExW = modkernel32.NewProc("GetVersionExW") + procGetProductInfo = modkernel32.NewProc("GetProductInfo") + procSetNamedSecurityInfo = modadvapi32.NewProc("SetNamedSecurityInfoW") + procGetSecurityDescriptorDacl = modadvapi32.NewProc("GetSecurityDescriptorDacl") ) // OSVersion is a wrapper for Windows version information @@ -125,3 +171,23 @@ func HasWin32KSupport() bool { // APIs. return ntuserApiset.Load() == nil } + +func SetNamedSecurityInfo(objectName *uint16, objectType uint32, securityInformation uint32, sidOwner *windows.SID, sidGroup *windows.SID, dacl *byte, sacl *byte) (result error) { + r0, _, _ := syscall.Syscall9(procSetNamedSecurityInfo.Addr(), 7, uintptr(unsafe.Pointer(objectName)), uintptr(objectType), uintptr(securityInformation), uintptr(unsafe.Pointer(sidOwner)), uintptr(unsafe.Pointer(sidGroup)), uintptr(unsafe.Pointer(dacl)), uintptr(unsafe.Pointer(sacl)), 0, 0) + if r0 != 0 { + result = syscall.Errno(r0) + } + return +} + +func GetSecurityDescriptorDacl(securityDescriptor *byte, daclPresent *uint32, dacl **byte, daclDefaulted *uint32) (result error) { + r1, _, e1 := syscall.Syscall6(procGetSecurityDescriptorDacl.Addr(), 4, uintptr(unsafe.Pointer(securityDescriptor)), uintptr(unsafe.Pointer(daclPresent)), uintptr(unsafe.Pointer(dacl)), uintptr(unsafe.Pointer(daclDefaulted)), 0, 0) + if r1 == 0 { + if e1 != 0 { + result = syscall.Errno(e1) + } else { + result = syscall.EINVAL + } + } + return +} diff --git a/vendor/github.com/docker/docker/pkg/term/term_windows.go b/vendor/github.com/docker/docker/pkg/term/term_windows.go index 64ead3c53b..a3c3db1315 100644 --- a/vendor/github.com/docker/docker/pkg/term/term_windows.go +++ b/vendor/github.com/docker/docker/pkg/term/term_windows.go @@ -62,13 +62,6 @@ func StdStreams() (stdIn io.ReadCloser, stdOut, stdErr io.Writer) { } } - if os.Getenv("ConEmuANSI") == "ON" || os.Getenv("ConsoleZVersion") != "" { - // The ConEmu and ConsoleZ terminals emulate ANSI on output streams well. - emulateStdin = true - emulateStdout = false - emulateStderr = false - } - // Temporarily use STD_INPUT_HANDLE, STD_OUTPUT_HANDLE and // STD_ERROR_HANDLE from syscall rather than x/sys/windows as long as // go-ansiterm hasn't switch to x/sys/windows. diff --git a/vendor/github.com/docker/docker/vendor.conf b/vendor/github.com/docker/docker/vendor.conf index 858182b841..0f48939f7e 100644 --- a/vendor/github.com/docker/docker/vendor.conf +++ b/vendor/github.com/docker/docker/vendor.conf @@ -1,51 +1,53 @@ # the following lines are in sorted order, FYI github.com/Azure/go-ansiterm d6e3b3328b783f23731bc4d058875b0371ff8109 -github.com/Microsoft/hcsshim v0.6.11 -github.com/Microsoft/go-winio v0.4.7 +github.com/Microsoft/hcsshim v0.7.12 +github.com/Microsoft/go-winio v0.4.11 github.com/docker/libtrust 9cbd2a1374f46905c68a4eb3694a130610adc62a github.com/go-check/check 4ed411733c5785b40214c70bce814c3a3a689609 https://github.com/cpuguy83/check.git github.com/golang/gddo 9b12a26f3fbd7397dee4e20939ddca719d840d2a github.com/gorilla/context v1.1 github.com/gorilla/mux v1.1 -github.com/Microsoft/opengcs v0.3.6 +github.com/Microsoft/opengcs v0.3.8 github.com/kr/pty 5cf931ef8f github.com/mattn/go-shellwords v1.0.3 -github.com/sirupsen/logrus v1.0.3 +github.com/sirupsen/logrus v1.0.6 github.com/tchap/go-patricia v2.2.6 github.com/vdemeester/shakers 24d7f1d6a71aa5d9cbe7390e4afb66b7eef9e1b3 -golang.org/x/net 0ed95abb35c445290478a5348a7b38bb154135fd -golang.org/x/sys 37707fdb30a5b38865cfb95e5aab41707daec7fd -github.com/docker/go-units 9e638d38cf6977a37a8ea0078f3ee75a7cdb2dd1 -github.com/docker/go-connections 7beb39f0b969b075d1325fecb092faf27fd357b6 -golang.org/x/text f72d8390a633d5dfb0cc84043294db9f6c935756 -github.com/pmezard/go-difflib v1.0.0 -github.com/gotestyourself/gotestyourself cf3a5ab914a2efa8bc838d09f5918c1d44d029 +golang.org/x/net a680a1efc54dd51c040b3b5ce4939ea3cf2ea0d1 +golang.org/x/sys ac767d655b305d4e9612f5f6e33120b9176c4ad4 +github.com/docker/go-units 47565b4f722fb6ceae66b95f853feed578a4a51c # v0.3.3 +github.com/docker/go-connections 7395e3f8aa162843a74ed6d48e79627d9792ac55 # v0.4.0 +golang.org/x/text f21a4dfb5e38f5895301dc265a8def02365cc3d0 # v0.3.0 +gotest.tools v2.1.0 github.com/google/go-cmp v0.2.0 github.com/RackSec/srslog 456df3a81436d29ba874f3590eeeee25d666f8a5 -github.com/imdario/mergo 0.2.1 -golang.org/x/sync fd80eb99c8f653c847d294a001bdf2a3a6f768f5 +github.com/imdario/mergo v0.3.6 +golang.org/x/sync 1d60e4601c6fd243af51cc01ddf169918a5407ca # buildkit -github.com/moby/buildkit 43e758232a0ac7d50c6a11413186e16684fc1e4f -github.com/tonistiigi/fsutil dc68c74458923f357474a9178bd198aa3ed11a5f +github.com/moby/buildkit d9f75920678e35090025bb89344c5370e2efc8e7 +github.com/tonistiigi/fsutil 2862f6bc5ac9b97124e552a5c108230b38a1b0ca github.com/grpc-ecosystem/grpc-opentracing 8e809c8a86450a29b90dcc9efbf062d0fe6d9746 github.com/opentracing/opentracing-go 1361b9cd60be79c4c3a7fa9841b3c132e40066a7 +github.com/google/shlex 6f45313302b9c56850fc17f99e40caebce98c716 +github.com/opentracing-contrib/go-stdlib b1a47cfbdd7543e70e9ef3e73d0802ad306cc1cc +github.com/mitchellh/hashstructure 2bca23e0e452137f789efbc8610126fd8b94f73b #get libnetwork packages # When updating, also update LIBNETWORK_COMMIT in hack/dockerfile/install/proxy accordingly -github.com/docker/libnetwork 3931ba4d815e385ab97093c64477b82f14dadefb +github.com/docker/libnetwork 4725f2163fb214a6312f3beae5991f838ec36326 # bump_18.09 branch github.com/docker/go-events 9461782956ad83b30282bf90e31fa6a70c255ba9 github.com/armon/go-radix e39d623f12e8e41c7b5529e9a9dd67a1e2261f80 github.com/armon/go-metrics eb0af217e5e9747e41dd5303755356b62d28e3ec github.com/hashicorp/go-msgpack 71c2886f5a673a35f909803f38ece5810165097b github.com/hashicorp/memberlist 3d8438da9589e7b608a83ffac1ef8211486bcb7c github.com/sean-/seed e2103e2c35297fb7e17febb81e49b312087a2372 -github.com/hashicorp/go-sockaddr acd314c5781ea706c710d9ea70069fd2e110d61d +github.com/hashicorp/go-sockaddr 6d291a969b86c4b633730bfc6b8b9d64c3aafed9 github.com/hashicorp/go-multierror fcdddc395df1ddf4247c69bd436e84cfa0733f7e github.com/hashicorp/serf 598c54895cc5a7b1a24a398d635e8c0ea0959870 -github.com/docker/libkv 1d8431073ae03cdaedb198a89722f3aab6d418ef +github.com/docker/libkv 458977154600b9f23984d9f4b82e79570b5ae12b github.com/vishvananda/netns 604eaf189ee867d8c147fafc28def2394e878d25 github.com/vishvananda/netlink b2de5d10e38ecce8607e6b438b6d174f389a004e @@ -57,13 +59,13 @@ github.com/coreos/etcd v3.2.1 github.com/coreos/go-semver v0.2.0 github.com/ugorji/go f1f1a805ed361a0e078bb537e4ea78cd37dcf065 github.com/hashicorp/consul v0.5.2 -github.com/boltdb/bolt fff57c100f4dea1905678da7e90d92429dff2904 github.com/miekg/dns v1.0.7 github.com/ishidawataru/sctp 07191f837fedd2f13d1ec7b5f885f0f3ec54b1cb +go.etcd.io/bbolt v1.3.1-etcd.8 # get graph and distribution packages github.com/docker/distribution 83389a148052d74ac602f5f1d62f86ff2f3c4aa5 -github.com/vbatts/tar-split v0.10.2 +github.com/vbatts/tar-split v0.11.0 github.com/opencontainers/go-digest v1.0.0-rc1 # get go-zfs packages @@ -72,9 +74,13 @@ github.com/pborman/uuid v1.0 google.golang.org/grpc v1.12.0 -# When updating, also update RUNC_COMMIT in hack/dockerfile/install/runc accordingly -github.com/opencontainers/runc 69663f0bd4b60df09991c08812a60108003fa340 -github.com/opencontainers/runtime-spec v1.0.1 +# The version of runc should match the version that is used by the containerd +# version that is used. If you need to update runc, open a pull request in +# the containerd project first, and update both after that is merged. +# This commit does not need to match RUNC_COMMIT as it is used for helper +# packages but should be newer or equal. +github.com/opencontainers/runc 96ec2177ae841256168fcf76954f7177af9446eb +github.com/opencontainers/runtime-spec 5684b8af48c1ac3b1451fa499724e30e3c20a294 # v1.0.1-49-g5684b8a github.com/opencontainers/image-spec v1.0.1 github.com/seccomp/libseccomp-golang 32f571b70023028bd57d9288c20efbcb237f3ce0 @@ -93,7 +99,7 @@ github.com/philhofer/fwd 98c11a7a6ec829d672b03833c3d69a7fae1ca972 github.com/tinylib/msgp 3b556c64540842d4f82967be066a7f7fffc3adad # fsnotify -github.com/fsnotify/fsnotify 4da3e2cfbabc9f751898f250b49f2439785783a1 +github.com/fsnotify/fsnotify v1.4.7 # awslogs deps github.com/aws/aws-sdk-go v1.12.66 @@ -112,27 +118,28 @@ github.com/googleapis/gax-go v2.0.0 google.golang.org/genproto 694d95ba50e67b2e363f3483057db5d4910c18f9 # containerd -github.com/containerd/containerd c7083eed5d8633d54c25fe81aa609010a4f2e495 +github.com/containerd/containerd 9754871865f7fe2f4e74d43e2fc7ccd237edcbce # v1.2.2 github.com/containerd/fifo 3d5202aec260678c48179c56f40e6f38a095738c -github.com/containerd/continuity d3c23511c1bf5851696cba83143d9cbcd666869b -github.com/containerd/cgroups fe281dd265766145e943a034aa41086474ea6130 -github.com/containerd/console cb7008ab3d8359b78c5f464cb7cf160107ad5925 -github.com/containerd/go-runc f271fa2021de855d4d918dbef83c5fe19db1bdd -github.com/containerd/typeurl f6943554a7e7e88b3c14aad190bf05932da84788 -github.com/stevvooe/ttrpc d4528379866b0ce7e9d71f3eb96f0582fc374577 +github.com/containerd/continuity 004b46473808b3e7a4a3049c20e4376c91eb966d +github.com/containerd/cgroups dbea6f2bd41658b84b00417ceefa416b979cbf10 +github.com/containerd/console c12b1e7919c14469339a5d38f2f8ed9b64a9de23 +github.com/containerd/cri 0d5cabd006cb5319dc965046067b8432d9fa5ef8 # release/1.2 branch +github.com/containerd/go-runc 5a6d9f37cfa36b15efba46dc7ea349fa9b7143c3 +github.com/containerd/typeurl a93fcdb778cd272c6e9b3028b2f42d813e785d40 +github.com/containerd/ttrpc 2a805f71863501300ae1976d29f0454ae003e85a github.com/gogo/googleapis 08a7655d27152912db7aaf4f983275eaf8d128ef # cluster -github.com/docker/swarmkit edd5641391926a50bc5f7040e20b7efc05003c26 +github.com/docker/swarmkit 19e791fd6dc76e8e894cbc99b77f946b7d00ebb9 # bump_v18.09 branch github.com/gogo/protobuf v1.0.0 -github.com/cloudflare/cfssl 7fb22c8cba7ecaf98e4082d22d65800cf45e042a +github.com/cloudflare/cfssl 1.3.2 github.com/fernet/fernet-go 1b2437bc582b3cfbb341ee5a29f8ef5b42912ff2 -github.com/google/certificate-transparency d90e65c3a07988180c5b1ece71791c0b6506826e -golang.org/x/crypto 1a580b3eff7814fc9b40602fd35256c63b50f491 -golang.org/x/time a4bde12657593d5e90d0533a3e4fd95e635124cb +github.com/google/certificate-transparency-go v1.0.20 +golang.org/x/crypto 0709b304e793a5edb4a2c0145f281ecdc20838a4 +golang.org/x/time fbb02b2291d28baffd63558aa44b4b56f178d650 github.com/hashicorp/go-memdb cb9a474f84cc5e41b273b20c6927680b2a8776ad -github.com/hashicorp/go-immutable-radix 8e8ed81f8f0bf1bdd829593fdd5c29922c1ea990 -github.com/hashicorp/golang-lru a0d98a5f288019575c6d1f4bb1573fef2d1fcdc4 +github.com/hashicorp/go-immutable-radix 826af9ccf0feeee615d546d69b11f8e98da8c8f1 git://github.com/tonistiigi/go-immutable-radix.git +github.com/hashicorp/golang-lru 0fb14efe8c47ae851c0034ed7a448854d3d34cf3 github.com/coreos/pkg fa29b1d70f0beaddd4c7021607cc3c3be8ce94b8 github.com/pivotal-golang/clock 3fd3c1944c59d9742e1cd333672181cd1a6f9fa0 github.com/prometheus/client_golang 52437c81da6b127a9925d17eb3a382a2e5fd395e @@ -141,19 +148,19 @@ github.com/prometheus/client_model fa8ad6fec33561be4280a8f0514318c79d7f6cb6 github.com/prometheus/common ebdfc6da46522d58825777cf1f90490a5b1ef1d8 github.com/prometheus/procfs abf152e5f3e97f2fafac028d2cc06c1feb87ffa5 github.com/matttproud/golang_protobuf_extensions v1.0.0 -github.com/pkg/errors 839d9e913e063e28dfd0e6c7b7512793e0a48be9 -github.com/grpc-ecosystem/go-grpc-prometheus 6b7015e65d366bf3f19b2b2a000a831940f0f7e0 +github.com/pkg/errors 645ef00459ed84a119197bfb8d8205042c6df63d # v0.8.0 +github.com/grpc-ecosystem/go-grpc-prometheus v1.2.0 # cli github.com/spf13/cobra v0.0.3 github.com/spf13/pflag v1.0.1 -github.com/inconshreveable/mousetrap 76626ae9c91c4f2a10f34cad8ce83ea42c93bb75 +github.com/inconshreveable/mousetrap 76626ae9c91c4f2a10f34cad8ce83ea42c93bb75 # v1.0 github.com/Nvveen/Gotty a8b993ba6abdb0e0c12b0125c603323a71c7790c https://github.com/ijc25/Gotty # metrics github.com/docker/go-metrics d466d4f6fd960e01820085bd7e1a24426ee7ef18 -github.com/opencontainers/selinux b29023b86e4a69d1b46b7e7b4e2b6fda03f0b9cd +github.com/opencontainers/selinux b6fa367ed7f534f9ba25391cc2d467085dbb445a # archive/tar (for Go 1.10, see https://github.com/golang/go/issues/24787) diff --git a/vendor/github.com/docker/go-connections/tlsconfig/config.go b/vendor/github.com/docker/go-connections/tlsconfig/config.go index f11f166a44..0ef3fdcb46 100644 --- a/vendor/github.com/docker/go-connections/tlsconfig/config.go +++ b/vendor/github.com/docker/go-connections/tlsconfig/config.go @@ -46,8 +46,6 @@ var acceptedCBCCiphers = []uint16{ tls.TLS_ECDHE_ECDSA_WITH_AES_128_CBC_SHA, tls.TLS_ECDHE_RSA_WITH_AES_256_CBC_SHA, tls.TLS_ECDHE_RSA_WITH_AES_128_CBC_SHA, - tls.TLS_RSA_WITH_AES_256_CBC_SHA, - tls.TLS_RSA_WITH_AES_128_CBC_SHA, } // DefaultServerAcceptedCiphers should be uses by code which already has a crypto/tls @@ -67,8 +65,8 @@ var allTLSVersions = map[uint16]struct{}{ // ServerDefault returns a secure-enough TLS configuration for the server TLS configuration. func ServerDefault(ops ...func(*tls.Config)) *tls.Config { tlsconfig := &tls.Config{ - // Avoid fallback by default to SSL protocols < TLS1.0 - MinVersion: tls.VersionTLS10, + // Avoid fallback by default to SSL protocols < TLS1.2 + MinVersion: tls.VersionTLS12, PreferServerCipherSuites: true, CipherSuites: DefaultServerAcceptedCiphers, } diff --git a/vendor/github.com/docker/go-units/size.go b/vendor/github.com/docker/go-units/size.go index 44616c2718..85f6ab0715 100644 --- a/vendor/github.com/docker/go-units/size.go +++ b/vendor/github.com/docker/go-units/size.go @@ -31,7 +31,7 @@ type unitMap map[string]int64 var ( decimalMap = unitMap{"k": KB, "m": MB, "g": GB, "t": TB, "p": PB} binaryMap = unitMap{"k": KiB, "m": MiB, "g": GiB, "t": TiB, "p": PiB} - sizeRegex = regexp.MustCompile(`^(\d+(\.\d+)*) ?([kKmMgGtTpP])?[bB]?$`) + sizeRegex = regexp.MustCompile(`^(\d+(\.\d+)*) ?([kKmMgGtTpP])?[iI]?[bB]?$`) ) var decimapAbbrs = []string{"B", "kB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"} diff --git a/vendor/github.com/docker/libkv/README.md b/vendor/github.com/docker/libkv/README.md index baad81b4f8..ff2cc446d3 100644 --- a/vendor/github.com/docker/libkv/README.md +++ b/vendor/github.com/docker/libkv/README.md @@ -90,7 +90,7 @@ Calls like `WatchTree` may return different events (or number of events) dependi Only `Consul` and `etcd` have support for TLS and you should build and provide your own `config.TLS` object to feed the client. Support is planned for `zookeeper`. -##Roadmap +## Roadmap - Make the API nicer to use (using `options`) - Provide more options (`consistency` for example) @@ -98,10 +98,10 @@ Only `Consul` and `etcd` have support for TLS and you should build and provide y - Better key formatting - New backends? -##Contributing +## Contributing Want to hack on libkv? [Docker's contributions guidelines](https://github.com/docker/docker/blob/master/CONTRIBUTING.md) apply. -##Copyright and license +## Copyright and license Copyright © 2014-2016 Docker, Inc. All rights reserved, except as follows. Code is released under the Apache 2.0 license. The README.md file, and files in the "docs" folder are licensed under the Creative Commons Attribution 4.0 International License under the terms and conditions set forth in the file "LICENSE.docs". You may obtain a duplicate copy of the same license, titled CC-BY-SA-4.0, at http://creativecommons.org/licenses/by/4.0/. diff --git a/vendor/github.com/docker/libkv/store/boltdb/boltdb.go b/vendor/github.com/docker/libkv/store/boltdb/boltdb.go index cdfd74f878..d62979cb72 100644 --- a/vendor/github.com/docker/libkv/store/boltdb/boltdb.go +++ b/vendor/github.com/docker/libkv/store/boltdb/boltdb.go @@ -10,9 +10,9 @@ import ( "sync/atomic" "time" - "github.com/boltdb/bolt" "github.com/docker/libkv" "github.com/docker/libkv/store" + bolt "go.etcd.io/bbolt" ) var ( diff --git a/vendor/github.com/docker/libkv/store/etcd/etcd.go b/vendor/github.com/docker/libkv/store/etcd/etcd.go index c932ca665e..ec407b0788 100644 --- a/vendor/github.com/docker/libkv/store/etcd/etcd.go +++ b/vendor/github.com/docker/libkv/store/etcd/etcd.go @@ -1,6 +1,7 @@ package etcd import ( + "context" "crypto/tls" "errors" "log" @@ -9,8 +10,6 @@ import ( "strings" "time" - "golang.org/x/net/context" - etcd "github.com/coreos/etcd/client" "github.com/docker/libkv" "github.com/docker/libkv/store" @@ -30,13 +29,29 @@ type Etcd struct { } type etcdLock struct { - client etcd.KeysAPI - stopLock chan struct{} + client etcd.KeysAPI + key string + value string + ttl time.Duration + + // Closed when the caller wants to stop renewing the lock. I'm not sure + // why this is even used - you could just call the Unlock() method. stopRenew chan struct{} - key string - value string - last *etcd.Response - ttl time.Duration + // When the lock is held, this is the last modified index of the key. + // Used for conditional updates when extending the lock TTL and when + // conditionall deleteing when Unlock() is called. + lastIndex uint64 + // When the lock is held, this function will cancel the locked context. + // This is called both by the Unlock() method in order to stop the + // background holding goroutine and in a deferred call in that background + // holding goroutine in case the lock is lost due to an error or the + // stopRenew channel is closed. Calling this function also closes the chan + // returned by the Lock() method. + cancel context.CancelFunc + // Used to sync the Unlock() call with the background holding goroutine. + // This channel is closed when that background goroutine exits, signalling + // that it is okay to conditionally delete the key. + doneHolding chan struct{} } const ( @@ -472,112 +487,97 @@ func (s *Etcd) NewLock(key string, options *store.LockOptions) (lock store.Locke // doing so. It returns a channel that is closed if our // lock is lost or if an error occurs func (l *etcdLock) Lock(stopChan chan struct{}) (<-chan struct{}, error) { - - // Lock holder channel - lockHeld := make(chan struct{}) - stopLocking := l.stopRenew - + // Conditional Set - only if the key does not exist. setOpts := &etcd.SetOptions{ - TTL: l.ttl, + TTL: l.ttl, + PrevExist: etcd.PrevNoExist, } for { - setOpts.PrevExist = etcd.PrevNoExist resp, err := l.client.Set(context.Background(), l.key, l.value, setOpts) - if err != nil { - if etcdError, ok := err.(etcd.Error); ok { - if etcdError.Code != etcd.ErrorCodeNodeExist { - return nil, err - } - setOpts.PrevIndex = ^uint64(0) - } - } else { - setOpts.PrevIndex = resp.Node.ModifiedIndex - } - - setOpts.PrevExist = etcd.PrevExist - l.last, err = l.client.Set(context.Background(), l.key, l.value, setOpts) - if err == nil { - // Leader section - l.stopLock = stopLocking - go l.holdLock(l.key, lockHeld, stopLocking) - break - } else { - // If this is a legitimate error, return - if etcdError, ok := err.(etcd.Error); ok { - if etcdError.Code != etcd.ErrorCodeTestFailed { - return nil, err - } - } + // Acquired the lock! + l.lastIndex = resp.Node.ModifiedIndex + lockedCtx, cancel := context.WithCancel(context.Background()) + l.cancel = cancel + l.doneHolding = make(chan struct{}) - // Seeker section - errorCh := make(chan error) - chWStop := make(chan bool) - free := make(chan bool) + go l.holdLock(lockedCtx) - go l.waitLock(l.key, errorCh, chWStop, free) + return lockedCtx.Done(), nil + } - // Wait for the key to be available or for - // a signal to stop trying to lock the key - select { - case <-free: - break - case err := <-errorCh: - return nil, err - case <-stopChan: - return nil, ErrAbortTryLock - } + etcdErr, ok := err.(etcd.Error) + if !ok || etcdErr.Code != etcd.ErrorCodeNodeExist { + return nil, err // Unexpected error. + } - // Delete or Expire event occurred - // Retry + // Need to wait for the lock key to expire or be deleted. + if err := l.waitLock(stopChan, etcdErr.Index); err != nil { + return nil, err } - } - return lockHeld, nil + // Delete or Expire event occurred. + // Retry + } } -// Hold the lock as long as we can +// Hold the lock as long as we can. // Updates the key ttl periodically until we receive -// an explicit stop signal from the Unlock method -func (l *etcdLock) holdLock(key string, lockHeld chan struct{}, stopLocking <-chan struct{}) { - defer close(lockHeld) +// an explicit stop signal from the Unlock method OR +// the stopRenew channel is closed. +func (l *etcdLock) holdLock(ctx context.Context) { + defer close(l.doneHolding) + defer l.cancel() update := time.NewTicker(l.ttl / 3) defer update.Stop() - var err error setOpts := &etcd.SetOptions{TTL: l.ttl} for { select { case <-update.C: - setOpts.PrevIndex = l.last.Node.ModifiedIndex - l.last, err = l.client.Set(context.Background(), key, l.value, setOpts) + setOpts.PrevIndex = l.lastIndex + resp, err := l.client.Set(ctx, l.key, l.value, setOpts) if err != nil { return } - - case <-stopLocking: + l.lastIndex = resp.Node.ModifiedIndex + case <-l.stopRenew: + return + case <-ctx.Done(): return } } } -// WaitLock simply waits for the key to be available for creation -func (l *etcdLock) waitLock(key string, errorCh chan error, stopWatchCh chan bool, free chan<- bool) { - opts := &etcd.WatcherOptions{Recursive: false} - watcher := l.client.Watcher(key, opts) +// WaitLock simply waits for the key to be available for creation. +func (l *etcdLock) waitLock(stopWait <-chan struct{}, afterIndex uint64) error { + waitCtx, waitCancel := context.WithCancel(context.Background()) + defer waitCancel() + go func() { + select { + case <-stopWait: + // If the caller closes the stopWait, cancel the wait context. + waitCancel() + case <-waitCtx.Done(): + // No longer waiting. + } + }() + watcher := l.client.Watcher(l.key, &etcd.WatcherOptions{AfterIndex: afterIndex}) for { - event, err := watcher.Next(context.Background()) + event, err := watcher.Next(waitCtx) if err != nil { - errorCh <- err - return + if err == context.Canceled { + return ErrAbortTryLock + } + return err } - if event.Action == "delete" || event.Action == "expire" { - free <- true - return + switch event.Action { + case "delete", "compareAndDelete", "expire": + return nil // The key has been deleted or expired. } } } @@ -585,19 +585,17 @@ func (l *etcdLock) waitLock(key string, errorCh chan error, stopWatchCh chan boo // Unlock the "key". Calling unlock while // not holding the lock will throw an error func (l *etcdLock) Unlock() error { - if l.stopLock != nil { - l.stopLock <- struct{}{} - } - if l.last != nil { + l.cancel() // Will signal the holdLock goroutine to exit. + <-l.doneHolding // Wait for the holdLock goroutine to exit. + + var err error + if l.lastIndex != 0 { delOpts := &etcd.DeleteOptions{ - PrevIndex: l.last.Node.ModifiedIndex, - } - _, err := l.client.Delete(context.Background(), l.key, delOpts) - if err != nil { - return err + PrevIndex: l.lastIndex, } + _, err = l.client.Delete(context.Background(), l.key, delOpts) } - return nil + return err } // Close closes the client connection diff --git a/vendor/github.com/opencontainers/runtime-spec/README.md b/vendor/github.com/opencontainers/runtime-spec/README.md index f0ad86e672..b40dba17d8 100644 --- a/vendor/github.com/opencontainers/runtime-spec/README.md +++ b/vendor/github.com/opencontainers/runtime-spec/README.md @@ -22,12 +22,12 @@ To provide context for users the following section gives example use cases for e ### Application Bundle Builders Application bundle builders can create a [bundle](bundle.md) directory that includes all of the files required for launching an application as a container. -The bundle contains an OCI [configuration file](config.md) where the builder can specify host-independent details such as [which executable to launch](config.md#process) and host-specific settings such as [mount](config.md#mounts) locations, [hook](config.md#hooks) paths, Linux [namespaces](config-linux.md#namespaces) and [cgroups](config-linux.md#control-groups). +The bundle contains an OCI [configuration file](config.md) where the builder can specify host-independent details such as [which executable to launch](config.md#process) and host-specific settings such as [mount](config.md#mounts) locations, [hook](config.md#posix-platform-hooks) paths, Linux [namespaces](config-linux.md#namespaces) and [cgroups](config-linux.md#control-groups). Because the configuration includes host-specific settings, application bundle directories copied between two hosts may require configuration adjustments. ### Hook Developers -[Hook](config.md#hooks) developers can extend the functionality of an OCI-compliant runtime by hooking into a container's lifecycle with an external application. +[Hook](config.md#posix-platform-hooks) developers can extend the functionality of an OCI-compliant runtime by hooking into a container's lifecycle with an external application. Example use cases include sophisticated network configuration, volume garbage collection, etc. ### Runtime Developers @@ -54,7 +54,7 @@ When in doubt, start on the [mailing-list](#mailing-list). ### Meetings -The contributors and maintainers of all OCI projects have monthly meetings at 2:00 PM (USA Pacific) on the first Wednesday of every month. +The contributors and maintainers of all OCI projects have monthly meetings, which are usually at 2:00 PM (USA Pacific) on the first Wednesday of every month. There is an [iCalendar][rfc5545] format for the meetings [here](meeting.ics). Everyone is welcome to participate via [UberConference web][uberconference] or audio-only: +1 415 968 0849 (no PIN needed). An initial agenda will be posted to the [mailing list](#mailing-list) in the week before each meeting, and everyone is welcome to propose additional topics or suggest other agenda alterations there. diff --git a/vendor/github.com/opencontainers/runtime-spec/specs-go/config.go b/vendor/github.com/opencontainers/runtime-spec/specs-go/config.go index 71c9fa7731..9984bbce30 100644 --- a/vendor/github.com/opencontainers/runtime-spec/specs-go/config.go +++ b/vendor/github.com/opencontainers/runtime-spec/specs-go/config.go @@ -25,6 +25,8 @@ type Spec struct { Solaris *Solaris `json:"solaris,omitempty" platform:"solaris"` // Windows is platform-specific configuration for Windows based containers. Windows *Windows `json:"windows,omitempty" platform:"windows"` + // VM specifies configuration for virtual-machine-based containers. + VM *VM `json:"vm,omitempty" platform:"vm"` } // Process contains information to start a specific application inside the container. @@ -158,8 +160,8 @@ type Linux struct { ReadonlyPaths []string `json:"readonlyPaths,omitempty"` // MountLabel specifies the selinux context for the mounts in the container. MountLabel string `json:"mountLabel,omitempty"` - // IntelRdt contains Intel Resource Director Technology (RDT) information - // for handling resource constraints (e.g., L3 cache) for the container + // IntelRdt contains Intel Resource Director Technology (RDT) information for + // handling resource constraints (e.g., L3 cache, memory bandwidth) for the container IntelRdt *LinuxIntelRdt `json:"intelRdt,omitempty"` } @@ -194,10 +196,10 @@ const ( // LinuxIDMapping specifies UID/GID mappings type LinuxIDMapping struct { - // HostID is the starting UID/GID on the host to be mapped to 'ContainerID' - HostID uint32 `json:"hostID"` // ContainerID is the starting UID/GID in the container ContainerID uint32 `json:"containerID"` + // HostID is the starting UID/GID on the host to be mapped to 'ContainerID' + HostID uint32 `json:"hostID"` // Size is the number of IDs to be mapped Size uint32 `json:"size"` } @@ -320,6 +322,14 @@ type LinuxNetwork struct { Priorities []LinuxInterfacePriority `json:"priorities,omitempty"` } +// LinuxRdma for Linux cgroup 'rdma' resource management (Linux 4.11) +type LinuxRdma struct { + // Maximum number of HCA handles that can be opened. Default is "no limit". + HcaHandles *uint32 `json:"hcaHandles,omitempty"` + // Maximum number of HCA objects that can be created. Default is "no limit". + HcaObjects *uint32 `json:"hcaObjects,omitempty"` +} + // LinuxResources has container runtime resource constraints type LinuxResources struct { // Devices configures the device whitelist. @@ -336,6 +346,10 @@ type LinuxResources struct { HugepageLimits []LinuxHugepageLimit `json:"hugepageLimits,omitempty"` // Network restriction configuration Network *LinuxNetwork `json:"network,omitempty"` + // Rdma resource restriction configuration. + // Limits are a set of key value pairs that define RDMA resource limits, + // where the key is device name and value is resource limits. + Rdma map[string]LinuxRdma `json:"rdma,omitempty"` } // LinuxDevice represents the mknod information for a Linux special device file @@ -419,6 +433,8 @@ type SolarisAnet struct { type Windows struct { // LayerFolders contains a list of absolute paths to directories containing image layers. LayerFolders []string `json:"layerFolders"` + // Devices are the list of devices to be mapped into the container. + Devices []WindowsDevice `json:"devices,omitempty"` // Resources contains information for handling resource constraints for the container. Resources *WindowsResources `json:"resources,omitempty"` // CredentialSpec contains a JSON object describing a group Managed Service Account (gMSA) specification. @@ -433,6 +449,14 @@ type Windows struct { Network *WindowsNetwork `json:"network,omitempty"` } +// WindowsDevice represents information about a host device to be mapped into the container. +type WindowsDevice struct { + // Device identifier: interface class GUID, etc. + ID string `json:"id"` + // Device identifier type: "class", etc. + IDType string `json:"idType"` +} + // WindowsResources has container runtime resource constraints for containers running on Windows. type WindowsResources struct { // Memory restriction configuration. @@ -479,6 +503,8 @@ type WindowsNetwork struct { DNSSearchList []string `json:"DNSSearchList,omitempty"` // Name (ID) of the container that we will share with the network stack. NetworkSharedContainerName string `json:"networkSharedContainerName,omitempty"` + // name (ID) of the network namespace that will be used for the container. + NetworkNamespace string `json:"networkNamespace,omitempty"` } // WindowsHyperV contains information for configuring a container to run with Hyper-V isolation. @@ -487,6 +513,42 @@ type WindowsHyperV struct { UtilityVMPath string `json:"utilityVMPath,omitempty"` } +// VM contains information for virtual-machine-based containers. +type VM struct { + // Hypervisor specifies hypervisor-related configuration for virtual-machine-based containers. + Hypervisor VMHypervisor `json:"hypervisor,omitempty"` + // Kernel specifies kernel-related configuration for virtual-machine-based containers. + Kernel VMKernel `json:"kernel"` + // Image specifies guest image related configuration for virtual-machine-based containers. + Image VMImage `json:"image,omitempty"` +} + +// VMHypervisor contains information about the hypervisor to use for a virtual machine. +type VMHypervisor struct { + // Path is the host path to the hypervisor used to manage the virtual machine. + Path string `json:"path"` + // Parameters specifies parameters to pass to the hypervisor. + Parameters string `json:"parameters,omitempty"` +} + +// VMKernel contains information about the kernel to use for a virtual machine. +type VMKernel struct { + // Path is the host path to the kernel used to boot the virtual machine. + Path string `json:"path"` + // Parameters specifies parameters to pass to the kernel. + Parameters string `json:"parameters,omitempty"` + // InitRD is the host path to an initial ramdisk to be used by the kernel. + InitRD string `json:"initrd,omitempty"` +} + +// VMImage contains information about the virtual machine root image. +type VMImage struct { + // Path is the host path to the root image that the VM kernel would boot into. + Path string `json:"path"` + // Format is the root image format type (e.g. "qcow2", "raw", "vhd", etc). + Format string `json:"format"` +} + // LinuxSeccomp represents syscall restrictions type LinuxSeccomp struct { DefaultAction LinuxSeccompAction `json:"defaultAction"` @@ -561,10 +623,16 @@ type LinuxSyscall struct { Args []LinuxSeccompArg `json:"args,omitempty"` } -// LinuxIntelRdt has container runtime resource constraints -// for Intel RDT/CAT which introduced in Linux 4.10 kernel +// LinuxIntelRdt has container runtime resource constraints for Intel RDT +// CAT and MBA features which introduced in Linux 4.10 and 4.12 kernel type LinuxIntelRdt struct { + // The identity for RDT Class of Service + ClosID string `json:"closID,omitempty"` // The schema for L3 cache id and capacity bitmask (CBM) // Format: "L3:=;=;..." L3CacheSchema string `json:"l3CacheSchema,omitempty"` + + // The schema of memory bandwidth percentage per L3 cache id + // Format: "MB:=bandwidth0;=bandwidth1;..." + MemBwSchema string `json:"memBwSchema,omitempty"` } diff --git a/vendor/github.com/opencontainers/runtime-spec/specs-go/version.go b/vendor/github.com/opencontainers/runtime-spec/specs-go/version.go index ff0cb6a80e..b920fc1b39 100644 --- a/vendor/github.com/opencontainers/runtime-spec/specs-go/version.go +++ b/vendor/github.com/opencontainers/runtime-spec/specs-go/version.go @@ -11,7 +11,7 @@ const ( VersionPatch = 1 // VersionDev indicates development branch. Releases will be empty string. - VersionDev = "" + VersionDev = "-dev" ) // Version is the specification version that the package types support. diff --git a/vendor/github.com/boltdb/bolt/LICENSE b/vendor/go.etcd.io/bbolt/LICENSE similarity index 100% rename from vendor/github.com/boltdb/bolt/LICENSE rename to vendor/go.etcd.io/bbolt/LICENSE diff --git a/vendor/github.com/boltdb/bolt/README.md b/vendor/go.etcd.io/bbolt/README.md similarity index 84% rename from vendor/github.com/boltdb/bolt/README.md rename to vendor/go.etcd.io/bbolt/README.md index 2a69d95e78..6546fc01ac 100644 --- a/vendor/github.com/boltdb/bolt/README.md +++ b/vendor/go.etcd.io/bbolt/README.md @@ -1,5 +1,18 @@ -Bolt [![Coverage Status](https://coveralls.io/repos/boltdb/bolt/badge.svg?branch=master)](https://coveralls.io/r/boltdb/bolt?branch=master) [![GoDoc](https://godoc.org/github.com/boltdb/bolt?status.svg)](https://godoc.org/github.com/boltdb/bolt) ![Version](https://img.shields.io/badge/version-1.2.1-green.svg) -==== +bbolt +===== + +[![Go Report Card](https://goreportcard.com/badge/github.com/etcd-io/bbolt?style=flat-square)](https://goreportcard.com/report/github.com/etcd-io/bbolt) +[![Coverage](https://codecov.io/gh/etcd-io/bbolt/branch/master/graph/badge.svg)](https://codecov.io/gh/etcd-io/bbolt) +[![Build Status Travis](https://img.shields.io/travis/etcd-io/bboltlabs.svg?style=flat-square&&branch=master)](https://travis-ci.com/etcd-io/bbolt) +[![Godoc](http://img.shields.io/badge/go-documentation-blue.svg?style=flat-square)](https://godoc.org/github.com/etcd-io/bbolt) +[![Releases](https://img.shields.io/github/release/etcd-io/bbolt/all.svg?style=flat-square)](https://github.com/etcd-io/bbolt/releases) +[![LICENSE](https://img.shields.io/github/license/etcd-io/bbolt.svg?style=flat-square)](https://github.com/etcd-io/bbolt/blob/master/LICENSE) + +bbolt is a fork of [Ben Johnson's][gh_ben] [Bolt][bolt] key/value +store. The purpose of this fork is to provide the Go community with an active +maintenance and development target for Bolt; the goal is improved reliability +and stability. bbolt includes bug fixes, performance enhancements, and features +not found in Bolt while preserving backwards compatibility with the Bolt API. Bolt is a pure Go key/value store inspired by [Howard Chu's][hyc_symas] [LMDB project][lmdb]. The goal of the project is to provide a simple, @@ -10,6 +23,8 @@ Since Bolt is meant to be used as such a low-level piece of functionality, simplicity is key. The API will be small and only focus on getting values and setting values. That's it. +[gh_ben]: https://github.com/benbjohnson +[bolt]: https://github.com/boltdb/bolt [hyc_symas]: https://twitter.com/hyc_symas [lmdb]: http://symas.com/mdb/ @@ -17,40 +32,46 @@ and setting values. That's it. Bolt is stable, the API is fixed, and the file format is fixed. Full unit test coverage and randomized black box testing are used to ensure database -consistency and thread safety. Bolt is currently in high-load production +consistency and thread safety. Bolt is currently used in high-load production environments serving databases as large as 1TB. Many companies such as Shopify and Heroku use Bolt-backed services every day. +## Project versioning + +bbolt uses [semantic versioning](http://semver.org). +API should not change between patch and minor releases. +New minor versions may add additional features to the API. + ## Table of Contents -- [Getting Started](#getting-started) - - [Installing](#installing) - - [Opening a database](#opening-a-database) - - [Transactions](#transactions) - - [Read-write transactions](#read-write-transactions) - - [Read-only transactions](#read-only-transactions) - - [Batch read-write transactions](#batch-read-write-transactions) - - [Managing transactions manually](#managing-transactions-manually) - - [Using buckets](#using-buckets) - - [Using key/value pairs](#using-keyvalue-pairs) - - [Autoincrementing integer for the bucket](#autoincrementing-integer-for-the-bucket) - - [Iterating over keys](#iterating-over-keys) - - [Prefix scans](#prefix-scans) - - [Range scans](#range-scans) - - [ForEach()](#foreach) - - [Nested buckets](#nested-buckets) - - [Database backups](#database-backups) - - [Statistics](#statistics) - - [Read-Only Mode](#read-only-mode) - - [Mobile Use (iOS/Android)](#mobile-use-iosandroid) -- [Resources](#resources) -- [Comparison with other databases](#comparison-with-other-databases) - - [Postgres, MySQL, & other relational databases](#postgres-mysql--other-relational-databases) - - [LevelDB, RocksDB](#leveldb-rocksdb) - - [LMDB](#lmdb) -- [Caveats & Limitations](#caveats--limitations) -- [Reading the Source](#reading-the-source) -- [Other Projects Using Bolt](#other-projects-using-bolt) + - [Getting Started](#getting-started) + - [Installing](#installing) + - [Opening a database](#opening-a-database) + - [Transactions](#transactions) + - [Read-write transactions](#read-write-transactions) + - [Read-only transactions](#read-only-transactions) + - [Batch read-write transactions](#batch-read-write-transactions) + - [Managing transactions manually](#managing-transactions-manually) + - [Using buckets](#using-buckets) + - [Using key/value pairs](#using-keyvalue-pairs) + - [Autoincrementing integer for the bucket](#autoincrementing-integer-for-the-bucket) + - [Iterating over keys](#iterating-over-keys) + - [Prefix scans](#prefix-scans) + - [Range scans](#range-scans) + - [ForEach()](#foreach) + - [Nested buckets](#nested-buckets) + - [Database backups](#database-backups) + - [Statistics](#statistics) + - [Read-Only Mode](#read-only-mode) + - [Mobile Use (iOS/Android)](#mobile-use-iosandroid) + - [Resources](#resources) + - [Comparison with other databases](#comparison-with-other-databases) + - [Postgres, MySQL, & other relational databases](#postgres-mysql--other-relational-databases) + - [LevelDB, RocksDB](#leveldb-rocksdb) + - [LMDB](#lmdb) + - [Caveats & Limitations](#caveats--limitations) + - [Reading the Source](#reading-the-source) + - [Other Projects Using Bolt](#other-projects-using-bolt) ## Getting Started @@ -59,13 +80,28 @@ Shopify and Heroku use Bolt-backed services every day. To start using Bolt, install Go and run `go get`: ```sh -$ go get github.com/boltdb/bolt/... +$ go get go.etcd.io/bbolt/... ``` This will retrieve the library and install the `bolt` command line utility into your `$GOBIN` path. +### Importing bbolt + +To use bbolt as an embedded key-value store, import as: + +```go +import bolt "go.etcd.io/bbolt" + +db, err := bolt.Open(path, 0666, nil) +if err != nil { + return err +} +defer db.Close() +``` + + ### Opening a database The top-level object in Bolt is a `DB`. It is represented as a single file on @@ -79,7 +115,7 @@ package main import ( "log" - "github.com/boltdb/bolt" + bolt "go.etcd.io/bbolt" ) func main() { @@ -395,7 +431,7 @@ db.View(func(tx *bolt.Tx) error { c := tx.Bucket([]byte("MyBucket")).Cursor() prefix := []byte("1234") - for k, v := c.Seek(prefix); bytes.HasPrefix(k, prefix); k, v = c.Next() { + for k, v := c.Seek(prefix); k != nil && bytes.HasPrefix(k, prefix); k, v = c.Next() { fmt.Printf("key=%s, value=%s\n", k, v) } @@ -464,6 +500,55 @@ func (*Bucket) CreateBucketIfNotExists(key []byte) (*Bucket, error) func (*Bucket) DeleteBucket(key []byte) error ``` +Say you had a multi-tenant application where the root level bucket was the account bucket. Inside of this bucket was a sequence of accounts which themselves are buckets. And inside the sequence bucket you could have many buckets pertaining to the Account itself (Users, Notes, etc) isolating the information into logical groupings. + +```go + +// createUser creates a new user in the given account. +func createUser(accountID int, u *User) error { + // Start the transaction. + tx, err := db.Begin(true) + if err != nil { + return err + } + defer tx.Rollback() + + // Retrieve the root bucket for the account. + // Assume this has already been created when the account was set up. + root := tx.Bucket([]byte(strconv.FormatUint(accountID, 10))) + + // Setup the users bucket. + bkt, err := root.CreateBucketIfNotExists([]byte("USERS")) + if err != nil { + return err + } + + // Generate an ID for the new user. + userID, err := bkt.NextSequence() + if err != nil { + return err + } + u.ID = userID + + // Marshal and save the encoded user. + if buf, err := json.Marshal(u); err != nil { + return err + } else if err := bkt.Put([]byte(strconv.FormatUint(u.ID, 10)), buf); err != nil { + return err + } + + // Commit the transaction. + if err := tx.Commit(); err != nil { + return err + } + + return nil +} + +``` + + + ### Database backups @@ -473,7 +558,7 @@ this from a read-only transaction, it will perform a hot backup and not block your other database reads and writes. By default, it will use a regular file handle which will utilize the operating -system's page cache. See the [`Tx`](https://godoc.org/github.com/boltdb/bolt#Tx) +system's page cache. See the [`Tx`](https://godoc.org/go.etcd.io/bbolt#Tx) documentation for information about optimizing for larger-than-RAM datasets. One common use case is to backup over HTTP so you can use tools like `cURL` to @@ -719,6 +804,9 @@ Here are a few things to note when evaluating and using Bolt: can be reused by a new page or can be unmapped from virtual memory and you'll see an `unexpected fault address` panic when accessing it. +* Bolt uses an exclusive write lock on the database file so it cannot be + shared by multiple processes. + * Be careful when using `Bucket.FillPercent`. Setting a high fill percent for buckets that have random inserts will cause your database to have very poor page utilization. @@ -759,7 +847,7 @@ Here are a few things to note when evaluating and using Bolt: ## Reading the Source -Bolt is a relatively small code base (<3KLOC) for an embedded, serializable, +Bolt is a relatively small code base (<5KLOC) for an embedded, serializable, transactional key/value database so it can be a good starting point for people interested in how databases work. @@ -811,47 +899,55 @@ them via pull request. Below is a list of public, open source projects that use Bolt: -* [BoltDbWeb](https://github.com/evnix/boltdbweb) - A web based GUI for BoltDB files. -* [Operation Go: A Routine Mission](http://gocode.io) - An online programming game for Golang using Bolt for user accounts and a leaderboard. +* [Algernon](https://github.com/xyproto/algernon) - A HTTP/2 web server with built-in support for Lua. Uses BoltDB as the default database backend. * [Bazil](https://bazil.org/) - A file system that lets your data reside where it is most convenient for it to reside. -* [DVID](https://github.com/janelia-flyem/dvid) - Added Bolt as optional storage engine and testing it against Basho-tuned leveldb. -* [Skybox Analytics](https://github.com/skybox/skybox) - A standalone funnel analysis tool for web analytics. -* [Scuttlebutt](https://github.com/benbjohnson/scuttlebutt) - Uses Bolt to store and process all Twitter mentions of GitHub projects. -* [Wiki](https://github.com/peterhellberg/wiki) - A tiny wiki using Goji, BoltDB and Blackfriday. +* [bolter](https://github.com/hasit/bolter) - Command-line app for viewing BoltDB file in your terminal. +* [boltcli](https://github.com/spacewander/boltcli) - the redis-cli for boltdb with Lua script support. +* [BoltHold](https://github.com/timshannon/bolthold) - An embeddable NoSQL store for Go types built on BoltDB +* [BoltStore](https://github.com/yosssi/boltstore) - Session store using Bolt. +* [Boltdb Boilerplate](https://github.com/bobintornado/boltdb-boilerplate) - Boilerplate wrapper around bolt aiming to make simple calls one-liners. +* [BoltDbWeb](https://github.com/evnix/boltdbweb) - A web based GUI for BoltDB files. +* [bleve](http://www.blevesearch.com/) - A pure Go search engine similar to ElasticSearch that uses Bolt as the default storage backend. +* [btcwallet](https://github.com/btcsuite/btcwallet) - A bitcoin wallet. +* [buckets](https://github.com/joyrexus/buckets) - a bolt wrapper streamlining + simple tx and key scans. +* [cayley](https://github.com/google/cayley) - Cayley is an open-source graph database using Bolt as optional backend. * [ChainStore](https://github.com/pressly/chainstore) - Simple key-value interface to a variety of storage engines organized as a chain of operations. -* [MetricBase](https://github.com/msiebuhr/MetricBase) - Single-binary version of Graphite. -* [Gitchain](https://github.com/gitchain/gitchain) - Decentralized, peer-to-peer Git repositories aka "Git meets Bitcoin". +* [Consul](https://github.com/hashicorp/consul) - Consul is service discovery and configuration made easy. Distributed, highly available, and datacenter-aware. +* [DVID](https://github.com/janelia-flyem/dvid) - Added Bolt as optional storage engine and testing it against Basho-tuned leveldb. +* [dcrwallet](https://github.com/decred/dcrwallet) - A wallet for the Decred cryptocurrency. +* [drive](https://github.com/odeke-em/drive) - drive is an unofficial Google Drive command line client for \*NIX operating systems. * [event-shuttle](https://github.com/sclasen/event-shuttle) - A Unix system service to collect and reliably deliver messages to Kafka. +* [Freehold](http://tshannon.bitbucket.org/freehold/) - An open, secure, and lightweight platform for your files and data. +* [Go Report Card](https://goreportcard.com/) - Go code quality report cards as a (free and open source) service. +* [GoWebApp](https://github.com/josephspurrier/gowebapp) - A basic MVC web application in Go using BoltDB. +* [GoShort](https://github.com/pankajkhairnar/goShort) - GoShort is a URL shortener written in Golang and BoltDB for persistent key/value storage and for routing it's using high performent HTTPRouter. +* [gopherpit](https://github.com/gopherpit/gopherpit) - A web service to manage Go remote import paths with custom domains +* [Gitchain](https://github.com/gitchain/gitchain) - Decentralized, peer-to-peer Git repositories aka "Git meets Bitcoin". +* [InfluxDB](https://influxdata.com) - Scalable datastore for metrics, events, and real-time analytics. +* [ipLocator](https://github.com/AndreasBriese/ipLocator) - A fast ip-geo-location-server using bolt with bloom filters. * [ipxed](https://github.com/kelseyhightower/ipxed) - Web interface and api for ipxed. -* [BoltStore](https://github.com/yosssi/boltstore) - Session store using Bolt. -* [photosite/session](https://godoc.org/bitbucket.org/kardianos/photosite/session) - Sessions for a photo viewing site. +* [Ironsmith](https://github.com/timshannon/ironsmith) - A simple, script-driven continuous integration (build - > test -> release) tool, with no external dependencies +* [Kala](https://github.com/ajvb/kala) - Kala is a modern job scheduler optimized to run on a single node. It is persistent, JSON over HTTP API, ISO 8601 duration notation, and dependent jobs. * [LedisDB](https://github.com/siddontang/ledisdb) - A high performance NoSQL, using Bolt as optional storage. -* [ipLocator](https://github.com/AndreasBriese/ipLocator) - A fast ip-geo-location-server using bolt with bloom filters. -* [cayley](https://github.com/google/cayley) - Cayley is an open-source graph database using Bolt as optional backend. -* [bleve](http://www.blevesearch.com/) - A pure Go search engine similar to ElasticSearch that uses Bolt as the default storage backend. -* [tentacool](https://github.com/optiflows/tentacool) - REST api server to manage system stuff (IP, DNS, Gateway...) on a linux server. -* [Seaweed File System](https://github.com/chrislusf/seaweedfs) - Highly scalable distributed key~file system with O(1) disk read. -* [InfluxDB](https://influxdata.com) - Scalable datastore for metrics, events, and real-time analytics. -* [Freehold](http://tshannon.bitbucket.org/freehold/) - An open, secure, and lightweight platform for your files and data. +* [lru](https://github.com/crowdriff/lru) - Easy to use Bolt-backed Least-Recently-Used (LRU) read-through cache with chainable remote stores. +* [mbuckets](https://github.com/abhigupta912/mbuckets) - A Bolt wrapper that allows easy operations on multi level (nested) buckets. +* [MetricBase](https://github.com/msiebuhr/MetricBase) - Single-binary version of Graphite. +* [MuLiFS](https://github.com/dankomiocevic/mulifs) - Music Library Filesystem creates a filesystem to organise your music files. +* [Operation Go: A Routine Mission](http://gocode.io) - An online programming game for Golang using Bolt for user accounts and a leaderboard. +* [photosite/session](https://godoc.org/bitbucket.org/kardianos/photosite/session) - Sessions for a photo viewing site. * [Prometheus Annotation Server](https://github.com/oliver006/prom_annotation_server) - Annotation server for PromDash & Prometheus service monitoring system. -* [Consul](https://github.com/hashicorp/consul) - Consul is service discovery and configuration made easy. Distributed, highly available, and datacenter-aware. -* [Kala](https://github.com/ajvb/kala) - Kala is a modern job scheduler optimized to run on a single node. It is persistent, JSON over HTTP API, ISO 8601 duration notation, and dependent jobs. -* [drive](https://github.com/odeke-em/drive) - drive is an unofficial Google Drive command line client for \*NIX operating systems. +* [reef-pi](https://github.com/reef-pi/reef-pi) - reef-pi is an award winning, modular, DIY reef tank controller using easy to learn electronics based on a Raspberry Pi. +* [Request Baskets](https://github.com/darklynx/request-baskets) - A web service to collect arbitrary HTTP requests and inspect them via REST API or simple web UI, similar to [RequestBin](http://requestb.in/) service +* [Seaweed File System](https://github.com/chrislusf/seaweedfs) - Highly scalable distributed key~file system with O(1) disk read. * [stow](https://github.com/djherbis/stow) - a persistence manager for objects backed by boltdb. -* [buckets](https://github.com/joyrexus/buckets) - a bolt wrapper streamlining - simple tx and key scans. -* [mbuckets](https://github.com/abhigupta912/mbuckets) - A Bolt wrapper that allows easy operations on multi level (nested) buckets. -* [Request Baskets](https://github.com/darklynx/request-baskets) - A web service to collect arbitrary HTTP requests and inspect them via REST API or simple web UI, similar to [RequestBin](http://requestb.in/) service -* [Go Report Card](https://goreportcard.com/) - Go code quality report cards as a (free and open source) service. -* [Boltdb Boilerplate](https://github.com/bobintornado/boltdb-boilerplate) - Boilerplate wrapper around bolt aiming to make simple calls one-liners. -* [lru](https://github.com/crowdriff/lru) - Easy to use Bolt-backed Least-Recently-Used (LRU) read-through cache with chainable remote stores. * [Storm](https://github.com/asdine/storm) - Simple and powerful ORM for BoltDB. -* [GoWebApp](https://github.com/josephspurrier/gowebapp) - A basic MVC web application in Go using BoltDB. * [SimpleBolt](https://github.com/xyproto/simplebolt) - A simple way to use BoltDB. Deals mainly with strings. -* [Algernon](https://github.com/xyproto/algernon) - A HTTP/2 web server with built-in support for Lua. Uses BoltDB as the default database backend. -* [MuLiFS](https://github.com/dankomiocevic/mulifs) - Music Library Filesystem creates a filesystem to organise your music files. -* [GoShort](https://github.com/pankajkhairnar/goShort) - GoShort is a URL shortener written in Golang and BoltDB for persistent key/value storage and for routing it's using high performent HTTPRouter. +* [Skybox Analytics](https://github.com/skybox/skybox) - A standalone funnel analysis tool for web analytics. +* [Scuttlebutt](https://github.com/benbjohnson/scuttlebutt) - Uses Bolt to store and process all Twitter mentions of GitHub projects. +* [tentacool](https://github.com/optiflows/tentacool) - REST api server to manage system stuff (IP, DNS, Gateway...) on a linux server. * [torrent](https://github.com/anacrolix/torrent) - Full-featured BitTorrent client package and utilities in Go. BoltDB is a storage backend in development. +* [Wiki](https://github.com/peterhellberg/wiki) - A tiny wiki using Goji, BoltDB and Blackfriday. If you are using Bolt in a project please send a pull request to add it to the list. diff --git a/vendor/github.com/boltdb/bolt/bolt_386.go b/vendor/go.etcd.io/bbolt/bolt_386.go similarity index 95% rename from vendor/github.com/boltdb/bolt/bolt_386.go rename to vendor/go.etcd.io/bbolt/bolt_386.go index 820d533c15..4d35ee7cf3 100644 --- a/vendor/github.com/boltdb/bolt/bolt_386.go +++ b/vendor/go.etcd.io/bbolt/bolt_386.go @@ -1,4 +1,4 @@ -package bolt +package bbolt // maxMapSize represents the largest mmap size supported by Bolt. const maxMapSize = 0x7FFFFFFF // 2GB diff --git a/vendor/github.com/boltdb/bolt/bolt_amd64.go b/vendor/go.etcd.io/bbolt/bolt_amd64.go similarity index 95% rename from vendor/github.com/boltdb/bolt/bolt_amd64.go rename to vendor/go.etcd.io/bbolt/bolt_amd64.go index 98fafdb47d..60a52dad56 100644 --- a/vendor/github.com/boltdb/bolt/bolt_amd64.go +++ b/vendor/go.etcd.io/bbolt/bolt_amd64.go @@ -1,4 +1,4 @@ -package bolt +package bbolt // maxMapSize represents the largest mmap size supported by Bolt. const maxMapSize = 0xFFFFFFFFFFFF // 256TB diff --git a/vendor/github.com/boltdb/bolt/bolt_arm.go b/vendor/go.etcd.io/bbolt/bolt_arm.go similarity index 98% rename from vendor/github.com/boltdb/bolt/bolt_arm.go rename to vendor/go.etcd.io/bbolt/bolt_arm.go index 7e5cb4b941..105d27ddb7 100644 --- a/vendor/github.com/boltdb/bolt/bolt_arm.go +++ b/vendor/go.etcd.io/bbolt/bolt_arm.go @@ -1,4 +1,4 @@ -package bolt +package bbolt import "unsafe" diff --git a/vendor/github.com/boltdb/bolt/bolt_arm64.go b/vendor/go.etcd.io/bbolt/bolt_arm64.go similarity index 95% rename from vendor/github.com/boltdb/bolt/bolt_arm64.go rename to vendor/go.etcd.io/bbolt/bolt_arm64.go index b26d84f91b..f5aa2a5ee2 100644 --- a/vendor/github.com/boltdb/bolt/bolt_arm64.go +++ b/vendor/go.etcd.io/bbolt/bolt_arm64.go @@ -1,6 +1,6 @@ // +build arm64 -package bolt +package bbolt // maxMapSize represents the largest mmap size supported by Bolt. const maxMapSize = 0xFFFFFFFFFFFF // 256TB diff --git a/vendor/github.com/boltdb/bolt/bolt_linux.go b/vendor/go.etcd.io/bbolt/bolt_linux.go similarity index 91% rename from vendor/github.com/boltdb/bolt/bolt_linux.go rename to vendor/go.etcd.io/bbolt/bolt_linux.go index 2b67666140..7707bcacf0 100644 --- a/vendor/github.com/boltdb/bolt/bolt_linux.go +++ b/vendor/go.etcd.io/bbolt/bolt_linux.go @@ -1,4 +1,4 @@ -package bolt +package bbolt import ( "syscall" diff --git a/vendor/go.etcd.io/bbolt/bolt_mips64x.go b/vendor/go.etcd.io/bbolt/bolt_mips64x.go new file mode 100644 index 0000000000..baeb289fd9 --- /dev/null +++ b/vendor/go.etcd.io/bbolt/bolt_mips64x.go @@ -0,0 +1,12 @@ +// +build mips64 mips64le + +package bbolt + +// maxMapSize represents the largest mmap size supported by Bolt. +const maxMapSize = 0x8000000000 // 512GB + +// maxAllocSize is the size used when creating array pointers. +const maxAllocSize = 0x7FFFFFFF + +// Are unaligned load/stores broken on this arch? +var brokenUnaligned = false diff --git a/vendor/go.etcd.io/bbolt/bolt_mipsx.go b/vendor/go.etcd.io/bbolt/bolt_mipsx.go new file mode 100644 index 0000000000..2d9b1a91f3 --- /dev/null +++ b/vendor/go.etcd.io/bbolt/bolt_mipsx.go @@ -0,0 +1,12 @@ +// +build mips mipsle + +package bbolt + +// maxMapSize represents the largest mmap size supported by Bolt. +const maxMapSize = 0x40000000 // 1GB + +// maxAllocSize is the size used when creating array pointers. +const maxAllocSize = 0xFFFFFFF + +// Are unaligned load/stores broken on this arch? +var brokenUnaligned = false diff --git a/vendor/github.com/boltdb/bolt/bolt_openbsd.go b/vendor/go.etcd.io/bbolt/bolt_openbsd.go similarity index 97% rename from vendor/github.com/boltdb/bolt/bolt_openbsd.go rename to vendor/go.etcd.io/bbolt/bolt_openbsd.go index 7058c3d734..d7f50358ef 100644 --- a/vendor/github.com/boltdb/bolt/bolt_openbsd.go +++ b/vendor/go.etcd.io/bbolt/bolt_openbsd.go @@ -1,4 +1,4 @@ -package bolt +package bbolt import ( "syscall" diff --git a/vendor/github.com/boltdb/bolt/bolt_ppc.go b/vendor/go.etcd.io/bbolt/bolt_ppc.go similarity index 69% rename from vendor/github.com/boltdb/bolt/bolt_ppc.go rename to vendor/go.etcd.io/bbolt/bolt_ppc.go index 645ddc3edc..69804714aa 100644 --- a/vendor/github.com/boltdb/bolt/bolt_ppc.go +++ b/vendor/go.etcd.io/bbolt/bolt_ppc.go @@ -1,9 +1,12 @@ // +build ppc -package bolt +package bbolt // maxMapSize represents the largest mmap size supported by Bolt. const maxMapSize = 0x7FFFFFFF // 2GB // maxAllocSize is the size used when creating array pointers. const maxAllocSize = 0xFFFFFFF + +// Are unaligned load/stores broken on this arch? +var brokenUnaligned = false diff --git a/vendor/github.com/boltdb/bolt/bolt_ppc64.go b/vendor/go.etcd.io/bbolt/bolt_ppc64.go similarity index 70% rename from vendor/github.com/boltdb/bolt/bolt_ppc64.go rename to vendor/go.etcd.io/bbolt/bolt_ppc64.go index 2dc6be02e3..3565908576 100644 --- a/vendor/github.com/boltdb/bolt/bolt_ppc64.go +++ b/vendor/go.etcd.io/bbolt/bolt_ppc64.go @@ -1,9 +1,12 @@ // +build ppc64 -package bolt +package bbolt // maxMapSize represents the largest mmap size supported by Bolt. const maxMapSize = 0xFFFFFFFFFFFF // 256TB // maxAllocSize is the size used when creating array pointers. const maxAllocSize = 0x7FFFFFFF + +// Are unaligned load/stores broken on this arch? +var brokenUnaligned = false diff --git a/vendor/github.com/boltdb/bolt/bolt_ppc64le.go b/vendor/go.etcd.io/bbolt/bolt_ppc64le.go similarity index 95% rename from vendor/github.com/boltdb/bolt/bolt_ppc64le.go rename to vendor/go.etcd.io/bbolt/bolt_ppc64le.go index 8c143bc5d1..422c7c69d6 100644 --- a/vendor/github.com/boltdb/bolt/bolt_ppc64le.go +++ b/vendor/go.etcd.io/bbolt/bolt_ppc64le.go @@ -1,6 +1,6 @@ // +build ppc64le -package bolt +package bbolt // maxMapSize represents the largest mmap size supported by Bolt. const maxMapSize = 0xFFFFFFFFFFFF // 256TB diff --git a/vendor/github.com/boltdb/bolt/bolt_s390x.go b/vendor/go.etcd.io/bbolt/bolt_s390x.go similarity index 95% rename from vendor/github.com/boltdb/bolt/bolt_s390x.go rename to vendor/go.etcd.io/bbolt/bolt_s390x.go index d7c39af925..6d3fcb825d 100644 --- a/vendor/github.com/boltdb/bolt/bolt_s390x.go +++ b/vendor/go.etcd.io/bbolt/bolt_s390x.go @@ -1,6 +1,6 @@ // +build s390x -package bolt +package bbolt // maxMapSize represents the largest mmap size supported by Bolt. const maxMapSize = 0xFFFFFFFFFFFF // 256TB diff --git a/vendor/github.com/boltdb/bolt/bolt_unix.go b/vendor/go.etcd.io/bbolt/bolt_unix.go similarity index 71% rename from vendor/github.com/boltdb/bolt/bolt_unix.go rename to vendor/go.etcd.io/bbolt/bolt_unix.go index cad62dda1e..5f2bb51451 100644 --- a/vendor/github.com/boltdb/bolt/bolt_unix.go +++ b/vendor/go.etcd.io/bbolt/bolt_unix.go @@ -1,41 +1,43 @@ // +build !windows,!plan9,!solaris -package bolt +package bbolt import ( "fmt" - "os" "syscall" "time" "unsafe" ) // flock acquires an advisory lock on a file descriptor. -func flock(db *DB, mode os.FileMode, exclusive bool, timeout time.Duration) error { +func flock(db *DB, exclusive bool, timeout time.Duration) error { var t time.Time + if timeout != 0 { + t = time.Now() + } + fd := db.file.Fd() + flag := syscall.LOCK_NB + if exclusive { + flag |= syscall.LOCK_EX + } else { + flag |= syscall.LOCK_SH + } for { - // If we're beyond our timeout then return an error. - // This can only occur after we've attempted a flock once. - if t.IsZero() { - t = time.Now() - } else if timeout > 0 && time.Since(t) > timeout { - return ErrTimeout - } - flag := syscall.LOCK_SH - if exclusive { - flag = syscall.LOCK_EX - } - - // Otherwise attempt to obtain an exclusive lock. - err := syscall.Flock(int(db.file.Fd()), flag|syscall.LOCK_NB) + // Attempt to obtain an exclusive lock. + err := syscall.Flock(int(fd), flag) if err == nil { return nil } else if err != syscall.EWOULDBLOCK { return err } + // If we timed out then return an error. + if timeout != 0 && time.Since(t) > timeout-flockRetryTimeout { + return ErrTimeout + } + // Wait for a bit and try again. - time.Sleep(50 * time.Millisecond) + time.Sleep(flockRetryTimeout) } } @@ -53,7 +55,9 @@ func mmap(db *DB, sz int) error { } // Advise the kernel that the mmap is accessed randomly. - if err := madvise(b, syscall.MADV_RANDOM); err != nil { + err = madvise(b, syscall.MADV_RANDOM) + if err != nil && err != syscall.ENOSYS { + // Ignore not implemented error in kernel because it still works. return fmt.Errorf("madvise: %s", err) } diff --git a/vendor/github.com/boltdb/bolt/bolt_unix_solaris.go b/vendor/go.etcd.io/bbolt/bolt_unix_solaris.go similarity index 70% rename from vendor/github.com/boltdb/bolt/bolt_unix_solaris.go rename to vendor/go.etcd.io/bbolt/bolt_unix_solaris.go index 307bf2b3ee..babad65786 100644 --- a/vendor/github.com/boltdb/bolt/bolt_unix_solaris.go +++ b/vendor/go.etcd.io/bbolt/bolt_unix_solaris.go @@ -1,8 +1,7 @@ -package bolt +package bbolt import ( "fmt" - "os" "syscall" "time" "unsafe" @@ -11,36 +10,35 @@ import ( ) // flock acquires an advisory lock on a file descriptor. -func flock(db *DB, mode os.FileMode, exclusive bool, timeout time.Duration) error { +func flock(db *DB, exclusive bool, timeout time.Duration) error { var t time.Time + if timeout != 0 { + t = time.Now() + } + fd := db.file.Fd() + var lockType int16 + if exclusive { + lockType = syscall.F_WRLCK + } else { + lockType = syscall.F_RDLCK + } for { - // If we're beyond our timeout then return an error. - // This can only occur after we've attempted a flock once. - if t.IsZero() { - t = time.Now() - } else if timeout > 0 && time.Since(t) > timeout { - return ErrTimeout - } - var lock syscall.Flock_t - lock.Start = 0 - lock.Len = 0 - lock.Pid = 0 - lock.Whence = 0 - lock.Pid = 0 - if exclusive { - lock.Type = syscall.F_WRLCK - } else { - lock.Type = syscall.F_RDLCK - } - err := syscall.FcntlFlock(db.file.Fd(), syscall.F_SETLK, &lock) + // Attempt to obtain an exclusive lock. + lock := syscall.Flock_t{Type: lockType} + err := syscall.FcntlFlock(fd, syscall.F_SETLK, &lock) if err == nil { return nil } else if err != syscall.EAGAIN { return err } + // If we timed out then return an error. + if timeout != 0 && time.Since(t) > timeout-flockRetryTimeout { + return ErrTimeout + } + // Wait for a bit and try again. - time.Sleep(50 * time.Millisecond) + time.Sleep(flockRetryTimeout) } } diff --git a/vendor/github.com/boltdb/bolt/bolt_windows.go b/vendor/go.etcd.io/bbolt/bolt_windows.go similarity index 76% rename from vendor/github.com/boltdb/bolt/bolt_windows.go rename to vendor/go.etcd.io/bbolt/bolt_windows.go index d538e6afd7..fca178bd29 100644 --- a/vendor/github.com/boltdb/bolt/bolt_windows.go +++ b/vendor/go.etcd.io/bbolt/bolt_windows.go @@ -1,4 +1,4 @@ -package bolt +package bbolt import ( "fmt" @@ -16,8 +16,6 @@ var ( ) const ( - lockExt = ".lock" - // see https://msdn.microsoft.com/en-us/library/windows/desktop/aa365203(v=vs.85).aspx flagLockExclusive = 2 flagLockFailImmediately = 1 @@ -48,48 +46,47 @@ func fdatasync(db *DB) error { } // flock acquires an advisory lock on a file descriptor. -func flock(db *DB, mode os.FileMode, exclusive bool, timeout time.Duration) error { - // Create a separate lock file on windows because a process - // cannot share an exclusive lock on the same file. This is - // needed during Tx.WriteTo(). - f, err := os.OpenFile(db.path+lockExt, os.O_CREATE, mode) - if err != nil { - return err - } - db.lockfile = f - +func flock(db *DB, exclusive bool, timeout time.Duration) error { var t time.Time + if timeout != 0 { + t = time.Now() + } + var flag uint32 = flagLockFailImmediately + if exclusive { + flag |= flagLockExclusive + } for { - // If we're beyond our timeout then return an error. - // This can only occur after we've attempted a flock once. - if t.IsZero() { - t = time.Now() - } else if timeout > 0 && time.Since(t) > timeout { - return ErrTimeout - } - - var flag uint32 = flagLockFailImmediately - if exclusive { - flag |= flagLockExclusive - } + // Fix for https://github.com/etcd-io/bbolt/issues/121. Use byte-range + // -1..0 as the lock on the database file. + var m1 uint32 = (1 << 32) - 1 // -1 in a uint32 + err := lockFileEx(syscall.Handle(db.file.Fd()), flag, 0, 1, 0, &syscall.Overlapped{ + Offset: m1, + OffsetHigh: m1, + }) - err := lockFileEx(syscall.Handle(db.lockfile.Fd()), flag, 0, 1, 0, &syscall.Overlapped{}) if err == nil { return nil } else if err != errLockViolation { return err } + // If we timed oumercit then return an error. + if timeout != 0 && time.Since(t) > timeout-flockRetryTimeout { + return ErrTimeout + } + // Wait for a bit and try again. - time.Sleep(50 * time.Millisecond) + time.Sleep(flockRetryTimeout) } } // funlock releases an advisory lock on a file descriptor. func funlock(db *DB) error { - err := unlockFileEx(syscall.Handle(db.lockfile.Fd()), 0, 1, 0, &syscall.Overlapped{}) - db.lockfile.Close() - os.Remove(db.path+lockExt) + var m1 uint32 = (1 << 32) - 1 // -1 in a uint32 + err := unlockFileEx(syscall.Handle(db.file.Fd()), 0, 1, 0, &syscall.Overlapped{ + Offset: m1, + OffsetHigh: m1, + }) return err } diff --git a/vendor/github.com/boltdb/bolt/boltsync_unix.go b/vendor/go.etcd.io/bbolt/boltsync_unix.go similarity index 91% rename from vendor/github.com/boltdb/bolt/boltsync_unix.go rename to vendor/go.etcd.io/bbolt/boltsync_unix.go index f50442523c..9587afefee 100644 --- a/vendor/github.com/boltdb/bolt/boltsync_unix.go +++ b/vendor/go.etcd.io/bbolt/boltsync_unix.go @@ -1,6 +1,6 @@ // +build !windows,!plan9,!linux,!openbsd -package bolt +package bbolt // fdatasync flushes written data to a file descriptor. func fdatasync(db *DB) error { diff --git a/vendor/github.com/boltdb/bolt/bucket.go b/vendor/go.etcd.io/bbolt/bucket.go similarity index 99% rename from vendor/github.com/boltdb/bolt/bucket.go rename to vendor/go.etcd.io/bbolt/bucket.go index 511ce72d33..84bfd4d6a2 100644 --- a/vendor/github.com/boltdb/bolt/bucket.go +++ b/vendor/go.etcd.io/bbolt/bucket.go @@ -1,4 +1,4 @@ -package bolt +package bbolt import ( "bytes" @@ -14,13 +14,6 @@ const ( MaxValueSize = (1 << 31) - 2 ) -const ( - maxUint = ^uint(0) - minUint = 0 - maxInt = int(^uint(0) >> 1) - minInt = -maxInt - 1 -) - const bucketHeaderSize = int(unsafe.Sizeof(bucket{})) const ( @@ -175,9 +168,8 @@ func (b *Bucket) CreateBucket(key []byte) (*Bucket, error) { if bytes.Equal(key, k) { if (flags & bucketLeafFlag) != 0 { return nil, ErrBucketExists - } else { - return nil, ErrIncompatibleValue } + return nil, ErrIncompatibleValue } // Create empty, inline bucket. @@ -324,7 +316,12 @@ func (b *Bucket) Delete(key []byte) error { // Move cursor to correct position. c := b.Cursor() - _, _, flags := c.seek(key) + k, _, flags := c.seek(key) + + // Return nil if the key doesn't exist. + if !bytes.Equal(key, k) { + return nil + } // Return an error if there is already existing bucket value. if (flags & bucketLeafFlag) != 0 { diff --git a/vendor/github.com/boltdb/bolt/cursor.go b/vendor/go.etcd.io/bbolt/cursor.go similarity index 99% rename from vendor/github.com/boltdb/bolt/cursor.go rename to vendor/go.etcd.io/bbolt/cursor.go index 1be9f35e3e..3000aced6c 100644 --- a/vendor/github.com/boltdb/bolt/cursor.go +++ b/vendor/go.etcd.io/bbolt/cursor.go @@ -1,4 +1,4 @@ -package bolt +package bbolt import ( "bytes" @@ -157,12 +157,6 @@ func (c *Cursor) seek(seek []byte) (key []byte, value []byte, flags uint32) { // Start from root page/node and traverse to correct page. c.stack = c.stack[:0] c.search(seek, c.bucket.root) - ref := &c.stack[len(c.stack)-1] - - // If the cursor is pointing to the end of page/node then return nil. - if ref.index >= ref.count() { - return nil, nil, 0 - } // If this is a bucket then return a nil value. return c.keyValue() @@ -339,6 +333,8 @@ func (c *Cursor) nsearch(key []byte) { // keyValue returns the key and value of the current leaf element. func (c *Cursor) keyValue() ([]byte, []byte, uint32) { ref := &c.stack[len(c.stack)-1] + + // If the cursor is pointing to the end of page/node then return nil. if ref.count() == 0 || ref.index >= ref.count() { return nil, nil, 0 } diff --git a/vendor/github.com/boltdb/bolt/db.go b/vendor/go.etcd.io/bbolt/db.go similarity index 84% rename from vendor/github.com/boltdb/bolt/db.go rename to vendor/go.etcd.io/bbolt/db.go index 1223493ca7..d91dcf813a 100644 --- a/vendor/github.com/boltdb/bolt/db.go +++ b/vendor/go.etcd.io/bbolt/db.go @@ -1,4 +1,4 @@ -package bolt +package bbolt import ( "errors" @@ -7,8 +7,7 @@ import ( "log" "os" "runtime" - "runtime/debug" - "strings" + "sort" "sync" "time" "unsafe" @@ -23,6 +22,8 @@ const version = 2 // Represents a marker value to indicate that a file is a Bolt DB. const magic uint32 = 0xED0CDAED +const pgidNoFreelist pgid = 0xffffffffffffffff + // IgnoreNoSync specifies whether the NoSync field of a DB is ignored when // syncing changes to a file. This is required as some operating systems, // such as OpenBSD, do not have a unified buffer cache (UBC) and writes @@ -39,6 +40,9 @@ const ( // default page size for db is set to the OS page size. var defaultPageSize = os.Getpagesize() +// The time elapsed between consecutive file locking attempts. +const flockRetryTimeout = 50 * time.Millisecond + // DB represents a collection of buckets persisted to a file on disk. // All data access is performed through transactions which can be obtained through the DB. // All the functions on DB will return a ErrDatabaseNotOpen if accessed before Open() is called. @@ -61,6 +65,11 @@ type DB struct { // THIS IS UNSAFE. PLEASE USE WITH CAUTION. NoSync bool + // When true, skips syncing freelist to disk. This improves the database + // write performance under normal operation, but requires a full database + // re-sync during recovery. + NoFreelistSync bool + // When true, skips the truncate call when growing the database. // Setting this to true is only safe on non-ext3/ext4 systems. // Skipping truncation avoids preallocation of hard drive space and @@ -96,8 +105,7 @@ type DB struct { path string file *os.File - lockfile *os.File // windows only - dataref []byte // mmap'ed readonly, write throws SEGV + dataref []byte // mmap'ed readonly, write throws SEGV data *[maxMapSize]byte datasz int filesz int // current on disk file size @@ -107,9 +115,11 @@ type DB struct { opened bool rwtx *Tx txs []*Tx - freelist *freelist stats Stats + freelist *freelist + freelistLoad sync.Once + pagePool sync.Pool batchMu sync.Mutex @@ -148,14 +158,17 @@ func (db *DB) String() string { // If the file does not exist then it will be created automatically. // Passing in nil options will cause Bolt to open the database with the default options. func Open(path string, mode os.FileMode, options *Options) (*DB, error) { - var db = &DB{opened: true} - + db := &DB{ + opened: true, + } // Set default options if no options are provided. if options == nil { options = DefaultOptions } + db.NoSync = options.NoSync db.NoGrowSync = options.NoGrowSync db.MmapFlags = options.MmapFlags + db.NoFreelistSync = options.NoFreelistSync // Set default values for later DB operations. db.MaxBatchSize = DefaultMaxBatchSize @@ -183,7 +196,7 @@ func Open(path string, mode os.FileMode, options *Options) (*DB, error) { // if !options.ReadOnly. // The database file is locked using the shared lock (more than one process may // hold a lock at the same time) otherwise (options.ReadOnly is set). - if err := flock(db, mode, !db.readOnly, options.Timeout); err != nil { + if err := flock(db, !db.readOnly, options.Timeout); err != nil { _ = db.close() return nil, err } @@ -191,31 +204,41 @@ func Open(path string, mode os.FileMode, options *Options) (*DB, error) { // Default values for test hooks db.ops.writeAt = db.file.WriteAt + if db.pageSize = options.PageSize; db.pageSize == 0 { + // Set the default page size to the OS page size. + db.pageSize = defaultPageSize + } + // Initialize the database if it doesn't exist. if info, err := db.file.Stat(); err != nil { + _ = db.close() return nil, err } else if info.Size() == 0 { // Initialize new files with meta pages. if err := db.init(); err != nil { + // clean up file descriptor on initialization fail + _ = db.close() return nil, err } } else { // Read the first meta page to determine the page size. var buf [0x1000]byte - if _, err := db.file.ReadAt(buf[:], 0); err == nil { - m := db.pageInBuffer(buf[:], 0).meta() - if err := m.validate(); err != nil { - // If we can't read the page size, we can assume it's the same - // as the OS -- since that's how the page size was chosen in the - // first place. - // - // If the first page is invalid and this OS uses a different - // page size than what the database was created with then we - // are out of luck and cannot access the database. - db.pageSize = os.Getpagesize() - } else { + // If we can't read the page size, but can read a page, assume + // it's the same as the OS or one given -- since that's how the + // page size was chosen in the first place. + // + // If the first page is invalid and this OS uses a different + // page size than what the database was created with then we + // are out of luck and cannot access the database. + // + // TODO: scan for next page + if bw, err := db.file.ReadAt(buf[:], 0); err == nil && bw == len(buf) { + if m := db.pageInBuffer(buf[:], 0).meta(); m.validate() == nil { db.pageSize = int(m.pageSize) } + } else { + _ = db.close() + return nil, ErrInvalid } } @@ -232,14 +255,50 @@ func Open(path string, mode os.FileMode, options *Options) (*DB, error) { return nil, err } - // Read in the freelist. - db.freelist = newFreelist() - db.freelist.read(db.page(db.meta().freelist)) + if db.readOnly { + return db, nil + } + + db.loadFreelist() + + // Flush freelist when transitioning from no sync to sync so + // NoFreelistSync unaware boltdb can open the db later. + if !db.NoFreelistSync && !db.hasSyncedFreelist() { + tx, err := db.Begin(true) + if tx != nil { + err = tx.Commit() + } + if err != nil { + _ = db.close() + return nil, err + } + } // Mark the database as opened and return. return db, nil } +// loadFreelist reads the freelist if it is synced, or reconstructs it +// by scanning the DB if it is not synced. It assumes there are no +// concurrent accesses being made to the freelist. +func (db *DB) loadFreelist() { + db.freelistLoad.Do(func() { + db.freelist = newFreelist() + if !db.hasSyncedFreelist() { + // Reconstruct free list by scanning the DB. + db.freelist.readIDs(db.freepages()) + } else { + // Read free list from freelist page. + db.freelist.read(db.page(db.meta().freelist)) + } + db.stats.FreePageN = len(db.freelist.ids) + }) +} + +func (db *DB) hasSyncedFreelist() bool { + return db.meta().freelist != pgidNoFreelist +} + // mmap opens the underlying memory-mapped file and initializes the meta references. // minsz is the minimum size that the new mmap can be. func (db *DB) mmap(minsz int) error { @@ -341,9 +400,6 @@ func (db *DB) mmapSize(size int) (int, error) { // init creates a new database file and initializes its meta pages. func (db *DB) init() error { - // Set the page size to the OS page size. - db.pageSize = os.Getpagesize() - // Create two meta pages on a buffer. buf := make([]byte, db.pageSize*4) for i := 0; i < 2; i++ { @@ -387,7 +443,8 @@ func (db *DB) init() error { } // Close releases all database resources. -// All transactions must be closed before closing the database. +// It will block waiting for any open transactions to finish +// before closing the database and returning. func (db *DB) Close() error { db.rwlock.Lock() defer db.rwlock.Unlock() @@ -395,8 +452,8 @@ func (db *DB) Close() error { db.metalock.Lock() defer db.metalock.Unlock() - db.mmaplock.RLock() - defer db.mmaplock.RUnlock() + db.mmaplock.Lock() + defer db.mmaplock.Unlock() return db.close() } @@ -526,21 +583,36 @@ func (db *DB) beginRWTx() (*Tx, error) { t := &Tx{writable: true} t.init(db) db.rwtx = t + db.freePages() + return t, nil +} - // Free any pages associated with closed read-only transactions. - var minid txid = 0xFFFFFFFFFFFFFFFF - for _, t := range db.txs { - if t.meta.txid < minid { - minid = t.meta.txid - } +// freePages releases any pages associated with closed read-only transactions. +func (db *DB) freePages() { + // Free all pending pages prior to earliest open transaction. + sort.Sort(txsById(db.txs)) + minid := txid(0xFFFFFFFFFFFFFFFF) + if len(db.txs) > 0 { + minid = db.txs[0].meta.txid } if minid > 0 { db.freelist.release(minid - 1) } - - return t, nil + // Release unused txid extents. + for _, t := range db.txs { + db.freelist.releaseRange(minid, t.meta.txid-1) + minid = t.meta.txid + 1 + } + db.freelist.releaseRange(minid, txid(0xFFFFFFFFFFFFFFFF)) + // Any page both allocated and freed in an extent is safe to release. } +type txsById []*Tx + +func (t txsById) Len() int { return len(t) } +func (t txsById) Swap(i, j int) { t[i], t[j] = t[j], t[i] } +func (t txsById) Less(i, j int) bool { return t[i].meta.txid < t[j].meta.txid } + // removeTx removes a transaction from the database. func (db *DB) removeTx(tx *Tx) { // Release the read lock on the mmap. @@ -552,7 +624,10 @@ func (db *DB) removeTx(tx *Tx) { // Remove the transaction. for i, t := range db.txs { if t == tx { - db.txs = append(db.txs[:i], db.txs[i+1:]...) + last := len(db.txs) - 1 + db.txs[i] = db.txs[last] + db.txs[last] = nil + db.txs = db.txs[:last] break } } @@ -630,11 +705,7 @@ func (db *DB) View(fn func(*Tx) error) error { return err } - if err := t.Rollback(); err != nil { - return err - } - - return nil + return t.Rollback() } // Batch calls fn as part of a batch. It behaves similar to Update, @@ -734,9 +805,7 @@ retry: // pass success, or bolt internal errors, to all callers for _, c := range b.calls { - if c.err != nil { - c.err <- err - } + c.err <- err } break retry } @@ -823,7 +892,7 @@ func (db *DB) meta() *meta { } // allocate returns a contiguous block of memory starting at a given page. -func (db *DB) allocate(count int) (*page, error) { +func (db *DB) allocate(txid txid, count int) (*page, error) { // Allocate a temporary buffer for the page. var buf []byte if count == 1 { @@ -835,7 +904,7 @@ func (db *DB) allocate(count int) (*page, error) { p.overflow = uint32(count - 1) // Use pages from the freelist if they are available. - if p.id = db.freelist.allocate(count); p.id != 0 { + if p.id = db.freelist.allocate(txid, count); p.id != 0 { return p, nil } @@ -890,6 +959,38 @@ func (db *DB) IsReadOnly() bool { return db.readOnly } +func (db *DB) freepages() []pgid { + tx, err := db.beginTx() + defer func() { + err = tx.Rollback() + if err != nil { + panic("freepages: failed to rollback tx") + } + }() + if err != nil { + panic("freepages: failed to open read only tx") + } + + reachable := make(map[pgid]*page) + nofreed := make(map[pgid]bool) + ech := make(chan error) + go func() { + for e := range ech { + panic(fmt.Sprintf("freepages: failed to get all reachable pages (%v)", e)) + } + }() + tx.checkBucket(&tx.root, reachable, nofreed, ech) + close(ech) + + var fids []pgid + for i := pgid(2); i < db.meta().pgid; i++ { + if _, ok := reachable[i]; !ok { + fids = append(fids, i) + } + } + return fids +} + // Options represents the options that can be set when opening a database. type Options struct { // Timeout is the amount of time to wait to obtain a file lock. @@ -900,6 +1001,10 @@ type Options struct { // Sets the DB.NoGrowSync flag before memory mapping the file. NoGrowSync bool + // Do not sync freelist to disk. This improves the database write performance + // under normal operation, but requires a full database re-sync during recovery. + NoFreelistSync bool + // Open database in read-only mode. Uses flock(..., LOCK_SH |LOCK_NB) to // grab a shared lock (UNIX). ReadOnly bool @@ -916,6 +1021,14 @@ type Options struct { // If initialMmapSize is smaller than the previous database size, // it takes no effect. InitialMmapSize int + + // PageSize overrides the default OS page size. + PageSize int + + // NoSync sets the initial value of DB.NoSync. Normally this can just be + // set directly on the DB itself when returned from Open(), but this option + // is useful in APIs which expose Options but not the underlying DB. + NoSync bool } // DefaultOptions represent the options used if nil options are passed into Open(). @@ -952,15 +1065,11 @@ func (s *Stats) Sub(other *Stats) Stats { diff.PendingPageN = s.PendingPageN diff.FreeAlloc = s.FreeAlloc diff.FreelistInuse = s.FreelistInuse - diff.TxN = other.TxN - s.TxN + diff.TxN = s.TxN - other.TxN diff.TxStats = s.TxStats.Sub(&other.TxStats) return diff } -func (s *Stats) add(other *Stats) { - s.TxStats.add(&other.TxStats) -} - type Info struct { Data uintptr PageSize int @@ -999,7 +1108,8 @@ func (m *meta) copy(dest *meta) { func (m *meta) write(p *page) { if m.root.root >= m.pgid { panic(fmt.Sprintf("root bucket pgid (%d) above high water mark (%d)", m.root.root, m.pgid)) - } else if m.freelist >= m.pgid { + } else if m.freelist >= m.pgid && m.freelist != pgidNoFreelist { + // TODO: reject pgidNoFreeList if !NoFreelistSync panic(fmt.Sprintf("freelist pgid (%d) above high water mark (%d)", m.freelist, m.pgid)) } @@ -1026,11 +1136,3 @@ func _assert(condition bool, msg string, v ...interface{}) { panic(fmt.Sprintf("assertion failed: "+msg, v...)) } } - -func warn(v ...interface{}) { fmt.Fprintln(os.Stderr, v...) } -func warnf(msg string, v ...interface{}) { fmt.Fprintf(os.Stderr, msg+"\n", v...) } - -func printstack() { - stack := strings.Join(strings.Split(string(debug.Stack()), "\n")[2:], "\n") - fmt.Fprintln(os.Stderr, stack) -} diff --git a/vendor/github.com/boltdb/bolt/doc.go b/vendor/go.etcd.io/bbolt/doc.go similarity index 94% rename from vendor/github.com/boltdb/bolt/doc.go rename to vendor/go.etcd.io/bbolt/doc.go index cc937845db..95f25f01c6 100644 --- a/vendor/github.com/boltdb/bolt/doc.go +++ b/vendor/go.etcd.io/bbolt/doc.go @@ -1,5 +1,5 @@ /* -Package bolt implements a low-level key/value store in pure Go. It supports +package bbolt implements a low-level key/value store in pure Go. It supports fully serializable transactions, ACID semantics, and lock-free MVCC with multiple readers and a single writer. Bolt can be used for projects that want a simple data store without the need to add large dependencies such as @@ -41,4 +41,4 @@ point to different data or can point to invalid memory which will cause a panic. */ -package bolt +package bbolt diff --git a/vendor/github.com/boltdb/bolt/errors.go b/vendor/go.etcd.io/bbolt/errors.go similarity index 99% rename from vendor/github.com/boltdb/bolt/errors.go rename to vendor/go.etcd.io/bbolt/errors.go index a3620a3ebb..48758ca577 100644 --- a/vendor/github.com/boltdb/bolt/errors.go +++ b/vendor/go.etcd.io/bbolt/errors.go @@ -1,4 +1,4 @@ -package bolt +package bbolt import "errors" diff --git a/vendor/github.com/boltdb/bolt/freelist.go b/vendor/go.etcd.io/bbolt/freelist.go similarity index 57% rename from vendor/github.com/boltdb/bolt/freelist.go rename to vendor/go.etcd.io/bbolt/freelist.go index d32f6cd937..e4bcb2dcf9 100644 --- a/vendor/github.com/boltdb/bolt/freelist.go +++ b/vendor/go.etcd.io/bbolt/freelist.go @@ -1,4 +1,4 @@ -package bolt +package bbolt import ( "fmt" @@ -6,25 +6,40 @@ import ( "unsafe" ) +// txPending holds a list of pgids and corresponding allocation txns +// that are pending to be freed. +type txPending struct { + ids []pgid + alloctx []txid // txids allocating the ids + lastReleaseBegin txid // beginning txid of last matching releaseRange +} + // freelist represents a list of all pages that are available for allocation. // It also tracks pages that have been freed but are still in use by open transactions. type freelist struct { - ids []pgid // all free and available free page ids. - pending map[txid][]pgid // mapping of soon-to-be free page ids by tx. - cache map[pgid]bool // fast lookup of all free and pending page ids. + ids []pgid // all free and available free page ids. + allocs map[pgid]txid // mapping of txid that allocated a pgid. + pending map[txid]*txPending // mapping of soon-to-be free page ids by tx. + cache map[pgid]bool // fast lookup of all free and pending page ids. } // newFreelist returns an empty, initialized freelist. func newFreelist() *freelist { return &freelist{ - pending: make(map[txid][]pgid), + allocs: make(map[pgid]txid), + pending: make(map[txid]*txPending), cache: make(map[pgid]bool), } } // size returns the size of the page after serialization. func (f *freelist) size() int { - return pageHeaderSize + (int(unsafe.Sizeof(pgid(0))) * f.count()) + n := f.count() + if n >= 0xFFFF { + // The first element will be used to store the count. See freelist.write. + n++ + } + return pageHeaderSize + (int(unsafe.Sizeof(pgid(0))) * n) } // count returns count of pages on the freelist @@ -40,27 +55,26 @@ func (f *freelist) free_count() int { // pending_count returns count of pending pages func (f *freelist) pending_count() int { var count int - for _, list := range f.pending { - count += len(list) + for _, txp := range f.pending { + count += len(txp.ids) } return count } -// all returns a list of all free ids and all pending ids in one sorted list. -func (f *freelist) all() []pgid { - m := make(pgids, 0) - - for _, list := range f.pending { - m = append(m, list...) +// copyall copies into dst a list of all free ids and all pending ids in one sorted list. +// f.count returns the minimum length required for dst. +func (f *freelist) copyall(dst []pgid) { + m := make(pgids, 0, f.pending_count()) + for _, txp := range f.pending { + m = append(m, txp.ids...) } - sort.Sort(m) - return pgids(f.ids).merge(m) + mergepgids(dst, f.ids, m) } // allocate returns the starting page id of a contiguous list of pages of a given size. // If a contiguous block cannot be found then 0 is returned. -func (f *freelist) allocate(n int) pgid { +func (f *freelist) allocate(txid txid, n int) pgid { if len(f.ids) == 0 { return 0 } @@ -93,7 +107,7 @@ func (f *freelist) allocate(n int) pgid { for i := pgid(0); i < pgid(n); i++ { delete(f.cache, initial+i) } - + f.allocs[initial] = txid return initial } @@ -110,28 +124,73 @@ func (f *freelist) free(txid txid, p *page) { } // Free page and all its overflow pages. - var ids = f.pending[txid] + txp := f.pending[txid] + if txp == nil { + txp = &txPending{} + f.pending[txid] = txp + } + allocTxid, ok := f.allocs[p.id] + if ok { + delete(f.allocs, p.id) + } else if (p.flags & freelistPageFlag) != 0 { + // Freelist is always allocated by prior tx. + allocTxid = txid - 1 + } + for id := p.id; id <= p.id+pgid(p.overflow); id++ { // Verify that page is not already free. if f.cache[id] { panic(fmt.Sprintf("page %d already freed", id)) } - // Add to the freelist and cache. - ids = append(ids, id) + txp.ids = append(txp.ids, id) + txp.alloctx = append(txp.alloctx, allocTxid) f.cache[id] = true } - f.pending[txid] = ids } // release moves all page ids for a transaction id (or older) to the freelist. func (f *freelist) release(txid txid) { m := make(pgids, 0) - for tid, ids := range f.pending { + for tid, txp := range f.pending { if tid <= txid { // Move transaction's pending pages to the available freelist. // Don't remove from the cache since the page is still free. - m = append(m, ids...) + m = append(m, txp.ids...) + delete(f.pending, tid) + } + } + sort.Sort(m) + f.ids = pgids(f.ids).merge(m) +} + +// releaseRange moves pending pages allocated within an extent [begin,end] to the free list. +func (f *freelist) releaseRange(begin, end txid) { + if begin > end { + return + } + var m pgids + for tid, txp := range f.pending { + if tid < begin || tid > end { + continue + } + // Don't recompute freed pages if ranges haven't updated. + if txp.lastReleaseBegin == begin { + continue + } + for i := 0; i < len(txp.ids); i++ { + if atx := txp.alloctx[i]; atx < begin || atx > end { + continue + } + m = append(m, txp.ids[i]) + txp.ids[i] = txp.ids[len(txp.ids)-1] + txp.ids = txp.ids[:len(txp.ids)-1] + txp.alloctx[i] = txp.alloctx[len(txp.alloctx)-1] + txp.alloctx = txp.alloctx[:len(txp.alloctx)-1] + i-- + } + txp.lastReleaseBegin = begin + if len(txp.ids) == 0 { delete(f.pending, tid) } } @@ -142,12 +201,29 @@ func (f *freelist) release(txid txid) { // rollback removes the pages from a given pending tx. func (f *freelist) rollback(txid txid) { // Remove page ids from cache. - for _, id := range f.pending[txid] { - delete(f.cache, id) + txp := f.pending[txid] + if txp == nil { + return } - - // Remove pages from pending list. + var m pgids + for i, pgid := range txp.ids { + delete(f.cache, pgid) + tx := txp.alloctx[i] + if tx == 0 { + continue + } + if tx != txid { + // Pending free aborted; restore page back to alloc list. + f.allocs[pgid] = tx + } else { + // Freed page was allocated by this txn; OK to throw away. + m = append(m, pgid) + } + } + // Remove pages from pending list and mark as free if allocated by txid. delete(f.pending, txid) + sort.Sort(m) + f.ids = pgids(f.ids).merge(m) } // freed returns whether a given page is in the free list. @@ -157,6 +233,9 @@ func (f *freelist) freed(pgid pgid) bool { // read initializes the freelist from a freelist page. func (f *freelist) read(p *page) { + if (p.flags & freelistPageFlag) == 0 { + panic(fmt.Sprintf("invalid freelist page: %d, page type is %s", p.id, p.typ())) + } // If the page.count is at the max uint16 value (64k) then it's considered // an overflow and the size of the freelist is stored as the first element. idx, count := 0, int(p.count) @@ -169,7 +248,7 @@ func (f *freelist) read(p *page) { if count == 0 { f.ids = nil } else { - ids := ((*[maxAllocSize]pgid)(unsafe.Pointer(&p.ptr)))[idx:count] + ids := ((*[maxAllocSize]pgid)(unsafe.Pointer(&p.ptr)))[idx : idx+count] f.ids = make([]pgid, len(ids)) copy(f.ids, ids) @@ -181,27 +260,33 @@ func (f *freelist) read(p *page) { f.reindex() } +// read initializes the freelist from a given list of ids. +func (f *freelist) readIDs(ids []pgid) { + f.ids = ids + f.reindex() +} + // write writes the page ids onto a freelist page. All free and pending ids are // saved to disk since in the event of a program crash, all pending ids will // become free. func (f *freelist) write(p *page) error { // Combine the old free pgids and pgids waiting on an open transaction. - ids := f.all() // Update the header flag. p.flags |= freelistPageFlag // The page.count can only hold up to 64k elements so if we overflow that // number then we handle it by putting the size in the first element. - if len(ids) == 0 { - p.count = uint16(len(ids)) - } else if len(ids) < 0xFFFF { - p.count = uint16(len(ids)) - copy(((*[maxAllocSize]pgid)(unsafe.Pointer(&p.ptr)))[:], ids) + lenids := f.count() + if lenids == 0 { + p.count = uint16(lenids) + } else if lenids < 0xFFFF { + p.count = uint16(lenids) + f.copyall(((*[maxAllocSize]pgid)(unsafe.Pointer(&p.ptr)))[:]) } else { p.count = 0xFFFF - ((*[maxAllocSize]pgid)(unsafe.Pointer(&p.ptr)))[0] = pgid(len(ids)) - copy(((*[maxAllocSize]pgid)(unsafe.Pointer(&p.ptr)))[1:], ids) + ((*[maxAllocSize]pgid)(unsafe.Pointer(&p.ptr)))[0] = pgid(lenids) + f.copyall(((*[maxAllocSize]pgid)(unsafe.Pointer(&p.ptr)))[1:]) } return nil @@ -213,8 +298,8 @@ func (f *freelist) reload(p *page) { // Build a cache of only pending pages. pcache := make(map[pgid]bool) - for _, pendingIDs := range f.pending { - for _, pendingID := range pendingIDs { + for _, txp := range f.pending { + for _, pendingID := range txp.ids { pcache[pendingID] = true } } @@ -240,8 +325,8 @@ func (f *freelist) reindex() { for _, id := range f.ids { f.cache[id] = true } - for _, pendingIDs := range f.pending { - for _, pendingID := range pendingIDs { + for _, txp := range f.pending { + for _, pendingID := range txp.ids { f.cache[pendingID] = true } } diff --git a/vendor/github.com/boltdb/bolt/node.go b/vendor/go.etcd.io/bbolt/node.go similarity index 99% rename from vendor/github.com/boltdb/bolt/node.go rename to vendor/go.etcd.io/bbolt/node.go index 159318b229..6c3fa553ea 100644 --- a/vendor/github.com/boltdb/bolt/node.go +++ b/vendor/go.etcd.io/bbolt/node.go @@ -1,4 +1,4 @@ -package bolt +package bbolt import ( "bytes" @@ -365,7 +365,7 @@ func (n *node) spill() error { } // Allocate contiguous space for the node. - p, err := tx.allocate((node.size() / tx.db.pageSize) + 1) + p, err := tx.allocate((node.size() + tx.db.pageSize - 1) / tx.db.pageSize) if err != nil { return err } diff --git a/vendor/github.com/boltdb/bolt/page.go b/vendor/go.etcd.io/bbolt/page.go similarity index 88% rename from vendor/github.com/boltdb/bolt/page.go rename to vendor/go.etcd.io/bbolt/page.go index 7651a6bf7d..bca9615f0f 100644 --- a/vendor/github.com/boltdb/bolt/page.go +++ b/vendor/go.etcd.io/bbolt/page.go @@ -1,4 +1,4 @@ -package bolt +package bbolt import ( "fmt" @@ -145,12 +145,33 @@ func (a pgids) merge(b pgids) pgids { // Return the opposite slice if one is nil. if len(a) == 0 { return b - } else if len(b) == 0 { + } + if len(b) == 0 { return a } + merged := make(pgids, len(a)+len(b)) + mergepgids(merged, a, b) + return merged +} + +// mergepgids copies the sorted union of a and b into dst. +// If dst is too small, it panics. +func mergepgids(dst, a, b pgids) { + if len(dst) < len(a)+len(b) { + panic(fmt.Errorf("mergepgids bad len %d < %d + %d", len(dst), len(a), len(b))) + } + // Copy in the opposite slice if one is nil. + if len(a) == 0 { + copy(dst, b) + return + } + if len(b) == 0 { + copy(dst, a) + return + } - // Create a list to hold all elements from both lists. - merged := make(pgids, 0, len(a)+len(b)) + // Merged will hold all elements from both lists. + merged := dst[:0] // Assign lead to the slice with a lower starting value, follow to the higher value. lead, follow := a, b @@ -172,7 +193,5 @@ func (a pgids) merge(b pgids) pgids { } // Append what's left in follow. - merged = append(merged, follow...) - - return merged + _ = append(merged, follow...) } diff --git a/vendor/github.com/boltdb/bolt/tx.go b/vendor/go.etcd.io/bbolt/tx.go similarity index 93% rename from vendor/github.com/boltdb/bolt/tx.go rename to vendor/go.etcd.io/bbolt/tx.go index 1cfb4cde85..f508641427 100644 --- a/vendor/github.com/boltdb/bolt/tx.go +++ b/vendor/go.etcd.io/bbolt/tx.go @@ -1,4 +1,4 @@ -package bolt +package bbolt import ( "fmt" @@ -126,10 +126,7 @@ func (tx *Tx) DeleteBucket(name []byte) error { // the error is returned to the caller. func (tx *Tx) ForEach(fn func(name []byte, b *Bucket) error) error { return tx.root.ForEach(func(k, v []byte) error { - if err := fn(k, tx.root.Bucket(k)); err != nil { - return err - } - return nil + return fn(k, tx.root.Bucket(k)) }) } @@ -169,28 +166,18 @@ func (tx *Tx) Commit() error { // Free the old root bucket. tx.meta.root.root = tx.root.root - opgid := tx.meta.pgid - - // Free the freelist and allocate new pages for it. This will overestimate - // the size of the freelist but not underestimate the size (which would be bad). - tx.db.freelist.free(tx.meta.txid, tx.db.page(tx.meta.freelist)) - p, err := tx.allocate((tx.db.freelist.size() / tx.db.pageSize) + 1) - if err != nil { - tx.rollback() - return err - } - if err := tx.db.freelist.write(p); err != nil { - tx.rollback() - return err + // Free the old freelist because commit writes out a fresh freelist. + if tx.meta.freelist != pgidNoFreelist { + tx.db.freelist.free(tx.meta.txid, tx.db.page(tx.meta.freelist)) } - tx.meta.freelist = p.id - // If the high water mark has moved up then attempt to grow the database. - if tx.meta.pgid > opgid { - if err := tx.db.grow(int(tx.meta.pgid+1) * tx.db.pageSize); err != nil { - tx.rollback() + if !tx.db.NoFreelistSync { + err := tx.commitFreelist() + if err != nil { return err } + } else { + tx.meta.freelist = pgidNoFreelist } // Write dirty pages to disk. @@ -235,6 +222,31 @@ func (tx *Tx) Commit() error { return nil } +func (tx *Tx) commitFreelist() error { + // Allocate new pages for the new free list. This will overestimate + // the size of the freelist but not underestimate the size (which would be bad). + opgid := tx.meta.pgid + p, err := tx.allocate((tx.db.freelist.size() / tx.db.pageSize) + 1) + if err != nil { + tx.rollback() + return err + } + if err := tx.db.freelist.write(p); err != nil { + tx.rollback() + return err + } + tx.meta.freelist = p.id + // If the high water mark has moved up then attempt to grow the database. + if tx.meta.pgid > opgid { + if err := tx.db.grow(int(tx.meta.pgid+1) * tx.db.pageSize); err != nil { + tx.rollback() + return err + } + } + + return nil +} + // Rollback closes the transaction and ignores all previous updates. Read-only // transactions must be rolled back and not committed. func (tx *Tx) Rollback() error { @@ -291,7 +303,9 @@ func (tx *Tx) close() { } // Copy writes the entire database to a writer. -// This function exists for backwards compatibility. Use WriteTo() instead. +// This function exists for backwards compatibility. +// +// Deprecated; Use WriteTo() instead. func (tx *Tx) Copy(w io.Writer) error { _, err := tx.WriteTo(w) return err @@ -305,7 +319,11 @@ func (tx *Tx) WriteTo(w io.Writer) (n int64, err error) { if err != nil { return 0, err } - defer func() { _ = f.Close() }() + defer func() { + if cerr := f.Close(); err == nil { + err = cerr + } + }() // Generate a meta page. We use the same page data for both meta pages. buf := make([]byte, tx.db.pageSize) @@ -333,7 +351,7 @@ func (tx *Tx) WriteTo(w io.Writer) (n int64, err error) { } // Move past the meta pages in the file. - if _, err := f.Seek(int64(tx.db.pageSize*2), os.SEEK_SET); err != nil { + if _, err := f.Seek(int64(tx.db.pageSize*2), io.SeekStart); err != nil { return n, fmt.Errorf("seek: %s", err) } @@ -344,7 +362,7 @@ func (tx *Tx) WriteTo(w io.Writer) (n int64, err error) { return n, err } - return n, f.Close() + return n, nil } // CopyFile copies the entire database to file at the given path. @@ -379,9 +397,14 @@ func (tx *Tx) Check() <-chan error { } func (tx *Tx) check(ch chan error) { + // Force loading free list if opened in ReadOnly mode. + tx.db.loadFreelist() + // Check if any pages are double freed. freed := make(map[pgid]bool) - for _, id := range tx.db.freelist.all() { + all := make([]pgid, tx.db.freelist.count()) + tx.db.freelist.copyall(all) + for _, id := range all { if freed[id] { ch <- fmt.Errorf("page %d: already freed", id) } @@ -392,8 +415,10 @@ func (tx *Tx) check(ch chan error) { reachable := make(map[pgid]*page) reachable[0] = tx.page(0) // meta0 reachable[1] = tx.page(1) // meta1 - for i := uint32(0); i <= tx.page(tx.meta.freelist).overflow; i++ { - reachable[tx.meta.freelist+pgid(i)] = tx.page(tx.meta.freelist) + if tx.meta.freelist != pgidNoFreelist { + for i := uint32(0); i <= tx.page(tx.meta.freelist).overflow; i++ { + reachable[tx.meta.freelist+pgid(i)] = tx.page(tx.meta.freelist) + } } // Recursively check buckets. @@ -451,7 +476,7 @@ func (tx *Tx) checkBucket(b *Bucket, reachable map[pgid]*page, freed map[pgid]bo // allocate returns a contiguous block of memory starting at a given page. func (tx *Tx) allocate(count int) (*page, error) { - p, err := tx.db.allocate(count) + p, err := tx.db.allocate(tx.meta.txid, count) if err != nil { return nil, err } @@ -460,7 +485,7 @@ func (tx *Tx) allocate(count int) (*page, error) { tx.pages[p.id] = p // Update statistics. - tx.stats.PageCount++ + tx.stats.PageCount += count tx.stats.PageAlloc += count * tx.db.pageSize return p, nil diff --git a/vendor/golang.org/x/crypto/ed25519/ed25519.go b/vendor/golang.org/x/crypto/ed25519/ed25519.go index a57771a1ed..d6f683ba3f 100644 --- a/vendor/golang.org/x/crypto/ed25519/ed25519.go +++ b/vendor/golang.org/x/crypto/ed25519/ed25519.go @@ -6,7 +6,10 @@ // https://ed25519.cr.yp.to/. // // These functions are also compatible with the “Ed25519” function defined in -// RFC 8032. +// RFC 8032. However, unlike RFC 8032's formulation, this package's private key +// representation includes a public key suffix to make multiple signing +// operations with the same key more efficient. This package refers to the RFC +// 8032 private key as the “seed”. package ed25519 // This code is a port of the public domain, “ref10” implementation of ed25519 @@ -31,6 +34,8 @@ const ( PrivateKeySize = 64 // SignatureSize is the size, in bytes, of signatures generated and verified by this package. SignatureSize = 64 + // SeedSize is the size, in bytes, of private key seeds. These are the private key representations used by RFC 8032. + SeedSize = 32 ) // PublicKey is the type of Ed25519 public keys. @@ -46,6 +51,15 @@ func (priv PrivateKey) Public() crypto.PublicKey { return PublicKey(publicKey) } +// Seed returns the private key seed corresponding to priv. It is provided for +// interoperability with RFC 8032. RFC 8032's private keys correspond to seeds +// in this package. +func (priv PrivateKey) Seed() []byte { + seed := make([]byte, SeedSize) + copy(seed, priv[:32]) + return seed +} + // Sign signs the given message with priv. // Ed25519 performs two passes over messages to be signed and therefore cannot // handle pre-hashed messages. Thus opts.HashFunc() must return zero to @@ -61,19 +75,33 @@ func (priv PrivateKey) Sign(rand io.Reader, message []byte, opts crypto.SignerOp // GenerateKey generates a public/private key pair using entropy from rand. // If rand is nil, crypto/rand.Reader will be used. -func GenerateKey(rand io.Reader) (publicKey PublicKey, privateKey PrivateKey, err error) { +func GenerateKey(rand io.Reader) (PublicKey, PrivateKey, error) { if rand == nil { rand = cryptorand.Reader } - privateKey = make([]byte, PrivateKeySize) - publicKey = make([]byte, PublicKeySize) - _, err = io.ReadFull(rand, privateKey[:32]) - if err != nil { + seed := make([]byte, SeedSize) + if _, err := io.ReadFull(rand, seed); err != nil { return nil, nil, err } - digest := sha512.Sum512(privateKey[:32]) + privateKey := NewKeyFromSeed(seed) + publicKey := make([]byte, PublicKeySize) + copy(publicKey, privateKey[32:]) + + return publicKey, privateKey, nil +} + +// NewKeyFromSeed calculates a private key from a seed. It will panic if +// len(seed) is not SeedSize. This function is provided for interoperability +// with RFC 8032. RFC 8032's private keys correspond to seeds in this +// package. +func NewKeyFromSeed(seed []byte) PrivateKey { + if l := len(seed); l != SeedSize { + panic("ed25519: bad seed length: " + strconv.Itoa(l)) + } + + digest := sha512.Sum512(seed) digest[0] &= 248 digest[31] &= 127 digest[31] |= 64 @@ -85,10 +113,11 @@ func GenerateKey(rand io.Reader) (publicKey PublicKey, privateKey PrivateKey, er var publicKeyBytes [32]byte A.ToBytes(&publicKeyBytes) + privateKey := make([]byte, PrivateKeySize) + copy(privateKey, seed) copy(privateKey[32:], publicKeyBytes[:]) - copy(publicKey, publicKeyBytes[:]) - return publicKey, privateKey, nil + return privateKey } // Sign signs the message with privateKey and returns a signature. It will diff --git a/vendor/golang.org/x/crypto/otr/libotr_test_helper.c b/vendor/golang.org/x/crypto/otr/libotr_test_helper.c new file mode 100644 index 0000000000..b3ca072d48 --- /dev/null +++ b/vendor/golang.org/x/crypto/otr/libotr_test_helper.c @@ -0,0 +1,197 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This code can be compiled and used to test the otr package against libotr. +// See otr_test.go. + +// +build ignore + +#include +#include +#include + +#include +#include +#include + +static int g_session_established = 0; + +OtrlPolicy policy(void *opdata, ConnContext *context) { + return OTRL_POLICY_ALWAYS; +} + +int is_logged_in(void *opdata, const char *accountname, const char *protocol, + const char *recipient) { + return 1; +} + +void inject_message(void *opdata, const char *accountname, const char *protocol, + const char *recipient, const char *message) { + printf("%s\n", message); + fflush(stdout); + fprintf(stderr, "libotr helper sent: %s\n", message); +} + +void update_context_list(void *opdata) {} + +void new_fingerprint(void *opdata, OtrlUserState us, const char *accountname, + const char *protocol, const char *username, + unsigned char fingerprint[20]) { + fprintf(stderr, "NEW FINGERPRINT\n"); + g_session_established = 1; +} + +void write_fingerprints(void *opdata) {} + +void gone_secure(void *opdata, ConnContext *context) {} + +void gone_insecure(void *opdata, ConnContext *context) {} + +void still_secure(void *opdata, ConnContext *context, int is_reply) {} + +int max_message_size(void *opdata, ConnContext *context) { return 99999; } + +const char *account_name(void *opdata, const char *account, + const char *protocol) { + return "ACCOUNT"; +} + +void account_name_free(void *opdata, const char *account_name) {} + +const char *error_message(void *opdata, ConnContext *context, + OtrlErrorCode err_code) { + return "ERR"; +} + +void error_message_free(void *opdata, const char *msg) {} + +void resent_msg_prefix_free(void *opdata, const char *prefix) {} + +void handle_smp_event(void *opdata, OtrlSMPEvent smp_event, + ConnContext *context, unsigned short progress_event, + char *question) {} + +void handle_msg_event(void *opdata, OtrlMessageEvent msg_event, + ConnContext *context, const char *message, + gcry_error_t err) { + fprintf(stderr, "msg event: %d %s\n", msg_event, message); +} + +OtrlMessageAppOps uiops = { + policy, + NULL, + is_logged_in, + inject_message, + update_context_list, + new_fingerprint, + write_fingerprints, + gone_secure, + gone_insecure, + still_secure, + max_message_size, + account_name, + account_name_free, + NULL, /* received_symkey */ + error_message, + error_message_free, + NULL, /* resent_msg_prefix */ + resent_msg_prefix_free, + handle_smp_event, + handle_msg_event, + NULL /* create_instag */, + NULL /* convert_msg */, + NULL /* convert_free */, + NULL /* timer_control */, +}; + +static const char kPrivateKeyData[] = + "(privkeys (account (name \"account\") (protocol proto) (private-key (dsa " + "(p " + "#00FC07ABCF0DC916AFF6E9AE47BEF60C7AB9B4D6B2469E436630E36F8A489BE812486A09F" + "30B71224508654940A835301ACC525A4FF133FC152CC53DCC59D65C30A54F1993FE13FE63E" + "5823D4C746DB21B90F9B9C00B49EC7404AB1D929BA7FBA12F2E45C6E0A651689750E8528AB" + "8C031D3561FECEE72EBB4A090D450A9B7A857#) (q " + "#00997BD266EF7B1F60A5C23F3A741F2AEFD07A2081#) (g " + "#535E360E8A95EBA46A4F7DE50AD6E9B2A6DB785A66B64EB9F20338D2A3E8FB0E94725848F" + "1AA6CC567CB83A1CC517EC806F2E92EAE71457E80B2210A189B91250779434B41FC8A8873F" + "6DB94BEA7D177F5D59E7E114EE10A49CFD9CEF88AE43387023B672927BA74B04EB6BBB5E57" + "597766A2F9CE3857D7ACE3E1E3BC1FC6F26#) (y " + "#0AC8670AD767D7A8D9D14CC1AC6744CD7D76F993B77FFD9E39DF01E5A6536EF65E775FCEF" + "2A983E2A19BD6415500F6979715D9FD1257E1FE2B6F5E1E74B333079E7C880D39868462A93" + "454B41877BE62E5EF0A041C2EE9C9E76BD1E12AE25D9628DECB097025DD625EF49C3258A1A" + "3C0FF501E3DC673B76D7BABF349009B6ECF#) (x " + "#14D0345A3562C480A039E3C72764F72D79043216#)))))\n"; + +int main() { + OTRL_INIT; + + // We have to write the private key information to a file because the libotr + // API demands a filename to read from. + const char *tmpdir = "/tmp"; + if (getenv("TMP")) { + tmpdir = getenv("TMP"); + } + + char private_key_file[256]; + snprintf(private_key_file, sizeof(private_key_file), + "%s/libotr_test_helper_privatekeys-XXXXXX", tmpdir); + int fd = mkstemp(private_key_file); + if (fd == -1) { + perror("creating temp file"); + } + write(fd, kPrivateKeyData, sizeof(kPrivateKeyData) - 1); + close(fd); + + OtrlUserState userstate = otrl_userstate_create(); + otrl_privkey_read(userstate, private_key_file); + unlink(private_key_file); + + fprintf(stderr, "libotr helper started\n"); + + char buf[4096]; + + for (;;) { + char *message = fgets(buf, sizeof(buf), stdin); + if (strlen(message) == 0) { + break; + } + message[strlen(message) - 1] = 0; + fprintf(stderr, "libotr helper got: %s\n", message); + + char *newmessage = NULL; + OtrlTLV *tlvs; + int ignore_message = otrl_message_receiving( + userstate, &uiops, NULL, "account", "proto", "peer", message, + &newmessage, &tlvs, NULL, NULL, NULL); + if (tlvs) { + otrl_tlv_free(tlvs); + } + + if (newmessage != NULL) { + fprintf(stderr, "libotr got: %s\n", newmessage); + otrl_message_free(newmessage); + + gcry_error_t err; + char *newmessage = NULL; + + err = otrl_message_sending(userstate, &uiops, NULL, "account", "proto", + "peer", 0, "test message", NULL, &newmessage, + OTRL_FRAGMENT_SEND_SKIP, NULL, NULL, NULL); + if (newmessage == NULL) { + fprintf(stderr, "libotr didn't encrypt message\n"); + return 1; + } + write(1, newmessage, strlen(newmessage)); + write(1, "\n", 1); + fprintf(stderr, "libotr sent: %s\n", newmessage); + otrl_message_free(newmessage); + + g_session_established = 0; + write(1, "?OTRv2?\n", 8); + fprintf(stderr, "libotr sent: ?OTRv2\n"); + } + } + + return 0; +} diff --git a/vendor/golang.org/x/crypto/otr/otr.go b/vendor/golang.org/x/crypto/otr/otr.go new file mode 100644 index 0000000000..173b753dbd --- /dev/null +++ b/vendor/golang.org/x/crypto/otr/otr.go @@ -0,0 +1,1415 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package otr implements the Off The Record protocol as specified in +// http://www.cypherpunks.ca/otr/Protocol-v2-3.1.0.html +package otr // import "golang.org/x/crypto/otr" + +import ( + "bytes" + "crypto/aes" + "crypto/cipher" + "crypto/dsa" + "crypto/hmac" + "crypto/rand" + "crypto/sha1" + "crypto/sha256" + "crypto/subtle" + "encoding/base64" + "encoding/hex" + "errors" + "hash" + "io" + "math/big" + "strconv" +) + +// SecurityChange describes a change in the security state of a Conversation. +type SecurityChange int + +const ( + NoChange SecurityChange = iota + // NewKeys indicates that a key exchange has completed. This occurs + // when a conversation first becomes encrypted, and when the keys are + // renegotiated within an encrypted conversation. + NewKeys + // SMPSecretNeeded indicates that the peer has started an + // authentication and that we need to supply a secret. Call SMPQuestion + // to get the optional, human readable challenge and then Authenticate + // to supply the matching secret. + SMPSecretNeeded + // SMPComplete indicates that an authentication completed. The identity + // of the peer has now been confirmed. + SMPComplete + // SMPFailed indicates that an authentication failed. + SMPFailed + // ConversationEnded indicates that the peer ended the secure + // conversation. + ConversationEnded +) + +// QueryMessage can be sent to a peer to start an OTR conversation. +var QueryMessage = "?OTRv2?" + +// ErrorPrefix can be used to make an OTR error by appending an error message +// to it. +var ErrorPrefix = "?OTR Error:" + +var ( + fragmentPartSeparator = []byte(",") + fragmentPrefix = []byte("?OTR,") + msgPrefix = []byte("?OTR:") + queryMarker = []byte("?OTR") +) + +// isQuery attempts to parse an OTR query from msg and returns the greatest +// common version, or 0 if msg is not an OTR query. +func isQuery(msg []byte) (greatestCommonVersion int) { + pos := bytes.Index(msg, queryMarker) + if pos == -1 { + return 0 + } + for i, c := range msg[pos+len(queryMarker):] { + if i == 0 { + if c == '?' { + // Indicates support for version 1, but we don't + // implement that. + continue + } + + if c != 'v' { + // Invalid message + return 0 + } + + continue + } + + if c == '?' { + // End of message + return + } + + if c == ' ' || c == '\t' { + // Probably an invalid message + return 0 + } + + if c == '2' { + greatestCommonVersion = 2 + } + } + + return 0 +} + +const ( + statePlaintext = iota + stateEncrypted + stateFinished +) + +const ( + authStateNone = iota + authStateAwaitingDHKey + authStateAwaitingRevealSig + authStateAwaitingSig +) + +const ( + msgTypeDHCommit = 2 + msgTypeData = 3 + msgTypeDHKey = 10 + msgTypeRevealSig = 17 + msgTypeSig = 18 +) + +const ( + // If the requested fragment size is less than this, it will be ignored. + minFragmentSize = 18 + // Messages are padded to a multiple of this number of bytes. + paddingGranularity = 256 + // The number of bytes in a Diffie-Hellman private value (320-bits). + dhPrivateBytes = 40 + // The number of bytes needed to represent an element of the DSA + // subgroup (160-bits). + dsaSubgroupBytes = 20 + // The number of bytes of the MAC that are sent on the wire (160-bits). + macPrefixBytes = 20 +) + +// These are the global, common group parameters for OTR. +var ( + p *big.Int // group prime + g *big.Int // group generator + q *big.Int // group order + pMinus2 *big.Int +) + +func init() { + p, _ = new(big.Int).SetString("FFFFFFFFFFFFFFFFC90FDAA22168C234C4C6628B80DC1CD129024E088A67CC74020BBEA63B139B22514A08798E3404DDEF9519B3CD3A431B302B0A6DF25F14374FE1356D6D51C245E485B576625E7EC6F44C42E9A637ED6B0BFF5CB6F406B7EDEE386BFB5A899FA5AE9F24117C4B1FE649286651ECE45B3DC2007CB8A163BF0598DA48361C55D39A69163FA8FD24CF5F83655D23DCA3AD961C62F356208552BB9ED529077096966D670C354E4ABC9804F1746C08CA237327FFFFFFFFFFFFFFFF", 16) + q, _ = new(big.Int).SetString("7FFFFFFFFFFFFFFFE487ED5110B4611A62633145C06E0E68948127044533E63A0105DF531D89CD9128A5043CC71A026EF7CA8CD9E69D218D98158536F92F8A1BA7F09AB6B6A8E122F242DABB312F3F637A262174D31BF6B585FFAE5B7A035BF6F71C35FDAD44CFD2D74F9208BE258FF324943328F6722D9EE1003E5C50B1DF82CC6D241B0E2AE9CD348B1FD47E9267AFC1B2AE91EE51D6CB0E3179AB1042A95DCF6A9483B84B4B36B3861AA7255E4C0278BA36046511B993FFFFFFFFFFFFFFFF", 16) + g = new(big.Int).SetInt64(2) + pMinus2 = new(big.Int).Sub(p, g) +} + +// Conversation represents a relation with a peer. The zero value is a valid +// Conversation, although PrivateKey must be set. +// +// When communicating with a peer, all inbound messages should be passed to +// Conversation.Receive and all outbound messages to Conversation.Send. The +// Conversation will take care of maintaining the encryption state and +// negotiating encryption as needed. +type Conversation struct { + // PrivateKey contains the private key to use to sign key exchanges. + PrivateKey *PrivateKey + + // Rand can be set to override the entropy source. Otherwise, + // crypto/rand will be used. + Rand io.Reader + // If FragmentSize is set, all messages produced by Receive and Send + // will be fragmented into messages of, at most, this number of bytes. + FragmentSize int + + // Once Receive has returned NewKeys once, the following fields are + // valid. + SSID [8]byte + TheirPublicKey PublicKey + + state, authState int + + r [16]byte + x, y *big.Int + gx, gy *big.Int + gxBytes []byte + digest [sha256.Size]byte + + revealKeys, sigKeys akeKeys + + myKeyId uint32 + myCurrentDHPub *big.Int + myCurrentDHPriv *big.Int + myLastDHPub *big.Int + myLastDHPriv *big.Int + + theirKeyId uint32 + theirCurrentDHPub *big.Int + theirLastDHPub *big.Int + + keySlots [4]keySlot + + myCounter [8]byte + theirLastCtr [8]byte + oldMACs []byte + + k, n int // fragment state + frag []byte + + smp smpState +} + +// A keySlot contains key material for a specific (their keyid, my keyid) pair. +type keySlot struct { + // used is true if this slot is valid. If false, it's free for reuse. + used bool + theirKeyId uint32 + myKeyId uint32 + sendAESKey, recvAESKey []byte + sendMACKey, recvMACKey []byte + theirLastCtr [8]byte +} + +// akeKeys are generated during key exchange. There's one set for the reveal +// signature message and another for the signature message. In the protocol +// spec the latter are indicated with a prime mark. +type akeKeys struct { + c [16]byte + m1, m2 [32]byte +} + +func (c *Conversation) rand() io.Reader { + if c.Rand != nil { + return c.Rand + } + return rand.Reader +} + +func (c *Conversation) randMPI(buf []byte) *big.Int { + _, err := io.ReadFull(c.rand(), buf) + if err != nil { + panic("otr: short read from random source") + } + + return new(big.Int).SetBytes(buf) +} + +// tlv represents the type-length value from the protocol. +type tlv struct { + typ, length uint16 + data []byte +} + +const ( + tlvTypePadding = 0 + tlvTypeDisconnected = 1 + tlvTypeSMP1 = 2 + tlvTypeSMP2 = 3 + tlvTypeSMP3 = 4 + tlvTypeSMP4 = 5 + tlvTypeSMPAbort = 6 + tlvTypeSMP1WithQuestion = 7 +) + +// Receive handles a message from a peer. It returns a human readable message, +// an indicator of whether that message was encrypted, a hint about the +// encryption state and zero or more messages to send back to the peer. +// These messages do not need to be passed to Send before transmission. +func (c *Conversation) Receive(in []byte) (out []byte, encrypted bool, change SecurityChange, toSend [][]byte, err error) { + if bytes.HasPrefix(in, fragmentPrefix) { + in, err = c.processFragment(in) + if in == nil || err != nil { + return + } + } + + if bytes.HasPrefix(in, msgPrefix) && in[len(in)-1] == '.' { + in = in[len(msgPrefix) : len(in)-1] + } else if version := isQuery(in); version > 0 { + c.authState = authStateAwaitingDHKey + c.reset() + toSend = c.encode(c.generateDHCommit()) + return + } else { + // plaintext message + out = in + return + } + + msg := make([]byte, base64.StdEncoding.DecodedLen(len(in))) + msgLen, err := base64.StdEncoding.Decode(msg, in) + if err != nil { + err = errors.New("otr: invalid base64 encoding in message") + return + } + msg = msg[:msgLen] + + // The first two bytes are the protocol version (2) + if len(msg) < 3 || msg[0] != 0 || msg[1] != 2 { + err = errors.New("otr: invalid OTR message") + return + } + + msgType := int(msg[2]) + msg = msg[3:] + + switch msgType { + case msgTypeDHCommit: + switch c.authState { + case authStateNone: + c.authState = authStateAwaitingRevealSig + if err = c.processDHCommit(msg); err != nil { + return + } + c.reset() + toSend = c.encode(c.generateDHKey()) + return + case authStateAwaitingDHKey: + // This is a 'SYN-crossing'. The greater digest wins. + var cmp int + if cmp, err = c.compareToDHCommit(msg); err != nil { + return + } + if cmp > 0 { + // We win. Retransmit DH commit. + toSend = c.encode(c.serializeDHCommit()) + return + } else { + // They win. We forget about our DH commit. + c.authState = authStateAwaitingRevealSig + if err = c.processDHCommit(msg); err != nil { + return + } + c.reset() + toSend = c.encode(c.generateDHKey()) + return + } + case authStateAwaitingRevealSig: + if err = c.processDHCommit(msg); err != nil { + return + } + toSend = c.encode(c.serializeDHKey()) + case authStateAwaitingSig: + if err = c.processDHCommit(msg); err != nil { + return + } + c.reset() + toSend = c.encode(c.generateDHKey()) + c.authState = authStateAwaitingRevealSig + default: + panic("bad state") + } + case msgTypeDHKey: + switch c.authState { + case authStateAwaitingDHKey: + var isSame bool + if isSame, err = c.processDHKey(msg); err != nil { + return + } + if isSame { + err = errors.New("otr: unexpected duplicate DH key") + return + } + toSend = c.encode(c.generateRevealSig()) + c.authState = authStateAwaitingSig + case authStateAwaitingSig: + var isSame bool + if isSame, err = c.processDHKey(msg); err != nil { + return + } + if isSame { + toSend = c.encode(c.serializeDHKey()) + } + } + case msgTypeRevealSig: + if c.authState != authStateAwaitingRevealSig { + return + } + if err = c.processRevealSig(msg); err != nil { + return + } + toSend = c.encode(c.generateSig()) + c.authState = authStateNone + c.state = stateEncrypted + change = NewKeys + case msgTypeSig: + if c.authState != authStateAwaitingSig { + return + } + if err = c.processSig(msg); err != nil { + return + } + c.authState = authStateNone + c.state = stateEncrypted + change = NewKeys + case msgTypeData: + if c.state != stateEncrypted { + err = errors.New("otr: encrypted message received without encrypted session established") + return + } + var tlvs []tlv + out, tlvs, err = c.processData(msg) + encrypted = true + + EachTLV: + for _, inTLV := range tlvs { + switch inTLV.typ { + case tlvTypeDisconnected: + change = ConversationEnded + c.state = stateFinished + break EachTLV + case tlvTypeSMP1, tlvTypeSMP2, tlvTypeSMP3, tlvTypeSMP4, tlvTypeSMPAbort, tlvTypeSMP1WithQuestion: + var reply tlv + var complete bool + reply, complete, err = c.processSMP(inTLV) + if err == smpSecretMissingError { + err = nil + change = SMPSecretNeeded + c.smp.saved = &inTLV + return + } + if err == smpFailureError { + err = nil + change = SMPFailed + } else if complete { + change = SMPComplete + } + if reply.typ != 0 { + toSend = c.encode(c.generateData(nil, &reply)) + } + break EachTLV + default: + // skip unknown TLVs + } + } + default: + err = errors.New("otr: unknown message type " + strconv.Itoa(msgType)) + } + + return +} + +// Send takes a human readable message from the local user, possibly encrypts +// it and returns zero one or more messages to send to the peer. +func (c *Conversation) Send(msg []byte) ([][]byte, error) { + switch c.state { + case statePlaintext: + return [][]byte{msg}, nil + case stateEncrypted: + return c.encode(c.generateData(msg, nil)), nil + case stateFinished: + return nil, errors.New("otr: cannot send message because secure conversation has finished") + } + + return nil, errors.New("otr: cannot send message in current state") +} + +// SMPQuestion returns the human readable challenge question from the peer. +// It's only valid after Receive has returned SMPSecretNeeded. +func (c *Conversation) SMPQuestion() string { + return c.smp.question +} + +// Authenticate begins an authentication with the peer. Authentication involves +// an optional challenge message and a shared secret. The authentication +// proceeds until either Receive returns SMPComplete, SMPSecretNeeded (which +// indicates that a new authentication is happening and thus this one was +// aborted) or SMPFailed. +func (c *Conversation) Authenticate(question string, mutualSecret []byte) (toSend [][]byte, err error) { + if c.state != stateEncrypted { + err = errors.New("otr: can't authenticate a peer without a secure conversation established") + return + } + + if c.smp.saved != nil { + c.calcSMPSecret(mutualSecret, false /* they started it */) + + var out tlv + var complete bool + out, complete, err = c.processSMP(*c.smp.saved) + if complete { + panic("SMP completed on the first message") + } + c.smp.saved = nil + if out.typ != 0 { + toSend = c.encode(c.generateData(nil, &out)) + } + return + } + + c.calcSMPSecret(mutualSecret, true /* we started it */) + outs := c.startSMP(question) + for _, out := range outs { + toSend = append(toSend, c.encode(c.generateData(nil, &out))...) + } + return +} + +// End ends a secure conversation by generating a termination message for +// the peer and switches to unencrypted communication. +func (c *Conversation) End() (toSend [][]byte) { + switch c.state { + case statePlaintext: + return nil + case stateEncrypted: + c.state = statePlaintext + return c.encode(c.generateData(nil, &tlv{typ: tlvTypeDisconnected})) + case stateFinished: + c.state = statePlaintext + return nil + } + panic("unreachable") +} + +// IsEncrypted returns true if a message passed to Send would be encrypted +// before transmission. This result remains valid until the next call to +// Receive or End, which may change the state of the Conversation. +func (c *Conversation) IsEncrypted() bool { + return c.state == stateEncrypted +} + +var fragmentError = errors.New("otr: invalid OTR fragment") + +// processFragment processes a fragmented OTR message and possibly returns a +// complete message. Fragmented messages look like "?OTR,k,n,msg," where k is +// the fragment number (starting from 1), n is the number of fragments in this +// message and msg is a substring of the base64 encoded message. +func (c *Conversation) processFragment(in []byte) (out []byte, err error) { + in = in[len(fragmentPrefix):] // remove "?OTR," + parts := bytes.Split(in, fragmentPartSeparator) + if len(parts) != 4 || len(parts[3]) != 0 { + return nil, fragmentError + } + + k, err := strconv.Atoi(string(parts[0])) + if err != nil { + return nil, fragmentError + } + + n, err := strconv.Atoi(string(parts[1])) + if err != nil { + return nil, fragmentError + } + + if k < 1 || n < 1 || k > n { + return nil, fragmentError + } + + if k == 1 { + c.frag = append(c.frag[:0], parts[2]...) + c.k, c.n = k, n + } else if n == c.n && k == c.k+1 { + c.frag = append(c.frag, parts[2]...) + c.k++ + } else { + c.frag = c.frag[:0] + c.n, c.k = 0, 0 + } + + if c.n > 0 && c.k == c.n { + c.n, c.k = 0, 0 + return c.frag, nil + } + + return nil, nil +} + +func (c *Conversation) generateDHCommit() []byte { + _, err := io.ReadFull(c.rand(), c.r[:]) + if err != nil { + panic("otr: short read from random source") + } + + var xBytes [dhPrivateBytes]byte + c.x = c.randMPI(xBytes[:]) + c.gx = new(big.Int).Exp(g, c.x, p) + c.gy = nil + c.gxBytes = appendMPI(nil, c.gx) + + h := sha256.New() + h.Write(c.gxBytes) + h.Sum(c.digest[:0]) + + aesCipher, err := aes.NewCipher(c.r[:]) + if err != nil { + panic(err.Error()) + } + + var iv [aes.BlockSize]byte + ctr := cipher.NewCTR(aesCipher, iv[:]) + ctr.XORKeyStream(c.gxBytes, c.gxBytes) + + return c.serializeDHCommit() +} + +func (c *Conversation) serializeDHCommit() []byte { + var ret []byte + ret = appendU16(ret, 2) // protocol version + ret = append(ret, msgTypeDHCommit) + ret = appendData(ret, c.gxBytes) + ret = appendData(ret, c.digest[:]) + return ret +} + +func (c *Conversation) processDHCommit(in []byte) error { + var ok1, ok2 bool + c.gxBytes, in, ok1 = getData(in) + digest, in, ok2 := getData(in) + if !ok1 || !ok2 || len(in) > 0 { + return errors.New("otr: corrupt DH commit message") + } + copy(c.digest[:], digest) + return nil +} + +func (c *Conversation) compareToDHCommit(in []byte) (int, error) { + _, in, ok1 := getData(in) + digest, in, ok2 := getData(in) + if !ok1 || !ok2 || len(in) > 0 { + return 0, errors.New("otr: corrupt DH commit message") + } + return bytes.Compare(c.digest[:], digest), nil +} + +func (c *Conversation) generateDHKey() []byte { + var yBytes [dhPrivateBytes]byte + c.y = c.randMPI(yBytes[:]) + c.gy = new(big.Int).Exp(g, c.y, p) + return c.serializeDHKey() +} + +func (c *Conversation) serializeDHKey() []byte { + var ret []byte + ret = appendU16(ret, 2) // protocol version + ret = append(ret, msgTypeDHKey) + ret = appendMPI(ret, c.gy) + return ret +} + +func (c *Conversation) processDHKey(in []byte) (isSame bool, err error) { + gy, in, ok := getMPI(in) + if !ok { + err = errors.New("otr: corrupt DH key message") + return + } + if gy.Cmp(g) < 0 || gy.Cmp(pMinus2) > 0 { + err = errors.New("otr: DH value out of range") + return + } + if c.gy != nil { + isSame = c.gy.Cmp(gy) == 0 + return + } + c.gy = gy + return +} + +func (c *Conversation) generateEncryptedSignature(keys *akeKeys, xFirst bool) ([]byte, []byte) { + var xb []byte + xb = c.PrivateKey.PublicKey.Serialize(xb) + + var verifyData []byte + if xFirst { + verifyData = appendMPI(verifyData, c.gx) + verifyData = appendMPI(verifyData, c.gy) + } else { + verifyData = appendMPI(verifyData, c.gy) + verifyData = appendMPI(verifyData, c.gx) + } + verifyData = append(verifyData, xb...) + verifyData = appendU32(verifyData, c.myKeyId) + + mac := hmac.New(sha256.New, keys.m1[:]) + mac.Write(verifyData) + mb := mac.Sum(nil) + + xb = appendU32(xb, c.myKeyId) + xb = append(xb, c.PrivateKey.Sign(c.rand(), mb)...) + + aesCipher, err := aes.NewCipher(keys.c[:]) + if err != nil { + panic(err.Error()) + } + var iv [aes.BlockSize]byte + ctr := cipher.NewCTR(aesCipher, iv[:]) + ctr.XORKeyStream(xb, xb) + + mac = hmac.New(sha256.New, keys.m2[:]) + encryptedSig := appendData(nil, xb) + mac.Write(encryptedSig) + + return encryptedSig, mac.Sum(nil) +} + +func (c *Conversation) generateRevealSig() []byte { + s := new(big.Int).Exp(c.gy, c.x, p) + c.calcAKEKeys(s) + c.myKeyId++ + + encryptedSig, mac := c.generateEncryptedSignature(&c.revealKeys, true /* gx comes first */) + + c.myCurrentDHPub = c.gx + c.myCurrentDHPriv = c.x + c.rotateDHKeys() + incCounter(&c.myCounter) + + var ret []byte + ret = appendU16(ret, 2) + ret = append(ret, msgTypeRevealSig) + ret = appendData(ret, c.r[:]) + ret = append(ret, encryptedSig...) + ret = append(ret, mac[:20]...) + return ret +} + +func (c *Conversation) processEncryptedSig(encryptedSig, theirMAC []byte, keys *akeKeys, xFirst bool) error { + mac := hmac.New(sha256.New, keys.m2[:]) + mac.Write(appendData(nil, encryptedSig)) + myMAC := mac.Sum(nil)[:20] + + if len(myMAC) != len(theirMAC) || subtle.ConstantTimeCompare(myMAC, theirMAC) == 0 { + return errors.New("bad signature MAC in encrypted signature") + } + + aesCipher, err := aes.NewCipher(keys.c[:]) + if err != nil { + panic(err.Error()) + } + var iv [aes.BlockSize]byte + ctr := cipher.NewCTR(aesCipher, iv[:]) + ctr.XORKeyStream(encryptedSig, encryptedSig) + + sig := encryptedSig + sig, ok1 := c.TheirPublicKey.Parse(sig) + keyId, sig, ok2 := getU32(sig) + if !ok1 || !ok2 { + return errors.New("otr: corrupt encrypted signature") + } + + var verifyData []byte + if xFirst { + verifyData = appendMPI(verifyData, c.gx) + verifyData = appendMPI(verifyData, c.gy) + } else { + verifyData = appendMPI(verifyData, c.gy) + verifyData = appendMPI(verifyData, c.gx) + } + verifyData = c.TheirPublicKey.Serialize(verifyData) + verifyData = appendU32(verifyData, keyId) + + mac = hmac.New(sha256.New, keys.m1[:]) + mac.Write(verifyData) + mb := mac.Sum(nil) + + sig, ok1 = c.TheirPublicKey.Verify(mb, sig) + if !ok1 { + return errors.New("bad signature in encrypted signature") + } + if len(sig) > 0 { + return errors.New("corrupt encrypted signature") + } + + c.theirKeyId = keyId + zero(c.theirLastCtr[:]) + return nil +} + +func (c *Conversation) processRevealSig(in []byte) error { + r, in, ok1 := getData(in) + encryptedSig, in, ok2 := getData(in) + theirMAC := in + if !ok1 || !ok2 || len(theirMAC) != 20 { + return errors.New("otr: corrupt reveal signature message") + } + + aesCipher, err := aes.NewCipher(r) + if err != nil { + return errors.New("otr: cannot create AES cipher from reveal signature message: " + err.Error()) + } + var iv [aes.BlockSize]byte + ctr := cipher.NewCTR(aesCipher, iv[:]) + ctr.XORKeyStream(c.gxBytes, c.gxBytes) + h := sha256.New() + h.Write(c.gxBytes) + digest := h.Sum(nil) + if len(digest) != len(c.digest) || subtle.ConstantTimeCompare(digest, c.digest[:]) == 0 { + return errors.New("otr: bad commit MAC in reveal signature message") + } + var rest []byte + c.gx, rest, ok1 = getMPI(c.gxBytes) + if !ok1 || len(rest) > 0 { + return errors.New("otr: gx corrupt after decryption") + } + if c.gx.Cmp(g) < 0 || c.gx.Cmp(pMinus2) > 0 { + return errors.New("otr: DH value out of range") + } + s := new(big.Int).Exp(c.gx, c.y, p) + c.calcAKEKeys(s) + + if err := c.processEncryptedSig(encryptedSig, theirMAC, &c.revealKeys, true /* gx comes first */); err != nil { + return errors.New("otr: in reveal signature message: " + err.Error()) + } + + c.theirCurrentDHPub = c.gx + c.theirLastDHPub = nil + + return nil +} + +func (c *Conversation) generateSig() []byte { + c.myKeyId++ + + encryptedSig, mac := c.generateEncryptedSignature(&c.sigKeys, false /* gy comes first */) + + c.myCurrentDHPub = c.gy + c.myCurrentDHPriv = c.y + c.rotateDHKeys() + incCounter(&c.myCounter) + + var ret []byte + ret = appendU16(ret, 2) + ret = append(ret, msgTypeSig) + ret = append(ret, encryptedSig...) + ret = append(ret, mac[:macPrefixBytes]...) + return ret +} + +func (c *Conversation) processSig(in []byte) error { + encryptedSig, in, ok1 := getData(in) + theirMAC := in + if !ok1 || len(theirMAC) != macPrefixBytes { + return errors.New("otr: corrupt signature message") + } + + if err := c.processEncryptedSig(encryptedSig, theirMAC, &c.sigKeys, false /* gy comes first */); err != nil { + return errors.New("otr: in signature message: " + err.Error()) + } + + c.theirCurrentDHPub = c.gy + c.theirLastDHPub = nil + + return nil +} + +func (c *Conversation) rotateDHKeys() { + // evict slots using our retired key id + for i := range c.keySlots { + slot := &c.keySlots[i] + if slot.used && slot.myKeyId == c.myKeyId-1 { + slot.used = false + c.oldMACs = append(c.oldMACs, slot.recvMACKey...) + } + } + + c.myLastDHPriv = c.myCurrentDHPriv + c.myLastDHPub = c.myCurrentDHPub + + var xBytes [dhPrivateBytes]byte + c.myCurrentDHPriv = c.randMPI(xBytes[:]) + c.myCurrentDHPub = new(big.Int).Exp(g, c.myCurrentDHPriv, p) + c.myKeyId++ +} + +func (c *Conversation) processData(in []byte) (out []byte, tlvs []tlv, err error) { + origIn := in + flags, in, ok1 := getU8(in) + theirKeyId, in, ok2 := getU32(in) + myKeyId, in, ok3 := getU32(in) + y, in, ok4 := getMPI(in) + counter, in, ok5 := getNBytes(in, 8) + encrypted, in, ok6 := getData(in) + macedData := origIn[:len(origIn)-len(in)] + theirMAC, in, ok7 := getNBytes(in, macPrefixBytes) + _, in, ok8 := getData(in) + if !ok1 || !ok2 || !ok3 || !ok4 || !ok5 || !ok6 || !ok7 || !ok8 || len(in) > 0 { + err = errors.New("otr: corrupt data message") + return + } + + ignoreErrors := flags&1 != 0 + + slot, err := c.calcDataKeys(myKeyId, theirKeyId) + if err != nil { + if ignoreErrors { + err = nil + } + return + } + + mac := hmac.New(sha1.New, slot.recvMACKey) + mac.Write([]byte{0, 2, 3}) + mac.Write(macedData) + myMAC := mac.Sum(nil) + if len(myMAC) != len(theirMAC) || subtle.ConstantTimeCompare(myMAC, theirMAC) == 0 { + if !ignoreErrors { + err = errors.New("otr: bad MAC on data message") + } + return + } + + if bytes.Compare(counter, slot.theirLastCtr[:]) <= 0 { + err = errors.New("otr: counter regressed") + return + } + copy(slot.theirLastCtr[:], counter) + + var iv [aes.BlockSize]byte + copy(iv[:], counter) + aesCipher, err := aes.NewCipher(slot.recvAESKey) + if err != nil { + panic(err.Error()) + } + ctr := cipher.NewCTR(aesCipher, iv[:]) + ctr.XORKeyStream(encrypted, encrypted) + decrypted := encrypted + + if myKeyId == c.myKeyId { + c.rotateDHKeys() + } + if theirKeyId == c.theirKeyId { + // evict slots using their retired key id + for i := range c.keySlots { + slot := &c.keySlots[i] + if slot.used && slot.theirKeyId == theirKeyId-1 { + slot.used = false + c.oldMACs = append(c.oldMACs, slot.recvMACKey...) + } + } + + c.theirLastDHPub = c.theirCurrentDHPub + c.theirKeyId++ + c.theirCurrentDHPub = y + } + + if nulPos := bytes.IndexByte(decrypted, 0); nulPos >= 0 { + out = decrypted[:nulPos] + tlvData := decrypted[nulPos+1:] + for len(tlvData) > 0 { + var t tlv + var ok1, ok2, ok3 bool + + t.typ, tlvData, ok1 = getU16(tlvData) + t.length, tlvData, ok2 = getU16(tlvData) + t.data, tlvData, ok3 = getNBytes(tlvData, int(t.length)) + if !ok1 || !ok2 || !ok3 { + err = errors.New("otr: corrupt tlv data") + return + } + tlvs = append(tlvs, t) + } + } else { + out = decrypted + } + + return +} + +func (c *Conversation) generateData(msg []byte, extra *tlv) []byte { + slot, err := c.calcDataKeys(c.myKeyId-1, c.theirKeyId) + if err != nil { + panic("otr: failed to generate sending keys: " + err.Error()) + } + + var plaintext []byte + plaintext = append(plaintext, msg...) + plaintext = append(plaintext, 0) + + padding := paddingGranularity - ((len(plaintext) + 4) % paddingGranularity) + plaintext = appendU16(plaintext, tlvTypePadding) + plaintext = appendU16(plaintext, uint16(padding)) + for i := 0; i < padding; i++ { + plaintext = append(plaintext, 0) + } + + if extra != nil { + plaintext = appendU16(plaintext, extra.typ) + plaintext = appendU16(plaintext, uint16(len(extra.data))) + plaintext = append(plaintext, extra.data...) + } + + encrypted := make([]byte, len(plaintext)) + + var iv [aes.BlockSize]byte + copy(iv[:], c.myCounter[:]) + aesCipher, err := aes.NewCipher(slot.sendAESKey) + if err != nil { + panic(err.Error()) + } + ctr := cipher.NewCTR(aesCipher, iv[:]) + ctr.XORKeyStream(encrypted, plaintext) + + var ret []byte + ret = appendU16(ret, 2) + ret = append(ret, msgTypeData) + ret = append(ret, 0 /* flags */) + ret = appendU32(ret, c.myKeyId-1) + ret = appendU32(ret, c.theirKeyId) + ret = appendMPI(ret, c.myCurrentDHPub) + ret = append(ret, c.myCounter[:]...) + ret = appendData(ret, encrypted) + + mac := hmac.New(sha1.New, slot.sendMACKey) + mac.Write(ret) + ret = append(ret, mac.Sum(nil)[:macPrefixBytes]...) + ret = appendData(ret, c.oldMACs) + c.oldMACs = nil + incCounter(&c.myCounter) + + return ret +} + +func incCounter(counter *[8]byte) { + for i := 7; i >= 0; i-- { + counter[i]++ + if counter[i] > 0 { + break + } + } +} + +// calcDataKeys computes the keys used to encrypt a data message given the key +// IDs. +func (c *Conversation) calcDataKeys(myKeyId, theirKeyId uint32) (slot *keySlot, err error) { + // Check for a cache hit. + for i := range c.keySlots { + slot = &c.keySlots[i] + if slot.used && slot.theirKeyId == theirKeyId && slot.myKeyId == myKeyId { + return + } + } + + // Find an empty slot to write into. + slot = nil + for i := range c.keySlots { + if !c.keySlots[i].used { + slot = &c.keySlots[i] + break + } + } + if slot == nil { + return nil, errors.New("otr: internal error: no more key slots") + } + + var myPriv, myPub, theirPub *big.Int + + if myKeyId == c.myKeyId { + myPriv = c.myCurrentDHPriv + myPub = c.myCurrentDHPub + } else if myKeyId == c.myKeyId-1 { + myPriv = c.myLastDHPriv + myPub = c.myLastDHPub + } else { + err = errors.New("otr: peer requested keyid " + strconv.FormatUint(uint64(myKeyId), 10) + " when I'm on " + strconv.FormatUint(uint64(c.myKeyId), 10)) + return + } + + if theirKeyId == c.theirKeyId { + theirPub = c.theirCurrentDHPub + } else if theirKeyId == c.theirKeyId-1 && c.theirLastDHPub != nil { + theirPub = c.theirLastDHPub + } else { + err = errors.New("otr: peer requested keyid " + strconv.FormatUint(uint64(myKeyId), 10) + " when they're on " + strconv.FormatUint(uint64(c.myKeyId), 10)) + return + } + + var sendPrefixByte, recvPrefixByte [1]byte + + if myPub.Cmp(theirPub) > 0 { + // we're the high end + sendPrefixByte[0], recvPrefixByte[0] = 1, 2 + } else { + // we're the low end + sendPrefixByte[0], recvPrefixByte[0] = 2, 1 + } + + s := new(big.Int).Exp(theirPub, myPriv, p) + sBytes := appendMPI(nil, s) + + h := sha1.New() + h.Write(sendPrefixByte[:]) + h.Write(sBytes) + slot.sendAESKey = h.Sum(slot.sendAESKey[:0])[:16] + + h.Reset() + h.Write(slot.sendAESKey) + slot.sendMACKey = h.Sum(slot.sendMACKey[:0]) + + h.Reset() + h.Write(recvPrefixByte[:]) + h.Write(sBytes) + slot.recvAESKey = h.Sum(slot.recvAESKey[:0])[:16] + + h.Reset() + h.Write(slot.recvAESKey) + slot.recvMACKey = h.Sum(slot.recvMACKey[:0]) + + slot.theirKeyId = theirKeyId + slot.myKeyId = myKeyId + slot.used = true + + zero(slot.theirLastCtr[:]) + return +} + +func (c *Conversation) calcAKEKeys(s *big.Int) { + mpi := appendMPI(nil, s) + h := sha256.New() + + var cBytes [32]byte + hashWithPrefix(c.SSID[:], 0, mpi, h) + + hashWithPrefix(cBytes[:], 1, mpi, h) + copy(c.revealKeys.c[:], cBytes[:16]) + copy(c.sigKeys.c[:], cBytes[16:]) + + hashWithPrefix(c.revealKeys.m1[:], 2, mpi, h) + hashWithPrefix(c.revealKeys.m2[:], 3, mpi, h) + hashWithPrefix(c.sigKeys.m1[:], 4, mpi, h) + hashWithPrefix(c.sigKeys.m2[:], 5, mpi, h) +} + +func hashWithPrefix(out []byte, prefix byte, in []byte, h hash.Hash) { + h.Reset() + var p [1]byte + p[0] = prefix + h.Write(p[:]) + h.Write(in) + if len(out) == h.Size() { + h.Sum(out[:0]) + } else { + digest := h.Sum(nil) + copy(out, digest) + } +} + +func (c *Conversation) encode(msg []byte) [][]byte { + b64 := make([]byte, base64.StdEncoding.EncodedLen(len(msg))+len(msgPrefix)+1) + base64.StdEncoding.Encode(b64[len(msgPrefix):], msg) + copy(b64, msgPrefix) + b64[len(b64)-1] = '.' + + if c.FragmentSize < minFragmentSize || len(b64) <= c.FragmentSize { + // We can encode this in a single fragment. + return [][]byte{b64} + } + + // We have to fragment this message. + var ret [][]byte + bytesPerFragment := c.FragmentSize - minFragmentSize + numFragments := (len(b64) + bytesPerFragment) / bytesPerFragment + + for i := 0; i < numFragments; i++ { + frag := []byte("?OTR," + strconv.Itoa(i+1) + "," + strconv.Itoa(numFragments) + ",") + todo := bytesPerFragment + if todo > len(b64) { + todo = len(b64) + } + frag = append(frag, b64[:todo]...) + b64 = b64[todo:] + frag = append(frag, ',') + ret = append(ret, frag) + } + + return ret +} + +func (c *Conversation) reset() { + c.myKeyId = 0 + + for i := range c.keySlots { + c.keySlots[i].used = false + } +} + +type PublicKey struct { + dsa.PublicKey +} + +func (pk *PublicKey) Parse(in []byte) ([]byte, bool) { + var ok bool + var pubKeyType uint16 + + if pubKeyType, in, ok = getU16(in); !ok || pubKeyType != 0 { + return nil, false + } + if pk.P, in, ok = getMPI(in); !ok { + return nil, false + } + if pk.Q, in, ok = getMPI(in); !ok { + return nil, false + } + if pk.G, in, ok = getMPI(in); !ok { + return nil, false + } + if pk.Y, in, ok = getMPI(in); !ok { + return nil, false + } + + return in, true +} + +func (pk *PublicKey) Serialize(in []byte) []byte { + in = appendU16(in, 0) + in = appendMPI(in, pk.P) + in = appendMPI(in, pk.Q) + in = appendMPI(in, pk.G) + in = appendMPI(in, pk.Y) + return in +} + +// Fingerprint returns the 20-byte, binary fingerprint of the PublicKey. +func (pk *PublicKey) Fingerprint() []byte { + b := pk.Serialize(nil) + h := sha1.New() + h.Write(b[2:]) + return h.Sum(nil) +} + +func (pk *PublicKey) Verify(hashed, sig []byte) ([]byte, bool) { + if len(sig) != 2*dsaSubgroupBytes { + return nil, false + } + r := new(big.Int).SetBytes(sig[:dsaSubgroupBytes]) + s := new(big.Int).SetBytes(sig[dsaSubgroupBytes:]) + ok := dsa.Verify(&pk.PublicKey, hashed, r, s) + return sig[dsaSubgroupBytes*2:], ok +} + +type PrivateKey struct { + PublicKey + dsa.PrivateKey +} + +func (priv *PrivateKey) Sign(rand io.Reader, hashed []byte) []byte { + r, s, err := dsa.Sign(rand, &priv.PrivateKey, hashed) + if err != nil { + panic(err.Error()) + } + rBytes := r.Bytes() + sBytes := s.Bytes() + if len(rBytes) > dsaSubgroupBytes || len(sBytes) > dsaSubgroupBytes { + panic("DSA signature too large") + } + + out := make([]byte, 2*dsaSubgroupBytes) + copy(out[dsaSubgroupBytes-len(rBytes):], rBytes) + copy(out[len(out)-len(sBytes):], sBytes) + return out +} + +func (priv *PrivateKey) Serialize(in []byte) []byte { + in = priv.PublicKey.Serialize(in) + in = appendMPI(in, priv.PrivateKey.X) + return in +} + +func (priv *PrivateKey) Parse(in []byte) ([]byte, bool) { + in, ok := priv.PublicKey.Parse(in) + if !ok { + return in, ok + } + priv.PrivateKey.PublicKey = priv.PublicKey.PublicKey + priv.PrivateKey.X, in, ok = getMPI(in) + return in, ok +} + +func (priv *PrivateKey) Generate(rand io.Reader) { + if err := dsa.GenerateParameters(&priv.PrivateKey.PublicKey.Parameters, rand, dsa.L1024N160); err != nil { + panic(err.Error()) + } + if err := dsa.GenerateKey(&priv.PrivateKey, rand); err != nil { + panic(err.Error()) + } + priv.PublicKey.PublicKey = priv.PrivateKey.PublicKey +} + +func notHex(r rune) bool { + if r >= '0' && r <= '9' || + r >= 'a' && r <= 'f' || + r >= 'A' && r <= 'F' { + return false + } + + return true +} + +// Import parses the contents of a libotr private key file. +func (priv *PrivateKey) Import(in []byte) bool { + mpiStart := []byte(" #") + + mpis := make([]*big.Int, 5) + + for i := 0; i < len(mpis); i++ { + start := bytes.Index(in, mpiStart) + if start == -1 { + return false + } + in = in[start+len(mpiStart):] + end := bytes.IndexFunc(in, notHex) + if end == -1 { + return false + } + hexBytes := in[:end] + in = in[end:] + + if len(hexBytes)&1 != 0 { + return false + } + + mpiBytes := make([]byte, len(hexBytes)/2) + if _, err := hex.Decode(mpiBytes, hexBytes); err != nil { + return false + } + + mpis[i] = new(big.Int).SetBytes(mpiBytes) + } + + for _, mpi := range mpis { + if mpi.Sign() <= 0 { + return false + } + } + + priv.PrivateKey.P = mpis[0] + priv.PrivateKey.Q = mpis[1] + priv.PrivateKey.G = mpis[2] + priv.PrivateKey.Y = mpis[3] + priv.PrivateKey.X = mpis[4] + priv.PublicKey.PublicKey = priv.PrivateKey.PublicKey + + a := new(big.Int).Exp(priv.PrivateKey.G, priv.PrivateKey.X, priv.PrivateKey.P) + return a.Cmp(priv.PrivateKey.Y) == 0 +} + +func getU8(in []byte) (uint8, []byte, bool) { + if len(in) < 1 { + return 0, in, false + } + return in[0], in[1:], true +} + +func getU16(in []byte) (uint16, []byte, bool) { + if len(in) < 2 { + return 0, in, false + } + r := uint16(in[0])<<8 | uint16(in[1]) + return r, in[2:], true +} + +func getU32(in []byte) (uint32, []byte, bool) { + if len(in) < 4 { + return 0, in, false + } + r := uint32(in[0])<<24 | uint32(in[1])<<16 | uint32(in[2])<<8 | uint32(in[3]) + return r, in[4:], true +} + +func getMPI(in []byte) (*big.Int, []byte, bool) { + l, in, ok := getU32(in) + if !ok || uint32(len(in)) < l { + return nil, in, false + } + r := new(big.Int).SetBytes(in[:l]) + return r, in[l:], true +} + +func getData(in []byte) ([]byte, []byte, bool) { + l, in, ok := getU32(in) + if !ok || uint32(len(in)) < l { + return nil, in, false + } + return in[:l], in[l:], true +} + +func getNBytes(in []byte, n int) ([]byte, []byte, bool) { + if len(in) < n { + return nil, in, false + } + return in[:n], in[n:], true +} + +func appendU16(out []byte, v uint16) []byte { + out = append(out, byte(v>>8), byte(v)) + return out +} + +func appendU32(out []byte, v uint32) []byte { + out = append(out, byte(v>>24), byte(v>>16), byte(v>>8), byte(v)) + return out +} + +func appendData(out, v []byte) []byte { + out = appendU32(out, uint32(len(v))) + out = append(out, v...) + return out +} + +func appendMPI(out []byte, v *big.Int) []byte { + vBytes := v.Bytes() + out = appendU32(out, uint32(len(vBytes))) + out = append(out, vBytes...) + return out +} + +func appendMPIs(out []byte, mpis ...*big.Int) []byte { + for _, mpi := range mpis { + out = appendMPI(out, mpi) + } + return out +} + +func zero(b []byte) { + for i := range b { + b[i] = 0 + } +} diff --git a/vendor/golang.org/x/crypto/otr/smp.go b/vendor/golang.org/x/crypto/otr/smp.go new file mode 100644 index 0000000000..dc6de4ee0e --- /dev/null +++ b/vendor/golang.org/x/crypto/otr/smp.go @@ -0,0 +1,572 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This file implements the Socialist Millionaires Protocol as described in +// http://www.cypherpunks.ca/otr/Protocol-v2-3.1.0.html. The protocol +// specification is required in order to understand this code and, where +// possible, the variable names in the code match up with the spec. + +package otr + +import ( + "bytes" + "crypto/sha256" + "errors" + "hash" + "math/big" +) + +type smpFailure string + +func (s smpFailure) Error() string { + return string(s) +} + +var smpFailureError = smpFailure("otr: SMP protocol failed") +var smpSecretMissingError = smpFailure("otr: mutual secret needed") + +const smpVersion = 1 + +const ( + smpState1 = iota + smpState2 + smpState3 + smpState4 +) + +type smpState struct { + state int + a2, a3, b2, b3, pb, qb *big.Int + g2a, g3a *big.Int + g2, g3 *big.Int + g3b, papb, qaqb, ra *big.Int + saved *tlv + secret *big.Int + question string +} + +func (c *Conversation) startSMP(question string) (tlvs []tlv) { + if c.smp.state != smpState1 { + tlvs = append(tlvs, c.generateSMPAbort()) + } + tlvs = append(tlvs, c.generateSMP1(question)) + c.smp.question = "" + c.smp.state = smpState2 + return +} + +func (c *Conversation) resetSMP() { + c.smp.state = smpState1 + c.smp.secret = nil + c.smp.question = "" +} + +func (c *Conversation) processSMP(in tlv) (out tlv, complete bool, err error) { + data := in.data + + switch in.typ { + case tlvTypeSMPAbort: + if c.smp.state != smpState1 { + err = smpFailureError + } + c.resetSMP() + return + case tlvTypeSMP1WithQuestion: + // We preprocess this into a SMP1 message. + nulPos := bytes.IndexByte(data, 0) + if nulPos == -1 { + err = errors.New("otr: SMP message with question didn't contain a NUL byte") + return + } + c.smp.question = string(data[:nulPos]) + data = data[nulPos+1:] + } + + numMPIs, data, ok := getU32(data) + if !ok || numMPIs > 20 { + err = errors.New("otr: corrupt SMP message") + return + } + + mpis := make([]*big.Int, numMPIs) + for i := range mpis { + var ok bool + mpis[i], data, ok = getMPI(data) + if !ok { + err = errors.New("otr: corrupt SMP message") + return + } + } + + switch in.typ { + case tlvTypeSMP1, tlvTypeSMP1WithQuestion: + if c.smp.state != smpState1 { + c.resetSMP() + out = c.generateSMPAbort() + return + } + if c.smp.secret == nil { + err = smpSecretMissingError + return + } + if err = c.processSMP1(mpis); err != nil { + return + } + c.smp.state = smpState3 + out = c.generateSMP2() + case tlvTypeSMP2: + if c.smp.state != smpState2 { + c.resetSMP() + out = c.generateSMPAbort() + return + } + if out, err = c.processSMP2(mpis); err != nil { + out = c.generateSMPAbort() + return + } + c.smp.state = smpState4 + case tlvTypeSMP3: + if c.smp.state != smpState3 { + c.resetSMP() + out = c.generateSMPAbort() + return + } + if out, err = c.processSMP3(mpis); err != nil { + return + } + c.smp.state = smpState1 + c.smp.secret = nil + complete = true + case tlvTypeSMP4: + if c.smp.state != smpState4 { + c.resetSMP() + out = c.generateSMPAbort() + return + } + if err = c.processSMP4(mpis); err != nil { + out = c.generateSMPAbort() + return + } + c.smp.state = smpState1 + c.smp.secret = nil + complete = true + default: + panic("unknown SMP message") + } + + return +} + +func (c *Conversation) calcSMPSecret(mutualSecret []byte, weStarted bool) { + h := sha256.New() + h.Write([]byte{smpVersion}) + if weStarted { + h.Write(c.PrivateKey.PublicKey.Fingerprint()) + h.Write(c.TheirPublicKey.Fingerprint()) + } else { + h.Write(c.TheirPublicKey.Fingerprint()) + h.Write(c.PrivateKey.PublicKey.Fingerprint()) + } + h.Write(c.SSID[:]) + h.Write(mutualSecret) + c.smp.secret = new(big.Int).SetBytes(h.Sum(nil)) +} + +func (c *Conversation) generateSMP1(question string) tlv { + var randBuf [16]byte + c.smp.a2 = c.randMPI(randBuf[:]) + c.smp.a3 = c.randMPI(randBuf[:]) + g2a := new(big.Int).Exp(g, c.smp.a2, p) + g3a := new(big.Int).Exp(g, c.smp.a3, p) + h := sha256.New() + + r2 := c.randMPI(randBuf[:]) + r := new(big.Int).Exp(g, r2, p) + c2 := new(big.Int).SetBytes(hashMPIs(h, 1, r)) + d2 := new(big.Int).Mul(c.smp.a2, c2) + d2.Sub(r2, d2) + d2.Mod(d2, q) + if d2.Sign() < 0 { + d2.Add(d2, q) + } + + r3 := c.randMPI(randBuf[:]) + r.Exp(g, r3, p) + c3 := new(big.Int).SetBytes(hashMPIs(h, 2, r)) + d3 := new(big.Int).Mul(c.smp.a3, c3) + d3.Sub(r3, d3) + d3.Mod(d3, q) + if d3.Sign() < 0 { + d3.Add(d3, q) + } + + var ret tlv + if len(question) > 0 { + ret.typ = tlvTypeSMP1WithQuestion + ret.data = append(ret.data, question...) + ret.data = append(ret.data, 0) + } else { + ret.typ = tlvTypeSMP1 + } + ret.data = appendU32(ret.data, 6) + ret.data = appendMPIs(ret.data, g2a, c2, d2, g3a, c3, d3) + return ret +} + +func (c *Conversation) processSMP1(mpis []*big.Int) error { + if len(mpis) != 6 { + return errors.New("otr: incorrect number of arguments in SMP1 message") + } + g2a := mpis[0] + c2 := mpis[1] + d2 := mpis[2] + g3a := mpis[3] + c3 := mpis[4] + d3 := mpis[5] + h := sha256.New() + + r := new(big.Int).Exp(g, d2, p) + s := new(big.Int).Exp(g2a, c2, p) + r.Mul(r, s) + r.Mod(r, p) + t := new(big.Int).SetBytes(hashMPIs(h, 1, r)) + if c2.Cmp(t) != 0 { + return errors.New("otr: ZKP c2 incorrect in SMP1 message") + } + r.Exp(g, d3, p) + s.Exp(g3a, c3, p) + r.Mul(r, s) + r.Mod(r, p) + t.SetBytes(hashMPIs(h, 2, r)) + if c3.Cmp(t) != 0 { + return errors.New("otr: ZKP c3 incorrect in SMP1 message") + } + + c.smp.g2a = g2a + c.smp.g3a = g3a + return nil +} + +func (c *Conversation) generateSMP2() tlv { + var randBuf [16]byte + b2 := c.randMPI(randBuf[:]) + c.smp.b3 = c.randMPI(randBuf[:]) + r2 := c.randMPI(randBuf[:]) + r3 := c.randMPI(randBuf[:]) + r4 := c.randMPI(randBuf[:]) + r5 := c.randMPI(randBuf[:]) + r6 := c.randMPI(randBuf[:]) + + g2b := new(big.Int).Exp(g, b2, p) + g3b := new(big.Int).Exp(g, c.smp.b3, p) + + r := new(big.Int).Exp(g, r2, p) + h := sha256.New() + c2 := new(big.Int).SetBytes(hashMPIs(h, 3, r)) + d2 := new(big.Int).Mul(b2, c2) + d2.Sub(r2, d2) + d2.Mod(d2, q) + if d2.Sign() < 0 { + d2.Add(d2, q) + } + + r.Exp(g, r3, p) + c3 := new(big.Int).SetBytes(hashMPIs(h, 4, r)) + d3 := new(big.Int).Mul(c.smp.b3, c3) + d3.Sub(r3, d3) + d3.Mod(d3, q) + if d3.Sign() < 0 { + d3.Add(d3, q) + } + + c.smp.g2 = new(big.Int).Exp(c.smp.g2a, b2, p) + c.smp.g3 = new(big.Int).Exp(c.smp.g3a, c.smp.b3, p) + c.smp.pb = new(big.Int).Exp(c.smp.g3, r4, p) + c.smp.qb = new(big.Int).Exp(g, r4, p) + r.Exp(c.smp.g2, c.smp.secret, p) + c.smp.qb.Mul(c.smp.qb, r) + c.smp.qb.Mod(c.smp.qb, p) + + s := new(big.Int) + s.Exp(c.smp.g2, r6, p) + r.Exp(g, r5, p) + s.Mul(r, s) + s.Mod(s, p) + r.Exp(c.smp.g3, r5, p) + cp := new(big.Int).SetBytes(hashMPIs(h, 5, r, s)) + + // D5 = r5 - r4 cP mod q and D6 = r6 - y cP mod q + + s.Mul(r4, cp) + r.Sub(r5, s) + d5 := new(big.Int).Mod(r, q) + if d5.Sign() < 0 { + d5.Add(d5, q) + } + + s.Mul(c.smp.secret, cp) + r.Sub(r6, s) + d6 := new(big.Int).Mod(r, q) + if d6.Sign() < 0 { + d6.Add(d6, q) + } + + var ret tlv + ret.typ = tlvTypeSMP2 + ret.data = appendU32(ret.data, 11) + ret.data = appendMPIs(ret.data, g2b, c2, d2, g3b, c3, d3, c.smp.pb, c.smp.qb, cp, d5, d6) + return ret +} + +func (c *Conversation) processSMP2(mpis []*big.Int) (out tlv, err error) { + if len(mpis) != 11 { + err = errors.New("otr: incorrect number of arguments in SMP2 message") + return + } + g2b := mpis[0] + c2 := mpis[1] + d2 := mpis[2] + g3b := mpis[3] + c3 := mpis[4] + d3 := mpis[5] + pb := mpis[6] + qb := mpis[7] + cp := mpis[8] + d5 := mpis[9] + d6 := mpis[10] + h := sha256.New() + + r := new(big.Int).Exp(g, d2, p) + s := new(big.Int).Exp(g2b, c2, p) + r.Mul(r, s) + r.Mod(r, p) + s.SetBytes(hashMPIs(h, 3, r)) + if c2.Cmp(s) != 0 { + err = errors.New("otr: ZKP c2 failed in SMP2 message") + return + } + + r.Exp(g, d3, p) + s.Exp(g3b, c3, p) + r.Mul(r, s) + r.Mod(r, p) + s.SetBytes(hashMPIs(h, 4, r)) + if c3.Cmp(s) != 0 { + err = errors.New("otr: ZKP c3 failed in SMP2 message") + return + } + + c.smp.g2 = new(big.Int).Exp(g2b, c.smp.a2, p) + c.smp.g3 = new(big.Int).Exp(g3b, c.smp.a3, p) + + r.Exp(g, d5, p) + s.Exp(c.smp.g2, d6, p) + r.Mul(r, s) + s.Exp(qb, cp, p) + r.Mul(r, s) + r.Mod(r, p) + + s.Exp(c.smp.g3, d5, p) + t := new(big.Int).Exp(pb, cp, p) + s.Mul(s, t) + s.Mod(s, p) + t.SetBytes(hashMPIs(h, 5, s, r)) + if cp.Cmp(t) != 0 { + err = errors.New("otr: ZKP cP failed in SMP2 message") + return + } + + var randBuf [16]byte + r4 := c.randMPI(randBuf[:]) + r5 := c.randMPI(randBuf[:]) + r6 := c.randMPI(randBuf[:]) + r7 := c.randMPI(randBuf[:]) + + pa := new(big.Int).Exp(c.smp.g3, r4, p) + r.Exp(c.smp.g2, c.smp.secret, p) + qa := new(big.Int).Exp(g, r4, p) + qa.Mul(qa, r) + qa.Mod(qa, p) + + r.Exp(g, r5, p) + s.Exp(c.smp.g2, r6, p) + r.Mul(r, s) + r.Mod(r, p) + + s.Exp(c.smp.g3, r5, p) + cp.SetBytes(hashMPIs(h, 6, s, r)) + + r.Mul(r4, cp) + d5 = new(big.Int).Sub(r5, r) + d5.Mod(d5, q) + if d5.Sign() < 0 { + d5.Add(d5, q) + } + + r.Mul(c.smp.secret, cp) + d6 = new(big.Int).Sub(r6, r) + d6.Mod(d6, q) + if d6.Sign() < 0 { + d6.Add(d6, q) + } + + r.ModInverse(qb, p) + qaqb := new(big.Int).Mul(qa, r) + qaqb.Mod(qaqb, p) + + ra := new(big.Int).Exp(qaqb, c.smp.a3, p) + r.Exp(qaqb, r7, p) + s.Exp(g, r7, p) + cr := new(big.Int).SetBytes(hashMPIs(h, 7, s, r)) + + r.Mul(c.smp.a3, cr) + d7 := new(big.Int).Sub(r7, r) + d7.Mod(d7, q) + if d7.Sign() < 0 { + d7.Add(d7, q) + } + + c.smp.g3b = g3b + c.smp.qaqb = qaqb + + r.ModInverse(pb, p) + c.smp.papb = new(big.Int).Mul(pa, r) + c.smp.papb.Mod(c.smp.papb, p) + c.smp.ra = ra + + out.typ = tlvTypeSMP3 + out.data = appendU32(out.data, 8) + out.data = appendMPIs(out.data, pa, qa, cp, d5, d6, ra, cr, d7) + return +} + +func (c *Conversation) processSMP3(mpis []*big.Int) (out tlv, err error) { + if len(mpis) != 8 { + err = errors.New("otr: incorrect number of arguments in SMP3 message") + return + } + pa := mpis[0] + qa := mpis[1] + cp := mpis[2] + d5 := mpis[3] + d6 := mpis[4] + ra := mpis[5] + cr := mpis[6] + d7 := mpis[7] + h := sha256.New() + + r := new(big.Int).Exp(g, d5, p) + s := new(big.Int).Exp(c.smp.g2, d6, p) + r.Mul(r, s) + s.Exp(qa, cp, p) + r.Mul(r, s) + r.Mod(r, p) + + s.Exp(c.smp.g3, d5, p) + t := new(big.Int).Exp(pa, cp, p) + s.Mul(s, t) + s.Mod(s, p) + t.SetBytes(hashMPIs(h, 6, s, r)) + if t.Cmp(cp) != 0 { + err = errors.New("otr: ZKP cP failed in SMP3 message") + return + } + + r.ModInverse(c.smp.qb, p) + qaqb := new(big.Int).Mul(qa, r) + qaqb.Mod(qaqb, p) + + r.Exp(qaqb, d7, p) + s.Exp(ra, cr, p) + r.Mul(r, s) + r.Mod(r, p) + + s.Exp(g, d7, p) + t.Exp(c.smp.g3a, cr, p) + s.Mul(s, t) + s.Mod(s, p) + t.SetBytes(hashMPIs(h, 7, s, r)) + if t.Cmp(cr) != 0 { + err = errors.New("otr: ZKP cR failed in SMP3 message") + return + } + + var randBuf [16]byte + r7 := c.randMPI(randBuf[:]) + rb := new(big.Int).Exp(qaqb, c.smp.b3, p) + + r.Exp(qaqb, r7, p) + s.Exp(g, r7, p) + cr = new(big.Int).SetBytes(hashMPIs(h, 8, s, r)) + + r.Mul(c.smp.b3, cr) + d7 = new(big.Int).Sub(r7, r) + d7.Mod(d7, q) + if d7.Sign() < 0 { + d7.Add(d7, q) + } + + out.typ = tlvTypeSMP4 + out.data = appendU32(out.data, 3) + out.data = appendMPIs(out.data, rb, cr, d7) + + r.ModInverse(c.smp.pb, p) + r.Mul(pa, r) + r.Mod(r, p) + s.Exp(ra, c.smp.b3, p) + if r.Cmp(s) != 0 { + err = smpFailureError + } + + return +} + +func (c *Conversation) processSMP4(mpis []*big.Int) error { + if len(mpis) != 3 { + return errors.New("otr: incorrect number of arguments in SMP4 message") + } + rb := mpis[0] + cr := mpis[1] + d7 := mpis[2] + h := sha256.New() + + r := new(big.Int).Exp(c.smp.qaqb, d7, p) + s := new(big.Int).Exp(rb, cr, p) + r.Mul(r, s) + r.Mod(r, p) + + s.Exp(g, d7, p) + t := new(big.Int).Exp(c.smp.g3b, cr, p) + s.Mul(s, t) + s.Mod(s, p) + t.SetBytes(hashMPIs(h, 8, s, r)) + if t.Cmp(cr) != 0 { + return errors.New("otr: ZKP cR failed in SMP4 message") + } + + r.Exp(rb, c.smp.a3, p) + if r.Cmp(c.smp.papb) != 0 { + return smpFailureError + } + + return nil +} + +func (c *Conversation) generateSMPAbort() tlv { + return tlv{typ: tlvTypeSMPAbort} +} + +func hashMPIs(h hash.Hash, magic byte, mpis ...*big.Int) []byte { + if h != nil { + h.Reset() + } else { + h = sha256.New() + } + + h.Write([]byte{magic}) + for _, mpi := range mpis { + h.Write(appendMPI(nil, mpi)) + } + return h.Sum(nil) +} diff --git a/vendor/golang.org/x/crypto/ssh/test/doc.go b/vendor/golang.org/x/crypto/ssh/test/doc.go new file mode 100644 index 0000000000..198f0ca1e2 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/test/doc.go @@ -0,0 +1,7 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package test contains integration tests for the +// golang.org/x/crypto/ssh package. +package test // import "golang.org/x/crypto/ssh/test" diff --git a/vendor/golang.org/x/crypto/ssh/test/sshd_test_pw.c b/vendor/golang.org/x/crypto/ssh/test/sshd_test_pw.c new file mode 100644 index 0000000000..2794a563a4 --- /dev/null +++ b/vendor/golang.org/x/crypto/ssh/test/sshd_test_pw.c @@ -0,0 +1,173 @@ +// Copyright 2017 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// sshd_test_pw.c +// Wrapper to inject test password data for sshd PAM authentication +// +// This wrapper implements custom versions of getpwnam, getpwnam_r, +// getspnam and getspnam_r. These functions first call their real +// libc versions, then check if the requested user matches test user +// specified in env variable TEST_USER and if so replace the password +// with crypted() value of TEST_PASSWD env variable. +// +// Compile: +// gcc -Wall -shared -o sshd_test_pw.so -fPIC sshd_test_pw.c +// +// Compile with debug: +// gcc -DVERBOSE -Wall -shared -o sshd_test_pw.so -fPIC sshd_test_pw.c +// +// Run sshd: +// LD_PRELOAD="sshd_test_pw.so" TEST_USER="..." TEST_PASSWD="..." sshd ... + +// +build ignore + +#define _GNU_SOURCE +#include +#include +#include +#include +#include +#include +#include + +#ifdef VERBOSE +#define DEBUG(X...) fprintf(stderr, X) +#else +#define DEBUG(X...) while (0) { } +#endif + +/* crypt() password */ +static char * +pwhash(char *passwd) { + return strdup(crypt(passwd, "$6$")); +} + +/* Pointers to real functions in libc */ +static struct passwd * (*real_getpwnam)(const char *) = NULL; +static int (*real_getpwnam_r)(const char *, struct passwd *, char *, size_t, struct passwd **) = NULL; +static struct spwd * (*real_getspnam)(const char *) = NULL; +static int (*real_getspnam_r)(const char *, struct spwd *, char *, size_t, struct spwd **) = NULL; + +/* Cached test user and test password */ +static char *test_user = NULL; +static char *test_passwd_hash = NULL; + +static void +init(void) { + /* Fetch real libc function pointers */ + real_getpwnam = dlsym(RTLD_NEXT, "getpwnam"); + real_getpwnam_r = dlsym(RTLD_NEXT, "getpwnam_r"); + real_getspnam = dlsym(RTLD_NEXT, "getspnam"); + real_getspnam_r = dlsym(RTLD_NEXT, "getspnam_r"); + + /* abort if env variables are not defined */ + if (getenv("TEST_USER") == NULL || getenv("TEST_PASSWD") == NULL) { + fprintf(stderr, "env variables TEST_USER and TEST_PASSWD are missing\n"); + abort(); + } + + /* Fetch test user and test password from env */ + test_user = strdup(getenv("TEST_USER")); + test_passwd_hash = pwhash(getenv("TEST_PASSWD")); + + DEBUG("sshd_test_pw init():\n"); + DEBUG("\treal_getpwnam: %p\n", real_getpwnam); + DEBUG("\treal_getpwnam_r: %p\n", real_getpwnam_r); + DEBUG("\treal_getspnam: %p\n", real_getspnam); + DEBUG("\treal_getspnam_r: %p\n", real_getspnam_r); + DEBUG("\tTEST_USER: '%s'\n", test_user); + DEBUG("\tTEST_PASSWD: '%s'\n", getenv("TEST_PASSWD")); + DEBUG("\tTEST_PASSWD_HASH: '%s'\n", test_passwd_hash); +} + +static int +is_test_user(const char *name) { + if (test_user != NULL && strcmp(test_user, name) == 0) + return 1; + return 0; +} + +/* getpwnam */ + +struct passwd * +getpwnam(const char *name) { + struct passwd *pw; + + DEBUG("sshd_test_pw getpwnam(%s)\n", name); + + if (real_getpwnam == NULL) + init(); + if ((pw = real_getpwnam(name)) == NULL) + return NULL; + + if (is_test_user(name)) + pw->pw_passwd = strdup(test_passwd_hash); + + return pw; +} + +/* getpwnam_r */ + +int +getpwnam_r(const char *name, + struct passwd *pwd, + char *buf, + size_t buflen, + struct passwd **result) { + int r; + + DEBUG("sshd_test_pw getpwnam_r(%s)\n", name); + + if (real_getpwnam_r == NULL) + init(); + if ((r = real_getpwnam_r(name, pwd, buf, buflen, result)) != 0 || *result == NULL) + return r; + + if (is_test_user(name)) + pwd->pw_passwd = strdup(test_passwd_hash); + + return 0; +} + +/* getspnam */ + +struct spwd * +getspnam(const char *name) { + struct spwd *sp; + + DEBUG("sshd_test_pw getspnam(%s)\n", name); + + if (real_getspnam == NULL) + init(); + if ((sp = real_getspnam(name)) == NULL) + return NULL; + + if (is_test_user(name)) + sp->sp_pwdp = strdup(test_passwd_hash); + + return sp; +} + +/* getspnam_r */ + +int +getspnam_r(const char *name, + struct spwd *spbuf, + char *buf, + size_t buflen, + struct spwd **spbufp) { + int r; + + DEBUG("sshd_test_pw getspnam_r(%s)\n", name); + + if (real_getspnam_r == NULL) + init(); + if ((r = real_getspnam_r(name, spbuf, buf, buflen, spbufp)) != 0) + return r; + + if (is_test_user(name)) + spbuf->sp_pwdp = strdup(test_passwd_hash); + + return r; +} diff --git a/vendor/golang.org/x/net/bpf/instructions.go b/vendor/golang.org/x/net/bpf/instructions.go index 3b4fd08916..f9dc0e8ee7 100644 --- a/vendor/golang.org/x/net/bpf/instructions.go +++ b/vendor/golang.org/x/net/bpf/instructions.go @@ -198,7 +198,7 @@ func (a LoadConstant) Assemble() (RawInstruction, error) { return assembleLoad(a.Dst, 4, opAddrModeImmediate, a.Val) } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a LoadConstant) String() string { switch a.Dst { case RegA: @@ -224,7 +224,7 @@ func (a LoadScratch) Assemble() (RawInstruction, error) { return assembleLoad(a.Dst, 4, opAddrModeScratch, uint32(a.N)) } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a LoadScratch) String() string { switch a.Dst { case RegA: @@ -248,7 +248,7 @@ func (a LoadAbsolute) Assemble() (RawInstruction, error) { return assembleLoad(RegA, a.Size, opAddrModeAbsolute, a.Off) } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a LoadAbsolute) String() string { switch a.Size { case 1: // byte @@ -277,7 +277,7 @@ func (a LoadIndirect) Assemble() (RawInstruction, error) { return assembleLoad(RegA, a.Size, opAddrModeIndirect, a.Off) } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a LoadIndirect) String() string { switch a.Size { case 1: // byte @@ -306,7 +306,7 @@ func (a LoadMemShift) Assemble() (RawInstruction, error) { return assembleLoad(RegX, 1, opAddrModeMemShift, a.Off) } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a LoadMemShift) String() string { return fmt.Sprintf("ldx 4*([%d]&0xf)", a.Off) } @@ -325,7 +325,7 @@ func (a LoadExtension) Assemble() (RawInstruction, error) { return assembleLoad(RegA, 4, opAddrModeAbsolute, uint32(extOffset+a.Num)) } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a LoadExtension) String() string { switch a.Num { case ExtLen: @@ -392,7 +392,7 @@ func (a StoreScratch) Assemble() (RawInstruction, error) { }, nil } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a StoreScratch) String() string { switch a.Src { case RegA: @@ -418,7 +418,7 @@ func (a ALUOpConstant) Assemble() (RawInstruction, error) { }, nil } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a ALUOpConstant) String() string { switch a.Op { case ALUOpAdd: @@ -458,7 +458,7 @@ func (a ALUOpX) Assemble() (RawInstruction, error) { }, nil } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a ALUOpX) String() string { switch a.Op { case ALUOpAdd: @@ -496,7 +496,7 @@ func (a NegateA) Assemble() (RawInstruction, error) { }, nil } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a NegateA) String() string { return fmt.Sprintf("neg") } @@ -514,7 +514,7 @@ func (a Jump) Assemble() (RawInstruction, error) { }, nil } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a Jump) String() string { return fmt.Sprintf("ja %d", a.Skip) } @@ -566,7 +566,7 @@ func (a JumpIf) Assemble() (RawInstruction, error) { }, nil } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a JumpIf) String() string { switch a.Cond { // K == A @@ -621,7 +621,7 @@ func (a RetA) Assemble() (RawInstruction, error) { }, nil } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a RetA) String() string { return fmt.Sprintf("ret a") } @@ -639,7 +639,7 @@ func (a RetConstant) Assemble() (RawInstruction, error) { }, nil } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a RetConstant) String() string { return fmt.Sprintf("ret #%d", a.Val) } @@ -654,7 +654,7 @@ func (a TXA) Assemble() (RawInstruction, error) { }, nil } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a TXA) String() string { return fmt.Sprintf("txa") } @@ -669,7 +669,7 @@ func (a TAX) Assemble() (RawInstruction, error) { }, nil } -// String returns the the instruction in assembler notation. +// String returns the instruction in assembler notation. func (a TAX) String() string { return fmt.Sprintf("tax") } diff --git a/vendor/golang.org/x/net/internal/iana/const.go b/vendor/golang.org/x/net/internal/iana/const.go index c9df24d95f..cea712fac0 100644 --- a/vendor/golang.org/x/net/internal/iana/const.go +++ b/vendor/golang.org/x/net/internal/iana/const.go @@ -1,44 +1,40 @@ // go generate gen.go -// GENERATED BY THE COMMAND ABOVE; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. // Package iana provides protocol number resources managed by the Internet Assigned Numbers Authority (IANA). package iana // import "golang.org/x/net/internal/iana" -// Differentiated Services Field Codepoints (DSCP), Updated: 2017-05-12 +// Differentiated Services Field Codepoints (DSCP), Updated: 2018-05-04 const ( - DiffServCS0 = 0x0 // CS0 - DiffServCS1 = 0x20 // CS1 - DiffServCS2 = 0x40 // CS2 - DiffServCS3 = 0x60 // CS3 - DiffServCS4 = 0x80 // CS4 - DiffServCS5 = 0xa0 // CS5 - DiffServCS6 = 0xc0 // CS6 - DiffServCS7 = 0xe0 // CS7 - DiffServAF11 = 0x28 // AF11 - DiffServAF12 = 0x30 // AF12 - DiffServAF13 = 0x38 // AF13 - DiffServAF21 = 0x48 // AF21 - DiffServAF22 = 0x50 // AF22 - DiffServAF23 = 0x58 // AF23 - DiffServAF31 = 0x68 // AF31 - DiffServAF32 = 0x70 // AF32 - DiffServAF33 = 0x78 // AF33 - DiffServAF41 = 0x88 // AF41 - DiffServAF42 = 0x90 // AF42 - DiffServAF43 = 0x98 // AF43 - DiffServEF = 0xb8 // EF - DiffServVOICEADMIT = 0xb0 // VOICE-ADMIT + DiffServCS0 = 0x00 // CS0 + DiffServCS1 = 0x20 // CS1 + DiffServCS2 = 0x40 // CS2 + DiffServCS3 = 0x60 // CS3 + DiffServCS4 = 0x80 // CS4 + DiffServCS5 = 0xa0 // CS5 + DiffServCS6 = 0xc0 // CS6 + DiffServCS7 = 0xe0 // CS7 + DiffServAF11 = 0x28 // AF11 + DiffServAF12 = 0x30 // AF12 + DiffServAF13 = 0x38 // AF13 + DiffServAF21 = 0x48 // AF21 + DiffServAF22 = 0x50 // AF22 + DiffServAF23 = 0x58 // AF23 + DiffServAF31 = 0x68 // AF31 + DiffServAF32 = 0x70 // AF32 + DiffServAF33 = 0x78 // AF33 + DiffServAF41 = 0x88 // AF41 + DiffServAF42 = 0x90 // AF42 + DiffServAF43 = 0x98 // AF43 + DiffServEF = 0xb8 // EF + DiffServVOICEADMIT = 0xb0 // VOICE-ADMIT + NotECNTransport = 0x00 // Not-ECT (Not ECN-Capable Transport) + ECNTransport1 = 0x01 // ECT(1) (ECN-Capable Transport(1)) + ECNTransport0 = 0x02 // ECT(0) (ECN-Capable Transport(0)) + CongestionExperienced = 0x03 // CE (Congestion Experienced) ) -// IPv4 TOS Byte and IPv6 Traffic Class Octet, Updated: 2001-09-06 -const ( - NotECNTransport = 0x0 // Not-ECT (Not ECN-Capable Transport) - ECNTransport1 = 0x1 // ECT(1) (ECN-Capable Transport(1)) - ECNTransport0 = 0x2 // ECT(0) (ECN-Capable Transport(0)) - CongestionExperienced = 0x3 // CE (Congestion Experienced) -) - -// Protocol Numbers, Updated: 2016-06-22 +// Protocol Numbers, Updated: 2017-10-13 const ( ProtocolIP = 0 // IPv4 encapsulation, pseudo protocol number ProtocolHOPOPT = 0 // IPv6 Hop-by-Hop Option @@ -178,3 +174,50 @@ const ( ProtocolROHC = 142 // Robust Header Compression ProtocolReserved = 255 // Reserved ) + +// Address Family Numbers, Updated: 2018-04-02 +const ( + AddrFamilyIPv4 = 1 // IP (IP version 4) + AddrFamilyIPv6 = 2 // IP6 (IP version 6) + AddrFamilyNSAP = 3 // NSAP + AddrFamilyHDLC = 4 // HDLC (8-bit multidrop) + AddrFamilyBBN1822 = 5 // BBN 1822 + AddrFamily802 = 6 // 802 (includes all 802 media plus Ethernet "canonical format") + AddrFamilyE163 = 7 // E.163 + AddrFamilyE164 = 8 // E.164 (SMDS, Frame Relay, ATM) + AddrFamilyF69 = 9 // F.69 (Telex) + AddrFamilyX121 = 10 // X.121 (X.25, Frame Relay) + AddrFamilyIPX = 11 // IPX + AddrFamilyAppletalk = 12 // Appletalk + AddrFamilyDecnetIV = 13 // Decnet IV + AddrFamilyBanyanVines = 14 // Banyan Vines + AddrFamilyE164withSubaddress = 15 // E.164 with NSAP format subaddress + AddrFamilyDNS = 16 // DNS (Domain Name System) + AddrFamilyDistinguishedName = 17 // Distinguished Name + AddrFamilyASNumber = 18 // AS Number + AddrFamilyXTPoverIPv4 = 19 // XTP over IP version 4 + AddrFamilyXTPoverIPv6 = 20 // XTP over IP version 6 + AddrFamilyXTPnativemodeXTP = 21 // XTP native mode XTP + AddrFamilyFibreChannelWorldWidePortName = 22 // Fibre Channel World-Wide Port Name + AddrFamilyFibreChannelWorldWideNodeName = 23 // Fibre Channel World-Wide Node Name + AddrFamilyGWID = 24 // GWID + AddrFamilyL2VPN = 25 // AFI for L2VPN information + AddrFamilyMPLSTPSectionEndpointID = 26 // MPLS-TP Section Endpoint Identifier + AddrFamilyMPLSTPLSPEndpointID = 27 // MPLS-TP LSP Endpoint Identifier + AddrFamilyMPLSTPPseudowireEndpointID = 28 // MPLS-TP Pseudowire Endpoint Identifier + AddrFamilyMTIPv4 = 29 // MT IP: Multi-Topology IP version 4 + AddrFamilyMTIPv6 = 30 // MT IPv6: Multi-Topology IP version 6 + AddrFamilyEIGRPCommonServiceFamily = 16384 // EIGRP Common Service Family + AddrFamilyEIGRPIPv4ServiceFamily = 16385 // EIGRP IPv4 Service Family + AddrFamilyEIGRPIPv6ServiceFamily = 16386 // EIGRP IPv6 Service Family + AddrFamilyLISPCanonicalAddressFormat = 16387 // LISP Canonical Address Format (LCAF) + AddrFamilyBGPLS = 16388 // BGP-LS + AddrFamily48bitMAC = 16389 // 48-bit MAC + AddrFamily64bitMAC = 16390 // 64-bit MAC + AddrFamilyOUI = 16391 // OUI + AddrFamilyMACFinal24bits = 16392 // MAC/24 + AddrFamilyMACFinal40bits = 16393 // MAC/40 + AddrFamilyIPv6Initial64bits = 16394 // IPv6/64 + AddrFamilyRBridgePortID = 16395 // RBridge Port ID + AddrFamilyTRILLNickname = 16396 // TRILL Nickname +) diff --git a/vendor/golang.org/x/net/internal/socket/zsys_netbsd_arm.go b/vendor/golang.org/x/net/internal/socket/zsys_netbsd_arm.go index 206ea2d115..db60491fe3 100644 --- a/vendor/golang.org/x/net/internal/socket/zsys_netbsd_arm.go +++ b/vendor/golang.org/x/net/internal/socket/zsys_netbsd_arm.go @@ -26,6 +26,11 @@ type msghdr struct { Flags int32 } +type mmsghdr struct { + Hdr msghdr + Len uint32 +} + type cmsghdr struct { Len uint32 Level int32 @@ -52,6 +57,7 @@ type sockaddrInet6 struct { const ( sizeofIovec = 0x8 sizeofMsghdr = 0x1c + sizeofMmsghdr = 0x20 sizeofCmsghdr = 0xc sizeofSockaddrInet = 0x10 diff --git a/vendor/golang.org/x/net/internal/socks/client.go b/vendor/golang.org/x/net/internal/socks/client.go new file mode 100644 index 0000000000..3d6f516a59 --- /dev/null +++ b/vendor/golang.org/x/net/internal/socks/client.go @@ -0,0 +1,168 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package socks + +import ( + "context" + "errors" + "io" + "net" + "strconv" + "time" +) + +var ( + noDeadline = time.Time{} + aLongTimeAgo = time.Unix(1, 0) +) + +func (d *Dialer) connect(ctx context.Context, c net.Conn, address string) (_ net.Addr, ctxErr error) { + host, port, err := splitHostPort(address) + if err != nil { + return nil, err + } + if deadline, ok := ctx.Deadline(); ok && !deadline.IsZero() { + c.SetDeadline(deadline) + defer c.SetDeadline(noDeadline) + } + if ctx != context.Background() { + errCh := make(chan error, 1) + done := make(chan struct{}) + defer func() { + close(done) + if ctxErr == nil { + ctxErr = <-errCh + } + }() + go func() { + select { + case <-ctx.Done(): + c.SetDeadline(aLongTimeAgo) + errCh <- ctx.Err() + case <-done: + errCh <- nil + } + }() + } + + b := make([]byte, 0, 6+len(host)) // the size here is just an estimate + b = append(b, Version5) + if len(d.AuthMethods) == 0 || d.Authenticate == nil { + b = append(b, 1, byte(AuthMethodNotRequired)) + } else { + ams := d.AuthMethods + if len(ams) > 255 { + return nil, errors.New("too many authentication methods") + } + b = append(b, byte(len(ams))) + for _, am := range ams { + b = append(b, byte(am)) + } + } + if _, ctxErr = c.Write(b); ctxErr != nil { + return + } + + if _, ctxErr = io.ReadFull(c, b[:2]); ctxErr != nil { + return + } + if b[0] != Version5 { + return nil, errors.New("unexpected protocol version " + strconv.Itoa(int(b[0]))) + } + am := AuthMethod(b[1]) + if am == AuthMethodNoAcceptableMethods { + return nil, errors.New("no acceptable authentication methods") + } + if d.Authenticate != nil { + if ctxErr = d.Authenticate(ctx, c, am); ctxErr != nil { + return + } + } + + b = b[:0] + b = append(b, Version5, byte(d.cmd), 0) + if ip := net.ParseIP(host); ip != nil { + if ip4 := ip.To4(); ip4 != nil { + b = append(b, AddrTypeIPv4) + b = append(b, ip4...) + } else if ip6 := ip.To16(); ip6 != nil { + b = append(b, AddrTypeIPv6) + b = append(b, ip6...) + } else { + return nil, errors.New("unknown address type") + } + } else { + if len(host) > 255 { + return nil, errors.New("FQDN too long") + } + b = append(b, AddrTypeFQDN) + b = append(b, byte(len(host))) + b = append(b, host...) + } + b = append(b, byte(port>>8), byte(port)) + if _, ctxErr = c.Write(b); ctxErr != nil { + return + } + + if _, ctxErr = io.ReadFull(c, b[:4]); ctxErr != nil { + return + } + if b[0] != Version5 { + return nil, errors.New("unexpected protocol version " + strconv.Itoa(int(b[0]))) + } + if cmdErr := Reply(b[1]); cmdErr != StatusSucceeded { + return nil, errors.New("unknown error " + cmdErr.String()) + } + if b[2] != 0 { + return nil, errors.New("non-zero reserved field") + } + l := 2 + var a Addr + switch b[3] { + case AddrTypeIPv4: + l += net.IPv4len + a.IP = make(net.IP, net.IPv4len) + case AddrTypeIPv6: + l += net.IPv6len + a.IP = make(net.IP, net.IPv6len) + case AddrTypeFQDN: + if _, err := io.ReadFull(c, b[:1]); err != nil { + return nil, err + } + l += int(b[0]) + default: + return nil, errors.New("unknown address type " + strconv.Itoa(int(b[3]))) + } + if cap(b) < l { + b = make([]byte, l) + } else { + b = b[:l] + } + if _, ctxErr = io.ReadFull(c, b); ctxErr != nil { + return + } + if a.IP != nil { + copy(a.IP, b) + } else { + a.Name = string(b[:len(b)-2]) + } + a.Port = int(b[len(b)-2])<<8 | int(b[len(b)-1]) + return &a, nil +} + +func splitHostPort(address string) (string, int, error) { + host, port, err := net.SplitHostPort(address) + if err != nil { + return "", 0, err + } + portnum, err := strconv.Atoi(port) + if err != nil { + return "", 0, err + } + if 1 > portnum || portnum > 0xffff { + return "", 0, errors.New("port number out of range " + port) + } + return host, portnum, nil +} diff --git a/vendor/golang.org/x/net/internal/socks/socks.go b/vendor/golang.org/x/net/internal/socks/socks.go new file mode 100644 index 0000000000..d93e699b46 --- /dev/null +++ b/vendor/golang.org/x/net/internal/socks/socks.go @@ -0,0 +1,316 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package socks provides a SOCKS version 5 client implementation. +// +// SOCKS protocol version 5 is defined in RFC 1928. +// Username/Password authentication for SOCKS version 5 is defined in +// RFC 1929. +package socks + +import ( + "context" + "errors" + "io" + "net" + "strconv" +) + +// A Command represents a SOCKS command. +type Command int + +func (cmd Command) String() string { + switch cmd { + case CmdConnect: + return "socks connect" + case cmdBind: + return "socks bind" + default: + return "socks " + strconv.Itoa(int(cmd)) + } +} + +// An AuthMethod represents a SOCKS authentication method. +type AuthMethod int + +// A Reply represents a SOCKS command reply code. +type Reply int + +func (code Reply) String() string { + switch code { + case StatusSucceeded: + return "succeeded" + case 0x01: + return "general SOCKS server failure" + case 0x02: + return "connection not allowed by ruleset" + case 0x03: + return "network unreachable" + case 0x04: + return "host unreachable" + case 0x05: + return "connection refused" + case 0x06: + return "TTL expired" + case 0x07: + return "command not supported" + case 0x08: + return "address type not supported" + default: + return "unknown code: " + strconv.Itoa(int(code)) + } +} + +// Wire protocol constants. +const ( + Version5 = 0x05 + + AddrTypeIPv4 = 0x01 + AddrTypeFQDN = 0x03 + AddrTypeIPv6 = 0x04 + + CmdConnect Command = 0x01 // establishes an active-open forward proxy connection + cmdBind Command = 0x02 // establishes a passive-open forward proxy connection + + AuthMethodNotRequired AuthMethod = 0x00 // no authentication required + AuthMethodUsernamePassword AuthMethod = 0x02 // use username/password + AuthMethodNoAcceptableMethods AuthMethod = 0xff // no acceptable authentication methods + + StatusSucceeded Reply = 0x00 +) + +// An Addr represents a SOCKS-specific address. +// Either Name or IP is used exclusively. +type Addr struct { + Name string // fully-qualified domain name + IP net.IP + Port int +} + +func (a *Addr) Network() string { return "socks" } + +func (a *Addr) String() string { + if a == nil { + return "" + } + port := strconv.Itoa(a.Port) + if a.IP == nil { + return net.JoinHostPort(a.Name, port) + } + return net.JoinHostPort(a.IP.String(), port) +} + +// A Conn represents a forward proxy connection. +type Conn struct { + net.Conn + + boundAddr net.Addr +} + +// BoundAddr returns the address assigned by the proxy server for +// connecting to the command target address from the proxy server. +func (c *Conn) BoundAddr() net.Addr { + if c == nil { + return nil + } + return c.boundAddr +} + +// A Dialer holds SOCKS-specific options. +type Dialer struct { + cmd Command // either CmdConnect or cmdBind + proxyNetwork string // network between a proxy server and a client + proxyAddress string // proxy server address + + // ProxyDial specifies the optional dial function for + // establishing the transport connection. + ProxyDial func(context.Context, string, string) (net.Conn, error) + + // AuthMethods specifies the list of request authention + // methods. + // If empty, SOCKS client requests only AuthMethodNotRequired. + AuthMethods []AuthMethod + + // Authenticate specifies the optional authentication + // function. It must be non-nil when AuthMethods is not empty. + // It must return an error when the authentication is failed. + Authenticate func(context.Context, io.ReadWriter, AuthMethod) error +} + +// DialContext connects to the provided address on the provided +// network. +// +// The returned error value may be a net.OpError. When the Op field of +// net.OpError contains "socks", the Source field contains a proxy +// server address and the Addr field contains a command target +// address. +// +// See func Dial of the net package of standard library for a +// description of the network and address parameters. +func (d *Dialer) DialContext(ctx context.Context, network, address string) (net.Conn, error) { + if err := d.validateTarget(network, address); err != nil { + proxy, dst, _ := d.pathAddrs(address) + return nil, &net.OpError{Op: d.cmd.String(), Net: network, Source: proxy, Addr: dst, Err: err} + } + if ctx == nil { + proxy, dst, _ := d.pathAddrs(address) + return nil, &net.OpError{Op: d.cmd.String(), Net: network, Source: proxy, Addr: dst, Err: errors.New("nil context")} + } + var err error + var c net.Conn + if d.ProxyDial != nil { + c, err = d.ProxyDial(ctx, d.proxyNetwork, d.proxyAddress) + } else { + var dd net.Dialer + c, err = dd.DialContext(ctx, d.proxyNetwork, d.proxyAddress) + } + if err != nil { + proxy, dst, _ := d.pathAddrs(address) + return nil, &net.OpError{Op: d.cmd.String(), Net: network, Source: proxy, Addr: dst, Err: err} + } + a, err := d.connect(ctx, c, address) + if err != nil { + c.Close() + proxy, dst, _ := d.pathAddrs(address) + return nil, &net.OpError{Op: d.cmd.String(), Net: network, Source: proxy, Addr: dst, Err: err} + } + return &Conn{Conn: c, boundAddr: a}, nil +} + +// DialWithConn initiates a connection from SOCKS server to the target +// network and address using the connection c that is already +// connected to the SOCKS server. +// +// It returns the connection's local address assigned by the SOCKS +// server. +func (d *Dialer) DialWithConn(ctx context.Context, c net.Conn, network, address string) (net.Addr, error) { + if err := d.validateTarget(network, address); err != nil { + proxy, dst, _ := d.pathAddrs(address) + return nil, &net.OpError{Op: d.cmd.String(), Net: network, Source: proxy, Addr: dst, Err: err} + } + if ctx == nil { + proxy, dst, _ := d.pathAddrs(address) + return nil, &net.OpError{Op: d.cmd.String(), Net: network, Source: proxy, Addr: dst, Err: errors.New("nil context")} + } + a, err := d.connect(ctx, c, address) + if err != nil { + proxy, dst, _ := d.pathAddrs(address) + return nil, &net.OpError{Op: d.cmd.String(), Net: network, Source: proxy, Addr: dst, Err: err} + } + return a, nil +} + +// Dial connects to the provided address on the provided network. +// +// Unlike DialContext, it returns a raw transport connection instead +// of a forward proxy connection. +// +// Deprecated: Use DialContext or DialWithConn instead. +func (d *Dialer) Dial(network, address string) (net.Conn, error) { + if err := d.validateTarget(network, address); err != nil { + proxy, dst, _ := d.pathAddrs(address) + return nil, &net.OpError{Op: d.cmd.String(), Net: network, Source: proxy, Addr: dst, Err: err} + } + var err error + var c net.Conn + if d.ProxyDial != nil { + c, err = d.ProxyDial(context.Background(), d.proxyNetwork, d.proxyAddress) + } else { + c, err = net.Dial(d.proxyNetwork, d.proxyAddress) + } + if err != nil { + proxy, dst, _ := d.pathAddrs(address) + return nil, &net.OpError{Op: d.cmd.String(), Net: network, Source: proxy, Addr: dst, Err: err} + } + if _, err := d.DialWithConn(context.Background(), c, network, address); err != nil { + return nil, err + } + return c, nil +} + +func (d *Dialer) validateTarget(network, address string) error { + switch network { + case "tcp", "tcp6", "tcp4": + default: + return errors.New("network not implemented") + } + switch d.cmd { + case CmdConnect, cmdBind: + default: + return errors.New("command not implemented") + } + return nil +} + +func (d *Dialer) pathAddrs(address string) (proxy, dst net.Addr, err error) { + for i, s := range []string{d.proxyAddress, address} { + host, port, err := splitHostPort(s) + if err != nil { + return nil, nil, err + } + a := &Addr{Port: port} + a.IP = net.ParseIP(host) + if a.IP == nil { + a.Name = host + } + if i == 0 { + proxy = a + } else { + dst = a + } + } + return +} + +// NewDialer returns a new Dialer that dials through the provided +// proxy server's network and address. +func NewDialer(network, address string) *Dialer { + return &Dialer{proxyNetwork: network, proxyAddress: address, cmd: CmdConnect} +} + +const ( + authUsernamePasswordVersion = 0x01 + authStatusSucceeded = 0x00 +) + +// UsernamePassword are the credentials for the username/password +// authentication method. +type UsernamePassword struct { + Username string + Password string +} + +// Authenticate authenticates a pair of username and password with the +// proxy server. +func (up *UsernamePassword) Authenticate(ctx context.Context, rw io.ReadWriter, auth AuthMethod) error { + switch auth { + case AuthMethodNotRequired: + return nil + case AuthMethodUsernamePassword: + if len(up.Username) == 0 || len(up.Username) > 255 || len(up.Password) == 0 || len(up.Password) > 255 { + return errors.New("invalid username/password") + } + b := []byte{authUsernamePasswordVersion} + b = append(b, byte(len(up.Username))) + b = append(b, up.Username...) + b = append(b, byte(len(up.Password))) + b = append(b, up.Password...) + // TODO(mikio): handle IO deadlines and cancelation if + // necessary + if _, err := rw.Write(b); err != nil { + return err + } + if _, err := io.ReadFull(rw, b[:2]); err != nil { + return err + } + if b[0] != authUsernamePasswordVersion { + return errors.New("invalid username/password version") + } + if b[1] != authStatusSucceeded { + return errors.New("username/password authentication failed") + } + return nil + } + return errors.New("unsupported authentication method " + strconv.Itoa(int(auth))) +} diff --git a/vendor/golang.org/x/net/ipv4/batch.go b/vendor/golang.org/x/net/ipv4/batch.go index b445499288..5ce9b3583c 100644 --- a/vendor/golang.org/x/net/ipv4/batch.go +++ b/vendor/golang.org/x/net/ipv4/batch.go @@ -9,7 +9,6 @@ package ipv4 import ( "net" "runtime" - "syscall" "golang.org/x/net/internal/socket" ) @@ -76,7 +75,7 @@ type Message = socket.Message // headers. func (c *payloadHandler) ReadBatch(ms []Message, flags int) (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } switch runtime.GOOS { case "linux": @@ -107,7 +106,7 @@ func (c *payloadHandler) ReadBatch(ms []Message, flags int) (int, error) { // On other platforms, this method will write only a single message. func (c *payloadHandler) WriteBatch(ms []Message, flags int) (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } switch runtime.GOOS { case "linux": @@ -139,7 +138,7 @@ func (c *payloadHandler) WriteBatch(ms []Message, flags int) (int, error) { // On other platforms, this method will read only a single message. func (c *packetHandler) ReadBatch(ms []Message, flags int) (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } switch runtime.GOOS { case "linux": @@ -170,7 +169,7 @@ func (c *packetHandler) ReadBatch(ms []Message, flags int) (int, error) { // On other platforms, this method will write only a single message. func (c *packetHandler) WriteBatch(ms []Message, flags int) (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } switch runtime.GOOS { case "linux": diff --git a/vendor/golang.org/x/net/ipv4/dgramopt.go b/vendor/golang.org/x/net/ipv4/dgramopt.go index 54d77d5fed..36764492d9 100644 --- a/vendor/golang.org/x/net/ipv4/dgramopt.go +++ b/vendor/golang.org/x/net/ipv4/dgramopt.go @@ -6,7 +6,6 @@ package ipv4 import ( "net" - "syscall" "golang.org/x/net/bpf" ) @@ -15,7 +14,7 @@ import ( // multicast packets. func (c *dgramOpt) MulticastTTL() (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } so, ok := sockOpts[ssoMulticastTTL] if !ok { @@ -28,7 +27,7 @@ func (c *dgramOpt) MulticastTTL() (int, error) { // outgoing multicast packets. func (c *dgramOpt) SetMulticastTTL(ttl int) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoMulticastTTL] if !ok { @@ -41,7 +40,7 @@ func (c *dgramOpt) SetMulticastTTL(ttl int) error { // packet transmissions. func (c *dgramOpt) MulticastInterface() (*net.Interface, error) { if !c.ok() { - return nil, syscall.EINVAL + return nil, errInvalidConn } so, ok := sockOpts[ssoMulticastInterface] if !ok { @@ -54,7 +53,7 @@ func (c *dgramOpt) MulticastInterface() (*net.Interface, error) { // multicast packet transmissions. func (c *dgramOpt) SetMulticastInterface(ifi *net.Interface) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoMulticastInterface] if !ok { @@ -67,7 +66,7 @@ func (c *dgramOpt) SetMulticastInterface(ifi *net.Interface) error { // should be copied and send back to the originator. func (c *dgramOpt) MulticastLoopback() (bool, error) { if !c.ok() { - return false, syscall.EINVAL + return false, errInvalidConn } so, ok := sockOpts[ssoMulticastLoopback] if !ok { @@ -84,7 +83,7 @@ func (c *dgramOpt) MulticastLoopback() (bool, error) { // should be copied and send back to the originator. func (c *dgramOpt) SetMulticastLoopback(on bool) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoMulticastLoopback] if !ok { @@ -104,7 +103,7 @@ func (c *dgramOpt) SetMulticastLoopback(on bool) error { // configuration. func (c *dgramOpt) JoinGroup(ifi *net.Interface, group net.Addr) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoJoinGroup] if !ok { @@ -122,7 +121,7 @@ func (c *dgramOpt) JoinGroup(ifi *net.Interface, group net.Addr) error { // source-specific group. func (c *dgramOpt) LeaveGroup(ifi *net.Interface, group net.Addr) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoLeaveGroup] if !ok { @@ -143,7 +142,7 @@ func (c *dgramOpt) LeaveGroup(ifi *net.Interface, group net.Addr) error { // routing configuration. func (c *dgramOpt) JoinSourceSpecificGroup(ifi *net.Interface, group, source net.Addr) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoJoinSourceGroup] if !ok { @@ -164,7 +163,7 @@ func (c *dgramOpt) JoinSourceSpecificGroup(ifi *net.Interface, group, source net // interface ifi. func (c *dgramOpt) LeaveSourceSpecificGroup(ifi *net.Interface, group, source net.Addr) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoLeaveSourceGroup] if !ok { @@ -186,7 +185,7 @@ func (c *dgramOpt) LeaveSourceSpecificGroup(ifi *net.Interface, group, source ne // ifi. func (c *dgramOpt) ExcludeSourceSpecificGroup(ifi *net.Interface, group, source net.Addr) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoBlockSourceGroup] if !ok { @@ -207,7 +206,7 @@ func (c *dgramOpt) ExcludeSourceSpecificGroup(ifi *net.Interface, group, source // group by ExcludeSourceSpecificGroup again on the interface ifi. func (c *dgramOpt) IncludeSourceSpecificGroup(ifi *net.Interface, group, source net.Addr) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoUnblockSourceGroup] if !ok { @@ -228,7 +227,7 @@ func (c *dgramOpt) IncludeSourceSpecificGroup(ifi *net.Interface, group, source // Currently only Linux supports this. func (c *dgramOpt) ICMPFilter() (*ICMPFilter, error) { if !c.ok() { - return nil, syscall.EINVAL + return nil, errInvalidConn } so, ok := sockOpts[ssoICMPFilter] if !ok { @@ -241,7 +240,7 @@ func (c *dgramOpt) ICMPFilter() (*ICMPFilter, error) { // Currently only Linux supports this. func (c *dgramOpt) SetICMPFilter(f *ICMPFilter) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoICMPFilter] if !ok { @@ -255,7 +254,7 @@ func (c *dgramOpt) SetICMPFilter(f *ICMPFilter) error { // Only supported on Linux. func (c *dgramOpt) SetBPF(filter []bpf.RawInstruction) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoAttachFilter] if !ok { diff --git a/vendor/golang.org/x/net/ipv4/doc.go b/vendor/golang.org/x/net/ipv4/doc.go index b43935a5ae..d12455548f 100644 --- a/vendor/golang.org/x/net/ipv4/doc.go +++ b/vendor/golang.org/x/net/ipv4/doc.go @@ -241,4 +241,4 @@ // IncludeSourceSpecificGroup may return an error. package ipv4 // import "golang.org/x/net/ipv4" -// BUG(mikio): This package is not implemented on NaCl and Plan 9. +// BUG(mikio): This package is not implemented on JS, NaCl and Plan 9. diff --git a/vendor/golang.org/x/net/ipv4/endpoint.go b/vendor/golang.org/x/net/ipv4/endpoint.go index 2ab8773630..5009463787 100644 --- a/vendor/golang.org/x/net/ipv4/endpoint.go +++ b/vendor/golang.org/x/net/ipv4/endpoint.go @@ -6,7 +6,6 @@ package ipv4 import ( "net" - "syscall" "time" "golang.org/x/net/internal/socket" @@ -58,7 +57,7 @@ func (c *dgramOpt) ok() bool { return c != nil && c.Conn != nil } // SetControlMessage sets the per packet IP-level socket options. func (c *PacketConn) SetControlMessage(cf ControlFlags, on bool) error { if !c.payloadHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return setControlMessage(c.dgramOpt.Conn, &c.payloadHandler.rawOpt, cf, on) } @@ -67,7 +66,7 @@ func (c *PacketConn) SetControlMessage(cf ControlFlags, on bool) error { // endpoint. func (c *PacketConn) SetDeadline(t time.Time) error { if !c.payloadHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return c.payloadHandler.PacketConn.SetDeadline(t) } @@ -76,7 +75,7 @@ func (c *PacketConn) SetDeadline(t time.Time) error { // endpoint. func (c *PacketConn) SetReadDeadline(t time.Time) error { if !c.payloadHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return c.payloadHandler.PacketConn.SetReadDeadline(t) } @@ -85,7 +84,7 @@ func (c *PacketConn) SetReadDeadline(t time.Time) error { // endpoint. func (c *PacketConn) SetWriteDeadline(t time.Time) error { if !c.payloadHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return c.payloadHandler.PacketConn.SetWriteDeadline(t) } @@ -93,7 +92,7 @@ func (c *PacketConn) SetWriteDeadline(t time.Time) error { // Close closes the endpoint. func (c *PacketConn) Close() error { if !c.payloadHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return c.payloadHandler.PacketConn.Close() } @@ -124,7 +123,7 @@ type RawConn struct { // SetControlMessage sets the per packet IP-level socket options. func (c *RawConn) SetControlMessage(cf ControlFlags, on bool) error { if !c.packetHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return setControlMessage(c.dgramOpt.Conn, &c.packetHandler.rawOpt, cf, on) } @@ -133,7 +132,7 @@ func (c *RawConn) SetControlMessage(cf ControlFlags, on bool) error { // endpoint. func (c *RawConn) SetDeadline(t time.Time) error { if !c.packetHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return c.packetHandler.IPConn.SetDeadline(t) } @@ -142,7 +141,7 @@ func (c *RawConn) SetDeadline(t time.Time) error { // endpoint. func (c *RawConn) SetReadDeadline(t time.Time) error { if !c.packetHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return c.packetHandler.IPConn.SetReadDeadline(t) } @@ -151,7 +150,7 @@ func (c *RawConn) SetReadDeadline(t time.Time) error { // endpoint. func (c *RawConn) SetWriteDeadline(t time.Time) error { if !c.packetHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return c.packetHandler.IPConn.SetWriteDeadline(t) } @@ -159,7 +158,7 @@ func (c *RawConn) SetWriteDeadline(t time.Time) error { // Close closes the endpoint. func (c *RawConn) Close() error { if !c.packetHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return c.packetHandler.IPConn.Close() } diff --git a/vendor/golang.org/x/net/ipv4/genericopt.go b/vendor/golang.org/x/net/ipv4/genericopt.go index 119bf841b6..587ae4a194 100644 --- a/vendor/golang.org/x/net/ipv4/genericopt.go +++ b/vendor/golang.org/x/net/ipv4/genericopt.go @@ -4,12 +4,10 @@ package ipv4 -import "syscall" - // TOS returns the type-of-service field value for outgoing packets. func (c *genericOpt) TOS() (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } so, ok := sockOpts[ssoTOS] if !ok { @@ -22,7 +20,7 @@ func (c *genericOpt) TOS() (int, error) { // packets. func (c *genericOpt) SetTOS(tos int) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoTOS] if !ok { @@ -34,7 +32,7 @@ func (c *genericOpt) SetTOS(tos int) error { // TTL returns the time-to-live field value for outgoing packets. func (c *genericOpt) TTL() (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } so, ok := sockOpts[ssoTTL] if !ok { @@ -47,7 +45,7 @@ func (c *genericOpt) TTL() (int, error) { // packets. func (c *genericOpt) SetTTL(ttl int) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoTTL] if !ok { diff --git a/vendor/golang.org/x/net/ipv4/header.go b/vendor/golang.org/x/net/ipv4/header.go index 8bb0f0f4d4..358afe2f11 100644 --- a/vendor/golang.org/x/net/ipv4/header.go +++ b/vendor/golang.org/x/net/ipv4/header.go @@ -9,7 +9,6 @@ import ( "fmt" "net" "runtime" - "syscall" "golang.org/x/net/internal/socket" ) @@ -54,7 +53,7 @@ func (h *Header) String() string { // Marshal returns the binary encoding of h. func (h *Header) Marshal() ([]byte, error) { if h == nil { - return nil, syscall.EINVAL + return nil, errInvalidConn } if h.Len < HeaderLen { return nil, errHeaderTooShort @@ -98,7 +97,7 @@ func (h *Header) Marshal() ([]byte, error) { return b, nil } -// Parse parses b as an IPv4 header and sotres the result in h. +// Parse parses b as an IPv4 header and stores the result in h. func (h *Header) Parse(b []byte) error { if h == nil || len(b) < HeaderLen { return errHeaderTooShort diff --git a/vendor/golang.org/x/net/ipv4/helper.go b/vendor/golang.org/x/net/ipv4/helper.go index a5052e3249..8d8ff98e94 100644 --- a/vendor/golang.org/x/net/ipv4/helper.go +++ b/vendor/golang.org/x/net/ipv4/helper.go @@ -10,6 +10,7 @@ import ( ) var ( + errInvalidConn = errors.New("invalid connection") errMissingAddress = errors.New("missing address") errMissingHeader = errors.New("missing header") errHeaderTooShort = errors.New("header too short") diff --git a/vendor/golang.org/x/net/ipv4/iana.go b/vendor/golang.org/x/net/ipv4/iana.go index be10c94888..4375b4099b 100644 --- a/vendor/golang.org/x/net/ipv4/iana.go +++ b/vendor/golang.org/x/net/ipv4/iana.go @@ -1,9 +1,9 @@ // go generate gen.go -// GENERATED BY THE COMMAND ABOVE; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. package ipv4 -// Internet Control Message Protocol (ICMP) Parameters, Updated: 2013-04-19 +// Internet Control Message Protocol (ICMP) Parameters, Updated: 2018-02-26 const ( ICMPTypeEchoReply ICMPType = 0 // Echo Reply ICMPTypeDestinationUnreachable ICMPType = 3 // Destination Unreachable @@ -16,9 +16,11 @@ const ( ICMPTypeTimestamp ICMPType = 13 // Timestamp ICMPTypeTimestampReply ICMPType = 14 // Timestamp Reply ICMPTypePhoturis ICMPType = 40 // Photuris + ICMPTypeExtendedEchoRequest ICMPType = 42 // Extended Echo Request + ICMPTypeExtendedEchoReply ICMPType = 43 // Extended Echo Reply ) -// Internet Control Message Protocol (ICMP) Parameters, Updated: 2013-04-19 +// Internet Control Message Protocol (ICMP) Parameters, Updated: 2018-02-26 var icmpTypes = map[ICMPType]string{ 0: "echo reply", 3: "destination unreachable", @@ -31,4 +33,6 @@ var icmpTypes = map[ICMPType]string{ 13: "timestamp", 14: "timestamp reply", 40: "photuris", + 42: "extended echo request", + 43: "extended echo reply", } diff --git a/vendor/golang.org/x/net/ipv4/packet.go b/vendor/golang.org/x/net/ipv4/packet.go index f00f5b052f..966bb776f5 100644 --- a/vendor/golang.org/x/net/ipv4/packet.go +++ b/vendor/golang.org/x/net/ipv4/packet.go @@ -6,7 +6,6 @@ package ipv4 import ( "net" - "syscall" "golang.org/x/net/internal/socket" ) @@ -28,7 +27,7 @@ func (c *packetHandler) ok() bool { return c != nil && c.IPConn != nil && c.Conn // header h, the payload p and the control message cm. func (c *packetHandler) ReadFrom(b []byte) (h *Header, p []byte, cm *ControlMessage, err error) { if !c.ok() { - return nil, nil, nil, syscall.EINVAL + return nil, nil, nil, errInvalidConn } return c.readFrom(b) } @@ -63,7 +62,7 @@ func slicePacket(b []byte) (h, p []byte, err error) { // Options = optional func (c *packetHandler) WriteTo(h *Header, p []byte, cm *ControlMessage) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } return c.writeTo(h, p, cm) } diff --git a/vendor/golang.org/x/net/ipv4/payload_cmsg.go b/vendor/golang.org/x/net/ipv4/payload_cmsg.go index 3f06d76063..204a49fea7 100644 --- a/vendor/golang.org/x/net/ipv4/payload_cmsg.go +++ b/vendor/golang.org/x/net/ipv4/payload_cmsg.go @@ -2,14 +2,11 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. -// +build !nacl,!plan9,!windows +// +build !js,!nacl,!plan9,!windows package ipv4 -import ( - "net" - "syscall" -) +import "net" // ReadFrom reads a payload of the received IPv4 datagram, from the // endpoint c, copying the payload into b. It returns the number of @@ -17,7 +14,7 @@ import ( // src of the received datagram. func (c *payloadHandler) ReadFrom(b []byte) (n int, cm *ControlMessage, src net.Addr, err error) { if !c.ok() { - return 0, nil, nil, syscall.EINVAL + return 0, nil, nil, errInvalidConn } return c.readFrom(b) } @@ -30,7 +27,7 @@ func (c *payloadHandler) ReadFrom(b []byte) (n int, cm *ControlMessage, src net. // control of the outgoing datagram is not required. func (c *payloadHandler) WriteTo(b []byte, cm *ControlMessage, dst net.Addr) (n int, err error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } return c.writeTo(b, cm, dst) } diff --git a/vendor/golang.org/x/net/ipv4/payload_cmsg_go1_8.go b/vendor/golang.org/x/net/ipv4/payload_cmsg_go1_8.go index d26ccd90c4..8d45599f48 100644 --- a/vendor/golang.org/x/net/ipv4/payload_cmsg_go1_8.go +++ b/vendor/golang.org/x/net/ipv4/payload_cmsg_go1_8.go @@ -3,7 +3,7 @@ // license that can be found in the LICENSE file. // +build !go1.9 -// +build !nacl,!plan9,!windows +// +build !js,!nacl,!plan9,!windows package ipv4 diff --git a/vendor/golang.org/x/net/ipv4/payload_cmsg_go1_9.go b/vendor/golang.org/x/net/ipv4/payload_cmsg_go1_9.go index 2f19311839..4081aad8bc 100644 --- a/vendor/golang.org/x/net/ipv4/payload_cmsg_go1_9.go +++ b/vendor/golang.org/x/net/ipv4/payload_cmsg_go1_9.go @@ -3,7 +3,7 @@ // license that can be found in the LICENSE file. // +build go1.9 -// +build !nacl,!plan9,!windows +// +build !js,!nacl,!plan9,!windows package ipv4 diff --git a/vendor/golang.org/x/net/ipv4/payload_nocmsg.go b/vendor/golang.org/x/net/ipv4/payload_nocmsg.go index 3926de70b8..1d434c61ac 100644 --- a/vendor/golang.org/x/net/ipv4/payload_nocmsg.go +++ b/vendor/golang.org/x/net/ipv4/payload_nocmsg.go @@ -2,14 +2,11 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. -// +build nacl plan9 windows +// +build js nacl plan9 windows package ipv4 -import ( - "net" - "syscall" -) +import "net" // ReadFrom reads a payload of the received IPv4 datagram, from the // endpoint c, copying the payload into b. It returns the number of @@ -17,7 +14,7 @@ import ( // src of the received datagram. func (c *payloadHandler) ReadFrom(b []byte) (n int, cm *ControlMessage, src net.Addr, err error) { if !c.ok() { - return 0, nil, nil, syscall.EINVAL + return 0, nil, nil, errInvalidConn } if n, src, err = c.PacketConn.ReadFrom(b); err != nil { return 0, nil, nil, err @@ -33,7 +30,7 @@ func (c *payloadHandler) ReadFrom(b []byte) (n int, cm *ControlMessage, src net. // control of the outgoing datagram is not required. func (c *payloadHandler) WriteTo(b []byte, cm *ControlMessage, dst net.Addr) (n int, err error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } if dst == nil { return 0, errMissingAddress diff --git a/vendor/golang.org/x/net/ipv6/batch.go b/vendor/golang.org/x/net/ipv6/batch.go index 4f5fe683d5..10d6492451 100644 --- a/vendor/golang.org/x/net/ipv6/batch.go +++ b/vendor/golang.org/x/net/ipv6/batch.go @@ -9,7 +9,6 @@ package ipv6 import ( "net" "runtime" - "syscall" "golang.org/x/net/internal/socket" ) @@ -67,7 +66,7 @@ type Message = socket.Message // On other platforms, this method will read only a single message. func (c *payloadHandler) ReadBatch(ms []Message, flags int) (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } switch runtime.GOOS { case "linux": @@ -98,7 +97,7 @@ func (c *payloadHandler) ReadBatch(ms []Message, flags int) (int, error) { // On other platforms, this method will write only a single message. func (c *payloadHandler) WriteBatch(ms []Message, flags int) (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } switch runtime.GOOS { case "linux": diff --git a/vendor/golang.org/x/net/ipv6/dgramopt.go b/vendor/golang.org/x/net/ipv6/dgramopt.go index 703dafe84a..eea4fde256 100644 --- a/vendor/golang.org/x/net/ipv6/dgramopt.go +++ b/vendor/golang.org/x/net/ipv6/dgramopt.go @@ -6,7 +6,6 @@ package ipv6 import ( "net" - "syscall" "golang.org/x/net/bpf" ) @@ -15,7 +14,7 @@ import ( // multicast packets. func (c *dgramOpt) MulticastHopLimit() (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } so, ok := sockOpts[ssoMulticastHopLimit] if !ok { @@ -28,7 +27,7 @@ func (c *dgramOpt) MulticastHopLimit() (int, error) { // outgoing multicast packets. func (c *dgramOpt) SetMulticastHopLimit(hoplim int) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoMulticastHopLimit] if !ok { @@ -41,7 +40,7 @@ func (c *dgramOpt) SetMulticastHopLimit(hoplim int) error { // packet transmissions. func (c *dgramOpt) MulticastInterface() (*net.Interface, error) { if !c.ok() { - return nil, syscall.EINVAL + return nil, errInvalidConn } so, ok := sockOpts[ssoMulticastInterface] if !ok { @@ -54,7 +53,7 @@ func (c *dgramOpt) MulticastInterface() (*net.Interface, error) { // multicast packet transmissions. func (c *dgramOpt) SetMulticastInterface(ifi *net.Interface) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoMulticastInterface] if !ok { @@ -67,7 +66,7 @@ func (c *dgramOpt) SetMulticastInterface(ifi *net.Interface) error { // should be copied and send back to the originator. func (c *dgramOpt) MulticastLoopback() (bool, error) { if !c.ok() { - return false, syscall.EINVAL + return false, errInvalidConn } so, ok := sockOpts[ssoMulticastLoopback] if !ok { @@ -84,7 +83,7 @@ func (c *dgramOpt) MulticastLoopback() (bool, error) { // should be copied and send back to the originator. func (c *dgramOpt) SetMulticastLoopback(on bool) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoMulticastLoopback] if !ok { @@ -104,7 +103,7 @@ func (c *dgramOpt) SetMulticastLoopback(on bool) error { // configuration. func (c *dgramOpt) JoinGroup(ifi *net.Interface, group net.Addr) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoJoinGroup] if !ok { @@ -122,7 +121,7 @@ func (c *dgramOpt) JoinGroup(ifi *net.Interface, group net.Addr) error { // source-specific group. func (c *dgramOpt) LeaveGroup(ifi *net.Interface, group net.Addr) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoLeaveGroup] if !ok { @@ -143,7 +142,7 @@ func (c *dgramOpt) LeaveGroup(ifi *net.Interface, group net.Addr) error { // routing configuration. func (c *dgramOpt) JoinSourceSpecificGroup(ifi *net.Interface, group, source net.Addr) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoJoinSourceGroup] if !ok { @@ -164,7 +163,7 @@ func (c *dgramOpt) JoinSourceSpecificGroup(ifi *net.Interface, group, source net // interface ifi. func (c *dgramOpt) LeaveSourceSpecificGroup(ifi *net.Interface, group, source net.Addr) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoLeaveSourceGroup] if !ok { @@ -186,7 +185,7 @@ func (c *dgramOpt) LeaveSourceSpecificGroup(ifi *net.Interface, group, source ne // ifi. func (c *dgramOpt) ExcludeSourceSpecificGroup(ifi *net.Interface, group, source net.Addr) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoBlockSourceGroup] if !ok { @@ -207,7 +206,7 @@ func (c *dgramOpt) ExcludeSourceSpecificGroup(ifi *net.Interface, group, source // group by ExcludeSourceSpecificGroup again on the interface ifi. func (c *dgramOpt) IncludeSourceSpecificGroup(ifi *net.Interface, group, source net.Addr) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoUnblockSourceGroup] if !ok { @@ -230,7 +229,7 @@ func (c *dgramOpt) IncludeSourceSpecificGroup(ifi *net.Interface, group, source // field is located. func (c *dgramOpt) Checksum() (on bool, offset int, err error) { if !c.ok() { - return false, 0, syscall.EINVAL + return false, 0, errInvalidConn } so, ok := sockOpts[ssoChecksum] if !ok { @@ -251,7 +250,7 @@ func (c *dgramOpt) Checksum() (on bool, offset int, err error) { // checksum field is located. func (c *dgramOpt) SetChecksum(on bool, offset int) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoChecksum] if !ok { @@ -266,7 +265,7 @@ func (c *dgramOpt) SetChecksum(on bool, offset int) error { // ICMPFilter returns an ICMP filter. func (c *dgramOpt) ICMPFilter() (*ICMPFilter, error) { if !c.ok() { - return nil, syscall.EINVAL + return nil, errInvalidConn } so, ok := sockOpts[ssoICMPFilter] if !ok { @@ -278,7 +277,7 @@ func (c *dgramOpt) ICMPFilter() (*ICMPFilter, error) { // SetICMPFilter deploys the ICMP filter. func (c *dgramOpt) SetICMPFilter(f *ICMPFilter) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoICMPFilter] if !ok { @@ -292,7 +291,7 @@ func (c *dgramOpt) SetICMPFilter(f *ICMPFilter) error { // Only supported on Linux. func (c *dgramOpt) SetBPF(filter []bpf.RawInstruction) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoAttachFilter] if !ok { diff --git a/vendor/golang.org/x/net/ipv6/doc.go b/vendor/golang.org/x/net/ipv6/doc.go index 664a97dea1..cb40006232 100644 --- a/vendor/golang.org/x/net/ipv6/doc.go +++ b/vendor/golang.org/x/net/ipv6/doc.go @@ -240,4 +240,4 @@ // IncludeSourceSpecificGroup may return an error. package ipv6 // import "golang.org/x/net/ipv6" -// BUG(mikio): This package is not implemented on NaCl and Plan 9. +// BUG(mikio): This package is not implemented on JS, NaCl and Plan 9. diff --git a/vendor/golang.org/x/net/ipv6/endpoint.go b/vendor/golang.org/x/net/ipv6/endpoint.go index 0624c17404..9325756396 100644 --- a/vendor/golang.org/x/net/ipv6/endpoint.go +++ b/vendor/golang.org/x/net/ipv6/endpoint.go @@ -6,7 +6,6 @@ package ipv6 import ( "net" - "syscall" "time" "golang.org/x/net/internal/socket" @@ -34,7 +33,7 @@ func (c *genericOpt) ok() bool { return c != nil && c.Conn != nil } // with the endpoint. func (c *Conn) PathMTU() (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } so, ok := sockOpts[ssoPathMTU] if !ok { @@ -76,7 +75,7 @@ func (c *dgramOpt) ok() bool { return c != nil && c.Conn != nil } // socket options. func (c *PacketConn) SetControlMessage(cf ControlFlags, on bool) error { if !c.payloadHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return setControlMessage(c.dgramOpt.Conn, &c.payloadHandler.rawOpt, cf, on) } @@ -85,7 +84,7 @@ func (c *PacketConn) SetControlMessage(cf ControlFlags, on bool) error { // endpoint. func (c *PacketConn) SetDeadline(t time.Time) error { if !c.payloadHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return c.payloadHandler.SetDeadline(t) } @@ -94,7 +93,7 @@ func (c *PacketConn) SetDeadline(t time.Time) error { // endpoint. func (c *PacketConn) SetReadDeadline(t time.Time) error { if !c.payloadHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return c.payloadHandler.SetReadDeadline(t) } @@ -103,7 +102,7 @@ func (c *PacketConn) SetReadDeadline(t time.Time) error { // endpoint. func (c *PacketConn) SetWriteDeadline(t time.Time) error { if !c.payloadHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return c.payloadHandler.SetWriteDeadline(t) } @@ -111,7 +110,7 @@ func (c *PacketConn) SetWriteDeadline(t time.Time) error { // Close closes the endpoint. func (c *PacketConn) Close() error { if !c.payloadHandler.ok() { - return syscall.EINVAL + return errInvalidConn } return c.payloadHandler.Close() } diff --git a/vendor/golang.org/x/net/ipv6/genericopt.go b/vendor/golang.org/x/net/ipv6/genericopt.go index e9dbc2e189..1a18f7549a 100644 --- a/vendor/golang.org/x/net/ipv6/genericopt.go +++ b/vendor/golang.org/x/net/ipv6/genericopt.go @@ -4,13 +4,11 @@ package ipv6 -import "syscall" - // TrafficClass returns the traffic class field value for outgoing // packets. func (c *genericOpt) TrafficClass() (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } so, ok := sockOpts[ssoTrafficClass] if !ok { @@ -23,7 +21,7 @@ func (c *genericOpt) TrafficClass() (int, error) { // outgoing packets. func (c *genericOpt) SetTrafficClass(tclass int) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoTrafficClass] if !ok { @@ -35,7 +33,7 @@ func (c *genericOpt) SetTrafficClass(tclass int) error { // HopLimit returns the hop limit field value for outgoing packets. func (c *genericOpt) HopLimit() (int, error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } so, ok := sockOpts[ssoHopLimit] if !ok { @@ -48,7 +46,7 @@ func (c *genericOpt) HopLimit() (int, error) { // packets. func (c *genericOpt) SetHopLimit(hoplim int) error { if !c.ok() { - return syscall.EINVAL + return errInvalidConn } so, ok := sockOpts[ssoHopLimit] if !ok { diff --git a/vendor/golang.org/x/net/ipv6/helper.go b/vendor/golang.org/x/net/ipv6/helper.go index 259740132c..7ac5352294 100644 --- a/vendor/golang.org/x/net/ipv6/helper.go +++ b/vendor/golang.org/x/net/ipv6/helper.go @@ -10,6 +10,7 @@ import ( ) var ( + errInvalidConn = errors.New("invalid connection") errMissingAddress = errors.New("missing address") errHeaderTooShort = errors.New("header too short") errInvalidConnType = errors.New("invalid conn type") diff --git a/vendor/golang.org/x/net/ipv6/iana.go b/vendor/golang.org/x/net/ipv6/iana.go index 3c6214fb69..32db1aa949 100644 --- a/vendor/golang.org/x/net/ipv6/iana.go +++ b/vendor/golang.org/x/net/ipv6/iana.go @@ -1,9 +1,9 @@ // go generate gen.go -// GENERATED BY THE COMMAND ABOVE; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. package ipv6 -// Internet Control Message Protocol version 6 (ICMPv6) Parameters, Updated: 2015-07-07 +// Internet Control Message Protocol version 6 (ICMPv6) Parameters, Updated: 2018-03-09 const ( ICMPTypeDestinationUnreachable ICMPType = 1 // Destination Unreachable ICMPTypePacketTooBig ICMPType = 2 // Packet Too Big @@ -40,9 +40,11 @@ const ( ICMPTypeDuplicateAddressRequest ICMPType = 157 // Duplicate Address Request ICMPTypeDuplicateAddressConfirmation ICMPType = 158 // Duplicate Address Confirmation ICMPTypeMPLControl ICMPType = 159 // MPL Control Message + ICMPTypeExtendedEchoRequest ICMPType = 160 // Extended Echo Request + ICMPTypeExtendedEchoReply ICMPType = 161 // Extended Echo Reply ) -// Internet Control Message Protocol version 6 (ICMPv6) Parameters, Updated: 2015-07-07 +// Internet Control Message Protocol version 6 (ICMPv6) Parameters, Updated: 2018-03-09 var icmpTypes = map[ICMPType]string{ 1: "destination unreachable", 2: "packet too big", @@ -79,4 +81,6 @@ var icmpTypes = map[ICMPType]string{ 157: "duplicate address request", 158: "duplicate address confirmation", 159: "mpl control message", + 160: "extended echo request", + 161: "extended echo reply", } diff --git a/vendor/golang.org/x/net/ipv6/payload_cmsg.go b/vendor/golang.org/x/net/ipv6/payload_cmsg.go index 4ee4b062ca..3f23b5d21d 100644 --- a/vendor/golang.org/x/net/ipv6/payload_cmsg.go +++ b/vendor/golang.org/x/net/ipv6/payload_cmsg.go @@ -2,14 +2,11 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. -// +build !nacl,!plan9,!windows +// +build !js,!nacl,!plan9,!windows package ipv6 -import ( - "net" - "syscall" -) +import "net" // ReadFrom reads a payload of the received IPv6 datagram, from the // endpoint c, copying the payload into b. It returns the number of @@ -17,7 +14,7 @@ import ( // src of the received datagram. func (c *payloadHandler) ReadFrom(b []byte) (n int, cm *ControlMessage, src net.Addr, err error) { if !c.ok() { - return 0, nil, nil, syscall.EINVAL + return 0, nil, nil, errInvalidConn } return c.readFrom(b) } @@ -29,7 +26,7 @@ func (c *payloadHandler) ReadFrom(b []byte) (n int, cm *ControlMessage, src net. // cm may be nil if control of the outgoing datagram is not required. func (c *payloadHandler) WriteTo(b []byte, cm *ControlMessage, dst net.Addr) (n int, err error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } return c.writeTo(b, cm, dst) } diff --git a/vendor/golang.org/x/net/ipv6/payload_cmsg_go1_8.go b/vendor/golang.org/x/net/ipv6/payload_cmsg_go1_8.go index fdc6c39941..bc4209db70 100644 --- a/vendor/golang.org/x/net/ipv6/payload_cmsg_go1_8.go +++ b/vendor/golang.org/x/net/ipv6/payload_cmsg_go1_8.go @@ -3,7 +3,7 @@ // license that can be found in the LICENSE file. // +build !go1.9 -// +build !nacl,!plan9,!windows +// +build !js,!nacl,!plan9,!windows package ipv6 diff --git a/vendor/golang.org/x/net/ipv6/payload_cmsg_go1_9.go b/vendor/golang.org/x/net/ipv6/payload_cmsg_go1_9.go index 8f6d02e2f8..7dd6504802 100644 --- a/vendor/golang.org/x/net/ipv6/payload_cmsg_go1_9.go +++ b/vendor/golang.org/x/net/ipv6/payload_cmsg_go1_9.go @@ -3,7 +3,7 @@ // license that can be found in the LICENSE file. // +build go1.9 -// +build !nacl,!plan9,!windows +// +build !js,!nacl,!plan9,!windows package ipv6 diff --git a/vendor/golang.org/x/net/ipv6/payload_nocmsg.go b/vendor/golang.org/x/net/ipv6/payload_nocmsg.go index 99a43542b4..459142d264 100644 --- a/vendor/golang.org/x/net/ipv6/payload_nocmsg.go +++ b/vendor/golang.org/x/net/ipv6/payload_nocmsg.go @@ -2,14 +2,11 @@ // Use of this source code is governed by a BSD-style // license that can be found in the LICENSE file. -// +build nacl plan9 windows +// +build js nacl plan9 windows package ipv6 -import ( - "net" - "syscall" -) +import "net" // ReadFrom reads a payload of the received IPv6 datagram, from the // endpoint c, copying the payload into b. It returns the number of @@ -17,7 +14,7 @@ import ( // src of the received datagram. func (c *payloadHandler) ReadFrom(b []byte) (n int, cm *ControlMessage, src net.Addr, err error) { if !c.ok() { - return 0, nil, nil, syscall.EINVAL + return 0, nil, nil, errInvalidConn } if n, src, err = c.PacketConn.ReadFrom(b); err != nil { return 0, nil, nil, err @@ -32,7 +29,7 @@ func (c *payloadHandler) ReadFrom(b []byte) (n int, cm *ControlMessage, src net. // cm may be nil if control of the outgoing datagram is not required. func (c *payloadHandler) WriteTo(b []byte, cm *ControlMessage, dst net.Addr) (n int, err error) { if !c.ok() { - return 0, syscall.EINVAL + return 0, errInvalidConn } if dst == nil { return 0, errMissingAddress diff --git a/vendor/golang.org/x/net/proxy/socks5.go b/vendor/golang.org/x/net/proxy/socks5.go index 3fed38ef1c..56345ec8b6 100644 --- a/vendor/golang.org/x/net/proxy/socks5.go +++ b/vendor/golang.org/x/net/proxy/socks5.go @@ -5,210 +5,32 @@ package proxy import ( - "errors" - "io" + "context" "net" - "strconv" -) - -// SOCKS5 returns a Dialer that makes SOCKSv5 connections to the given address -// with an optional username and password. See RFC 1928 and RFC 1929. -func SOCKS5(network, addr string, auth *Auth, forward Dialer) (Dialer, error) { - s := &socks5{ - network: network, - addr: addr, - forward: forward, - } - if auth != nil { - s.user = auth.User - s.password = auth.Password - } - - return s, nil -} -type socks5 struct { - user, password string - network, addr string - forward Dialer -} - -const socks5Version = 5 - -const ( - socks5AuthNone = 0 - socks5AuthPassword = 2 + "golang.org/x/net/internal/socks" ) -const socks5Connect = 1 - -const ( - socks5IP4 = 1 - socks5Domain = 3 - socks5IP6 = 4 -) - -var socks5Errors = []string{ - "", - "general failure", - "connection forbidden", - "network unreachable", - "host unreachable", - "connection refused", - "TTL expired", - "command not supported", - "address type not supported", -} - -// Dial connects to the address addr on the given network via the SOCKS5 proxy. -func (s *socks5) Dial(network, addr string) (net.Conn, error) { - switch network { - case "tcp", "tcp6", "tcp4": - default: - return nil, errors.New("proxy: no support for SOCKS5 proxy connections of type " + network) - } - - conn, err := s.forward.Dial(s.network, s.addr) - if err != nil { - return nil, err - } - if err := s.connect(conn, addr); err != nil { - conn.Close() - return nil, err - } - return conn, nil -} - -// connect takes an existing connection to a socks5 proxy server, -// and commands the server to extend that connection to target, -// which must be a canonical address with a host and port. -func (s *socks5) connect(conn net.Conn, target string) error { - host, portStr, err := net.SplitHostPort(target) - if err != nil { - return err - } - - port, err := strconv.Atoi(portStr) - if err != nil { - return errors.New("proxy: failed to parse port number: " + portStr) - } - if port < 1 || port > 0xffff { - return errors.New("proxy: port number out of range: " + portStr) - } - - // the size here is just an estimate - buf := make([]byte, 0, 6+len(host)) - - buf = append(buf, socks5Version) - if len(s.user) > 0 && len(s.user) < 256 && len(s.password) < 256 { - buf = append(buf, 2 /* num auth methods */, socks5AuthNone, socks5AuthPassword) - } else { - buf = append(buf, 1 /* num auth methods */, socks5AuthNone) - } - - if _, err := conn.Write(buf); err != nil { - return errors.New("proxy: failed to write greeting to SOCKS5 proxy at " + s.addr + ": " + err.Error()) - } - - if _, err := io.ReadFull(conn, buf[:2]); err != nil { - return errors.New("proxy: failed to read greeting from SOCKS5 proxy at " + s.addr + ": " + err.Error()) - } - if buf[0] != 5 { - return errors.New("proxy: SOCKS5 proxy at " + s.addr + " has unexpected version " + strconv.Itoa(int(buf[0]))) - } - if buf[1] == 0xff { - return errors.New("proxy: SOCKS5 proxy at " + s.addr + " requires authentication") - } - - // See RFC 1929 - if buf[1] == socks5AuthPassword { - buf = buf[:0] - buf = append(buf, 1 /* password protocol version */) - buf = append(buf, uint8(len(s.user))) - buf = append(buf, s.user...) - buf = append(buf, uint8(len(s.password))) - buf = append(buf, s.password...) - - if _, err := conn.Write(buf); err != nil { - return errors.New("proxy: failed to write authentication request to SOCKS5 proxy at " + s.addr + ": " + err.Error()) - } - - if _, err := io.ReadFull(conn, buf[:2]); err != nil { - return errors.New("proxy: failed to read authentication reply from SOCKS5 proxy at " + s.addr + ": " + err.Error()) - } - - if buf[1] != 0 { - return errors.New("proxy: SOCKS5 proxy at " + s.addr + " rejected username/password") +// SOCKS5 returns a Dialer that makes SOCKSv5 connections to the given +// address with an optional username and password. +// See RFC 1928 and RFC 1929. +func SOCKS5(network, address string, auth *Auth, forward Dialer) (Dialer, error) { + d := socks.NewDialer(network, address) + if forward != nil { + d.ProxyDial = func(_ context.Context, network string, address string) (net.Conn, error) { + return forward.Dial(network, address) } } - - buf = buf[:0] - buf = append(buf, socks5Version, socks5Connect, 0 /* reserved */) - - if ip := net.ParseIP(host); ip != nil { - if ip4 := ip.To4(); ip4 != nil { - buf = append(buf, socks5IP4) - ip = ip4 - } else { - buf = append(buf, socks5IP6) - } - buf = append(buf, ip...) - } else { - if len(host) > 255 { - return errors.New("proxy: destination host name too long: " + host) + if auth != nil { + up := socks.UsernamePassword{ + Username: auth.User, + Password: auth.Password, } - buf = append(buf, socks5Domain) - buf = append(buf, byte(len(host))) - buf = append(buf, host...) - } - buf = append(buf, byte(port>>8), byte(port)) - - if _, err := conn.Write(buf); err != nil { - return errors.New("proxy: failed to write connect request to SOCKS5 proxy at " + s.addr + ": " + err.Error()) - } - - if _, err := io.ReadFull(conn, buf[:4]); err != nil { - return errors.New("proxy: failed to read connect reply from SOCKS5 proxy at " + s.addr + ": " + err.Error()) - } - - failure := "unknown error" - if int(buf[1]) < len(socks5Errors) { - failure = socks5Errors[buf[1]] - } - - if len(failure) > 0 { - return errors.New("proxy: SOCKS5 proxy at " + s.addr + " failed to connect: " + failure) - } - - bytesToDiscard := 0 - switch buf[3] { - case socks5IP4: - bytesToDiscard = net.IPv4len - case socks5IP6: - bytesToDiscard = net.IPv6len - case socks5Domain: - _, err := io.ReadFull(conn, buf[:1]) - if err != nil { - return errors.New("proxy: failed to read domain length from SOCKS5 proxy at " + s.addr + ": " + err.Error()) + d.AuthMethods = []socks.AuthMethod{ + socks.AuthMethodNotRequired, + socks.AuthMethodUsernamePassword, } - bytesToDiscard = int(buf[0]) - default: - return errors.New("proxy: got unknown address type " + strconv.Itoa(int(buf[3])) + " from SOCKS5 proxy at " + s.addr) - } - - if cap(buf) < bytesToDiscard { - buf = make([]byte, bytesToDiscard) - } else { - buf = buf[:bytesToDiscard] - } - if _, err := io.ReadFull(conn, buf); err != nil { - return errors.New("proxy: failed to read address from SOCKS5 proxy at " + s.addr + ": " + err.Error()) + d.Authenticate = up.Authenticate } - - // Also need to discard the port number - if _, err := io.ReadFull(conn, buf[:2]); err != nil { - return errors.New("proxy: failed to read port from SOCKS5 proxy at " + s.addr + ": " + err.Error()) - } - - return nil + return d, nil } diff --git a/vendor/golang.org/x/sys/cpu/cpu.go b/vendor/golang.org/x/sys/cpu/cpu.go new file mode 100644 index 0000000000..3d88f86673 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu.go @@ -0,0 +1,38 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// Package cpu implements processor feature detection for +// various CPU architectures. +package cpu + +// CacheLinePad is used to pad structs to avoid false sharing. +type CacheLinePad struct{ _ [cacheLineSize]byte } + +// X86 contains the supported CPU features of the +// current X86/AMD64 platform. If the current platform +// is not X86/AMD64 then all feature flags are false. +// +// X86 is padded to avoid false sharing. Further the HasAVX +// and HasAVX2 are only set if the OS supports XMM and YMM +// registers in addition to the CPUID feature bit being set. +var X86 struct { + _ CacheLinePad + HasAES bool // AES hardware implementation (AES NI) + HasADX bool // Multi-precision add-carry instruction extensions + HasAVX bool // Advanced vector extension + HasAVX2 bool // Advanced vector extension 2 + HasBMI1 bool // Bit manipulation instruction set 1 + HasBMI2 bool // Bit manipulation instruction set 2 + HasERMS bool // Enhanced REP for MOVSB and STOSB + HasFMA bool // Fused-multiply-add instructions + HasOSXSAVE bool // OS supports XSAVE/XRESTOR for saving/restoring XMM registers. + HasPCLMULQDQ bool // PCLMULQDQ instruction - most often used for AES-GCM + HasPOPCNT bool // Hamming weight instruction POPCNT. + HasSSE2 bool // Streaming SIMD extension 2 (always available on amd64) + HasSSE3 bool // Streaming SIMD extension 3 + HasSSSE3 bool // Supplemental streaming SIMD extension 3 + HasSSE41 bool // Streaming SIMD extension 4 and 4.1 + HasSSE42 bool // Streaming SIMD extension 4 and 4.2 + _ CacheLinePad +} diff --git a/vendor/golang.org/x/sys/cpu/cpu_arm.go b/vendor/golang.org/x/sys/cpu/cpu_arm.go new file mode 100644 index 0000000000..d93036f752 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_arm.go @@ -0,0 +1,7 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package cpu + +const cacheLineSize = 32 diff --git a/vendor/golang.org/x/sys/cpu/cpu_arm64.go b/vendor/golang.org/x/sys/cpu/cpu_arm64.go new file mode 100644 index 0000000000..1d2ab2902a --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_arm64.go @@ -0,0 +1,7 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package cpu + +const cacheLineSize = 64 diff --git a/vendor/golang.org/x/sys/cpu/cpu_gc_x86.go b/vendor/golang.org/x/sys/cpu/cpu_gc_x86.go new file mode 100644 index 0000000000..f7cb46971c --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_gc_x86.go @@ -0,0 +1,16 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build 386 amd64 amd64p32 +// +build !gccgo + +package cpu + +// cpuid is implemented in cpu_x86.s for gc compiler +// and in cpu_gccgo.c for gccgo. +func cpuid(eaxArg, ecxArg uint32) (eax, ebx, ecx, edx uint32) + +// xgetbv with ecx = 0 is implemented in cpu_x86.s for gc compiler +// and in cpu_gccgo.c for gccgo. +func xgetbv() (eax, edx uint32) diff --git a/vendor/golang.org/x/sys/cpu/cpu_gccgo.c b/vendor/golang.org/x/sys/cpu/cpu_gccgo.c new file mode 100644 index 0000000000..e363c7d131 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_gccgo.c @@ -0,0 +1,43 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build 386 amd64 amd64p32 +// +build gccgo + +#include +#include + +// Need to wrap __get_cpuid_count because it's declared as static. +int +gccgoGetCpuidCount(uint32_t leaf, uint32_t subleaf, + uint32_t *eax, uint32_t *ebx, + uint32_t *ecx, uint32_t *edx) +{ + return __get_cpuid_count(leaf, subleaf, eax, ebx, ecx, edx); +} + +// xgetbv reads the contents of an XCR (Extended Control Register) +// specified in the ECX register into registers EDX:EAX. +// Currently, the only supported value for XCR is 0. +// +// TODO: Replace with a better alternative: +// +// #include +// +// #pragma GCC target("xsave") +// +// void gccgoXgetbv(uint32_t *eax, uint32_t *edx) { +// unsigned long long x = _xgetbv(0); +// *eax = x & 0xffffffff; +// *edx = (x >> 32) & 0xffffffff; +// } +// +// Note that _xgetbv is defined starting with GCC 8. +void +gccgoXgetbv(uint32_t *eax, uint32_t *edx) +{ + __asm(" xorl %%ecx, %%ecx\n" + " xgetbv" + : "=a"(*eax), "=d"(*edx)); +} diff --git a/vendor/golang.org/x/sys/cpu/cpu_gccgo.go b/vendor/golang.org/x/sys/cpu/cpu_gccgo.go new file mode 100644 index 0000000000..ba49b91bd3 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_gccgo.go @@ -0,0 +1,26 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build 386 amd64 amd64p32 +// +build gccgo + +package cpu + +//extern gccgoGetCpuidCount +func gccgoGetCpuidCount(eaxArg, ecxArg uint32, eax, ebx, ecx, edx *uint32) + +func cpuid(eaxArg, ecxArg uint32) (eax, ebx, ecx, edx uint32) { + var a, b, c, d uint32 + gccgoGetCpuidCount(eaxArg, ecxArg, &a, &b, &c, &d) + return a, b, c, d +} + +//extern gccgoXgetbv +func gccgoXgetbv(eax, edx *uint32) + +func xgetbv() (eax, edx uint32) { + var a, d uint32 + gccgoXgetbv(&a, &d) + return a, d +} diff --git a/vendor/golang.org/x/sys/cpu/cpu_mips64x.go b/vendor/golang.org/x/sys/cpu/cpu_mips64x.go new file mode 100644 index 0000000000..6165f12124 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_mips64x.go @@ -0,0 +1,9 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build mips64 mips64le + +package cpu + +const cacheLineSize = 32 diff --git a/vendor/golang.org/x/sys/cpu/cpu_mipsx.go b/vendor/golang.org/x/sys/cpu/cpu_mipsx.go new file mode 100644 index 0000000000..1269eee88d --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_mipsx.go @@ -0,0 +1,9 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build mips mipsle + +package cpu + +const cacheLineSize = 32 diff --git a/vendor/golang.org/x/sys/cpu/cpu_ppc64x.go b/vendor/golang.org/x/sys/cpu/cpu_ppc64x.go new file mode 100644 index 0000000000..d10759a524 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_ppc64x.go @@ -0,0 +1,9 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build ppc64 ppc64le + +package cpu + +const cacheLineSize = 128 diff --git a/vendor/golang.org/x/sys/cpu/cpu_s390x.go b/vendor/golang.org/x/sys/cpu/cpu_s390x.go new file mode 100644 index 0000000000..684c4f005d --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_s390x.go @@ -0,0 +1,7 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package cpu + +const cacheLineSize = 256 diff --git a/vendor/golang.org/x/sys/cpu/cpu_x86.go b/vendor/golang.org/x/sys/cpu/cpu_x86.go new file mode 100644 index 0000000000..71e288b062 --- /dev/null +++ b/vendor/golang.org/x/sys/cpu/cpu_x86.go @@ -0,0 +1,55 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build 386 amd64 amd64p32 + +package cpu + +const cacheLineSize = 64 + +func init() { + maxID, _, _, _ := cpuid(0, 0) + + if maxID < 1 { + return + } + + _, _, ecx1, edx1 := cpuid(1, 0) + X86.HasSSE2 = isSet(26, edx1) + + X86.HasSSE3 = isSet(0, ecx1) + X86.HasPCLMULQDQ = isSet(1, ecx1) + X86.HasSSSE3 = isSet(9, ecx1) + X86.HasFMA = isSet(12, ecx1) + X86.HasSSE41 = isSet(19, ecx1) + X86.HasSSE42 = isSet(20, ecx1) + X86.HasPOPCNT = isSet(23, ecx1) + X86.HasAES = isSet(25, ecx1) + X86.HasOSXSAVE = isSet(27, ecx1) + + osSupportsAVX := false + // For XGETBV, OSXSAVE bit is required and sufficient. + if X86.HasOSXSAVE { + eax, _ := xgetbv() + // Check if XMM and YMM registers have OS support. + osSupportsAVX = isSet(1, eax) && isSet(2, eax) + } + + X86.HasAVX = isSet(28, ecx1) && osSupportsAVX + + if maxID < 7 { + return + } + + _, ebx7, _, _ := cpuid(7, 0) + X86.HasBMI1 = isSet(3, ebx7) + X86.HasAVX2 = isSet(5, ebx7) && osSupportsAVX + X86.HasBMI2 = isSet(8, ebx7) + X86.HasERMS = isSet(9, ebx7) + X86.HasADX = isSet(19, ebx7) +} + +func isSet(bitpos uint, value uint32) bool { + return value&(1< capArSizeMax { - return errorspkg.New("bad rights size") + return errors.New("bad rights size") } for _, right := range setrights { if caprver(right) != CAP_RIGHTS_VERSION_00 { - return errorspkg.New("bad right version") + return errors.New("bad right version") } i, err := rightToIndex(right) if err != nil { return err } if i >= n { - return errorspkg.New("index overflow") + return errors.New("index overflow") } if capidxbit(rights.Rights[i]) != capidxbit(right) { - return errorspkg.New("index mismatch") + return errors.New("index mismatch") } rights.Rights[i] |= right if capidxbit(rights.Rights[i]) != capidxbit(right) { - return errorspkg.New("index mismatch (after assign)") + return errors.New("index mismatch (after assign)") } } @@ -95,26 +95,26 @@ func CapRightsClear(rights *CapRights, clearrights []uint64) error { n := caparsize(rights) if n < capArSizeMin || n > capArSizeMax { - return errorspkg.New("bad rights size") + return errors.New("bad rights size") } for _, right := range clearrights { if caprver(right) != CAP_RIGHTS_VERSION_00 { - return errorspkg.New("bad right version") + return errors.New("bad right version") } i, err := rightToIndex(right) if err != nil { return err } if i >= n { - return errorspkg.New("index overflow") + return errors.New("index overflow") } if capidxbit(rights.Rights[i]) != capidxbit(right) { - return errorspkg.New("index mismatch") + return errors.New("index mismatch") } rights.Rights[i] &= ^(right & 0x01FFFFFFFFFFFFFF) if capidxbit(rights.Rights[i]) != capidxbit(right) { - return errorspkg.New("index mismatch (after assign)") + return errors.New("index mismatch (after assign)") } } @@ -130,22 +130,22 @@ func CapRightsIsSet(rights *CapRights, setrights []uint64) (bool, error) { n := caparsize(rights) if n < capArSizeMin || n > capArSizeMax { - return false, errorspkg.New("bad rights size") + return false, errors.New("bad rights size") } for _, right := range setrights { if caprver(right) != CAP_RIGHTS_VERSION_00 { - return false, errorspkg.New("bad right version") + return false, errors.New("bad right version") } i, err := rightToIndex(right) if err != nil { return false, err } if i >= n { - return false, errorspkg.New("index overflow") + return false, errors.New("index overflow") } if capidxbit(rights.Rights[i]) != capidxbit(right) { - return false, errorspkg.New("index mismatch") + return false, errors.New("index mismatch") } if (rights.Rights[i] & right) != right { return false, nil diff --git a/vendor/golang.org/x/sys/unix/flock.go b/vendor/golang.org/x/sys/unix/fcntl.go similarity index 70% rename from vendor/golang.org/x/sys/unix/flock.go rename to vendor/golang.org/x/sys/unix/fcntl.go index 2994ce75f2..9379ba9cef 100644 --- a/vendor/golang.org/x/sys/unix/flock.go +++ b/vendor/golang.org/x/sys/unix/fcntl.go @@ -12,6 +12,16 @@ import "unsafe" // systems by flock_linux_32bit.go to be SYS_FCNTL64. var fcntl64Syscall uintptr = SYS_FCNTL +// FcntlInt performs a fcntl syscall on fd with the provided command and argument. +func FcntlInt(fd uintptr, cmd, arg int) (int, error) { + valptr, _, errno := Syscall(fcntl64Syscall, fd, uintptr(cmd), uintptr(arg)) + var err error + if errno != 0 { + err = errno + } + return int(valptr), err +} + // FcntlFlock performs a fcntl syscall for the F_GETLK, F_SETLK or F_SETLKW command. func FcntlFlock(fd uintptr, cmd int, lk *Flock_t) error { _, _, errno := Syscall(fcntl64Syscall, fd, uintptr(cmd), uintptr(unsafe.Pointer(lk))) diff --git a/vendor/golang.org/x/sys/unix/flock_linux_32bit.go b/vendor/golang.org/x/sys/unix/fcntl_linux_32bit.go similarity index 100% rename from vendor/golang.org/x/sys/unix/flock_linux_32bit.go rename to vendor/golang.org/x/sys/unix/fcntl_linux_32bit.go diff --git a/vendor/golang.org/x/sys/unix/gccgo_c.c b/vendor/golang.org/x/sys/unix/gccgo_c.c index 24e96b1198..46523ced65 100644 --- a/vendor/golang.org/x/sys/unix/gccgo_c.c +++ b/vendor/golang.org/x/sys/unix/gccgo_c.c @@ -36,12 +36,3 @@ gccgoRealSyscallNoError(uintptr_t trap, uintptr_t a1, uintptr_t a2, uintptr_t a3 { return syscall(trap, a1, a2, a3, a4, a5, a6, a7, a8, a9); } - -// Define the use function in C so that it is not inlined. - -extern void use(void *) __asm__ (GOSYM_PREFIX GOPKGPATH ".use") __attribute__((noinline)); - -void -use(void *p __attribute__ ((unused))) -{ -} diff --git a/vendor/golang.org/x/sys/unix/openbsd_pledge.go b/vendor/golang.org/x/sys/unix/openbsd_pledge.go index db4f72ea9c..9b1e86a12b 100644 --- a/vendor/golang.org/x/sys/unix/openbsd_pledge.go +++ b/vendor/golang.org/x/sys/unix/openbsd_pledge.go @@ -13,7 +13,7 @@ import ( ) const ( - SYS_PLEDGE = 108 + _SYS_PLEDGE = 108 ) // Pledge implements the pledge syscall. For more information see pledge(2). @@ -30,7 +30,7 @@ func Pledge(promises string, paths []string) error { } pathsUnsafe = unsafe.Pointer(&pathsPtr[0]) } - _, _, e := syscall.Syscall(SYS_PLEDGE, uintptr(promisesUnsafe), uintptr(pathsUnsafe), 0) + _, _, e := syscall.Syscall(_SYS_PLEDGE, uintptr(promisesUnsafe), uintptr(pathsUnsafe), 0) if e != 0 { return e } diff --git a/vendor/golang.org/x/sys/unix/syscall.go b/vendor/golang.org/x/sys/unix/syscall.go index 857d2a42d4..ef35fce804 100644 --- a/vendor/golang.org/x/sys/unix/syscall.go +++ b/vendor/golang.org/x/sys/unix/syscall.go @@ -11,24 +11,27 @@ // system, set $GOOS and $GOARCH to the desired system. For example, if // you want to view documentation for freebsd/arm on linux/amd64, set $GOOS // to freebsd and $GOARCH to arm. +// // The primary use of this package is inside other packages that provide a more // portable interface to the system, such as "os", "time" and "net". Use // those packages rather than this one if you can. +// // For details of the functions and data types in this package consult // the manuals for the appropriate operating system. +// // These calls return err == nil to indicate success; otherwise // err represents an operating system error describing the failure and // holds a value of type syscall.Errno. package unix // import "golang.org/x/sys/unix" +import "strings" + // ByteSliceFromString returns a NUL-terminated slice of bytes // containing the text of s. If s contains a NUL byte at any // location, it returns (nil, EINVAL). func ByteSliceFromString(s string) ([]byte, error) { - for i := 0; i < len(s); i++ { - if s[i] == 0 { - return nil, EINVAL - } + if strings.IndexByte(s, 0) != -1 { + return nil, EINVAL } a := make([]byte, len(s)+1) copy(a, s) diff --git a/vendor/golang.org/x/sys/unix/syscall_bsd.go b/vendor/golang.org/x/sys/unix/syscall_bsd.go index d3903edeba..33c8b5f0db 100644 --- a/vendor/golang.org/x/sys/unix/syscall_bsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_bsd.go @@ -206,7 +206,7 @@ func (sa *SockaddrDatalink) sockaddr() (unsafe.Pointer, _Socklen, error) { return unsafe.Pointer(&sa.raw), SizeofSockaddrDatalink, nil } -func anyToSockaddr(rsa *RawSockaddrAny) (Sockaddr, error) { +func anyToSockaddr(fd int, rsa *RawSockaddrAny) (Sockaddr, error) { switch rsa.Addr.Family { case AF_LINK: pp := (*RawSockaddrDatalink)(unsafe.Pointer(rsa)) @@ -286,7 +286,7 @@ func Accept(fd int) (nfd int, sa Sockaddr, err error) { Close(nfd) return 0, nil, ECONNABORTED } - sa, err = anyToSockaddr(&rsa) + sa, err = anyToSockaddr(fd, &rsa) if err != nil { Close(nfd) nfd = 0 @@ -306,52 +306,11 @@ func Getsockname(fd int) (sa Sockaddr, err error) { rsa.Addr.Family = AF_UNIX rsa.Addr.Len = SizeofSockaddrUnix } - return anyToSockaddr(&rsa) + return anyToSockaddr(fd, &rsa) } //sysnb socketpair(domain int, typ int, proto int, fd *[2]int32) (err error) -func GetsockoptByte(fd, level, opt int) (value byte, err error) { - var n byte - vallen := _Socklen(1) - err = getsockopt(fd, level, opt, unsafe.Pointer(&n), &vallen) - return n, err -} - -func GetsockoptInet4Addr(fd, level, opt int) (value [4]byte, err error) { - vallen := _Socklen(4) - err = getsockopt(fd, level, opt, unsafe.Pointer(&value[0]), &vallen) - return value, err -} - -func GetsockoptIPMreq(fd, level, opt int) (*IPMreq, error) { - var value IPMreq - vallen := _Socklen(SizeofIPMreq) - err := getsockopt(fd, level, opt, unsafe.Pointer(&value), &vallen) - return &value, err -} - -func GetsockoptIPv6Mreq(fd, level, opt int) (*IPv6Mreq, error) { - var value IPv6Mreq - vallen := _Socklen(SizeofIPv6Mreq) - err := getsockopt(fd, level, opt, unsafe.Pointer(&value), &vallen) - return &value, err -} - -func GetsockoptIPv6MTUInfo(fd, level, opt int) (*IPv6MTUInfo, error) { - var value IPv6MTUInfo - vallen := _Socklen(SizeofIPv6MTUInfo) - err := getsockopt(fd, level, opt, unsafe.Pointer(&value), &vallen) - return &value, err -} - -func GetsockoptICMPv6Filter(fd, level, opt int) (*ICMPv6Filter, error) { - var value ICMPv6Filter - vallen := _Socklen(SizeofICMPv6Filter) - err := getsockopt(fd, level, opt, unsafe.Pointer(&value), &vallen) - return &value, err -} - // GetsockoptString returns the string value of the socket option opt for the // socket associated with fd at the given socket level. func GetsockoptString(fd, level, opt int) (string, error) { @@ -397,7 +356,7 @@ func Recvmsg(fd int, p, oob []byte, flags int) (n, oobn int, recvflags int, from recvflags = int(msg.Flags) // source address is only specified if the socket is unconnected if rsa.Addr.Family != AF_UNSPEC { - from, err = anyToSockaddr(&rsa) + from, err = anyToSockaddr(fd, &rsa) } return } diff --git a/vendor/golang.org/x/sys/unix/syscall_darwin.go b/vendor/golang.org/x/sys/unix/syscall_darwin.go index b9598694c6..79e94767de 100644 --- a/vendor/golang.org/x/sys/unix/syscall_darwin.go +++ b/vendor/golang.org/x/sys/unix/syscall_darwin.go @@ -13,7 +13,7 @@ package unix import ( - errorspkg "errors" + "errors" "syscall" "unsafe" ) @@ -98,7 +98,7 @@ type attrList struct { func getAttrList(path string, attrList attrList, attrBuf []byte, options uint) (attrs [][]byte, err error) { if len(attrBuf) < 4 { - return nil, errorspkg.New("attrBuf too small") + return nil, errors.New("attrBuf too small") } attrList.bitmapCount = attrBitMapCount @@ -134,12 +134,12 @@ func getAttrList(path string, attrList attrList, attrBuf []byte, options uint) ( for i := uint32(0); int(i) < len(dat); { header := dat[i:] if len(header) < 8 { - return attrs, errorspkg.New("truncated attribute header") + return attrs, errors.New("truncated attribute header") } datOff := *(*int32)(unsafe.Pointer(&header[0])) attrLen := *(*uint32)(unsafe.Pointer(&header[4])) if datOff < 0 || uint32(datOff)+attrLen > uint32(len(dat)) { - return attrs, errorspkg.New("truncated results; attrBuf too small") + return attrs, errors.New("truncated results; attrBuf too small") } end := uint32(datOff) + attrLen attrs = append(attrs, dat[datOff:end]) @@ -176,6 +176,88 @@ func Getfsstat(buf []Statfs_t, flags int) (n int, err error) { return } +func xattrPointer(dest []byte) *byte { + // It's only when dest is set to NULL that the OS X implementations of + // getxattr() and listxattr() return the current sizes of the named attributes. + // An empty byte array is not sufficient. To maintain the same behaviour as the + // linux implementation, we wrap around the system calls and pass in NULL when + // dest is empty. + var destp *byte + if len(dest) > 0 { + destp = &dest[0] + } + return destp +} + +//sys getxattr(path string, attr string, dest *byte, size int, position uint32, options int) (sz int, err error) + +func Getxattr(path string, attr string, dest []byte) (sz int, err error) { + return getxattr(path, attr, xattrPointer(dest), len(dest), 0, 0) +} + +func Lgetxattr(link string, attr string, dest []byte) (sz int, err error) { + return getxattr(link, attr, xattrPointer(dest), len(dest), 0, XATTR_NOFOLLOW) +} + +//sys setxattr(path string, attr string, data *byte, size int, position uint32, options int) (err error) + +func Setxattr(path string, attr string, data []byte, flags int) (err error) { + // The parameters for the OS X implementation vary slightly compared to the + // linux system call, specifically the position parameter: + // + // linux: + // int setxattr( + // const char *path, + // const char *name, + // const void *value, + // size_t size, + // int flags + // ); + // + // darwin: + // int setxattr( + // const char *path, + // const char *name, + // void *value, + // size_t size, + // u_int32_t position, + // int options + // ); + // + // position specifies the offset within the extended attribute. In the + // current implementation, only the resource fork extended attribute makes + // use of this argument. For all others, position is reserved. We simply + // default to setting it to zero. + return setxattr(path, attr, xattrPointer(data), len(data), 0, flags) +} + +func Lsetxattr(link string, attr string, data []byte, flags int) (err error) { + return setxattr(link, attr, xattrPointer(data), len(data), 0, flags|XATTR_NOFOLLOW) +} + +//sys removexattr(path string, attr string, options int) (err error) + +func Removexattr(path string, attr string) (err error) { + // We wrap around and explicitly zero out the options provided to the OS X + // implementation of removexattr, we do so for interoperability with the + // linux variant. + return removexattr(path, attr, 0) +} + +func Lremovexattr(link string, attr string) (err error) { + return removexattr(link, attr, XATTR_NOFOLLOW) +} + +//sys listxattr(path string, dest *byte, size int, options int) (sz int, err error) + +func Listxattr(path string, dest []byte) (sz int, err error) { + return listxattr(path, xattrPointer(dest), len(dest), 0) +} + +func Llistxattr(link string, dest []byte) (sz int, err error) { + return listxattr(link, xattrPointer(dest), len(dest), XATTR_NOFOLLOW) +} + func setattrlistTimes(path string, times []Timespec, flags int) error { _p0, err := BytePtrFromString(path) if err != nil { @@ -330,6 +412,7 @@ func Uname(uname *Utsname) error { //sys Flock(fd int, how int) (err error) //sys Fpathconf(fd int, name int) (val int, err error) //sys Fstat(fd int, stat *Stat_t) (err error) = SYS_FSTAT64 +//sys Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) = SYS_FSTATAT64 //sys Fstatfs(fd int, stat *Statfs_t) (err error) = SYS_FSTATFS64 //sys Fsync(fd int) (err error) //sys Ftruncate(fd int, length int64) (err error) @@ -446,13 +529,9 @@ func Uname(uname *Utsname) error { // Watchevent // Waitevent // Modwatch -// Getxattr // Fgetxattr -// Setxattr // Fsetxattr -// Removexattr // Fremovexattr -// Listxattr // Flistxattr // Fsctl // Initgroups diff --git a/vendor/golang.org/x/sys/unix/syscall_dragonfly.go b/vendor/golang.org/x/sys/unix/syscall_dragonfly.go index 777860bf09..e34abe29df 100644 --- a/vendor/golang.org/x/sys/unix/syscall_dragonfly.go +++ b/vendor/golang.org/x/sys/unix/syscall_dragonfly.go @@ -87,7 +87,7 @@ func Accept4(fd, flags int) (nfd int, sa Sockaddr, err error) { if len > SizeofSockaddrAny { panic("RawSockaddrAny too small") } - sa, err = anyToSockaddr(&rsa) + sa, err = anyToSockaddr(fd, &rsa) if err != nil { Close(nfd) nfd = 0 @@ -251,10 +251,12 @@ func Uname(uname *Utsname) error { //sys Fchdir(fd int) (err error) //sys Fchflags(fd int, flags int) (err error) //sys Fchmod(fd int, mode uint32) (err error) +//sys Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) //sys Fchown(fd int, uid int, gid int) (err error) //sys Flock(fd int, how int) (err error) //sys Fpathconf(fd int, name int) (val int, err error) //sys Fstat(fd int, stat *Stat_t) (err error) +//sys Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) //sys Fstatfs(fd int, stat *Statfs_t) (err error) //sys Fsync(fd int) (err error) //sys Ftruncate(fd int, length int64) (err error) diff --git a/vendor/golang.org/x/sys/unix/syscall_freebsd.go b/vendor/golang.org/x/sys/unix/syscall_freebsd.go index 89f2c3fc17..5561a3eb76 100644 --- a/vendor/golang.org/x/sys/unix/syscall_freebsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_freebsd.go @@ -12,7 +12,10 @@ package unix -import "unsafe" +import ( + "strings" + "unsafe" +) // SockaddrDatalink implements the Sockaddr interface for AF_LINK type sockets. type SockaddrDatalink struct { @@ -86,7 +89,7 @@ func Accept4(fd, flags int) (nfd int, sa Sockaddr, err error) { if len > SizeofSockaddrAny { panic("RawSockaddrAny too small") } - sa, err = anyToSockaddr(&rsa) + sa, err = anyToSockaddr(fd, &rsa) if err != nil { Close(nfd) nfd = 0 @@ -134,14 +137,7 @@ func setattrlistTimes(path string, times []Timespec, flags int) error { // Derive extattr namespace and attribute name func xattrnamespace(fullattr string) (ns int, attr string, err error) { - s := -1 - for idx, val := range fullattr { - if val == '.' { - s = idx - break - } - } - + s := strings.IndexByte(fullattr, '.') if s == -1 { return -1, "", ENOATTR } @@ -482,6 +478,7 @@ func Uname(uname *Utsname) error { //sys Flock(fd int, how int) (err error) //sys Fpathconf(fd int, name int) (val int, err error) //sys Fstat(fd int, stat *Stat_t) (err error) +//sys Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) //sys Fstatfs(fd int, stat *Statfs_t) (err error) //sys Fsync(fd int) (err error) //sys Ftruncate(fd int, length int64) (err error) diff --git a/vendor/golang.org/x/sys/unix/syscall_linux.go b/vendor/golang.org/x/sys/unix/syscall_linux.go index 76cf81f579..690c2c87f0 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux.go @@ -148,8 +148,6 @@ func Unlink(path string) error { //sys Unlinkat(dirfd int, path string, flags int) (err error) -//sys utimes(path string, times *[2]Timeval) (err error) - func Utimes(path string, tv []Timeval) error { if tv == nil { err := utimensat(AT_FDCWD, path, nil, 0) @@ -207,20 +205,14 @@ func UtimesNanoAt(dirfd int, path string, ts []Timespec, flags int) error { return utimensat(dirfd, path, (*[2]Timespec)(unsafe.Pointer(&ts[0])), flags) } -//sys futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) - func Futimesat(dirfd int, path string, tv []Timeval) error { - pathp, err := BytePtrFromString(path) - if err != nil { - return err - } if tv == nil { - return futimesat(dirfd, pathp, nil) + return futimesat(dirfd, path, nil) } if len(tv) != 2 { return EINVAL } - return futimesat(dirfd, pathp, (*[2]Timeval)(unsafe.Pointer(&tv[0]))) + return futimesat(dirfd, path, (*[2]Timeval)(unsafe.Pointer(&tv[0]))) } func Futimes(fd int, tv []Timeval) (err error) { @@ -497,6 +489,47 @@ func (sa *SockaddrL2) sockaddr() (unsafe.Pointer, _Socklen, error) { return unsafe.Pointer(&sa.raw), SizeofSockaddrL2, nil } +// SockaddrRFCOMM implements the Sockaddr interface for AF_BLUETOOTH type sockets +// using the RFCOMM protocol. +// +// Server example: +// +// fd, _ := Socket(AF_BLUETOOTH, SOCK_STREAM, BTPROTO_RFCOMM) +// _ = unix.Bind(fd, &unix.SockaddrRFCOMM{ +// Channel: 1, +// Addr: [6]uint8{0, 0, 0, 0, 0, 0}, // BDADDR_ANY or 00:00:00:00:00:00 +// }) +// _ = Listen(fd, 1) +// nfd, sa, _ := Accept(fd) +// fmt.Printf("conn addr=%v fd=%d", sa.(*unix.SockaddrRFCOMM).Addr, nfd) +// Read(nfd, buf) +// +// Client example: +// +// fd, _ := Socket(AF_BLUETOOTH, SOCK_STREAM, BTPROTO_RFCOMM) +// _ = Connect(fd, &SockaddrRFCOMM{ +// Channel: 1, +// Addr: [6]byte{0x11, 0x22, 0x33, 0xaa, 0xbb, 0xcc}, // CC:BB:AA:33:22:11 +// }) +// Write(fd, []byte(`hello`)) +type SockaddrRFCOMM struct { + // Addr represents a bluetooth address, byte ordering is little-endian. + Addr [6]uint8 + + // Channel is a designated bluetooth channel, only 1-30 are available for use. + // Since Linux 2.6.7 and further zero value is the first available channel. + Channel uint8 + + raw RawSockaddrRFCOMM +} + +func (sa *SockaddrRFCOMM) sockaddr() (unsafe.Pointer, _Socklen, error) { + sa.raw.Family = AF_BLUETOOTH + sa.raw.Channel = sa.Channel + sa.raw.Bdaddr = sa.Addr + return unsafe.Pointer(&sa.raw), SizeofSockaddrRFCOMM, nil +} + // SockaddrCAN implements the Sockaddr interface for AF_CAN type sockets. // The RxID and TxID fields are used for transport protocol addressing in // (CAN_TP16, CAN_TP20, CAN_MCNET, and CAN_ISOTP), they can be left with @@ -659,7 +692,7 @@ func (sa *SockaddrVM) sockaddr() (unsafe.Pointer, _Socklen, error) { return unsafe.Pointer(&sa.raw), SizeofSockaddrVM, nil } -func anyToSockaddr(rsa *RawSockaddrAny) (Sockaddr, error) { +func anyToSockaddr(fd int, rsa *RawSockaddrAny) (Sockaddr, error) { switch rsa.Addr.Family { case AF_NETLINK: pp := (*RawSockaddrNetlink)(unsafe.Pointer(rsa)) @@ -736,6 +769,30 @@ func anyToSockaddr(rsa *RawSockaddrAny) (Sockaddr, error) { Port: pp.Port, } return sa, nil + case AF_BLUETOOTH: + proto, err := GetsockoptInt(fd, SOL_SOCKET, SO_PROTOCOL) + if err != nil { + return nil, err + } + // only BTPROTO_L2CAP and BTPROTO_RFCOMM can accept connections + switch proto { + case BTPROTO_L2CAP: + pp := (*RawSockaddrL2)(unsafe.Pointer(rsa)) + sa := &SockaddrL2{ + PSM: pp.Psm, + CID: pp.Cid, + Addr: pp.Bdaddr, + AddrType: pp.Bdaddr_type, + } + return sa, nil + case BTPROTO_RFCOMM: + pp := (*RawSockaddrRFCOMM)(unsafe.Pointer(rsa)) + sa := &SockaddrRFCOMM{ + Channel: pp.Channel, + Addr: pp.Bdaddr, + } + return sa, nil + } } return nil, EAFNOSUPPORT } @@ -747,7 +804,7 @@ func Accept(fd int) (nfd int, sa Sockaddr, err error) { if err != nil { return } - sa, err = anyToSockaddr(&rsa) + sa, err = anyToSockaddr(fd, &rsa) if err != nil { Close(nfd) nfd = 0 @@ -765,7 +822,7 @@ func Accept4(fd int, flags int) (nfd int, sa Sockaddr, err error) { if len > SizeofSockaddrAny { panic("RawSockaddrAny too small") } - sa, err = anyToSockaddr(&rsa) + sa, err = anyToSockaddr(fd, &rsa) if err != nil { Close(nfd) nfd = 0 @@ -779,20 +836,7 @@ func Getsockname(fd int) (sa Sockaddr, err error) { if err = getsockname(fd, &rsa, &len); err != nil { return } - return anyToSockaddr(&rsa) -} - -func GetsockoptInet4Addr(fd, level, opt int) (value [4]byte, err error) { - vallen := _Socklen(4) - err = getsockopt(fd, level, opt, unsafe.Pointer(&value[0]), &vallen) - return value, err -} - -func GetsockoptIPMreq(fd, level, opt int) (*IPMreq, error) { - var value IPMreq - vallen := _Socklen(SizeofIPMreq) - err := getsockopt(fd, level, opt, unsafe.Pointer(&value), &vallen) - return &value, err + return anyToSockaddr(fd, &rsa) } func GetsockoptIPMreqn(fd, level, opt int) (*IPMreqn, error) { @@ -802,27 +846,6 @@ func GetsockoptIPMreqn(fd, level, opt int) (*IPMreqn, error) { return &value, err } -func GetsockoptIPv6Mreq(fd, level, opt int) (*IPv6Mreq, error) { - var value IPv6Mreq - vallen := _Socklen(SizeofIPv6Mreq) - err := getsockopt(fd, level, opt, unsafe.Pointer(&value), &vallen) - return &value, err -} - -func GetsockoptIPv6MTUInfo(fd, level, opt int) (*IPv6MTUInfo, error) { - var value IPv6MTUInfo - vallen := _Socklen(SizeofIPv6MTUInfo) - err := getsockopt(fd, level, opt, unsafe.Pointer(&value), &vallen) - return &value, err -} - -func GetsockoptICMPv6Filter(fd, level, opt int) (*ICMPv6Filter, error) { - var value ICMPv6Filter - vallen := _Socklen(SizeofICMPv6Filter) - err := getsockopt(fd, level, opt, unsafe.Pointer(&value), &vallen) - return &value, err -} - func GetsockoptUcred(fd, level, opt int) (*Ucred, error) { var value Ucred vallen := _Socklen(SizeofUcred) @@ -978,15 +1001,17 @@ func Recvmsg(fd int, p, oob []byte, flags int) (n, oobn int, recvflags int, from } var dummy byte if len(oob) > 0 { - var sockType int - sockType, err = GetsockoptInt(fd, SOL_SOCKET, SO_TYPE) - if err != nil { - return - } - // receive at least one normal byte - if sockType != SOCK_DGRAM && len(p) == 0 { - iov.Base = &dummy - iov.SetLen(1) + if len(p) == 0 { + var sockType int + sockType, err = GetsockoptInt(fd, SOL_SOCKET, SO_TYPE) + if err != nil { + return + } + // receive at least one normal byte + if sockType != SOCK_DGRAM { + iov.Base = &dummy + iov.SetLen(1) + } } msg.Control = &oob[0] msg.SetControllen(len(oob)) @@ -1000,7 +1025,7 @@ func Recvmsg(fd int, p, oob []byte, flags int) (n, oobn int, recvflags int, from recvflags = int(msg.Flags) // source address is only specified if the socket is unconnected if rsa.Addr.Family != AF_UNSPEC { - from, err = anyToSockaddr(&rsa) + from, err = anyToSockaddr(fd, &rsa) } return } @@ -1030,15 +1055,17 @@ func SendmsgN(fd int, p, oob []byte, to Sockaddr, flags int) (n int, err error) } var dummy byte if len(oob) > 0 { - var sockType int - sockType, err = GetsockoptInt(fd, SOL_SOCKET, SO_TYPE) - if err != nil { - return 0, err - } - // send at least one normal byte - if sockType != SOCK_DGRAM && len(p) == 0 { - iov.Base = &dummy - iov.SetLen(1) + if len(p) == 0 { + var sockType int + sockType, err = GetsockoptInt(fd, SOL_SOCKET, SO_TYPE) + if err != nil { + return 0, err + } + // send at least one normal byte + if sockType != SOCK_DGRAM { + iov.Base = &dummy + iov.SetLen(1) + } } msg.Control = &oob[0] msg.SetControllen(len(oob)) @@ -1251,12 +1278,10 @@ func Mount(source string, target string, fstype string, flags uintptr, data stri //sys CopyFileRange(rfd int, roff *int64, wfd int, woff *int64, len int, flags int) (n int, err error) //sys Dup(oldfd int) (fd int, err error) //sys Dup3(oldfd int, newfd int, flags int) (err error) -//sysnb EpollCreate(size int) (fd int, err error) //sysnb EpollCreate1(flag int) (fd int, err error) //sysnb EpollCtl(epfd int, op int, fd int, event *EpollEvent) (err error) //sys Eventfd(initval uint, flags int) (fd int, err error) = SYS_EVENTFD2 //sys Exit(code int) = SYS_EXIT_GROUP -//sys Faccessat(dirfd int, path string, mode uint32, flags int) (err error) //sys Fallocate(fd int, mode uint32, off int64, len int64) (err error) //sys Fchdir(fd int) (err error) //sys Fchmod(fd int, mode uint32) (err error) @@ -1294,6 +1319,7 @@ func Getpgrp() (pid int) { //sys Mkdirat(dirfd int, path string, mode uint32) (err error) //sys Mknodat(dirfd int, path string, mode uint32, dev int) (err error) //sys Nanosleep(time *Timespec, leftover *Timespec) (err error) +//sys PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) //sys PivotRoot(newroot string, putold string) (err error) = SYS_PIVOT_ROOT //sysnb prlimit(pid int, resource int, newlimit *Rlimit, old *Rlimit) (err error) = SYS_PRLIMIT64 //sys Prctl(option int, arg2 uintptr, arg3 uintptr, arg4 uintptr, arg5 uintptr) (err error) @@ -1335,7 +1361,6 @@ func Setgid(uid int) (err error) { //sysnb Uname(buf *Utsname) (err error) //sys Unmount(target string, flags int) (err error) = SYS_UMOUNT2 //sys Unshare(flags int) (err error) -//sys Ustat(dev int, ubuf *Ustat_t) (err error) //sys write(fd int, p []byte) (n int, err error) //sys exitThread(code int) (err error) = SYS_EXIT //sys readlen(fd int, p *byte, np int) (n int, err error) = SYS_READ @@ -1385,6 +1410,17 @@ func Vmsplice(fd int, iovs []Iovec, flags int) (int, error) { return int(n), nil } +//sys faccessat(dirfd int, path string, mode uint32) (err error) + +func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { + if flags & ^(AT_SYMLINK_NOFOLLOW|AT_EACCESS) != 0 { + return EINVAL + } else if flags&(AT_SYMLINK_NOFOLLOW|AT_EACCESS) != 0 { + return EOPNOTSUPP + } + return faccessat(dirfd, path, mode) +} + /* * Unimplemented */ diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_386.go b/vendor/golang.org/x/sys/unix/syscall_linux_386.go index bb8e4fbd86..74bc098ce1 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_386.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_386.go @@ -10,7 +10,6 @@ package unix import ( - "syscall" "unsafe" ) @@ -51,6 +50,8 @@ func Pipe2(p []int, flags int) (err error) { // 64-bit file system and 32-bit uid calls // (386 default is 32-bit file system and 16-bit uid). //sys Dup2(oldfd int, newfd int) (err error) +//sysnb EpollCreate(size int) (fd int, err error) +//sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) //sys Fadvise(fd int, offset int64, length int64, advice int) (err error) = SYS_FADVISE64_64 //sys Fchown(fd int, uid int, gid int) (err error) = SYS_FCHOWN32 //sys Fstat(fd int, stat *Stat_t) (err error) = SYS_FSTAT64 @@ -78,12 +79,12 @@ func Pipe2(p []int, flags int) (err error) { //sys Stat(path string, stat *Stat_t) (err error) = SYS_STAT64 //sys SyncFileRange(fd int, off int64, n int64, flags int) (err error) //sys Truncate(path string, length int64) (err error) = SYS_TRUNCATE64 +//sys Ustat(dev int, ubuf *Ustat_t) (err error) //sysnb getgroups(n int, list *_Gid_t) (nn int, err error) = SYS_GETGROUPS32 //sysnb setgroups(n int, list *_Gid_t) (err error) = SYS_SETGROUPS32 //sys Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err error) = SYS__NEWSELECT //sys mmap2(addr uintptr, length uintptr, prot int, flags int, fd int, pageOffset uintptr) (xaddr uintptr, err error) -//sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) //sys Pause() (err error) func mmap(addr uintptr, length uintptr, prot int, flags int, fd int, offset int64) (xaddr uintptr, err error) { @@ -157,10 +158,6 @@ func Setrlimit(resource int, rlim *Rlimit) (err error) { return setrlimit(resource, &rl) } -// Underlying system call writes to newoffset via pointer. -// Implemented in assembly to avoid allocation. -func seek(fd int, offset int64, whence int) (newoffset int64, err syscall.Errno) - func Seek(fd int, offset int64, whence int) (newoffset int64, err error) { newoffset, errno := seek(fd, offset, whence) if errno != 0 { @@ -169,11 +166,11 @@ func Seek(fd int, offset int64, whence int) (newoffset int64, err error) { return newoffset, nil } -// Vsyscalls on amd64. +//sys futimesat(dirfd int, path string, times *[2]Timeval) (err error) //sysnb Gettimeofday(tv *Timeval) (err error) //sysnb Time(t *Time_t) (tt Time_t, err error) - //sys Utime(path string, buf *Utimbuf) (err error) +//sys utimes(path string, times *[2]Timeval) (err error) // On x86 Linux, all the socket calls go through an extra indirection, // I think because the 5-register system call interface can't handle @@ -206,9 +203,6 @@ const ( _SENDMMSG = 20 ) -func socketcall(call int, a0, a1, a2, a3, a4, a5 uintptr) (n int, err syscall.Errno) -func rawsocketcall(call int, a0, a1, a2, a3, a4, a5 uintptr) (n int, err syscall.Errno) - func accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) { fd, e := socketcall(_ACCEPT, uintptr(s), uintptr(unsafe.Pointer(rsa)), uintptr(unsafe.Pointer(addrlen)), 0, 0, 0) if e != 0 { diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go b/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go index 53d38a5342..5f9b2454ad 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_amd64.go @@ -7,6 +7,7 @@ package unix //sys Dup2(oldfd int, newfd int) (err error) +//sysnb EpollCreate(size int) (fd int, err error) //sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) //sys Fadvise(fd int, offset int64, length int64, advice int) (err error) = SYS_FADVISE64 //sys Fchown(fd int, uid int, gid int) (err error) @@ -29,7 +30,15 @@ package unix //sys Pread(fd int, p []byte, offset int64) (n int, err error) = SYS_PREAD64 //sys Pwrite(fd int, p []byte, offset int64) (n int, err error) = SYS_PWRITE64 //sys Seek(fd int, offset int64, whence int) (off int64, err error) = SYS_LSEEK -//sys Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err error) + +func Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err error) { + var ts *Timespec + if timeout != nil { + ts = &Timespec{Sec: timeout.Sec, Nsec: timeout.Usec * 1000} + } + return Pselect(nfd, r, w, e, ts, nil) +} + //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) //sys Setfsgid(gid int) (err error) //sys Setfsuid(uid int) (err error) @@ -40,10 +49,16 @@ package unix //sysnb Setreuid(ruid int, euid int) (err error) //sys Shutdown(fd int, how int) (err error) //sys Splice(rfd int, roff *int64, wfd int, woff *int64, len int, flags int) (n int64, err error) -//sys Stat(path string, stat *Stat_t) (err error) + +func Stat(path string, stat *Stat_t) (err error) { + // Use fstatat, because Android's seccomp policy blocks stat. + return Fstatat(AT_FDCWD, path, stat, 0) +} + //sys Statfs(path string, buf *Statfs_t) (err error) //sys SyncFileRange(fd int, off int64, n int64, flags int) (err error) //sys Truncate(path string, length int64) (err error) +//sys Ustat(dev int, ubuf *Ustat_t) (err error) //sys accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) //sys accept4(s int, rsa *RawSockaddrAny, addrlen *_Socklen, flags int) (fd int, err error) //sys bind(s int, addr unsafe.Pointer, addrlen _Socklen) (err error) @@ -62,6 +77,8 @@ package unix //sys sendmsg(s int, msg *Msghdr, flags int) (n int, err error) //sys mmap(addr uintptr, length uintptr, prot int, flags int, fd int, offset int64) (xaddr uintptr, err error) +//sys futimesat(dirfd int, path string, times *[2]Timeval) (err error) + func Gettimeofday(tv *Timeval) (err error) { errno := gettimeofday(tv) if errno != 0 { @@ -83,6 +100,7 @@ func Time(t *Time_t) (tt Time_t, err error) { } //sys Utime(path string, buf *Utimbuf) (err error) +//sys utimes(path string, times *[2]Timeval) (err error) func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: sec, Nsec: nsec} diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_arm.go b/vendor/golang.org/x/sys/unix/syscall_linux_arm.go index c59f8588f1..3ec7a9329d 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_arm.go @@ -75,6 +75,8 @@ func Seek(fd int, offset int64, whence int) (newoffset int64, err error) { // 64-bit file system and 32-bit uid calls // (16-bit uid calls are not always supported in newer kernels) //sys Dup2(oldfd int, newfd int) (err error) +//sysnb EpollCreate(size int) (fd int, err error) +//sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) //sys Fchown(fd int, uid int, gid int) (err error) = SYS_FCHOWN32 //sys Fstat(fd int, stat *Stat_t) (err error) = SYS_FSTAT64 //sys Fstatat(dirfd int, path string, stat *Stat_t, flags int) (err error) = SYS_FSTATAT64 @@ -86,6 +88,7 @@ func Seek(fd int, offset int64, whence int) (newoffset int64, err error) { //sys Lchown(path string, uid int, gid int) (err error) = SYS_LCHOWN32 //sys Listen(s int, n int) (err error) //sys Lstat(path string, stat *Stat_t) (err error) = SYS_LSTAT64 +//sys Pause() (err error) //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) = SYS_SENDFILE64 //sys Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err error) = SYS__NEWSELECT //sys Setfsgid(gid int) (err error) = SYS_SETFSGID32 @@ -97,11 +100,10 @@ func Seek(fd int, offset int64, whence int) (newoffset int64, err error) { //sys Shutdown(fd int, how int) (err error) //sys Splice(rfd int, roff *int64, wfd int, woff *int64, len int, flags int) (n int, err error) //sys Stat(path string, stat *Stat_t) (err error) = SYS_STAT64 +//sys Ustat(dev int, ubuf *Ustat_t) (err error) -// Vsyscalls on amd64. +//sys futimesat(dirfd int, path string, times *[2]Timeval) (err error) //sysnb Gettimeofday(tv *Timeval) (err error) -//sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) -//sys Pause() (err error) func Time(t *Time_t) (Time_t, error) { var tv Timeval @@ -123,6 +125,8 @@ func Utime(path string, buf *Utimbuf) error { return Utimes(path, tv) } +//sys utimes(path string, times *[2]Timeval) (err error) + //sys Pread(fd int, p []byte, offset int64) (n int, err error) = SYS_PREAD64 //sys Pwrite(fd int, p []byte, offset int64) (n int, err error) = SYS_PWRITE64 //sys Truncate(path string, length int64) (err error) = SYS_TRUNCATE64 diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go b/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go index 9a8e6e4117..646f295ade 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_arm64.go @@ -6,7 +6,17 @@ package unix +import "unsafe" + +func EpollCreate(size int) (fd int, err error) { + if size <= 0 { + return -1, EINVAL + } + return EpollCreate1(0) +} + //sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) = SYS_EPOLL_PWAIT +//sys Fadvise(fd int, offset int64, length int64, advice int) (err error) = SYS_FADVISE64 //sys Fchown(fd int, uid int, gid int) (err error) //sys Fstat(fd int, stat *Stat_t) (err error) //sys Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) @@ -23,8 +33,11 @@ package unix //sys Seek(fd int, offset int64, whence int) (off int64, err error) = SYS_LSEEK func Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err error) { - ts := Timespec{Sec: timeout.Sec, Nsec: timeout.Usec * 1000} - return Pselect(nfd, r, w, e, &ts, nil) + var ts *Timespec + if timeout != nil { + ts = &Timespec{Sec: timeout.Sec, Nsec: timeout.Usec * 1000} + } + return Pselect(nfd, r, w, e, ts, nil) } //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) @@ -53,6 +66,11 @@ func Lstat(path string, stat *Stat_t) (err error) { //sys Statfs(path string, buf *Statfs_t) (err error) //sys SyncFileRange(fd int, off int64, n int64, flags int) (err error) //sys Truncate(path string, length int64) (err error) + +func Ustat(dev int, ubuf *Ustat_t) (err error) { + return ENOSYS +} + //sys accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) //sys accept4(s int, rsa *RawSockaddrAny, addrlen *_Socklen, flags int) (fd int, err error) //sys bind(s int, addr unsafe.Pointer, addrlen _Socklen) (err error) @@ -81,6 +99,18 @@ func setTimeval(sec, usec int64) Timeval { return Timeval{Sec: sec, Usec: usec} } +func futimesat(dirfd int, path string, tv *[2]Timeval) (err error) { + if tv == nil { + return utimensat(dirfd, path, nil, 0) + } + + ts := []Timespec{ + NsecToTimespec(TimevalToNsec(tv[0])), + NsecToTimespec(TimevalToNsec(tv[1])), + } + return utimensat(dirfd, path, (*[2]Timespec)(unsafe.Pointer(&ts[0])), 0) +} + func Time(t *Time_t) (Time_t, error) { var tv Timeval err := Gettimeofday(&tv) @@ -101,6 +131,18 @@ func Utime(path string, buf *Utimbuf) error { return Utimes(path, tv) } +func utimes(path string, tv *[2]Timeval) (err error) { + if tv == nil { + return utimensat(AT_FDCWD, path, nil, 0) + } + + ts := []Timespec{ + NsecToTimespec(TimevalToNsec(tv[0])), + NsecToTimespec(TimevalToNsec(tv[1])), + } + return utimensat(AT_FDCWD, path, (*[2]Timespec)(unsafe.Pointer(&ts[0])), 0) +} + func Pipe(p []int) (err error) { if len(p) != 2 { return EINVAL @@ -157,22 +199,6 @@ func Pause() (err error) { return } -// TODO(dfc): constants that should be in zsysnum_linux_arm64.go, remove -// these when the deprecated syscalls that the syscall package relies on -// are removed. -const ( - SYS_GETPGRP = 1060 - SYS_UTIMES = 1037 - SYS_FUTIMESAT = 1066 - SYS_PAUSE = 1061 - SYS_USTAT = 1070 - SYS_UTIME = 1063 - SYS_LCHOWN = 1032 - SYS_TIME = 1062 - SYS_EPOLL_CREATE = 1042 - SYS_EPOLL_WAIT = 1069 -) - func Poll(fds []PollFd, timeout int) (n int, err error) { var ts *Timespec if timeout >= 0 { diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_gc_386.go b/vendor/golang.org/x/sys/unix/syscall_linux_gc_386.go new file mode 100644 index 0000000000..070bd38994 --- /dev/null +++ b/vendor/golang.org/x/sys/unix/syscall_linux_gc_386.go @@ -0,0 +1,16 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build linux,!gccgo,386 + +package unix + +import "syscall" + +// Underlying system call writes to newoffset via pointer. +// Implemented in assembly to avoid allocation. +func seek(fd int, offset int64, whence int) (newoffset int64, err syscall.Errno) + +func socketcall(call int, a0, a1, a2, a3, a4, a5 uintptr) (n int, err syscall.Errno) +func rawsocketcall(call int, a0, a1, a2, a3, a4, a5 uintptr) (n int, err syscall.Errno) diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_gccgo_386.go b/vendor/golang.org/x/sys/unix/syscall_linux_gccgo_386.go new file mode 100644 index 0000000000..308eb7aecf --- /dev/null +++ b/vendor/golang.org/x/sys/unix/syscall_linux_gccgo_386.go @@ -0,0 +1,30 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build linux,gccgo,386 + +package unix + +import ( + "syscall" + "unsafe" +) + +func seek(fd int, offset int64, whence int) (int64, syscall.Errno) { + var newoffset int64 + offsetLow := uint32(offset & 0xffffffff) + offsetHigh := uint32((offset >> 32) & 0xffffffff) + _, _, err := Syscall6(SYS__LLSEEK, uintptr(fd), uintptr(offsetHigh), uintptr(offsetLow), uintptr(unsafe.Pointer(&newoffset)), uintptr(whence), 0) + return newoffset, err +} + +func socketcall(call int, a0, a1, a2, a3, a4, a5 uintptr) (int, syscall.Errno) { + fd, _, err := Syscall(SYS_SOCKETCALL, uintptr(call), uintptr(unsafe.Pointer(&a0)), 0) + return int(fd), err +} + +func rawsocketcall(call int, a0, a1, a2, a3, a4, a5 uintptr) (int, syscall.Errno) { + fd, _, err := RawSyscall(SYS_SOCKETCALL, uintptr(call), uintptr(unsafe.Pointer(&a0)), 0) + return int(fd), err +} diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_gccgo_arm.go b/vendor/golang.org/x/sys/unix/syscall_linux_gccgo_arm.go new file mode 100644 index 0000000000..aa7fc9e199 --- /dev/null +++ b/vendor/golang.org/x/sys/unix/syscall_linux_gccgo_arm.go @@ -0,0 +1,20 @@ +// Copyright 2018 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build linux,gccgo,arm + +package unix + +import ( + "syscall" + "unsafe" +) + +func seek(fd int, offset int64, whence int) (int64, syscall.Errno) { + var newoffset int64 + offsetLow := uint32(offset & 0xffffffff) + offsetHigh := uint32((offset >> 32) & 0xffffffff) + _, _, err := Syscall6(SYS__LLSEEK, uintptr(fd), uintptr(offsetHigh), uintptr(offsetLow), uintptr(unsafe.Pointer(&newoffset)), uintptr(whence), 0) + return newoffset, err +} diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go b/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go index 46aa4ff9c1..ad991031c7 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_mips64x.go @@ -8,7 +8,9 @@ package unix //sys Dup2(oldfd int, newfd int) (err error) +//sysnb EpollCreate(size int) (fd int, err error) //sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) +//sys Fadvise(fd int, offset int64, length int64, advice int) (err error) = SYS_FADVISE64 //sys Fchown(fd int, uid int, gid int) (err error) //sys Fstatat(dirfd int, path string, stat *Stat_t, flags int) (err error) = SYS_NEWFSTATAT //sys Fstatfs(fd int, buf *Statfs_t) (err error) @@ -26,8 +28,11 @@ package unix //sys Seek(fd int, offset int64, whence int) (off int64, err error) = SYS_LSEEK func Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err error) { - ts := Timespec{Sec: timeout.Sec, Nsec: timeout.Usec * 1000} - return Pselect(nfd, r, w, e, &ts, nil) + var ts *Timespec + if timeout != nil { + ts = &Timespec{Sec: timeout.Sec, Nsec: timeout.Usec * 1000} + } + return Pselect(nfd, r, w, e, ts, nil) } //sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) @@ -43,6 +48,7 @@ func Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err //sys Statfs(path string, buf *Statfs_t) (err error) //sys SyncFileRange(fd int, off int64, n int64, flags int) (err error) //sys Truncate(path string, length int64) (err error) +//sys Ustat(dev int, ubuf *Ustat_t) (err error) //sys accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) //sys accept4(s int, rsa *RawSockaddrAny, addrlen *_Socklen, flags int) (fd int, err error) //sys bind(s int, addr unsafe.Pointer, addrlen _Socklen) (err error) @@ -61,6 +67,7 @@ func Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err //sys sendmsg(s int, msg *Msghdr, flags int) (n int, err error) //sys mmap(addr uintptr, length uintptr, prot int, flags int, fd int, offset int64) (xaddr uintptr, err error) +//sys futimesat(dirfd int, path string, times *[2]Timeval) (err error) //sysnb Gettimeofday(tv *Timeval) (err error) func Time(t *Time_t) (tt Time_t, err error) { @@ -76,6 +83,7 @@ func Time(t *Time_t) (tt Time_t, err error) { } //sys Utime(path string, buf *Utimbuf) (err error) +//sys utimes(path string, times *[2]Timeval) (err error) func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: sec, Nsec: nsec} diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go b/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go index 40b8e4f0fc..0e05924820 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_mipsx.go @@ -15,6 +15,9 @@ import ( func Syscall9(trap, a1, a2, a3, a4, a5, a6, a7, a8, a9 uintptr) (r1, r2 uintptr, err syscall.Errno) //sys Dup2(oldfd int, newfd int) (err error) +//sysnb EpollCreate(size int) (fd int, err error) +//sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) +//sys Fadvise(fd int, offset int64, length int64, advice int) (err error) = SYS_FADVISE64 //sys Fchown(fd int, uid int, gid int) (err error) //sys Ftruncate(fd int, length int64) (err error) = SYS_FTRUNCATE64 //sysnb Getegid() (egid int) @@ -32,13 +35,12 @@ func Syscall9(trap, a1, a2, a3, a4, a5, a6, a7, a8, a9 uintptr) (r1, r2 uintptr, //sysnb Setregid(rgid int, egid int) (err error) //sysnb Setresgid(rgid int, egid int, sgid int) (err error) //sysnb Setresuid(ruid int, euid int, suid int) (err error) - //sysnb Setreuid(ruid int, euid int) (err error) //sys Shutdown(fd int, how int) (err error) -//sys Splice(rfd int, roff *int64, wfd int, woff *int64, len int, flags int) (n int64, err error) - +//sys Splice(rfd int, roff *int64, wfd int, woff *int64, len int, flags int) (n int, err error) //sys SyncFileRange(fd int, off int64, n int64, flags int) (err error) //sys Truncate(path string, length int64) (err error) = SYS_TRUNCATE64 +//sys Ustat(dev int, ubuf *Ustat_t) (err error) //sys accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) //sys accept4(s int, rsa *RawSockaddrAny, addrlen *_Socklen, flags int) (fd int, err error) //sys bind(s int, addr unsafe.Pointer, addrlen _Socklen) (err error) @@ -60,16 +62,17 @@ func Syscall9(trap, a1, a2, a3, a4, a5, a6, a7, a8, a9 uintptr) (r1, r2 uintptr, //sys Ioperm(from int, num int, on int) (err error) //sys Iopl(level int) (err error) +//sys futimesat(dirfd int, path string, times *[2]Timeval) (err error) //sysnb Gettimeofday(tv *Timeval) (err error) //sysnb Time(t *Time_t) (tt Time_t, err error) +//sys Utime(path string, buf *Utimbuf) (err error) +//sys utimes(path string, times *[2]Timeval) (err error) //sys Lstat(path string, stat *Stat_t) (err error) = SYS_LSTAT64 //sys Fstat(fd int, stat *Stat_t) (err error) = SYS_FSTAT64 //sys Fstatat(dirfd int, path string, stat *Stat_t, flags int) (err error) = SYS_FSTATAT64 //sys Stat(path string, stat *Stat_t) (err error) = SYS_STAT64 -//sys Utime(path string, buf *Utimbuf) (err error) -//sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) //sys Pause() (err error) func Fstatfs(fd int, buf *Statfs_t) (err error) { diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go b/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go index 17c9116e81..8c6720f7f4 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_ppc64x.go @@ -7,8 +7,10 @@ package unix -//sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) //sys Dup2(oldfd int, newfd int) (err error) +//sysnb EpollCreate(size int) (fd int, err error) +//sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) +//sys Fadvise(fd int, offset int64, length int64, advice int) (err error) = SYS_FADVISE64 //sys Fchown(fd int, uid int, gid int) (err error) //sys Fstat(fd int, stat *Stat_t) (err error) //sys Fstatat(dirfd int, path string, stat *Stat_t, flags int) (err error) = SYS_NEWFSTATAT @@ -44,6 +46,7 @@ package unix //sys Statfs(path string, buf *Statfs_t) (err error) //sys SyncFileRange(fd int, off int64, n int64, flags int) (err error) = SYS_SYNC_FILE_RANGE2 //sys Truncate(path string, length int64) (err error) +//sys Ustat(dev int, ubuf *Ustat_t) (err error) //sys accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) //sys accept4(s int, rsa *RawSockaddrAny, addrlen *_Socklen, flags int) (fd int, err error) //sys bind(s int, addr unsafe.Pointer, addrlen _Socklen) (err error) @@ -62,10 +65,11 @@ package unix //sys sendmsg(s int, msg *Msghdr, flags int) (n int, err error) //sys mmap(addr uintptr, length uintptr, prot int, flags int, fd int, offset int64) (xaddr uintptr, err error) +//sys futimesat(dirfd int, path string, times *[2]Timeval) (err error) //sysnb Gettimeofday(tv *Timeval) (err error) //sysnb Time(t *Time_t) (tt Time_t, err error) - //sys Utime(path string, buf *Utimbuf) (err error) +//sys utimes(path string, times *[2]Timeval) (err error) func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: sec, Nsec: nsec} diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go b/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go index c0d86e722b..6e4ee0cf2a 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_s390x.go @@ -11,6 +11,7 @@ import ( ) //sys Dup2(oldfd int, newfd int) (err error) +//sysnb EpollCreate(size int) (fd int, err error) //sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) //sys Fadvise(fd int, offset int64, length int64, advice int) (err error) = SYS_FADVISE64 //sys Fchown(fd int, uid int, gid int) (err error) @@ -44,9 +45,11 @@ import ( //sys Statfs(path string, buf *Statfs_t) (err error) //sys SyncFileRange(fd int, off int64, n int64, flags int) (err error) //sys Truncate(path string, length int64) (err error) +//sys Ustat(dev int, ubuf *Ustat_t) (err error) //sysnb getgroups(n int, list *_Gid_t) (nn int, err error) //sysnb setgroups(n int, list *_Gid_t) (err error) +//sys futimesat(dirfd int, path string, times *[2]Timeval) (err error) //sysnb Gettimeofday(tv *Timeval) (err error) func Time(t *Time_t) (tt Time_t, err error) { @@ -62,6 +65,7 @@ func Time(t *Time_t) (tt Time_t, err error) { } //sys Utime(path string, buf *Utimbuf) (err error) +//sys utimes(path string, times *[2]Timeval) (err error) func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: sec, Nsec: nsec} diff --git a/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go b/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go index a00f992798..72e64187de 100644 --- a/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/syscall_linux_sparc64.go @@ -7,6 +7,7 @@ package unix //sys EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) +//sys Fadvise(fd int, offset int64, length int64, advice int) (err error) = SYS_FADVISE64 //sys Dup2(oldfd int, newfd int) (err error) //sys Fchown(fd int, uid int, gid int) (err error) //sys Fstat(fd int, stat *Stat_t) (err error) @@ -67,6 +68,7 @@ func Iopl(level int) (err error) { return ENOSYS } +//sys futimesat(dirfd int, path string, times *[2]Timeval) (err error) //sysnb Gettimeofday(tv *Timeval) (err error) func Time(t *Time_t) (tt Time_t, err error) { @@ -82,6 +84,7 @@ func Time(t *Time_t) (tt Time_t, err error) { } //sys Utime(path string, buf *Utimbuf) (err error) +//sys utimes(path string, times *[2]Timeval) (err error) func setTimespec(sec, nsec int64) Timespec { return Timespec{Sec: sec, Nsec: nsec} diff --git a/vendor/golang.org/x/sys/unix/syscall_netbsd.go b/vendor/golang.org/x/sys/unix/syscall_netbsd.go index 71b7078380..369a2be2dc 100644 --- a/vendor/golang.org/x/sys/unix/syscall_netbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_netbsd.go @@ -233,13 +233,17 @@ func Uname(uname *Utsname) error { //sys Dup(fd int) (nfd int, err error) //sys Dup2(from int, to int) (err error) //sys Exit(code int) +//sys Faccessat(dirfd int, path string, mode uint32, flags int) (err error) +//sys Fadvise(fd int, offset int64, length int64, advice int) (err error) = SYS_POSIX_FADVISE //sys Fchdir(fd int) (err error) //sys Fchflags(fd int, flags int) (err error) //sys Fchmod(fd int, mode uint32) (err error) +//sys Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) //sys Fchown(fd int, uid int, gid int) (err error) //sys Flock(fd int, how int) (err error) //sys Fpathconf(fd int, name int) (val int, err error) //sys Fstat(fd int, stat *Stat_t) (err error) +//sys Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) //sys Fsync(fd int) (err error) //sys Ftruncate(fd int, length int64) (err error) //sysnb Getegid() (egid int) @@ -320,7 +324,6 @@ func Uname(uname *Utsname) error { // __msync13 // __ntp_gettime30 // __posix_chown -// __posix_fadvise50 // __posix_fchown // __posix_lchown // __posix_rename diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd.go b/vendor/golang.org/x/sys/unix/syscall_openbsd.go index 37556e775d..9fc9c06a08 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd.go @@ -201,13 +201,16 @@ func Uname(uname *Utsname) error { //sys Dup(fd int) (nfd int, err error) //sys Dup2(from int, to int) (err error) //sys Exit(code int) +//sys Faccessat(dirfd int, path string, mode uint32, flags int) (err error) //sys Fchdir(fd int) (err error) //sys Fchflags(fd int, flags int) (err error) //sys Fchmod(fd int, mode uint32) (err error) +//sys Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) //sys Fchown(fd int, uid int, gid int) (err error) //sys Flock(fd int, how int) (err error) //sys Fpathconf(fd int, name int) (val int, err error) //sys Fstat(fd int, stat *Stat_t) (err error) +//sys Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) //sys Fstatfs(fd int, stat *Statfs_t) (err error) //sys Fsync(fd int) (err error) //sys Ftruncate(fd int, length int64) (err error) @@ -220,6 +223,7 @@ func Uname(uname *Utsname) error { //sysnb Getppid() (ppid int) //sys Getpriority(which int, who int) (prio int, err error) //sysnb Getrlimit(which int, lim *Rlimit) (err error) +//sysnb Getrtable() (rtable int, err error) //sysnb Getrusage(who int, rusage *Rusage) (err error) //sysnb Getsid(pid int) (sid int, err error) //sysnb Gettimeofday(tv *Timeval) (err error) @@ -257,6 +261,7 @@ func Uname(uname *Utsname) error { //sysnb Setresgid(rgid int, egid int, sgid int) (err error) //sysnb Setresuid(ruid int, euid int, suid int) (err error) //sysnb Setrlimit(which int, lim *Rlimit) (err error) +//sysnb Setrtable(rtable int) (err error) //sysnb Setsid() (pid int, err error) //sysnb Settimeofday(tp *Timeval) (err error) //sysnb Setuid(uid int) (err error) @@ -305,7 +310,6 @@ func Uname(uname *Utsname) error { // getlogin // getresgid // getresuid -// getrtable // getthrid // ktrace // lfs_bmapv @@ -341,7 +345,6 @@ func Uname(uname *Utsname) error { // semop // setgroups // setitimer -// setrtable // setsockopt // shmat // shmctl diff --git a/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go index 649e67fccc..9a35334cba 100644 --- a/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_openbsd_amd64.go @@ -31,3 +31,7 @@ func (msghdr *Msghdr) SetControllen(length int) { func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } + +// SYS___SYSCTL is used by syscall_bsd.go for all BSDs, but in modern versions +// of openbsd/amd64 the syscall is called sysctl instead of __sysctl. +const SYS___SYSCTL = SYS_SYSCTL diff --git a/vendor/golang.org/x/sys/unix/syscall_solaris.go b/vendor/golang.org/x/sys/unix/syscall_solaris.go index eca8d1d09d..a05337d540 100644 --- a/vendor/golang.org/x/sys/unix/syscall_solaris.go +++ b/vendor/golang.org/x/sys/unix/syscall_solaris.go @@ -112,7 +112,7 @@ func Getsockname(fd int) (sa Sockaddr, err error) { if err = getsockname(fd, &rsa, &len); err != nil { return } - return anyToSockaddr(&rsa) + return anyToSockaddr(fd, &rsa) } // GetsockoptString returns the string value of the socket option opt for the @@ -312,6 +312,16 @@ func UtimesNanoAt(dirfd int, path string, ts []Timespec, flags int) error { //sys fcntl(fd int, cmd int, arg int) (val int, err error) +// FcntlInt performs a fcntl syscall on fd with the provided command and argument. +func FcntlInt(fd uintptr, cmd, arg int) (int, error) { + valptr, _, errno := sysvicall6(uintptr(unsafe.Pointer(&procfcntl)), 3, uintptr(fd), uintptr(cmd), uintptr(arg), 0, 0, 0) + var err error + if errno != 0 { + err = errno + } + return int(valptr), err +} + // FcntlFlock performs a fcntl syscall for the F_GETLK, F_SETLK or F_SETLKW command. func FcntlFlock(fd uintptr, cmd int, lk *Flock_t) error { _, _, e1 := sysvicall6(uintptr(unsafe.Pointer(&procfcntl)), 3, uintptr(fd), uintptr(cmd), uintptr(unsafe.Pointer(lk)), 0, 0, 0) @@ -350,7 +360,7 @@ func Futimes(fd int, tv []Timeval) error { return futimesat(fd, nil, (*[2]Timeval)(unsafe.Pointer(&tv[0]))) } -func anyToSockaddr(rsa *RawSockaddrAny) (Sockaddr, error) { +func anyToSockaddr(fd int, rsa *RawSockaddrAny) (Sockaddr, error) { switch rsa.Addr.Family { case AF_UNIX: pp := (*RawSockaddrUnix)(unsafe.Pointer(rsa)) @@ -401,7 +411,7 @@ func Accept(fd int) (nfd int, sa Sockaddr, err error) { if nfd == -1 { return } - sa, err = anyToSockaddr(&rsa) + sa, err = anyToSockaddr(fd, &rsa) if err != nil { Close(nfd) nfd = 0 @@ -438,7 +448,7 @@ func Recvmsg(fd int, p, oob []byte, flags int) (n, oobn int, recvflags int, from oobn = int(msg.Accrightslen) // source address is only specified if the socket is unconnected if rsa.Addr.Family != AF_UNSPEC { - from, err = anyToSockaddr(&rsa) + from, err = anyToSockaddr(fd, &rsa) } return } @@ -589,15 +599,17 @@ func Poll(fds []PollFd, timeout int) (n int, err error) { //sys Dup(fd int) (nfd int, err error) //sys Dup2(oldfd int, newfd int) (err error) //sys Exit(code int) +//sys Faccessat(dirfd int, path string, mode uint32, flags int) (err error) //sys Fchdir(fd int) (err error) //sys Fchmod(fd int, mode uint32) (err error) //sys Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) //sys Fchown(fd int, uid int, gid int) (err error) //sys Fchownat(dirfd int, path string, uid int, gid int, flags int) (err error) //sys Fdatasync(fd int) (err error) -//sys Flock(fd int, how int) (err error) +//sys Flock(fd int, how int) (err error) //sys Fpathconf(fd int, name int) (val int, err error) //sys Fstat(fd int, stat *Stat_t) (err error) +//sys Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) //sys Fstatvfs(fd int, vfsstat *Statvfs_t) (err error) //sys Getdents(fd int, buf []byte, basep *uintptr) (n int, err error) //sysnb Getgid() (gid int) @@ -675,6 +687,7 @@ func Poll(fds []PollFd, timeout int) (n int, err error) { //sys connect(s int, addr unsafe.Pointer, addrlen _Socklen) (err error) = libsocket.__xnet_connect //sys mmap(addr uintptr, length uintptr, prot int, flag int, fd int, pos int64) (ret uintptr, err error) //sys munmap(addr uintptr, length uintptr) (err error) +//sys sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) = libsendfile.sendfile //sys sendto(s int, buf []byte, flags int, to unsafe.Pointer, addrlen _Socklen) (err error) = libsocket.__xnet_sendto //sys socket(domain int, typ int, proto int) (fd int, err error) = libsocket.__xnet_socket //sysnb socketpair(domain int, typ int, proto int, fd *[2]int32) (err error) = libsocket.__xnet_socketpair diff --git a/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go b/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go index 9d4e7a678f..91c32ddf02 100644 --- a/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go +++ b/vendor/golang.org/x/sys/unix/syscall_solaris_amd64.go @@ -21,8 +21,3 @@ func (iov *Iovec) SetLen(length int) { func (cmsg *Cmsghdr) SetLen(length int) { cmsg.Len = uint32(length) } - -func sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) { - // TODO(aram): implement this, see issue 5847. - panic("unimplemented") -} diff --git a/vendor/golang.org/x/sys/unix/syscall_unix.go b/vendor/golang.org/x/sys/unix/syscall_unix.go index cd8f3a9c28..95b2180aeb 100644 --- a/vendor/golang.org/x/sys/unix/syscall_unix.go +++ b/vendor/golang.org/x/sys/unix/syscall_unix.go @@ -7,7 +7,9 @@ package unix import ( + "bytes" "runtime" + "sort" "sync" "syscall" "unsafe" @@ -50,14 +52,35 @@ func errnoErr(e syscall.Errno) error { return e } +// ErrnoName returns the error name for error number e. +func ErrnoName(e syscall.Errno) string { + i := sort.Search(len(errorList), func(i int) bool { + return errorList[i].num >= e + }) + if i < len(errorList) && errorList[i].num == e { + return errorList[i].name + } + return "" +} + +// SignalName returns the signal name for signal number s. +func SignalName(s syscall.Signal) string { + i := sort.Search(len(signalList), func(i int) bool { + return signalList[i].num >= s + }) + if i < len(signalList) && signalList[i].num == s { + return signalList[i].name + } + return "" +} + // clen returns the index of the first NULL byte in n or len(n) if n contains no NULL byte. func clen(n []byte) int { - for i := 0; i < len(n); i++ { - if n[i] == 0 { - return i - } + i := bytes.IndexByte(n, 0) + if i == -1 { + i = len(n) } - return len(n) + return i } // Mmap manager, for use by operating system-specific implementations. @@ -196,7 +219,14 @@ func Getpeername(fd int) (sa Sockaddr, err error) { if err = getpeername(fd, &rsa, &len); err != nil { return } - return anyToSockaddr(&rsa) + return anyToSockaddr(fd, &rsa) +} + +func GetsockoptByte(fd, level, opt int) (value byte, err error) { + var n byte + vallen := _Socklen(1) + err = getsockopt(fd, level, opt, unsafe.Pointer(&n), &vallen) + return n, err } func GetsockoptInt(fd, level, opt int) (value int, err error) { @@ -206,6 +236,54 @@ func GetsockoptInt(fd, level, opt int) (value int, err error) { return int(n), err } +func GetsockoptInet4Addr(fd, level, opt int) (value [4]byte, err error) { + vallen := _Socklen(4) + err = getsockopt(fd, level, opt, unsafe.Pointer(&value[0]), &vallen) + return value, err +} + +func GetsockoptIPMreq(fd, level, opt int) (*IPMreq, error) { + var value IPMreq + vallen := _Socklen(SizeofIPMreq) + err := getsockopt(fd, level, opt, unsafe.Pointer(&value), &vallen) + return &value, err +} + +func GetsockoptIPv6Mreq(fd, level, opt int) (*IPv6Mreq, error) { + var value IPv6Mreq + vallen := _Socklen(SizeofIPv6Mreq) + err := getsockopt(fd, level, opt, unsafe.Pointer(&value), &vallen) + return &value, err +} + +func GetsockoptIPv6MTUInfo(fd, level, opt int) (*IPv6MTUInfo, error) { + var value IPv6MTUInfo + vallen := _Socklen(SizeofIPv6MTUInfo) + err := getsockopt(fd, level, opt, unsafe.Pointer(&value), &vallen) + return &value, err +} + +func GetsockoptICMPv6Filter(fd, level, opt int) (*ICMPv6Filter, error) { + var value ICMPv6Filter + vallen := _Socklen(SizeofICMPv6Filter) + err := getsockopt(fd, level, opt, unsafe.Pointer(&value), &vallen) + return &value, err +} + +func GetsockoptLinger(fd, level, opt int) (*Linger, error) { + var linger Linger + vallen := _Socklen(SizeofLinger) + err := getsockopt(fd, level, opt, unsafe.Pointer(&linger), &vallen) + return &linger, err +} + +func GetsockoptTimeval(fd, level, opt int) (*Timeval, error) { + var tv Timeval + vallen := _Socklen(unsafe.Sizeof(tv)) + err := getsockopt(fd, level, opt, unsafe.Pointer(&tv), &vallen) + return &tv, err +} + func Recvfrom(fd int, p []byte, flags int) (n int, from Sockaddr, err error) { var rsa RawSockaddrAny var len _Socklen = SizeofSockaddrAny @@ -213,7 +291,7 @@ func Recvfrom(fd int, p []byte, flags int) (n int, from Sockaddr, err error) { return } if rsa.Addr.Family != AF_UNSPEC { - from, err = anyToSockaddr(&rsa) + from, err = anyToSockaddr(fd, &rsa) } return } @@ -305,3 +383,12 @@ func SetNonblock(fd int, nonblocking bool) (err error) { _, err = fcntl(fd, F_SETFL, flag) return err } + +// Exec calls execve(2), which replaces the calling executable in the process +// tree. argv0 should be the full path to an executable ("/bin/ls") and the +// executable name should also be the first argument in argv (["ls", "-l"]). +// envv are the environment variables that should be passed to the new +// process (["USER=go", "PWD=/tmp"]). +func Exec(argv0 string, argv []string, envv []string) error { + return syscall.Exec(argv0, argv, envv) +} diff --git a/vendor/golang.org/x/sys/unix/zerrors_darwin_386.go b/vendor/golang.org/x/sys/unix/zerrors_darwin_386.go index dcba88424b..3b39d7408a 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_darwin_386.go +++ b/vendor/golang.org/x/sys/unix/zerrors_darwin_386.go @@ -1473,6 +1473,12 @@ const ( WORDSIZE = 0x20 WSTOPPED = 0x8 WUNTRACED = 0x2 + XATTR_CREATE = 0x2 + XATTR_NODEFAULT = 0x10 + XATTR_NOFOLLOW = 0x1 + XATTR_NOSECURITY = 0x8 + XATTR_REPLACE = 0x4 + XATTR_SHOWCOMPRESSION = 0x20 ) // Errors @@ -1624,146 +1630,154 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "resource busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "operation timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "device power is off", - 83: "device error", - 84: "value too large to be stored in data type", - 85: "bad executable (or shared library)", - 86: "bad CPU type in executable", - 87: "shared library version mismatch", - 88: "malformed Mach-o file", - 89: "operation canceled", - 90: "identifier removed", - 91: "no message of desired type", - 92: "illegal byte sequence", - 93: "attribute not found", - 94: "bad message", - 95: "EMULTIHOP (Reserved)", - 96: "no message available on STREAM", - 97: "ENOLINK (Reserved)", - 98: "no STREAM resources", - 99: "not a STREAM", - 100: "protocol error", - 101: "STREAM ioctl timeout", - 102: "operation not supported on socket", - 103: "policy not found", - 104: "state not recoverable", - 105: "previous owner died", - 106: "interface output queue is full", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large"}, + {35, "EAGAIN", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "ENOTSUP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "operation timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disc quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC prog. not avail"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EPWROFF", "device power is off"}, + {83, "EDEVERR", "device error"}, + {84, "EOVERFLOW", "value too large to be stored in data type"}, + {85, "EBADEXEC", "bad executable (or shared library)"}, + {86, "EBADARCH", "bad CPU type in executable"}, + {87, "ESHLIBVERS", "shared library version mismatch"}, + {88, "EBADMACHO", "malformed Mach-o file"}, + {89, "ECANCELED", "operation canceled"}, + {90, "EIDRM", "identifier removed"}, + {91, "ENOMSG", "no message of desired type"}, + {92, "EILSEQ", "illegal byte sequence"}, + {93, "ENOATTR", "attribute not found"}, + {94, "EBADMSG", "bad message"}, + {95, "EMULTIHOP", "EMULTIHOP (Reserved)"}, + {96, "ENODATA", "no message available on STREAM"}, + {97, "ENOLINK", "ENOLINK (Reserved)"}, + {98, "ENOSR", "no STREAM resources"}, + {99, "ENOSTR", "not a STREAM"}, + {100, "EPROTO", "protocol error"}, + {101, "ETIME", "STREAM ioctl timeout"}, + {102, "EOPNOTSUPP", "operation not supported on socket"}, + {103, "ENOPOLICY", "policy not found"}, + {104, "ENOTRECOVERABLE", "state not recoverable"}, + {105, "EOWNERDEAD", "previous owner died"}, + {106, "EQFULL", "interface output queue is full"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "suspended (signal)", - 18: "suspended", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGABRT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "suspended (signal)"}, + {18, "SIGTSTP", "suspended"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_darwin_amd64.go b/vendor/golang.org/x/sys/unix/zerrors_darwin_amd64.go index 1a51c963c8..8fe5547775 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_darwin_amd64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_darwin_amd64.go @@ -1473,6 +1473,12 @@ const ( WORDSIZE = 0x40 WSTOPPED = 0x8 WUNTRACED = 0x2 + XATTR_CREATE = 0x2 + XATTR_NODEFAULT = 0x10 + XATTR_NOFOLLOW = 0x1 + XATTR_NOSECURITY = 0x8 + XATTR_REPLACE = 0x4 + XATTR_SHOWCOMPRESSION = 0x20 ) // Errors @@ -1624,146 +1630,154 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "resource busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "operation timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "device power is off", - 83: "device error", - 84: "value too large to be stored in data type", - 85: "bad executable (or shared library)", - 86: "bad CPU type in executable", - 87: "shared library version mismatch", - 88: "malformed Mach-o file", - 89: "operation canceled", - 90: "identifier removed", - 91: "no message of desired type", - 92: "illegal byte sequence", - 93: "attribute not found", - 94: "bad message", - 95: "EMULTIHOP (Reserved)", - 96: "no message available on STREAM", - 97: "ENOLINK (Reserved)", - 98: "no STREAM resources", - 99: "not a STREAM", - 100: "protocol error", - 101: "STREAM ioctl timeout", - 102: "operation not supported on socket", - 103: "policy not found", - 104: "state not recoverable", - 105: "previous owner died", - 106: "interface output queue is full", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large"}, + {35, "EAGAIN", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "ENOTSUP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "operation timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disc quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC prog. not avail"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EPWROFF", "device power is off"}, + {83, "EDEVERR", "device error"}, + {84, "EOVERFLOW", "value too large to be stored in data type"}, + {85, "EBADEXEC", "bad executable (or shared library)"}, + {86, "EBADARCH", "bad CPU type in executable"}, + {87, "ESHLIBVERS", "shared library version mismatch"}, + {88, "EBADMACHO", "malformed Mach-o file"}, + {89, "ECANCELED", "operation canceled"}, + {90, "EIDRM", "identifier removed"}, + {91, "ENOMSG", "no message of desired type"}, + {92, "EILSEQ", "illegal byte sequence"}, + {93, "ENOATTR", "attribute not found"}, + {94, "EBADMSG", "bad message"}, + {95, "EMULTIHOP", "EMULTIHOP (Reserved)"}, + {96, "ENODATA", "no message available on STREAM"}, + {97, "ENOLINK", "ENOLINK (Reserved)"}, + {98, "ENOSR", "no STREAM resources"}, + {99, "ENOSTR", "not a STREAM"}, + {100, "EPROTO", "protocol error"}, + {101, "ETIME", "STREAM ioctl timeout"}, + {102, "EOPNOTSUPP", "operation not supported on socket"}, + {103, "ENOPOLICY", "policy not found"}, + {104, "ENOTRECOVERABLE", "state not recoverable"}, + {105, "EOWNERDEAD", "previous owner died"}, + {106, "EQFULL", "interface output queue is full"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "suspended (signal)", - 18: "suspended", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGABRT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "suspended (signal)"}, + {18, "SIGTSTP", "suspended"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_darwin_arm.go b/vendor/golang.org/x/sys/unix/zerrors_darwin_arm.go index fa135b17c1..7a977770d0 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_darwin_arm.go +++ b/vendor/golang.org/x/sys/unix/zerrors_darwin_arm.go @@ -1473,6 +1473,12 @@ const ( WORDSIZE = 0x40 WSTOPPED = 0x8 WUNTRACED = 0x2 + XATTR_CREATE = 0x2 + XATTR_NODEFAULT = 0x10 + XATTR_NOFOLLOW = 0x1 + XATTR_NOSECURITY = 0x8 + XATTR_REPLACE = 0x4 + XATTR_SHOWCOMPRESSION = 0x20 ) // Errors @@ -1624,146 +1630,154 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "resource busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "operation timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "device power is off", - 83: "device error", - 84: "value too large to be stored in data type", - 85: "bad executable (or shared library)", - 86: "bad CPU type in executable", - 87: "shared library version mismatch", - 88: "malformed Mach-o file", - 89: "operation canceled", - 90: "identifier removed", - 91: "no message of desired type", - 92: "illegal byte sequence", - 93: "attribute not found", - 94: "bad message", - 95: "EMULTIHOP (Reserved)", - 96: "no message available on STREAM", - 97: "ENOLINK (Reserved)", - 98: "no STREAM resources", - 99: "not a STREAM", - 100: "protocol error", - 101: "STREAM ioctl timeout", - 102: "operation not supported on socket", - 103: "policy not found", - 104: "state not recoverable", - 105: "previous owner died", - 106: "interface output queue is full", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large"}, + {35, "EAGAIN", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "ENOTSUP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "operation timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disc quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC prog. not avail"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EPWROFF", "device power is off"}, + {83, "EDEVERR", "device error"}, + {84, "EOVERFLOW", "value too large to be stored in data type"}, + {85, "EBADEXEC", "bad executable (or shared library)"}, + {86, "EBADARCH", "bad CPU type in executable"}, + {87, "ESHLIBVERS", "shared library version mismatch"}, + {88, "EBADMACHO", "malformed Mach-o file"}, + {89, "ECANCELED", "operation canceled"}, + {90, "EIDRM", "identifier removed"}, + {91, "ENOMSG", "no message of desired type"}, + {92, "EILSEQ", "illegal byte sequence"}, + {93, "ENOATTR", "attribute not found"}, + {94, "EBADMSG", "bad message"}, + {95, "EMULTIHOP", "EMULTIHOP (Reserved)"}, + {96, "ENODATA", "no message available on STREAM"}, + {97, "ENOLINK", "ENOLINK (Reserved)"}, + {98, "ENOSR", "no STREAM resources"}, + {99, "ENOSTR", "not a STREAM"}, + {100, "EPROTO", "protocol error"}, + {101, "ETIME", "STREAM ioctl timeout"}, + {102, "EOPNOTSUPP", "operation not supported on socket"}, + {103, "ENOPOLICY", "policy not found"}, + {104, "ENOTRECOVERABLE", "state not recoverable"}, + {105, "EOWNERDEAD", "previous owner died"}, + {106, "EQFULL", "interface output queue is full"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "suspended (signal)", - 18: "suspended", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGABRT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "suspended (signal)"}, + {18, "SIGTSTP", "suspended"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_darwin_arm64.go b/vendor/golang.org/x/sys/unix/zerrors_darwin_arm64.go index 6419c65e13..6d56d8a059 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_darwin_arm64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_darwin_arm64.go @@ -1473,6 +1473,12 @@ const ( WORDSIZE = 0x40 WSTOPPED = 0x8 WUNTRACED = 0x2 + XATTR_CREATE = 0x2 + XATTR_NODEFAULT = 0x10 + XATTR_NOFOLLOW = 0x1 + XATTR_NOSECURITY = 0x8 + XATTR_REPLACE = 0x4 + XATTR_SHOWCOMPRESSION = 0x20 ) // Errors @@ -1624,146 +1630,154 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "resource busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "operation timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "device power is off", - 83: "device error", - 84: "value too large to be stored in data type", - 85: "bad executable (or shared library)", - 86: "bad CPU type in executable", - 87: "shared library version mismatch", - 88: "malformed Mach-o file", - 89: "operation canceled", - 90: "identifier removed", - 91: "no message of desired type", - 92: "illegal byte sequence", - 93: "attribute not found", - 94: "bad message", - 95: "EMULTIHOP (Reserved)", - 96: "no message available on STREAM", - 97: "ENOLINK (Reserved)", - 98: "no STREAM resources", - 99: "not a STREAM", - 100: "protocol error", - 101: "STREAM ioctl timeout", - 102: "operation not supported on socket", - 103: "policy not found", - 104: "state not recoverable", - 105: "previous owner died", - 106: "interface output queue is full", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large"}, + {35, "EAGAIN", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "ENOTSUP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "operation timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disc quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC prog. not avail"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EPWROFF", "device power is off"}, + {83, "EDEVERR", "device error"}, + {84, "EOVERFLOW", "value too large to be stored in data type"}, + {85, "EBADEXEC", "bad executable (or shared library)"}, + {86, "EBADARCH", "bad CPU type in executable"}, + {87, "ESHLIBVERS", "shared library version mismatch"}, + {88, "EBADMACHO", "malformed Mach-o file"}, + {89, "ECANCELED", "operation canceled"}, + {90, "EIDRM", "identifier removed"}, + {91, "ENOMSG", "no message of desired type"}, + {92, "EILSEQ", "illegal byte sequence"}, + {93, "ENOATTR", "attribute not found"}, + {94, "EBADMSG", "bad message"}, + {95, "EMULTIHOP", "EMULTIHOP (Reserved)"}, + {96, "ENODATA", "no message available on STREAM"}, + {97, "ENOLINK", "ENOLINK (Reserved)"}, + {98, "ENOSR", "no STREAM resources"}, + {99, "ENOSTR", "not a STREAM"}, + {100, "EPROTO", "protocol error"}, + {101, "ETIME", "STREAM ioctl timeout"}, + {102, "EOPNOTSUPP", "operation not supported on socket"}, + {103, "ENOPOLICY", "policy not found"}, + {104, "ENOTRECOVERABLE", "state not recoverable"}, + {105, "EOWNERDEAD", "previous owner died"}, + {106, "EQFULL", "interface output queue is full"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "suspended (signal)", - 18: "suspended", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGABRT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "suspended (signal)"}, + {18, "SIGTSTP", "suspended"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_dragonfly_amd64.go b/vendor/golang.org/x/sys/unix/zerrors_dragonfly_amd64.go index d96015505f..46a082b6d5 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_dragonfly_amd64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_dragonfly_amd64.go @@ -980,7 +980,10 @@ const ( RLIMIT_CPU = 0x0 RLIMIT_DATA = 0x2 RLIMIT_FSIZE = 0x1 + RLIMIT_MEMLOCK = 0x6 RLIMIT_NOFILE = 0x8 + RLIMIT_NPROC = 0x7 + RLIMIT_RSS = 0x5 RLIMIT_STACK = 0x3 RLIM_INFINITY = 0x7fffffffffffffff RTAX_AUTHOR = 0x6 @@ -1434,142 +1437,150 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "operation timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "identifier removed", - 83: "no message of desired type", - 84: "value too large to be stored in data type", - 85: "operation canceled", - 86: "illegal byte sequence", - 87: "attribute not found", - 88: "programming error", - 89: "bad message", - 90: "multihop attempted", - 91: "link has been severed", - 92: "protocol error", - 93: "no medium found", - 94: "unknown error: 94", - 95: "unknown error: 95", - 96: "unknown error: 96", - 97: "unknown error: 97", - 98: "unknown error: 98", - 99: "unknown error: 99", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large"}, + {35, "EWOULDBLOCK", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "EOPNOTSUPP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "operation timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disc quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC prog. not avail"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EIDRM", "identifier removed"}, + {83, "ENOMSG", "no message of desired type"}, + {84, "EOVERFLOW", "value too large to be stored in data type"}, + {85, "ECANCELED", "operation canceled"}, + {86, "EILSEQ", "illegal byte sequence"}, + {87, "ENOATTR", "attribute not found"}, + {88, "EDOOFUS", "programming error"}, + {89, "EBADMSG", "bad message"}, + {90, "EMULTIHOP", "multihop attempted"}, + {91, "ENOLINK", "link has been severed"}, + {92, "EPROTO", "protocol error"}, + {93, "ENOMEDIUM", "no medium found"}, + {94, "EUNUSED94", "unknown error: 94"}, + {95, "EUNUSED95", "unknown error: 95"}, + {96, "EUNUSED96", "unknown error: 96"}, + {97, "EUNUSED97", "unknown error: 97"}, + {98, "EUNUSED98", "unknown error: 98"}, + {99, "ELAST", "unknown error: 99"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "suspended (signal)", - 18: "suspended", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", - 32: "thread Scheduler", - 33: "checkPoint", - 34: "checkPointExit", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGIOT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "suspended (signal)"}, + {18, "SIGTSTP", "suspended"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, + {32, "SIGTHR", "thread Scheduler"}, + {33, "SIGCKPT", "checkPoint"}, + {34, "SIGCKPTEXIT", "checkPointExit"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_freebsd_386.go b/vendor/golang.org/x/sys/unix/zerrors_freebsd_386.go index a8b05878e3..2947dc0382 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_freebsd_386.go +++ b/vendor/golang.org/x/sys/unix/zerrors_freebsd_386.go @@ -1619,138 +1619,146 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "operation timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "identifier removed", - 83: "no message of desired type", - 84: "value too large to be stored in data type", - 85: "operation canceled", - 86: "illegal byte sequence", - 87: "attribute not found", - 88: "programming error", - 89: "bad message", - 90: "multihop attempted", - 91: "link has been severed", - 92: "protocol error", - 93: "capabilities insufficient", - 94: "not permitted in capability mode", - 95: "state not recoverable", - 96: "previous owner died", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large"}, + {35, "EAGAIN", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "EOPNOTSUPP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "operation timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disc quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC prog. not avail"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EIDRM", "identifier removed"}, + {83, "ENOMSG", "no message of desired type"}, + {84, "EOVERFLOW", "value too large to be stored in data type"}, + {85, "ECANCELED", "operation canceled"}, + {86, "EILSEQ", "illegal byte sequence"}, + {87, "ENOATTR", "attribute not found"}, + {88, "EDOOFUS", "programming error"}, + {89, "EBADMSG", "bad message"}, + {90, "EMULTIHOP", "multihop attempted"}, + {91, "ENOLINK", "link has been severed"}, + {92, "EPROTO", "protocol error"}, + {93, "ENOTCAPABLE", "capabilities insufficient"}, + {94, "ECAPMODE", "not permitted in capability mode"}, + {95, "ENOTRECOVERABLE", "state not recoverable"}, + {96, "EOWNERDEAD", "previous owner died"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "suspended (signal)", - 18: "suspended", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", - 32: "unknown signal", - 33: "unknown signal", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGIOT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "suspended (signal)"}, + {18, "SIGTSTP", "suspended"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, + {32, "SIGTHR", "unknown signal"}, + {33, "SIGLIBRT", "unknown signal"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_freebsd_amd64.go b/vendor/golang.org/x/sys/unix/zerrors_freebsd_amd64.go index cf5f01260e..c600d012d0 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_freebsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_freebsd_amd64.go @@ -1620,138 +1620,146 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "operation timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "identifier removed", - 83: "no message of desired type", - 84: "value too large to be stored in data type", - 85: "operation canceled", - 86: "illegal byte sequence", - 87: "attribute not found", - 88: "programming error", - 89: "bad message", - 90: "multihop attempted", - 91: "link has been severed", - 92: "protocol error", - 93: "capabilities insufficient", - 94: "not permitted in capability mode", - 95: "state not recoverable", - 96: "previous owner died", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large"}, + {35, "EAGAIN", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "EOPNOTSUPP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "operation timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disc quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC prog. not avail"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EIDRM", "identifier removed"}, + {83, "ENOMSG", "no message of desired type"}, + {84, "EOVERFLOW", "value too large to be stored in data type"}, + {85, "ECANCELED", "operation canceled"}, + {86, "EILSEQ", "illegal byte sequence"}, + {87, "ENOATTR", "attribute not found"}, + {88, "EDOOFUS", "programming error"}, + {89, "EBADMSG", "bad message"}, + {90, "EMULTIHOP", "multihop attempted"}, + {91, "ENOLINK", "link has been severed"}, + {92, "EPROTO", "protocol error"}, + {93, "ENOTCAPABLE", "capabilities insufficient"}, + {94, "ECAPMODE", "not permitted in capability mode"}, + {95, "ENOTRECOVERABLE", "state not recoverable"}, + {96, "EOWNERDEAD", "previous owner died"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "suspended (signal)", - 18: "suspended", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", - 32: "unknown signal", - 33: "unknown signal", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGIOT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "suspended (signal)"}, + {18, "SIGTSTP", "suspended"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, + {32, "SIGTHR", "unknown signal"}, + {33, "SIGLIBRT", "unknown signal"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_freebsd_arm.go b/vendor/golang.org/x/sys/unix/zerrors_freebsd_arm.go index 9bbb90ad8a..e8240d2397 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_freebsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zerrors_freebsd_arm.go @@ -1628,138 +1628,146 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "operation timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "identifier removed", - 83: "no message of desired type", - 84: "value too large to be stored in data type", - 85: "operation canceled", - 86: "illegal byte sequence", - 87: "attribute not found", - 88: "programming error", - 89: "bad message", - 90: "multihop attempted", - 91: "link has been severed", - 92: "protocol error", - 93: "capabilities insufficient", - 94: "not permitted in capability mode", - 95: "state not recoverable", - 96: "previous owner died", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large"}, + {35, "EAGAIN", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "EOPNOTSUPP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "operation timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disc quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC prog. not avail"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EIDRM", "identifier removed"}, + {83, "ENOMSG", "no message of desired type"}, + {84, "EOVERFLOW", "value too large to be stored in data type"}, + {85, "ECANCELED", "operation canceled"}, + {86, "EILSEQ", "illegal byte sequence"}, + {87, "ENOATTR", "attribute not found"}, + {88, "EDOOFUS", "programming error"}, + {89, "EBADMSG", "bad message"}, + {90, "EMULTIHOP", "multihop attempted"}, + {91, "ENOLINK", "link has been severed"}, + {92, "EPROTO", "protocol error"}, + {93, "ENOTCAPABLE", "capabilities insufficient"}, + {94, "ECAPMODE", "not permitted in capability mode"}, + {95, "ENOTRECOVERABLE", "state not recoverable"}, + {96, "EOWNERDEAD", "previous owner died"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "suspended (signal)", - 18: "suspended", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", - 32: "unknown signal", - 33: "unknown signal", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGIOT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "suspended (signal)"}, + {18, "SIGTSTP", "suspended"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, + {32, "SIGTHR", "unknown signal"}, + {33, "SIGLIBRT", "unknown signal"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_386.go b/vendor/golang.org/x/sys/unix/zerrors_linux_386.go index 4fba476e32..2f0091bbc9 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_386.go @@ -3,7 +3,7 @@ // +build 386,linux -// Created by cgo -godefs - DO NOT EDIT +// Code generated by cmd/cgo -godefs; DO NOT EDIT. // cgo -godefs -- -Wall -Werror -static -I/tmp/include -m32 _const.go package unix @@ -11,6 +11,11 @@ package unix import "syscall" const ( + AAFS_MAGIC = 0x5a3c69f0 + ADFS_SUPER_MAGIC = 0xadf5 + AFFS_SUPER_MAGIC = 0xadff + AFS_FS_MAGIC = 0x6b414653 + AFS_SUPER_MAGIC = 0x5346414f AF_ALG = 0x26 AF_APPLETALK = 0x5 AF_ASH = 0x12 @@ -66,6 +71,7 @@ const ( ALG_SET_IV = 0x2 ALG_SET_KEY = 0x1 ALG_SET_OP = 0x3 + ANON_INODE_FS_MAGIC = 0x9041934 ARPHRD_6LOWPAN = 0x339 ARPHRD_ADAPT = 0x108 ARPHRD_APPLETLK = 0x8 @@ -121,6 +127,7 @@ const ( ARPHRD_PPP = 0x200 ARPHRD_PRONET = 0x4 ARPHRD_RAWHDLC = 0x206 + ARPHRD_RAWIP = 0x207 ARPHRD_ROSE = 0x10e ARPHRD_RSRVD = 0x104 ARPHRD_SIT = 0x308 @@ -132,6 +139,7 @@ const ( ARPHRD_VOID = 0xffff ARPHRD_VSOCKMON = 0x33a ARPHRD_X25 = 0x10f + AUTOFS_SUPER_MAGIC = 0x187 B0 = 0x0 B1000000 = 0x1008 B110 = 0x3 @@ -163,6 +171,9 @@ const ( B75 = 0x2 B921600 = 0x1007 B9600 = 0xd + BALLOON_KVM_MAGIC = 0x13661366 + BDEVFS_MAGIC = 0x62646576 + BINFMTFS_MAGIC = 0x42494e4d BLKBSZGET = 0x80041270 BLKBSZSET = 0x40041271 BLKFLSBUF = 0x1261 @@ -187,6 +198,7 @@ const ( BPF_AND = 0x50 BPF_B = 0x10 BPF_DIV = 0x30 + BPF_FS_MAGIC = 0xcafe4a11 BPF_H = 0x8 BPF_IMM = 0x0 BPF_IND = 0x40 @@ -228,6 +240,8 @@ const ( BS0 = 0x0 BS1 = 0x2000 BSDLY = 0x2000 + BTRFS_SUPER_MAGIC = 0x9123683e + BTRFS_TEST_MAGIC = 0x73727279 CAN_BCM = 0x2 CAN_EFF_FLAG = 0x80000000 CAN_EFF_ID_BITS = 0x1d @@ -251,6 +265,8 @@ const ( CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf + CGROUP2_SUPER_MAGIC = 0x63677270 + CGROUP_SUPER_MAGIC = 0x27e0eb CIBAUD = 0x100f0000 CLOCAL = 0x800 CLOCK_BOOTTIME = 0x7 @@ -293,10 +309,12 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CMSPAR = 0x40000000 + CODA_SUPER_MAGIC = 0x73757245 CR0 = 0x0 CR1 = 0x200 CR2 = 0x400 CR3 = 0x600 + CRAMFS_MAGIC = 0x28cd3d45 CRDLY = 0x600 CREAD = 0x80 CRTSCTS = 0x80000000 @@ -311,6 +329,9 @@ const ( CSTOP = 0x13 CSTOPB = 0x40 CSUSP = 0x1a + DAXFS_MAGIC = 0x64646178 + DEBUGFS_MAGIC = 0x64626720 + DEVPTS_SUPER_MAGIC = 0x1cd1 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -327,9 +348,12 @@ const ( ECHOKE = 0x800 ECHONL = 0x40 ECHOPRT = 0x400 + ECRYPTFS_SUPER_MAGIC = 0xf15f EFD_CLOEXEC = 0x80000 EFD_NONBLOCK = 0x800 EFD_SEMAPHORE = 0x1 + EFIVARFS_MAGIC = 0xde5e81e4 + EFS_SUPER_MAGIC = 0x414a53 ENCODING_DEFAULT = 0x0 ENCODING_FM_MARK = 0x3 ENCODING_FM_SPACE = 0x4 @@ -390,6 +414,8 @@ const ( ETH_P_DSA = 0x1b ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada + ETH_P_ERSPAN = 0x88be + ETH_P_ERSPAN2 = 0x22eb ETH_P_FCOE = 0x8906 ETH_P_FIP = 0x8914 ETH_P_HDLC = 0x19 @@ -398,6 +424,7 @@ const ( ETH_P_IEEE802154 = 0xf6 ETH_P_IEEEPUP = 0xa00 ETH_P_IEEEPUPAT = 0xa01 + ETH_P_IFE = 0xed3e ETH_P_IP = 0x800 ETH_P_IPV6 = 0x86dd ETH_P_IPX = 0x8137 @@ -408,11 +435,13 @@ const ( ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 ETH_P_MACSEC = 0x88e5 + ETH_P_MAP = 0xf9 ETH_P_MOBITEX = 0x15 ETH_P_MPLS_MC = 0x8848 ETH_P_MPLS_UC = 0x8847 ETH_P_MVRP = 0x88f5 ETH_P_NCSI = 0x88f8 + ETH_P_NSH = 0x894f ETH_P_PAE = 0x888e ETH_P_PAUSE = 0x8808 ETH_P_PHONET = 0xf5 @@ -420,6 +449,7 @@ const ( ETH_P_PPP_DISC = 0x8863 ETH_P_PPP_MP = 0x8 ETH_P_PPP_SES = 0x8864 + ETH_P_PREAUTH = 0x88c7 ETH_P_PRP = 0x88fb ETH_P_PUP = 0x200 ETH_P_PUPAT = 0x201 @@ -440,9 +470,14 @@ const ( ETH_P_WCCP = 0x883e ETH_P_X25 = 0x805 ETH_P_XDSA = 0xf8 + EXABYTE_ENABLE_NEST = 0xf0 + EXT2_SUPER_MAGIC = 0xef53 + EXT3_SUPER_MAGIC = 0xef53 + EXT4_SUPER_MAGIC = 0xef53 EXTA = 0xe EXTB = 0xf EXTPROC = 0x10000 + F2FS_SUPER_MAGIC = 0xf2f52010 FALLOC_FL_COLLAPSE_RANGE = 0x8 FALLOC_FL_INSERT_RANGE = 0x20 FALLOC_FL_KEEP_SIZE = 0x1 @@ -456,6 +491,7 @@ const ( FF1 = 0x8000 FFDLY = 0x8000 FLUSHO = 0x1000 + FP_XSTATE_MAGIC2 = 0x46505845 FS_ENCRYPTION_MODE_AES_128_CBC = 0x5 FS_ENCRYPTION_MODE_AES_128_CTS = 0x6 FS_ENCRYPTION_MODE_AES_256_CBC = 0x3 @@ -476,6 +512,8 @@ const ( FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 FS_POLICY_FLAGS_VALID = 0x3 + FUTEXFS_SUPER_MAGIC = 0xbad1dea + F_ADD_SEALS = 0x409 F_DUPFD = 0x0 F_DUPFD_CLOEXEC = 0x406 F_EXLCK = 0x4 @@ -488,6 +526,9 @@ const ( F_GETOWN_EX = 0x10 F_GETPIPE_SZ = 0x408 F_GETSIG = 0xb + F_GET_FILE_RW_HINT = 0x40d + F_GET_RW_HINT = 0x40b + F_GET_SEALS = 0x40a F_LOCK = 0x1 F_NOTIFY = 0x402 F_OFD_GETLK = 0x24 @@ -495,6 +536,10 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_GROW = 0x4 + F_SEAL_SEAL = 0x1 + F_SEAL_SHRINK = 0x2 + F_SEAL_WRITE = 0x8 F_SETFD = 0x2 F_SETFL = 0x4 F_SETLEASE = 0x400 @@ -506,6 +551,8 @@ const ( F_SETOWN_EX = 0xf F_SETPIPE_SZ = 0x407 F_SETSIG = 0xa + F_SET_FILE_RW_HINT = 0x40e + F_SET_RW_HINT = 0x40c F_SHLCK = 0x8 F_TEST = 0x3 F_TLOCK = 0x2 @@ -527,6 +574,49 @@ const ( GENL_UNS_ADMIN_PERM = 0x10 GRND_NONBLOCK = 0x1 GRND_RANDOM = 0x2 + HDIO_DRIVE_CMD = 0x31f + HDIO_DRIVE_CMD_AEB = 0x31e + HDIO_DRIVE_CMD_HDR_SIZE = 0x4 + HDIO_DRIVE_HOB_HDR_SIZE = 0x8 + HDIO_DRIVE_RESET = 0x31c + HDIO_DRIVE_TASK = 0x31e + HDIO_DRIVE_TASKFILE = 0x31d + HDIO_DRIVE_TASK_HDR_SIZE = 0x8 + HDIO_GETGEO = 0x301 + HDIO_GET_32BIT = 0x309 + HDIO_GET_ACOUSTIC = 0x30f + HDIO_GET_ADDRESS = 0x310 + HDIO_GET_BUSSTATE = 0x31a + HDIO_GET_DMA = 0x30b + HDIO_GET_IDENTITY = 0x30d + HDIO_GET_KEEPSETTINGS = 0x308 + HDIO_GET_MULTCOUNT = 0x304 + HDIO_GET_NICE = 0x30c + HDIO_GET_NOWERR = 0x30a + HDIO_GET_QDMA = 0x305 + HDIO_GET_UNMASKINTR = 0x302 + HDIO_GET_WCACHE = 0x30e + HDIO_OBSOLETE_IDENTITY = 0x307 + HDIO_SCAN_HWIF = 0x328 + HDIO_SET_32BIT = 0x324 + HDIO_SET_ACOUSTIC = 0x32c + HDIO_SET_ADDRESS = 0x32f + HDIO_SET_BUSSTATE = 0x32d + HDIO_SET_DMA = 0x326 + HDIO_SET_KEEPSETTINGS = 0x323 + HDIO_SET_MULTCOUNT = 0x321 + HDIO_SET_NICE = 0x329 + HDIO_SET_NOWERR = 0x325 + HDIO_SET_PIO_MODE = 0x327 + HDIO_SET_QDMA = 0x32e + HDIO_SET_UNMASKINTR = 0x322 + HDIO_SET_WCACHE = 0x32b + HDIO_SET_XFER = 0x306 + HDIO_TRISTATE_HWIF = 0x31b + HDIO_UNREGISTER_HWIF = 0x32a + HOSTFS_SUPER_MAGIC = 0xc0ffee + HPFS_SUPER_MAGIC = 0xf995e849 + HUGETLBFS_MAGIC = 0x958458f6 HUPCL = 0x400 IBSHIFT = 0x10 ICANON = 0x2 @@ -561,6 +651,8 @@ const ( IFF_MASTER = 0x400 IFF_MULTICAST = 0x1000 IFF_MULTI_QUEUE = 0x100 + IFF_NAPI = 0x10 + IFF_NAPI_FRAGS = 0x20 IFF_NOARP = 0x80 IFF_NOFILTER = 0x1000 IFF_NOTRAILERS = 0x20 @@ -775,12 +867,14 @@ const ( IP_UNICAST_IF = 0x32 IP_XFRM_POLICY = 0x11 ISIG = 0x1 + ISOFS_SUPER_MAGIC = 0x9660 ISTRIP = 0x20 IUCLC = 0x200 IUTF8 = 0x4000 IXANY = 0x800 IXOFF = 0x1000 IXON = 0x400 + JFFS2_SUPER_MAGIC = 0x72b6 KEYCTL_ASSUME_AUTHORITY = 0x10 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 @@ -845,6 +939,7 @@ const ( MADV_FREE = 0x8 MADV_HUGEPAGE = 0xe MADV_HWPOISON = 0x64 + MADV_KEEPONFORK = 0x13 MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 @@ -853,6 +948,7 @@ const ( MADV_SEQUENTIAL = 0x2 MADV_UNMERGEABLE = 0xd MADV_WILLNEED = 0x3 + MADV_WIPEONFORK = 0x12 MAP_32BIT = 0x40 MAP_ANON = 0x20 MAP_ANONYMOUS = 0x20 @@ -875,9 +971,15 @@ const ( MCL_CURRENT = 0x1 MCL_FUTURE = 0x2 MCL_ONFAULT = 0x4 + MINIX2_SUPER_MAGIC = 0x2468 + MINIX2_SUPER_MAGIC2 = 0x2478 + MINIX3_SUPER_MAGIC = 0x4d5a + MINIX_SUPER_MAGIC = 0x137f + MINIX_SUPER_MAGIC2 = 0x138f MNT_DETACH = 0x2 MNT_EXPIRE = 0x4 MNT_FORCE = 0x1 + MSDOS_SUPER_MAGIC = 0x4d44 MSG_BATCH = 0x40000 MSG_CMSG_CLOEXEC = 0x40000000 MSG_CONFIRM = 0x800 @@ -899,6 +1001,7 @@ const ( MSG_TRYHARD = 0x4 MSG_WAITALL = 0x100 MSG_WAITFORONE = 0x10000 + MSG_ZEROCOPY = 0x4000000 MS_ACTIVE = 0x40000000 MS_ASYNC = 0x1 MS_BIND = 0x1000 @@ -936,7 +1039,9 @@ const ( MS_SYNCHRONOUS = 0x10 MS_UNBINDABLE = 0x20000 MS_VERBOSE = 0x8000 + MTD_INODE_FS_MAGIC = 0x11307854 NAME_MAX = 0xff + NCP_SUPER_MAGIC = 0x564c NETLINK_ADD_MEMBERSHIP = 0x1 NETLINK_AUDIT = 0x9 NETLINK_BROADCAST_ERROR = 0x4 @@ -971,6 +1076,37 @@ const ( NETLINK_UNUSED = 0x1 NETLINK_USERSOCK = 0x2 NETLINK_XFRM = 0x6 + NFNETLINK_V0 = 0x0 + NFNLGRP_ACCT_QUOTA = 0x8 + NFNLGRP_CONNTRACK_DESTROY = 0x3 + NFNLGRP_CONNTRACK_EXP_DESTROY = 0x6 + NFNLGRP_CONNTRACK_EXP_NEW = 0x4 + NFNLGRP_CONNTRACK_EXP_UPDATE = 0x5 + NFNLGRP_CONNTRACK_NEW = 0x1 + NFNLGRP_CONNTRACK_UPDATE = 0x2 + NFNLGRP_MAX = 0x9 + NFNLGRP_NFTABLES = 0x7 + NFNLGRP_NFTRACE = 0x9 + NFNLGRP_NONE = 0x0 + NFNL_BATCH_MAX = 0x1 + NFNL_MSG_BATCH_BEGIN = 0x10 + NFNL_MSG_BATCH_END = 0x11 + NFNL_NFA_NEST = 0x8000 + NFNL_SUBSYS_ACCT = 0x7 + NFNL_SUBSYS_COUNT = 0xc + NFNL_SUBSYS_CTHELPER = 0x9 + NFNL_SUBSYS_CTNETLINK = 0x1 + NFNL_SUBSYS_CTNETLINK_EXP = 0x2 + NFNL_SUBSYS_CTNETLINK_TIMEOUT = 0x8 + NFNL_SUBSYS_IPSET = 0x6 + NFNL_SUBSYS_NFTABLES = 0xa + NFNL_SUBSYS_NFT_COMPAT = 0xb + NFNL_SUBSYS_NONE = 0x0 + NFNL_SUBSYS_OSF = 0x5 + NFNL_SUBSYS_QUEUE = 0x3 + NFNL_SUBSYS_ULOG = 0x4 + NFS_SUPER_MAGIC = 0x6969 + NILFS_SUPER_MAGIC = 0x3434 NL0 = 0x0 NL1 = 0x100 NLA_ALIGNTO = 0x4 @@ -998,10 +1134,13 @@ const ( NLM_F_EXCL = 0x200 NLM_F_MATCH = 0x200 NLM_F_MULTI = 0x2 + NLM_F_NONREC = 0x100 NLM_F_REPLACE = 0x100 NLM_F_REQUEST = 0x1 NLM_F_ROOT = 0x100 NOFLSH = 0x80 + NSFS_MAGIC = 0x6e736673 + OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 OFILL = 0x40 @@ -1009,7 +1148,9 @@ const ( ONLCR = 0x4 ONLRET = 0x20 ONOCR = 0x10 + OPENPROM_SUPER_MAGIC = 0x9fa1 OPOST = 0x1 + OVERLAYFS_SUPER_MAGIC = 0x794c7630 O_ACCMODE = 0x3 O_APPEND = 0x400 O_ASYNC = 0x2000 @@ -1094,16 +1235,20 @@ const ( PERF_EVENT_IOC_DISABLE = 0x2401 PERF_EVENT_IOC_ENABLE = 0x2400 PERF_EVENT_IOC_ID = 0x80042407 + PERF_EVENT_IOC_MODIFY_ATTRIBUTES = 0x4004240b PERF_EVENT_IOC_PAUSE_OUTPUT = 0x40042409 PERF_EVENT_IOC_PERIOD = 0x40082404 + PERF_EVENT_IOC_QUERY_BPF = 0xc004240a PERF_EVENT_IOC_REFRESH = 0x2402 PERF_EVENT_IOC_RESET = 0x2403 PERF_EVENT_IOC_SET_BPF = 0x40042408 PERF_EVENT_IOC_SET_FILTER = 0x40042406 PERF_EVENT_IOC_SET_OUTPUT = 0x2405 + PIPEFS_MAGIC = 0x50495045 PRIO_PGRP = 0x1 PRIO_PROCESS = 0x0 PRIO_USER = 0x2 + PROC_SUPER_MAGIC = 0x9fa0 PROT_EXEC = 0x4 PROT_GROWSDOWN = 0x1000000 PROT_GROWSUP = 0x2000000 @@ -1146,6 +1291,7 @@ const ( PR_GET_PDEATHSIG = 0x2 PR_GET_SECCOMP = 0x15 PR_GET_SECUREBITS = 0x1b + PR_GET_SPECULATION_CTRL = 0x34 PR_GET_THP_DISABLE = 0x2a PR_GET_TID_ADDRESS = 0x28 PR_GET_TIMERSLACK = 0x1e @@ -1191,11 +1337,23 @@ const ( PR_SET_PTRACER_ANY = 0xffffffff PR_SET_SECCOMP = 0x16 PR_SET_SECUREBITS = 0x1c + PR_SET_SPECULATION_CTRL = 0x35 PR_SET_THP_DISABLE = 0x29 PR_SET_TIMERSLACK = 0x1d PR_SET_TIMING = 0xe PR_SET_TSC = 0x1a PR_SET_UNALIGN = 0x6 + PR_SPEC_DISABLE = 0x4 + PR_SPEC_ENABLE = 0x2 + PR_SPEC_FORCE_DISABLE = 0x8 + PR_SPEC_NOT_AFFECTED = 0x0 + PR_SPEC_PRCTL = 0x1 + PR_SPEC_STORE_BYPASS = 0x0 + PR_SVE_GET_VL = 0x33 + PR_SVE_SET_VL = 0x32 + PR_SVE_SET_VL_ONEXEC = 0x40000 + PR_SVE_VL_INHERIT = 0x20000 + PR_SVE_VL_LEN_MASK = 0xffff PR_TASK_PERF_EVENTS_DISABLE = 0x1f PR_TASK_PERF_EVENTS_ENABLE = 0x20 PR_TIMING_STATISTICAL = 0x0 @@ -1204,6 +1362,7 @@ const ( PR_TSC_SIGSEGV = 0x2 PR_UNALIGN_NOPRINT = 0x1 PR_UNALIGN_SIGBUS = 0x2 + PSTOREFS_MAGIC = 0x6165676c PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 @@ -1247,6 +1406,7 @@ const ( PTRACE_POKETEXT = 0x4 PTRACE_POKEUSR = 0x6 PTRACE_SECCOMP_GET_FILTER = 0x420c + PTRACE_SECCOMP_GET_METADATA = 0x420d PTRACE_SEIZE = 0x4206 PTRACE_SETFPREGS = 0xf PTRACE_SETFPXREGS = 0x13 @@ -1262,6 +1422,11 @@ const ( PTRACE_SYSEMU = 0x1f PTRACE_SYSEMU_SINGLESTEP = 0x20 PTRACE_TRACEME = 0x0 + QNX4_SUPER_MAGIC = 0x2f + QNX6_SUPER_MAGIC = 0x68191122 + RAMFS_MAGIC = 0x858458f6 + RDTGROUP_SUPER_MAGIC = 0x7655821 + REISERFS_SUPER_MAGIC = 0x52654973 RLIMIT_AS = 0x9 RLIMIT_CORE = 0x4 RLIMIT_CPU = 0x0 @@ -1282,6 +1447,7 @@ const ( RTAX_ADVMSS = 0x8 RTAX_CC_ALGO = 0x10 RTAX_CWND = 0x7 + RTAX_FASTOPEN_NO_COOKIE = 0x11 RTAX_FEATURES = 0xc RTAX_FEATURE_ALLFRAG = 0x8 RTAX_FEATURE_ECN = 0x1 @@ -1292,7 +1458,7 @@ const ( RTAX_INITCWND = 0xb RTAX_INITRWND = 0xe RTAX_LOCK = 0x1 - RTAX_MAX = 0x10 + RTAX_MAX = 0x11 RTAX_MTU = 0x2 RTAX_QUICKACK = 0xf RTAX_REORDERING = 0x9 @@ -1310,6 +1476,33 @@ const ( RTCF_MASQ = 0x400000 RTCF_NAT = 0x800000 RTCF_VALVE = 0x200000 + RTC_AF = 0x20 + RTC_AIE_OFF = 0x7002 + RTC_AIE_ON = 0x7001 + RTC_ALM_READ = 0x80247008 + RTC_ALM_SET = 0x40247007 + RTC_EPOCH_READ = 0x8004700d + RTC_EPOCH_SET = 0x4004700e + RTC_IRQF = 0x80 + RTC_IRQP_READ = 0x8004700b + RTC_IRQP_SET = 0x4004700c + RTC_MAX_FREQ = 0x2000 + RTC_PF = 0x40 + RTC_PIE_OFF = 0x7006 + RTC_PIE_ON = 0x7005 + RTC_PLL_GET = 0x801c7011 + RTC_PLL_SET = 0x401c7012 + RTC_RD_TIME = 0x80247009 + RTC_SET_TIME = 0x4024700a + RTC_UF = 0x10 + RTC_UIE_OFF = 0x7004 + RTC_UIE_ON = 0x7003 + RTC_VL_CLR = 0x7014 + RTC_VL_READ = 0x80047013 + RTC_WIE_OFF = 0x7010 + RTC_WIE_ON = 0x700f + RTC_WKALM_RD = 0x80287010 + RTC_WKALM_SET = 0x4028700f RTF_ADDRCLASSMASK = 0xf8000000 RTF_ADDRCONF = 0x40000 RTF_ALLONLINK = 0x20000 @@ -1446,6 +1639,8 @@ const ( SECCOMP_MODE_DISABLED = 0x0 SECCOMP_MODE_FILTER = 0x2 SECCOMP_MODE_STRICT = 0x1 + SECURITYFS_MAGIC = 0x73636673 + SELINUX_MAGIC = 0xf97cff8c SHUT_RD = 0x0 SHUT_RDWR = 0x2 SHUT_WR = 0x1 @@ -1530,6 +1725,23 @@ const ( SIOCSPGRP = 0x8902 SIOCSRARP = 0x8962 SIOCWANDEV = 0x894a + SMACK_MAGIC = 0x43415d53 + SMART_AUTOSAVE = 0xd2 + SMART_AUTO_OFFLINE = 0xdb + SMART_DISABLE = 0xd9 + SMART_ENABLE = 0xd8 + SMART_HCYL_PASS = 0xc2 + SMART_IMMEDIATE_OFFLINE = 0xd4 + SMART_LCYL_PASS = 0x4f + SMART_READ_LOG_SECTOR = 0xd5 + SMART_READ_THRESHOLDS = 0xd1 + SMART_READ_VALUES = 0xd0 + SMART_SAVE = 0xd3 + SMART_STATUS = 0xda + SMART_WRITE_LOG_SECTOR = 0xd6 + SMART_WRITE_THRESHOLDS = 0xd7 + SMB_SUPER_MAGIC = 0x517b + SOCKFS_MAGIC = 0x534f434b SOCK_CLOEXEC = 0x80000 SOCK_DCCP = 0x6 SOCK_DGRAM = 0x2 @@ -1566,6 +1778,7 @@ const ( SOL_SOCKET = 0x1 SOL_TCP = 0x6 SOL_TIPC = 0x10f + SOL_TLS = 0x11a SOL_X25 = 0x106 SOMAXCONN = 0x80 SO_ACCEPTCONN = 0x1e @@ -1634,10 +1847,13 @@ const ( SO_VM_SOCKETS_PEER_HOST_VM_ID = 0x3 SO_VM_SOCKETS_TRUSTED = 0x5 SO_WIFI_STATUS = 0x29 + SO_ZEROCOPY = 0x3c SPLICE_F_GIFT = 0x8 SPLICE_F_MORE = 0x4 SPLICE_F_MOVE = 0x1 SPLICE_F_NONBLOCK = 0x2 + SQUASHFS_MAGIC = 0x73717368 + STACK_END_MAGIC = 0x57ac6e9d STATX_ALL = 0xfff STATX_ATIME = 0x20 STATX_ATTR_APPEND = 0x20 @@ -1659,6 +1875,7 @@ const ( STATX_TYPE = 0x1 STATX_UID = 0x8 STATX__RESERVED = 0x80000000 + SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 S_IFBLK = 0x6000 @@ -1730,6 +1947,8 @@ const ( TCP_MAXWIN = 0xffff TCP_MAX_WINSHIFT = 0xe TCP_MD5SIG = 0xe + TCP_MD5SIG_EXT = 0x20 + TCP_MD5SIG_FLAG_PREFIX = 0x1 TCP_MD5SIG_MAXKEYLEN = 0x50 TCP_MSS = 0x200 TCP_MSS_DEFAULT = 0x218 @@ -1750,6 +1969,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa TCSAFLUSH = 0x2 @@ -1837,7 +2057,27 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 + TPACKET_ALIGNMENT = 0x10 + TPACKET_HDRLEN = 0x34 + TP_STATUS_AVAILABLE = 0x0 + TP_STATUS_BLK_TMO = 0x20 + TP_STATUS_COPY = 0x2 + TP_STATUS_CSUMNOTREADY = 0x8 + TP_STATUS_CSUM_VALID = 0x80 + TP_STATUS_KERNEL = 0x0 + TP_STATUS_LOSING = 0x4 + TP_STATUS_SENDING = 0x2 + TP_STATUS_SEND_REQUEST = 0x1 + TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_SOFTWARE = 0x20000000 + TP_STATUS_TS_SYS_HARDWARE = 0x40000000 + TP_STATUS_USER = 0x1 + TP_STATUS_VLAN_TPID_VALID = 0x40 + TP_STATUS_VLAN_VALID = 0x10 + TP_STATUS_WRONG_FORMAT = 0x4 + TRACEFS_MAGIC = 0x74726163 TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x400854d5 TUNDETACHFILTER = 0x400854d6 @@ -1849,6 +2089,7 @@ const ( TUNGETVNETHDRSZ = 0x800454d7 TUNGETVNETLE = 0x800454dd TUNSETDEBUG = 0x400454c9 + TUNSETFILTEREBPF = 0x800454e1 TUNSETGROUP = 0x400454ce TUNSETIFF = 0x400454ca TUNSETIFINDEX = 0x400454da @@ -1859,13 +2100,17 @@ const ( TUNSETPERSIST = 0x400454cb TUNSETQUEUE = 0x400454d9 TUNSETSNDBUF = 0x400454d4 + TUNSETSTEERINGEBPF = 0x800454e0 TUNSETTXFILTER = 0x400454d1 TUNSETVNETBE = 0x400454de TUNSETVNETHDRSZ = 0x400454d8 TUNSETVNETLE = 0x400454dc + UDF_SUPER_MAGIC = 0x15013346 UMOUNT_NOFOLLOW = 0x8 + USBDEVICE_SUPER_MAGIC = 0x9fa2 UTIME_NOW = 0x3fffffff UTIME_OMIT = 0x3ffffffe + V9FS_MAGIC = 0x1021997 VDISCARD = 0xd VEOF = 0x4 VEOL = 0xb @@ -1907,16 +2152,99 @@ const ( WDIOC_SETPRETIMEOUT = 0xc0045708 WDIOC_SETTIMEOUT = 0xc0045706 WEXITED = 0x4 + WIN_ACKMEDIACHANGE = 0xdb + WIN_CHECKPOWERMODE1 = 0xe5 + WIN_CHECKPOWERMODE2 = 0x98 + WIN_DEVICE_RESET = 0x8 + WIN_DIAGNOSE = 0x90 + WIN_DOORLOCK = 0xde + WIN_DOORUNLOCK = 0xdf + WIN_DOWNLOAD_MICROCODE = 0x92 + WIN_FLUSH_CACHE = 0xe7 + WIN_FLUSH_CACHE_EXT = 0xea + WIN_FORMAT = 0x50 + WIN_GETMEDIASTATUS = 0xda + WIN_IDENTIFY = 0xec + WIN_IDENTIFY_DMA = 0xee + WIN_IDLEIMMEDIATE = 0xe1 + WIN_INIT = 0x60 + WIN_MEDIAEJECT = 0xed + WIN_MULTREAD = 0xc4 + WIN_MULTREAD_EXT = 0x29 + WIN_MULTWRITE = 0xc5 + WIN_MULTWRITE_EXT = 0x39 + WIN_NOP = 0x0 + WIN_PACKETCMD = 0xa0 + WIN_PIDENTIFY = 0xa1 + WIN_POSTBOOT = 0xdc + WIN_PREBOOT = 0xdd + WIN_QUEUED_SERVICE = 0xa2 + WIN_READ = 0x20 + WIN_READDMA = 0xc8 + WIN_READDMA_EXT = 0x25 + WIN_READDMA_ONCE = 0xc9 + WIN_READDMA_QUEUED = 0xc7 + WIN_READDMA_QUEUED_EXT = 0x26 + WIN_READ_BUFFER = 0xe4 + WIN_READ_EXT = 0x24 + WIN_READ_LONG = 0x22 + WIN_READ_LONG_ONCE = 0x23 + WIN_READ_NATIVE_MAX = 0xf8 + WIN_READ_NATIVE_MAX_EXT = 0x27 + WIN_READ_ONCE = 0x21 + WIN_RECAL = 0x10 + WIN_RESTORE = 0x10 + WIN_SECURITY_DISABLE = 0xf6 + WIN_SECURITY_ERASE_PREPARE = 0xf3 + WIN_SECURITY_ERASE_UNIT = 0xf4 + WIN_SECURITY_FREEZE_LOCK = 0xf5 + WIN_SECURITY_SET_PASS = 0xf1 + WIN_SECURITY_UNLOCK = 0xf2 + WIN_SEEK = 0x70 + WIN_SETFEATURES = 0xef + WIN_SETIDLE1 = 0xe3 + WIN_SETIDLE2 = 0x97 + WIN_SETMULT = 0xc6 + WIN_SET_MAX = 0xf9 + WIN_SET_MAX_EXT = 0x37 + WIN_SLEEPNOW1 = 0xe6 + WIN_SLEEPNOW2 = 0x99 + WIN_SMART = 0xb0 + WIN_SPECIFY = 0x91 + WIN_SRST = 0x8 + WIN_STANDBY = 0xe2 + WIN_STANDBY2 = 0x96 + WIN_STANDBYNOW1 = 0xe0 + WIN_STANDBYNOW2 = 0x94 + WIN_VERIFY = 0x40 + WIN_VERIFY_EXT = 0x42 + WIN_VERIFY_ONCE = 0x41 + WIN_WRITE = 0x30 + WIN_WRITEDMA = 0xca + WIN_WRITEDMA_EXT = 0x35 + WIN_WRITEDMA_ONCE = 0xcb + WIN_WRITEDMA_QUEUED = 0xcc + WIN_WRITEDMA_QUEUED_EXT = 0x36 + WIN_WRITE_BUFFER = 0xe8 + WIN_WRITE_EXT = 0x34 + WIN_WRITE_LONG = 0x32 + WIN_WRITE_LONG_ONCE = 0x33 + WIN_WRITE_ONCE = 0x31 + WIN_WRITE_SAME = 0xe9 + WIN_WRITE_VERIFY = 0x3c WNOHANG = 0x1 WNOTHREAD = 0x20000000 WNOWAIT = 0x1000000 WORDSIZE = 0x20 WSTOPPED = 0x2 WUNTRACED = 0x2 + X86_FXSR_MAGIC = 0x0 XATTR_CREATE = 0x1 XATTR_REPLACE = 0x2 XCASE = 0x4 + XENFS_SUPER_MAGIC = 0xabba1974 XTABS = 0x1800 + ZSMALLOC_MAGIC = 0x58295829 ) // Errors @@ -2096,171 +2424,179 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "no such device or address", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource temporarily unavailable", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device or resource busy", - 17: "file exists", - 18: "invalid cross-device link", - 19: "no such device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "numerical result out of range", - 35: "resource deadlock avoided", - 36: "file name too long", - 37: "no locks available", - 38: "function not implemented", - 39: "directory not empty", - 40: "too many levels of symbolic links", - 42: "no message of desired type", - 43: "identifier removed", - 44: "channel number out of range", - 45: "level 2 not synchronized", - 46: "level 3 halted", - 47: "level 3 reset", - 48: "link number out of range", - 49: "protocol driver not attached", - 50: "no CSI structure available", - 51: "level 2 halted", - 52: "invalid exchange", - 53: "invalid request descriptor", - 54: "exchange full", - 55: "no anode", - 56: "invalid request code", - 57: "invalid slot", - 59: "bad font file format", - 60: "device not a stream", - 61: "no data available", - 62: "timer expired", - 63: "out of streams resources", - 64: "machine is not on the network", - 65: "package not installed", - 66: "object is remote", - 67: "link has been severed", - 68: "advertise error", - 69: "srmount error", - 70: "communication error on send", - 71: "protocol error", - 72: "multihop attempted", - 73: "RFS specific error", - 74: "bad message", - 75: "value too large for defined data type", - 76: "name not unique on network", - 77: "file descriptor in bad state", - 78: "remote address changed", - 79: "can not access a needed shared library", - 80: "accessing a corrupted shared library", - 81: ".lib section in a.out corrupted", - 82: "attempting to link in too many shared libraries", - 83: "cannot exec a shared library directly", - 84: "invalid or incomplete multibyte or wide character", - 85: "interrupted system call should be restarted", - 86: "streams pipe error", - 87: "too many users", - 88: "socket operation on non-socket", - 89: "destination address required", - 90: "message too long", - 91: "protocol wrong type for socket", - 92: "protocol not available", - 93: "protocol not supported", - 94: "socket type not supported", - 95: "operation not supported", - 96: "protocol family not supported", - 97: "address family not supported by protocol", - 98: "address already in use", - 99: "cannot assign requested address", - 100: "network is down", - 101: "network is unreachable", - 102: "network dropped connection on reset", - 103: "software caused connection abort", - 104: "connection reset by peer", - 105: "no buffer space available", - 106: "transport endpoint is already connected", - 107: "transport endpoint is not connected", - 108: "cannot send after transport endpoint shutdown", - 109: "too many references: cannot splice", - 110: "connection timed out", - 111: "connection refused", - 112: "host is down", - 113: "no route to host", - 114: "operation already in progress", - 115: "operation now in progress", - 116: "stale file handle", - 117: "structure needs cleaning", - 118: "not a XENIX named type file", - 119: "no XENIX semaphores available", - 120: "is a named type file", - 121: "remote I/O error", - 122: "disk quota exceeded", - 123: "no medium found", - 124: "wrong medium type", - 125: "operation canceled", - 126: "required key not available", - 127: "key has expired", - 128: "key has been revoked", - 129: "key was rejected by service", - 130: "owner died", - 131: "state not recoverable", - 132: "operation not possible due to RF-kill", - 133: "memory page has hardware error", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "no such device or address"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EAGAIN", "resource temporarily unavailable"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device or resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "invalid cross-device link"}, + {19, "ENODEV", "no such device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "numerical result out of range"}, + {35, "EDEADLK", "resource deadlock avoided"}, + {36, "ENAMETOOLONG", "file name too long"}, + {37, "ENOLCK", "no locks available"}, + {38, "ENOSYS", "function not implemented"}, + {39, "ENOTEMPTY", "directory not empty"}, + {40, "ELOOP", "too many levels of symbolic links"}, + {42, "ENOMSG", "no message of desired type"}, + {43, "EIDRM", "identifier removed"}, + {44, "ECHRNG", "channel number out of range"}, + {45, "EL2NSYNC", "level 2 not synchronized"}, + {46, "EL3HLT", "level 3 halted"}, + {47, "EL3RST", "level 3 reset"}, + {48, "ELNRNG", "link number out of range"}, + {49, "EUNATCH", "protocol driver not attached"}, + {50, "ENOCSI", "no CSI structure available"}, + {51, "EL2HLT", "level 2 halted"}, + {52, "EBADE", "invalid exchange"}, + {53, "EBADR", "invalid request descriptor"}, + {54, "EXFULL", "exchange full"}, + {55, "ENOANO", "no anode"}, + {56, "EBADRQC", "invalid request code"}, + {57, "EBADSLT", "invalid slot"}, + {59, "EBFONT", "bad font file format"}, + {60, "ENOSTR", "device not a stream"}, + {61, "ENODATA", "no data available"}, + {62, "ETIME", "timer expired"}, + {63, "ENOSR", "out of streams resources"}, + {64, "ENONET", "machine is not on the network"}, + {65, "ENOPKG", "package not installed"}, + {66, "EREMOTE", "object is remote"}, + {67, "ENOLINK", "link has been severed"}, + {68, "EADV", "advertise error"}, + {69, "ESRMNT", "srmount error"}, + {70, "ECOMM", "communication error on send"}, + {71, "EPROTO", "protocol error"}, + {72, "EMULTIHOP", "multihop attempted"}, + {73, "EDOTDOT", "RFS specific error"}, + {74, "EBADMSG", "bad message"}, + {75, "EOVERFLOW", "value too large for defined data type"}, + {76, "ENOTUNIQ", "name not unique on network"}, + {77, "EBADFD", "file descriptor in bad state"}, + {78, "EREMCHG", "remote address changed"}, + {79, "ELIBACC", "can not access a needed shared library"}, + {80, "ELIBBAD", "accessing a corrupted shared library"}, + {81, "ELIBSCN", ".lib section in a.out corrupted"}, + {82, "ELIBMAX", "attempting to link in too many shared libraries"}, + {83, "ELIBEXEC", "cannot exec a shared library directly"}, + {84, "EILSEQ", "invalid or incomplete multibyte or wide character"}, + {85, "ERESTART", "interrupted system call should be restarted"}, + {86, "ESTRPIPE", "streams pipe error"}, + {87, "EUSERS", "too many users"}, + {88, "ENOTSOCK", "socket operation on non-socket"}, + {89, "EDESTADDRREQ", "destination address required"}, + {90, "EMSGSIZE", "message too long"}, + {91, "EPROTOTYPE", "protocol wrong type for socket"}, + {92, "ENOPROTOOPT", "protocol not available"}, + {93, "EPROTONOSUPPORT", "protocol not supported"}, + {94, "ESOCKTNOSUPPORT", "socket type not supported"}, + {95, "ENOTSUP", "operation not supported"}, + {96, "EPFNOSUPPORT", "protocol family not supported"}, + {97, "EAFNOSUPPORT", "address family not supported by protocol"}, + {98, "EADDRINUSE", "address already in use"}, + {99, "EADDRNOTAVAIL", "cannot assign requested address"}, + {100, "ENETDOWN", "network is down"}, + {101, "ENETUNREACH", "network is unreachable"}, + {102, "ENETRESET", "network dropped connection on reset"}, + {103, "ECONNABORTED", "software caused connection abort"}, + {104, "ECONNRESET", "connection reset by peer"}, + {105, "ENOBUFS", "no buffer space available"}, + {106, "EISCONN", "transport endpoint is already connected"}, + {107, "ENOTCONN", "transport endpoint is not connected"}, + {108, "ESHUTDOWN", "cannot send after transport endpoint shutdown"}, + {109, "ETOOMANYREFS", "too many references: cannot splice"}, + {110, "ETIMEDOUT", "connection timed out"}, + {111, "ECONNREFUSED", "connection refused"}, + {112, "EHOSTDOWN", "host is down"}, + {113, "EHOSTUNREACH", "no route to host"}, + {114, "EALREADY", "operation already in progress"}, + {115, "EINPROGRESS", "operation now in progress"}, + {116, "ESTALE", "stale file handle"}, + {117, "EUCLEAN", "structure needs cleaning"}, + {118, "ENOTNAM", "not a XENIX named type file"}, + {119, "ENAVAIL", "no XENIX semaphores available"}, + {120, "EISNAM", "is a named type file"}, + {121, "EREMOTEIO", "remote I/O error"}, + {122, "EDQUOT", "disk quota exceeded"}, + {123, "ENOMEDIUM", "no medium found"}, + {124, "EMEDIUMTYPE", "wrong medium type"}, + {125, "ECANCELED", "operation canceled"}, + {126, "ENOKEY", "required key not available"}, + {127, "EKEYEXPIRED", "key has expired"}, + {128, "EKEYREVOKED", "key has been revoked"}, + {129, "EKEYREJECTED", "key was rejected by service"}, + {130, "EOWNERDEAD", "owner died"}, + {131, "ENOTRECOVERABLE", "state not recoverable"}, + {132, "ERFKILL", "operation not possible due to RF-kill"}, + {133, "EHWPOISON", "memory page has hardware error"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/breakpoint trap", - 6: "aborted", - 7: "bus error", - 8: "floating point exception", - 9: "killed", - 10: "user defined signal 1", - 11: "segmentation fault", - 12: "user defined signal 2", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "stack fault", - 17: "child exited", - 18: "continued", - 19: "stopped (signal)", - 20: "stopped", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "urgent I/O condition", - 24: "CPU time limit exceeded", - 25: "file size limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window changed", - 29: "I/O possible", - 30: "power failure", - 31: "bad system call", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/breakpoint trap"}, + {6, "SIGABRT", "aborted"}, + {7, "SIGBUS", "bus error"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGUSR1", "user defined signal 1"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGUSR2", "user defined signal 2"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGSTKFLT", "stack fault"}, + {17, "SIGCHLD", "child exited"}, + {18, "SIGCONT", "continued"}, + {19, "SIGSTOP", "stopped (signal)"}, + {20, "SIGTSTP", "stopped"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGURG", "urgent I/O condition"}, + {24, "SIGXCPU", "CPU time limit exceeded"}, + {25, "SIGXFSZ", "file size limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window changed"}, + {29, "SIGIO", "I/O possible"}, + {30, "SIGPWR", "power failure"}, + {31, "SIGSYS", "bad system call"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go index 7e2a108d87..a80c7ae5fb 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_amd64.go @@ -3,7 +3,7 @@ // +build amd64,linux -// Created by cgo -godefs - DO NOT EDIT +// Code generated by cmd/cgo -godefs; DO NOT EDIT. // cgo -godefs -- -Wall -Werror -static -I/tmp/include -m64 _const.go package unix @@ -11,6 +11,11 @@ package unix import "syscall" const ( + AAFS_MAGIC = 0x5a3c69f0 + ADFS_SUPER_MAGIC = 0xadf5 + AFFS_SUPER_MAGIC = 0xadff + AFS_FS_MAGIC = 0x6b414653 + AFS_SUPER_MAGIC = 0x5346414f AF_ALG = 0x26 AF_APPLETALK = 0x5 AF_ASH = 0x12 @@ -66,6 +71,7 @@ const ( ALG_SET_IV = 0x2 ALG_SET_KEY = 0x1 ALG_SET_OP = 0x3 + ANON_INODE_FS_MAGIC = 0x9041934 ARPHRD_6LOWPAN = 0x339 ARPHRD_ADAPT = 0x108 ARPHRD_APPLETLK = 0x8 @@ -121,6 +127,7 @@ const ( ARPHRD_PPP = 0x200 ARPHRD_PRONET = 0x4 ARPHRD_RAWHDLC = 0x206 + ARPHRD_RAWIP = 0x207 ARPHRD_ROSE = 0x10e ARPHRD_RSRVD = 0x104 ARPHRD_SIT = 0x308 @@ -132,6 +139,7 @@ const ( ARPHRD_VOID = 0xffff ARPHRD_VSOCKMON = 0x33a ARPHRD_X25 = 0x10f + AUTOFS_SUPER_MAGIC = 0x187 B0 = 0x0 B1000000 = 0x1008 B110 = 0x3 @@ -163,6 +171,9 @@ const ( B75 = 0x2 B921600 = 0x1007 B9600 = 0xd + BALLOON_KVM_MAGIC = 0x13661366 + BDEVFS_MAGIC = 0x62646576 + BINFMTFS_MAGIC = 0x42494e4d BLKBSZGET = 0x80081270 BLKBSZSET = 0x40081271 BLKFLSBUF = 0x1261 @@ -187,6 +198,7 @@ const ( BPF_AND = 0x50 BPF_B = 0x10 BPF_DIV = 0x30 + BPF_FS_MAGIC = 0xcafe4a11 BPF_H = 0x8 BPF_IMM = 0x0 BPF_IND = 0x40 @@ -228,6 +240,8 @@ const ( BS0 = 0x0 BS1 = 0x2000 BSDLY = 0x2000 + BTRFS_SUPER_MAGIC = 0x9123683e + BTRFS_TEST_MAGIC = 0x73727279 CAN_BCM = 0x2 CAN_EFF_FLAG = 0x80000000 CAN_EFF_ID_BITS = 0x1d @@ -251,6 +265,8 @@ const ( CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf + CGROUP2_SUPER_MAGIC = 0x63677270 + CGROUP_SUPER_MAGIC = 0x27e0eb CIBAUD = 0x100f0000 CLOCAL = 0x800 CLOCK_BOOTTIME = 0x7 @@ -293,10 +309,12 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CMSPAR = 0x40000000 + CODA_SUPER_MAGIC = 0x73757245 CR0 = 0x0 CR1 = 0x200 CR2 = 0x400 CR3 = 0x600 + CRAMFS_MAGIC = 0x28cd3d45 CRDLY = 0x600 CREAD = 0x80 CRTSCTS = 0x80000000 @@ -311,6 +329,9 @@ const ( CSTOP = 0x13 CSTOPB = 0x40 CSUSP = 0x1a + DAXFS_MAGIC = 0x64646178 + DEBUGFS_MAGIC = 0x64626720 + DEVPTS_SUPER_MAGIC = 0x1cd1 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -327,9 +348,12 @@ const ( ECHOKE = 0x800 ECHONL = 0x40 ECHOPRT = 0x400 + ECRYPTFS_SUPER_MAGIC = 0xf15f EFD_CLOEXEC = 0x80000 EFD_NONBLOCK = 0x800 EFD_SEMAPHORE = 0x1 + EFIVARFS_MAGIC = 0xde5e81e4 + EFS_SUPER_MAGIC = 0x414a53 ENCODING_DEFAULT = 0x0 ENCODING_FM_MARK = 0x3 ENCODING_FM_SPACE = 0x4 @@ -390,6 +414,8 @@ const ( ETH_P_DSA = 0x1b ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada + ETH_P_ERSPAN = 0x88be + ETH_P_ERSPAN2 = 0x22eb ETH_P_FCOE = 0x8906 ETH_P_FIP = 0x8914 ETH_P_HDLC = 0x19 @@ -398,6 +424,7 @@ const ( ETH_P_IEEE802154 = 0xf6 ETH_P_IEEEPUP = 0xa00 ETH_P_IEEEPUPAT = 0xa01 + ETH_P_IFE = 0xed3e ETH_P_IP = 0x800 ETH_P_IPV6 = 0x86dd ETH_P_IPX = 0x8137 @@ -408,11 +435,13 @@ const ( ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 ETH_P_MACSEC = 0x88e5 + ETH_P_MAP = 0xf9 ETH_P_MOBITEX = 0x15 ETH_P_MPLS_MC = 0x8848 ETH_P_MPLS_UC = 0x8847 ETH_P_MVRP = 0x88f5 ETH_P_NCSI = 0x88f8 + ETH_P_NSH = 0x894f ETH_P_PAE = 0x888e ETH_P_PAUSE = 0x8808 ETH_P_PHONET = 0xf5 @@ -420,6 +449,7 @@ const ( ETH_P_PPP_DISC = 0x8863 ETH_P_PPP_MP = 0x8 ETH_P_PPP_SES = 0x8864 + ETH_P_PREAUTH = 0x88c7 ETH_P_PRP = 0x88fb ETH_P_PUP = 0x200 ETH_P_PUPAT = 0x201 @@ -440,9 +470,14 @@ const ( ETH_P_WCCP = 0x883e ETH_P_X25 = 0x805 ETH_P_XDSA = 0xf8 + EXABYTE_ENABLE_NEST = 0xf0 + EXT2_SUPER_MAGIC = 0xef53 + EXT3_SUPER_MAGIC = 0xef53 + EXT4_SUPER_MAGIC = 0xef53 EXTA = 0xe EXTB = 0xf EXTPROC = 0x10000 + F2FS_SUPER_MAGIC = 0xf2f52010 FALLOC_FL_COLLAPSE_RANGE = 0x8 FALLOC_FL_INSERT_RANGE = 0x20 FALLOC_FL_KEEP_SIZE = 0x1 @@ -456,6 +491,7 @@ const ( FF1 = 0x8000 FFDLY = 0x8000 FLUSHO = 0x1000 + FP_XSTATE_MAGIC2 = 0x46505845 FS_ENCRYPTION_MODE_AES_128_CBC = 0x5 FS_ENCRYPTION_MODE_AES_128_CTS = 0x6 FS_ENCRYPTION_MODE_AES_256_CBC = 0x3 @@ -476,6 +512,8 @@ const ( FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 FS_POLICY_FLAGS_VALID = 0x3 + FUTEXFS_SUPER_MAGIC = 0xbad1dea + F_ADD_SEALS = 0x409 F_DUPFD = 0x0 F_DUPFD_CLOEXEC = 0x406 F_EXLCK = 0x4 @@ -488,6 +526,9 @@ const ( F_GETOWN_EX = 0x10 F_GETPIPE_SZ = 0x408 F_GETSIG = 0xb + F_GET_FILE_RW_HINT = 0x40d + F_GET_RW_HINT = 0x40b + F_GET_SEALS = 0x40a F_LOCK = 0x1 F_NOTIFY = 0x402 F_OFD_GETLK = 0x24 @@ -495,6 +536,10 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_GROW = 0x4 + F_SEAL_SEAL = 0x1 + F_SEAL_SHRINK = 0x2 + F_SEAL_WRITE = 0x8 F_SETFD = 0x2 F_SETFL = 0x4 F_SETLEASE = 0x400 @@ -506,6 +551,8 @@ const ( F_SETOWN_EX = 0xf F_SETPIPE_SZ = 0x407 F_SETSIG = 0xa + F_SET_FILE_RW_HINT = 0x40e + F_SET_RW_HINT = 0x40c F_SHLCK = 0x8 F_TEST = 0x3 F_TLOCK = 0x2 @@ -527,6 +574,49 @@ const ( GENL_UNS_ADMIN_PERM = 0x10 GRND_NONBLOCK = 0x1 GRND_RANDOM = 0x2 + HDIO_DRIVE_CMD = 0x31f + HDIO_DRIVE_CMD_AEB = 0x31e + HDIO_DRIVE_CMD_HDR_SIZE = 0x4 + HDIO_DRIVE_HOB_HDR_SIZE = 0x8 + HDIO_DRIVE_RESET = 0x31c + HDIO_DRIVE_TASK = 0x31e + HDIO_DRIVE_TASKFILE = 0x31d + HDIO_DRIVE_TASK_HDR_SIZE = 0x8 + HDIO_GETGEO = 0x301 + HDIO_GET_32BIT = 0x309 + HDIO_GET_ACOUSTIC = 0x30f + HDIO_GET_ADDRESS = 0x310 + HDIO_GET_BUSSTATE = 0x31a + HDIO_GET_DMA = 0x30b + HDIO_GET_IDENTITY = 0x30d + HDIO_GET_KEEPSETTINGS = 0x308 + HDIO_GET_MULTCOUNT = 0x304 + HDIO_GET_NICE = 0x30c + HDIO_GET_NOWERR = 0x30a + HDIO_GET_QDMA = 0x305 + HDIO_GET_UNMASKINTR = 0x302 + HDIO_GET_WCACHE = 0x30e + HDIO_OBSOLETE_IDENTITY = 0x307 + HDIO_SCAN_HWIF = 0x328 + HDIO_SET_32BIT = 0x324 + HDIO_SET_ACOUSTIC = 0x32c + HDIO_SET_ADDRESS = 0x32f + HDIO_SET_BUSSTATE = 0x32d + HDIO_SET_DMA = 0x326 + HDIO_SET_KEEPSETTINGS = 0x323 + HDIO_SET_MULTCOUNT = 0x321 + HDIO_SET_NICE = 0x329 + HDIO_SET_NOWERR = 0x325 + HDIO_SET_PIO_MODE = 0x327 + HDIO_SET_QDMA = 0x32e + HDIO_SET_UNMASKINTR = 0x322 + HDIO_SET_WCACHE = 0x32b + HDIO_SET_XFER = 0x306 + HDIO_TRISTATE_HWIF = 0x31b + HDIO_UNREGISTER_HWIF = 0x32a + HOSTFS_SUPER_MAGIC = 0xc0ffee + HPFS_SUPER_MAGIC = 0xf995e849 + HUGETLBFS_MAGIC = 0x958458f6 HUPCL = 0x400 IBSHIFT = 0x10 ICANON = 0x2 @@ -561,6 +651,8 @@ const ( IFF_MASTER = 0x400 IFF_MULTICAST = 0x1000 IFF_MULTI_QUEUE = 0x100 + IFF_NAPI = 0x10 + IFF_NAPI_FRAGS = 0x20 IFF_NOARP = 0x80 IFF_NOFILTER = 0x1000 IFF_NOTRAILERS = 0x20 @@ -775,12 +867,14 @@ const ( IP_UNICAST_IF = 0x32 IP_XFRM_POLICY = 0x11 ISIG = 0x1 + ISOFS_SUPER_MAGIC = 0x9660 ISTRIP = 0x20 IUCLC = 0x200 IUTF8 = 0x4000 IXANY = 0x800 IXOFF = 0x1000 IXON = 0x400 + JFFS2_SUPER_MAGIC = 0x72b6 KEYCTL_ASSUME_AUTHORITY = 0x10 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 @@ -845,6 +939,7 @@ const ( MADV_FREE = 0x8 MADV_HUGEPAGE = 0xe MADV_HWPOISON = 0x64 + MADV_KEEPONFORK = 0x13 MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 @@ -853,6 +948,7 @@ const ( MADV_SEQUENTIAL = 0x2 MADV_UNMERGEABLE = 0xd MADV_WILLNEED = 0x3 + MADV_WIPEONFORK = 0x12 MAP_32BIT = 0x40 MAP_ANON = 0x20 MAP_ANONYMOUS = 0x20 @@ -875,9 +971,15 @@ const ( MCL_CURRENT = 0x1 MCL_FUTURE = 0x2 MCL_ONFAULT = 0x4 + MINIX2_SUPER_MAGIC = 0x2468 + MINIX2_SUPER_MAGIC2 = 0x2478 + MINIX3_SUPER_MAGIC = 0x4d5a + MINIX_SUPER_MAGIC = 0x137f + MINIX_SUPER_MAGIC2 = 0x138f MNT_DETACH = 0x2 MNT_EXPIRE = 0x4 MNT_FORCE = 0x1 + MSDOS_SUPER_MAGIC = 0x4d44 MSG_BATCH = 0x40000 MSG_CMSG_CLOEXEC = 0x40000000 MSG_CONFIRM = 0x800 @@ -899,6 +1001,7 @@ const ( MSG_TRYHARD = 0x4 MSG_WAITALL = 0x100 MSG_WAITFORONE = 0x10000 + MSG_ZEROCOPY = 0x4000000 MS_ACTIVE = 0x40000000 MS_ASYNC = 0x1 MS_BIND = 0x1000 @@ -936,7 +1039,9 @@ const ( MS_SYNCHRONOUS = 0x10 MS_UNBINDABLE = 0x20000 MS_VERBOSE = 0x8000 + MTD_INODE_FS_MAGIC = 0x11307854 NAME_MAX = 0xff + NCP_SUPER_MAGIC = 0x564c NETLINK_ADD_MEMBERSHIP = 0x1 NETLINK_AUDIT = 0x9 NETLINK_BROADCAST_ERROR = 0x4 @@ -971,6 +1076,37 @@ const ( NETLINK_UNUSED = 0x1 NETLINK_USERSOCK = 0x2 NETLINK_XFRM = 0x6 + NFNETLINK_V0 = 0x0 + NFNLGRP_ACCT_QUOTA = 0x8 + NFNLGRP_CONNTRACK_DESTROY = 0x3 + NFNLGRP_CONNTRACK_EXP_DESTROY = 0x6 + NFNLGRP_CONNTRACK_EXP_NEW = 0x4 + NFNLGRP_CONNTRACK_EXP_UPDATE = 0x5 + NFNLGRP_CONNTRACK_NEW = 0x1 + NFNLGRP_CONNTRACK_UPDATE = 0x2 + NFNLGRP_MAX = 0x9 + NFNLGRP_NFTABLES = 0x7 + NFNLGRP_NFTRACE = 0x9 + NFNLGRP_NONE = 0x0 + NFNL_BATCH_MAX = 0x1 + NFNL_MSG_BATCH_BEGIN = 0x10 + NFNL_MSG_BATCH_END = 0x11 + NFNL_NFA_NEST = 0x8000 + NFNL_SUBSYS_ACCT = 0x7 + NFNL_SUBSYS_COUNT = 0xc + NFNL_SUBSYS_CTHELPER = 0x9 + NFNL_SUBSYS_CTNETLINK = 0x1 + NFNL_SUBSYS_CTNETLINK_EXP = 0x2 + NFNL_SUBSYS_CTNETLINK_TIMEOUT = 0x8 + NFNL_SUBSYS_IPSET = 0x6 + NFNL_SUBSYS_NFTABLES = 0xa + NFNL_SUBSYS_NFT_COMPAT = 0xb + NFNL_SUBSYS_NONE = 0x0 + NFNL_SUBSYS_OSF = 0x5 + NFNL_SUBSYS_QUEUE = 0x3 + NFNL_SUBSYS_ULOG = 0x4 + NFS_SUPER_MAGIC = 0x6969 + NILFS_SUPER_MAGIC = 0x3434 NL0 = 0x0 NL1 = 0x100 NLA_ALIGNTO = 0x4 @@ -998,10 +1134,13 @@ const ( NLM_F_EXCL = 0x200 NLM_F_MATCH = 0x200 NLM_F_MULTI = 0x2 + NLM_F_NONREC = 0x100 NLM_F_REPLACE = 0x100 NLM_F_REQUEST = 0x1 NLM_F_ROOT = 0x100 NOFLSH = 0x80 + NSFS_MAGIC = 0x6e736673 + OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 OFILL = 0x40 @@ -1009,7 +1148,9 @@ const ( ONLCR = 0x4 ONLRET = 0x20 ONOCR = 0x10 + OPENPROM_SUPER_MAGIC = 0x9fa1 OPOST = 0x1 + OVERLAYFS_SUPER_MAGIC = 0x794c7630 O_ACCMODE = 0x3 O_APPEND = 0x400 O_ASYNC = 0x2000 @@ -1094,16 +1235,20 @@ const ( PERF_EVENT_IOC_DISABLE = 0x2401 PERF_EVENT_IOC_ENABLE = 0x2400 PERF_EVENT_IOC_ID = 0x80082407 + PERF_EVENT_IOC_MODIFY_ATTRIBUTES = 0x4008240b PERF_EVENT_IOC_PAUSE_OUTPUT = 0x40042409 PERF_EVENT_IOC_PERIOD = 0x40082404 + PERF_EVENT_IOC_QUERY_BPF = 0xc008240a PERF_EVENT_IOC_REFRESH = 0x2402 PERF_EVENT_IOC_RESET = 0x2403 PERF_EVENT_IOC_SET_BPF = 0x40042408 PERF_EVENT_IOC_SET_FILTER = 0x40082406 PERF_EVENT_IOC_SET_OUTPUT = 0x2405 + PIPEFS_MAGIC = 0x50495045 PRIO_PGRP = 0x1 PRIO_PROCESS = 0x0 PRIO_USER = 0x2 + PROC_SUPER_MAGIC = 0x9fa0 PROT_EXEC = 0x4 PROT_GROWSDOWN = 0x1000000 PROT_GROWSUP = 0x2000000 @@ -1146,6 +1291,7 @@ const ( PR_GET_PDEATHSIG = 0x2 PR_GET_SECCOMP = 0x15 PR_GET_SECUREBITS = 0x1b + PR_GET_SPECULATION_CTRL = 0x34 PR_GET_THP_DISABLE = 0x2a PR_GET_TID_ADDRESS = 0x28 PR_GET_TIMERSLACK = 0x1e @@ -1191,11 +1337,23 @@ const ( PR_SET_PTRACER_ANY = 0xffffffffffffffff PR_SET_SECCOMP = 0x16 PR_SET_SECUREBITS = 0x1c + PR_SET_SPECULATION_CTRL = 0x35 PR_SET_THP_DISABLE = 0x29 PR_SET_TIMERSLACK = 0x1d PR_SET_TIMING = 0xe PR_SET_TSC = 0x1a PR_SET_UNALIGN = 0x6 + PR_SPEC_DISABLE = 0x4 + PR_SPEC_ENABLE = 0x2 + PR_SPEC_FORCE_DISABLE = 0x8 + PR_SPEC_NOT_AFFECTED = 0x0 + PR_SPEC_PRCTL = 0x1 + PR_SPEC_STORE_BYPASS = 0x0 + PR_SVE_GET_VL = 0x33 + PR_SVE_SET_VL = 0x32 + PR_SVE_SET_VL_ONEXEC = 0x40000 + PR_SVE_VL_INHERIT = 0x20000 + PR_SVE_VL_LEN_MASK = 0xffff PR_TASK_PERF_EVENTS_DISABLE = 0x1f PR_TASK_PERF_EVENTS_ENABLE = 0x20 PR_TIMING_STATISTICAL = 0x0 @@ -1204,6 +1362,7 @@ const ( PR_TSC_SIGSEGV = 0x2 PR_UNALIGN_NOPRINT = 0x1 PR_UNALIGN_SIGBUS = 0x2 + PSTOREFS_MAGIC = 0x6165676c PTRACE_ARCH_PRCTL = 0x1e PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 @@ -1248,6 +1407,7 @@ const ( PTRACE_POKETEXT = 0x4 PTRACE_POKEUSR = 0x6 PTRACE_SECCOMP_GET_FILTER = 0x420c + PTRACE_SECCOMP_GET_METADATA = 0x420d PTRACE_SEIZE = 0x4206 PTRACE_SETFPREGS = 0xf PTRACE_SETFPXREGS = 0x13 @@ -1263,6 +1423,11 @@ const ( PTRACE_SYSEMU = 0x1f PTRACE_SYSEMU_SINGLESTEP = 0x20 PTRACE_TRACEME = 0x0 + QNX4_SUPER_MAGIC = 0x2f + QNX6_SUPER_MAGIC = 0x68191122 + RAMFS_MAGIC = 0x858458f6 + RDTGROUP_SUPER_MAGIC = 0x7655821 + REISERFS_SUPER_MAGIC = 0x52654973 RLIMIT_AS = 0x9 RLIMIT_CORE = 0x4 RLIMIT_CPU = 0x0 @@ -1283,6 +1448,7 @@ const ( RTAX_ADVMSS = 0x8 RTAX_CC_ALGO = 0x10 RTAX_CWND = 0x7 + RTAX_FASTOPEN_NO_COOKIE = 0x11 RTAX_FEATURES = 0xc RTAX_FEATURE_ALLFRAG = 0x8 RTAX_FEATURE_ECN = 0x1 @@ -1293,7 +1459,7 @@ const ( RTAX_INITCWND = 0xb RTAX_INITRWND = 0xe RTAX_LOCK = 0x1 - RTAX_MAX = 0x10 + RTAX_MAX = 0x11 RTAX_MTU = 0x2 RTAX_QUICKACK = 0xf RTAX_REORDERING = 0x9 @@ -1311,6 +1477,33 @@ const ( RTCF_MASQ = 0x400000 RTCF_NAT = 0x800000 RTCF_VALVE = 0x200000 + RTC_AF = 0x20 + RTC_AIE_OFF = 0x7002 + RTC_AIE_ON = 0x7001 + RTC_ALM_READ = 0x80247008 + RTC_ALM_SET = 0x40247007 + RTC_EPOCH_READ = 0x8008700d + RTC_EPOCH_SET = 0x4008700e + RTC_IRQF = 0x80 + RTC_IRQP_READ = 0x8008700b + RTC_IRQP_SET = 0x4008700c + RTC_MAX_FREQ = 0x2000 + RTC_PF = 0x40 + RTC_PIE_OFF = 0x7006 + RTC_PIE_ON = 0x7005 + RTC_PLL_GET = 0x80207011 + RTC_PLL_SET = 0x40207012 + RTC_RD_TIME = 0x80247009 + RTC_SET_TIME = 0x4024700a + RTC_UF = 0x10 + RTC_UIE_OFF = 0x7004 + RTC_UIE_ON = 0x7003 + RTC_VL_CLR = 0x7014 + RTC_VL_READ = 0x80047013 + RTC_WIE_OFF = 0x7010 + RTC_WIE_ON = 0x700f + RTC_WKALM_RD = 0x80287010 + RTC_WKALM_SET = 0x4028700f RTF_ADDRCLASSMASK = 0xf8000000 RTF_ADDRCONF = 0x40000 RTF_ALLONLINK = 0x20000 @@ -1447,6 +1640,8 @@ const ( SECCOMP_MODE_DISABLED = 0x0 SECCOMP_MODE_FILTER = 0x2 SECCOMP_MODE_STRICT = 0x1 + SECURITYFS_MAGIC = 0x73636673 + SELINUX_MAGIC = 0xf97cff8c SHUT_RD = 0x0 SHUT_RDWR = 0x2 SHUT_WR = 0x1 @@ -1531,6 +1726,23 @@ const ( SIOCSPGRP = 0x8902 SIOCSRARP = 0x8962 SIOCWANDEV = 0x894a + SMACK_MAGIC = 0x43415d53 + SMART_AUTOSAVE = 0xd2 + SMART_AUTO_OFFLINE = 0xdb + SMART_DISABLE = 0xd9 + SMART_ENABLE = 0xd8 + SMART_HCYL_PASS = 0xc2 + SMART_IMMEDIATE_OFFLINE = 0xd4 + SMART_LCYL_PASS = 0x4f + SMART_READ_LOG_SECTOR = 0xd5 + SMART_READ_THRESHOLDS = 0xd1 + SMART_READ_VALUES = 0xd0 + SMART_SAVE = 0xd3 + SMART_STATUS = 0xda + SMART_WRITE_LOG_SECTOR = 0xd6 + SMART_WRITE_THRESHOLDS = 0xd7 + SMB_SUPER_MAGIC = 0x517b + SOCKFS_MAGIC = 0x534f434b SOCK_CLOEXEC = 0x80000 SOCK_DCCP = 0x6 SOCK_DGRAM = 0x2 @@ -1567,6 +1779,7 @@ const ( SOL_SOCKET = 0x1 SOL_TCP = 0x6 SOL_TIPC = 0x10f + SOL_TLS = 0x11a SOL_X25 = 0x106 SOMAXCONN = 0x80 SO_ACCEPTCONN = 0x1e @@ -1635,10 +1848,13 @@ const ( SO_VM_SOCKETS_PEER_HOST_VM_ID = 0x3 SO_VM_SOCKETS_TRUSTED = 0x5 SO_WIFI_STATUS = 0x29 + SO_ZEROCOPY = 0x3c SPLICE_F_GIFT = 0x8 SPLICE_F_MORE = 0x4 SPLICE_F_MOVE = 0x1 SPLICE_F_NONBLOCK = 0x2 + SQUASHFS_MAGIC = 0x73717368 + STACK_END_MAGIC = 0x57ac6e9d STATX_ALL = 0xfff STATX_ATIME = 0x20 STATX_ATTR_APPEND = 0x20 @@ -1660,6 +1876,7 @@ const ( STATX_TYPE = 0x1 STATX_UID = 0x8 STATX__RESERVED = 0x80000000 + SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 S_IFBLK = 0x6000 @@ -1731,6 +1948,8 @@ const ( TCP_MAXWIN = 0xffff TCP_MAX_WINSHIFT = 0xe TCP_MD5SIG = 0xe + TCP_MD5SIG_EXT = 0x20 + TCP_MD5SIG_FLAG_PREFIX = 0x1 TCP_MD5SIG_MAXKEYLEN = 0x50 TCP_MSS = 0x200 TCP_MSS_DEFAULT = 0x218 @@ -1751,6 +1970,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa TCSAFLUSH = 0x2 @@ -1838,7 +2058,27 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 + TPACKET_ALIGNMENT = 0x10 + TPACKET_HDRLEN = 0x34 + TP_STATUS_AVAILABLE = 0x0 + TP_STATUS_BLK_TMO = 0x20 + TP_STATUS_COPY = 0x2 + TP_STATUS_CSUMNOTREADY = 0x8 + TP_STATUS_CSUM_VALID = 0x80 + TP_STATUS_KERNEL = 0x0 + TP_STATUS_LOSING = 0x4 + TP_STATUS_SENDING = 0x2 + TP_STATUS_SEND_REQUEST = 0x1 + TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_SOFTWARE = 0x20000000 + TP_STATUS_TS_SYS_HARDWARE = 0x40000000 + TP_STATUS_USER = 0x1 + TP_STATUS_VLAN_TPID_VALID = 0x40 + TP_STATUS_VLAN_VALID = 0x10 + TP_STATUS_WRONG_FORMAT = 0x4 + TRACEFS_MAGIC = 0x74726163 TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x401054d5 TUNDETACHFILTER = 0x401054d6 @@ -1850,6 +2090,7 @@ const ( TUNGETVNETHDRSZ = 0x800454d7 TUNGETVNETLE = 0x800454dd TUNSETDEBUG = 0x400454c9 + TUNSETFILTEREBPF = 0x800454e1 TUNSETGROUP = 0x400454ce TUNSETIFF = 0x400454ca TUNSETIFINDEX = 0x400454da @@ -1860,13 +2101,17 @@ const ( TUNSETPERSIST = 0x400454cb TUNSETQUEUE = 0x400454d9 TUNSETSNDBUF = 0x400454d4 + TUNSETSTEERINGEBPF = 0x800454e0 TUNSETTXFILTER = 0x400454d1 TUNSETVNETBE = 0x400454de TUNSETVNETHDRSZ = 0x400454d8 TUNSETVNETLE = 0x400454dc + UDF_SUPER_MAGIC = 0x15013346 UMOUNT_NOFOLLOW = 0x8 + USBDEVICE_SUPER_MAGIC = 0x9fa2 UTIME_NOW = 0x3fffffff UTIME_OMIT = 0x3ffffffe + V9FS_MAGIC = 0x1021997 VDISCARD = 0xd VEOF = 0x4 VEOL = 0xb @@ -1908,6 +2153,86 @@ const ( WDIOC_SETPRETIMEOUT = 0xc0045708 WDIOC_SETTIMEOUT = 0xc0045706 WEXITED = 0x4 + WIN_ACKMEDIACHANGE = 0xdb + WIN_CHECKPOWERMODE1 = 0xe5 + WIN_CHECKPOWERMODE2 = 0x98 + WIN_DEVICE_RESET = 0x8 + WIN_DIAGNOSE = 0x90 + WIN_DOORLOCK = 0xde + WIN_DOORUNLOCK = 0xdf + WIN_DOWNLOAD_MICROCODE = 0x92 + WIN_FLUSH_CACHE = 0xe7 + WIN_FLUSH_CACHE_EXT = 0xea + WIN_FORMAT = 0x50 + WIN_GETMEDIASTATUS = 0xda + WIN_IDENTIFY = 0xec + WIN_IDENTIFY_DMA = 0xee + WIN_IDLEIMMEDIATE = 0xe1 + WIN_INIT = 0x60 + WIN_MEDIAEJECT = 0xed + WIN_MULTREAD = 0xc4 + WIN_MULTREAD_EXT = 0x29 + WIN_MULTWRITE = 0xc5 + WIN_MULTWRITE_EXT = 0x39 + WIN_NOP = 0x0 + WIN_PACKETCMD = 0xa0 + WIN_PIDENTIFY = 0xa1 + WIN_POSTBOOT = 0xdc + WIN_PREBOOT = 0xdd + WIN_QUEUED_SERVICE = 0xa2 + WIN_READ = 0x20 + WIN_READDMA = 0xc8 + WIN_READDMA_EXT = 0x25 + WIN_READDMA_ONCE = 0xc9 + WIN_READDMA_QUEUED = 0xc7 + WIN_READDMA_QUEUED_EXT = 0x26 + WIN_READ_BUFFER = 0xe4 + WIN_READ_EXT = 0x24 + WIN_READ_LONG = 0x22 + WIN_READ_LONG_ONCE = 0x23 + WIN_READ_NATIVE_MAX = 0xf8 + WIN_READ_NATIVE_MAX_EXT = 0x27 + WIN_READ_ONCE = 0x21 + WIN_RECAL = 0x10 + WIN_RESTORE = 0x10 + WIN_SECURITY_DISABLE = 0xf6 + WIN_SECURITY_ERASE_PREPARE = 0xf3 + WIN_SECURITY_ERASE_UNIT = 0xf4 + WIN_SECURITY_FREEZE_LOCK = 0xf5 + WIN_SECURITY_SET_PASS = 0xf1 + WIN_SECURITY_UNLOCK = 0xf2 + WIN_SEEK = 0x70 + WIN_SETFEATURES = 0xef + WIN_SETIDLE1 = 0xe3 + WIN_SETIDLE2 = 0x97 + WIN_SETMULT = 0xc6 + WIN_SET_MAX = 0xf9 + WIN_SET_MAX_EXT = 0x37 + WIN_SLEEPNOW1 = 0xe6 + WIN_SLEEPNOW2 = 0x99 + WIN_SMART = 0xb0 + WIN_SPECIFY = 0x91 + WIN_SRST = 0x8 + WIN_STANDBY = 0xe2 + WIN_STANDBY2 = 0x96 + WIN_STANDBYNOW1 = 0xe0 + WIN_STANDBYNOW2 = 0x94 + WIN_VERIFY = 0x40 + WIN_VERIFY_EXT = 0x42 + WIN_VERIFY_ONCE = 0x41 + WIN_WRITE = 0x30 + WIN_WRITEDMA = 0xca + WIN_WRITEDMA_EXT = 0x35 + WIN_WRITEDMA_ONCE = 0xcb + WIN_WRITEDMA_QUEUED = 0xcc + WIN_WRITEDMA_QUEUED_EXT = 0x36 + WIN_WRITE_BUFFER = 0xe8 + WIN_WRITE_EXT = 0x34 + WIN_WRITE_LONG = 0x32 + WIN_WRITE_LONG_ONCE = 0x33 + WIN_WRITE_ONCE = 0x31 + WIN_WRITE_SAME = 0xe9 + WIN_WRITE_VERIFY = 0x3c WNOHANG = 0x1 WNOTHREAD = 0x20000000 WNOWAIT = 0x1000000 @@ -1917,7 +2242,9 @@ const ( XATTR_CREATE = 0x1 XATTR_REPLACE = 0x2 XCASE = 0x4 + XENFS_SUPER_MAGIC = 0xabba1974 XTABS = 0x1800 + ZSMALLOC_MAGIC = 0x58295829 ) // Errors @@ -2097,171 +2424,179 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "no such device or address", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource temporarily unavailable", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device or resource busy", - 17: "file exists", - 18: "invalid cross-device link", - 19: "no such device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "numerical result out of range", - 35: "resource deadlock avoided", - 36: "file name too long", - 37: "no locks available", - 38: "function not implemented", - 39: "directory not empty", - 40: "too many levels of symbolic links", - 42: "no message of desired type", - 43: "identifier removed", - 44: "channel number out of range", - 45: "level 2 not synchronized", - 46: "level 3 halted", - 47: "level 3 reset", - 48: "link number out of range", - 49: "protocol driver not attached", - 50: "no CSI structure available", - 51: "level 2 halted", - 52: "invalid exchange", - 53: "invalid request descriptor", - 54: "exchange full", - 55: "no anode", - 56: "invalid request code", - 57: "invalid slot", - 59: "bad font file format", - 60: "device not a stream", - 61: "no data available", - 62: "timer expired", - 63: "out of streams resources", - 64: "machine is not on the network", - 65: "package not installed", - 66: "object is remote", - 67: "link has been severed", - 68: "advertise error", - 69: "srmount error", - 70: "communication error on send", - 71: "protocol error", - 72: "multihop attempted", - 73: "RFS specific error", - 74: "bad message", - 75: "value too large for defined data type", - 76: "name not unique on network", - 77: "file descriptor in bad state", - 78: "remote address changed", - 79: "can not access a needed shared library", - 80: "accessing a corrupted shared library", - 81: ".lib section in a.out corrupted", - 82: "attempting to link in too many shared libraries", - 83: "cannot exec a shared library directly", - 84: "invalid or incomplete multibyte or wide character", - 85: "interrupted system call should be restarted", - 86: "streams pipe error", - 87: "too many users", - 88: "socket operation on non-socket", - 89: "destination address required", - 90: "message too long", - 91: "protocol wrong type for socket", - 92: "protocol not available", - 93: "protocol not supported", - 94: "socket type not supported", - 95: "operation not supported", - 96: "protocol family not supported", - 97: "address family not supported by protocol", - 98: "address already in use", - 99: "cannot assign requested address", - 100: "network is down", - 101: "network is unreachable", - 102: "network dropped connection on reset", - 103: "software caused connection abort", - 104: "connection reset by peer", - 105: "no buffer space available", - 106: "transport endpoint is already connected", - 107: "transport endpoint is not connected", - 108: "cannot send after transport endpoint shutdown", - 109: "too many references: cannot splice", - 110: "connection timed out", - 111: "connection refused", - 112: "host is down", - 113: "no route to host", - 114: "operation already in progress", - 115: "operation now in progress", - 116: "stale file handle", - 117: "structure needs cleaning", - 118: "not a XENIX named type file", - 119: "no XENIX semaphores available", - 120: "is a named type file", - 121: "remote I/O error", - 122: "disk quota exceeded", - 123: "no medium found", - 124: "wrong medium type", - 125: "operation canceled", - 126: "required key not available", - 127: "key has expired", - 128: "key has been revoked", - 129: "key was rejected by service", - 130: "owner died", - 131: "state not recoverable", - 132: "operation not possible due to RF-kill", - 133: "memory page has hardware error", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "no such device or address"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EAGAIN", "resource temporarily unavailable"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device or resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "invalid cross-device link"}, + {19, "ENODEV", "no such device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "numerical result out of range"}, + {35, "EDEADLK", "resource deadlock avoided"}, + {36, "ENAMETOOLONG", "file name too long"}, + {37, "ENOLCK", "no locks available"}, + {38, "ENOSYS", "function not implemented"}, + {39, "ENOTEMPTY", "directory not empty"}, + {40, "ELOOP", "too many levels of symbolic links"}, + {42, "ENOMSG", "no message of desired type"}, + {43, "EIDRM", "identifier removed"}, + {44, "ECHRNG", "channel number out of range"}, + {45, "EL2NSYNC", "level 2 not synchronized"}, + {46, "EL3HLT", "level 3 halted"}, + {47, "EL3RST", "level 3 reset"}, + {48, "ELNRNG", "link number out of range"}, + {49, "EUNATCH", "protocol driver not attached"}, + {50, "ENOCSI", "no CSI structure available"}, + {51, "EL2HLT", "level 2 halted"}, + {52, "EBADE", "invalid exchange"}, + {53, "EBADR", "invalid request descriptor"}, + {54, "EXFULL", "exchange full"}, + {55, "ENOANO", "no anode"}, + {56, "EBADRQC", "invalid request code"}, + {57, "EBADSLT", "invalid slot"}, + {59, "EBFONT", "bad font file format"}, + {60, "ENOSTR", "device not a stream"}, + {61, "ENODATA", "no data available"}, + {62, "ETIME", "timer expired"}, + {63, "ENOSR", "out of streams resources"}, + {64, "ENONET", "machine is not on the network"}, + {65, "ENOPKG", "package not installed"}, + {66, "EREMOTE", "object is remote"}, + {67, "ENOLINK", "link has been severed"}, + {68, "EADV", "advertise error"}, + {69, "ESRMNT", "srmount error"}, + {70, "ECOMM", "communication error on send"}, + {71, "EPROTO", "protocol error"}, + {72, "EMULTIHOP", "multihop attempted"}, + {73, "EDOTDOT", "RFS specific error"}, + {74, "EBADMSG", "bad message"}, + {75, "EOVERFLOW", "value too large for defined data type"}, + {76, "ENOTUNIQ", "name not unique on network"}, + {77, "EBADFD", "file descriptor in bad state"}, + {78, "EREMCHG", "remote address changed"}, + {79, "ELIBACC", "can not access a needed shared library"}, + {80, "ELIBBAD", "accessing a corrupted shared library"}, + {81, "ELIBSCN", ".lib section in a.out corrupted"}, + {82, "ELIBMAX", "attempting to link in too many shared libraries"}, + {83, "ELIBEXEC", "cannot exec a shared library directly"}, + {84, "EILSEQ", "invalid or incomplete multibyte or wide character"}, + {85, "ERESTART", "interrupted system call should be restarted"}, + {86, "ESTRPIPE", "streams pipe error"}, + {87, "EUSERS", "too many users"}, + {88, "ENOTSOCK", "socket operation on non-socket"}, + {89, "EDESTADDRREQ", "destination address required"}, + {90, "EMSGSIZE", "message too long"}, + {91, "EPROTOTYPE", "protocol wrong type for socket"}, + {92, "ENOPROTOOPT", "protocol not available"}, + {93, "EPROTONOSUPPORT", "protocol not supported"}, + {94, "ESOCKTNOSUPPORT", "socket type not supported"}, + {95, "ENOTSUP", "operation not supported"}, + {96, "EPFNOSUPPORT", "protocol family not supported"}, + {97, "EAFNOSUPPORT", "address family not supported by protocol"}, + {98, "EADDRINUSE", "address already in use"}, + {99, "EADDRNOTAVAIL", "cannot assign requested address"}, + {100, "ENETDOWN", "network is down"}, + {101, "ENETUNREACH", "network is unreachable"}, + {102, "ENETRESET", "network dropped connection on reset"}, + {103, "ECONNABORTED", "software caused connection abort"}, + {104, "ECONNRESET", "connection reset by peer"}, + {105, "ENOBUFS", "no buffer space available"}, + {106, "EISCONN", "transport endpoint is already connected"}, + {107, "ENOTCONN", "transport endpoint is not connected"}, + {108, "ESHUTDOWN", "cannot send after transport endpoint shutdown"}, + {109, "ETOOMANYREFS", "too many references: cannot splice"}, + {110, "ETIMEDOUT", "connection timed out"}, + {111, "ECONNREFUSED", "connection refused"}, + {112, "EHOSTDOWN", "host is down"}, + {113, "EHOSTUNREACH", "no route to host"}, + {114, "EALREADY", "operation already in progress"}, + {115, "EINPROGRESS", "operation now in progress"}, + {116, "ESTALE", "stale file handle"}, + {117, "EUCLEAN", "structure needs cleaning"}, + {118, "ENOTNAM", "not a XENIX named type file"}, + {119, "ENAVAIL", "no XENIX semaphores available"}, + {120, "EISNAM", "is a named type file"}, + {121, "EREMOTEIO", "remote I/O error"}, + {122, "EDQUOT", "disk quota exceeded"}, + {123, "ENOMEDIUM", "no medium found"}, + {124, "EMEDIUMTYPE", "wrong medium type"}, + {125, "ECANCELED", "operation canceled"}, + {126, "ENOKEY", "required key not available"}, + {127, "EKEYEXPIRED", "key has expired"}, + {128, "EKEYREVOKED", "key has been revoked"}, + {129, "EKEYREJECTED", "key was rejected by service"}, + {130, "EOWNERDEAD", "owner died"}, + {131, "ENOTRECOVERABLE", "state not recoverable"}, + {132, "ERFKILL", "operation not possible due to RF-kill"}, + {133, "EHWPOISON", "memory page has hardware error"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/breakpoint trap", - 6: "aborted", - 7: "bus error", - 8: "floating point exception", - 9: "killed", - 10: "user defined signal 1", - 11: "segmentation fault", - 12: "user defined signal 2", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "stack fault", - 17: "child exited", - 18: "continued", - 19: "stopped (signal)", - 20: "stopped", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "urgent I/O condition", - 24: "CPU time limit exceeded", - 25: "file size limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window changed", - 29: "I/O possible", - 30: "power failure", - 31: "bad system call", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/breakpoint trap"}, + {6, "SIGABRT", "aborted"}, + {7, "SIGBUS", "bus error"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGUSR1", "user defined signal 1"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGUSR2", "user defined signal 2"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGSTKFLT", "stack fault"}, + {17, "SIGCHLD", "child exited"}, + {18, "SIGCONT", "continued"}, + {19, "SIGSTOP", "stopped (signal)"}, + {20, "SIGTSTP", "stopped"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGURG", "urgent I/O condition"}, + {24, "SIGXCPU", "CPU time limit exceeded"}, + {25, "SIGXFSZ", "file size limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window changed"}, + {29, "SIGIO", "I/O possible"}, + {30, "SIGPWR", "power failure"}, + {31, "SIGSYS", "bad system call"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go b/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go index 250841bdc9..49a9b0133b 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_arm.go @@ -3,7 +3,7 @@ // +build arm,linux -// Created by cgo -godefs - DO NOT EDIT +// Code generated by cmd/cgo -godefs; DO NOT EDIT. // cgo -godefs -- -Wall -Werror -static -I/tmp/include _const.go package unix @@ -11,6 +11,11 @@ package unix import "syscall" const ( + AAFS_MAGIC = 0x5a3c69f0 + ADFS_SUPER_MAGIC = 0xadf5 + AFFS_SUPER_MAGIC = 0xadff + AFS_FS_MAGIC = 0x6b414653 + AFS_SUPER_MAGIC = 0x5346414f AF_ALG = 0x26 AF_APPLETALK = 0x5 AF_ASH = 0x12 @@ -66,6 +71,7 @@ const ( ALG_SET_IV = 0x2 ALG_SET_KEY = 0x1 ALG_SET_OP = 0x3 + ANON_INODE_FS_MAGIC = 0x9041934 ARPHRD_6LOWPAN = 0x339 ARPHRD_ADAPT = 0x108 ARPHRD_APPLETLK = 0x8 @@ -121,6 +127,7 @@ const ( ARPHRD_PPP = 0x200 ARPHRD_PRONET = 0x4 ARPHRD_RAWHDLC = 0x206 + ARPHRD_RAWIP = 0x207 ARPHRD_ROSE = 0x10e ARPHRD_RSRVD = 0x104 ARPHRD_SIT = 0x308 @@ -132,6 +139,7 @@ const ( ARPHRD_VOID = 0xffff ARPHRD_VSOCKMON = 0x33a ARPHRD_X25 = 0x10f + AUTOFS_SUPER_MAGIC = 0x187 B0 = 0x0 B1000000 = 0x1008 B110 = 0x3 @@ -163,6 +171,9 @@ const ( B75 = 0x2 B921600 = 0x1007 B9600 = 0xd + BALLOON_KVM_MAGIC = 0x13661366 + BDEVFS_MAGIC = 0x62646576 + BINFMTFS_MAGIC = 0x42494e4d BLKBSZGET = 0x80041270 BLKBSZSET = 0x40041271 BLKFLSBUF = 0x1261 @@ -187,6 +198,7 @@ const ( BPF_AND = 0x50 BPF_B = 0x10 BPF_DIV = 0x30 + BPF_FS_MAGIC = 0xcafe4a11 BPF_H = 0x8 BPF_IMM = 0x0 BPF_IND = 0x40 @@ -228,6 +240,8 @@ const ( BS0 = 0x0 BS1 = 0x2000 BSDLY = 0x2000 + BTRFS_SUPER_MAGIC = 0x9123683e + BTRFS_TEST_MAGIC = 0x73727279 CAN_BCM = 0x2 CAN_EFF_FLAG = 0x80000000 CAN_EFF_ID_BITS = 0x1d @@ -251,6 +265,8 @@ const ( CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf + CGROUP2_SUPER_MAGIC = 0x63677270 + CGROUP_SUPER_MAGIC = 0x27e0eb CIBAUD = 0x100f0000 CLOCAL = 0x800 CLOCK_BOOTTIME = 0x7 @@ -293,10 +309,12 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CMSPAR = 0x40000000 + CODA_SUPER_MAGIC = 0x73757245 CR0 = 0x0 CR1 = 0x200 CR2 = 0x400 CR3 = 0x600 + CRAMFS_MAGIC = 0x28cd3d45 CRDLY = 0x600 CREAD = 0x80 CRTSCTS = 0x80000000 @@ -311,6 +329,9 @@ const ( CSTOP = 0x13 CSTOPB = 0x40 CSUSP = 0x1a + DAXFS_MAGIC = 0x64646178 + DEBUGFS_MAGIC = 0x64626720 + DEVPTS_SUPER_MAGIC = 0x1cd1 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -327,9 +348,12 @@ const ( ECHOKE = 0x800 ECHONL = 0x40 ECHOPRT = 0x400 + ECRYPTFS_SUPER_MAGIC = 0xf15f EFD_CLOEXEC = 0x80000 EFD_NONBLOCK = 0x800 EFD_SEMAPHORE = 0x1 + EFIVARFS_MAGIC = 0xde5e81e4 + EFS_SUPER_MAGIC = 0x414a53 ENCODING_DEFAULT = 0x0 ENCODING_FM_MARK = 0x3 ENCODING_FM_SPACE = 0x4 @@ -390,6 +414,8 @@ const ( ETH_P_DSA = 0x1b ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada + ETH_P_ERSPAN = 0x88be + ETH_P_ERSPAN2 = 0x22eb ETH_P_FCOE = 0x8906 ETH_P_FIP = 0x8914 ETH_P_HDLC = 0x19 @@ -398,6 +424,7 @@ const ( ETH_P_IEEE802154 = 0xf6 ETH_P_IEEEPUP = 0xa00 ETH_P_IEEEPUPAT = 0xa01 + ETH_P_IFE = 0xed3e ETH_P_IP = 0x800 ETH_P_IPV6 = 0x86dd ETH_P_IPX = 0x8137 @@ -408,11 +435,13 @@ const ( ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 ETH_P_MACSEC = 0x88e5 + ETH_P_MAP = 0xf9 ETH_P_MOBITEX = 0x15 ETH_P_MPLS_MC = 0x8848 ETH_P_MPLS_UC = 0x8847 ETH_P_MVRP = 0x88f5 ETH_P_NCSI = 0x88f8 + ETH_P_NSH = 0x894f ETH_P_PAE = 0x888e ETH_P_PAUSE = 0x8808 ETH_P_PHONET = 0xf5 @@ -420,6 +449,7 @@ const ( ETH_P_PPP_DISC = 0x8863 ETH_P_PPP_MP = 0x8 ETH_P_PPP_SES = 0x8864 + ETH_P_PREAUTH = 0x88c7 ETH_P_PRP = 0x88fb ETH_P_PUP = 0x200 ETH_P_PUPAT = 0x201 @@ -440,9 +470,14 @@ const ( ETH_P_WCCP = 0x883e ETH_P_X25 = 0x805 ETH_P_XDSA = 0xf8 + EXABYTE_ENABLE_NEST = 0xf0 + EXT2_SUPER_MAGIC = 0xef53 + EXT3_SUPER_MAGIC = 0xef53 + EXT4_SUPER_MAGIC = 0xef53 EXTA = 0xe EXTB = 0xf EXTPROC = 0x10000 + F2FS_SUPER_MAGIC = 0xf2f52010 FALLOC_FL_COLLAPSE_RANGE = 0x8 FALLOC_FL_INSERT_RANGE = 0x20 FALLOC_FL_KEEP_SIZE = 0x1 @@ -476,6 +511,8 @@ const ( FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 FS_POLICY_FLAGS_VALID = 0x3 + FUTEXFS_SUPER_MAGIC = 0xbad1dea + F_ADD_SEALS = 0x409 F_DUPFD = 0x0 F_DUPFD_CLOEXEC = 0x406 F_EXLCK = 0x4 @@ -488,6 +525,9 @@ const ( F_GETOWN_EX = 0x10 F_GETPIPE_SZ = 0x408 F_GETSIG = 0xb + F_GET_FILE_RW_HINT = 0x40d + F_GET_RW_HINT = 0x40b + F_GET_SEALS = 0x40a F_LOCK = 0x1 F_NOTIFY = 0x402 F_OFD_GETLK = 0x24 @@ -495,6 +535,10 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_GROW = 0x4 + F_SEAL_SEAL = 0x1 + F_SEAL_SHRINK = 0x2 + F_SEAL_WRITE = 0x8 F_SETFD = 0x2 F_SETFL = 0x4 F_SETLEASE = 0x400 @@ -506,6 +550,8 @@ const ( F_SETOWN_EX = 0xf F_SETPIPE_SZ = 0x407 F_SETSIG = 0xa + F_SET_FILE_RW_HINT = 0x40e + F_SET_RW_HINT = 0x40c F_SHLCK = 0x8 F_TEST = 0x3 F_TLOCK = 0x2 @@ -527,6 +573,49 @@ const ( GENL_UNS_ADMIN_PERM = 0x10 GRND_NONBLOCK = 0x1 GRND_RANDOM = 0x2 + HDIO_DRIVE_CMD = 0x31f + HDIO_DRIVE_CMD_AEB = 0x31e + HDIO_DRIVE_CMD_HDR_SIZE = 0x4 + HDIO_DRIVE_HOB_HDR_SIZE = 0x8 + HDIO_DRIVE_RESET = 0x31c + HDIO_DRIVE_TASK = 0x31e + HDIO_DRIVE_TASKFILE = 0x31d + HDIO_DRIVE_TASK_HDR_SIZE = 0x8 + HDIO_GETGEO = 0x301 + HDIO_GET_32BIT = 0x309 + HDIO_GET_ACOUSTIC = 0x30f + HDIO_GET_ADDRESS = 0x310 + HDIO_GET_BUSSTATE = 0x31a + HDIO_GET_DMA = 0x30b + HDIO_GET_IDENTITY = 0x30d + HDIO_GET_KEEPSETTINGS = 0x308 + HDIO_GET_MULTCOUNT = 0x304 + HDIO_GET_NICE = 0x30c + HDIO_GET_NOWERR = 0x30a + HDIO_GET_QDMA = 0x305 + HDIO_GET_UNMASKINTR = 0x302 + HDIO_GET_WCACHE = 0x30e + HDIO_OBSOLETE_IDENTITY = 0x307 + HDIO_SCAN_HWIF = 0x328 + HDIO_SET_32BIT = 0x324 + HDIO_SET_ACOUSTIC = 0x32c + HDIO_SET_ADDRESS = 0x32f + HDIO_SET_BUSSTATE = 0x32d + HDIO_SET_DMA = 0x326 + HDIO_SET_KEEPSETTINGS = 0x323 + HDIO_SET_MULTCOUNT = 0x321 + HDIO_SET_NICE = 0x329 + HDIO_SET_NOWERR = 0x325 + HDIO_SET_PIO_MODE = 0x327 + HDIO_SET_QDMA = 0x32e + HDIO_SET_UNMASKINTR = 0x322 + HDIO_SET_WCACHE = 0x32b + HDIO_SET_XFER = 0x306 + HDIO_TRISTATE_HWIF = 0x31b + HDIO_UNREGISTER_HWIF = 0x32a + HOSTFS_SUPER_MAGIC = 0xc0ffee + HPFS_SUPER_MAGIC = 0xf995e849 + HUGETLBFS_MAGIC = 0x958458f6 HUPCL = 0x400 IBSHIFT = 0x10 ICANON = 0x2 @@ -561,6 +650,8 @@ const ( IFF_MASTER = 0x400 IFF_MULTICAST = 0x1000 IFF_MULTI_QUEUE = 0x100 + IFF_NAPI = 0x10 + IFF_NAPI_FRAGS = 0x20 IFF_NOARP = 0x80 IFF_NOFILTER = 0x1000 IFF_NOTRAILERS = 0x20 @@ -775,12 +866,14 @@ const ( IP_UNICAST_IF = 0x32 IP_XFRM_POLICY = 0x11 ISIG = 0x1 + ISOFS_SUPER_MAGIC = 0x9660 ISTRIP = 0x20 IUCLC = 0x200 IUTF8 = 0x4000 IXANY = 0x800 IXOFF = 0x1000 IXON = 0x400 + JFFS2_SUPER_MAGIC = 0x72b6 KEYCTL_ASSUME_AUTHORITY = 0x10 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 @@ -845,6 +938,7 @@ const ( MADV_FREE = 0x8 MADV_HUGEPAGE = 0xe MADV_HWPOISON = 0x64 + MADV_KEEPONFORK = 0x13 MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 @@ -853,6 +947,7 @@ const ( MADV_SEQUENTIAL = 0x2 MADV_UNMERGEABLE = 0xd MADV_WILLNEED = 0x3 + MADV_WIPEONFORK = 0x12 MAP_ANON = 0x20 MAP_ANONYMOUS = 0x20 MAP_DENYWRITE = 0x800 @@ -874,9 +969,15 @@ const ( MCL_CURRENT = 0x1 MCL_FUTURE = 0x2 MCL_ONFAULT = 0x4 + MINIX2_SUPER_MAGIC = 0x2468 + MINIX2_SUPER_MAGIC2 = 0x2478 + MINIX3_SUPER_MAGIC = 0x4d5a + MINIX_SUPER_MAGIC = 0x137f + MINIX_SUPER_MAGIC2 = 0x138f MNT_DETACH = 0x2 MNT_EXPIRE = 0x4 MNT_FORCE = 0x1 + MSDOS_SUPER_MAGIC = 0x4d44 MSG_BATCH = 0x40000 MSG_CMSG_CLOEXEC = 0x40000000 MSG_CONFIRM = 0x800 @@ -898,6 +999,7 @@ const ( MSG_TRYHARD = 0x4 MSG_WAITALL = 0x100 MSG_WAITFORONE = 0x10000 + MSG_ZEROCOPY = 0x4000000 MS_ACTIVE = 0x40000000 MS_ASYNC = 0x1 MS_BIND = 0x1000 @@ -935,7 +1037,9 @@ const ( MS_SYNCHRONOUS = 0x10 MS_UNBINDABLE = 0x20000 MS_VERBOSE = 0x8000 + MTD_INODE_FS_MAGIC = 0x11307854 NAME_MAX = 0xff + NCP_SUPER_MAGIC = 0x564c NETLINK_ADD_MEMBERSHIP = 0x1 NETLINK_AUDIT = 0x9 NETLINK_BROADCAST_ERROR = 0x4 @@ -970,6 +1074,37 @@ const ( NETLINK_UNUSED = 0x1 NETLINK_USERSOCK = 0x2 NETLINK_XFRM = 0x6 + NFNETLINK_V0 = 0x0 + NFNLGRP_ACCT_QUOTA = 0x8 + NFNLGRP_CONNTRACK_DESTROY = 0x3 + NFNLGRP_CONNTRACK_EXP_DESTROY = 0x6 + NFNLGRP_CONNTRACK_EXP_NEW = 0x4 + NFNLGRP_CONNTRACK_EXP_UPDATE = 0x5 + NFNLGRP_CONNTRACK_NEW = 0x1 + NFNLGRP_CONNTRACK_UPDATE = 0x2 + NFNLGRP_MAX = 0x9 + NFNLGRP_NFTABLES = 0x7 + NFNLGRP_NFTRACE = 0x9 + NFNLGRP_NONE = 0x0 + NFNL_BATCH_MAX = 0x1 + NFNL_MSG_BATCH_BEGIN = 0x10 + NFNL_MSG_BATCH_END = 0x11 + NFNL_NFA_NEST = 0x8000 + NFNL_SUBSYS_ACCT = 0x7 + NFNL_SUBSYS_COUNT = 0xc + NFNL_SUBSYS_CTHELPER = 0x9 + NFNL_SUBSYS_CTNETLINK = 0x1 + NFNL_SUBSYS_CTNETLINK_EXP = 0x2 + NFNL_SUBSYS_CTNETLINK_TIMEOUT = 0x8 + NFNL_SUBSYS_IPSET = 0x6 + NFNL_SUBSYS_NFTABLES = 0xa + NFNL_SUBSYS_NFT_COMPAT = 0xb + NFNL_SUBSYS_NONE = 0x0 + NFNL_SUBSYS_OSF = 0x5 + NFNL_SUBSYS_QUEUE = 0x3 + NFNL_SUBSYS_ULOG = 0x4 + NFS_SUPER_MAGIC = 0x6969 + NILFS_SUPER_MAGIC = 0x3434 NL0 = 0x0 NL1 = 0x100 NLA_ALIGNTO = 0x4 @@ -997,10 +1132,13 @@ const ( NLM_F_EXCL = 0x200 NLM_F_MATCH = 0x200 NLM_F_MULTI = 0x2 + NLM_F_NONREC = 0x100 NLM_F_REPLACE = 0x100 NLM_F_REQUEST = 0x1 NLM_F_ROOT = 0x100 NOFLSH = 0x80 + NSFS_MAGIC = 0x6e736673 + OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 OFILL = 0x40 @@ -1008,7 +1146,9 @@ const ( ONLCR = 0x4 ONLRET = 0x20 ONOCR = 0x10 + OPENPROM_SUPER_MAGIC = 0x9fa1 OPOST = 0x1 + OVERLAYFS_SUPER_MAGIC = 0x794c7630 O_ACCMODE = 0x3 O_APPEND = 0x400 O_ASYNC = 0x2000 @@ -1093,16 +1233,20 @@ const ( PERF_EVENT_IOC_DISABLE = 0x2401 PERF_EVENT_IOC_ENABLE = 0x2400 PERF_EVENT_IOC_ID = 0x80042407 + PERF_EVENT_IOC_MODIFY_ATTRIBUTES = 0x4004240b PERF_EVENT_IOC_PAUSE_OUTPUT = 0x40042409 PERF_EVENT_IOC_PERIOD = 0x40082404 + PERF_EVENT_IOC_QUERY_BPF = 0xc004240a PERF_EVENT_IOC_REFRESH = 0x2402 PERF_EVENT_IOC_RESET = 0x2403 PERF_EVENT_IOC_SET_BPF = 0x40042408 PERF_EVENT_IOC_SET_FILTER = 0x40042406 PERF_EVENT_IOC_SET_OUTPUT = 0x2405 + PIPEFS_MAGIC = 0x50495045 PRIO_PGRP = 0x1 PRIO_PROCESS = 0x0 PRIO_USER = 0x2 + PROC_SUPER_MAGIC = 0x9fa0 PROT_EXEC = 0x4 PROT_GROWSDOWN = 0x1000000 PROT_GROWSUP = 0x2000000 @@ -1145,6 +1289,7 @@ const ( PR_GET_PDEATHSIG = 0x2 PR_GET_SECCOMP = 0x15 PR_GET_SECUREBITS = 0x1b + PR_GET_SPECULATION_CTRL = 0x34 PR_GET_THP_DISABLE = 0x2a PR_GET_TID_ADDRESS = 0x28 PR_GET_TIMERSLACK = 0x1e @@ -1190,11 +1335,23 @@ const ( PR_SET_PTRACER_ANY = 0xffffffff PR_SET_SECCOMP = 0x16 PR_SET_SECUREBITS = 0x1c + PR_SET_SPECULATION_CTRL = 0x35 PR_SET_THP_DISABLE = 0x29 PR_SET_TIMERSLACK = 0x1d PR_SET_TIMING = 0xe PR_SET_TSC = 0x1a PR_SET_UNALIGN = 0x6 + PR_SPEC_DISABLE = 0x4 + PR_SPEC_ENABLE = 0x2 + PR_SPEC_FORCE_DISABLE = 0x8 + PR_SPEC_NOT_AFFECTED = 0x0 + PR_SPEC_PRCTL = 0x1 + PR_SPEC_STORE_BYPASS = 0x0 + PR_SVE_GET_VL = 0x33 + PR_SVE_SET_VL = 0x32 + PR_SVE_SET_VL_ONEXEC = 0x40000 + PR_SVE_VL_INHERIT = 0x20000 + PR_SVE_VL_LEN_MASK = 0xffff PR_TASK_PERF_EVENTS_DISABLE = 0x1f PR_TASK_PERF_EVENTS_ENABLE = 0x20 PR_TIMING_STATISTICAL = 0x0 @@ -1203,6 +1360,7 @@ const ( PR_TSC_SIGSEGV = 0x2 PR_UNALIGN_NOPRINT = 0x1 PR_UNALIGN_SIGBUS = 0x2 + PSTOREFS_MAGIC = 0x6165676c PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 @@ -1216,6 +1374,9 @@ const ( PTRACE_EVENT_VFORK_DONE = 0x5 PTRACE_GETCRUNCHREGS = 0x19 PTRACE_GETEVENTMSG = 0x4201 + PTRACE_GETFDPIC = 0x1f + PTRACE_GETFDPIC_EXEC = 0x0 + PTRACE_GETFDPIC_INTERP = 0x1 PTRACE_GETFPREGS = 0xe PTRACE_GETHBPREGS = 0x1d PTRACE_GETREGS = 0xc @@ -1249,6 +1410,7 @@ const ( PTRACE_POKETEXT = 0x4 PTRACE_POKEUSR = 0x6 PTRACE_SECCOMP_GET_FILTER = 0x420c + PTRACE_SECCOMP_GET_METADATA = 0x420d PTRACE_SEIZE = 0x4206 PTRACE_SETCRUNCHREGS = 0x1a PTRACE_SETFPREGS = 0xf @@ -1267,6 +1429,11 @@ const ( PT_DATA_ADDR = 0x10004 PT_TEXT_ADDR = 0x10000 PT_TEXT_END_ADDR = 0x10008 + QNX4_SUPER_MAGIC = 0x2f + QNX6_SUPER_MAGIC = 0x68191122 + RAMFS_MAGIC = 0x858458f6 + RDTGROUP_SUPER_MAGIC = 0x7655821 + REISERFS_SUPER_MAGIC = 0x52654973 RLIMIT_AS = 0x9 RLIMIT_CORE = 0x4 RLIMIT_CPU = 0x0 @@ -1287,6 +1454,7 @@ const ( RTAX_ADVMSS = 0x8 RTAX_CC_ALGO = 0x10 RTAX_CWND = 0x7 + RTAX_FASTOPEN_NO_COOKIE = 0x11 RTAX_FEATURES = 0xc RTAX_FEATURE_ALLFRAG = 0x8 RTAX_FEATURE_ECN = 0x1 @@ -1297,7 +1465,7 @@ const ( RTAX_INITCWND = 0xb RTAX_INITRWND = 0xe RTAX_LOCK = 0x1 - RTAX_MAX = 0x10 + RTAX_MAX = 0x11 RTAX_MTU = 0x2 RTAX_QUICKACK = 0xf RTAX_REORDERING = 0x9 @@ -1315,6 +1483,33 @@ const ( RTCF_MASQ = 0x400000 RTCF_NAT = 0x800000 RTCF_VALVE = 0x200000 + RTC_AF = 0x20 + RTC_AIE_OFF = 0x7002 + RTC_AIE_ON = 0x7001 + RTC_ALM_READ = 0x80247008 + RTC_ALM_SET = 0x40247007 + RTC_EPOCH_READ = 0x8004700d + RTC_EPOCH_SET = 0x4004700e + RTC_IRQF = 0x80 + RTC_IRQP_READ = 0x8004700b + RTC_IRQP_SET = 0x4004700c + RTC_MAX_FREQ = 0x2000 + RTC_PF = 0x40 + RTC_PIE_OFF = 0x7006 + RTC_PIE_ON = 0x7005 + RTC_PLL_GET = 0x801c7011 + RTC_PLL_SET = 0x401c7012 + RTC_RD_TIME = 0x80247009 + RTC_SET_TIME = 0x4024700a + RTC_UF = 0x10 + RTC_UIE_OFF = 0x7004 + RTC_UIE_ON = 0x7003 + RTC_VL_CLR = 0x7014 + RTC_VL_READ = 0x80047013 + RTC_WIE_OFF = 0x7010 + RTC_WIE_ON = 0x700f + RTC_WKALM_RD = 0x80287010 + RTC_WKALM_SET = 0x4028700f RTF_ADDRCLASSMASK = 0xf8000000 RTF_ADDRCONF = 0x40000 RTF_ALLONLINK = 0x20000 @@ -1451,6 +1646,8 @@ const ( SECCOMP_MODE_DISABLED = 0x0 SECCOMP_MODE_FILTER = 0x2 SECCOMP_MODE_STRICT = 0x1 + SECURITYFS_MAGIC = 0x73636673 + SELINUX_MAGIC = 0xf97cff8c SHUT_RD = 0x0 SHUT_RDWR = 0x2 SHUT_WR = 0x1 @@ -1535,6 +1732,23 @@ const ( SIOCSPGRP = 0x8902 SIOCSRARP = 0x8962 SIOCWANDEV = 0x894a + SMACK_MAGIC = 0x43415d53 + SMART_AUTOSAVE = 0xd2 + SMART_AUTO_OFFLINE = 0xdb + SMART_DISABLE = 0xd9 + SMART_ENABLE = 0xd8 + SMART_HCYL_PASS = 0xc2 + SMART_IMMEDIATE_OFFLINE = 0xd4 + SMART_LCYL_PASS = 0x4f + SMART_READ_LOG_SECTOR = 0xd5 + SMART_READ_THRESHOLDS = 0xd1 + SMART_READ_VALUES = 0xd0 + SMART_SAVE = 0xd3 + SMART_STATUS = 0xda + SMART_WRITE_LOG_SECTOR = 0xd6 + SMART_WRITE_THRESHOLDS = 0xd7 + SMB_SUPER_MAGIC = 0x517b + SOCKFS_MAGIC = 0x534f434b SOCK_CLOEXEC = 0x80000 SOCK_DCCP = 0x6 SOCK_DGRAM = 0x2 @@ -1571,6 +1785,7 @@ const ( SOL_SOCKET = 0x1 SOL_TCP = 0x6 SOL_TIPC = 0x10f + SOL_TLS = 0x11a SOL_X25 = 0x106 SOMAXCONN = 0x80 SO_ACCEPTCONN = 0x1e @@ -1639,10 +1854,13 @@ const ( SO_VM_SOCKETS_PEER_HOST_VM_ID = 0x3 SO_VM_SOCKETS_TRUSTED = 0x5 SO_WIFI_STATUS = 0x29 + SO_ZEROCOPY = 0x3c SPLICE_F_GIFT = 0x8 SPLICE_F_MORE = 0x4 SPLICE_F_MOVE = 0x1 SPLICE_F_NONBLOCK = 0x2 + SQUASHFS_MAGIC = 0x73717368 + STACK_END_MAGIC = 0x57ac6e9d STATX_ALL = 0xfff STATX_ATIME = 0x20 STATX_ATTR_APPEND = 0x20 @@ -1664,6 +1882,7 @@ const ( STATX_TYPE = 0x1 STATX_UID = 0x8 STATX__RESERVED = 0x80000000 + SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 S_IFBLK = 0x6000 @@ -1735,6 +1954,8 @@ const ( TCP_MAXWIN = 0xffff TCP_MAX_WINSHIFT = 0xe TCP_MD5SIG = 0xe + TCP_MD5SIG_EXT = 0x20 + TCP_MD5SIG_FLAG_PREFIX = 0x1 TCP_MD5SIG_MAXKEYLEN = 0x50 TCP_MSS = 0x200 TCP_MSS_DEFAULT = 0x218 @@ -1755,6 +1976,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa TCSAFLUSH = 0x2 @@ -1842,7 +2064,27 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 + TPACKET_ALIGNMENT = 0x10 + TPACKET_HDRLEN = 0x34 + TP_STATUS_AVAILABLE = 0x0 + TP_STATUS_BLK_TMO = 0x20 + TP_STATUS_COPY = 0x2 + TP_STATUS_CSUMNOTREADY = 0x8 + TP_STATUS_CSUM_VALID = 0x80 + TP_STATUS_KERNEL = 0x0 + TP_STATUS_LOSING = 0x4 + TP_STATUS_SENDING = 0x2 + TP_STATUS_SEND_REQUEST = 0x1 + TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_SOFTWARE = 0x20000000 + TP_STATUS_TS_SYS_HARDWARE = 0x40000000 + TP_STATUS_USER = 0x1 + TP_STATUS_VLAN_TPID_VALID = 0x40 + TP_STATUS_VLAN_VALID = 0x10 + TP_STATUS_WRONG_FORMAT = 0x4 + TRACEFS_MAGIC = 0x74726163 TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x400854d5 TUNDETACHFILTER = 0x400854d6 @@ -1854,6 +2096,7 @@ const ( TUNGETVNETHDRSZ = 0x800454d7 TUNGETVNETLE = 0x800454dd TUNSETDEBUG = 0x400454c9 + TUNSETFILTEREBPF = 0x800454e1 TUNSETGROUP = 0x400454ce TUNSETIFF = 0x400454ca TUNSETIFINDEX = 0x400454da @@ -1864,13 +2107,17 @@ const ( TUNSETPERSIST = 0x400454cb TUNSETQUEUE = 0x400454d9 TUNSETSNDBUF = 0x400454d4 + TUNSETSTEERINGEBPF = 0x800454e0 TUNSETTXFILTER = 0x400454d1 TUNSETVNETBE = 0x400454de TUNSETVNETHDRSZ = 0x400454d8 TUNSETVNETLE = 0x400454dc + UDF_SUPER_MAGIC = 0x15013346 UMOUNT_NOFOLLOW = 0x8 + USBDEVICE_SUPER_MAGIC = 0x9fa2 UTIME_NOW = 0x3fffffff UTIME_OMIT = 0x3ffffffe + V9FS_MAGIC = 0x1021997 VDISCARD = 0xd VEOF = 0x4 VEOL = 0xb @@ -1912,6 +2159,86 @@ const ( WDIOC_SETPRETIMEOUT = 0xc0045708 WDIOC_SETTIMEOUT = 0xc0045706 WEXITED = 0x4 + WIN_ACKMEDIACHANGE = 0xdb + WIN_CHECKPOWERMODE1 = 0xe5 + WIN_CHECKPOWERMODE2 = 0x98 + WIN_DEVICE_RESET = 0x8 + WIN_DIAGNOSE = 0x90 + WIN_DOORLOCK = 0xde + WIN_DOORUNLOCK = 0xdf + WIN_DOWNLOAD_MICROCODE = 0x92 + WIN_FLUSH_CACHE = 0xe7 + WIN_FLUSH_CACHE_EXT = 0xea + WIN_FORMAT = 0x50 + WIN_GETMEDIASTATUS = 0xda + WIN_IDENTIFY = 0xec + WIN_IDENTIFY_DMA = 0xee + WIN_IDLEIMMEDIATE = 0xe1 + WIN_INIT = 0x60 + WIN_MEDIAEJECT = 0xed + WIN_MULTREAD = 0xc4 + WIN_MULTREAD_EXT = 0x29 + WIN_MULTWRITE = 0xc5 + WIN_MULTWRITE_EXT = 0x39 + WIN_NOP = 0x0 + WIN_PACKETCMD = 0xa0 + WIN_PIDENTIFY = 0xa1 + WIN_POSTBOOT = 0xdc + WIN_PREBOOT = 0xdd + WIN_QUEUED_SERVICE = 0xa2 + WIN_READ = 0x20 + WIN_READDMA = 0xc8 + WIN_READDMA_EXT = 0x25 + WIN_READDMA_ONCE = 0xc9 + WIN_READDMA_QUEUED = 0xc7 + WIN_READDMA_QUEUED_EXT = 0x26 + WIN_READ_BUFFER = 0xe4 + WIN_READ_EXT = 0x24 + WIN_READ_LONG = 0x22 + WIN_READ_LONG_ONCE = 0x23 + WIN_READ_NATIVE_MAX = 0xf8 + WIN_READ_NATIVE_MAX_EXT = 0x27 + WIN_READ_ONCE = 0x21 + WIN_RECAL = 0x10 + WIN_RESTORE = 0x10 + WIN_SECURITY_DISABLE = 0xf6 + WIN_SECURITY_ERASE_PREPARE = 0xf3 + WIN_SECURITY_ERASE_UNIT = 0xf4 + WIN_SECURITY_FREEZE_LOCK = 0xf5 + WIN_SECURITY_SET_PASS = 0xf1 + WIN_SECURITY_UNLOCK = 0xf2 + WIN_SEEK = 0x70 + WIN_SETFEATURES = 0xef + WIN_SETIDLE1 = 0xe3 + WIN_SETIDLE2 = 0x97 + WIN_SETMULT = 0xc6 + WIN_SET_MAX = 0xf9 + WIN_SET_MAX_EXT = 0x37 + WIN_SLEEPNOW1 = 0xe6 + WIN_SLEEPNOW2 = 0x99 + WIN_SMART = 0xb0 + WIN_SPECIFY = 0x91 + WIN_SRST = 0x8 + WIN_STANDBY = 0xe2 + WIN_STANDBY2 = 0x96 + WIN_STANDBYNOW1 = 0xe0 + WIN_STANDBYNOW2 = 0x94 + WIN_VERIFY = 0x40 + WIN_VERIFY_EXT = 0x42 + WIN_VERIFY_ONCE = 0x41 + WIN_WRITE = 0x30 + WIN_WRITEDMA = 0xca + WIN_WRITEDMA_EXT = 0x35 + WIN_WRITEDMA_ONCE = 0xcb + WIN_WRITEDMA_QUEUED = 0xcc + WIN_WRITEDMA_QUEUED_EXT = 0x36 + WIN_WRITE_BUFFER = 0xe8 + WIN_WRITE_EXT = 0x34 + WIN_WRITE_LONG = 0x32 + WIN_WRITE_LONG_ONCE = 0x33 + WIN_WRITE_ONCE = 0x31 + WIN_WRITE_SAME = 0xe9 + WIN_WRITE_VERIFY = 0x3c WNOHANG = 0x1 WNOTHREAD = 0x20000000 WNOWAIT = 0x1000000 @@ -1921,7 +2248,9 @@ const ( XATTR_CREATE = 0x1 XATTR_REPLACE = 0x2 XCASE = 0x4 + XENFS_SUPER_MAGIC = 0xabba1974 XTABS = 0x1800 + ZSMALLOC_MAGIC = 0x58295829 ) // Errors @@ -2101,171 +2430,179 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "no such device or address", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource temporarily unavailable", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device or resource busy", - 17: "file exists", - 18: "invalid cross-device link", - 19: "no such device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "numerical result out of range", - 35: "resource deadlock avoided", - 36: "file name too long", - 37: "no locks available", - 38: "function not implemented", - 39: "directory not empty", - 40: "too many levels of symbolic links", - 42: "no message of desired type", - 43: "identifier removed", - 44: "channel number out of range", - 45: "level 2 not synchronized", - 46: "level 3 halted", - 47: "level 3 reset", - 48: "link number out of range", - 49: "protocol driver not attached", - 50: "no CSI structure available", - 51: "level 2 halted", - 52: "invalid exchange", - 53: "invalid request descriptor", - 54: "exchange full", - 55: "no anode", - 56: "invalid request code", - 57: "invalid slot", - 59: "bad font file format", - 60: "device not a stream", - 61: "no data available", - 62: "timer expired", - 63: "out of streams resources", - 64: "machine is not on the network", - 65: "package not installed", - 66: "object is remote", - 67: "link has been severed", - 68: "advertise error", - 69: "srmount error", - 70: "communication error on send", - 71: "protocol error", - 72: "multihop attempted", - 73: "RFS specific error", - 74: "bad message", - 75: "value too large for defined data type", - 76: "name not unique on network", - 77: "file descriptor in bad state", - 78: "remote address changed", - 79: "can not access a needed shared library", - 80: "accessing a corrupted shared library", - 81: ".lib section in a.out corrupted", - 82: "attempting to link in too many shared libraries", - 83: "cannot exec a shared library directly", - 84: "invalid or incomplete multibyte or wide character", - 85: "interrupted system call should be restarted", - 86: "streams pipe error", - 87: "too many users", - 88: "socket operation on non-socket", - 89: "destination address required", - 90: "message too long", - 91: "protocol wrong type for socket", - 92: "protocol not available", - 93: "protocol not supported", - 94: "socket type not supported", - 95: "operation not supported", - 96: "protocol family not supported", - 97: "address family not supported by protocol", - 98: "address already in use", - 99: "cannot assign requested address", - 100: "network is down", - 101: "network is unreachable", - 102: "network dropped connection on reset", - 103: "software caused connection abort", - 104: "connection reset by peer", - 105: "no buffer space available", - 106: "transport endpoint is already connected", - 107: "transport endpoint is not connected", - 108: "cannot send after transport endpoint shutdown", - 109: "too many references: cannot splice", - 110: "connection timed out", - 111: "connection refused", - 112: "host is down", - 113: "no route to host", - 114: "operation already in progress", - 115: "operation now in progress", - 116: "stale file handle", - 117: "structure needs cleaning", - 118: "not a XENIX named type file", - 119: "no XENIX semaphores available", - 120: "is a named type file", - 121: "remote I/O error", - 122: "disk quota exceeded", - 123: "no medium found", - 124: "wrong medium type", - 125: "operation canceled", - 126: "required key not available", - 127: "key has expired", - 128: "key has been revoked", - 129: "key was rejected by service", - 130: "owner died", - 131: "state not recoverable", - 132: "operation not possible due to RF-kill", - 133: "memory page has hardware error", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "no such device or address"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EAGAIN", "resource temporarily unavailable"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device or resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "invalid cross-device link"}, + {19, "ENODEV", "no such device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "numerical result out of range"}, + {35, "EDEADLK", "resource deadlock avoided"}, + {36, "ENAMETOOLONG", "file name too long"}, + {37, "ENOLCK", "no locks available"}, + {38, "ENOSYS", "function not implemented"}, + {39, "ENOTEMPTY", "directory not empty"}, + {40, "ELOOP", "too many levels of symbolic links"}, + {42, "ENOMSG", "no message of desired type"}, + {43, "EIDRM", "identifier removed"}, + {44, "ECHRNG", "channel number out of range"}, + {45, "EL2NSYNC", "level 2 not synchronized"}, + {46, "EL3HLT", "level 3 halted"}, + {47, "EL3RST", "level 3 reset"}, + {48, "ELNRNG", "link number out of range"}, + {49, "EUNATCH", "protocol driver not attached"}, + {50, "ENOCSI", "no CSI structure available"}, + {51, "EL2HLT", "level 2 halted"}, + {52, "EBADE", "invalid exchange"}, + {53, "EBADR", "invalid request descriptor"}, + {54, "EXFULL", "exchange full"}, + {55, "ENOANO", "no anode"}, + {56, "EBADRQC", "invalid request code"}, + {57, "EBADSLT", "invalid slot"}, + {59, "EBFONT", "bad font file format"}, + {60, "ENOSTR", "device not a stream"}, + {61, "ENODATA", "no data available"}, + {62, "ETIME", "timer expired"}, + {63, "ENOSR", "out of streams resources"}, + {64, "ENONET", "machine is not on the network"}, + {65, "ENOPKG", "package not installed"}, + {66, "EREMOTE", "object is remote"}, + {67, "ENOLINK", "link has been severed"}, + {68, "EADV", "advertise error"}, + {69, "ESRMNT", "srmount error"}, + {70, "ECOMM", "communication error on send"}, + {71, "EPROTO", "protocol error"}, + {72, "EMULTIHOP", "multihop attempted"}, + {73, "EDOTDOT", "RFS specific error"}, + {74, "EBADMSG", "bad message"}, + {75, "EOVERFLOW", "value too large for defined data type"}, + {76, "ENOTUNIQ", "name not unique on network"}, + {77, "EBADFD", "file descriptor in bad state"}, + {78, "EREMCHG", "remote address changed"}, + {79, "ELIBACC", "can not access a needed shared library"}, + {80, "ELIBBAD", "accessing a corrupted shared library"}, + {81, "ELIBSCN", ".lib section in a.out corrupted"}, + {82, "ELIBMAX", "attempting to link in too many shared libraries"}, + {83, "ELIBEXEC", "cannot exec a shared library directly"}, + {84, "EILSEQ", "invalid or incomplete multibyte or wide character"}, + {85, "ERESTART", "interrupted system call should be restarted"}, + {86, "ESTRPIPE", "streams pipe error"}, + {87, "EUSERS", "too many users"}, + {88, "ENOTSOCK", "socket operation on non-socket"}, + {89, "EDESTADDRREQ", "destination address required"}, + {90, "EMSGSIZE", "message too long"}, + {91, "EPROTOTYPE", "protocol wrong type for socket"}, + {92, "ENOPROTOOPT", "protocol not available"}, + {93, "EPROTONOSUPPORT", "protocol not supported"}, + {94, "ESOCKTNOSUPPORT", "socket type not supported"}, + {95, "ENOTSUP", "operation not supported"}, + {96, "EPFNOSUPPORT", "protocol family not supported"}, + {97, "EAFNOSUPPORT", "address family not supported by protocol"}, + {98, "EADDRINUSE", "address already in use"}, + {99, "EADDRNOTAVAIL", "cannot assign requested address"}, + {100, "ENETDOWN", "network is down"}, + {101, "ENETUNREACH", "network is unreachable"}, + {102, "ENETRESET", "network dropped connection on reset"}, + {103, "ECONNABORTED", "software caused connection abort"}, + {104, "ECONNRESET", "connection reset by peer"}, + {105, "ENOBUFS", "no buffer space available"}, + {106, "EISCONN", "transport endpoint is already connected"}, + {107, "ENOTCONN", "transport endpoint is not connected"}, + {108, "ESHUTDOWN", "cannot send after transport endpoint shutdown"}, + {109, "ETOOMANYREFS", "too many references: cannot splice"}, + {110, "ETIMEDOUT", "connection timed out"}, + {111, "ECONNREFUSED", "connection refused"}, + {112, "EHOSTDOWN", "host is down"}, + {113, "EHOSTUNREACH", "no route to host"}, + {114, "EALREADY", "operation already in progress"}, + {115, "EINPROGRESS", "operation now in progress"}, + {116, "ESTALE", "stale file handle"}, + {117, "EUCLEAN", "structure needs cleaning"}, + {118, "ENOTNAM", "not a XENIX named type file"}, + {119, "ENAVAIL", "no XENIX semaphores available"}, + {120, "EISNAM", "is a named type file"}, + {121, "EREMOTEIO", "remote I/O error"}, + {122, "EDQUOT", "disk quota exceeded"}, + {123, "ENOMEDIUM", "no medium found"}, + {124, "EMEDIUMTYPE", "wrong medium type"}, + {125, "ECANCELED", "operation canceled"}, + {126, "ENOKEY", "required key not available"}, + {127, "EKEYEXPIRED", "key has expired"}, + {128, "EKEYREVOKED", "key has been revoked"}, + {129, "EKEYREJECTED", "key was rejected by service"}, + {130, "EOWNERDEAD", "owner died"}, + {131, "ENOTRECOVERABLE", "state not recoverable"}, + {132, "ERFKILL", "operation not possible due to RF-kill"}, + {133, "EHWPOISON", "memory page has hardware error"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/breakpoint trap", - 6: "aborted", - 7: "bus error", - 8: "floating point exception", - 9: "killed", - 10: "user defined signal 1", - 11: "segmentation fault", - 12: "user defined signal 2", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "stack fault", - 17: "child exited", - 18: "continued", - 19: "stopped (signal)", - 20: "stopped", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "urgent I/O condition", - 24: "CPU time limit exceeded", - 25: "file size limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window changed", - 29: "I/O possible", - 30: "power failure", - 31: "bad system call", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/breakpoint trap"}, + {6, "SIGABRT", "aborted"}, + {7, "SIGBUS", "bus error"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGUSR1", "user defined signal 1"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGUSR2", "user defined signal 2"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGSTKFLT", "stack fault"}, + {17, "SIGCHLD", "child exited"}, + {18, "SIGCONT", "continued"}, + {19, "SIGSTOP", "stopped (signal)"}, + {20, "SIGTSTP", "stopped"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGURG", "urgent I/O condition"}, + {24, "SIGXCPU", "CPU time limit exceeded"}, + {25, "SIGXFSZ", "file size limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window changed"}, + {29, "SIGIO", "I/O possible"}, + {30, "SIGPWR", "power failure"}, + {31, "SIGSYS", "bad system call"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go index f5d7856108..8d70233b26 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_arm64.go @@ -3,7 +3,7 @@ // +build arm64,linux -// Created by cgo -godefs - DO NOT EDIT +// Code generated by cmd/cgo -godefs; DO NOT EDIT. // cgo -godefs -- -Wall -Werror -static -I/tmp/include -fsigned-char _const.go package unix @@ -11,6 +11,11 @@ package unix import "syscall" const ( + AAFS_MAGIC = 0x5a3c69f0 + ADFS_SUPER_MAGIC = 0xadf5 + AFFS_SUPER_MAGIC = 0xadff + AFS_FS_MAGIC = 0x6b414653 + AFS_SUPER_MAGIC = 0x5346414f AF_ALG = 0x26 AF_APPLETALK = 0x5 AF_ASH = 0x12 @@ -66,6 +71,7 @@ const ( ALG_SET_IV = 0x2 ALG_SET_KEY = 0x1 ALG_SET_OP = 0x3 + ANON_INODE_FS_MAGIC = 0x9041934 ARPHRD_6LOWPAN = 0x339 ARPHRD_ADAPT = 0x108 ARPHRD_APPLETLK = 0x8 @@ -121,6 +127,7 @@ const ( ARPHRD_PPP = 0x200 ARPHRD_PRONET = 0x4 ARPHRD_RAWHDLC = 0x206 + ARPHRD_RAWIP = 0x207 ARPHRD_ROSE = 0x10e ARPHRD_RSRVD = 0x104 ARPHRD_SIT = 0x308 @@ -132,6 +139,7 @@ const ( ARPHRD_VOID = 0xffff ARPHRD_VSOCKMON = 0x33a ARPHRD_X25 = 0x10f + AUTOFS_SUPER_MAGIC = 0x187 B0 = 0x0 B1000000 = 0x1008 B110 = 0x3 @@ -163,6 +171,9 @@ const ( B75 = 0x2 B921600 = 0x1007 B9600 = 0xd + BALLOON_KVM_MAGIC = 0x13661366 + BDEVFS_MAGIC = 0x62646576 + BINFMTFS_MAGIC = 0x42494e4d BLKBSZGET = 0x80081270 BLKBSZSET = 0x40081271 BLKFLSBUF = 0x1261 @@ -187,6 +198,7 @@ const ( BPF_AND = 0x50 BPF_B = 0x10 BPF_DIV = 0x30 + BPF_FS_MAGIC = 0xcafe4a11 BPF_H = 0x8 BPF_IMM = 0x0 BPF_IND = 0x40 @@ -228,6 +240,8 @@ const ( BS0 = 0x0 BS1 = 0x2000 BSDLY = 0x2000 + BTRFS_SUPER_MAGIC = 0x9123683e + BTRFS_TEST_MAGIC = 0x73727279 CAN_BCM = 0x2 CAN_EFF_FLAG = 0x80000000 CAN_EFF_ID_BITS = 0x1d @@ -251,6 +265,8 @@ const ( CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf + CGROUP2_SUPER_MAGIC = 0x63677270 + CGROUP_SUPER_MAGIC = 0x27e0eb CIBAUD = 0x100f0000 CLOCAL = 0x800 CLOCK_BOOTTIME = 0x7 @@ -293,10 +309,12 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CMSPAR = 0x40000000 + CODA_SUPER_MAGIC = 0x73757245 CR0 = 0x0 CR1 = 0x200 CR2 = 0x400 CR3 = 0x600 + CRAMFS_MAGIC = 0x28cd3d45 CRDLY = 0x600 CREAD = 0x80 CRTSCTS = 0x80000000 @@ -311,6 +329,9 @@ const ( CSTOP = 0x13 CSTOPB = 0x40 CSUSP = 0x1a + DAXFS_MAGIC = 0x64646178 + DEBUGFS_MAGIC = 0x64626720 + DEVPTS_SUPER_MAGIC = 0x1cd1 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -327,9 +348,12 @@ const ( ECHOKE = 0x800 ECHONL = 0x40 ECHOPRT = 0x400 + ECRYPTFS_SUPER_MAGIC = 0xf15f EFD_CLOEXEC = 0x80000 EFD_NONBLOCK = 0x800 EFD_SEMAPHORE = 0x1 + EFIVARFS_MAGIC = 0xde5e81e4 + EFS_SUPER_MAGIC = 0x414a53 ENCODING_DEFAULT = 0x0 ENCODING_FM_MARK = 0x3 ENCODING_FM_SPACE = 0x4 @@ -391,6 +415,8 @@ const ( ETH_P_DSA = 0x1b ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada + ETH_P_ERSPAN = 0x88be + ETH_P_ERSPAN2 = 0x22eb ETH_P_FCOE = 0x8906 ETH_P_FIP = 0x8914 ETH_P_HDLC = 0x19 @@ -399,6 +425,7 @@ const ( ETH_P_IEEE802154 = 0xf6 ETH_P_IEEEPUP = 0xa00 ETH_P_IEEEPUPAT = 0xa01 + ETH_P_IFE = 0xed3e ETH_P_IP = 0x800 ETH_P_IPV6 = 0x86dd ETH_P_IPX = 0x8137 @@ -409,11 +436,13 @@ const ( ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 ETH_P_MACSEC = 0x88e5 + ETH_P_MAP = 0xf9 ETH_P_MOBITEX = 0x15 ETH_P_MPLS_MC = 0x8848 ETH_P_MPLS_UC = 0x8847 ETH_P_MVRP = 0x88f5 ETH_P_NCSI = 0x88f8 + ETH_P_NSH = 0x894f ETH_P_PAE = 0x888e ETH_P_PAUSE = 0x8808 ETH_P_PHONET = 0xf5 @@ -421,6 +450,7 @@ const ( ETH_P_PPP_DISC = 0x8863 ETH_P_PPP_MP = 0x8 ETH_P_PPP_SES = 0x8864 + ETH_P_PREAUTH = 0x88c7 ETH_P_PRP = 0x88fb ETH_P_PUP = 0x200 ETH_P_PUPAT = 0x201 @@ -441,10 +471,15 @@ const ( ETH_P_WCCP = 0x883e ETH_P_X25 = 0x805 ETH_P_XDSA = 0xf8 + EXABYTE_ENABLE_NEST = 0xf0 + EXT2_SUPER_MAGIC = 0xef53 + EXT3_SUPER_MAGIC = 0xef53 + EXT4_SUPER_MAGIC = 0xef53 EXTA = 0xe EXTB = 0xf EXTPROC = 0x10000 EXTRA_MAGIC = 0x45585401 + F2FS_SUPER_MAGIC = 0xf2f52010 FALLOC_FL_COLLAPSE_RANGE = 0x8 FALLOC_FL_INSERT_RANGE = 0x20 FALLOC_FL_KEEP_SIZE = 0x1 @@ -458,6 +493,7 @@ const ( FF1 = 0x8000 FFDLY = 0x8000 FLUSHO = 0x1000 + FPSIMD_MAGIC = 0x46508001 FS_ENCRYPTION_MODE_AES_128_CBC = 0x5 FS_ENCRYPTION_MODE_AES_128_CTS = 0x6 FS_ENCRYPTION_MODE_AES_256_CBC = 0x3 @@ -478,6 +514,8 @@ const ( FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 FS_POLICY_FLAGS_VALID = 0x3 + FUTEXFS_SUPER_MAGIC = 0xbad1dea + F_ADD_SEALS = 0x409 F_DUPFD = 0x0 F_DUPFD_CLOEXEC = 0x406 F_EXLCK = 0x4 @@ -490,6 +528,9 @@ const ( F_GETOWN_EX = 0x10 F_GETPIPE_SZ = 0x408 F_GETSIG = 0xb + F_GET_FILE_RW_HINT = 0x40d + F_GET_RW_HINT = 0x40b + F_GET_SEALS = 0x40a F_LOCK = 0x1 F_NOTIFY = 0x402 F_OFD_GETLK = 0x24 @@ -497,6 +538,10 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_GROW = 0x4 + F_SEAL_SEAL = 0x1 + F_SEAL_SHRINK = 0x2 + F_SEAL_WRITE = 0x8 F_SETFD = 0x2 F_SETFL = 0x4 F_SETLEASE = 0x400 @@ -508,6 +553,8 @@ const ( F_SETOWN_EX = 0xf F_SETPIPE_SZ = 0x407 F_SETSIG = 0xa + F_SET_FILE_RW_HINT = 0x40e + F_SET_RW_HINT = 0x40c F_SHLCK = 0x8 F_TEST = 0x3 F_TLOCK = 0x2 @@ -529,6 +576,49 @@ const ( GENL_UNS_ADMIN_PERM = 0x10 GRND_NONBLOCK = 0x1 GRND_RANDOM = 0x2 + HDIO_DRIVE_CMD = 0x31f + HDIO_DRIVE_CMD_AEB = 0x31e + HDIO_DRIVE_CMD_HDR_SIZE = 0x4 + HDIO_DRIVE_HOB_HDR_SIZE = 0x8 + HDIO_DRIVE_RESET = 0x31c + HDIO_DRIVE_TASK = 0x31e + HDIO_DRIVE_TASKFILE = 0x31d + HDIO_DRIVE_TASK_HDR_SIZE = 0x8 + HDIO_GETGEO = 0x301 + HDIO_GET_32BIT = 0x309 + HDIO_GET_ACOUSTIC = 0x30f + HDIO_GET_ADDRESS = 0x310 + HDIO_GET_BUSSTATE = 0x31a + HDIO_GET_DMA = 0x30b + HDIO_GET_IDENTITY = 0x30d + HDIO_GET_KEEPSETTINGS = 0x308 + HDIO_GET_MULTCOUNT = 0x304 + HDIO_GET_NICE = 0x30c + HDIO_GET_NOWERR = 0x30a + HDIO_GET_QDMA = 0x305 + HDIO_GET_UNMASKINTR = 0x302 + HDIO_GET_WCACHE = 0x30e + HDIO_OBSOLETE_IDENTITY = 0x307 + HDIO_SCAN_HWIF = 0x328 + HDIO_SET_32BIT = 0x324 + HDIO_SET_ACOUSTIC = 0x32c + HDIO_SET_ADDRESS = 0x32f + HDIO_SET_BUSSTATE = 0x32d + HDIO_SET_DMA = 0x326 + HDIO_SET_KEEPSETTINGS = 0x323 + HDIO_SET_MULTCOUNT = 0x321 + HDIO_SET_NICE = 0x329 + HDIO_SET_NOWERR = 0x325 + HDIO_SET_PIO_MODE = 0x327 + HDIO_SET_QDMA = 0x32e + HDIO_SET_UNMASKINTR = 0x322 + HDIO_SET_WCACHE = 0x32b + HDIO_SET_XFER = 0x306 + HDIO_TRISTATE_HWIF = 0x31b + HDIO_UNREGISTER_HWIF = 0x32a + HOSTFS_SUPER_MAGIC = 0xc0ffee + HPFS_SUPER_MAGIC = 0xf995e849 + HUGETLBFS_MAGIC = 0x958458f6 HUPCL = 0x400 IBSHIFT = 0x10 ICANON = 0x2 @@ -563,6 +653,8 @@ const ( IFF_MASTER = 0x400 IFF_MULTICAST = 0x1000 IFF_MULTI_QUEUE = 0x100 + IFF_NAPI = 0x10 + IFF_NAPI_FRAGS = 0x20 IFF_NOARP = 0x80 IFF_NOFILTER = 0x1000 IFF_NOTRAILERS = 0x20 @@ -777,12 +869,14 @@ const ( IP_UNICAST_IF = 0x32 IP_XFRM_POLICY = 0x11 ISIG = 0x1 + ISOFS_SUPER_MAGIC = 0x9660 ISTRIP = 0x20 IUCLC = 0x200 IUTF8 = 0x4000 IXANY = 0x800 IXOFF = 0x1000 IXON = 0x400 + JFFS2_SUPER_MAGIC = 0x72b6 KEYCTL_ASSUME_AUTHORITY = 0x10 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 @@ -847,6 +941,7 @@ const ( MADV_FREE = 0x8 MADV_HUGEPAGE = 0xe MADV_HWPOISON = 0x64 + MADV_KEEPONFORK = 0x13 MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 @@ -855,6 +950,7 @@ const ( MADV_SEQUENTIAL = 0x2 MADV_UNMERGEABLE = 0xd MADV_WILLNEED = 0x3 + MADV_WIPEONFORK = 0x12 MAP_ANON = 0x20 MAP_ANONYMOUS = 0x20 MAP_DENYWRITE = 0x800 @@ -876,9 +972,15 @@ const ( MCL_CURRENT = 0x1 MCL_FUTURE = 0x2 MCL_ONFAULT = 0x4 + MINIX2_SUPER_MAGIC = 0x2468 + MINIX2_SUPER_MAGIC2 = 0x2478 + MINIX3_SUPER_MAGIC = 0x4d5a + MINIX_SUPER_MAGIC = 0x137f + MINIX_SUPER_MAGIC2 = 0x138f MNT_DETACH = 0x2 MNT_EXPIRE = 0x4 MNT_FORCE = 0x1 + MSDOS_SUPER_MAGIC = 0x4d44 MSG_BATCH = 0x40000 MSG_CMSG_CLOEXEC = 0x40000000 MSG_CONFIRM = 0x800 @@ -900,6 +1002,7 @@ const ( MSG_TRYHARD = 0x4 MSG_WAITALL = 0x100 MSG_WAITFORONE = 0x10000 + MSG_ZEROCOPY = 0x4000000 MS_ACTIVE = 0x40000000 MS_ASYNC = 0x1 MS_BIND = 0x1000 @@ -937,7 +1040,9 @@ const ( MS_SYNCHRONOUS = 0x10 MS_UNBINDABLE = 0x20000 MS_VERBOSE = 0x8000 + MTD_INODE_FS_MAGIC = 0x11307854 NAME_MAX = 0xff + NCP_SUPER_MAGIC = 0x564c NETLINK_ADD_MEMBERSHIP = 0x1 NETLINK_AUDIT = 0x9 NETLINK_BROADCAST_ERROR = 0x4 @@ -972,6 +1077,37 @@ const ( NETLINK_UNUSED = 0x1 NETLINK_USERSOCK = 0x2 NETLINK_XFRM = 0x6 + NFNETLINK_V0 = 0x0 + NFNLGRP_ACCT_QUOTA = 0x8 + NFNLGRP_CONNTRACK_DESTROY = 0x3 + NFNLGRP_CONNTRACK_EXP_DESTROY = 0x6 + NFNLGRP_CONNTRACK_EXP_NEW = 0x4 + NFNLGRP_CONNTRACK_EXP_UPDATE = 0x5 + NFNLGRP_CONNTRACK_NEW = 0x1 + NFNLGRP_CONNTRACK_UPDATE = 0x2 + NFNLGRP_MAX = 0x9 + NFNLGRP_NFTABLES = 0x7 + NFNLGRP_NFTRACE = 0x9 + NFNLGRP_NONE = 0x0 + NFNL_BATCH_MAX = 0x1 + NFNL_MSG_BATCH_BEGIN = 0x10 + NFNL_MSG_BATCH_END = 0x11 + NFNL_NFA_NEST = 0x8000 + NFNL_SUBSYS_ACCT = 0x7 + NFNL_SUBSYS_COUNT = 0xc + NFNL_SUBSYS_CTHELPER = 0x9 + NFNL_SUBSYS_CTNETLINK = 0x1 + NFNL_SUBSYS_CTNETLINK_EXP = 0x2 + NFNL_SUBSYS_CTNETLINK_TIMEOUT = 0x8 + NFNL_SUBSYS_IPSET = 0x6 + NFNL_SUBSYS_NFTABLES = 0xa + NFNL_SUBSYS_NFT_COMPAT = 0xb + NFNL_SUBSYS_NONE = 0x0 + NFNL_SUBSYS_OSF = 0x5 + NFNL_SUBSYS_QUEUE = 0x3 + NFNL_SUBSYS_ULOG = 0x4 + NFS_SUPER_MAGIC = 0x6969 + NILFS_SUPER_MAGIC = 0x3434 NL0 = 0x0 NL1 = 0x100 NLA_ALIGNTO = 0x4 @@ -999,10 +1135,13 @@ const ( NLM_F_EXCL = 0x200 NLM_F_MATCH = 0x200 NLM_F_MULTI = 0x2 + NLM_F_NONREC = 0x100 NLM_F_REPLACE = 0x100 NLM_F_REQUEST = 0x1 NLM_F_ROOT = 0x100 NOFLSH = 0x80 + NSFS_MAGIC = 0x6e736673 + OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 OFILL = 0x40 @@ -1010,7 +1149,9 @@ const ( ONLCR = 0x4 ONLRET = 0x20 ONOCR = 0x10 + OPENPROM_SUPER_MAGIC = 0x9fa1 OPOST = 0x1 + OVERLAYFS_SUPER_MAGIC = 0x794c7630 O_ACCMODE = 0x3 O_APPEND = 0x400 O_ASYNC = 0x2000 @@ -1095,16 +1236,20 @@ const ( PERF_EVENT_IOC_DISABLE = 0x2401 PERF_EVENT_IOC_ENABLE = 0x2400 PERF_EVENT_IOC_ID = 0x80082407 + PERF_EVENT_IOC_MODIFY_ATTRIBUTES = 0x4008240b PERF_EVENT_IOC_PAUSE_OUTPUT = 0x40042409 PERF_EVENT_IOC_PERIOD = 0x40082404 + PERF_EVENT_IOC_QUERY_BPF = 0xc008240a PERF_EVENT_IOC_REFRESH = 0x2402 PERF_EVENT_IOC_RESET = 0x2403 PERF_EVENT_IOC_SET_BPF = 0x40042408 PERF_EVENT_IOC_SET_FILTER = 0x40082406 PERF_EVENT_IOC_SET_OUTPUT = 0x2405 + PIPEFS_MAGIC = 0x50495045 PRIO_PGRP = 0x1 PRIO_PROCESS = 0x0 PRIO_USER = 0x2 + PROC_SUPER_MAGIC = 0x9fa0 PROT_EXEC = 0x4 PROT_GROWSDOWN = 0x1000000 PROT_GROWSUP = 0x2000000 @@ -1147,6 +1292,7 @@ const ( PR_GET_PDEATHSIG = 0x2 PR_GET_SECCOMP = 0x15 PR_GET_SECUREBITS = 0x1b + PR_GET_SPECULATION_CTRL = 0x34 PR_GET_THP_DISABLE = 0x2a PR_GET_TID_ADDRESS = 0x28 PR_GET_TIMERSLACK = 0x1e @@ -1192,11 +1338,23 @@ const ( PR_SET_PTRACER_ANY = 0xffffffffffffffff PR_SET_SECCOMP = 0x16 PR_SET_SECUREBITS = 0x1c + PR_SET_SPECULATION_CTRL = 0x35 PR_SET_THP_DISABLE = 0x29 PR_SET_TIMERSLACK = 0x1d PR_SET_TIMING = 0xe PR_SET_TSC = 0x1a PR_SET_UNALIGN = 0x6 + PR_SPEC_DISABLE = 0x4 + PR_SPEC_ENABLE = 0x2 + PR_SPEC_FORCE_DISABLE = 0x8 + PR_SPEC_NOT_AFFECTED = 0x0 + PR_SPEC_PRCTL = 0x1 + PR_SPEC_STORE_BYPASS = 0x0 + PR_SVE_GET_VL = 0x33 + PR_SVE_SET_VL = 0x32 + PR_SVE_SET_VL_ONEXEC = 0x40000 + PR_SVE_VL_INHERIT = 0x20000 + PR_SVE_VL_LEN_MASK = 0xffff PR_TASK_PERF_EVENTS_DISABLE = 0x1f PR_TASK_PERF_EVENTS_ENABLE = 0x20 PR_TIMING_STATISTICAL = 0x0 @@ -1205,6 +1363,7 @@ const ( PR_TSC_SIGSEGV = 0x2 PR_UNALIGN_NOPRINT = 0x1 PR_UNALIGN_SIGBUS = 0x2 + PSTOREFS_MAGIC = 0x6165676c PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 @@ -1244,6 +1403,7 @@ const ( PTRACE_POKETEXT = 0x4 PTRACE_POKEUSR = 0x6 PTRACE_SECCOMP_GET_FILTER = 0x420c + PTRACE_SECCOMP_GET_METADATA = 0x420d PTRACE_SEIZE = 0x4206 PTRACE_SETOPTIONS = 0x4200 PTRACE_SETREGS = 0xd @@ -1253,6 +1413,11 @@ const ( PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 PTRACE_TRACEME = 0x0 + QNX4_SUPER_MAGIC = 0x2f + QNX6_SUPER_MAGIC = 0x68191122 + RAMFS_MAGIC = 0x858458f6 + RDTGROUP_SUPER_MAGIC = 0x7655821 + REISERFS_SUPER_MAGIC = 0x52654973 RLIMIT_AS = 0x9 RLIMIT_CORE = 0x4 RLIMIT_CPU = 0x0 @@ -1273,6 +1438,7 @@ const ( RTAX_ADVMSS = 0x8 RTAX_CC_ALGO = 0x10 RTAX_CWND = 0x7 + RTAX_FASTOPEN_NO_COOKIE = 0x11 RTAX_FEATURES = 0xc RTAX_FEATURE_ALLFRAG = 0x8 RTAX_FEATURE_ECN = 0x1 @@ -1283,7 +1449,7 @@ const ( RTAX_INITCWND = 0xb RTAX_INITRWND = 0xe RTAX_LOCK = 0x1 - RTAX_MAX = 0x10 + RTAX_MAX = 0x11 RTAX_MTU = 0x2 RTAX_QUICKACK = 0xf RTAX_REORDERING = 0x9 @@ -1301,6 +1467,33 @@ const ( RTCF_MASQ = 0x400000 RTCF_NAT = 0x800000 RTCF_VALVE = 0x200000 + RTC_AF = 0x20 + RTC_AIE_OFF = 0x7002 + RTC_AIE_ON = 0x7001 + RTC_ALM_READ = 0x80247008 + RTC_ALM_SET = 0x40247007 + RTC_EPOCH_READ = 0x8008700d + RTC_EPOCH_SET = 0x4008700e + RTC_IRQF = 0x80 + RTC_IRQP_READ = 0x8008700b + RTC_IRQP_SET = 0x4008700c + RTC_MAX_FREQ = 0x2000 + RTC_PF = 0x40 + RTC_PIE_OFF = 0x7006 + RTC_PIE_ON = 0x7005 + RTC_PLL_GET = 0x80207011 + RTC_PLL_SET = 0x40207012 + RTC_RD_TIME = 0x80247009 + RTC_SET_TIME = 0x4024700a + RTC_UF = 0x10 + RTC_UIE_OFF = 0x7004 + RTC_UIE_ON = 0x7003 + RTC_VL_CLR = 0x7014 + RTC_VL_READ = 0x80047013 + RTC_WIE_OFF = 0x7010 + RTC_WIE_ON = 0x700f + RTC_WKALM_RD = 0x80287010 + RTC_WKALM_SET = 0x4028700f RTF_ADDRCLASSMASK = 0xf8000000 RTF_ADDRCONF = 0x40000 RTF_ALLONLINK = 0x20000 @@ -1437,6 +1630,8 @@ const ( SECCOMP_MODE_DISABLED = 0x0 SECCOMP_MODE_FILTER = 0x2 SECCOMP_MODE_STRICT = 0x1 + SECURITYFS_MAGIC = 0x73636673 + SELINUX_MAGIC = 0xf97cff8c SHUT_RD = 0x0 SHUT_RDWR = 0x2 SHUT_WR = 0x1 @@ -1521,6 +1716,23 @@ const ( SIOCSPGRP = 0x8902 SIOCSRARP = 0x8962 SIOCWANDEV = 0x894a + SMACK_MAGIC = 0x43415d53 + SMART_AUTOSAVE = 0xd2 + SMART_AUTO_OFFLINE = 0xdb + SMART_DISABLE = 0xd9 + SMART_ENABLE = 0xd8 + SMART_HCYL_PASS = 0xc2 + SMART_IMMEDIATE_OFFLINE = 0xd4 + SMART_LCYL_PASS = 0x4f + SMART_READ_LOG_SECTOR = 0xd5 + SMART_READ_THRESHOLDS = 0xd1 + SMART_READ_VALUES = 0xd0 + SMART_SAVE = 0xd3 + SMART_STATUS = 0xda + SMART_WRITE_LOG_SECTOR = 0xd6 + SMART_WRITE_THRESHOLDS = 0xd7 + SMB_SUPER_MAGIC = 0x517b + SOCKFS_MAGIC = 0x534f434b SOCK_CLOEXEC = 0x80000 SOCK_DCCP = 0x6 SOCK_DGRAM = 0x2 @@ -1557,6 +1769,7 @@ const ( SOL_SOCKET = 0x1 SOL_TCP = 0x6 SOL_TIPC = 0x10f + SOL_TLS = 0x11a SOL_X25 = 0x106 SOMAXCONN = 0x80 SO_ACCEPTCONN = 0x1e @@ -1625,10 +1838,13 @@ const ( SO_VM_SOCKETS_PEER_HOST_VM_ID = 0x3 SO_VM_SOCKETS_TRUSTED = 0x5 SO_WIFI_STATUS = 0x29 + SO_ZEROCOPY = 0x3c SPLICE_F_GIFT = 0x8 SPLICE_F_MORE = 0x4 SPLICE_F_MOVE = 0x1 SPLICE_F_NONBLOCK = 0x2 + SQUASHFS_MAGIC = 0x73717368 + STACK_END_MAGIC = 0x57ac6e9d STATX_ALL = 0xfff STATX_ATIME = 0x20 STATX_ATTR_APPEND = 0x20 @@ -1650,6 +1866,8 @@ const ( STATX_TYPE = 0x1 STATX_UID = 0x8 STATX__RESERVED = 0x80000000 + SVE_MAGIC = 0x53564501 + SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 S_IFBLK = 0x6000 @@ -1721,6 +1939,8 @@ const ( TCP_MAXWIN = 0xffff TCP_MAX_WINSHIFT = 0xe TCP_MD5SIG = 0xe + TCP_MD5SIG_EXT = 0x20 + TCP_MD5SIG_FLAG_PREFIX = 0x1 TCP_MD5SIG_MAXKEYLEN = 0x50 TCP_MSS = 0x200 TCP_MSS_DEFAULT = 0x218 @@ -1741,6 +1961,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa TCSAFLUSH = 0x2 @@ -1828,7 +2049,27 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 + TPACKET_ALIGNMENT = 0x10 + TPACKET_HDRLEN = 0x34 + TP_STATUS_AVAILABLE = 0x0 + TP_STATUS_BLK_TMO = 0x20 + TP_STATUS_COPY = 0x2 + TP_STATUS_CSUMNOTREADY = 0x8 + TP_STATUS_CSUM_VALID = 0x80 + TP_STATUS_KERNEL = 0x0 + TP_STATUS_LOSING = 0x4 + TP_STATUS_SENDING = 0x2 + TP_STATUS_SEND_REQUEST = 0x1 + TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_SOFTWARE = 0x20000000 + TP_STATUS_TS_SYS_HARDWARE = 0x40000000 + TP_STATUS_USER = 0x1 + TP_STATUS_VLAN_TPID_VALID = 0x40 + TP_STATUS_VLAN_VALID = 0x10 + TP_STATUS_WRONG_FORMAT = 0x4 + TRACEFS_MAGIC = 0x74726163 TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x401054d5 TUNDETACHFILTER = 0x401054d6 @@ -1840,6 +2081,7 @@ const ( TUNGETVNETHDRSZ = 0x800454d7 TUNGETVNETLE = 0x800454dd TUNSETDEBUG = 0x400454c9 + TUNSETFILTEREBPF = 0x800454e1 TUNSETGROUP = 0x400454ce TUNSETIFF = 0x400454ca TUNSETIFINDEX = 0x400454da @@ -1850,13 +2092,17 @@ const ( TUNSETPERSIST = 0x400454cb TUNSETQUEUE = 0x400454d9 TUNSETSNDBUF = 0x400454d4 + TUNSETSTEERINGEBPF = 0x800454e0 TUNSETTXFILTER = 0x400454d1 TUNSETVNETBE = 0x400454de TUNSETVNETHDRSZ = 0x400454d8 TUNSETVNETLE = 0x400454dc + UDF_SUPER_MAGIC = 0x15013346 UMOUNT_NOFOLLOW = 0x8 + USBDEVICE_SUPER_MAGIC = 0x9fa2 UTIME_NOW = 0x3fffffff UTIME_OMIT = 0x3ffffffe + V9FS_MAGIC = 0x1021997 VDISCARD = 0xd VEOF = 0x4 VEOL = 0xb @@ -1898,6 +2144,86 @@ const ( WDIOC_SETPRETIMEOUT = 0xc0045708 WDIOC_SETTIMEOUT = 0xc0045706 WEXITED = 0x4 + WIN_ACKMEDIACHANGE = 0xdb + WIN_CHECKPOWERMODE1 = 0xe5 + WIN_CHECKPOWERMODE2 = 0x98 + WIN_DEVICE_RESET = 0x8 + WIN_DIAGNOSE = 0x90 + WIN_DOORLOCK = 0xde + WIN_DOORUNLOCK = 0xdf + WIN_DOWNLOAD_MICROCODE = 0x92 + WIN_FLUSH_CACHE = 0xe7 + WIN_FLUSH_CACHE_EXT = 0xea + WIN_FORMAT = 0x50 + WIN_GETMEDIASTATUS = 0xda + WIN_IDENTIFY = 0xec + WIN_IDENTIFY_DMA = 0xee + WIN_IDLEIMMEDIATE = 0xe1 + WIN_INIT = 0x60 + WIN_MEDIAEJECT = 0xed + WIN_MULTREAD = 0xc4 + WIN_MULTREAD_EXT = 0x29 + WIN_MULTWRITE = 0xc5 + WIN_MULTWRITE_EXT = 0x39 + WIN_NOP = 0x0 + WIN_PACKETCMD = 0xa0 + WIN_PIDENTIFY = 0xa1 + WIN_POSTBOOT = 0xdc + WIN_PREBOOT = 0xdd + WIN_QUEUED_SERVICE = 0xa2 + WIN_READ = 0x20 + WIN_READDMA = 0xc8 + WIN_READDMA_EXT = 0x25 + WIN_READDMA_ONCE = 0xc9 + WIN_READDMA_QUEUED = 0xc7 + WIN_READDMA_QUEUED_EXT = 0x26 + WIN_READ_BUFFER = 0xe4 + WIN_READ_EXT = 0x24 + WIN_READ_LONG = 0x22 + WIN_READ_LONG_ONCE = 0x23 + WIN_READ_NATIVE_MAX = 0xf8 + WIN_READ_NATIVE_MAX_EXT = 0x27 + WIN_READ_ONCE = 0x21 + WIN_RECAL = 0x10 + WIN_RESTORE = 0x10 + WIN_SECURITY_DISABLE = 0xf6 + WIN_SECURITY_ERASE_PREPARE = 0xf3 + WIN_SECURITY_ERASE_UNIT = 0xf4 + WIN_SECURITY_FREEZE_LOCK = 0xf5 + WIN_SECURITY_SET_PASS = 0xf1 + WIN_SECURITY_UNLOCK = 0xf2 + WIN_SEEK = 0x70 + WIN_SETFEATURES = 0xef + WIN_SETIDLE1 = 0xe3 + WIN_SETIDLE2 = 0x97 + WIN_SETMULT = 0xc6 + WIN_SET_MAX = 0xf9 + WIN_SET_MAX_EXT = 0x37 + WIN_SLEEPNOW1 = 0xe6 + WIN_SLEEPNOW2 = 0x99 + WIN_SMART = 0xb0 + WIN_SPECIFY = 0x91 + WIN_SRST = 0x8 + WIN_STANDBY = 0xe2 + WIN_STANDBY2 = 0x96 + WIN_STANDBYNOW1 = 0xe0 + WIN_STANDBYNOW2 = 0x94 + WIN_VERIFY = 0x40 + WIN_VERIFY_EXT = 0x42 + WIN_VERIFY_ONCE = 0x41 + WIN_WRITE = 0x30 + WIN_WRITEDMA = 0xca + WIN_WRITEDMA_EXT = 0x35 + WIN_WRITEDMA_ONCE = 0xcb + WIN_WRITEDMA_QUEUED = 0xcc + WIN_WRITEDMA_QUEUED_EXT = 0x36 + WIN_WRITE_BUFFER = 0xe8 + WIN_WRITE_EXT = 0x34 + WIN_WRITE_LONG = 0x32 + WIN_WRITE_LONG_ONCE = 0x33 + WIN_WRITE_ONCE = 0x31 + WIN_WRITE_SAME = 0xe9 + WIN_WRITE_VERIFY = 0x3c WNOHANG = 0x1 WNOTHREAD = 0x20000000 WNOWAIT = 0x1000000 @@ -1907,7 +2233,9 @@ const ( XATTR_CREATE = 0x1 XATTR_REPLACE = 0x2 XCASE = 0x4 + XENFS_SUPER_MAGIC = 0xabba1974 XTABS = 0x1800 + ZSMALLOC_MAGIC = 0x58295829 ) // Errors @@ -2087,171 +2415,179 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "no such device or address", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource temporarily unavailable", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device or resource busy", - 17: "file exists", - 18: "invalid cross-device link", - 19: "no such device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "numerical result out of range", - 35: "resource deadlock avoided", - 36: "file name too long", - 37: "no locks available", - 38: "function not implemented", - 39: "directory not empty", - 40: "too many levels of symbolic links", - 42: "no message of desired type", - 43: "identifier removed", - 44: "channel number out of range", - 45: "level 2 not synchronized", - 46: "level 3 halted", - 47: "level 3 reset", - 48: "link number out of range", - 49: "protocol driver not attached", - 50: "no CSI structure available", - 51: "level 2 halted", - 52: "invalid exchange", - 53: "invalid request descriptor", - 54: "exchange full", - 55: "no anode", - 56: "invalid request code", - 57: "invalid slot", - 59: "bad font file format", - 60: "device not a stream", - 61: "no data available", - 62: "timer expired", - 63: "out of streams resources", - 64: "machine is not on the network", - 65: "package not installed", - 66: "object is remote", - 67: "link has been severed", - 68: "advertise error", - 69: "srmount error", - 70: "communication error on send", - 71: "protocol error", - 72: "multihop attempted", - 73: "RFS specific error", - 74: "bad message", - 75: "value too large for defined data type", - 76: "name not unique on network", - 77: "file descriptor in bad state", - 78: "remote address changed", - 79: "can not access a needed shared library", - 80: "accessing a corrupted shared library", - 81: ".lib section in a.out corrupted", - 82: "attempting to link in too many shared libraries", - 83: "cannot exec a shared library directly", - 84: "invalid or incomplete multibyte or wide character", - 85: "interrupted system call should be restarted", - 86: "streams pipe error", - 87: "too many users", - 88: "socket operation on non-socket", - 89: "destination address required", - 90: "message too long", - 91: "protocol wrong type for socket", - 92: "protocol not available", - 93: "protocol not supported", - 94: "socket type not supported", - 95: "operation not supported", - 96: "protocol family not supported", - 97: "address family not supported by protocol", - 98: "address already in use", - 99: "cannot assign requested address", - 100: "network is down", - 101: "network is unreachable", - 102: "network dropped connection on reset", - 103: "software caused connection abort", - 104: "connection reset by peer", - 105: "no buffer space available", - 106: "transport endpoint is already connected", - 107: "transport endpoint is not connected", - 108: "cannot send after transport endpoint shutdown", - 109: "too many references: cannot splice", - 110: "connection timed out", - 111: "connection refused", - 112: "host is down", - 113: "no route to host", - 114: "operation already in progress", - 115: "operation now in progress", - 116: "stale file handle", - 117: "structure needs cleaning", - 118: "not a XENIX named type file", - 119: "no XENIX semaphores available", - 120: "is a named type file", - 121: "remote I/O error", - 122: "disk quota exceeded", - 123: "no medium found", - 124: "wrong medium type", - 125: "operation canceled", - 126: "required key not available", - 127: "key has expired", - 128: "key has been revoked", - 129: "key was rejected by service", - 130: "owner died", - 131: "state not recoverable", - 132: "operation not possible due to RF-kill", - 133: "memory page has hardware error", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "no such device or address"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EAGAIN", "resource temporarily unavailable"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device or resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "invalid cross-device link"}, + {19, "ENODEV", "no such device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "numerical result out of range"}, + {35, "EDEADLK", "resource deadlock avoided"}, + {36, "ENAMETOOLONG", "file name too long"}, + {37, "ENOLCK", "no locks available"}, + {38, "ENOSYS", "function not implemented"}, + {39, "ENOTEMPTY", "directory not empty"}, + {40, "ELOOP", "too many levels of symbolic links"}, + {42, "ENOMSG", "no message of desired type"}, + {43, "EIDRM", "identifier removed"}, + {44, "ECHRNG", "channel number out of range"}, + {45, "EL2NSYNC", "level 2 not synchronized"}, + {46, "EL3HLT", "level 3 halted"}, + {47, "EL3RST", "level 3 reset"}, + {48, "ELNRNG", "link number out of range"}, + {49, "EUNATCH", "protocol driver not attached"}, + {50, "ENOCSI", "no CSI structure available"}, + {51, "EL2HLT", "level 2 halted"}, + {52, "EBADE", "invalid exchange"}, + {53, "EBADR", "invalid request descriptor"}, + {54, "EXFULL", "exchange full"}, + {55, "ENOANO", "no anode"}, + {56, "EBADRQC", "invalid request code"}, + {57, "EBADSLT", "invalid slot"}, + {59, "EBFONT", "bad font file format"}, + {60, "ENOSTR", "device not a stream"}, + {61, "ENODATA", "no data available"}, + {62, "ETIME", "timer expired"}, + {63, "ENOSR", "out of streams resources"}, + {64, "ENONET", "machine is not on the network"}, + {65, "ENOPKG", "package not installed"}, + {66, "EREMOTE", "object is remote"}, + {67, "ENOLINK", "link has been severed"}, + {68, "EADV", "advertise error"}, + {69, "ESRMNT", "srmount error"}, + {70, "ECOMM", "communication error on send"}, + {71, "EPROTO", "protocol error"}, + {72, "EMULTIHOP", "multihop attempted"}, + {73, "EDOTDOT", "RFS specific error"}, + {74, "EBADMSG", "bad message"}, + {75, "EOVERFLOW", "value too large for defined data type"}, + {76, "ENOTUNIQ", "name not unique on network"}, + {77, "EBADFD", "file descriptor in bad state"}, + {78, "EREMCHG", "remote address changed"}, + {79, "ELIBACC", "can not access a needed shared library"}, + {80, "ELIBBAD", "accessing a corrupted shared library"}, + {81, "ELIBSCN", ".lib section in a.out corrupted"}, + {82, "ELIBMAX", "attempting to link in too many shared libraries"}, + {83, "ELIBEXEC", "cannot exec a shared library directly"}, + {84, "EILSEQ", "invalid or incomplete multibyte or wide character"}, + {85, "ERESTART", "interrupted system call should be restarted"}, + {86, "ESTRPIPE", "streams pipe error"}, + {87, "EUSERS", "too many users"}, + {88, "ENOTSOCK", "socket operation on non-socket"}, + {89, "EDESTADDRREQ", "destination address required"}, + {90, "EMSGSIZE", "message too long"}, + {91, "EPROTOTYPE", "protocol wrong type for socket"}, + {92, "ENOPROTOOPT", "protocol not available"}, + {93, "EPROTONOSUPPORT", "protocol not supported"}, + {94, "ESOCKTNOSUPPORT", "socket type not supported"}, + {95, "ENOTSUP", "operation not supported"}, + {96, "EPFNOSUPPORT", "protocol family not supported"}, + {97, "EAFNOSUPPORT", "address family not supported by protocol"}, + {98, "EADDRINUSE", "address already in use"}, + {99, "EADDRNOTAVAIL", "cannot assign requested address"}, + {100, "ENETDOWN", "network is down"}, + {101, "ENETUNREACH", "network is unreachable"}, + {102, "ENETRESET", "network dropped connection on reset"}, + {103, "ECONNABORTED", "software caused connection abort"}, + {104, "ECONNRESET", "connection reset by peer"}, + {105, "ENOBUFS", "no buffer space available"}, + {106, "EISCONN", "transport endpoint is already connected"}, + {107, "ENOTCONN", "transport endpoint is not connected"}, + {108, "ESHUTDOWN", "cannot send after transport endpoint shutdown"}, + {109, "ETOOMANYREFS", "too many references: cannot splice"}, + {110, "ETIMEDOUT", "connection timed out"}, + {111, "ECONNREFUSED", "connection refused"}, + {112, "EHOSTDOWN", "host is down"}, + {113, "EHOSTUNREACH", "no route to host"}, + {114, "EALREADY", "operation already in progress"}, + {115, "EINPROGRESS", "operation now in progress"}, + {116, "ESTALE", "stale file handle"}, + {117, "EUCLEAN", "structure needs cleaning"}, + {118, "ENOTNAM", "not a XENIX named type file"}, + {119, "ENAVAIL", "no XENIX semaphores available"}, + {120, "EISNAM", "is a named type file"}, + {121, "EREMOTEIO", "remote I/O error"}, + {122, "EDQUOT", "disk quota exceeded"}, + {123, "ENOMEDIUM", "no medium found"}, + {124, "EMEDIUMTYPE", "wrong medium type"}, + {125, "ECANCELED", "operation canceled"}, + {126, "ENOKEY", "required key not available"}, + {127, "EKEYEXPIRED", "key has expired"}, + {128, "EKEYREVOKED", "key has been revoked"}, + {129, "EKEYREJECTED", "key was rejected by service"}, + {130, "EOWNERDEAD", "owner died"}, + {131, "ENOTRECOVERABLE", "state not recoverable"}, + {132, "ERFKILL", "operation not possible due to RF-kill"}, + {133, "EHWPOISON", "memory page has hardware error"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/breakpoint trap", - 6: "aborted", - 7: "bus error", - 8: "floating point exception", - 9: "killed", - 10: "user defined signal 1", - 11: "segmentation fault", - 12: "user defined signal 2", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "stack fault", - 17: "child exited", - 18: "continued", - 19: "stopped (signal)", - 20: "stopped", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "urgent I/O condition", - 24: "CPU time limit exceeded", - 25: "file size limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window changed", - 29: "I/O possible", - 30: "power failure", - 31: "bad system call", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/breakpoint trap"}, + {6, "SIGABRT", "aborted"}, + {7, "SIGBUS", "bus error"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGUSR1", "user defined signal 1"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGUSR2", "user defined signal 2"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGSTKFLT", "stack fault"}, + {17, "SIGCHLD", "child exited"}, + {18, "SIGCONT", "continued"}, + {19, "SIGSTOP", "stopped (signal)"}, + {20, "SIGTSTP", "stopped"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGURG", "urgent I/O condition"}, + {24, "SIGXCPU", "CPU time limit exceeded"}, + {25, "SIGXFSZ", "file size limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window changed"}, + {29, "SIGIO", "I/O possible"}, + {30, "SIGPWR", "power failure"}, + {31, "SIGSYS", "bad system call"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go index f45492db53..410ab56b09 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips.go @@ -3,7 +3,7 @@ // +build mips,linux -// Created by cgo -godefs - DO NOT EDIT +// Code generated by cmd/cgo -godefs; DO NOT EDIT. // cgo -godefs -- -Wall -Werror -static -I/tmp/include _const.go package unix @@ -11,6 +11,11 @@ package unix import "syscall" const ( + AAFS_MAGIC = 0x5a3c69f0 + ADFS_SUPER_MAGIC = 0xadf5 + AFFS_SUPER_MAGIC = 0xadff + AFS_FS_MAGIC = 0x6b414653 + AFS_SUPER_MAGIC = 0x5346414f AF_ALG = 0x26 AF_APPLETALK = 0x5 AF_ASH = 0x12 @@ -66,6 +71,7 @@ const ( ALG_SET_IV = 0x2 ALG_SET_KEY = 0x1 ALG_SET_OP = 0x3 + ANON_INODE_FS_MAGIC = 0x9041934 ARPHRD_6LOWPAN = 0x339 ARPHRD_ADAPT = 0x108 ARPHRD_APPLETLK = 0x8 @@ -121,6 +127,7 @@ const ( ARPHRD_PPP = 0x200 ARPHRD_PRONET = 0x4 ARPHRD_RAWHDLC = 0x206 + ARPHRD_RAWIP = 0x207 ARPHRD_ROSE = 0x10e ARPHRD_RSRVD = 0x104 ARPHRD_SIT = 0x308 @@ -132,6 +139,7 @@ const ( ARPHRD_VOID = 0xffff ARPHRD_VSOCKMON = 0x33a ARPHRD_X25 = 0x10f + AUTOFS_SUPER_MAGIC = 0x187 B0 = 0x0 B1000000 = 0x1008 B110 = 0x3 @@ -163,6 +171,9 @@ const ( B75 = 0x2 B921600 = 0x1007 B9600 = 0xd + BALLOON_KVM_MAGIC = 0x13661366 + BDEVFS_MAGIC = 0x62646576 + BINFMTFS_MAGIC = 0x42494e4d BLKBSZGET = 0x40041270 BLKBSZSET = 0x80041271 BLKFLSBUF = 0x20001261 @@ -187,6 +198,7 @@ const ( BPF_AND = 0x50 BPF_B = 0x10 BPF_DIV = 0x30 + BPF_FS_MAGIC = 0xcafe4a11 BPF_H = 0x8 BPF_IMM = 0x0 BPF_IND = 0x40 @@ -228,6 +240,8 @@ const ( BS0 = 0x0 BS1 = 0x2000 BSDLY = 0x2000 + BTRFS_SUPER_MAGIC = 0x9123683e + BTRFS_TEST_MAGIC = 0x73727279 CAN_BCM = 0x2 CAN_EFF_FLAG = 0x80000000 CAN_EFF_ID_BITS = 0x1d @@ -251,6 +265,8 @@ const ( CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf + CGROUP2_SUPER_MAGIC = 0x63677270 + CGROUP_SUPER_MAGIC = 0x27e0eb CIBAUD = 0x100f0000 CLOCAL = 0x800 CLOCK_BOOTTIME = 0x7 @@ -293,10 +309,12 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CMSPAR = 0x40000000 + CODA_SUPER_MAGIC = 0x73757245 CR0 = 0x0 CR1 = 0x200 CR2 = 0x400 CR3 = 0x600 + CRAMFS_MAGIC = 0x28cd3d45 CRDLY = 0x600 CREAD = 0x80 CRTSCTS = 0x80000000 @@ -311,6 +329,9 @@ const ( CSTOP = 0x13 CSTOPB = 0x40 CSUSP = 0x1a + DAXFS_MAGIC = 0x64646178 + DEBUGFS_MAGIC = 0x64626720 + DEVPTS_SUPER_MAGIC = 0x1cd1 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -327,9 +348,12 @@ const ( ECHOKE = 0x800 ECHONL = 0x40 ECHOPRT = 0x400 + ECRYPTFS_SUPER_MAGIC = 0xf15f EFD_CLOEXEC = 0x80000 EFD_NONBLOCK = 0x80 EFD_SEMAPHORE = 0x1 + EFIVARFS_MAGIC = 0xde5e81e4 + EFS_SUPER_MAGIC = 0x414a53 ENCODING_DEFAULT = 0x0 ENCODING_FM_MARK = 0x3 ENCODING_FM_SPACE = 0x4 @@ -390,6 +414,8 @@ const ( ETH_P_DSA = 0x1b ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada + ETH_P_ERSPAN = 0x88be + ETH_P_ERSPAN2 = 0x22eb ETH_P_FCOE = 0x8906 ETH_P_FIP = 0x8914 ETH_P_HDLC = 0x19 @@ -398,6 +424,7 @@ const ( ETH_P_IEEE802154 = 0xf6 ETH_P_IEEEPUP = 0xa00 ETH_P_IEEEPUPAT = 0xa01 + ETH_P_IFE = 0xed3e ETH_P_IP = 0x800 ETH_P_IPV6 = 0x86dd ETH_P_IPX = 0x8137 @@ -408,11 +435,13 @@ const ( ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 ETH_P_MACSEC = 0x88e5 + ETH_P_MAP = 0xf9 ETH_P_MOBITEX = 0x15 ETH_P_MPLS_MC = 0x8848 ETH_P_MPLS_UC = 0x8847 ETH_P_MVRP = 0x88f5 ETH_P_NCSI = 0x88f8 + ETH_P_NSH = 0x894f ETH_P_PAE = 0x888e ETH_P_PAUSE = 0x8808 ETH_P_PHONET = 0xf5 @@ -420,6 +449,7 @@ const ( ETH_P_PPP_DISC = 0x8863 ETH_P_PPP_MP = 0x8 ETH_P_PPP_SES = 0x8864 + ETH_P_PREAUTH = 0x88c7 ETH_P_PRP = 0x88fb ETH_P_PUP = 0x200 ETH_P_PUPAT = 0x201 @@ -440,9 +470,14 @@ const ( ETH_P_WCCP = 0x883e ETH_P_X25 = 0x805 ETH_P_XDSA = 0xf8 + EXABYTE_ENABLE_NEST = 0xf0 + EXT2_SUPER_MAGIC = 0xef53 + EXT3_SUPER_MAGIC = 0xef53 + EXT4_SUPER_MAGIC = 0xef53 EXTA = 0xe EXTB = 0xf EXTPROC = 0x10000 + F2FS_SUPER_MAGIC = 0xf2f52010 FALLOC_FL_COLLAPSE_RANGE = 0x8 FALLOC_FL_INSERT_RANGE = 0x20 FALLOC_FL_KEEP_SIZE = 0x1 @@ -476,6 +511,8 @@ const ( FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 FS_POLICY_FLAGS_VALID = 0x3 + FUTEXFS_SUPER_MAGIC = 0xbad1dea + F_ADD_SEALS = 0x409 F_DUPFD = 0x0 F_DUPFD_CLOEXEC = 0x406 F_EXLCK = 0x4 @@ -488,6 +525,9 @@ const ( F_GETOWN_EX = 0x10 F_GETPIPE_SZ = 0x408 F_GETSIG = 0xb + F_GET_FILE_RW_HINT = 0x40d + F_GET_RW_HINT = 0x40b + F_GET_SEALS = 0x40a F_LOCK = 0x1 F_NOTIFY = 0x402 F_OFD_GETLK = 0x24 @@ -495,6 +535,10 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_GROW = 0x4 + F_SEAL_SEAL = 0x1 + F_SEAL_SHRINK = 0x2 + F_SEAL_WRITE = 0x8 F_SETFD = 0x2 F_SETFL = 0x4 F_SETLEASE = 0x400 @@ -506,6 +550,8 @@ const ( F_SETOWN_EX = 0xf F_SETPIPE_SZ = 0x407 F_SETSIG = 0xa + F_SET_FILE_RW_HINT = 0x40e + F_SET_RW_HINT = 0x40c F_SHLCK = 0x8 F_TEST = 0x3 F_TLOCK = 0x2 @@ -527,6 +573,49 @@ const ( GENL_UNS_ADMIN_PERM = 0x10 GRND_NONBLOCK = 0x1 GRND_RANDOM = 0x2 + HDIO_DRIVE_CMD = 0x31f + HDIO_DRIVE_CMD_AEB = 0x31e + HDIO_DRIVE_CMD_HDR_SIZE = 0x4 + HDIO_DRIVE_HOB_HDR_SIZE = 0x8 + HDIO_DRIVE_RESET = 0x31c + HDIO_DRIVE_TASK = 0x31e + HDIO_DRIVE_TASKFILE = 0x31d + HDIO_DRIVE_TASK_HDR_SIZE = 0x8 + HDIO_GETGEO = 0x301 + HDIO_GET_32BIT = 0x309 + HDIO_GET_ACOUSTIC = 0x30f + HDIO_GET_ADDRESS = 0x310 + HDIO_GET_BUSSTATE = 0x31a + HDIO_GET_DMA = 0x30b + HDIO_GET_IDENTITY = 0x30d + HDIO_GET_KEEPSETTINGS = 0x308 + HDIO_GET_MULTCOUNT = 0x304 + HDIO_GET_NICE = 0x30c + HDIO_GET_NOWERR = 0x30a + HDIO_GET_QDMA = 0x305 + HDIO_GET_UNMASKINTR = 0x302 + HDIO_GET_WCACHE = 0x30e + HDIO_OBSOLETE_IDENTITY = 0x307 + HDIO_SCAN_HWIF = 0x328 + HDIO_SET_32BIT = 0x324 + HDIO_SET_ACOUSTIC = 0x32c + HDIO_SET_ADDRESS = 0x32f + HDIO_SET_BUSSTATE = 0x32d + HDIO_SET_DMA = 0x326 + HDIO_SET_KEEPSETTINGS = 0x323 + HDIO_SET_MULTCOUNT = 0x321 + HDIO_SET_NICE = 0x329 + HDIO_SET_NOWERR = 0x325 + HDIO_SET_PIO_MODE = 0x327 + HDIO_SET_QDMA = 0x32e + HDIO_SET_UNMASKINTR = 0x322 + HDIO_SET_WCACHE = 0x32b + HDIO_SET_XFER = 0x306 + HDIO_TRISTATE_HWIF = 0x31b + HDIO_UNREGISTER_HWIF = 0x32a + HOSTFS_SUPER_MAGIC = 0xc0ffee + HPFS_SUPER_MAGIC = 0xf995e849 + HUGETLBFS_MAGIC = 0x958458f6 HUPCL = 0x400 IBSHIFT = 0x10 ICANON = 0x2 @@ -561,6 +650,8 @@ const ( IFF_MASTER = 0x400 IFF_MULTICAST = 0x1000 IFF_MULTI_QUEUE = 0x100 + IFF_NAPI = 0x10 + IFF_NAPI_FRAGS = 0x20 IFF_NOARP = 0x80 IFF_NOFILTER = 0x1000 IFF_NOTRAILERS = 0x20 @@ -775,12 +866,14 @@ const ( IP_UNICAST_IF = 0x32 IP_XFRM_POLICY = 0x11 ISIG = 0x1 + ISOFS_SUPER_MAGIC = 0x9660 ISTRIP = 0x20 IUCLC = 0x200 IUTF8 = 0x4000 IXANY = 0x800 IXOFF = 0x1000 IXON = 0x400 + JFFS2_SUPER_MAGIC = 0x72b6 KEYCTL_ASSUME_AUTHORITY = 0x10 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 @@ -845,6 +938,7 @@ const ( MADV_FREE = 0x8 MADV_HUGEPAGE = 0xe MADV_HWPOISON = 0x64 + MADV_KEEPONFORK = 0x13 MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 @@ -853,6 +947,7 @@ const ( MADV_SEQUENTIAL = 0x2 MADV_UNMERGEABLE = 0xd MADV_WILLNEED = 0x3 + MADV_WIPEONFORK = 0x12 MAP_ANON = 0x800 MAP_ANONYMOUS = 0x800 MAP_DENYWRITE = 0x2000 @@ -875,9 +970,15 @@ const ( MCL_CURRENT = 0x1 MCL_FUTURE = 0x2 MCL_ONFAULT = 0x4 + MINIX2_SUPER_MAGIC = 0x2468 + MINIX2_SUPER_MAGIC2 = 0x2478 + MINIX3_SUPER_MAGIC = 0x4d5a + MINIX_SUPER_MAGIC = 0x137f + MINIX_SUPER_MAGIC2 = 0x138f MNT_DETACH = 0x2 MNT_EXPIRE = 0x4 MNT_FORCE = 0x1 + MSDOS_SUPER_MAGIC = 0x4d44 MSG_BATCH = 0x40000 MSG_CMSG_CLOEXEC = 0x40000000 MSG_CONFIRM = 0x800 @@ -899,6 +1000,7 @@ const ( MSG_TRYHARD = 0x4 MSG_WAITALL = 0x100 MSG_WAITFORONE = 0x10000 + MSG_ZEROCOPY = 0x4000000 MS_ACTIVE = 0x40000000 MS_ASYNC = 0x1 MS_BIND = 0x1000 @@ -936,7 +1038,9 @@ const ( MS_SYNCHRONOUS = 0x10 MS_UNBINDABLE = 0x20000 MS_VERBOSE = 0x8000 + MTD_INODE_FS_MAGIC = 0x11307854 NAME_MAX = 0xff + NCP_SUPER_MAGIC = 0x564c NETLINK_ADD_MEMBERSHIP = 0x1 NETLINK_AUDIT = 0x9 NETLINK_BROADCAST_ERROR = 0x4 @@ -971,6 +1075,37 @@ const ( NETLINK_UNUSED = 0x1 NETLINK_USERSOCK = 0x2 NETLINK_XFRM = 0x6 + NFNETLINK_V0 = 0x0 + NFNLGRP_ACCT_QUOTA = 0x8 + NFNLGRP_CONNTRACK_DESTROY = 0x3 + NFNLGRP_CONNTRACK_EXP_DESTROY = 0x6 + NFNLGRP_CONNTRACK_EXP_NEW = 0x4 + NFNLGRP_CONNTRACK_EXP_UPDATE = 0x5 + NFNLGRP_CONNTRACK_NEW = 0x1 + NFNLGRP_CONNTRACK_UPDATE = 0x2 + NFNLGRP_MAX = 0x9 + NFNLGRP_NFTABLES = 0x7 + NFNLGRP_NFTRACE = 0x9 + NFNLGRP_NONE = 0x0 + NFNL_BATCH_MAX = 0x1 + NFNL_MSG_BATCH_BEGIN = 0x10 + NFNL_MSG_BATCH_END = 0x11 + NFNL_NFA_NEST = 0x8000 + NFNL_SUBSYS_ACCT = 0x7 + NFNL_SUBSYS_COUNT = 0xc + NFNL_SUBSYS_CTHELPER = 0x9 + NFNL_SUBSYS_CTNETLINK = 0x1 + NFNL_SUBSYS_CTNETLINK_EXP = 0x2 + NFNL_SUBSYS_CTNETLINK_TIMEOUT = 0x8 + NFNL_SUBSYS_IPSET = 0x6 + NFNL_SUBSYS_NFTABLES = 0xa + NFNL_SUBSYS_NFT_COMPAT = 0xb + NFNL_SUBSYS_NONE = 0x0 + NFNL_SUBSYS_OSF = 0x5 + NFNL_SUBSYS_QUEUE = 0x3 + NFNL_SUBSYS_ULOG = 0x4 + NFS_SUPER_MAGIC = 0x6969 + NILFS_SUPER_MAGIC = 0x3434 NL0 = 0x0 NL1 = 0x100 NLA_ALIGNTO = 0x4 @@ -998,10 +1133,13 @@ const ( NLM_F_EXCL = 0x200 NLM_F_MATCH = 0x200 NLM_F_MULTI = 0x2 + NLM_F_NONREC = 0x100 NLM_F_REPLACE = 0x100 NLM_F_REQUEST = 0x1 NLM_F_ROOT = 0x100 NOFLSH = 0x80 + NSFS_MAGIC = 0x6e736673 + OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 OFILL = 0x40 @@ -1009,7 +1147,9 @@ const ( ONLCR = 0x4 ONLRET = 0x20 ONOCR = 0x10 + OPENPROM_SUPER_MAGIC = 0x9fa1 OPOST = 0x1 + OVERLAYFS_SUPER_MAGIC = 0x794c7630 O_ACCMODE = 0x3 O_APPEND = 0x8 O_ASYNC = 0x1000 @@ -1094,16 +1234,20 @@ const ( PERF_EVENT_IOC_DISABLE = 0x20002401 PERF_EVENT_IOC_ENABLE = 0x20002400 PERF_EVENT_IOC_ID = 0x40042407 + PERF_EVENT_IOC_MODIFY_ATTRIBUTES = 0x8004240b PERF_EVENT_IOC_PAUSE_OUTPUT = 0x80042409 PERF_EVENT_IOC_PERIOD = 0x80082404 + PERF_EVENT_IOC_QUERY_BPF = 0xc004240a PERF_EVENT_IOC_REFRESH = 0x20002402 PERF_EVENT_IOC_RESET = 0x20002403 PERF_EVENT_IOC_SET_BPF = 0x80042408 PERF_EVENT_IOC_SET_FILTER = 0x80042406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 + PIPEFS_MAGIC = 0x50495045 PRIO_PGRP = 0x1 PRIO_PROCESS = 0x0 PRIO_USER = 0x2 + PROC_SUPER_MAGIC = 0x9fa0 PROT_EXEC = 0x4 PROT_GROWSDOWN = 0x1000000 PROT_GROWSUP = 0x2000000 @@ -1146,6 +1290,7 @@ const ( PR_GET_PDEATHSIG = 0x2 PR_GET_SECCOMP = 0x15 PR_GET_SECUREBITS = 0x1b + PR_GET_SPECULATION_CTRL = 0x34 PR_GET_THP_DISABLE = 0x2a PR_GET_TID_ADDRESS = 0x28 PR_GET_TIMERSLACK = 0x1e @@ -1191,11 +1336,23 @@ const ( PR_SET_PTRACER_ANY = 0xffffffff PR_SET_SECCOMP = 0x16 PR_SET_SECUREBITS = 0x1c + PR_SET_SPECULATION_CTRL = 0x35 PR_SET_THP_DISABLE = 0x29 PR_SET_TIMERSLACK = 0x1d PR_SET_TIMING = 0xe PR_SET_TSC = 0x1a PR_SET_UNALIGN = 0x6 + PR_SPEC_DISABLE = 0x4 + PR_SPEC_ENABLE = 0x2 + PR_SPEC_FORCE_DISABLE = 0x8 + PR_SPEC_NOT_AFFECTED = 0x0 + PR_SPEC_PRCTL = 0x1 + PR_SPEC_STORE_BYPASS = 0x0 + PR_SVE_GET_VL = 0x33 + PR_SVE_SET_VL = 0x32 + PR_SVE_SET_VL_ONEXEC = 0x40000 + PR_SVE_VL_INHERIT = 0x20000 + PR_SVE_VL_LEN_MASK = 0xffff PR_TASK_PERF_EVENTS_DISABLE = 0x1f PR_TASK_PERF_EVENTS_ENABLE = 0x20 PR_TIMING_STATISTICAL = 0x0 @@ -1204,6 +1361,7 @@ const ( PR_TSC_SIGSEGV = 0x2 PR_UNALIGN_NOPRINT = 0x1 PR_UNALIGN_SIGBUS = 0x2 + PSTOREFS_MAGIC = 0x6165676c PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 @@ -1252,6 +1410,7 @@ const ( PTRACE_POKETEXT_3264 = 0xc2 PTRACE_POKEUSR = 0x6 PTRACE_SECCOMP_GET_FILTER = 0x420c + PTRACE_SECCOMP_GET_METADATA = 0x420d PTRACE_SEIZE = 0x4206 PTRACE_SETFPREGS = 0xf PTRACE_SETOPTIONS = 0x4200 @@ -1264,6 +1423,11 @@ const ( PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 PTRACE_TRACEME = 0x0 + QNX4_SUPER_MAGIC = 0x2f + QNX6_SUPER_MAGIC = 0x68191122 + RAMFS_MAGIC = 0x858458f6 + RDTGROUP_SUPER_MAGIC = 0x7655821 + REISERFS_SUPER_MAGIC = 0x52654973 RLIMIT_AS = 0x6 RLIMIT_CORE = 0x4 RLIMIT_CPU = 0x0 @@ -1284,6 +1448,7 @@ const ( RTAX_ADVMSS = 0x8 RTAX_CC_ALGO = 0x10 RTAX_CWND = 0x7 + RTAX_FASTOPEN_NO_COOKIE = 0x11 RTAX_FEATURES = 0xc RTAX_FEATURE_ALLFRAG = 0x8 RTAX_FEATURE_ECN = 0x1 @@ -1294,7 +1459,7 @@ const ( RTAX_INITCWND = 0xb RTAX_INITRWND = 0xe RTAX_LOCK = 0x1 - RTAX_MAX = 0x10 + RTAX_MAX = 0x11 RTAX_MTU = 0x2 RTAX_QUICKACK = 0xf RTAX_REORDERING = 0x9 @@ -1312,6 +1477,33 @@ const ( RTCF_MASQ = 0x400000 RTCF_NAT = 0x800000 RTCF_VALVE = 0x200000 + RTC_AF = 0x20 + RTC_AIE_OFF = 0x20007002 + RTC_AIE_ON = 0x20007001 + RTC_ALM_READ = 0x40247008 + RTC_ALM_SET = 0x80247007 + RTC_EPOCH_READ = 0x4004700d + RTC_EPOCH_SET = 0x8004700e + RTC_IRQF = 0x80 + RTC_IRQP_READ = 0x4004700b + RTC_IRQP_SET = 0x8004700c + RTC_MAX_FREQ = 0x2000 + RTC_PF = 0x40 + RTC_PIE_OFF = 0x20007006 + RTC_PIE_ON = 0x20007005 + RTC_PLL_GET = 0x401c7011 + RTC_PLL_SET = 0x801c7012 + RTC_RD_TIME = 0x40247009 + RTC_SET_TIME = 0x8024700a + RTC_UF = 0x10 + RTC_UIE_OFF = 0x20007004 + RTC_UIE_ON = 0x20007003 + RTC_VL_CLR = 0x20007014 + RTC_VL_READ = 0x40047013 + RTC_WIE_OFF = 0x20007010 + RTC_WIE_ON = 0x2000700f + RTC_WKALM_RD = 0x40287010 + RTC_WKALM_SET = 0x8028700f RTF_ADDRCLASSMASK = 0xf8000000 RTF_ADDRCONF = 0x40000 RTF_ALLONLINK = 0x20000 @@ -1448,6 +1640,8 @@ const ( SECCOMP_MODE_DISABLED = 0x0 SECCOMP_MODE_FILTER = 0x2 SECCOMP_MODE_STRICT = 0x1 + SECURITYFS_MAGIC = 0x73636673 + SELINUX_MAGIC = 0xf97cff8c SHUT_RD = 0x0 SHUT_RDWR = 0x2 SHUT_WR = 0x1 @@ -1532,6 +1726,23 @@ const ( SIOCSPGRP = 0x80047308 SIOCSRARP = 0x8962 SIOCWANDEV = 0x894a + SMACK_MAGIC = 0x43415d53 + SMART_AUTOSAVE = 0xd2 + SMART_AUTO_OFFLINE = 0xdb + SMART_DISABLE = 0xd9 + SMART_ENABLE = 0xd8 + SMART_HCYL_PASS = 0xc2 + SMART_IMMEDIATE_OFFLINE = 0xd4 + SMART_LCYL_PASS = 0x4f + SMART_READ_LOG_SECTOR = 0xd5 + SMART_READ_THRESHOLDS = 0xd1 + SMART_READ_VALUES = 0xd0 + SMART_SAVE = 0xd3 + SMART_STATUS = 0xda + SMART_WRITE_LOG_SECTOR = 0xd6 + SMART_WRITE_THRESHOLDS = 0xd7 + SMB_SUPER_MAGIC = 0x517b + SOCKFS_MAGIC = 0x534f434b SOCK_CLOEXEC = 0x80000 SOCK_DCCP = 0x6 SOCK_DGRAM = 0x1 @@ -1568,6 +1779,7 @@ const ( SOL_SOCKET = 0xffff SOL_TCP = 0x6 SOL_TIPC = 0x10f + SOL_TLS = 0x11a SOL_X25 = 0x106 SOMAXCONN = 0x80 SO_ACCEPTCONN = 0x1009 @@ -1637,10 +1849,13 @@ const ( SO_VM_SOCKETS_PEER_HOST_VM_ID = 0x3 SO_VM_SOCKETS_TRUSTED = 0x5 SO_WIFI_STATUS = 0x29 + SO_ZEROCOPY = 0x3c SPLICE_F_GIFT = 0x8 SPLICE_F_MORE = 0x4 SPLICE_F_MOVE = 0x1 SPLICE_F_NONBLOCK = 0x2 + SQUASHFS_MAGIC = 0x73717368 + STACK_END_MAGIC = 0x57ac6e9d STATX_ALL = 0xfff STATX_ATIME = 0x20 STATX_ATTR_APPEND = 0x20 @@ -1662,6 +1877,7 @@ const ( STATX_TYPE = 0x1 STATX_UID = 0x8 STATX__RESERVED = 0x80000000 + SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 S_IFBLK = 0x6000 @@ -1732,6 +1948,8 @@ const ( TCP_MAXWIN = 0xffff TCP_MAX_WINSHIFT = 0xe TCP_MD5SIG = 0xe + TCP_MD5SIG_EXT = 0x20 + TCP_MD5SIG_FLAG_PREFIX = 0x1 TCP_MD5SIG_MAXKEYLEN = 0x50 TCP_MSS = 0x200 TCP_MSS_DEFAULT = 0x218 @@ -1752,6 +1970,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa TCSAFLUSH = 0x5410 @@ -1841,7 +2060,27 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 + TPACKET_ALIGNMENT = 0x10 + TPACKET_HDRLEN = 0x34 + TP_STATUS_AVAILABLE = 0x0 + TP_STATUS_BLK_TMO = 0x20 + TP_STATUS_COPY = 0x2 + TP_STATUS_CSUMNOTREADY = 0x8 + TP_STATUS_CSUM_VALID = 0x80 + TP_STATUS_KERNEL = 0x0 + TP_STATUS_LOSING = 0x4 + TP_STATUS_SENDING = 0x2 + TP_STATUS_SEND_REQUEST = 0x1 + TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_SOFTWARE = 0x20000000 + TP_STATUS_TS_SYS_HARDWARE = 0x40000000 + TP_STATUS_USER = 0x1 + TP_STATUS_VLAN_TPID_VALID = 0x40 + TP_STATUS_VLAN_VALID = 0x10 + TP_STATUS_WRONG_FORMAT = 0x4 + TRACEFS_MAGIC = 0x74726163 TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x800854d5 TUNDETACHFILTER = 0x800854d6 @@ -1853,6 +2092,7 @@ const ( TUNGETVNETHDRSZ = 0x400454d7 TUNGETVNETLE = 0x400454dd TUNSETDEBUG = 0x800454c9 + TUNSETFILTEREBPF = 0x400454e1 TUNSETGROUP = 0x800454ce TUNSETIFF = 0x800454ca TUNSETIFINDEX = 0x800454da @@ -1863,13 +2103,17 @@ const ( TUNSETPERSIST = 0x800454cb TUNSETQUEUE = 0x800454d9 TUNSETSNDBUF = 0x800454d4 + TUNSETSTEERINGEBPF = 0x400454e0 TUNSETTXFILTER = 0x800454d1 TUNSETVNETBE = 0x800454de TUNSETVNETHDRSZ = 0x800454d8 TUNSETVNETLE = 0x800454dc + UDF_SUPER_MAGIC = 0x15013346 UMOUNT_NOFOLLOW = 0x8 + USBDEVICE_SUPER_MAGIC = 0x9fa2 UTIME_NOW = 0x3fffffff UTIME_OMIT = 0x3ffffffe + V9FS_MAGIC = 0x1021997 VDISCARD = 0xd VEOF = 0x10 VEOL = 0x11 @@ -1912,6 +2156,86 @@ const ( WDIOC_SETPRETIMEOUT = 0xc0045708 WDIOC_SETTIMEOUT = 0xc0045706 WEXITED = 0x4 + WIN_ACKMEDIACHANGE = 0xdb + WIN_CHECKPOWERMODE1 = 0xe5 + WIN_CHECKPOWERMODE2 = 0x98 + WIN_DEVICE_RESET = 0x8 + WIN_DIAGNOSE = 0x90 + WIN_DOORLOCK = 0xde + WIN_DOORUNLOCK = 0xdf + WIN_DOWNLOAD_MICROCODE = 0x92 + WIN_FLUSH_CACHE = 0xe7 + WIN_FLUSH_CACHE_EXT = 0xea + WIN_FORMAT = 0x50 + WIN_GETMEDIASTATUS = 0xda + WIN_IDENTIFY = 0xec + WIN_IDENTIFY_DMA = 0xee + WIN_IDLEIMMEDIATE = 0xe1 + WIN_INIT = 0x60 + WIN_MEDIAEJECT = 0xed + WIN_MULTREAD = 0xc4 + WIN_MULTREAD_EXT = 0x29 + WIN_MULTWRITE = 0xc5 + WIN_MULTWRITE_EXT = 0x39 + WIN_NOP = 0x0 + WIN_PACKETCMD = 0xa0 + WIN_PIDENTIFY = 0xa1 + WIN_POSTBOOT = 0xdc + WIN_PREBOOT = 0xdd + WIN_QUEUED_SERVICE = 0xa2 + WIN_READ = 0x20 + WIN_READDMA = 0xc8 + WIN_READDMA_EXT = 0x25 + WIN_READDMA_ONCE = 0xc9 + WIN_READDMA_QUEUED = 0xc7 + WIN_READDMA_QUEUED_EXT = 0x26 + WIN_READ_BUFFER = 0xe4 + WIN_READ_EXT = 0x24 + WIN_READ_LONG = 0x22 + WIN_READ_LONG_ONCE = 0x23 + WIN_READ_NATIVE_MAX = 0xf8 + WIN_READ_NATIVE_MAX_EXT = 0x27 + WIN_READ_ONCE = 0x21 + WIN_RECAL = 0x10 + WIN_RESTORE = 0x10 + WIN_SECURITY_DISABLE = 0xf6 + WIN_SECURITY_ERASE_PREPARE = 0xf3 + WIN_SECURITY_ERASE_UNIT = 0xf4 + WIN_SECURITY_FREEZE_LOCK = 0xf5 + WIN_SECURITY_SET_PASS = 0xf1 + WIN_SECURITY_UNLOCK = 0xf2 + WIN_SEEK = 0x70 + WIN_SETFEATURES = 0xef + WIN_SETIDLE1 = 0xe3 + WIN_SETIDLE2 = 0x97 + WIN_SETMULT = 0xc6 + WIN_SET_MAX = 0xf9 + WIN_SET_MAX_EXT = 0x37 + WIN_SLEEPNOW1 = 0xe6 + WIN_SLEEPNOW2 = 0x99 + WIN_SMART = 0xb0 + WIN_SPECIFY = 0x91 + WIN_SRST = 0x8 + WIN_STANDBY = 0xe2 + WIN_STANDBY2 = 0x96 + WIN_STANDBYNOW1 = 0xe0 + WIN_STANDBYNOW2 = 0x94 + WIN_VERIFY = 0x40 + WIN_VERIFY_EXT = 0x42 + WIN_VERIFY_ONCE = 0x41 + WIN_WRITE = 0x30 + WIN_WRITEDMA = 0xca + WIN_WRITEDMA_EXT = 0x35 + WIN_WRITEDMA_ONCE = 0xcb + WIN_WRITEDMA_QUEUED = 0xcc + WIN_WRITEDMA_QUEUED_EXT = 0x36 + WIN_WRITE_BUFFER = 0xe8 + WIN_WRITE_EXT = 0x34 + WIN_WRITE_LONG = 0x32 + WIN_WRITE_LONG_ONCE = 0x33 + WIN_WRITE_ONCE = 0x31 + WIN_WRITE_SAME = 0xe9 + WIN_WRITE_VERIFY = 0x3c WNOHANG = 0x1 WNOTHREAD = 0x20000000 WNOWAIT = 0x1000000 @@ -1921,7 +2245,9 @@ const ( XATTR_CREATE = 0x1 XATTR_REPLACE = 0x2 XCASE = 0x4 + XENFS_SUPER_MAGIC = 0xabba1974 XTABS = 0x1800 + ZSMALLOC_MAGIC = 0x58295829 ) // Errors @@ -2103,174 +2429,182 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "no such device or address", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource temporarily unavailable", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device or resource busy", - 17: "file exists", - 18: "invalid cross-device link", - 19: "no such device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "numerical result out of range", - 35: "no message of desired type", - 36: "identifier removed", - 37: "channel number out of range", - 38: "level 2 not synchronized", - 39: "level 3 halted", - 40: "level 3 reset", - 41: "link number out of range", - 42: "protocol driver not attached", - 43: "no CSI structure available", - 44: "level 2 halted", - 45: "resource deadlock avoided", - 46: "no locks available", - 50: "invalid exchange", - 51: "invalid request descriptor", - 52: "exchange full", - 53: "no anode", - 54: "invalid request code", - 55: "invalid slot", - 56: "file locking deadlock error", - 59: "bad font file format", - 60: "device not a stream", - 61: "no data available", - 62: "timer expired", - 63: "out of streams resources", - 64: "machine is not on the network", - 65: "package not installed", - 66: "object is remote", - 67: "link has been severed", - 68: "advertise error", - 69: "srmount error", - 70: "communication error on send", - 71: "protocol error", - 73: "RFS specific error", - 74: "multihop attempted", - 77: "bad message", - 78: "file name too long", - 79: "value too large for defined data type", - 80: "name not unique on network", - 81: "file descriptor in bad state", - 82: "remote address changed", - 83: "can not access a needed shared library", - 84: "accessing a corrupted shared library", - 85: ".lib section in a.out corrupted", - 86: "attempting to link in too many shared libraries", - 87: "cannot exec a shared library directly", - 88: "invalid or incomplete multibyte or wide character", - 89: "function not implemented", - 90: "too many levels of symbolic links", - 91: "interrupted system call should be restarted", - 92: "streams pipe error", - 93: "directory not empty", - 94: "too many users", - 95: "socket operation on non-socket", - 96: "destination address required", - 97: "message too long", - 98: "protocol wrong type for socket", - 99: "protocol not available", - 120: "protocol not supported", - 121: "socket type not supported", - 122: "operation not supported", - 123: "protocol family not supported", - 124: "address family not supported by protocol", - 125: "address already in use", - 126: "cannot assign requested address", - 127: "network is down", - 128: "network is unreachable", - 129: "network dropped connection on reset", - 130: "software caused connection abort", - 131: "connection reset by peer", - 132: "no buffer space available", - 133: "transport endpoint is already connected", - 134: "transport endpoint is not connected", - 135: "structure needs cleaning", - 137: "not a XENIX named type file", - 138: "no XENIX semaphores available", - 139: "is a named type file", - 140: "remote I/O error", - 141: "unknown error 141", - 142: "unknown error 142", - 143: "cannot send after transport endpoint shutdown", - 144: "too many references: cannot splice", - 145: "connection timed out", - 146: "connection refused", - 147: "host is down", - 148: "no route to host", - 149: "operation already in progress", - 150: "operation now in progress", - 151: "stale file handle", - 158: "operation canceled", - 159: "no medium found", - 160: "wrong medium type", - 161: "required key not available", - 162: "key has expired", - 163: "key has been revoked", - 164: "key was rejected by service", - 165: "owner died", - 166: "state not recoverable", - 167: "operation not possible due to RF-kill", - 168: "memory page has hardware error", - 1133: "disk quota exceeded", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "no such device or address"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EAGAIN", "resource temporarily unavailable"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device or resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "invalid cross-device link"}, + {19, "ENODEV", "no such device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "numerical result out of range"}, + {35, "ENOMSG", "no message of desired type"}, + {36, "EIDRM", "identifier removed"}, + {37, "ECHRNG", "channel number out of range"}, + {38, "EL2NSYNC", "level 2 not synchronized"}, + {39, "EL3HLT", "level 3 halted"}, + {40, "EL3RST", "level 3 reset"}, + {41, "ELNRNG", "link number out of range"}, + {42, "EUNATCH", "protocol driver not attached"}, + {43, "ENOCSI", "no CSI structure available"}, + {44, "EL2HLT", "level 2 halted"}, + {45, "EDEADLK", "resource deadlock avoided"}, + {46, "ENOLCK", "no locks available"}, + {50, "EBADE", "invalid exchange"}, + {51, "EBADR", "invalid request descriptor"}, + {52, "EXFULL", "exchange full"}, + {53, "ENOANO", "no anode"}, + {54, "EBADRQC", "invalid request code"}, + {55, "EBADSLT", "invalid slot"}, + {56, "EDEADLOCK", "file locking deadlock error"}, + {59, "EBFONT", "bad font file format"}, + {60, "ENOSTR", "device not a stream"}, + {61, "ENODATA", "no data available"}, + {62, "ETIME", "timer expired"}, + {63, "ENOSR", "out of streams resources"}, + {64, "ENONET", "machine is not on the network"}, + {65, "ENOPKG", "package not installed"}, + {66, "EREMOTE", "object is remote"}, + {67, "ENOLINK", "link has been severed"}, + {68, "EADV", "advertise error"}, + {69, "ESRMNT", "srmount error"}, + {70, "ECOMM", "communication error on send"}, + {71, "EPROTO", "protocol error"}, + {73, "EDOTDOT", "RFS specific error"}, + {74, "EMULTIHOP", "multihop attempted"}, + {77, "EBADMSG", "bad message"}, + {78, "ENAMETOOLONG", "file name too long"}, + {79, "EOVERFLOW", "value too large for defined data type"}, + {80, "ENOTUNIQ", "name not unique on network"}, + {81, "EBADFD", "file descriptor in bad state"}, + {82, "EREMCHG", "remote address changed"}, + {83, "ELIBACC", "can not access a needed shared library"}, + {84, "ELIBBAD", "accessing a corrupted shared library"}, + {85, "ELIBSCN", ".lib section in a.out corrupted"}, + {86, "ELIBMAX", "attempting to link in too many shared libraries"}, + {87, "ELIBEXEC", "cannot exec a shared library directly"}, + {88, "EILSEQ", "invalid or incomplete multibyte or wide character"}, + {89, "ENOSYS", "function not implemented"}, + {90, "ELOOP", "too many levels of symbolic links"}, + {91, "ERESTART", "interrupted system call should be restarted"}, + {92, "ESTRPIPE", "streams pipe error"}, + {93, "ENOTEMPTY", "directory not empty"}, + {94, "EUSERS", "too many users"}, + {95, "ENOTSOCK", "socket operation on non-socket"}, + {96, "EDESTADDRREQ", "destination address required"}, + {97, "EMSGSIZE", "message too long"}, + {98, "EPROTOTYPE", "protocol wrong type for socket"}, + {99, "ENOPROTOOPT", "protocol not available"}, + {120, "EPROTONOSUPPORT", "protocol not supported"}, + {121, "ESOCKTNOSUPPORT", "socket type not supported"}, + {122, "ENOTSUP", "operation not supported"}, + {123, "EPFNOSUPPORT", "protocol family not supported"}, + {124, "EAFNOSUPPORT", "address family not supported by protocol"}, + {125, "EADDRINUSE", "address already in use"}, + {126, "EADDRNOTAVAIL", "cannot assign requested address"}, + {127, "ENETDOWN", "network is down"}, + {128, "ENETUNREACH", "network is unreachable"}, + {129, "ENETRESET", "network dropped connection on reset"}, + {130, "ECONNABORTED", "software caused connection abort"}, + {131, "ECONNRESET", "connection reset by peer"}, + {132, "ENOBUFS", "no buffer space available"}, + {133, "EISCONN", "transport endpoint is already connected"}, + {134, "ENOTCONN", "transport endpoint is not connected"}, + {135, "EUCLEAN", "structure needs cleaning"}, + {137, "ENOTNAM", "not a XENIX named type file"}, + {138, "ENAVAIL", "no XENIX semaphores available"}, + {139, "EISNAM", "is a named type file"}, + {140, "EREMOTEIO", "remote I/O error"}, + {141, "EINIT", "unknown error 141"}, + {142, "EREMDEV", "unknown error 142"}, + {143, "ESHUTDOWN", "cannot send after transport endpoint shutdown"}, + {144, "ETOOMANYREFS", "too many references: cannot splice"}, + {145, "ETIMEDOUT", "connection timed out"}, + {146, "ECONNREFUSED", "connection refused"}, + {147, "EHOSTDOWN", "host is down"}, + {148, "EHOSTUNREACH", "no route to host"}, + {149, "EALREADY", "operation already in progress"}, + {150, "EINPROGRESS", "operation now in progress"}, + {151, "ESTALE", "stale file handle"}, + {158, "ECANCELED", "operation canceled"}, + {159, "ENOMEDIUM", "no medium found"}, + {160, "EMEDIUMTYPE", "wrong medium type"}, + {161, "ENOKEY", "required key not available"}, + {162, "EKEYEXPIRED", "key has expired"}, + {163, "EKEYREVOKED", "key has been revoked"}, + {164, "EKEYREJECTED", "key was rejected by service"}, + {165, "EOWNERDEAD", "owner died"}, + {166, "ENOTRECOVERABLE", "state not recoverable"}, + {167, "ERFKILL", "operation not possible due to RF-kill"}, + {168, "EHWPOISON", "memory page has hardware error"}, + {1133, "EDQUOT", "disk quota exceeded"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/breakpoint trap", - 6: "aborted", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "user defined signal 1", - 17: "user defined signal 2", - 18: "child exited", - 19: "power failure", - 20: "window changed", - 21: "urgent I/O condition", - 22: "I/O possible", - 23: "stopped (signal)", - 24: "stopped", - 25: "continued", - 26: "stopped (tty input)", - 27: "stopped (tty output)", - 28: "virtual timer expired", - 29: "profiling timer expired", - 30: "CPU time limit exceeded", - 31: "file size limit exceeded", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/breakpoint trap"}, + {6, "SIGABRT", "aborted"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGUSR1", "user defined signal 1"}, + {17, "SIGUSR2", "user defined signal 2"}, + {18, "SIGCHLD", "child exited"}, + {19, "SIGPWR", "power failure"}, + {20, "SIGWINCH", "window changed"}, + {21, "SIGURG", "urgent I/O condition"}, + {22, "SIGIO", "I/O possible"}, + {23, "SIGSTOP", "stopped (signal)"}, + {24, "SIGTSTP", "stopped"}, + {25, "SIGCONT", "continued"}, + {26, "SIGTTIN", "stopped (tty input)"}, + {27, "SIGTTOU", "stopped (tty output)"}, + {28, "SIGVTALRM", "virtual timer expired"}, + {29, "SIGPROF", "profiling timer expired"}, + {30, "SIGXCPU", "CPU time limit exceeded"}, + {31, "SIGXFSZ", "file size limit exceeded"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go index f5a64fba6b..dac4d90fad 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64.go @@ -3,7 +3,7 @@ // +build mips64,linux -// Created by cgo -godefs - DO NOT EDIT +// Code generated by cmd/cgo -godefs; DO NOT EDIT. // cgo -godefs -- -Wall -Werror -static -I/tmp/include _const.go package unix @@ -11,6 +11,11 @@ package unix import "syscall" const ( + AAFS_MAGIC = 0x5a3c69f0 + ADFS_SUPER_MAGIC = 0xadf5 + AFFS_SUPER_MAGIC = 0xadff + AFS_FS_MAGIC = 0x6b414653 + AFS_SUPER_MAGIC = 0x5346414f AF_ALG = 0x26 AF_APPLETALK = 0x5 AF_ASH = 0x12 @@ -66,6 +71,7 @@ const ( ALG_SET_IV = 0x2 ALG_SET_KEY = 0x1 ALG_SET_OP = 0x3 + ANON_INODE_FS_MAGIC = 0x9041934 ARPHRD_6LOWPAN = 0x339 ARPHRD_ADAPT = 0x108 ARPHRD_APPLETLK = 0x8 @@ -121,6 +127,7 @@ const ( ARPHRD_PPP = 0x200 ARPHRD_PRONET = 0x4 ARPHRD_RAWHDLC = 0x206 + ARPHRD_RAWIP = 0x207 ARPHRD_ROSE = 0x10e ARPHRD_RSRVD = 0x104 ARPHRD_SIT = 0x308 @@ -132,6 +139,7 @@ const ( ARPHRD_VOID = 0xffff ARPHRD_VSOCKMON = 0x33a ARPHRD_X25 = 0x10f + AUTOFS_SUPER_MAGIC = 0x187 B0 = 0x0 B1000000 = 0x1008 B110 = 0x3 @@ -163,6 +171,9 @@ const ( B75 = 0x2 B921600 = 0x1007 B9600 = 0xd + BALLOON_KVM_MAGIC = 0x13661366 + BDEVFS_MAGIC = 0x62646576 + BINFMTFS_MAGIC = 0x42494e4d BLKBSZGET = 0x40081270 BLKBSZSET = 0x80081271 BLKFLSBUF = 0x20001261 @@ -187,6 +198,7 @@ const ( BPF_AND = 0x50 BPF_B = 0x10 BPF_DIV = 0x30 + BPF_FS_MAGIC = 0xcafe4a11 BPF_H = 0x8 BPF_IMM = 0x0 BPF_IND = 0x40 @@ -228,6 +240,8 @@ const ( BS0 = 0x0 BS1 = 0x2000 BSDLY = 0x2000 + BTRFS_SUPER_MAGIC = 0x9123683e + BTRFS_TEST_MAGIC = 0x73727279 CAN_BCM = 0x2 CAN_EFF_FLAG = 0x80000000 CAN_EFF_ID_BITS = 0x1d @@ -251,6 +265,8 @@ const ( CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf + CGROUP2_SUPER_MAGIC = 0x63677270 + CGROUP_SUPER_MAGIC = 0x27e0eb CIBAUD = 0x100f0000 CLOCAL = 0x800 CLOCK_BOOTTIME = 0x7 @@ -293,10 +309,12 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CMSPAR = 0x40000000 + CODA_SUPER_MAGIC = 0x73757245 CR0 = 0x0 CR1 = 0x200 CR2 = 0x400 CR3 = 0x600 + CRAMFS_MAGIC = 0x28cd3d45 CRDLY = 0x600 CREAD = 0x80 CRTSCTS = 0x80000000 @@ -311,6 +329,9 @@ const ( CSTOP = 0x13 CSTOPB = 0x40 CSUSP = 0x1a + DAXFS_MAGIC = 0x64646178 + DEBUGFS_MAGIC = 0x64626720 + DEVPTS_SUPER_MAGIC = 0x1cd1 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -327,9 +348,12 @@ const ( ECHOKE = 0x800 ECHONL = 0x40 ECHOPRT = 0x400 + ECRYPTFS_SUPER_MAGIC = 0xf15f EFD_CLOEXEC = 0x80000 EFD_NONBLOCK = 0x80 EFD_SEMAPHORE = 0x1 + EFIVARFS_MAGIC = 0xde5e81e4 + EFS_SUPER_MAGIC = 0x414a53 ENCODING_DEFAULT = 0x0 ENCODING_FM_MARK = 0x3 ENCODING_FM_SPACE = 0x4 @@ -390,6 +414,8 @@ const ( ETH_P_DSA = 0x1b ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada + ETH_P_ERSPAN = 0x88be + ETH_P_ERSPAN2 = 0x22eb ETH_P_FCOE = 0x8906 ETH_P_FIP = 0x8914 ETH_P_HDLC = 0x19 @@ -398,6 +424,7 @@ const ( ETH_P_IEEE802154 = 0xf6 ETH_P_IEEEPUP = 0xa00 ETH_P_IEEEPUPAT = 0xa01 + ETH_P_IFE = 0xed3e ETH_P_IP = 0x800 ETH_P_IPV6 = 0x86dd ETH_P_IPX = 0x8137 @@ -408,11 +435,13 @@ const ( ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 ETH_P_MACSEC = 0x88e5 + ETH_P_MAP = 0xf9 ETH_P_MOBITEX = 0x15 ETH_P_MPLS_MC = 0x8848 ETH_P_MPLS_UC = 0x8847 ETH_P_MVRP = 0x88f5 ETH_P_NCSI = 0x88f8 + ETH_P_NSH = 0x894f ETH_P_PAE = 0x888e ETH_P_PAUSE = 0x8808 ETH_P_PHONET = 0xf5 @@ -420,6 +449,7 @@ const ( ETH_P_PPP_DISC = 0x8863 ETH_P_PPP_MP = 0x8 ETH_P_PPP_SES = 0x8864 + ETH_P_PREAUTH = 0x88c7 ETH_P_PRP = 0x88fb ETH_P_PUP = 0x200 ETH_P_PUPAT = 0x201 @@ -440,9 +470,14 @@ const ( ETH_P_WCCP = 0x883e ETH_P_X25 = 0x805 ETH_P_XDSA = 0xf8 + EXABYTE_ENABLE_NEST = 0xf0 + EXT2_SUPER_MAGIC = 0xef53 + EXT3_SUPER_MAGIC = 0xef53 + EXT4_SUPER_MAGIC = 0xef53 EXTA = 0xe EXTB = 0xf EXTPROC = 0x10000 + F2FS_SUPER_MAGIC = 0xf2f52010 FALLOC_FL_COLLAPSE_RANGE = 0x8 FALLOC_FL_INSERT_RANGE = 0x20 FALLOC_FL_KEEP_SIZE = 0x1 @@ -476,6 +511,8 @@ const ( FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 FS_POLICY_FLAGS_VALID = 0x3 + FUTEXFS_SUPER_MAGIC = 0xbad1dea + F_ADD_SEALS = 0x409 F_DUPFD = 0x0 F_DUPFD_CLOEXEC = 0x406 F_EXLCK = 0x4 @@ -488,6 +525,9 @@ const ( F_GETOWN_EX = 0x10 F_GETPIPE_SZ = 0x408 F_GETSIG = 0xb + F_GET_FILE_RW_HINT = 0x40d + F_GET_RW_HINT = 0x40b + F_GET_SEALS = 0x40a F_LOCK = 0x1 F_NOTIFY = 0x402 F_OFD_GETLK = 0x24 @@ -495,6 +535,10 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_GROW = 0x4 + F_SEAL_SEAL = 0x1 + F_SEAL_SHRINK = 0x2 + F_SEAL_WRITE = 0x8 F_SETFD = 0x2 F_SETFL = 0x4 F_SETLEASE = 0x400 @@ -506,6 +550,8 @@ const ( F_SETOWN_EX = 0xf F_SETPIPE_SZ = 0x407 F_SETSIG = 0xa + F_SET_FILE_RW_HINT = 0x40e + F_SET_RW_HINT = 0x40c F_SHLCK = 0x8 F_TEST = 0x3 F_TLOCK = 0x2 @@ -527,6 +573,49 @@ const ( GENL_UNS_ADMIN_PERM = 0x10 GRND_NONBLOCK = 0x1 GRND_RANDOM = 0x2 + HDIO_DRIVE_CMD = 0x31f + HDIO_DRIVE_CMD_AEB = 0x31e + HDIO_DRIVE_CMD_HDR_SIZE = 0x4 + HDIO_DRIVE_HOB_HDR_SIZE = 0x8 + HDIO_DRIVE_RESET = 0x31c + HDIO_DRIVE_TASK = 0x31e + HDIO_DRIVE_TASKFILE = 0x31d + HDIO_DRIVE_TASK_HDR_SIZE = 0x8 + HDIO_GETGEO = 0x301 + HDIO_GET_32BIT = 0x309 + HDIO_GET_ACOUSTIC = 0x30f + HDIO_GET_ADDRESS = 0x310 + HDIO_GET_BUSSTATE = 0x31a + HDIO_GET_DMA = 0x30b + HDIO_GET_IDENTITY = 0x30d + HDIO_GET_KEEPSETTINGS = 0x308 + HDIO_GET_MULTCOUNT = 0x304 + HDIO_GET_NICE = 0x30c + HDIO_GET_NOWERR = 0x30a + HDIO_GET_QDMA = 0x305 + HDIO_GET_UNMASKINTR = 0x302 + HDIO_GET_WCACHE = 0x30e + HDIO_OBSOLETE_IDENTITY = 0x307 + HDIO_SCAN_HWIF = 0x328 + HDIO_SET_32BIT = 0x324 + HDIO_SET_ACOUSTIC = 0x32c + HDIO_SET_ADDRESS = 0x32f + HDIO_SET_BUSSTATE = 0x32d + HDIO_SET_DMA = 0x326 + HDIO_SET_KEEPSETTINGS = 0x323 + HDIO_SET_MULTCOUNT = 0x321 + HDIO_SET_NICE = 0x329 + HDIO_SET_NOWERR = 0x325 + HDIO_SET_PIO_MODE = 0x327 + HDIO_SET_QDMA = 0x32e + HDIO_SET_UNMASKINTR = 0x322 + HDIO_SET_WCACHE = 0x32b + HDIO_SET_XFER = 0x306 + HDIO_TRISTATE_HWIF = 0x31b + HDIO_UNREGISTER_HWIF = 0x32a + HOSTFS_SUPER_MAGIC = 0xc0ffee + HPFS_SUPER_MAGIC = 0xf995e849 + HUGETLBFS_MAGIC = 0x958458f6 HUPCL = 0x400 IBSHIFT = 0x10 ICANON = 0x2 @@ -561,6 +650,8 @@ const ( IFF_MASTER = 0x400 IFF_MULTICAST = 0x1000 IFF_MULTI_QUEUE = 0x100 + IFF_NAPI = 0x10 + IFF_NAPI_FRAGS = 0x20 IFF_NOARP = 0x80 IFF_NOFILTER = 0x1000 IFF_NOTRAILERS = 0x20 @@ -775,12 +866,14 @@ const ( IP_UNICAST_IF = 0x32 IP_XFRM_POLICY = 0x11 ISIG = 0x1 + ISOFS_SUPER_MAGIC = 0x9660 ISTRIP = 0x20 IUCLC = 0x200 IUTF8 = 0x4000 IXANY = 0x800 IXOFF = 0x1000 IXON = 0x400 + JFFS2_SUPER_MAGIC = 0x72b6 KEYCTL_ASSUME_AUTHORITY = 0x10 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 @@ -845,6 +938,7 @@ const ( MADV_FREE = 0x8 MADV_HUGEPAGE = 0xe MADV_HWPOISON = 0x64 + MADV_KEEPONFORK = 0x13 MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 @@ -853,6 +947,7 @@ const ( MADV_SEQUENTIAL = 0x2 MADV_UNMERGEABLE = 0xd MADV_WILLNEED = 0x3 + MADV_WIPEONFORK = 0x12 MAP_ANON = 0x800 MAP_ANONYMOUS = 0x800 MAP_DENYWRITE = 0x2000 @@ -875,9 +970,15 @@ const ( MCL_CURRENT = 0x1 MCL_FUTURE = 0x2 MCL_ONFAULT = 0x4 + MINIX2_SUPER_MAGIC = 0x2468 + MINIX2_SUPER_MAGIC2 = 0x2478 + MINIX3_SUPER_MAGIC = 0x4d5a + MINIX_SUPER_MAGIC = 0x137f + MINIX_SUPER_MAGIC2 = 0x138f MNT_DETACH = 0x2 MNT_EXPIRE = 0x4 MNT_FORCE = 0x1 + MSDOS_SUPER_MAGIC = 0x4d44 MSG_BATCH = 0x40000 MSG_CMSG_CLOEXEC = 0x40000000 MSG_CONFIRM = 0x800 @@ -899,6 +1000,7 @@ const ( MSG_TRYHARD = 0x4 MSG_WAITALL = 0x100 MSG_WAITFORONE = 0x10000 + MSG_ZEROCOPY = 0x4000000 MS_ACTIVE = 0x40000000 MS_ASYNC = 0x1 MS_BIND = 0x1000 @@ -936,7 +1038,9 @@ const ( MS_SYNCHRONOUS = 0x10 MS_UNBINDABLE = 0x20000 MS_VERBOSE = 0x8000 + MTD_INODE_FS_MAGIC = 0x11307854 NAME_MAX = 0xff + NCP_SUPER_MAGIC = 0x564c NETLINK_ADD_MEMBERSHIP = 0x1 NETLINK_AUDIT = 0x9 NETLINK_BROADCAST_ERROR = 0x4 @@ -971,6 +1075,37 @@ const ( NETLINK_UNUSED = 0x1 NETLINK_USERSOCK = 0x2 NETLINK_XFRM = 0x6 + NFNETLINK_V0 = 0x0 + NFNLGRP_ACCT_QUOTA = 0x8 + NFNLGRP_CONNTRACK_DESTROY = 0x3 + NFNLGRP_CONNTRACK_EXP_DESTROY = 0x6 + NFNLGRP_CONNTRACK_EXP_NEW = 0x4 + NFNLGRP_CONNTRACK_EXP_UPDATE = 0x5 + NFNLGRP_CONNTRACK_NEW = 0x1 + NFNLGRP_CONNTRACK_UPDATE = 0x2 + NFNLGRP_MAX = 0x9 + NFNLGRP_NFTABLES = 0x7 + NFNLGRP_NFTRACE = 0x9 + NFNLGRP_NONE = 0x0 + NFNL_BATCH_MAX = 0x1 + NFNL_MSG_BATCH_BEGIN = 0x10 + NFNL_MSG_BATCH_END = 0x11 + NFNL_NFA_NEST = 0x8000 + NFNL_SUBSYS_ACCT = 0x7 + NFNL_SUBSYS_COUNT = 0xc + NFNL_SUBSYS_CTHELPER = 0x9 + NFNL_SUBSYS_CTNETLINK = 0x1 + NFNL_SUBSYS_CTNETLINK_EXP = 0x2 + NFNL_SUBSYS_CTNETLINK_TIMEOUT = 0x8 + NFNL_SUBSYS_IPSET = 0x6 + NFNL_SUBSYS_NFTABLES = 0xa + NFNL_SUBSYS_NFT_COMPAT = 0xb + NFNL_SUBSYS_NONE = 0x0 + NFNL_SUBSYS_OSF = 0x5 + NFNL_SUBSYS_QUEUE = 0x3 + NFNL_SUBSYS_ULOG = 0x4 + NFS_SUPER_MAGIC = 0x6969 + NILFS_SUPER_MAGIC = 0x3434 NL0 = 0x0 NL1 = 0x100 NLA_ALIGNTO = 0x4 @@ -998,10 +1133,13 @@ const ( NLM_F_EXCL = 0x200 NLM_F_MATCH = 0x200 NLM_F_MULTI = 0x2 + NLM_F_NONREC = 0x100 NLM_F_REPLACE = 0x100 NLM_F_REQUEST = 0x1 NLM_F_ROOT = 0x100 NOFLSH = 0x80 + NSFS_MAGIC = 0x6e736673 + OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 OFILL = 0x40 @@ -1009,7 +1147,9 @@ const ( ONLCR = 0x4 ONLRET = 0x20 ONOCR = 0x10 + OPENPROM_SUPER_MAGIC = 0x9fa1 OPOST = 0x1 + OVERLAYFS_SUPER_MAGIC = 0x794c7630 O_ACCMODE = 0x3 O_APPEND = 0x8 O_ASYNC = 0x1000 @@ -1094,16 +1234,20 @@ const ( PERF_EVENT_IOC_DISABLE = 0x20002401 PERF_EVENT_IOC_ENABLE = 0x20002400 PERF_EVENT_IOC_ID = 0x40082407 + PERF_EVENT_IOC_MODIFY_ATTRIBUTES = 0x8008240b PERF_EVENT_IOC_PAUSE_OUTPUT = 0x80042409 PERF_EVENT_IOC_PERIOD = 0x80082404 + PERF_EVENT_IOC_QUERY_BPF = 0xc008240a PERF_EVENT_IOC_REFRESH = 0x20002402 PERF_EVENT_IOC_RESET = 0x20002403 PERF_EVENT_IOC_SET_BPF = 0x80042408 PERF_EVENT_IOC_SET_FILTER = 0x80082406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 + PIPEFS_MAGIC = 0x50495045 PRIO_PGRP = 0x1 PRIO_PROCESS = 0x0 PRIO_USER = 0x2 + PROC_SUPER_MAGIC = 0x9fa0 PROT_EXEC = 0x4 PROT_GROWSDOWN = 0x1000000 PROT_GROWSUP = 0x2000000 @@ -1146,6 +1290,7 @@ const ( PR_GET_PDEATHSIG = 0x2 PR_GET_SECCOMP = 0x15 PR_GET_SECUREBITS = 0x1b + PR_GET_SPECULATION_CTRL = 0x34 PR_GET_THP_DISABLE = 0x2a PR_GET_TID_ADDRESS = 0x28 PR_GET_TIMERSLACK = 0x1e @@ -1191,11 +1336,23 @@ const ( PR_SET_PTRACER_ANY = 0xffffffffffffffff PR_SET_SECCOMP = 0x16 PR_SET_SECUREBITS = 0x1c + PR_SET_SPECULATION_CTRL = 0x35 PR_SET_THP_DISABLE = 0x29 PR_SET_TIMERSLACK = 0x1d PR_SET_TIMING = 0xe PR_SET_TSC = 0x1a PR_SET_UNALIGN = 0x6 + PR_SPEC_DISABLE = 0x4 + PR_SPEC_ENABLE = 0x2 + PR_SPEC_FORCE_DISABLE = 0x8 + PR_SPEC_NOT_AFFECTED = 0x0 + PR_SPEC_PRCTL = 0x1 + PR_SPEC_STORE_BYPASS = 0x0 + PR_SVE_GET_VL = 0x33 + PR_SVE_SET_VL = 0x32 + PR_SVE_SET_VL_ONEXEC = 0x40000 + PR_SVE_VL_INHERIT = 0x20000 + PR_SVE_VL_LEN_MASK = 0xffff PR_TASK_PERF_EVENTS_DISABLE = 0x1f PR_TASK_PERF_EVENTS_ENABLE = 0x20 PR_TIMING_STATISTICAL = 0x0 @@ -1204,6 +1361,7 @@ const ( PR_TSC_SIGSEGV = 0x2 PR_UNALIGN_NOPRINT = 0x1 PR_UNALIGN_SIGBUS = 0x2 + PSTOREFS_MAGIC = 0x6165676c PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 @@ -1252,6 +1410,7 @@ const ( PTRACE_POKETEXT_3264 = 0xc2 PTRACE_POKEUSR = 0x6 PTRACE_SECCOMP_GET_FILTER = 0x420c + PTRACE_SECCOMP_GET_METADATA = 0x420d PTRACE_SEIZE = 0x4206 PTRACE_SETFPREGS = 0xf PTRACE_SETOPTIONS = 0x4200 @@ -1264,6 +1423,11 @@ const ( PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 PTRACE_TRACEME = 0x0 + QNX4_SUPER_MAGIC = 0x2f + QNX6_SUPER_MAGIC = 0x68191122 + RAMFS_MAGIC = 0x858458f6 + RDTGROUP_SUPER_MAGIC = 0x7655821 + REISERFS_SUPER_MAGIC = 0x52654973 RLIMIT_AS = 0x6 RLIMIT_CORE = 0x4 RLIMIT_CPU = 0x0 @@ -1284,6 +1448,7 @@ const ( RTAX_ADVMSS = 0x8 RTAX_CC_ALGO = 0x10 RTAX_CWND = 0x7 + RTAX_FASTOPEN_NO_COOKIE = 0x11 RTAX_FEATURES = 0xc RTAX_FEATURE_ALLFRAG = 0x8 RTAX_FEATURE_ECN = 0x1 @@ -1294,7 +1459,7 @@ const ( RTAX_INITCWND = 0xb RTAX_INITRWND = 0xe RTAX_LOCK = 0x1 - RTAX_MAX = 0x10 + RTAX_MAX = 0x11 RTAX_MTU = 0x2 RTAX_QUICKACK = 0xf RTAX_REORDERING = 0x9 @@ -1312,6 +1477,33 @@ const ( RTCF_MASQ = 0x400000 RTCF_NAT = 0x800000 RTCF_VALVE = 0x200000 + RTC_AF = 0x20 + RTC_AIE_OFF = 0x20007002 + RTC_AIE_ON = 0x20007001 + RTC_ALM_READ = 0x40247008 + RTC_ALM_SET = 0x80247007 + RTC_EPOCH_READ = 0x4008700d + RTC_EPOCH_SET = 0x8008700e + RTC_IRQF = 0x80 + RTC_IRQP_READ = 0x4008700b + RTC_IRQP_SET = 0x8008700c + RTC_MAX_FREQ = 0x2000 + RTC_PF = 0x40 + RTC_PIE_OFF = 0x20007006 + RTC_PIE_ON = 0x20007005 + RTC_PLL_GET = 0x40207011 + RTC_PLL_SET = 0x80207012 + RTC_RD_TIME = 0x40247009 + RTC_SET_TIME = 0x8024700a + RTC_UF = 0x10 + RTC_UIE_OFF = 0x20007004 + RTC_UIE_ON = 0x20007003 + RTC_VL_CLR = 0x20007014 + RTC_VL_READ = 0x40047013 + RTC_WIE_OFF = 0x20007010 + RTC_WIE_ON = 0x2000700f + RTC_WKALM_RD = 0x40287010 + RTC_WKALM_SET = 0x8028700f RTF_ADDRCLASSMASK = 0xf8000000 RTF_ADDRCONF = 0x40000 RTF_ALLONLINK = 0x20000 @@ -1448,6 +1640,8 @@ const ( SECCOMP_MODE_DISABLED = 0x0 SECCOMP_MODE_FILTER = 0x2 SECCOMP_MODE_STRICT = 0x1 + SECURITYFS_MAGIC = 0x73636673 + SELINUX_MAGIC = 0xf97cff8c SHUT_RD = 0x0 SHUT_RDWR = 0x2 SHUT_WR = 0x1 @@ -1532,6 +1726,23 @@ const ( SIOCSPGRP = 0x80047308 SIOCSRARP = 0x8962 SIOCWANDEV = 0x894a + SMACK_MAGIC = 0x43415d53 + SMART_AUTOSAVE = 0xd2 + SMART_AUTO_OFFLINE = 0xdb + SMART_DISABLE = 0xd9 + SMART_ENABLE = 0xd8 + SMART_HCYL_PASS = 0xc2 + SMART_IMMEDIATE_OFFLINE = 0xd4 + SMART_LCYL_PASS = 0x4f + SMART_READ_LOG_SECTOR = 0xd5 + SMART_READ_THRESHOLDS = 0xd1 + SMART_READ_VALUES = 0xd0 + SMART_SAVE = 0xd3 + SMART_STATUS = 0xda + SMART_WRITE_LOG_SECTOR = 0xd6 + SMART_WRITE_THRESHOLDS = 0xd7 + SMB_SUPER_MAGIC = 0x517b + SOCKFS_MAGIC = 0x534f434b SOCK_CLOEXEC = 0x80000 SOCK_DCCP = 0x6 SOCK_DGRAM = 0x1 @@ -1568,6 +1779,7 @@ const ( SOL_SOCKET = 0xffff SOL_TCP = 0x6 SOL_TIPC = 0x10f + SOL_TLS = 0x11a SOL_X25 = 0x106 SOMAXCONN = 0x80 SO_ACCEPTCONN = 0x1009 @@ -1637,10 +1849,13 @@ const ( SO_VM_SOCKETS_PEER_HOST_VM_ID = 0x3 SO_VM_SOCKETS_TRUSTED = 0x5 SO_WIFI_STATUS = 0x29 + SO_ZEROCOPY = 0x3c SPLICE_F_GIFT = 0x8 SPLICE_F_MORE = 0x4 SPLICE_F_MOVE = 0x1 SPLICE_F_NONBLOCK = 0x2 + SQUASHFS_MAGIC = 0x73717368 + STACK_END_MAGIC = 0x57ac6e9d STATX_ALL = 0xfff STATX_ATIME = 0x20 STATX_ATTR_APPEND = 0x20 @@ -1662,6 +1877,7 @@ const ( STATX_TYPE = 0x1 STATX_UID = 0x8 STATX__RESERVED = 0x80000000 + SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 S_IFBLK = 0x6000 @@ -1732,6 +1948,8 @@ const ( TCP_MAXWIN = 0xffff TCP_MAX_WINSHIFT = 0xe TCP_MD5SIG = 0xe + TCP_MD5SIG_EXT = 0x20 + TCP_MD5SIG_FLAG_PREFIX = 0x1 TCP_MD5SIG_MAXKEYLEN = 0x50 TCP_MSS = 0x200 TCP_MSS_DEFAULT = 0x218 @@ -1752,6 +1970,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa TCSAFLUSH = 0x5410 @@ -1841,7 +2060,27 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 + TPACKET_ALIGNMENT = 0x10 + TPACKET_HDRLEN = 0x34 + TP_STATUS_AVAILABLE = 0x0 + TP_STATUS_BLK_TMO = 0x20 + TP_STATUS_COPY = 0x2 + TP_STATUS_CSUMNOTREADY = 0x8 + TP_STATUS_CSUM_VALID = 0x80 + TP_STATUS_KERNEL = 0x0 + TP_STATUS_LOSING = 0x4 + TP_STATUS_SENDING = 0x2 + TP_STATUS_SEND_REQUEST = 0x1 + TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_SOFTWARE = 0x20000000 + TP_STATUS_TS_SYS_HARDWARE = 0x40000000 + TP_STATUS_USER = 0x1 + TP_STATUS_VLAN_TPID_VALID = 0x40 + TP_STATUS_VLAN_VALID = 0x10 + TP_STATUS_WRONG_FORMAT = 0x4 + TRACEFS_MAGIC = 0x74726163 TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x801054d5 TUNDETACHFILTER = 0x801054d6 @@ -1853,6 +2092,7 @@ const ( TUNGETVNETHDRSZ = 0x400454d7 TUNGETVNETLE = 0x400454dd TUNSETDEBUG = 0x800454c9 + TUNSETFILTEREBPF = 0x400454e1 TUNSETGROUP = 0x800454ce TUNSETIFF = 0x800454ca TUNSETIFINDEX = 0x800454da @@ -1863,13 +2103,17 @@ const ( TUNSETPERSIST = 0x800454cb TUNSETQUEUE = 0x800454d9 TUNSETSNDBUF = 0x800454d4 + TUNSETSTEERINGEBPF = 0x400454e0 TUNSETTXFILTER = 0x800454d1 TUNSETVNETBE = 0x800454de TUNSETVNETHDRSZ = 0x800454d8 TUNSETVNETLE = 0x800454dc + UDF_SUPER_MAGIC = 0x15013346 UMOUNT_NOFOLLOW = 0x8 + USBDEVICE_SUPER_MAGIC = 0x9fa2 UTIME_NOW = 0x3fffffff UTIME_OMIT = 0x3ffffffe + V9FS_MAGIC = 0x1021997 VDISCARD = 0xd VEOF = 0x10 VEOL = 0x11 @@ -1912,6 +2156,86 @@ const ( WDIOC_SETPRETIMEOUT = 0xc0045708 WDIOC_SETTIMEOUT = 0xc0045706 WEXITED = 0x4 + WIN_ACKMEDIACHANGE = 0xdb + WIN_CHECKPOWERMODE1 = 0xe5 + WIN_CHECKPOWERMODE2 = 0x98 + WIN_DEVICE_RESET = 0x8 + WIN_DIAGNOSE = 0x90 + WIN_DOORLOCK = 0xde + WIN_DOORUNLOCK = 0xdf + WIN_DOWNLOAD_MICROCODE = 0x92 + WIN_FLUSH_CACHE = 0xe7 + WIN_FLUSH_CACHE_EXT = 0xea + WIN_FORMAT = 0x50 + WIN_GETMEDIASTATUS = 0xda + WIN_IDENTIFY = 0xec + WIN_IDENTIFY_DMA = 0xee + WIN_IDLEIMMEDIATE = 0xe1 + WIN_INIT = 0x60 + WIN_MEDIAEJECT = 0xed + WIN_MULTREAD = 0xc4 + WIN_MULTREAD_EXT = 0x29 + WIN_MULTWRITE = 0xc5 + WIN_MULTWRITE_EXT = 0x39 + WIN_NOP = 0x0 + WIN_PACKETCMD = 0xa0 + WIN_PIDENTIFY = 0xa1 + WIN_POSTBOOT = 0xdc + WIN_PREBOOT = 0xdd + WIN_QUEUED_SERVICE = 0xa2 + WIN_READ = 0x20 + WIN_READDMA = 0xc8 + WIN_READDMA_EXT = 0x25 + WIN_READDMA_ONCE = 0xc9 + WIN_READDMA_QUEUED = 0xc7 + WIN_READDMA_QUEUED_EXT = 0x26 + WIN_READ_BUFFER = 0xe4 + WIN_READ_EXT = 0x24 + WIN_READ_LONG = 0x22 + WIN_READ_LONG_ONCE = 0x23 + WIN_READ_NATIVE_MAX = 0xf8 + WIN_READ_NATIVE_MAX_EXT = 0x27 + WIN_READ_ONCE = 0x21 + WIN_RECAL = 0x10 + WIN_RESTORE = 0x10 + WIN_SECURITY_DISABLE = 0xf6 + WIN_SECURITY_ERASE_PREPARE = 0xf3 + WIN_SECURITY_ERASE_UNIT = 0xf4 + WIN_SECURITY_FREEZE_LOCK = 0xf5 + WIN_SECURITY_SET_PASS = 0xf1 + WIN_SECURITY_UNLOCK = 0xf2 + WIN_SEEK = 0x70 + WIN_SETFEATURES = 0xef + WIN_SETIDLE1 = 0xe3 + WIN_SETIDLE2 = 0x97 + WIN_SETMULT = 0xc6 + WIN_SET_MAX = 0xf9 + WIN_SET_MAX_EXT = 0x37 + WIN_SLEEPNOW1 = 0xe6 + WIN_SLEEPNOW2 = 0x99 + WIN_SMART = 0xb0 + WIN_SPECIFY = 0x91 + WIN_SRST = 0x8 + WIN_STANDBY = 0xe2 + WIN_STANDBY2 = 0x96 + WIN_STANDBYNOW1 = 0xe0 + WIN_STANDBYNOW2 = 0x94 + WIN_VERIFY = 0x40 + WIN_VERIFY_EXT = 0x42 + WIN_VERIFY_ONCE = 0x41 + WIN_WRITE = 0x30 + WIN_WRITEDMA = 0xca + WIN_WRITEDMA_EXT = 0x35 + WIN_WRITEDMA_ONCE = 0xcb + WIN_WRITEDMA_QUEUED = 0xcc + WIN_WRITEDMA_QUEUED_EXT = 0x36 + WIN_WRITE_BUFFER = 0xe8 + WIN_WRITE_EXT = 0x34 + WIN_WRITE_LONG = 0x32 + WIN_WRITE_LONG_ONCE = 0x33 + WIN_WRITE_ONCE = 0x31 + WIN_WRITE_SAME = 0xe9 + WIN_WRITE_VERIFY = 0x3c WNOHANG = 0x1 WNOTHREAD = 0x20000000 WNOWAIT = 0x1000000 @@ -1921,7 +2245,9 @@ const ( XATTR_CREATE = 0x1 XATTR_REPLACE = 0x2 XCASE = 0x4 + XENFS_SUPER_MAGIC = 0xabba1974 XTABS = 0x1800 + ZSMALLOC_MAGIC = 0x58295829 ) // Errors @@ -2103,174 +2429,182 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "no such device or address", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource temporarily unavailable", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device or resource busy", - 17: "file exists", - 18: "invalid cross-device link", - 19: "no such device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "numerical result out of range", - 35: "no message of desired type", - 36: "identifier removed", - 37: "channel number out of range", - 38: "level 2 not synchronized", - 39: "level 3 halted", - 40: "level 3 reset", - 41: "link number out of range", - 42: "protocol driver not attached", - 43: "no CSI structure available", - 44: "level 2 halted", - 45: "resource deadlock avoided", - 46: "no locks available", - 50: "invalid exchange", - 51: "invalid request descriptor", - 52: "exchange full", - 53: "no anode", - 54: "invalid request code", - 55: "invalid slot", - 56: "file locking deadlock error", - 59: "bad font file format", - 60: "device not a stream", - 61: "no data available", - 62: "timer expired", - 63: "out of streams resources", - 64: "machine is not on the network", - 65: "package not installed", - 66: "object is remote", - 67: "link has been severed", - 68: "advertise error", - 69: "srmount error", - 70: "communication error on send", - 71: "protocol error", - 73: "RFS specific error", - 74: "multihop attempted", - 77: "bad message", - 78: "file name too long", - 79: "value too large for defined data type", - 80: "name not unique on network", - 81: "file descriptor in bad state", - 82: "remote address changed", - 83: "can not access a needed shared library", - 84: "accessing a corrupted shared library", - 85: ".lib section in a.out corrupted", - 86: "attempting to link in too many shared libraries", - 87: "cannot exec a shared library directly", - 88: "invalid or incomplete multibyte or wide character", - 89: "function not implemented", - 90: "too many levels of symbolic links", - 91: "interrupted system call should be restarted", - 92: "streams pipe error", - 93: "directory not empty", - 94: "too many users", - 95: "socket operation on non-socket", - 96: "destination address required", - 97: "message too long", - 98: "protocol wrong type for socket", - 99: "protocol not available", - 120: "protocol not supported", - 121: "socket type not supported", - 122: "operation not supported", - 123: "protocol family not supported", - 124: "address family not supported by protocol", - 125: "address already in use", - 126: "cannot assign requested address", - 127: "network is down", - 128: "network is unreachable", - 129: "network dropped connection on reset", - 130: "software caused connection abort", - 131: "connection reset by peer", - 132: "no buffer space available", - 133: "transport endpoint is already connected", - 134: "transport endpoint is not connected", - 135: "structure needs cleaning", - 137: "not a XENIX named type file", - 138: "no XENIX semaphores available", - 139: "is a named type file", - 140: "remote I/O error", - 141: "unknown error 141", - 142: "unknown error 142", - 143: "cannot send after transport endpoint shutdown", - 144: "too many references: cannot splice", - 145: "connection timed out", - 146: "connection refused", - 147: "host is down", - 148: "no route to host", - 149: "operation already in progress", - 150: "operation now in progress", - 151: "stale file handle", - 158: "operation canceled", - 159: "no medium found", - 160: "wrong medium type", - 161: "required key not available", - 162: "key has expired", - 163: "key has been revoked", - 164: "key was rejected by service", - 165: "owner died", - 166: "state not recoverable", - 167: "operation not possible due to RF-kill", - 168: "memory page has hardware error", - 1133: "disk quota exceeded", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "no such device or address"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EAGAIN", "resource temporarily unavailable"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device or resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "invalid cross-device link"}, + {19, "ENODEV", "no such device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "numerical result out of range"}, + {35, "ENOMSG", "no message of desired type"}, + {36, "EIDRM", "identifier removed"}, + {37, "ECHRNG", "channel number out of range"}, + {38, "EL2NSYNC", "level 2 not synchronized"}, + {39, "EL3HLT", "level 3 halted"}, + {40, "EL3RST", "level 3 reset"}, + {41, "ELNRNG", "link number out of range"}, + {42, "EUNATCH", "protocol driver not attached"}, + {43, "ENOCSI", "no CSI structure available"}, + {44, "EL2HLT", "level 2 halted"}, + {45, "EDEADLK", "resource deadlock avoided"}, + {46, "ENOLCK", "no locks available"}, + {50, "EBADE", "invalid exchange"}, + {51, "EBADR", "invalid request descriptor"}, + {52, "EXFULL", "exchange full"}, + {53, "ENOANO", "no anode"}, + {54, "EBADRQC", "invalid request code"}, + {55, "EBADSLT", "invalid slot"}, + {56, "EDEADLOCK", "file locking deadlock error"}, + {59, "EBFONT", "bad font file format"}, + {60, "ENOSTR", "device not a stream"}, + {61, "ENODATA", "no data available"}, + {62, "ETIME", "timer expired"}, + {63, "ENOSR", "out of streams resources"}, + {64, "ENONET", "machine is not on the network"}, + {65, "ENOPKG", "package not installed"}, + {66, "EREMOTE", "object is remote"}, + {67, "ENOLINK", "link has been severed"}, + {68, "EADV", "advertise error"}, + {69, "ESRMNT", "srmount error"}, + {70, "ECOMM", "communication error on send"}, + {71, "EPROTO", "protocol error"}, + {73, "EDOTDOT", "RFS specific error"}, + {74, "EMULTIHOP", "multihop attempted"}, + {77, "EBADMSG", "bad message"}, + {78, "ENAMETOOLONG", "file name too long"}, + {79, "EOVERFLOW", "value too large for defined data type"}, + {80, "ENOTUNIQ", "name not unique on network"}, + {81, "EBADFD", "file descriptor in bad state"}, + {82, "EREMCHG", "remote address changed"}, + {83, "ELIBACC", "can not access a needed shared library"}, + {84, "ELIBBAD", "accessing a corrupted shared library"}, + {85, "ELIBSCN", ".lib section in a.out corrupted"}, + {86, "ELIBMAX", "attempting to link in too many shared libraries"}, + {87, "ELIBEXEC", "cannot exec a shared library directly"}, + {88, "EILSEQ", "invalid or incomplete multibyte or wide character"}, + {89, "ENOSYS", "function not implemented"}, + {90, "ELOOP", "too many levels of symbolic links"}, + {91, "ERESTART", "interrupted system call should be restarted"}, + {92, "ESTRPIPE", "streams pipe error"}, + {93, "ENOTEMPTY", "directory not empty"}, + {94, "EUSERS", "too many users"}, + {95, "ENOTSOCK", "socket operation on non-socket"}, + {96, "EDESTADDRREQ", "destination address required"}, + {97, "EMSGSIZE", "message too long"}, + {98, "EPROTOTYPE", "protocol wrong type for socket"}, + {99, "ENOPROTOOPT", "protocol not available"}, + {120, "EPROTONOSUPPORT", "protocol not supported"}, + {121, "ESOCKTNOSUPPORT", "socket type not supported"}, + {122, "ENOTSUP", "operation not supported"}, + {123, "EPFNOSUPPORT", "protocol family not supported"}, + {124, "EAFNOSUPPORT", "address family not supported by protocol"}, + {125, "EADDRINUSE", "address already in use"}, + {126, "EADDRNOTAVAIL", "cannot assign requested address"}, + {127, "ENETDOWN", "network is down"}, + {128, "ENETUNREACH", "network is unreachable"}, + {129, "ENETRESET", "network dropped connection on reset"}, + {130, "ECONNABORTED", "software caused connection abort"}, + {131, "ECONNRESET", "connection reset by peer"}, + {132, "ENOBUFS", "no buffer space available"}, + {133, "EISCONN", "transport endpoint is already connected"}, + {134, "ENOTCONN", "transport endpoint is not connected"}, + {135, "EUCLEAN", "structure needs cleaning"}, + {137, "ENOTNAM", "not a XENIX named type file"}, + {138, "ENAVAIL", "no XENIX semaphores available"}, + {139, "EISNAM", "is a named type file"}, + {140, "EREMOTEIO", "remote I/O error"}, + {141, "EINIT", "unknown error 141"}, + {142, "EREMDEV", "unknown error 142"}, + {143, "ESHUTDOWN", "cannot send after transport endpoint shutdown"}, + {144, "ETOOMANYREFS", "too many references: cannot splice"}, + {145, "ETIMEDOUT", "connection timed out"}, + {146, "ECONNREFUSED", "connection refused"}, + {147, "EHOSTDOWN", "host is down"}, + {148, "EHOSTUNREACH", "no route to host"}, + {149, "EALREADY", "operation already in progress"}, + {150, "EINPROGRESS", "operation now in progress"}, + {151, "ESTALE", "stale file handle"}, + {158, "ECANCELED", "operation canceled"}, + {159, "ENOMEDIUM", "no medium found"}, + {160, "EMEDIUMTYPE", "wrong medium type"}, + {161, "ENOKEY", "required key not available"}, + {162, "EKEYEXPIRED", "key has expired"}, + {163, "EKEYREVOKED", "key has been revoked"}, + {164, "EKEYREJECTED", "key was rejected by service"}, + {165, "EOWNERDEAD", "owner died"}, + {166, "ENOTRECOVERABLE", "state not recoverable"}, + {167, "ERFKILL", "operation not possible due to RF-kill"}, + {168, "EHWPOISON", "memory page has hardware error"}, + {1133, "EDQUOT", "disk quota exceeded"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/breakpoint trap", - 6: "aborted", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "user defined signal 1", - 17: "user defined signal 2", - 18: "child exited", - 19: "power failure", - 20: "window changed", - 21: "urgent I/O condition", - 22: "I/O possible", - 23: "stopped (signal)", - 24: "stopped", - 25: "continued", - 26: "stopped (tty input)", - 27: "stopped (tty output)", - 28: "virtual timer expired", - 29: "profiling timer expired", - 30: "CPU time limit exceeded", - 31: "file size limit exceeded", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/breakpoint trap"}, + {6, "SIGABRT", "aborted"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGUSR1", "user defined signal 1"}, + {17, "SIGUSR2", "user defined signal 2"}, + {18, "SIGCHLD", "child exited"}, + {19, "SIGPWR", "power failure"}, + {20, "SIGWINCH", "window changed"}, + {21, "SIGURG", "urgent I/O condition"}, + {22, "SIGIO", "I/O possible"}, + {23, "SIGSTOP", "stopped (signal)"}, + {24, "SIGTSTP", "stopped"}, + {25, "SIGCONT", "continued"}, + {26, "SIGTTIN", "stopped (tty input)"}, + {27, "SIGTTOU", "stopped (tty output)"}, + {28, "SIGVTALRM", "virtual timer expired"}, + {29, "SIGPROF", "profiling timer expired"}, + {30, "SIGXCPU", "CPU time limit exceeded"}, + {31, "SIGXFSZ", "file size limit exceeded"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go index db6d556b2c..1d2f0e6382 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mips64le.go @@ -3,7 +3,7 @@ // +build mips64le,linux -// Created by cgo -godefs - DO NOT EDIT +// Code generated by cmd/cgo -godefs; DO NOT EDIT. // cgo -godefs -- -Wall -Werror -static -I/tmp/include _const.go package unix @@ -11,6 +11,11 @@ package unix import "syscall" const ( + AAFS_MAGIC = 0x5a3c69f0 + ADFS_SUPER_MAGIC = 0xadf5 + AFFS_SUPER_MAGIC = 0xadff + AFS_FS_MAGIC = 0x6b414653 + AFS_SUPER_MAGIC = 0x5346414f AF_ALG = 0x26 AF_APPLETALK = 0x5 AF_ASH = 0x12 @@ -66,6 +71,7 @@ const ( ALG_SET_IV = 0x2 ALG_SET_KEY = 0x1 ALG_SET_OP = 0x3 + ANON_INODE_FS_MAGIC = 0x9041934 ARPHRD_6LOWPAN = 0x339 ARPHRD_ADAPT = 0x108 ARPHRD_APPLETLK = 0x8 @@ -121,6 +127,7 @@ const ( ARPHRD_PPP = 0x200 ARPHRD_PRONET = 0x4 ARPHRD_RAWHDLC = 0x206 + ARPHRD_RAWIP = 0x207 ARPHRD_ROSE = 0x10e ARPHRD_RSRVD = 0x104 ARPHRD_SIT = 0x308 @@ -132,6 +139,7 @@ const ( ARPHRD_VOID = 0xffff ARPHRD_VSOCKMON = 0x33a ARPHRD_X25 = 0x10f + AUTOFS_SUPER_MAGIC = 0x187 B0 = 0x0 B1000000 = 0x1008 B110 = 0x3 @@ -163,6 +171,9 @@ const ( B75 = 0x2 B921600 = 0x1007 B9600 = 0xd + BALLOON_KVM_MAGIC = 0x13661366 + BDEVFS_MAGIC = 0x62646576 + BINFMTFS_MAGIC = 0x42494e4d BLKBSZGET = 0x40081270 BLKBSZSET = 0x80081271 BLKFLSBUF = 0x20001261 @@ -187,6 +198,7 @@ const ( BPF_AND = 0x50 BPF_B = 0x10 BPF_DIV = 0x30 + BPF_FS_MAGIC = 0xcafe4a11 BPF_H = 0x8 BPF_IMM = 0x0 BPF_IND = 0x40 @@ -228,6 +240,8 @@ const ( BS0 = 0x0 BS1 = 0x2000 BSDLY = 0x2000 + BTRFS_SUPER_MAGIC = 0x9123683e + BTRFS_TEST_MAGIC = 0x73727279 CAN_BCM = 0x2 CAN_EFF_FLAG = 0x80000000 CAN_EFF_ID_BITS = 0x1d @@ -251,6 +265,8 @@ const ( CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf + CGROUP2_SUPER_MAGIC = 0x63677270 + CGROUP_SUPER_MAGIC = 0x27e0eb CIBAUD = 0x100f0000 CLOCAL = 0x800 CLOCK_BOOTTIME = 0x7 @@ -293,10 +309,12 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CMSPAR = 0x40000000 + CODA_SUPER_MAGIC = 0x73757245 CR0 = 0x0 CR1 = 0x200 CR2 = 0x400 CR3 = 0x600 + CRAMFS_MAGIC = 0x28cd3d45 CRDLY = 0x600 CREAD = 0x80 CRTSCTS = 0x80000000 @@ -311,6 +329,9 @@ const ( CSTOP = 0x13 CSTOPB = 0x40 CSUSP = 0x1a + DAXFS_MAGIC = 0x64646178 + DEBUGFS_MAGIC = 0x64626720 + DEVPTS_SUPER_MAGIC = 0x1cd1 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -327,9 +348,12 @@ const ( ECHOKE = 0x800 ECHONL = 0x40 ECHOPRT = 0x400 + ECRYPTFS_SUPER_MAGIC = 0xf15f EFD_CLOEXEC = 0x80000 EFD_NONBLOCK = 0x80 EFD_SEMAPHORE = 0x1 + EFIVARFS_MAGIC = 0xde5e81e4 + EFS_SUPER_MAGIC = 0x414a53 ENCODING_DEFAULT = 0x0 ENCODING_FM_MARK = 0x3 ENCODING_FM_SPACE = 0x4 @@ -390,6 +414,8 @@ const ( ETH_P_DSA = 0x1b ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada + ETH_P_ERSPAN = 0x88be + ETH_P_ERSPAN2 = 0x22eb ETH_P_FCOE = 0x8906 ETH_P_FIP = 0x8914 ETH_P_HDLC = 0x19 @@ -398,6 +424,7 @@ const ( ETH_P_IEEE802154 = 0xf6 ETH_P_IEEEPUP = 0xa00 ETH_P_IEEEPUPAT = 0xa01 + ETH_P_IFE = 0xed3e ETH_P_IP = 0x800 ETH_P_IPV6 = 0x86dd ETH_P_IPX = 0x8137 @@ -408,11 +435,13 @@ const ( ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 ETH_P_MACSEC = 0x88e5 + ETH_P_MAP = 0xf9 ETH_P_MOBITEX = 0x15 ETH_P_MPLS_MC = 0x8848 ETH_P_MPLS_UC = 0x8847 ETH_P_MVRP = 0x88f5 ETH_P_NCSI = 0x88f8 + ETH_P_NSH = 0x894f ETH_P_PAE = 0x888e ETH_P_PAUSE = 0x8808 ETH_P_PHONET = 0xf5 @@ -420,6 +449,7 @@ const ( ETH_P_PPP_DISC = 0x8863 ETH_P_PPP_MP = 0x8 ETH_P_PPP_SES = 0x8864 + ETH_P_PREAUTH = 0x88c7 ETH_P_PRP = 0x88fb ETH_P_PUP = 0x200 ETH_P_PUPAT = 0x201 @@ -440,9 +470,14 @@ const ( ETH_P_WCCP = 0x883e ETH_P_X25 = 0x805 ETH_P_XDSA = 0xf8 + EXABYTE_ENABLE_NEST = 0xf0 + EXT2_SUPER_MAGIC = 0xef53 + EXT3_SUPER_MAGIC = 0xef53 + EXT4_SUPER_MAGIC = 0xef53 EXTA = 0xe EXTB = 0xf EXTPROC = 0x10000 + F2FS_SUPER_MAGIC = 0xf2f52010 FALLOC_FL_COLLAPSE_RANGE = 0x8 FALLOC_FL_INSERT_RANGE = 0x20 FALLOC_FL_KEEP_SIZE = 0x1 @@ -476,6 +511,8 @@ const ( FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 FS_POLICY_FLAGS_VALID = 0x3 + FUTEXFS_SUPER_MAGIC = 0xbad1dea + F_ADD_SEALS = 0x409 F_DUPFD = 0x0 F_DUPFD_CLOEXEC = 0x406 F_EXLCK = 0x4 @@ -488,6 +525,9 @@ const ( F_GETOWN_EX = 0x10 F_GETPIPE_SZ = 0x408 F_GETSIG = 0xb + F_GET_FILE_RW_HINT = 0x40d + F_GET_RW_HINT = 0x40b + F_GET_SEALS = 0x40a F_LOCK = 0x1 F_NOTIFY = 0x402 F_OFD_GETLK = 0x24 @@ -495,6 +535,10 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_GROW = 0x4 + F_SEAL_SEAL = 0x1 + F_SEAL_SHRINK = 0x2 + F_SEAL_WRITE = 0x8 F_SETFD = 0x2 F_SETFL = 0x4 F_SETLEASE = 0x400 @@ -506,6 +550,8 @@ const ( F_SETOWN_EX = 0xf F_SETPIPE_SZ = 0x407 F_SETSIG = 0xa + F_SET_FILE_RW_HINT = 0x40e + F_SET_RW_HINT = 0x40c F_SHLCK = 0x8 F_TEST = 0x3 F_TLOCK = 0x2 @@ -527,6 +573,49 @@ const ( GENL_UNS_ADMIN_PERM = 0x10 GRND_NONBLOCK = 0x1 GRND_RANDOM = 0x2 + HDIO_DRIVE_CMD = 0x31f + HDIO_DRIVE_CMD_AEB = 0x31e + HDIO_DRIVE_CMD_HDR_SIZE = 0x4 + HDIO_DRIVE_HOB_HDR_SIZE = 0x8 + HDIO_DRIVE_RESET = 0x31c + HDIO_DRIVE_TASK = 0x31e + HDIO_DRIVE_TASKFILE = 0x31d + HDIO_DRIVE_TASK_HDR_SIZE = 0x8 + HDIO_GETGEO = 0x301 + HDIO_GET_32BIT = 0x309 + HDIO_GET_ACOUSTIC = 0x30f + HDIO_GET_ADDRESS = 0x310 + HDIO_GET_BUSSTATE = 0x31a + HDIO_GET_DMA = 0x30b + HDIO_GET_IDENTITY = 0x30d + HDIO_GET_KEEPSETTINGS = 0x308 + HDIO_GET_MULTCOUNT = 0x304 + HDIO_GET_NICE = 0x30c + HDIO_GET_NOWERR = 0x30a + HDIO_GET_QDMA = 0x305 + HDIO_GET_UNMASKINTR = 0x302 + HDIO_GET_WCACHE = 0x30e + HDIO_OBSOLETE_IDENTITY = 0x307 + HDIO_SCAN_HWIF = 0x328 + HDIO_SET_32BIT = 0x324 + HDIO_SET_ACOUSTIC = 0x32c + HDIO_SET_ADDRESS = 0x32f + HDIO_SET_BUSSTATE = 0x32d + HDIO_SET_DMA = 0x326 + HDIO_SET_KEEPSETTINGS = 0x323 + HDIO_SET_MULTCOUNT = 0x321 + HDIO_SET_NICE = 0x329 + HDIO_SET_NOWERR = 0x325 + HDIO_SET_PIO_MODE = 0x327 + HDIO_SET_QDMA = 0x32e + HDIO_SET_UNMASKINTR = 0x322 + HDIO_SET_WCACHE = 0x32b + HDIO_SET_XFER = 0x306 + HDIO_TRISTATE_HWIF = 0x31b + HDIO_UNREGISTER_HWIF = 0x32a + HOSTFS_SUPER_MAGIC = 0xc0ffee + HPFS_SUPER_MAGIC = 0xf995e849 + HUGETLBFS_MAGIC = 0x958458f6 HUPCL = 0x400 IBSHIFT = 0x10 ICANON = 0x2 @@ -561,6 +650,8 @@ const ( IFF_MASTER = 0x400 IFF_MULTICAST = 0x1000 IFF_MULTI_QUEUE = 0x100 + IFF_NAPI = 0x10 + IFF_NAPI_FRAGS = 0x20 IFF_NOARP = 0x80 IFF_NOFILTER = 0x1000 IFF_NOTRAILERS = 0x20 @@ -775,12 +866,14 @@ const ( IP_UNICAST_IF = 0x32 IP_XFRM_POLICY = 0x11 ISIG = 0x1 + ISOFS_SUPER_MAGIC = 0x9660 ISTRIP = 0x20 IUCLC = 0x200 IUTF8 = 0x4000 IXANY = 0x800 IXOFF = 0x1000 IXON = 0x400 + JFFS2_SUPER_MAGIC = 0x72b6 KEYCTL_ASSUME_AUTHORITY = 0x10 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 @@ -845,6 +938,7 @@ const ( MADV_FREE = 0x8 MADV_HUGEPAGE = 0xe MADV_HWPOISON = 0x64 + MADV_KEEPONFORK = 0x13 MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 @@ -853,6 +947,7 @@ const ( MADV_SEQUENTIAL = 0x2 MADV_UNMERGEABLE = 0xd MADV_WILLNEED = 0x3 + MADV_WIPEONFORK = 0x12 MAP_ANON = 0x800 MAP_ANONYMOUS = 0x800 MAP_DENYWRITE = 0x2000 @@ -875,9 +970,15 @@ const ( MCL_CURRENT = 0x1 MCL_FUTURE = 0x2 MCL_ONFAULT = 0x4 + MINIX2_SUPER_MAGIC = 0x2468 + MINIX2_SUPER_MAGIC2 = 0x2478 + MINIX3_SUPER_MAGIC = 0x4d5a + MINIX_SUPER_MAGIC = 0x137f + MINIX_SUPER_MAGIC2 = 0x138f MNT_DETACH = 0x2 MNT_EXPIRE = 0x4 MNT_FORCE = 0x1 + MSDOS_SUPER_MAGIC = 0x4d44 MSG_BATCH = 0x40000 MSG_CMSG_CLOEXEC = 0x40000000 MSG_CONFIRM = 0x800 @@ -899,6 +1000,7 @@ const ( MSG_TRYHARD = 0x4 MSG_WAITALL = 0x100 MSG_WAITFORONE = 0x10000 + MSG_ZEROCOPY = 0x4000000 MS_ACTIVE = 0x40000000 MS_ASYNC = 0x1 MS_BIND = 0x1000 @@ -936,7 +1038,9 @@ const ( MS_SYNCHRONOUS = 0x10 MS_UNBINDABLE = 0x20000 MS_VERBOSE = 0x8000 + MTD_INODE_FS_MAGIC = 0x11307854 NAME_MAX = 0xff + NCP_SUPER_MAGIC = 0x564c NETLINK_ADD_MEMBERSHIP = 0x1 NETLINK_AUDIT = 0x9 NETLINK_BROADCAST_ERROR = 0x4 @@ -971,6 +1075,37 @@ const ( NETLINK_UNUSED = 0x1 NETLINK_USERSOCK = 0x2 NETLINK_XFRM = 0x6 + NFNETLINK_V0 = 0x0 + NFNLGRP_ACCT_QUOTA = 0x8 + NFNLGRP_CONNTRACK_DESTROY = 0x3 + NFNLGRP_CONNTRACK_EXP_DESTROY = 0x6 + NFNLGRP_CONNTRACK_EXP_NEW = 0x4 + NFNLGRP_CONNTRACK_EXP_UPDATE = 0x5 + NFNLGRP_CONNTRACK_NEW = 0x1 + NFNLGRP_CONNTRACK_UPDATE = 0x2 + NFNLGRP_MAX = 0x9 + NFNLGRP_NFTABLES = 0x7 + NFNLGRP_NFTRACE = 0x9 + NFNLGRP_NONE = 0x0 + NFNL_BATCH_MAX = 0x1 + NFNL_MSG_BATCH_BEGIN = 0x10 + NFNL_MSG_BATCH_END = 0x11 + NFNL_NFA_NEST = 0x8000 + NFNL_SUBSYS_ACCT = 0x7 + NFNL_SUBSYS_COUNT = 0xc + NFNL_SUBSYS_CTHELPER = 0x9 + NFNL_SUBSYS_CTNETLINK = 0x1 + NFNL_SUBSYS_CTNETLINK_EXP = 0x2 + NFNL_SUBSYS_CTNETLINK_TIMEOUT = 0x8 + NFNL_SUBSYS_IPSET = 0x6 + NFNL_SUBSYS_NFTABLES = 0xa + NFNL_SUBSYS_NFT_COMPAT = 0xb + NFNL_SUBSYS_NONE = 0x0 + NFNL_SUBSYS_OSF = 0x5 + NFNL_SUBSYS_QUEUE = 0x3 + NFNL_SUBSYS_ULOG = 0x4 + NFS_SUPER_MAGIC = 0x6969 + NILFS_SUPER_MAGIC = 0x3434 NL0 = 0x0 NL1 = 0x100 NLA_ALIGNTO = 0x4 @@ -998,10 +1133,13 @@ const ( NLM_F_EXCL = 0x200 NLM_F_MATCH = 0x200 NLM_F_MULTI = 0x2 + NLM_F_NONREC = 0x100 NLM_F_REPLACE = 0x100 NLM_F_REQUEST = 0x1 NLM_F_ROOT = 0x100 NOFLSH = 0x80 + NSFS_MAGIC = 0x6e736673 + OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 OFILL = 0x40 @@ -1009,7 +1147,9 @@ const ( ONLCR = 0x4 ONLRET = 0x20 ONOCR = 0x10 + OPENPROM_SUPER_MAGIC = 0x9fa1 OPOST = 0x1 + OVERLAYFS_SUPER_MAGIC = 0x794c7630 O_ACCMODE = 0x3 O_APPEND = 0x8 O_ASYNC = 0x1000 @@ -1094,16 +1234,20 @@ const ( PERF_EVENT_IOC_DISABLE = 0x20002401 PERF_EVENT_IOC_ENABLE = 0x20002400 PERF_EVENT_IOC_ID = 0x40082407 + PERF_EVENT_IOC_MODIFY_ATTRIBUTES = 0x8008240b PERF_EVENT_IOC_PAUSE_OUTPUT = 0x80042409 PERF_EVENT_IOC_PERIOD = 0x80082404 + PERF_EVENT_IOC_QUERY_BPF = 0xc008240a PERF_EVENT_IOC_REFRESH = 0x20002402 PERF_EVENT_IOC_RESET = 0x20002403 PERF_EVENT_IOC_SET_BPF = 0x80042408 PERF_EVENT_IOC_SET_FILTER = 0x80082406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 + PIPEFS_MAGIC = 0x50495045 PRIO_PGRP = 0x1 PRIO_PROCESS = 0x0 PRIO_USER = 0x2 + PROC_SUPER_MAGIC = 0x9fa0 PROT_EXEC = 0x4 PROT_GROWSDOWN = 0x1000000 PROT_GROWSUP = 0x2000000 @@ -1146,6 +1290,7 @@ const ( PR_GET_PDEATHSIG = 0x2 PR_GET_SECCOMP = 0x15 PR_GET_SECUREBITS = 0x1b + PR_GET_SPECULATION_CTRL = 0x34 PR_GET_THP_DISABLE = 0x2a PR_GET_TID_ADDRESS = 0x28 PR_GET_TIMERSLACK = 0x1e @@ -1191,11 +1336,23 @@ const ( PR_SET_PTRACER_ANY = 0xffffffffffffffff PR_SET_SECCOMP = 0x16 PR_SET_SECUREBITS = 0x1c + PR_SET_SPECULATION_CTRL = 0x35 PR_SET_THP_DISABLE = 0x29 PR_SET_TIMERSLACK = 0x1d PR_SET_TIMING = 0xe PR_SET_TSC = 0x1a PR_SET_UNALIGN = 0x6 + PR_SPEC_DISABLE = 0x4 + PR_SPEC_ENABLE = 0x2 + PR_SPEC_FORCE_DISABLE = 0x8 + PR_SPEC_NOT_AFFECTED = 0x0 + PR_SPEC_PRCTL = 0x1 + PR_SPEC_STORE_BYPASS = 0x0 + PR_SVE_GET_VL = 0x33 + PR_SVE_SET_VL = 0x32 + PR_SVE_SET_VL_ONEXEC = 0x40000 + PR_SVE_VL_INHERIT = 0x20000 + PR_SVE_VL_LEN_MASK = 0xffff PR_TASK_PERF_EVENTS_DISABLE = 0x1f PR_TASK_PERF_EVENTS_ENABLE = 0x20 PR_TIMING_STATISTICAL = 0x0 @@ -1204,6 +1361,7 @@ const ( PR_TSC_SIGSEGV = 0x2 PR_UNALIGN_NOPRINT = 0x1 PR_UNALIGN_SIGBUS = 0x2 + PSTOREFS_MAGIC = 0x6165676c PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 @@ -1252,6 +1410,7 @@ const ( PTRACE_POKETEXT_3264 = 0xc2 PTRACE_POKEUSR = 0x6 PTRACE_SECCOMP_GET_FILTER = 0x420c + PTRACE_SECCOMP_GET_METADATA = 0x420d PTRACE_SEIZE = 0x4206 PTRACE_SETFPREGS = 0xf PTRACE_SETOPTIONS = 0x4200 @@ -1264,6 +1423,11 @@ const ( PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 PTRACE_TRACEME = 0x0 + QNX4_SUPER_MAGIC = 0x2f + QNX6_SUPER_MAGIC = 0x68191122 + RAMFS_MAGIC = 0x858458f6 + RDTGROUP_SUPER_MAGIC = 0x7655821 + REISERFS_SUPER_MAGIC = 0x52654973 RLIMIT_AS = 0x6 RLIMIT_CORE = 0x4 RLIMIT_CPU = 0x0 @@ -1284,6 +1448,7 @@ const ( RTAX_ADVMSS = 0x8 RTAX_CC_ALGO = 0x10 RTAX_CWND = 0x7 + RTAX_FASTOPEN_NO_COOKIE = 0x11 RTAX_FEATURES = 0xc RTAX_FEATURE_ALLFRAG = 0x8 RTAX_FEATURE_ECN = 0x1 @@ -1294,7 +1459,7 @@ const ( RTAX_INITCWND = 0xb RTAX_INITRWND = 0xe RTAX_LOCK = 0x1 - RTAX_MAX = 0x10 + RTAX_MAX = 0x11 RTAX_MTU = 0x2 RTAX_QUICKACK = 0xf RTAX_REORDERING = 0x9 @@ -1312,6 +1477,33 @@ const ( RTCF_MASQ = 0x400000 RTCF_NAT = 0x800000 RTCF_VALVE = 0x200000 + RTC_AF = 0x20 + RTC_AIE_OFF = 0x20007002 + RTC_AIE_ON = 0x20007001 + RTC_ALM_READ = 0x40247008 + RTC_ALM_SET = 0x80247007 + RTC_EPOCH_READ = 0x4008700d + RTC_EPOCH_SET = 0x8008700e + RTC_IRQF = 0x80 + RTC_IRQP_READ = 0x4008700b + RTC_IRQP_SET = 0x8008700c + RTC_MAX_FREQ = 0x2000 + RTC_PF = 0x40 + RTC_PIE_OFF = 0x20007006 + RTC_PIE_ON = 0x20007005 + RTC_PLL_GET = 0x40207011 + RTC_PLL_SET = 0x80207012 + RTC_RD_TIME = 0x40247009 + RTC_SET_TIME = 0x8024700a + RTC_UF = 0x10 + RTC_UIE_OFF = 0x20007004 + RTC_UIE_ON = 0x20007003 + RTC_VL_CLR = 0x20007014 + RTC_VL_READ = 0x40047013 + RTC_WIE_OFF = 0x20007010 + RTC_WIE_ON = 0x2000700f + RTC_WKALM_RD = 0x40287010 + RTC_WKALM_SET = 0x8028700f RTF_ADDRCLASSMASK = 0xf8000000 RTF_ADDRCONF = 0x40000 RTF_ALLONLINK = 0x20000 @@ -1448,6 +1640,8 @@ const ( SECCOMP_MODE_DISABLED = 0x0 SECCOMP_MODE_FILTER = 0x2 SECCOMP_MODE_STRICT = 0x1 + SECURITYFS_MAGIC = 0x73636673 + SELINUX_MAGIC = 0xf97cff8c SHUT_RD = 0x0 SHUT_RDWR = 0x2 SHUT_WR = 0x1 @@ -1532,6 +1726,23 @@ const ( SIOCSPGRP = 0x80047308 SIOCSRARP = 0x8962 SIOCWANDEV = 0x894a + SMACK_MAGIC = 0x43415d53 + SMART_AUTOSAVE = 0xd2 + SMART_AUTO_OFFLINE = 0xdb + SMART_DISABLE = 0xd9 + SMART_ENABLE = 0xd8 + SMART_HCYL_PASS = 0xc2 + SMART_IMMEDIATE_OFFLINE = 0xd4 + SMART_LCYL_PASS = 0x4f + SMART_READ_LOG_SECTOR = 0xd5 + SMART_READ_THRESHOLDS = 0xd1 + SMART_READ_VALUES = 0xd0 + SMART_SAVE = 0xd3 + SMART_STATUS = 0xda + SMART_WRITE_LOG_SECTOR = 0xd6 + SMART_WRITE_THRESHOLDS = 0xd7 + SMB_SUPER_MAGIC = 0x517b + SOCKFS_MAGIC = 0x534f434b SOCK_CLOEXEC = 0x80000 SOCK_DCCP = 0x6 SOCK_DGRAM = 0x1 @@ -1568,6 +1779,7 @@ const ( SOL_SOCKET = 0xffff SOL_TCP = 0x6 SOL_TIPC = 0x10f + SOL_TLS = 0x11a SOL_X25 = 0x106 SOMAXCONN = 0x80 SO_ACCEPTCONN = 0x1009 @@ -1637,10 +1849,13 @@ const ( SO_VM_SOCKETS_PEER_HOST_VM_ID = 0x3 SO_VM_SOCKETS_TRUSTED = 0x5 SO_WIFI_STATUS = 0x29 + SO_ZEROCOPY = 0x3c SPLICE_F_GIFT = 0x8 SPLICE_F_MORE = 0x4 SPLICE_F_MOVE = 0x1 SPLICE_F_NONBLOCK = 0x2 + SQUASHFS_MAGIC = 0x73717368 + STACK_END_MAGIC = 0x57ac6e9d STATX_ALL = 0xfff STATX_ATIME = 0x20 STATX_ATTR_APPEND = 0x20 @@ -1662,6 +1877,7 @@ const ( STATX_TYPE = 0x1 STATX_UID = 0x8 STATX__RESERVED = 0x80000000 + SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 S_IFBLK = 0x6000 @@ -1732,6 +1948,8 @@ const ( TCP_MAXWIN = 0xffff TCP_MAX_WINSHIFT = 0xe TCP_MD5SIG = 0xe + TCP_MD5SIG_EXT = 0x20 + TCP_MD5SIG_FLAG_PREFIX = 0x1 TCP_MD5SIG_MAXKEYLEN = 0x50 TCP_MSS = 0x200 TCP_MSS_DEFAULT = 0x218 @@ -1752,6 +1970,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa TCSAFLUSH = 0x5410 @@ -1841,7 +2060,27 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 + TPACKET_ALIGNMENT = 0x10 + TPACKET_HDRLEN = 0x34 + TP_STATUS_AVAILABLE = 0x0 + TP_STATUS_BLK_TMO = 0x20 + TP_STATUS_COPY = 0x2 + TP_STATUS_CSUMNOTREADY = 0x8 + TP_STATUS_CSUM_VALID = 0x80 + TP_STATUS_KERNEL = 0x0 + TP_STATUS_LOSING = 0x4 + TP_STATUS_SENDING = 0x2 + TP_STATUS_SEND_REQUEST = 0x1 + TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_SOFTWARE = 0x20000000 + TP_STATUS_TS_SYS_HARDWARE = 0x40000000 + TP_STATUS_USER = 0x1 + TP_STATUS_VLAN_TPID_VALID = 0x40 + TP_STATUS_VLAN_VALID = 0x10 + TP_STATUS_WRONG_FORMAT = 0x4 + TRACEFS_MAGIC = 0x74726163 TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x801054d5 TUNDETACHFILTER = 0x801054d6 @@ -1853,6 +2092,7 @@ const ( TUNGETVNETHDRSZ = 0x400454d7 TUNGETVNETLE = 0x400454dd TUNSETDEBUG = 0x800454c9 + TUNSETFILTEREBPF = 0x400454e1 TUNSETGROUP = 0x800454ce TUNSETIFF = 0x800454ca TUNSETIFINDEX = 0x800454da @@ -1863,13 +2103,17 @@ const ( TUNSETPERSIST = 0x800454cb TUNSETQUEUE = 0x800454d9 TUNSETSNDBUF = 0x800454d4 + TUNSETSTEERINGEBPF = 0x400454e0 TUNSETTXFILTER = 0x800454d1 TUNSETVNETBE = 0x800454de TUNSETVNETHDRSZ = 0x800454d8 TUNSETVNETLE = 0x800454dc + UDF_SUPER_MAGIC = 0x15013346 UMOUNT_NOFOLLOW = 0x8 + USBDEVICE_SUPER_MAGIC = 0x9fa2 UTIME_NOW = 0x3fffffff UTIME_OMIT = 0x3ffffffe + V9FS_MAGIC = 0x1021997 VDISCARD = 0xd VEOF = 0x10 VEOL = 0x11 @@ -1912,6 +2156,86 @@ const ( WDIOC_SETPRETIMEOUT = 0xc0045708 WDIOC_SETTIMEOUT = 0xc0045706 WEXITED = 0x4 + WIN_ACKMEDIACHANGE = 0xdb + WIN_CHECKPOWERMODE1 = 0xe5 + WIN_CHECKPOWERMODE2 = 0x98 + WIN_DEVICE_RESET = 0x8 + WIN_DIAGNOSE = 0x90 + WIN_DOORLOCK = 0xde + WIN_DOORUNLOCK = 0xdf + WIN_DOWNLOAD_MICROCODE = 0x92 + WIN_FLUSH_CACHE = 0xe7 + WIN_FLUSH_CACHE_EXT = 0xea + WIN_FORMAT = 0x50 + WIN_GETMEDIASTATUS = 0xda + WIN_IDENTIFY = 0xec + WIN_IDENTIFY_DMA = 0xee + WIN_IDLEIMMEDIATE = 0xe1 + WIN_INIT = 0x60 + WIN_MEDIAEJECT = 0xed + WIN_MULTREAD = 0xc4 + WIN_MULTREAD_EXT = 0x29 + WIN_MULTWRITE = 0xc5 + WIN_MULTWRITE_EXT = 0x39 + WIN_NOP = 0x0 + WIN_PACKETCMD = 0xa0 + WIN_PIDENTIFY = 0xa1 + WIN_POSTBOOT = 0xdc + WIN_PREBOOT = 0xdd + WIN_QUEUED_SERVICE = 0xa2 + WIN_READ = 0x20 + WIN_READDMA = 0xc8 + WIN_READDMA_EXT = 0x25 + WIN_READDMA_ONCE = 0xc9 + WIN_READDMA_QUEUED = 0xc7 + WIN_READDMA_QUEUED_EXT = 0x26 + WIN_READ_BUFFER = 0xe4 + WIN_READ_EXT = 0x24 + WIN_READ_LONG = 0x22 + WIN_READ_LONG_ONCE = 0x23 + WIN_READ_NATIVE_MAX = 0xf8 + WIN_READ_NATIVE_MAX_EXT = 0x27 + WIN_READ_ONCE = 0x21 + WIN_RECAL = 0x10 + WIN_RESTORE = 0x10 + WIN_SECURITY_DISABLE = 0xf6 + WIN_SECURITY_ERASE_PREPARE = 0xf3 + WIN_SECURITY_ERASE_UNIT = 0xf4 + WIN_SECURITY_FREEZE_LOCK = 0xf5 + WIN_SECURITY_SET_PASS = 0xf1 + WIN_SECURITY_UNLOCK = 0xf2 + WIN_SEEK = 0x70 + WIN_SETFEATURES = 0xef + WIN_SETIDLE1 = 0xe3 + WIN_SETIDLE2 = 0x97 + WIN_SETMULT = 0xc6 + WIN_SET_MAX = 0xf9 + WIN_SET_MAX_EXT = 0x37 + WIN_SLEEPNOW1 = 0xe6 + WIN_SLEEPNOW2 = 0x99 + WIN_SMART = 0xb0 + WIN_SPECIFY = 0x91 + WIN_SRST = 0x8 + WIN_STANDBY = 0xe2 + WIN_STANDBY2 = 0x96 + WIN_STANDBYNOW1 = 0xe0 + WIN_STANDBYNOW2 = 0x94 + WIN_VERIFY = 0x40 + WIN_VERIFY_EXT = 0x42 + WIN_VERIFY_ONCE = 0x41 + WIN_WRITE = 0x30 + WIN_WRITEDMA = 0xca + WIN_WRITEDMA_EXT = 0x35 + WIN_WRITEDMA_ONCE = 0xcb + WIN_WRITEDMA_QUEUED = 0xcc + WIN_WRITEDMA_QUEUED_EXT = 0x36 + WIN_WRITE_BUFFER = 0xe8 + WIN_WRITE_EXT = 0x34 + WIN_WRITE_LONG = 0x32 + WIN_WRITE_LONG_ONCE = 0x33 + WIN_WRITE_ONCE = 0x31 + WIN_WRITE_SAME = 0xe9 + WIN_WRITE_VERIFY = 0x3c WNOHANG = 0x1 WNOTHREAD = 0x20000000 WNOWAIT = 0x1000000 @@ -1921,7 +2245,9 @@ const ( XATTR_CREATE = 0x1 XATTR_REPLACE = 0x2 XCASE = 0x4 + XENFS_SUPER_MAGIC = 0xabba1974 XTABS = 0x1800 + ZSMALLOC_MAGIC = 0x58295829 ) // Errors @@ -2103,174 +2429,182 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "no such device or address", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource temporarily unavailable", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device or resource busy", - 17: "file exists", - 18: "invalid cross-device link", - 19: "no such device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "numerical result out of range", - 35: "no message of desired type", - 36: "identifier removed", - 37: "channel number out of range", - 38: "level 2 not synchronized", - 39: "level 3 halted", - 40: "level 3 reset", - 41: "link number out of range", - 42: "protocol driver not attached", - 43: "no CSI structure available", - 44: "level 2 halted", - 45: "resource deadlock avoided", - 46: "no locks available", - 50: "invalid exchange", - 51: "invalid request descriptor", - 52: "exchange full", - 53: "no anode", - 54: "invalid request code", - 55: "invalid slot", - 56: "file locking deadlock error", - 59: "bad font file format", - 60: "device not a stream", - 61: "no data available", - 62: "timer expired", - 63: "out of streams resources", - 64: "machine is not on the network", - 65: "package not installed", - 66: "object is remote", - 67: "link has been severed", - 68: "advertise error", - 69: "srmount error", - 70: "communication error on send", - 71: "protocol error", - 73: "RFS specific error", - 74: "multihop attempted", - 77: "bad message", - 78: "file name too long", - 79: "value too large for defined data type", - 80: "name not unique on network", - 81: "file descriptor in bad state", - 82: "remote address changed", - 83: "can not access a needed shared library", - 84: "accessing a corrupted shared library", - 85: ".lib section in a.out corrupted", - 86: "attempting to link in too many shared libraries", - 87: "cannot exec a shared library directly", - 88: "invalid or incomplete multibyte or wide character", - 89: "function not implemented", - 90: "too many levels of symbolic links", - 91: "interrupted system call should be restarted", - 92: "streams pipe error", - 93: "directory not empty", - 94: "too many users", - 95: "socket operation on non-socket", - 96: "destination address required", - 97: "message too long", - 98: "protocol wrong type for socket", - 99: "protocol not available", - 120: "protocol not supported", - 121: "socket type not supported", - 122: "operation not supported", - 123: "protocol family not supported", - 124: "address family not supported by protocol", - 125: "address already in use", - 126: "cannot assign requested address", - 127: "network is down", - 128: "network is unreachable", - 129: "network dropped connection on reset", - 130: "software caused connection abort", - 131: "connection reset by peer", - 132: "no buffer space available", - 133: "transport endpoint is already connected", - 134: "transport endpoint is not connected", - 135: "structure needs cleaning", - 137: "not a XENIX named type file", - 138: "no XENIX semaphores available", - 139: "is a named type file", - 140: "remote I/O error", - 141: "unknown error 141", - 142: "unknown error 142", - 143: "cannot send after transport endpoint shutdown", - 144: "too many references: cannot splice", - 145: "connection timed out", - 146: "connection refused", - 147: "host is down", - 148: "no route to host", - 149: "operation already in progress", - 150: "operation now in progress", - 151: "stale file handle", - 158: "operation canceled", - 159: "no medium found", - 160: "wrong medium type", - 161: "required key not available", - 162: "key has expired", - 163: "key has been revoked", - 164: "key was rejected by service", - 165: "owner died", - 166: "state not recoverable", - 167: "operation not possible due to RF-kill", - 168: "memory page has hardware error", - 1133: "disk quota exceeded", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "no such device or address"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EAGAIN", "resource temporarily unavailable"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device or resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "invalid cross-device link"}, + {19, "ENODEV", "no such device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "numerical result out of range"}, + {35, "ENOMSG", "no message of desired type"}, + {36, "EIDRM", "identifier removed"}, + {37, "ECHRNG", "channel number out of range"}, + {38, "EL2NSYNC", "level 2 not synchronized"}, + {39, "EL3HLT", "level 3 halted"}, + {40, "EL3RST", "level 3 reset"}, + {41, "ELNRNG", "link number out of range"}, + {42, "EUNATCH", "protocol driver not attached"}, + {43, "ENOCSI", "no CSI structure available"}, + {44, "EL2HLT", "level 2 halted"}, + {45, "EDEADLK", "resource deadlock avoided"}, + {46, "ENOLCK", "no locks available"}, + {50, "EBADE", "invalid exchange"}, + {51, "EBADR", "invalid request descriptor"}, + {52, "EXFULL", "exchange full"}, + {53, "ENOANO", "no anode"}, + {54, "EBADRQC", "invalid request code"}, + {55, "EBADSLT", "invalid slot"}, + {56, "EDEADLOCK", "file locking deadlock error"}, + {59, "EBFONT", "bad font file format"}, + {60, "ENOSTR", "device not a stream"}, + {61, "ENODATA", "no data available"}, + {62, "ETIME", "timer expired"}, + {63, "ENOSR", "out of streams resources"}, + {64, "ENONET", "machine is not on the network"}, + {65, "ENOPKG", "package not installed"}, + {66, "EREMOTE", "object is remote"}, + {67, "ENOLINK", "link has been severed"}, + {68, "EADV", "advertise error"}, + {69, "ESRMNT", "srmount error"}, + {70, "ECOMM", "communication error on send"}, + {71, "EPROTO", "protocol error"}, + {73, "EDOTDOT", "RFS specific error"}, + {74, "EMULTIHOP", "multihop attempted"}, + {77, "EBADMSG", "bad message"}, + {78, "ENAMETOOLONG", "file name too long"}, + {79, "EOVERFLOW", "value too large for defined data type"}, + {80, "ENOTUNIQ", "name not unique on network"}, + {81, "EBADFD", "file descriptor in bad state"}, + {82, "EREMCHG", "remote address changed"}, + {83, "ELIBACC", "can not access a needed shared library"}, + {84, "ELIBBAD", "accessing a corrupted shared library"}, + {85, "ELIBSCN", ".lib section in a.out corrupted"}, + {86, "ELIBMAX", "attempting to link in too many shared libraries"}, + {87, "ELIBEXEC", "cannot exec a shared library directly"}, + {88, "EILSEQ", "invalid or incomplete multibyte or wide character"}, + {89, "ENOSYS", "function not implemented"}, + {90, "ELOOP", "too many levels of symbolic links"}, + {91, "ERESTART", "interrupted system call should be restarted"}, + {92, "ESTRPIPE", "streams pipe error"}, + {93, "ENOTEMPTY", "directory not empty"}, + {94, "EUSERS", "too many users"}, + {95, "ENOTSOCK", "socket operation on non-socket"}, + {96, "EDESTADDRREQ", "destination address required"}, + {97, "EMSGSIZE", "message too long"}, + {98, "EPROTOTYPE", "protocol wrong type for socket"}, + {99, "ENOPROTOOPT", "protocol not available"}, + {120, "EPROTONOSUPPORT", "protocol not supported"}, + {121, "ESOCKTNOSUPPORT", "socket type not supported"}, + {122, "ENOTSUP", "operation not supported"}, + {123, "EPFNOSUPPORT", "protocol family not supported"}, + {124, "EAFNOSUPPORT", "address family not supported by protocol"}, + {125, "EADDRINUSE", "address already in use"}, + {126, "EADDRNOTAVAIL", "cannot assign requested address"}, + {127, "ENETDOWN", "network is down"}, + {128, "ENETUNREACH", "network is unreachable"}, + {129, "ENETRESET", "network dropped connection on reset"}, + {130, "ECONNABORTED", "software caused connection abort"}, + {131, "ECONNRESET", "connection reset by peer"}, + {132, "ENOBUFS", "no buffer space available"}, + {133, "EISCONN", "transport endpoint is already connected"}, + {134, "ENOTCONN", "transport endpoint is not connected"}, + {135, "EUCLEAN", "structure needs cleaning"}, + {137, "ENOTNAM", "not a XENIX named type file"}, + {138, "ENAVAIL", "no XENIX semaphores available"}, + {139, "EISNAM", "is a named type file"}, + {140, "EREMOTEIO", "remote I/O error"}, + {141, "EINIT", "unknown error 141"}, + {142, "EREMDEV", "unknown error 142"}, + {143, "ESHUTDOWN", "cannot send after transport endpoint shutdown"}, + {144, "ETOOMANYREFS", "too many references: cannot splice"}, + {145, "ETIMEDOUT", "connection timed out"}, + {146, "ECONNREFUSED", "connection refused"}, + {147, "EHOSTDOWN", "host is down"}, + {148, "EHOSTUNREACH", "no route to host"}, + {149, "EALREADY", "operation already in progress"}, + {150, "EINPROGRESS", "operation now in progress"}, + {151, "ESTALE", "stale file handle"}, + {158, "ECANCELED", "operation canceled"}, + {159, "ENOMEDIUM", "no medium found"}, + {160, "EMEDIUMTYPE", "wrong medium type"}, + {161, "ENOKEY", "required key not available"}, + {162, "EKEYEXPIRED", "key has expired"}, + {163, "EKEYREVOKED", "key has been revoked"}, + {164, "EKEYREJECTED", "key was rejected by service"}, + {165, "EOWNERDEAD", "owner died"}, + {166, "ENOTRECOVERABLE", "state not recoverable"}, + {167, "ERFKILL", "operation not possible due to RF-kill"}, + {168, "EHWPOISON", "memory page has hardware error"}, + {1133, "EDQUOT", "disk quota exceeded"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/breakpoint trap", - 6: "aborted", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "user defined signal 1", - 17: "user defined signal 2", - 18: "child exited", - 19: "power failure", - 20: "window changed", - 21: "urgent I/O condition", - 22: "I/O possible", - 23: "stopped (signal)", - 24: "stopped", - 25: "continued", - 26: "stopped (tty input)", - 27: "stopped (tty output)", - 28: "virtual timer expired", - 29: "profiling timer expired", - 30: "CPU time limit exceeded", - 31: "file size limit exceeded", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/breakpoint trap"}, + {6, "SIGABRT", "aborted"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGUSR1", "user defined signal 1"}, + {17, "SIGUSR2", "user defined signal 2"}, + {18, "SIGCHLD", "child exited"}, + {19, "SIGPWR", "power failure"}, + {20, "SIGWINCH", "window changed"}, + {21, "SIGURG", "urgent I/O condition"}, + {22, "SIGIO", "I/O possible"}, + {23, "SIGSTOP", "stopped (signal)"}, + {24, "SIGTSTP", "stopped"}, + {25, "SIGCONT", "continued"}, + {26, "SIGTTIN", "stopped (tty input)"}, + {27, "SIGTTOU", "stopped (tty output)"}, + {28, "SIGVTALRM", "virtual timer expired"}, + {29, "SIGPROF", "profiling timer expired"}, + {30, "SIGXCPU", "CPU time limit exceeded"}, + {31, "SIGXFSZ", "file size limit exceeded"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go index 4a62a55099..33b9940234 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_mipsle.go @@ -3,7 +3,7 @@ // +build mipsle,linux -// Created by cgo -godefs - DO NOT EDIT +// Code generated by cmd/cgo -godefs; DO NOT EDIT. // cgo -godefs -- -Wall -Werror -static -I/tmp/include _const.go package unix @@ -11,6 +11,11 @@ package unix import "syscall" const ( + AAFS_MAGIC = 0x5a3c69f0 + ADFS_SUPER_MAGIC = 0xadf5 + AFFS_SUPER_MAGIC = 0xadff + AFS_FS_MAGIC = 0x6b414653 + AFS_SUPER_MAGIC = 0x5346414f AF_ALG = 0x26 AF_APPLETALK = 0x5 AF_ASH = 0x12 @@ -66,6 +71,7 @@ const ( ALG_SET_IV = 0x2 ALG_SET_KEY = 0x1 ALG_SET_OP = 0x3 + ANON_INODE_FS_MAGIC = 0x9041934 ARPHRD_6LOWPAN = 0x339 ARPHRD_ADAPT = 0x108 ARPHRD_APPLETLK = 0x8 @@ -121,6 +127,7 @@ const ( ARPHRD_PPP = 0x200 ARPHRD_PRONET = 0x4 ARPHRD_RAWHDLC = 0x206 + ARPHRD_RAWIP = 0x207 ARPHRD_ROSE = 0x10e ARPHRD_RSRVD = 0x104 ARPHRD_SIT = 0x308 @@ -132,6 +139,7 @@ const ( ARPHRD_VOID = 0xffff ARPHRD_VSOCKMON = 0x33a ARPHRD_X25 = 0x10f + AUTOFS_SUPER_MAGIC = 0x187 B0 = 0x0 B1000000 = 0x1008 B110 = 0x3 @@ -163,6 +171,9 @@ const ( B75 = 0x2 B921600 = 0x1007 B9600 = 0xd + BALLOON_KVM_MAGIC = 0x13661366 + BDEVFS_MAGIC = 0x62646576 + BINFMTFS_MAGIC = 0x42494e4d BLKBSZGET = 0x40041270 BLKBSZSET = 0x80041271 BLKFLSBUF = 0x20001261 @@ -187,6 +198,7 @@ const ( BPF_AND = 0x50 BPF_B = 0x10 BPF_DIV = 0x30 + BPF_FS_MAGIC = 0xcafe4a11 BPF_H = 0x8 BPF_IMM = 0x0 BPF_IND = 0x40 @@ -228,6 +240,8 @@ const ( BS0 = 0x0 BS1 = 0x2000 BSDLY = 0x2000 + BTRFS_SUPER_MAGIC = 0x9123683e + BTRFS_TEST_MAGIC = 0x73727279 CAN_BCM = 0x2 CAN_EFF_FLAG = 0x80000000 CAN_EFF_ID_BITS = 0x1d @@ -251,6 +265,8 @@ const ( CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf + CGROUP2_SUPER_MAGIC = 0x63677270 + CGROUP_SUPER_MAGIC = 0x27e0eb CIBAUD = 0x100f0000 CLOCAL = 0x800 CLOCK_BOOTTIME = 0x7 @@ -293,10 +309,12 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CMSPAR = 0x40000000 + CODA_SUPER_MAGIC = 0x73757245 CR0 = 0x0 CR1 = 0x200 CR2 = 0x400 CR3 = 0x600 + CRAMFS_MAGIC = 0x28cd3d45 CRDLY = 0x600 CREAD = 0x80 CRTSCTS = 0x80000000 @@ -311,6 +329,9 @@ const ( CSTOP = 0x13 CSTOPB = 0x40 CSUSP = 0x1a + DAXFS_MAGIC = 0x64646178 + DEBUGFS_MAGIC = 0x64626720 + DEVPTS_SUPER_MAGIC = 0x1cd1 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -327,9 +348,12 @@ const ( ECHOKE = 0x800 ECHONL = 0x40 ECHOPRT = 0x400 + ECRYPTFS_SUPER_MAGIC = 0xf15f EFD_CLOEXEC = 0x80000 EFD_NONBLOCK = 0x80 EFD_SEMAPHORE = 0x1 + EFIVARFS_MAGIC = 0xde5e81e4 + EFS_SUPER_MAGIC = 0x414a53 ENCODING_DEFAULT = 0x0 ENCODING_FM_MARK = 0x3 ENCODING_FM_SPACE = 0x4 @@ -390,6 +414,8 @@ const ( ETH_P_DSA = 0x1b ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada + ETH_P_ERSPAN = 0x88be + ETH_P_ERSPAN2 = 0x22eb ETH_P_FCOE = 0x8906 ETH_P_FIP = 0x8914 ETH_P_HDLC = 0x19 @@ -398,6 +424,7 @@ const ( ETH_P_IEEE802154 = 0xf6 ETH_P_IEEEPUP = 0xa00 ETH_P_IEEEPUPAT = 0xa01 + ETH_P_IFE = 0xed3e ETH_P_IP = 0x800 ETH_P_IPV6 = 0x86dd ETH_P_IPX = 0x8137 @@ -408,11 +435,13 @@ const ( ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 ETH_P_MACSEC = 0x88e5 + ETH_P_MAP = 0xf9 ETH_P_MOBITEX = 0x15 ETH_P_MPLS_MC = 0x8848 ETH_P_MPLS_UC = 0x8847 ETH_P_MVRP = 0x88f5 ETH_P_NCSI = 0x88f8 + ETH_P_NSH = 0x894f ETH_P_PAE = 0x888e ETH_P_PAUSE = 0x8808 ETH_P_PHONET = 0xf5 @@ -420,6 +449,7 @@ const ( ETH_P_PPP_DISC = 0x8863 ETH_P_PPP_MP = 0x8 ETH_P_PPP_SES = 0x8864 + ETH_P_PREAUTH = 0x88c7 ETH_P_PRP = 0x88fb ETH_P_PUP = 0x200 ETH_P_PUPAT = 0x201 @@ -440,9 +470,14 @@ const ( ETH_P_WCCP = 0x883e ETH_P_X25 = 0x805 ETH_P_XDSA = 0xf8 + EXABYTE_ENABLE_NEST = 0xf0 + EXT2_SUPER_MAGIC = 0xef53 + EXT3_SUPER_MAGIC = 0xef53 + EXT4_SUPER_MAGIC = 0xef53 EXTA = 0xe EXTB = 0xf EXTPROC = 0x10000 + F2FS_SUPER_MAGIC = 0xf2f52010 FALLOC_FL_COLLAPSE_RANGE = 0x8 FALLOC_FL_INSERT_RANGE = 0x20 FALLOC_FL_KEEP_SIZE = 0x1 @@ -476,6 +511,8 @@ const ( FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 FS_POLICY_FLAGS_VALID = 0x3 + FUTEXFS_SUPER_MAGIC = 0xbad1dea + F_ADD_SEALS = 0x409 F_DUPFD = 0x0 F_DUPFD_CLOEXEC = 0x406 F_EXLCK = 0x4 @@ -488,6 +525,9 @@ const ( F_GETOWN_EX = 0x10 F_GETPIPE_SZ = 0x408 F_GETSIG = 0xb + F_GET_FILE_RW_HINT = 0x40d + F_GET_RW_HINT = 0x40b + F_GET_SEALS = 0x40a F_LOCK = 0x1 F_NOTIFY = 0x402 F_OFD_GETLK = 0x24 @@ -495,6 +535,10 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_GROW = 0x4 + F_SEAL_SEAL = 0x1 + F_SEAL_SHRINK = 0x2 + F_SEAL_WRITE = 0x8 F_SETFD = 0x2 F_SETFL = 0x4 F_SETLEASE = 0x400 @@ -506,6 +550,8 @@ const ( F_SETOWN_EX = 0xf F_SETPIPE_SZ = 0x407 F_SETSIG = 0xa + F_SET_FILE_RW_HINT = 0x40e + F_SET_RW_HINT = 0x40c F_SHLCK = 0x8 F_TEST = 0x3 F_TLOCK = 0x2 @@ -527,6 +573,49 @@ const ( GENL_UNS_ADMIN_PERM = 0x10 GRND_NONBLOCK = 0x1 GRND_RANDOM = 0x2 + HDIO_DRIVE_CMD = 0x31f + HDIO_DRIVE_CMD_AEB = 0x31e + HDIO_DRIVE_CMD_HDR_SIZE = 0x4 + HDIO_DRIVE_HOB_HDR_SIZE = 0x8 + HDIO_DRIVE_RESET = 0x31c + HDIO_DRIVE_TASK = 0x31e + HDIO_DRIVE_TASKFILE = 0x31d + HDIO_DRIVE_TASK_HDR_SIZE = 0x8 + HDIO_GETGEO = 0x301 + HDIO_GET_32BIT = 0x309 + HDIO_GET_ACOUSTIC = 0x30f + HDIO_GET_ADDRESS = 0x310 + HDIO_GET_BUSSTATE = 0x31a + HDIO_GET_DMA = 0x30b + HDIO_GET_IDENTITY = 0x30d + HDIO_GET_KEEPSETTINGS = 0x308 + HDIO_GET_MULTCOUNT = 0x304 + HDIO_GET_NICE = 0x30c + HDIO_GET_NOWERR = 0x30a + HDIO_GET_QDMA = 0x305 + HDIO_GET_UNMASKINTR = 0x302 + HDIO_GET_WCACHE = 0x30e + HDIO_OBSOLETE_IDENTITY = 0x307 + HDIO_SCAN_HWIF = 0x328 + HDIO_SET_32BIT = 0x324 + HDIO_SET_ACOUSTIC = 0x32c + HDIO_SET_ADDRESS = 0x32f + HDIO_SET_BUSSTATE = 0x32d + HDIO_SET_DMA = 0x326 + HDIO_SET_KEEPSETTINGS = 0x323 + HDIO_SET_MULTCOUNT = 0x321 + HDIO_SET_NICE = 0x329 + HDIO_SET_NOWERR = 0x325 + HDIO_SET_PIO_MODE = 0x327 + HDIO_SET_QDMA = 0x32e + HDIO_SET_UNMASKINTR = 0x322 + HDIO_SET_WCACHE = 0x32b + HDIO_SET_XFER = 0x306 + HDIO_TRISTATE_HWIF = 0x31b + HDIO_UNREGISTER_HWIF = 0x32a + HOSTFS_SUPER_MAGIC = 0xc0ffee + HPFS_SUPER_MAGIC = 0xf995e849 + HUGETLBFS_MAGIC = 0x958458f6 HUPCL = 0x400 IBSHIFT = 0x10 ICANON = 0x2 @@ -561,6 +650,8 @@ const ( IFF_MASTER = 0x400 IFF_MULTICAST = 0x1000 IFF_MULTI_QUEUE = 0x100 + IFF_NAPI = 0x10 + IFF_NAPI_FRAGS = 0x20 IFF_NOARP = 0x80 IFF_NOFILTER = 0x1000 IFF_NOTRAILERS = 0x20 @@ -775,12 +866,14 @@ const ( IP_UNICAST_IF = 0x32 IP_XFRM_POLICY = 0x11 ISIG = 0x1 + ISOFS_SUPER_MAGIC = 0x9660 ISTRIP = 0x20 IUCLC = 0x200 IUTF8 = 0x4000 IXANY = 0x800 IXOFF = 0x1000 IXON = 0x400 + JFFS2_SUPER_MAGIC = 0x72b6 KEYCTL_ASSUME_AUTHORITY = 0x10 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 @@ -845,6 +938,7 @@ const ( MADV_FREE = 0x8 MADV_HUGEPAGE = 0xe MADV_HWPOISON = 0x64 + MADV_KEEPONFORK = 0x13 MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 @@ -853,6 +947,7 @@ const ( MADV_SEQUENTIAL = 0x2 MADV_UNMERGEABLE = 0xd MADV_WILLNEED = 0x3 + MADV_WIPEONFORK = 0x12 MAP_ANON = 0x800 MAP_ANONYMOUS = 0x800 MAP_DENYWRITE = 0x2000 @@ -875,9 +970,15 @@ const ( MCL_CURRENT = 0x1 MCL_FUTURE = 0x2 MCL_ONFAULT = 0x4 + MINIX2_SUPER_MAGIC = 0x2468 + MINIX2_SUPER_MAGIC2 = 0x2478 + MINIX3_SUPER_MAGIC = 0x4d5a + MINIX_SUPER_MAGIC = 0x137f + MINIX_SUPER_MAGIC2 = 0x138f MNT_DETACH = 0x2 MNT_EXPIRE = 0x4 MNT_FORCE = 0x1 + MSDOS_SUPER_MAGIC = 0x4d44 MSG_BATCH = 0x40000 MSG_CMSG_CLOEXEC = 0x40000000 MSG_CONFIRM = 0x800 @@ -899,6 +1000,7 @@ const ( MSG_TRYHARD = 0x4 MSG_WAITALL = 0x100 MSG_WAITFORONE = 0x10000 + MSG_ZEROCOPY = 0x4000000 MS_ACTIVE = 0x40000000 MS_ASYNC = 0x1 MS_BIND = 0x1000 @@ -936,7 +1038,9 @@ const ( MS_SYNCHRONOUS = 0x10 MS_UNBINDABLE = 0x20000 MS_VERBOSE = 0x8000 + MTD_INODE_FS_MAGIC = 0x11307854 NAME_MAX = 0xff + NCP_SUPER_MAGIC = 0x564c NETLINK_ADD_MEMBERSHIP = 0x1 NETLINK_AUDIT = 0x9 NETLINK_BROADCAST_ERROR = 0x4 @@ -971,6 +1075,37 @@ const ( NETLINK_UNUSED = 0x1 NETLINK_USERSOCK = 0x2 NETLINK_XFRM = 0x6 + NFNETLINK_V0 = 0x0 + NFNLGRP_ACCT_QUOTA = 0x8 + NFNLGRP_CONNTRACK_DESTROY = 0x3 + NFNLGRP_CONNTRACK_EXP_DESTROY = 0x6 + NFNLGRP_CONNTRACK_EXP_NEW = 0x4 + NFNLGRP_CONNTRACK_EXP_UPDATE = 0x5 + NFNLGRP_CONNTRACK_NEW = 0x1 + NFNLGRP_CONNTRACK_UPDATE = 0x2 + NFNLGRP_MAX = 0x9 + NFNLGRP_NFTABLES = 0x7 + NFNLGRP_NFTRACE = 0x9 + NFNLGRP_NONE = 0x0 + NFNL_BATCH_MAX = 0x1 + NFNL_MSG_BATCH_BEGIN = 0x10 + NFNL_MSG_BATCH_END = 0x11 + NFNL_NFA_NEST = 0x8000 + NFNL_SUBSYS_ACCT = 0x7 + NFNL_SUBSYS_COUNT = 0xc + NFNL_SUBSYS_CTHELPER = 0x9 + NFNL_SUBSYS_CTNETLINK = 0x1 + NFNL_SUBSYS_CTNETLINK_EXP = 0x2 + NFNL_SUBSYS_CTNETLINK_TIMEOUT = 0x8 + NFNL_SUBSYS_IPSET = 0x6 + NFNL_SUBSYS_NFTABLES = 0xa + NFNL_SUBSYS_NFT_COMPAT = 0xb + NFNL_SUBSYS_NONE = 0x0 + NFNL_SUBSYS_OSF = 0x5 + NFNL_SUBSYS_QUEUE = 0x3 + NFNL_SUBSYS_ULOG = 0x4 + NFS_SUPER_MAGIC = 0x6969 + NILFS_SUPER_MAGIC = 0x3434 NL0 = 0x0 NL1 = 0x100 NLA_ALIGNTO = 0x4 @@ -998,10 +1133,13 @@ const ( NLM_F_EXCL = 0x200 NLM_F_MATCH = 0x200 NLM_F_MULTI = 0x2 + NLM_F_NONREC = 0x100 NLM_F_REPLACE = 0x100 NLM_F_REQUEST = 0x1 NLM_F_ROOT = 0x100 NOFLSH = 0x80 + NSFS_MAGIC = 0x6e736673 + OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 OFILL = 0x40 @@ -1009,7 +1147,9 @@ const ( ONLCR = 0x4 ONLRET = 0x20 ONOCR = 0x10 + OPENPROM_SUPER_MAGIC = 0x9fa1 OPOST = 0x1 + OVERLAYFS_SUPER_MAGIC = 0x794c7630 O_ACCMODE = 0x3 O_APPEND = 0x8 O_ASYNC = 0x1000 @@ -1094,16 +1234,20 @@ const ( PERF_EVENT_IOC_DISABLE = 0x20002401 PERF_EVENT_IOC_ENABLE = 0x20002400 PERF_EVENT_IOC_ID = 0x40042407 + PERF_EVENT_IOC_MODIFY_ATTRIBUTES = 0x8004240b PERF_EVENT_IOC_PAUSE_OUTPUT = 0x80042409 PERF_EVENT_IOC_PERIOD = 0x80082404 + PERF_EVENT_IOC_QUERY_BPF = 0xc004240a PERF_EVENT_IOC_REFRESH = 0x20002402 PERF_EVENT_IOC_RESET = 0x20002403 PERF_EVENT_IOC_SET_BPF = 0x80042408 PERF_EVENT_IOC_SET_FILTER = 0x80042406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 + PIPEFS_MAGIC = 0x50495045 PRIO_PGRP = 0x1 PRIO_PROCESS = 0x0 PRIO_USER = 0x2 + PROC_SUPER_MAGIC = 0x9fa0 PROT_EXEC = 0x4 PROT_GROWSDOWN = 0x1000000 PROT_GROWSUP = 0x2000000 @@ -1146,6 +1290,7 @@ const ( PR_GET_PDEATHSIG = 0x2 PR_GET_SECCOMP = 0x15 PR_GET_SECUREBITS = 0x1b + PR_GET_SPECULATION_CTRL = 0x34 PR_GET_THP_DISABLE = 0x2a PR_GET_TID_ADDRESS = 0x28 PR_GET_TIMERSLACK = 0x1e @@ -1191,11 +1336,23 @@ const ( PR_SET_PTRACER_ANY = 0xffffffff PR_SET_SECCOMP = 0x16 PR_SET_SECUREBITS = 0x1c + PR_SET_SPECULATION_CTRL = 0x35 PR_SET_THP_DISABLE = 0x29 PR_SET_TIMERSLACK = 0x1d PR_SET_TIMING = 0xe PR_SET_TSC = 0x1a PR_SET_UNALIGN = 0x6 + PR_SPEC_DISABLE = 0x4 + PR_SPEC_ENABLE = 0x2 + PR_SPEC_FORCE_DISABLE = 0x8 + PR_SPEC_NOT_AFFECTED = 0x0 + PR_SPEC_PRCTL = 0x1 + PR_SPEC_STORE_BYPASS = 0x0 + PR_SVE_GET_VL = 0x33 + PR_SVE_SET_VL = 0x32 + PR_SVE_SET_VL_ONEXEC = 0x40000 + PR_SVE_VL_INHERIT = 0x20000 + PR_SVE_VL_LEN_MASK = 0xffff PR_TASK_PERF_EVENTS_DISABLE = 0x1f PR_TASK_PERF_EVENTS_ENABLE = 0x20 PR_TIMING_STATISTICAL = 0x0 @@ -1204,6 +1361,7 @@ const ( PR_TSC_SIGSEGV = 0x2 PR_UNALIGN_NOPRINT = 0x1 PR_UNALIGN_SIGBUS = 0x2 + PSTOREFS_MAGIC = 0x6165676c PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 @@ -1252,6 +1410,7 @@ const ( PTRACE_POKETEXT_3264 = 0xc2 PTRACE_POKEUSR = 0x6 PTRACE_SECCOMP_GET_FILTER = 0x420c + PTRACE_SECCOMP_GET_METADATA = 0x420d PTRACE_SEIZE = 0x4206 PTRACE_SETFPREGS = 0xf PTRACE_SETOPTIONS = 0x4200 @@ -1264,6 +1423,11 @@ const ( PTRACE_SINGLESTEP = 0x9 PTRACE_SYSCALL = 0x18 PTRACE_TRACEME = 0x0 + QNX4_SUPER_MAGIC = 0x2f + QNX6_SUPER_MAGIC = 0x68191122 + RAMFS_MAGIC = 0x858458f6 + RDTGROUP_SUPER_MAGIC = 0x7655821 + REISERFS_SUPER_MAGIC = 0x52654973 RLIMIT_AS = 0x6 RLIMIT_CORE = 0x4 RLIMIT_CPU = 0x0 @@ -1284,6 +1448,7 @@ const ( RTAX_ADVMSS = 0x8 RTAX_CC_ALGO = 0x10 RTAX_CWND = 0x7 + RTAX_FASTOPEN_NO_COOKIE = 0x11 RTAX_FEATURES = 0xc RTAX_FEATURE_ALLFRAG = 0x8 RTAX_FEATURE_ECN = 0x1 @@ -1294,7 +1459,7 @@ const ( RTAX_INITCWND = 0xb RTAX_INITRWND = 0xe RTAX_LOCK = 0x1 - RTAX_MAX = 0x10 + RTAX_MAX = 0x11 RTAX_MTU = 0x2 RTAX_QUICKACK = 0xf RTAX_REORDERING = 0x9 @@ -1312,6 +1477,33 @@ const ( RTCF_MASQ = 0x400000 RTCF_NAT = 0x800000 RTCF_VALVE = 0x200000 + RTC_AF = 0x20 + RTC_AIE_OFF = 0x20007002 + RTC_AIE_ON = 0x20007001 + RTC_ALM_READ = 0x40247008 + RTC_ALM_SET = 0x80247007 + RTC_EPOCH_READ = 0x4004700d + RTC_EPOCH_SET = 0x8004700e + RTC_IRQF = 0x80 + RTC_IRQP_READ = 0x4004700b + RTC_IRQP_SET = 0x8004700c + RTC_MAX_FREQ = 0x2000 + RTC_PF = 0x40 + RTC_PIE_OFF = 0x20007006 + RTC_PIE_ON = 0x20007005 + RTC_PLL_GET = 0x401c7011 + RTC_PLL_SET = 0x801c7012 + RTC_RD_TIME = 0x40247009 + RTC_SET_TIME = 0x8024700a + RTC_UF = 0x10 + RTC_UIE_OFF = 0x20007004 + RTC_UIE_ON = 0x20007003 + RTC_VL_CLR = 0x20007014 + RTC_VL_READ = 0x40047013 + RTC_WIE_OFF = 0x20007010 + RTC_WIE_ON = 0x2000700f + RTC_WKALM_RD = 0x40287010 + RTC_WKALM_SET = 0x8028700f RTF_ADDRCLASSMASK = 0xf8000000 RTF_ADDRCONF = 0x40000 RTF_ALLONLINK = 0x20000 @@ -1448,6 +1640,8 @@ const ( SECCOMP_MODE_DISABLED = 0x0 SECCOMP_MODE_FILTER = 0x2 SECCOMP_MODE_STRICT = 0x1 + SECURITYFS_MAGIC = 0x73636673 + SELINUX_MAGIC = 0xf97cff8c SHUT_RD = 0x0 SHUT_RDWR = 0x2 SHUT_WR = 0x1 @@ -1532,6 +1726,23 @@ const ( SIOCSPGRP = 0x80047308 SIOCSRARP = 0x8962 SIOCWANDEV = 0x894a + SMACK_MAGIC = 0x43415d53 + SMART_AUTOSAVE = 0xd2 + SMART_AUTO_OFFLINE = 0xdb + SMART_DISABLE = 0xd9 + SMART_ENABLE = 0xd8 + SMART_HCYL_PASS = 0xc2 + SMART_IMMEDIATE_OFFLINE = 0xd4 + SMART_LCYL_PASS = 0x4f + SMART_READ_LOG_SECTOR = 0xd5 + SMART_READ_THRESHOLDS = 0xd1 + SMART_READ_VALUES = 0xd0 + SMART_SAVE = 0xd3 + SMART_STATUS = 0xda + SMART_WRITE_LOG_SECTOR = 0xd6 + SMART_WRITE_THRESHOLDS = 0xd7 + SMB_SUPER_MAGIC = 0x517b + SOCKFS_MAGIC = 0x534f434b SOCK_CLOEXEC = 0x80000 SOCK_DCCP = 0x6 SOCK_DGRAM = 0x1 @@ -1568,6 +1779,7 @@ const ( SOL_SOCKET = 0xffff SOL_TCP = 0x6 SOL_TIPC = 0x10f + SOL_TLS = 0x11a SOL_X25 = 0x106 SOMAXCONN = 0x80 SO_ACCEPTCONN = 0x1009 @@ -1637,10 +1849,13 @@ const ( SO_VM_SOCKETS_PEER_HOST_VM_ID = 0x3 SO_VM_SOCKETS_TRUSTED = 0x5 SO_WIFI_STATUS = 0x29 + SO_ZEROCOPY = 0x3c SPLICE_F_GIFT = 0x8 SPLICE_F_MORE = 0x4 SPLICE_F_MOVE = 0x1 SPLICE_F_NONBLOCK = 0x2 + SQUASHFS_MAGIC = 0x73717368 + STACK_END_MAGIC = 0x57ac6e9d STATX_ALL = 0xfff STATX_ATIME = 0x20 STATX_ATTR_APPEND = 0x20 @@ -1662,6 +1877,7 @@ const ( STATX_TYPE = 0x1 STATX_UID = 0x8 STATX__RESERVED = 0x80000000 + SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 S_IFBLK = 0x6000 @@ -1732,6 +1948,8 @@ const ( TCP_MAXWIN = 0xffff TCP_MAX_WINSHIFT = 0xe TCP_MD5SIG = 0xe + TCP_MD5SIG_EXT = 0x20 + TCP_MD5SIG_FLAG_PREFIX = 0x1 TCP_MD5SIG_MAXKEYLEN = 0x50 TCP_MSS = 0x200 TCP_MSS_DEFAULT = 0x218 @@ -1752,6 +1970,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa TCSAFLUSH = 0x5410 @@ -1841,7 +2060,27 @@ const ( TIOCSTI = 0x5472 TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TMPFS_MAGIC = 0x1021994 TOSTOP = 0x8000 + TPACKET_ALIGNMENT = 0x10 + TPACKET_HDRLEN = 0x34 + TP_STATUS_AVAILABLE = 0x0 + TP_STATUS_BLK_TMO = 0x20 + TP_STATUS_COPY = 0x2 + TP_STATUS_CSUMNOTREADY = 0x8 + TP_STATUS_CSUM_VALID = 0x80 + TP_STATUS_KERNEL = 0x0 + TP_STATUS_LOSING = 0x4 + TP_STATUS_SENDING = 0x2 + TP_STATUS_SEND_REQUEST = 0x1 + TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_SOFTWARE = 0x20000000 + TP_STATUS_TS_SYS_HARDWARE = 0x40000000 + TP_STATUS_USER = 0x1 + TP_STATUS_VLAN_TPID_VALID = 0x40 + TP_STATUS_VLAN_VALID = 0x10 + TP_STATUS_WRONG_FORMAT = 0x4 + TRACEFS_MAGIC = 0x74726163 TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x800854d5 TUNDETACHFILTER = 0x800854d6 @@ -1853,6 +2092,7 @@ const ( TUNGETVNETHDRSZ = 0x400454d7 TUNGETVNETLE = 0x400454dd TUNSETDEBUG = 0x800454c9 + TUNSETFILTEREBPF = 0x400454e1 TUNSETGROUP = 0x800454ce TUNSETIFF = 0x800454ca TUNSETIFINDEX = 0x800454da @@ -1863,13 +2103,17 @@ const ( TUNSETPERSIST = 0x800454cb TUNSETQUEUE = 0x800454d9 TUNSETSNDBUF = 0x800454d4 + TUNSETSTEERINGEBPF = 0x400454e0 TUNSETTXFILTER = 0x800454d1 TUNSETVNETBE = 0x800454de TUNSETVNETHDRSZ = 0x800454d8 TUNSETVNETLE = 0x800454dc + UDF_SUPER_MAGIC = 0x15013346 UMOUNT_NOFOLLOW = 0x8 + USBDEVICE_SUPER_MAGIC = 0x9fa2 UTIME_NOW = 0x3fffffff UTIME_OMIT = 0x3ffffffe + V9FS_MAGIC = 0x1021997 VDISCARD = 0xd VEOF = 0x10 VEOL = 0x11 @@ -1912,6 +2156,86 @@ const ( WDIOC_SETPRETIMEOUT = 0xc0045708 WDIOC_SETTIMEOUT = 0xc0045706 WEXITED = 0x4 + WIN_ACKMEDIACHANGE = 0xdb + WIN_CHECKPOWERMODE1 = 0xe5 + WIN_CHECKPOWERMODE2 = 0x98 + WIN_DEVICE_RESET = 0x8 + WIN_DIAGNOSE = 0x90 + WIN_DOORLOCK = 0xde + WIN_DOORUNLOCK = 0xdf + WIN_DOWNLOAD_MICROCODE = 0x92 + WIN_FLUSH_CACHE = 0xe7 + WIN_FLUSH_CACHE_EXT = 0xea + WIN_FORMAT = 0x50 + WIN_GETMEDIASTATUS = 0xda + WIN_IDENTIFY = 0xec + WIN_IDENTIFY_DMA = 0xee + WIN_IDLEIMMEDIATE = 0xe1 + WIN_INIT = 0x60 + WIN_MEDIAEJECT = 0xed + WIN_MULTREAD = 0xc4 + WIN_MULTREAD_EXT = 0x29 + WIN_MULTWRITE = 0xc5 + WIN_MULTWRITE_EXT = 0x39 + WIN_NOP = 0x0 + WIN_PACKETCMD = 0xa0 + WIN_PIDENTIFY = 0xa1 + WIN_POSTBOOT = 0xdc + WIN_PREBOOT = 0xdd + WIN_QUEUED_SERVICE = 0xa2 + WIN_READ = 0x20 + WIN_READDMA = 0xc8 + WIN_READDMA_EXT = 0x25 + WIN_READDMA_ONCE = 0xc9 + WIN_READDMA_QUEUED = 0xc7 + WIN_READDMA_QUEUED_EXT = 0x26 + WIN_READ_BUFFER = 0xe4 + WIN_READ_EXT = 0x24 + WIN_READ_LONG = 0x22 + WIN_READ_LONG_ONCE = 0x23 + WIN_READ_NATIVE_MAX = 0xf8 + WIN_READ_NATIVE_MAX_EXT = 0x27 + WIN_READ_ONCE = 0x21 + WIN_RECAL = 0x10 + WIN_RESTORE = 0x10 + WIN_SECURITY_DISABLE = 0xf6 + WIN_SECURITY_ERASE_PREPARE = 0xf3 + WIN_SECURITY_ERASE_UNIT = 0xf4 + WIN_SECURITY_FREEZE_LOCK = 0xf5 + WIN_SECURITY_SET_PASS = 0xf1 + WIN_SECURITY_UNLOCK = 0xf2 + WIN_SEEK = 0x70 + WIN_SETFEATURES = 0xef + WIN_SETIDLE1 = 0xe3 + WIN_SETIDLE2 = 0x97 + WIN_SETMULT = 0xc6 + WIN_SET_MAX = 0xf9 + WIN_SET_MAX_EXT = 0x37 + WIN_SLEEPNOW1 = 0xe6 + WIN_SLEEPNOW2 = 0x99 + WIN_SMART = 0xb0 + WIN_SPECIFY = 0x91 + WIN_SRST = 0x8 + WIN_STANDBY = 0xe2 + WIN_STANDBY2 = 0x96 + WIN_STANDBYNOW1 = 0xe0 + WIN_STANDBYNOW2 = 0x94 + WIN_VERIFY = 0x40 + WIN_VERIFY_EXT = 0x42 + WIN_VERIFY_ONCE = 0x41 + WIN_WRITE = 0x30 + WIN_WRITEDMA = 0xca + WIN_WRITEDMA_EXT = 0x35 + WIN_WRITEDMA_ONCE = 0xcb + WIN_WRITEDMA_QUEUED = 0xcc + WIN_WRITEDMA_QUEUED_EXT = 0x36 + WIN_WRITE_BUFFER = 0xe8 + WIN_WRITE_EXT = 0x34 + WIN_WRITE_LONG = 0x32 + WIN_WRITE_LONG_ONCE = 0x33 + WIN_WRITE_ONCE = 0x31 + WIN_WRITE_SAME = 0xe9 + WIN_WRITE_VERIFY = 0x3c WNOHANG = 0x1 WNOTHREAD = 0x20000000 WNOWAIT = 0x1000000 @@ -1921,7 +2245,9 @@ const ( XATTR_CREATE = 0x1 XATTR_REPLACE = 0x2 XCASE = 0x4 + XENFS_SUPER_MAGIC = 0xabba1974 XTABS = 0x1800 + ZSMALLOC_MAGIC = 0x58295829 ) // Errors @@ -2103,174 +2429,182 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "no such device or address", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource temporarily unavailable", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device or resource busy", - 17: "file exists", - 18: "invalid cross-device link", - 19: "no such device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "numerical result out of range", - 35: "no message of desired type", - 36: "identifier removed", - 37: "channel number out of range", - 38: "level 2 not synchronized", - 39: "level 3 halted", - 40: "level 3 reset", - 41: "link number out of range", - 42: "protocol driver not attached", - 43: "no CSI structure available", - 44: "level 2 halted", - 45: "resource deadlock avoided", - 46: "no locks available", - 50: "invalid exchange", - 51: "invalid request descriptor", - 52: "exchange full", - 53: "no anode", - 54: "invalid request code", - 55: "invalid slot", - 56: "file locking deadlock error", - 59: "bad font file format", - 60: "device not a stream", - 61: "no data available", - 62: "timer expired", - 63: "out of streams resources", - 64: "machine is not on the network", - 65: "package not installed", - 66: "object is remote", - 67: "link has been severed", - 68: "advertise error", - 69: "srmount error", - 70: "communication error on send", - 71: "protocol error", - 73: "RFS specific error", - 74: "multihop attempted", - 77: "bad message", - 78: "file name too long", - 79: "value too large for defined data type", - 80: "name not unique on network", - 81: "file descriptor in bad state", - 82: "remote address changed", - 83: "can not access a needed shared library", - 84: "accessing a corrupted shared library", - 85: ".lib section in a.out corrupted", - 86: "attempting to link in too many shared libraries", - 87: "cannot exec a shared library directly", - 88: "invalid or incomplete multibyte or wide character", - 89: "function not implemented", - 90: "too many levels of symbolic links", - 91: "interrupted system call should be restarted", - 92: "streams pipe error", - 93: "directory not empty", - 94: "too many users", - 95: "socket operation on non-socket", - 96: "destination address required", - 97: "message too long", - 98: "protocol wrong type for socket", - 99: "protocol not available", - 120: "protocol not supported", - 121: "socket type not supported", - 122: "operation not supported", - 123: "protocol family not supported", - 124: "address family not supported by protocol", - 125: "address already in use", - 126: "cannot assign requested address", - 127: "network is down", - 128: "network is unreachable", - 129: "network dropped connection on reset", - 130: "software caused connection abort", - 131: "connection reset by peer", - 132: "no buffer space available", - 133: "transport endpoint is already connected", - 134: "transport endpoint is not connected", - 135: "structure needs cleaning", - 137: "not a XENIX named type file", - 138: "no XENIX semaphores available", - 139: "is a named type file", - 140: "remote I/O error", - 141: "unknown error 141", - 142: "unknown error 142", - 143: "cannot send after transport endpoint shutdown", - 144: "too many references: cannot splice", - 145: "connection timed out", - 146: "connection refused", - 147: "host is down", - 148: "no route to host", - 149: "operation already in progress", - 150: "operation now in progress", - 151: "stale file handle", - 158: "operation canceled", - 159: "no medium found", - 160: "wrong medium type", - 161: "required key not available", - 162: "key has expired", - 163: "key has been revoked", - 164: "key was rejected by service", - 165: "owner died", - 166: "state not recoverable", - 167: "operation not possible due to RF-kill", - 168: "memory page has hardware error", - 1133: "disk quota exceeded", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "no such device or address"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EAGAIN", "resource temporarily unavailable"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device or resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "invalid cross-device link"}, + {19, "ENODEV", "no such device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "numerical result out of range"}, + {35, "ENOMSG", "no message of desired type"}, + {36, "EIDRM", "identifier removed"}, + {37, "ECHRNG", "channel number out of range"}, + {38, "EL2NSYNC", "level 2 not synchronized"}, + {39, "EL3HLT", "level 3 halted"}, + {40, "EL3RST", "level 3 reset"}, + {41, "ELNRNG", "link number out of range"}, + {42, "EUNATCH", "protocol driver not attached"}, + {43, "ENOCSI", "no CSI structure available"}, + {44, "EL2HLT", "level 2 halted"}, + {45, "EDEADLK", "resource deadlock avoided"}, + {46, "ENOLCK", "no locks available"}, + {50, "EBADE", "invalid exchange"}, + {51, "EBADR", "invalid request descriptor"}, + {52, "EXFULL", "exchange full"}, + {53, "ENOANO", "no anode"}, + {54, "EBADRQC", "invalid request code"}, + {55, "EBADSLT", "invalid slot"}, + {56, "EDEADLOCK", "file locking deadlock error"}, + {59, "EBFONT", "bad font file format"}, + {60, "ENOSTR", "device not a stream"}, + {61, "ENODATA", "no data available"}, + {62, "ETIME", "timer expired"}, + {63, "ENOSR", "out of streams resources"}, + {64, "ENONET", "machine is not on the network"}, + {65, "ENOPKG", "package not installed"}, + {66, "EREMOTE", "object is remote"}, + {67, "ENOLINK", "link has been severed"}, + {68, "EADV", "advertise error"}, + {69, "ESRMNT", "srmount error"}, + {70, "ECOMM", "communication error on send"}, + {71, "EPROTO", "protocol error"}, + {73, "EDOTDOT", "RFS specific error"}, + {74, "EMULTIHOP", "multihop attempted"}, + {77, "EBADMSG", "bad message"}, + {78, "ENAMETOOLONG", "file name too long"}, + {79, "EOVERFLOW", "value too large for defined data type"}, + {80, "ENOTUNIQ", "name not unique on network"}, + {81, "EBADFD", "file descriptor in bad state"}, + {82, "EREMCHG", "remote address changed"}, + {83, "ELIBACC", "can not access a needed shared library"}, + {84, "ELIBBAD", "accessing a corrupted shared library"}, + {85, "ELIBSCN", ".lib section in a.out corrupted"}, + {86, "ELIBMAX", "attempting to link in too many shared libraries"}, + {87, "ELIBEXEC", "cannot exec a shared library directly"}, + {88, "EILSEQ", "invalid or incomplete multibyte or wide character"}, + {89, "ENOSYS", "function not implemented"}, + {90, "ELOOP", "too many levels of symbolic links"}, + {91, "ERESTART", "interrupted system call should be restarted"}, + {92, "ESTRPIPE", "streams pipe error"}, + {93, "ENOTEMPTY", "directory not empty"}, + {94, "EUSERS", "too many users"}, + {95, "ENOTSOCK", "socket operation on non-socket"}, + {96, "EDESTADDRREQ", "destination address required"}, + {97, "EMSGSIZE", "message too long"}, + {98, "EPROTOTYPE", "protocol wrong type for socket"}, + {99, "ENOPROTOOPT", "protocol not available"}, + {120, "EPROTONOSUPPORT", "protocol not supported"}, + {121, "ESOCKTNOSUPPORT", "socket type not supported"}, + {122, "ENOTSUP", "operation not supported"}, + {123, "EPFNOSUPPORT", "protocol family not supported"}, + {124, "EAFNOSUPPORT", "address family not supported by protocol"}, + {125, "EADDRINUSE", "address already in use"}, + {126, "EADDRNOTAVAIL", "cannot assign requested address"}, + {127, "ENETDOWN", "network is down"}, + {128, "ENETUNREACH", "network is unreachable"}, + {129, "ENETRESET", "network dropped connection on reset"}, + {130, "ECONNABORTED", "software caused connection abort"}, + {131, "ECONNRESET", "connection reset by peer"}, + {132, "ENOBUFS", "no buffer space available"}, + {133, "EISCONN", "transport endpoint is already connected"}, + {134, "ENOTCONN", "transport endpoint is not connected"}, + {135, "EUCLEAN", "structure needs cleaning"}, + {137, "ENOTNAM", "not a XENIX named type file"}, + {138, "ENAVAIL", "no XENIX semaphores available"}, + {139, "EISNAM", "is a named type file"}, + {140, "EREMOTEIO", "remote I/O error"}, + {141, "EINIT", "unknown error 141"}, + {142, "EREMDEV", "unknown error 142"}, + {143, "ESHUTDOWN", "cannot send after transport endpoint shutdown"}, + {144, "ETOOMANYREFS", "too many references: cannot splice"}, + {145, "ETIMEDOUT", "connection timed out"}, + {146, "ECONNREFUSED", "connection refused"}, + {147, "EHOSTDOWN", "host is down"}, + {148, "EHOSTUNREACH", "no route to host"}, + {149, "EALREADY", "operation already in progress"}, + {150, "EINPROGRESS", "operation now in progress"}, + {151, "ESTALE", "stale file handle"}, + {158, "ECANCELED", "operation canceled"}, + {159, "ENOMEDIUM", "no medium found"}, + {160, "EMEDIUMTYPE", "wrong medium type"}, + {161, "ENOKEY", "required key not available"}, + {162, "EKEYEXPIRED", "key has expired"}, + {163, "EKEYREVOKED", "key has been revoked"}, + {164, "EKEYREJECTED", "key was rejected by service"}, + {165, "EOWNERDEAD", "owner died"}, + {166, "ENOTRECOVERABLE", "state not recoverable"}, + {167, "ERFKILL", "operation not possible due to RF-kill"}, + {168, "EHWPOISON", "memory page has hardware error"}, + {1133, "EDQUOT", "disk quota exceeded"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/breakpoint trap", - 6: "aborted", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "user defined signal 1", - 17: "user defined signal 2", - 18: "child exited", - 19: "power failure", - 20: "window changed", - 21: "urgent I/O condition", - 22: "I/O possible", - 23: "stopped (signal)", - 24: "stopped", - 25: "continued", - 26: "stopped (tty input)", - 27: "stopped (tty output)", - 28: "virtual timer expired", - 29: "profiling timer expired", - 30: "CPU time limit exceeded", - 31: "file size limit exceeded", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/breakpoint trap"}, + {6, "SIGABRT", "aborted"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGUSR1", "user defined signal 1"}, + {17, "SIGUSR2", "user defined signal 2"}, + {18, "SIGCHLD", "child exited"}, + {19, "SIGPWR", "power failure"}, + {20, "SIGWINCH", "window changed"}, + {21, "SIGURG", "urgent I/O condition"}, + {22, "SIGIO", "I/O possible"}, + {23, "SIGSTOP", "stopped (signal)"}, + {24, "SIGTSTP", "stopped"}, + {25, "SIGCONT", "continued"}, + {26, "SIGTTIN", "stopped (tty input)"}, + {27, "SIGTTOU", "stopped (tty output)"}, + {28, "SIGVTALRM", "virtual timer expired"}, + {29, "SIGPROF", "profiling timer expired"}, + {30, "SIGXCPU", "CPU time limit exceeded"}, + {31, "SIGXFSZ", "file size limit exceeded"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go index 5e1e81e0cc..c78d669761 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64.go @@ -3,7 +3,7 @@ // +build ppc64,linux -// Created by cgo -godefs - DO NOT EDIT +// Code generated by cmd/cgo -godefs; DO NOT EDIT. // cgo -godefs -- -Wall -Werror -static -I/tmp/include _const.go package unix @@ -11,6 +11,11 @@ package unix import "syscall" const ( + AAFS_MAGIC = 0x5a3c69f0 + ADFS_SUPER_MAGIC = 0xadf5 + AFFS_SUPER_MAGIC = 0xadff + AFS_FS_MAGIC = 0x6b414653 + AFS_SUPER_MAGIC = 0x5346414f AF_ALG = 0x26 AF_APPLETALK = 0x5 AF_ASH = 0x12 @@ -66,6 +71,7 @@ const ( ALG_SET_IV = 0x2 ALG_SET_KEY = 0x1 ALG_SET_OP = 0x3 + ANON_INODE_FS_MAGIC = 0x9041934 ARPHRD_6LOWPAN = 0x339 ARPHRD_ADAPT = 0x108 ARPHRD_APPLETLK = 0x8 @@ -121,6 +127,7 @@ const ( ARPHRD_PPP = 0x200 ARPHRD_PRONET = 0x4 ARPHRD_RAWHDLC = 0x206 + ARPHRD_RAWIP = 0x207 ARPHRD_ROSE = 0x10e ARPHRD_RSRVD = 0x104 ARPHRD_SIT = 0x308 @@ -132,6 +139,7 @@ const ( ARPHRD_VOID = 0xffff ARPHRD_VSOCKMON = 0x33a ARPHRD_X25 = 0x10f + AUTOFS_SUPER_MAGIC = 0x187 B0 = 0x0 B1000000 = 0x17 B110 = 0x3 @@ -163,6 +171,9 @@ const ( B75 = 0x2 B921600 = 0x16 B9600 = 0xd + BALLOON_KVM_MAGIC = 0x13661366 + BDEVFS_MAGIC = 0x62646576 + BINFMTFS_MAGIC = 0x42494e4d BLKBSZGET = 0x40081270 BLKBSZSET = 0x80081271 BLKFLSBUF = 0x20001261 @@ -187,6 +198,7 @@ const ( BPF_AND = 0x50 BPF_B = 0x10 BPF_DIV = 0x30 + BPF_FS_MAGIC = 0xcafe4a11 BPF_H = 0x8 BPF_IMM = 0x0 BPF_IND = 0x40 @@ -228,6 +240,8 @@ const ( BS0 = 0x0 BS1 = 0x8000 BSDLY = 0x8000 + BTRFS_SUPER_MAGIC = 0x9123683e + BTRFS_TEST_MAGIC = 0x73727279 CAN_BCM = 0x2 CAN_EFF_FLAG = 0x80000000 CAN_EFF_ID_BITS = 0x1d @@ -251,6 +265,8 @@ const ( CBAUD = 0xff CBAUDEX = 0x0 CFLUSH = 0xf + CGROUP2_SUPER_MAGIC = 0x63677270 + CGROUP_SUPER_MAGIC = 0x27e0eb CIBAUD = 0xff0000 CLOCAL = 0x8000 CLOCK_BOOTTIME = 0x7 @@ -293,10 +309,12 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CMSPAR = 0x40000000 + CODA_SUPER_MAGIC = 0x73757245 CR0 = 0x0 CR1 = 0x1000 CR2 = 0x2000 CR3 = 0x3000 + CRAMFS_MAGIC = 0x28cd3d45 CRDLY = 0x3000 CREAD = 0x800 CRTSCTS = 0x80000000 @@ -311,6 +329,9 @@ const ( CSTOP = 0x13 CSTOPB = 0x400 CSUSP = 0x1a + DAXFS_MAGIC = 0x64646178 + DEBUGFS_MAGIC = 0x64626720 + DEVPTS_SUPER_MAGIC = 0x1cd1 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -327,9 +348,12 @@ const ( ECHOKE = 0x1 ECHONL = 0x10 ECHOPRT = 0x20 + ECRYPTFS_SUPER_MAGIC = 0xf15f EFD_CLOEXEC = 0x80000 EFD_NONBLOCK = 0x800 EFD_SEMAPHORE = 0x1 + EFIVARFS_MAGIC = 0xde5e81e4 + EFS_SUPER_MAGIC = 0x414a53 ENCODING_DEFAULT = 0x0 ENCODING_FM_MARK = 0x3 ENCODING_FM_SPACE = 0x4 @@ -390,6 +414,8 @@ const ( ETH_P_DSA = 0x1b ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada + ETH_P_ERSPAN = 0x88be + ETH_P_ERSPAN2 = 0x22eb ETH_P_FCOE = 0x8906 ETH_P_FIP = 0x8914 ETH_P_HDLC = 0x19 @@ -398,6 +424,7 @@ const ( ETH_P_IEEE802154 = 0xf6 ETH_P_IEEEPUP = 0xa00 ETH_P_IEEEPUPAT = 0xa01 + ETH_P_IFE = 0xed3e ETH_P_IP = 0x800 ETH_P_IPV6 = 0x86dd ETH_P_IPX = 0x8137 @@ -408,11 +435,13 @@ const ( ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 ETH_P_MACSEC = 0x88e5 + ETH_P_MAP = 0xf9 ETH_P_MOBITEX = 0x15 ETH_P_MPLS_MC = 0x8848 ETH_P_MPLS_UC = 0x8847 ETH_P_MVRP = 0x88f5 ETH_P_NCSI = 0x88f8 + ETH_P_NSH = 0x894f ETH_P_PAE = 0x888e ETH_P_PAUSE = 0x8808 ETH_P_PHONET = 0xf5 @@ -420,6 +449,7 @@ const ( ETH_P_PPP_DISC = 0x8863 ETH_P_PPP_MP = 0x8 ETH_P_PPP_SES = 0x8864 + ETH_P_PREAUTH = 0x88c7 ETH_P_PRP = 0x88fb ETH_P_PUP = 0x200 ETH_P_PUPAT = 0x201 @@ -440,9 +470,14 @@ const ( ETH_P_WCCP = 0x883e ETH_P_X25 = 0x805 ETH_P_XDSA = 0xf8 + EXABYTE_ENABLE_NEST = 0xf0 + EXT2_SUPER_MAGIC = 0xef53 + EXT3_SUPER_MAGIC = 0xef53 + EXT4_SUPER_MAGIC = 0xef53 EXTA = 0xe EXTB = 0xf EXTPROC = 0x10000000 + F2FS_SUPER_MAGIC = 0xf2f52010 FALLOC_FL_COLLAPSE_RANGE = 0x8 FALLOC_FL_INSERT_RANGE = 0x20 FALLOC_FL_KEEP_SIZE = 0x1 @@ -476,6 +511,8 @@ const ( FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 FS_POLICY_FLAGS_VALID = 0x3 + FUTEXFS_SUPER_MAGIC = 0xbad1dea + F_ADD_SEALS = 0x409 F_DUPFD = 0x0 F_DUPFD_CLOEXEC = 0x406 F_EXLCK = 0x4 @@ -488,6 +525,9 @@ const ( F_GETOWN_EX = 0x10 F_GETPIPE_SZ = 0x408 F_GETSIG = 0xb + F_GET_FILE_RW_HINT = 0x40d + F_GET_RW_HINT = 0x40b + F_GET_SEALS = 0x40a F_LOCK = 0x1 F_NOTIFY = 0x402 F_OFD_GETLK = 0x24 @@ -495,6 +535,10 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_GROW = 0x4 + F_SEAL_SEAL = 0x1 + F_SEAL_SHRINK = 0x2 + F_SEAL_WRITE = 0x8 F_SETFD = 0x2 F_SETFL = 0x4 F_SETLEASE = 0x400 @@ -506,6 +550,8 @@ const ( F_SETOWN_EX = 0xf F_SETPIPE_SZ = 0x407 F_SETSIG = 0xa + F_SET_FILE_RW_HINT = 0x40e + F_SET_RW_HINT = 0x40c F_SHLCK = 0x8 F_TEST = 0x3 F_TLOCK = 0x2 @@ -527,6 +573,49 @@ const ( GENL_UNS_ADMIN_PERM = 0x10 GRND_NONBLOCK = 0x1 GRND_RANDOM = 0x2 + HDIO_DRIVE_CMD = 0x31f + HDIO_DRIVE_CMD_AEB = 0x31e + HDIO_DRIVE_CMD_HDR_SIZE = 0x4 + HDIO_DRIVE_HOB_HDR_SIZE = 0x8 + HDIO_DRIVE_RESET = 0x31c + HDIO_DRIVE_TASK = 0x31e + HDIO_DRIVE_TASKFILE = 0x31d + HDIO_DRIVE_TASK_HDR_SIZE = 0x8 + HDIO_GETGEO = 0x301 + HDIO_GET_32BIT = 0x309 + HDIO_GET_ACOUSTIC = 0x30f + HDIO_GET_ADDRESS = 0x310 + HDIO_GET_BUSSTATE = 0x31a + HDIO_GET_DMA = 0x30b + HDIO_GET_IDENTITY = 0x30d + HDIO_GET_KEEPSETTINGS = 0x308 + HDIO_GET_MULTCOUNT = 0x304 + HDIO_GET_NICE = 0x30c + HDIO_GET_NOWERR = 0x30a + HDIO_GET_QDMA = 0x305 + HDIO_GET_UNMASKINTR = 0x302 + HDIO_GET_WCACHE = 0x30e + HDIO_OBSOLETE_IDENTITY = 0x307 + HDIO_SCAN_HWIF = 0x328 + HDIO_SET_32BIT = 0x324 + HDIO_SET_ACOUSTIC = 0x32c + HDIO_SET_ADDRESS = 0x32f + HDIO_SET_BUSSTATE = 0x32d + HDIO_SET_DMA = 0x326 + HDIO_SET_KEEPSETTINGS = 0x323 + HDIO_SET_MULTCOUNT = 0x321 + HDIO_SET_NICE = 0x329 + HDIO_SET_NOWERR = 0x325 + HDIO_SET_PIO_MODE = 0x327 + HDIO_SET_QDMA = 0x32e + HDIO_SET_UNMASKINTR = 0x322 + HDIO_SET_WCACHE = 0x32b + HDIO_SET_XFER = 0x306 + HDIO_TRISTATE_HWIF = 0x31b + HDIO_UNREGISTER_HWIF = 0x32a + HOSTFS_SUPER_MAGIC = 0xc0ffee + HPFS_SUPER_MAGIC = 0xf995e849 + HUGETLBFS_MAGIC = 0x958458f6 HUPCL = 0x4000 IBSHIFT = 0x10 ICANON = 0x100 @@ -561,6 +650,8 @@ const ( IFF_MASTER = 0x400 IFF_MULTICAST = 0x1000 IFF_MULTI_QUEUE = 0x100 + IFF_NAPI = 0x10 + IFF_NAPI_FRAGS = 0x20 IFF_NOARP = 0x80 IFF_NOFILTER = 0x1000 IFF_NOTRAILERS = 0x20 @@ -775,12 +866,14 @@ const ( IP_UNICAST_IF = 0x32 IP_XFRM_POLICY = 0x11 ISIG = 0x80 + ISOFS_SUPER_MAGIC = 0x9660 ISTRIP = 0x20 IUCLC = 0x1000 IUTF8 = 0x4000 IXANY = 0x800 IXOFF = 0x400 IXON = 0x200 + JFFS2_SUPER_MAGIC = 0x72b6 KEYCTL_ASSUME_AUTHORITY = 0x10 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 @@ -845,6 +938,7 @@ const ( MADV_FREE = 0x8 MADV_HUGEPAGE = 0xe MADV_HWPOISON = 0x64 + MADV_KEEPONFORK = 0x13 MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 @@ -853,6 +947,7 @@ const ( MADV_SEQUENTIAL = 0x2 MADV_UNMERGEABLE = 0xd MADV_WILLNEED = 0x3 + MADV_WIPEONFORK = 0x12 MAP_ANON = 0x20 MAP_ANONYMOUS = 0x20 MAP_DENYWRITE = 0x800 @@ -874,9 +969,15 @@ const ( MCL_CURRENT = 0x2000 MCL_FUTURE = 0x4000 MCL_ONFAULT = 0x8000 + MINIX2_SUPER_MAGIC = 0x2468 + MINIX2_SUPER_MAGIC2 = 0x2478 + MINIX3_SUPER_MAGIC = 0x4d5a + MINIX_SUPER_MAGIC = 0x137f + MINIX_SUPER_MAGIC2 = 0x138f MNT_DETACH = 0x2 MNT_EXPIRE = 0x4 MNT_FORCE = 0x1 + MSDOS_SUPER_MAGIC = 0x4d44 MSG_BATCH = 0x40000 MSG_CMSG_CLOEXEC = 0x40000000 MSG_CONFIRM = 0x800 @@ -898,6 +999,7 @@ const ( MSG_TRYHARD = 0x4 MSG_WAITALL = 0x100 MSG_WAITFORONE = 0x10000 + MSG_ZEROCOPY = 0x4000000 MS_ACTIVE = 0x40000000 MS_ASYNC = 0x1 MS_BIND = 0x1000 @@ -935,7 +1037,9 @@ const ( MS_SYNCHRONOUS = 0x10 MS_UNBINDABLE = 0x20000 MS_VERBOSE = 0x8000 + MTD_INODE_FS_MAGIC = 0x11307854 NAME_MAX = 0xff + NCP_SUPER_MAGIC = 0x564c NETLINK_ADD_MEMBERSHIP = 0x1 NETLINK_AUDIT = 0x9 NETLINK_BROADCAST_ERROR = 0x4 @@ -970,6 +1074,37 @@ const ( NETLINK_UNUSED = 0x1 NETLINK_USERSOCK = 0x2 NETLINK_XFRM = 0x6 + NFNETLINK_V0 = 0x0 + NFNLGRP_ACCT_QUOTA = 0x8 + NFNLGRP_CONNTRACK_DESTROY = 0x3 + NFNLGRP_CONNTRACK_EXP_DESTROY = 0x6 + NFNLGRP_CONNTRACK_EXP_NEW = 0x4 + NFNLGRP_CONNTRACK_EXP_UPDATE = 0x5 + NFNLGRP_CONNTRACK_NEW = 0x1 + NFNLGRP_CONNTRACK_UPDATE = 0x2 + NFNLGRP_MAX = 0x9 + NFNLGRP_NFTABLES = 0x7 + NFNLGRP_NFTRACE = 0x9 + NFNLGRP_NONE = 0x0 + NFNL_BATCH_MAX = 0x1 + NFNL_MSG_BATCH_BEGIN = 0x10 + NFNL_MSG_BATCH_END = 0x11 + NFNL_NFA_NEST = 0x8000 + NFNL_SUBSYS_ACCT = 0x7 + NFNL_SUBSYS_COUNT = 0xc + NFNL_SUBSYS_CTHELPER = 0x9 + NFNL_SUBSYS_CTNETLINK = 0x1 + NFNL_SUBSYS_CTNETLINK_EXP = 0x2 + NFNL_SUBSYS_CTNETLINK_TIMEOUT = 0x8 + NFNL_SUBSYS_IPSET = 0x6 + NFNL_SUBSYS_NFTABLES = 0xa + NFNL_SUBSYS_NFT_COMPAT = 0xb + NFNL_SUBSYS_NONE = 0x0 + NFNL_SUBSYS_OSF = 0x5 + NFNL_SUBSYS_QUEUE = 0x3 + NFNL_SUBSYS_ULOG = 0x4 + NFS_SUPER_MAGIC = 0x6969 + NILFS_SUPER_MAGIC = 0x3434 NL0 = 0x0 NL1 = 0x100 NL2 = 0x200 @@ -999,10 +1134,13 @@ const ( NLM_F_EXCL = 0x200 NLM_F_MATCH = 0x200 NLM_F_MULTI = 0x2 + NLM_F_NONREC = 0x100 NLM_F_REPLACE = 0x100 NLM_F_REQUEST = 0x1 NLM_F_ROOT = 0x100 NOFLSH = 0x80000000 + NSFS_MAGIC = 0x6e736673 + OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 OFILL = 0x40 @@ -1010,7 +1148,9 @@ const ( ONLCR = 0x2 ONLRET = 0x20 ONOCR = 0x10 + OPENPROM_SUPER_MAGIC = 0x9fa1 OPOST = 0x1 + OVERLAYFS_SUPER_MAGIC = 0x794c7630 O_ACCMODE = 0x3 O_APPEND = 0x400 O_ASYNC = 0x2000 @@ -1095,16 +1235,20 @@ const ( PERF_EVENT_IOC_DISABLE = 0x20002401 PERF_EVENT_IOC_ENABLE = 0x20002400 PERF_EVENT_IOC_ID = 0x40082407 + PERF_EVENT_IOC_MODIFY_ATTRIBUTES = 0x8008240b PERF_EVENT_IOC_PAUSE_OUTPUT = 0x80042409 PERF_EVENT_IOC_PERIOD = 0x80082404 + PERF_EVENT_IOC_QUERY_BPF = 0xc008240a PERF_EVENT_IOC_REFRESH = 0x20002402 PERF_EVENT_IOC_RESET = 0x20002403 PERF_EVENT_IOC_SET_BPF = 0x80042408 PERF_EVENT_IOC_SET_FILTER = 0x80082406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 + PIPEFS_MAGIC = 0x50495045 PRIO_PGRP = 0x1 PRIO_PROCESS = 0x0 PRIO_USER = 0x2 + PROC_SUPER_MAGIC = 0x9fa0 PROT_EXEC = 0x4 PROT_GROWSDOWN = 0x1000000 PROT_GROWSUP = 0x2000000 @@ -1148,6 +1292,7 @@ const ( PR_GET_PDEATHSIG = 0x2 PR_GET_SECCOMP = 0x15 PR_GET_SECUREBITS = 0x1b + PR_GET_SPECULATION_CTRL = 0x34 PR_GET_THP_DISABLE = 0x2a PR_GET_TID_ADDRESS = 0x28 PR_GET_TIMERSLACK = 0x1e @@ -1193,11 +1338,23 @@ const ( PR_SET_PTRACER_ANY = 0xffffffffffffffff PR_SET_SECCOMP = 0x16 PR_SET_SECUREBITS = 0x1c + PR_SET_SPECULATION_CTRL = 0x35 PR_SET_THP_DISABLE = 0x29 PR_SET_TIMERSLACK = 0x1d PR_SET_TIMING = 0xe PR_SET_TSC = 0x1a PR_SET_UNALIGN = 0x6 + PR_SPEC_DISABLE = 0x4 + PR_SPEC_ENABLE = 0x2 + PR_SPEC_FORCE_DISABLE = 0x8 + PR_SPEC_NOT_AFFECTED = 0x0 + PR_SPEC_PRCTL = 0x1 + PR_SPEC_STORE_BYPASS = 0x0 + PR_SVE_GET_VL = 0x33 + PR_SVE_SET_VL = 0x32 + PR_SVE_SET_VL_ONEXEC = 0x40000 + PR_SVE_VL_INHERIT = 0x20000 + PR_SVE_VL_LEN_MASK = 0xffff PR_TASK_PERF_EVENTS_DISABLE = 0x1f PR_TASK_PERF_EVENTS_ENABLE = 0x20 PR_TIMING_STATISTICAL = 0x0 @@ -1206,6 +1363,7 @@ const ( PR_TSC_SIGSEGV = 0x2 PR_UNALIGN_NOPRINT = 0x1 PR_UNALIGN_SIGBUS = 0x2 + PSTOREFS_MAGIC = 0x6165676c PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 @@ -1251,6 +1409,7 @@ const ( PTRACE_POKETEXT = 0x4 PTRACE_POKEUSR = 0x6 PTRACE_SECCOMP_GET_FILTER = 0x420c + PTRACE_SECCOMP_GET_METADATA = 0x420d PTRACE_SEIZE = 0x4206 PTRACE_SETEVRREGS = 0x15 PTRACE_SETFPREGS = 0xf @@ -1320,6 +1479,11 @@ const ( PT_VSR0 = 0x96 PT_VSR31 = 0xd4 PT_XER = 0x25 + QNX4_SUPER_MAGIC = 0x2f + QNX6_SUPER_MAGIC = 0x68191122 + RAMFS_MAGIC = 0x858458f6 + RDTGROUP_SUPER_MAGIC = 0x7655821 + REISERFS_SUPER_MAGIC = 0x52654973 RLIMIT_AS = 0x9 RLIMIT_CORE = 0x4 RLIMIT_CPU = 0x0 @@ -1340,6 +1504,7 @@ const ( RTAX_ADVMSS = 0x8 RTAX_CC_ALGO = 0x10 RTAX_CWND = 0x7 + RTAX_FASTOPEN_NO_COOKIE = 0x11 RTAX_FEATURES = 0xc RTAX_FEATURE_ALLFRAG = 0x8 RTAX_FEATURE_ECN = 0x1 @@ -1350,7 +1515,7 @@ const ( RTAX_INITCWND = 0xb RTAX_INITRWND = 0xe RTAX_LOCK = 0x1 - RTAX_MAX = 0x10 + RTAX_MAX = 0x11 RTAX_MTU = 0x2 RTAX_QUICKACK = 0xf RTAX_REORDERING = 0x9 @@ -1368,6 +1533,33 @@ const ( RTCF_MASQ = 0x400000 RTCF_NAT = 0x800000 RTCF_VALVE = 0x200000 + RTC_AF = 0x20 + RTC_AIE_OFF = 0x20007002 + RTC_AIE_ON = 0x20007001 + RTC_ALM_READ = 0x40247008 + RTC_ALM_SET = 0x80247007 + RTC_EPOCH_READ = 0x4008700d + RTC_EPOCH_SET = 0x8008700e + RTC_IRQF = 0x80 + RTC_IRQP_READ = 0x4008700b + RTC_IRQP_SET = 0x8008700c + RTC_MAX_FREQ = 0x2000 + RTC_PF = 0x40 + RTC_PIE_OFF = 0x20007006 + RTC_PIE_ON = 0x20007005 + RTC_PLL_GET = 0x40207011 + RTC_PLL_SET = 0x80207012 + RTC_RD_TIME = 0x40247009 + RTC_SET_TIME = 0x8024700a + RTC_UF = 0x10 + RTC_UIE_OFF = 0x20007004 + RTC_UIE_ON = 0x20007003 + RTC_VL_CLR = 0x20007014 + RTC_VL_READ = 0x40047013 + RTC_WIE_OFF = 0x20007010 + RTC_WIE_ON = 0x2000700f + RTC_WKALM_RD = 0x40287010 + RTC_WKALM_SET = 0x8028700f RTF_ADDRCLASSMASK = 0xf8000000 RTF_ADDRCONF = 0x40000 RTF_ALLONLINK = 0x20000 @@ -1504,6 +1696,8 @@ const ( SECCOMP_MODE_DISABLED = 0x0 SECCOMP_MODE_FILTER = 0x2 SECCOMP_MODE_STRICT = 0x1 + SECURITYFS_MAGIC = 0x73636673 + SELINUX_MAGIC = 0xf97cff8c SHUT_RD = 0x0 SHUT_RDWR = 0x2 SHUT_WR = 0x1 @@ -1588,6 +1782,23 @@ const ( SIOCSPGRP = 0x8902 SIOCSRARP = 0x8962 SIOCWANDEV = 0x894a + SMACK_MAGIC = 0x43415d53 + SMART_AUTOSAVE = 0xd2 + SMART_AUTO_OFFLINE = 0xdb + SMART_DISABLE = 0xd9 + SMART_ENABLE = 0xd8 + SMART_HCYL_PASS = 0xc2 + SMART_IMMEDIATE_OFFLINE = 0xd4 + SMART_LCYL_PASS = 0x4f + SMART_READ_LOG_SECTOR = 0xd5 + SMART_READ_THRESHOLDS = 0xd1 + SMART_READ_VALUES = 0xd0 + SMART_SAVE = 0xd3 + SMART_STATUS = 0xda + SMART_WRITE_LOG_SECTOR = 0xd6 + SMART_WRITE_THRESHOLDS = 0xd7 + SMB_SUPER_MAGIC = 0x517b + SOCKFS_MAGIC = 0x534f434b SOCK_CLOEXEC = 0x80000 SOCK_DCCP = 0x6 SOCK_DGRAM = 0x2 @@ -1624,6 +1835,7 @@ const ( SOL_SOCKET = 0x1 SOL_TCP = 0x6 SOL_TIPC = 0x10f + SOL_TLS = 0x11a SOL_X25 = 0x106 SOMAXCONN = 0x80 SO_ACCEPTCONN = 0x1e @@ -1692,10 +1904,13 @@ const ( SO_VM_SOCKETS_PEER_HOST_VM_ID = 0x3 SO_VM_SOCKETS_TRUSTED = 0x5 SO_WIFI_STATUS = 0x29 + SO_ZEROCOPY = 0x3c SPLICE_F_GIFT = 0x8 SPLICE_F_MORE = 0x4 SPLICE_F_MOVE = 0x1 SPLICE_F_NONBLOCK = 0x2 + SQUASHFS_MAGIC = 0x73717368 + STACK_END_MAGIC = 0x57ac6e9d STATX_ALL = 0xfff STATX_ATIME = 0x20 STATX_ATTR_APPEND = 0x20 @@ -1717,6 +1932,7 @@ const ( STATX_TYPE = 0x1 STATX_UID = 0x8 STATX__RESERVED = 0x80000000 + SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 S_IFBLK = 0x6000 @@ -1786,6 +2002,8 @@ const ( TCP_MAXWIN = 0xffff TCP_MAX_WINSHIFT = 0xe TCP_MD5SIG = 0xe + TCP_MD5SIG_EXT = 0x20 + TCP_MD5SIG_FLAG_PREFIX = 0x1 TCP_MD5SIG_MAXKEYLEN = 0x50 TCP_MSS = 0x200 TCP_MSS_DEFAULT = 0x218 @@ -1806,6 +2024,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa TCSAFLUSH = 0x2 @@ -1899,7 +2118,27 @@ const ( TIOCSTOP = 0x2000746f TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TMPFS_MAGIC = 0x1021994 TOSTOP = 0x400000 + TPACKET_ALIGNMENT = 0x10 + TPACKET_HDRLEN = 0x34 + TP_STATUS_AVAILABLE = 0x0 + TP_STATUS_BLK_TMO = 0x20 + TP_STATUS_COPY = 0x2 + TP_STATUS_CSUMNOTREADY = 0x8 + TP_STATUS_CSUM_VALID = 0x80 + TP_STATUS_KERNEL = 0x0 + TP_STATUS_LOSING = 0x4 + TP_STATUS_SENDING = 0x2 + TP_STATUS_SEND_REQUEST = 0x1 + TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_SOFTWARE = 0x20000000 + TP_STATUS_TS_SYS_HARDWARE = 0x40000000 + TP_STATUS_USER = 0x1 + TP_STATUS_VLAN_TPID_VALID = 0x40 + TP_STATUS_VLAN_VALID = 0x10 + TP_STATUS_WRONG_FORMAT = 0x4 + TRACEFS_MAGIC = 0x74726163 TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x801054d5 TUNDETACHFILTER = 0x801054d6 @@ -1911,6 +2150,7 @@ const ( TUNGETVNETHDRSZ = 0x400454d7 TUNGETVNETLE = 0x400454dd TUNSETDEBUG = 0x800454c9 + TUNSETFILTEREBPF = 0x400454e1 TUNSETGROUP = 0x800454ce TUNSETIFF = 0x800454ca TUNSETIFINDEX = 0x800454da @@ -1921,13 +2161,17 @@ const ( TUNSETPERSIST = 0x800454cb TUNSETQUEUE = 0x800454d9 TUNSETSNDBUF = 0x800454d4 + TUNSETSTEERINGEBPF = 0x400454e0 TUNSETTXFILTER = 0x800454d1 TUNSETVNETBE = 0x800454de TUNSETVNETHDRSZ = 0x800454d8 TUNSETVNETLE = 0x800454dc + UDF_SUPER_MAGIC = 0x15013346 UMOUNT_NOFOLLOW = 0x8 + USBDEVICE_SUPER_MAGIC = 0x9fa2 UTIME_NOW = 0x3fffffff UTIME_OMIT = 0x3ffffffe + V9FS_MAGIC = 0x1021997 VDISCARD = 0x10 VEOF = 0x4 VEOL = 0x6 @@ -1969,6 +2213,86 @@ const ( WDIOC_SETPRETIMEOUT = 0xc0045708 WDIOC_SETTIMEOUT = 0xc0045706 WEXITED = 0x4 + WIN_ACKMEDIACHANGE = 0xdb + WIN_CHECKPOWERMODE1 = 0xe5 + WIN_CHECKPOWERMODE2 = 0x98 + WIN_DEVICE_RESET = 0x8 + WIN_DIAGNOSE = 0x90 + WIN_DOORLOCK = 0xde + WIN_DOORUNLOCK = 0xdf + WIN_DOWNLOAD_MICROCODE = 0x92 + WIN_FLUSH_CACHE = 0xe7 + WIN_FLUSH_CACHE_EXT = 0xea + WIN_FORMAT = 0x50 + WIN_GETMEDIASTATUS = 0xda + WIN_IDENTIFY = 0xec + WIN_IDENTIFY_DMA = 0xee + WIN_IDLEIMMEDIATE = 0xe1 + WIN_INIT = 0x60 + WIN_MEDIAEJECT = 0xed + WIN_MULTREAD = 0xc4 + WIN_MULTREAD_EXT = 0x29 + WIN_MULTWRITE = 0xc5 + WIN_MULTWRITE_EXT = 0x39 + WIN_NOP = 0x0 + WIN_PACKETCMD = 0xa0 + WIN_PIDENTIFY = 0xa1 + WIN_POSTBOOT = 0xdc + WIN_PREBOOT = 0xdd + WIN_QUEUED_SERVICE = 0xa2 + WIN_READ = 0x20 + WIN_READDMA = 0xc8 + WIN_READDMA_EXT = 0x25 + WIN_READDMA_ONCE = 0xc9 + WIN_READDMA_QUEUED = 0xc7 + WIN_READDMA_QUEUED_EXT = 0x26 + WIN_READ_BUFFER = 0xe4 + WIN_READ_EXT = 0x24 + WIN_READ_LONG = 0x22 + WIN_READ_LONG_ONCE = 0x23 + WIN_READ_NATIVE_MAX = 0xf8 + WIN_READ_NATIVE_MAX_EXT = 0x27 + WIN_READ_ONCE = 0x21 + WIN_RECAL = 0x10 + WIN_RESTORE = 0x10 + WIN_SECURITY_DISABLE = 0xf6 + WIN_SECURITY_ERASE_PREPARE = 0xf3 + WIN_SECURITY_ERASE_UNIT = 0xf4 + WIN_SECURITY_FREEZE_LOCK = 0xf5 + WIN_SECURITY_SET_PASS = 0xf1 + WIN_SECURITY_UNLOCK = 0xf2 + WIN_SEEK = 0x70 + WIN_SETFEATURES = 0xef + WIN_SETIDLE1 = 0xe3 + WIN_SETIDLE2 = 0x97 + WIN_SETMULT = 0xc6 + WIN_SET_MAX = 0xf9 + WIN_SET_MAX_EXT = 0x37 + WIN_SLEEPNOW1 = 0xe6 + WIN_SLEEPNOW2 = 0x99 + WIN_SMART = 0xb0 + WIN_SPECIFY = 0x91 + WIN_SRST = 0x8 + WIN_STANDBY = 0xe2 + WIN_STANDBY2 = 0x96 + WIN_STANDBYNOW1 = 0xe0 + WIN_STANDBYNOW2 = 0x94 + WIN_VERIFY = 0x40 + WIN_VERIFY_EXT = 0x42 + WIN_VERIFY_ONCE = 0x41 + WIN_WRITE = 0x30 + WIN_WRITEDMA = 0xca + WIN_WRITEDMA_EXT = 0x35 + WIN_WRITEDMA_ONCE = 0xcb + WIN_WRITEDMA_QUEUED = 0xcc + WIN_WRITEDMA_QUEUED_EXT = 0x36 + WIN_WRITE_BUFFER = 0xe8 + WIN_WRITE_EXT = 0x34 + WIN_WRITE_LONG = 0x32 + WIN_WRITE_LONG_ONCE = 0x33 + WIN_WRITE_ONCE = 0x31 + WIN_WRITE_SAME = 0xe9 + WIN_WRITE_VERIFY = 0x3c WNOHANG = 0x1 WNOTHREAD = 0x20000000 WNOWAIT = 0x1000000 @@ -1978,7 +2302,9 @@ const ( XATTR_CREATE = 0x1 XATTR_REPLACE = 0x2 XCASE = 0x4000 + XENFS_SUPER_MAGIC = 0xabba1974 XTABS = 0xc00 + ZSMALLOC_MAGIC = 0x58295829 ) // Errors @@ -2158,172 +2484,180 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "no such device or address", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource temporarily unavailable", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device or resource busy", - 17: "file exists", - 18: "invalid cross-device link", - 19: "no such device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "numerical result out of range", - 35: "resource deadlock avoided", - 36: "file name too long", - 37: "no locks available", - 38: "function not implemented", - 39: "directory not empty", - 40: "too many levels of symbolic links", - 42: "no message of desired type", - 43: "identifier removed", - 44: "channel number out of range", - 45: "level 2 not synchronized", - 46: "level 3 halted", - 47: "level 3 reset", - 48: "link number out of range", - 49: "protocol driver not attached", - 50: "no CSI structure available", - 51: "level 2 halted", - 52: "invalid exchange", - 53: "invalid request descriptor", - 54: "exchange full", - 55: "no anode", - 56: "invalid request code", - 57: "invalid slot", - 58: "file locking deadlock error", - 59: "bad font file format", - 60: "device not a stream", - 61: "no data available", - 62: "timer expired", - 63: "out of streams resources", - 64: "machine is not on the network", - 65: "package not installed", - 66: "object is remote", - 67: "link has been severed", - 68: "advertise error", - 69: "srmount error", - 70: "communication error on send", - 71: "protocol error", - 72: "multihop attempted", - 73: "RFS specific error", - 74: "bad message", - 75: "value too large for defined data type", - 76: "name not unique on network", - 77: "file descriptor in bad state", - 78: "remote address changed", - 79: "can not access a needed shared library", - 80: "accessing a corrupted shared library", - 81: ".lib section in a.out corrupted", - 82: "attempting to link in too many shared libraries", - 83: "cannot exec a shared library directly", - 84: "invalid or incomplete multibyte or wide character", - 85: "interrupted system call should be restarted", - 86: "streams pipe error", - 87: "too many users", - 88: "socket operation on non-socket", - 89: "destination address required", - 90: "message too long", - 91: "protocol wrong type for socket", - 92: "protocol not available", - 93: "protocol not supported", - 94: "socket type not supported", - 95: "operation not supported", - 96: "protocol family not supported", - 97: "address family not supported by protocol", - 98: "address already in use", - 99: "cannot assign requested address", - 100: "network is down", - 101: "network is unreachable", - 102: "network dropped connection on reset", - 103: "software caused connection abort", - 104: "connection reset by peer", - 105: "no buffer space available", - 106: "transport endpoint is already connected", - 107: "transport endpoint is not connected", - 108: "cannot send after transport endpoint shutdown", - 109: "too many references: cannot splice", - 110: "connection timed out", - 111: "connection refused", - 112: "host is down", - 113: "no route to host", - 114: "operation already in progress", - 115: "operation now in progress", - 116: "stale file handle", - 117: "structure needs cleaning", - 118: "not a XENIX named type file", - 119: "no XENIX semaphores available", - 120: "is a named type file", - 121: "remote I/O error", - 122: "disk quota exceeded", - 123: "no medium found", - 124: "wrong medium type", - 125: "operation canceled", - 126: "required key not available", - 127: "key has expired", - 128: "key has been revoked", - 129: "key was rejected by service", - 130: "owner died", - 131: "state not recoverable", - 132: "operation not possible due to RF-kill", - 133: "memory page has hardware error", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "no such device or address"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EAGAIN", "resource temporarily unavailable"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device or resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "invalid cross-device link"}, + {19, "ENODEV", "no such device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "numerical result out of range"}, + {35, "EDEADLK", "resource deadlock avoided"}, + {36, "ENAMETOOLONG", "file name too long"}, + {37, "ENOLCK", "no locks available"}, + {38, "ENOSYS", "function not implemented"}, + {39, "ENOTEMPTY", "directory not empty"}, + {40, "ELOOP", "too many levels of symbolic links"}, + {42, "ENOMSG", "no message of desired type"}, + {43, "EIDRM", "identifier removed"}, + {44, "ECHRNG", "channel number out of range"}, + {45, "EL2NSYNC", "level 2 not synchronized"}, + {46, "EL3HLT", "level 3 halted"}, + {47, "EL3RST", "level 3 reset"}, + {48, "ELNRNG", "link number out of range"}, + {49, "EUNATCH", "protocol driver not attached"}, + {50, "ENOCSI", "no CSI structure available"}, + {51, "EL2HLT", "level 2 halted"}, + {52, "EBADE", "invalid exchange"}, + {53, "EBADR", "invalid request descriptor"}, + {54, "EXFULL", "exchange full"}, + {55, "ENOANO", "no anode"}, + {56, "EBADRQC", "invalid request code"}, + {57, "EBADSLT", "invalid slot"}, + {58, "EDEADLOCK", "file locking deadlock error"}, + {59, "EBFONT", "bad font file format"}, + {60, "ENOSTR", "device not a stream"}, + {61, "ENODATA", "no data available"}, + {62, "ETIME", "timer expired"}, + {63, "ENOSR", "out of streams resources"}, + {64, "ENONET", "machine is not on the network"}, + {65, "ENOPKG", "package not installed"}, + {66, "EREMOTE", "object is remote"}, + {67, "ENOLINK", "link has been severed"}, + {68, "EADV", "advertise error"}, + {69, "ESRMNT", "srmount error"}, + {70, "ECOMM", "communication error on send"}, + {71, "EPROTO", "protocol error"}, + {72, "EMULTIHOP", "multihop attempted"}, + {73, "EDOTDOT", "RFS specific error"}, + {74, "EBADMSG", "bad message"}, + {75, "EOVERFLOW", "value too large for defined data type"}, + {76, "ENOTUNIQ", "name not unique on network"}, + {77, "EBADFD", "file descriptor in bad state"}, + {78, "EREMCHG", "remote address changed"}, + {79, "ELIBACC", "can not access a needed shared library"}, + {80, "ELIBBAD", "accessing a corrupted shared library"}, + {81, "ELIBSCN", ".lib section in a.out corrupted"}, + {82, "ELIBMAX", "attempting to link in too many shared libraries"}, + {83, "ELIBEXEC", "cannot exec a shared library directly"}, + {84, "EILSEQ", "invalid or incomplete multibyte or wide character"}, + {85, "ERESTART", "interrupted system call should be restarted"}, + {86, "ESTRPIPE", "streams pipe error"}, + {87, "EUSERS", "too many users"}, + {88, "ENOTSOCK", "socket operation on non-socket"}, + {89, "EDESTADDRREQ", "destination address required"}, + {90, "EMSGSIZE", "message too long"}, + {91, "EPROTOTYPE", "protocol wrong type for socket"}, + {92, "ENOPROTOOPT", "protocol not available"}, + {93, "EPROTONOSUPPORT", "protocol not supported"}, + {94, "ESOCKTNOSUPPORT", "socket type not supported"}, + {95, "ENOTSUP", "operation not supported"}, + {96, "EPFNOSUPPORT", "protocol family not supported"}, + {97, "EAFNOSUPPORT", "address family not supported by protocol"}, + {98, "EADDRINUSE", "address already in use"}, + {99, "EADDRNOTAVAIL", "cannot assign requested address"}, + {100, "ENETDOWN", "network is down"}, + {101, "ENETUNREACH", "network is unreachable"}, + {102, "ENETRESET", "network dropped connection on reset"}, + {103, "ECONNABORTED", "software caused connection abort"}, + {104, "ECONNRESET", "connection reset by peer"}, + {105, "ENOBUFS", "no buffer space available"}, + {106, "EISCONN", "transport endpoint is already connected"}, + {107, "ENOTCONN", "transport endpoint is not connected"}, + {108, "ESHUTDOWN", "cannot send after transport endpoint shutdown"}, + {109, "ETOOMANYREFS", "too many references: cannot splice"}, + {110, "ETIMEDOUT", "connection timed out"}, + {111, "ECONNREFUSED", "connection refused"}, + {112, "EHOSTDOWN", "host is down"}, + {113, "EHOSTUNREACH", "no route to host"}, + {114, "EALREADY", "operation already in progress"}, + {115, "EINPROGRESS", "operation now in progress"}, + {116, "ESTALE", "stale file handle"}, + {117, "EUCLEAN", "structure needs cleaning"}, + {118, "ENOTNAM", "not a XENIX named type file"}, + {119, "ENAVAIL", "no XENIX semaphores available"}, + {120, "EISNAM", "is a named type file"}, + {121, "EREMOTEIO", "remote I/O error"}, + {122, "EDQUOT", "disk quota exceeded"}, + {123, "ENOMEDIUM", "no medium found"}, + {124, "EMEDIUMTYPE", "wrong medium type"}, + {125, "ECANCELED", "operation canceled"}, + {126, "ENOKEY", "required key not available"}, + {127, "EKEYEXPIRED", "key has expired"}, + {128, "EKEYREVOKED", "key has been revoked"}, + {129, "EKEYREJECTED", "key was rejected by service"}, + {130, "EOWNERDEAD", "owner died"}, + {131, "ENOTRECOVERABLE", "state not recoverable"}, + {132, "ERFKILL", "operation not possible due to RF-kill"}, + {133, "EHWPOISON", "memory page has hardware error"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/breakpoint trap", - 6: "aborted", - 7: "bus error", - 8: "floating point exception", - 9: "killed", - 10: "user defined signal 1", - 11: "segmentation fault", - 12: "user defined signal 2", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "stack fault", - 17: "child exited", - 18: "continued", - 19: "stopped (signal)", - 20: "stopped", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "urgent I/O condition", - 24: "CPU time limit exceeded", - 25: "file size limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window changed", - 29: "I/O possible", - 30: "power failure", - 31: "bad system call", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/breakpoint trap"}, + {6, "SIGABRT", "aborted"}, + {7, "SIGBUS", "bus error"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGUSR1", "user defined signal 1"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGUSR2", "user defined signal 2"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGSTKFLT", "stack fault"}, + {17, "SIGCHLD", "child exited"}, + {18, "SIGCONT", "continued"}, + {19, "SIGSTOP", "stopped (signal)"}, + {20, "SIGTSTP", "stopped"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGURG", "urgent I/O condition"}, + {24, "SIGXCPU", "CPU time limit exceeded"}, + {25, "SIGXFSZ", "file size limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window changed"}, + {29, "SIGIO", "I/O possible"}, + {30, "SIGPWR", "power failure"}, + {31, "SIGSYS", "bad system call"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go index 6a8032439b..63493756d8 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_ppc64le.go @@ -3,7 +3,7 @@ // +build ppc64le,linux -// Created by cgo -godefs - DO NOT EDIT +// Code generated by cmd/cgo -godefs; DO NOT EDIT. // cgo -godefs -- -Wall -Werror -static -I/tmp/include _const.go package unix @@ -11,6 +11,11 @@ package unix import "syscall" const ( + AAFS_MAGIC = 0x5a3c69f0 + ADFS_SUPER_MAGIC = 0xadf5 + AFFS_SUPER_MAGIC = 0xadff + AFS_FS_MAGIC = 0x6b414653 + AFS_SUPER_MAGIC = 0x5346414f AF_ALG = 0x26 AF_APPLETALK = 0x5 AF_ASH = 0x12 @@ -66,6 +71,7 @@ const ( ALG_SET_IV = 0x2 ALG_SET_KEY = 0x1 ALG_SET_OP = 0x3 + ANON_INODE_FS_MAGIC = 0x9041934 ARPHRD_6LOWPAN = 0x339 ARPHRD_ADAPT = 0x108 ARPHRD_APPLETLK = 0x8 @@ -121,6 +127,7 @@ const ( ARPHRD_PPP = 0x200 ARPHRD_PRONET = 0x4 ARPHRD_RAWHDLC = 0x206 + ARPHRD_RAWIP = 0x207 ARPHRD_ROSE = 0x10e ARPHRD_RSRVD = 0x104 ARPHRD_SIT = 0x308 @@ -132,6 +139,7 @@ const ( ARPHRD_VOID = 0xffff ARPHRD_VSOCKMON = 0x33a ARPHRD_X25 = 0x10f + AUTOFS_SUPER_MAGIC = 0x187 B0 = 0x0 B1000000 = 0x17 B110 = 0x3 @@ -163,6 +171,9 @@ const ( B75 = 0x2 B921600 = 0x16 B9600 = 0xd + BALLOON_KVM_MAGIC = 0x13661366 + BDEVFS_MAGIC = 0x62646576 + BINFMTFS_MAGIC = 0x42494e4d BLKBSZGET = 0x40081270 BLKBSZSET = 0x80081271 BLKFLSBUF = 0x20001261 @@ -187,6 +198,7 @@ const ( BPF_AND = 0x50 BPF_B = 0x10 BPF_DIV = 0x30 + BPF_FS_MAGIC = 0xcafe4a11 BPF_H = 0x8 BPF_IMM = 0x0 BPF_IND = 0x40 @@ -228,6 +240,8 @@ const ( BS0 = 0x0 BS1 = 0x8000 BSDLY = 0x8000 + BTRFS_SUPER_MAGIC = 0x9123683e + BTRFS_TEST_MAGIC = 0x73727279 CAN_BCM = 0x2 CAN_EFF_FLAG = 0x80000000 CAN_EFF_ID_BITS = 0x1d @@ -251,6 +265,8 @@ const ( CBAUD = 0xff CBAUDEX = 0x0 CFLUSH = 0xf + CGROUP2_SUPER_MAGIC = 0x63677270 + CGROUP_SUPER_MAGIC = 0x27e0eb CIBAUD = 0xff0000 CLOCAL = 0x8000 CLOCK_BOOTTIME = 0x7 @@ -293,10 +309,12 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CMSPAR = 0x40000000 + CODA_SUPER_MAGIC = 0x73757245 CR0 = 0x0 CR1 = 0x1000 CR2 = 0x2000 CR3 = 0x3000 + CRAMFS_MAGIC = 0x28cd3d45 CRDLY = 0x3000 CREAD = 0x800 CRTSCTS = 0x80000000 @@ -311,6 +329,9 @@ const ( CSTOP = 0x13 CSTOPB = 0x400 CSUSP = 0x1a + DAXFS_MAGIC = 0x64646178 + DEBUGFS_MAGIC = 0x64626720 + DEVPTS_SUPER_MAGIC = 0x1cd1 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -327,9 +348,12 @@ const ( ECHOKE = 0x1 ECHONL = 0x10 ECHOPRT = 0x20 + ECRYPTFS_SUPER_MAGIC = 0xf15f EFD_CLOEXEC = 0x80000 EFD_NONBLOCK = 0x800 EFD_SEMAPHORE = 0x1 + EFIVARFS_MAGIC = 0xde5e81e4 + EFS_SUPER_MAGIC = 0x414a53 ENCODING_DEFAULT = 0x0 ENCODING_FM_MARK = 0x3 ENCODING_FM_SPACE = 0x4 @@ -390,6 +414,8 @@ const ( ETH_P_DSA = 0x1b ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada + ETH_P_ERSPAN = 0x88be + ETH_P_ERSPAN2 = 0x22eb ETH_P_FCOE = 0x8906 ETH_P_FIP = 0x8914 ETH_P_HDLC = 0x19 @@ -398,6 +424,7 @@ const ( ETH_P_IEEE802154 = 0xf6 ETH_P_IEEEPUP = 0xa00 ETH_P_IEEEPUPAT = 0xa01 + ETH_P_IFE = 0xed3e ETH_P_IP = 0x800 ETH_P_IPV6 = 0x86dd ETH_P_IPX = 0x8137 @@ -408,11 +435,13 @@ const ( ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 ETH_P_MACSEC = 0x88e5 + ETH_P_MAP = 0xf9 ETH_P_MOBITEX = 0x15 ETH_P_MPLS_MC = 0x8848 ETH_P_MPLS_UC = 0x8847 ETH_P_MVRP = 0x88f5 ETH_P_NCSI = 0x88f8 + ETH_P_NSH = 0x894f ETH_P_PAE = 0x888e ETH_P_PAUSE = 0x8808 ETH_P_PHONET = 0xf5 @@ -420,6 +449,7 @@ const ( ETH_P_PPP_DISC = 0x8863 ETH_P_PPP_MP = 0x8 ETH_P_PPP_SES = 0x8864 + ETH_P_PREAUTH = 0x88c7 ETH_P_PRP = 0x88fb ETH_P_PUP = 0x200 ETH_P_PUPAT = 0x201 @@ -440,9 +470,14 @@ const ( ETH_P_WCCP = 0x883e ETH_P_X25 = 0x805 ETH_P_XDSA = 0xf8 + EXABYTE_ENABLE_NEST = 0xf0 + EXT2_SUPER_MAGIC = 0xef53 + EXT3_SUPER_MAGIC = 0xef53 + EXT4_SUPER_MAGIC = 0xef53 EXTA = 0xe EXTB = 0xf EXTPROC = 0x10000000 + F2FS_SUPER_MAGIC = 0xf2f52010 FALLOC_FL_COLLAPSE_RANGE = 0x8 FALLOC_FL_INSERT_RANGE = 0x20 FALLOC_FL_KEEP_SIZE = 0x1 @@ -476,6 +511,8 @@ const ( FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 FS_POLICY_FLAGS_VALID = 0x3 + FUTEXFS_SUPER_MAGIC = 0xbad1dea + F_ADD_SEALS = 0x409 F_DUPFD = 0x0 F_DUPFD_CLOEXEC = 0x406 F_EXLCK = 0x4 @@ -488,6 +525,9 @@ const ( F_GETOWN_EX = 0x10 F_GETPIPE_SZ = 0x408 F_GETSIG = 0xb + F_GET_FILE_RW_HINT = 0x40d + F_GET_RW_HINT = 0x40b + F_GET_SEALS = 0x40a F_LOCK = 0x1 F_NOTIFY = 0x402 F_OFD_GETLK = 0x24 @@ -495,6 +535,10 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_GROW = 0x4 + F_SEAL_SEAL = 0x1 + F_SEAL_SHRINK = 0x2 + F_SEAL_WRITE = 0x8 F_SETFD = 0x2 F_SETFL = 0x4 F_SETLEASE = 0x400 @@ -506,6 +550,8 @@ const ( F_SETOWN_EX = 0xf F_SETPIPE_SZ = 0x407 F_SETSIG = 0xa + F_SET_FILE_RW_HINT = 0x40e + F_SET_RW_HINT = 0x40c F_SHLCK = 0x8 F_TEST = 0x3 F_TLOCK = 0x2 @@ -527,6 +573,49 @@ const ( GENL_UNS_ADMIN_PERM = 0x10 GRND_NONBLOCK = 0x1 GRND_RANDOM = 0x2 + HDIO_DRIVE_CMD = 0x31f + HDIO_DRIVE_CMD_AEB = 0x31e + HDIO_DRIVE_CMD_HDR_SIZE = 0x4 + HDIO_DRIVE_HOB_HDR_SIZE = 0x8 + HDIO_DRIVE_RESET = 0x31c + HDIO_DRIVE_TASK = 0x31e + HDIO_DRIVE_TASKFILE = 0x31d + HDIO_DRIVE_TASK_HDR_SIZE = 0x8 + HDIO_GETGEO = 0x301 + HDIO_GET_32BIT = 0x309 + HDIO_GET_ACOUSTIC = 0x30f + HDIO_GET_ADDRESS = 0x310 + HDIO_GET_BUSSTATE = 0x31a + HDIO_GET_DMA = 0x30b + HDIO_GET_IDENTITY = 0x30d + HDIO_GET_KEEPSETTINGS = 0x308 + HDIO_GET_MULTCOUNT = 0x304 + HDIO_GET_NICE = 0x30c + HDIO_GET_NOWERR = 0x30a + HDIO_GET_QDMA = 0x305 + HDIO_GET_UNMASKINTR = 0x302 + HDIO_GET_WCACHE = 0x30e + HDIO_OBSOLETE_IDENTITY = 0x307 + HDIO_SCAN_HWIF = 0x328 + HDIO_SET_32BIT = 0x324 + HDIO_SET_ACOUSTIC = 0x32c + HDIO_SET_ADDRESS = 0x32f + HDIO_SET_BUSSTATE = 0x32d + HDIO_SET_DMA = 0x326 + HDIO_SET_KEEPSETTINGS = 0x323 + HDIO_SET_MULTCOUNT = 0x321 + HDIO_SET_NICE = 0x329 + HDIO_SET_NOWERR = 0x325 + HDIO_SET_PIO_MODE = 0x327 + HDIO_SET_QDMA = 0x32e + HDIO_SET_UNMASKINTR = 0x322 + HDIO_SET_WCACHE = 0x32b + HDIO_SET_XFER = 0x306 + HDIO_TRISTATE_HWIF = 0x31b + HDIO_UNREGISTER_HWIF = 0x32a + HOSTFS_SUPER_MAGIC = 0xc0ffee + HPFS_SUPER_MAGIC = 0xf995e849 + HUGETLBFS_MAGIC = 0x958458f6 HUPCL = 0x4000 IBSHIFT = 0x10 ICANON = 0x100 @@ -561,6 +650,8 @@ const ( IFF_MASTER = 0x400 IFF_MULTICAST = 0x1000 IFF_MULTI_QUEUE = 0x100 + IFF_NAPI = 0x10 + IFF_NAPI_FRAGS = 0x20 IFF_NOARP = 0x80 IFF_NOFILTER = 0x1000 IFF_NOTRAILERS = 0x20 @@ -775,12 +866,14 @@ const ( IP_UNICAST_IF = 0x32 IP_XFRM_POLICY = 0x11 ISIG = 0x80 + ISOFS_SUPER_MAGIC = 0x9660 ISTRIP = 0x20 IUCLC = 0x1000 IUTF8 = 0x4000 IXANY = 0x800 IXOFF = 0x400 IXON = 0x200 + JFFS2_SUPER_MAGIC = 0x72b6 KEYCTL_ASSUME_AUTHORITY = 0x10 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 @@ -845,6 +938,7 @@ const ( MADV_FREE = 0x8 MADV_HUGEPAGE = 0xe MADV_HWPOISON = 0x64 + MADV_KEEPONFORK = 0x13 MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 @@ -853,6 +947,7 @@ const ( MADV_SEQUENTIAL = 0x2 MADV_UNMERGEABLE = 0xd MADV_WILLNEED = 0x3 + MADV_WIPEONFORK = 0x12 MAP_ANON = 0x20 MAP_ANONYMOUS = 0x20 MAP_DENYWRITE = 0x800 @@ -874,9 +969,15 @@ const ( MCL_CURRENT = 0x2000 MCL_FUTURE = 0x4000 MCL_ONFAULT = 0x8000 + MINIX2_SUPER_MAGIC = 0x2468 + MINIX2_SUPER_MAGIC2 = 0x2478 + MINIX3_SUPER_MAGIC = 0x4d5a + MINIX_SUPER_MAGIC = 0x137f + MINIX_SUPER_MAGIC2 = 0x138f MNT_DETACH = 0x2 MNT_EXPIRE = 0x4 MNT_FORCE = 0x1 + MSDOS_SUPER_MAGIC = 0x4d44 MSG_BATCH = 0x40000 MSG_CMSG_CLOEXEC = 0x40000000 MSG_CONFIRM = 0x800 @@ -898,6 +999,7 @@ const ( MSG_TRYHARD = 0x4 MSG_WAITALL = 0x100 MSG_WAITFORONE = 0x10000 + MSG_ZEROCOPY = 0x4000000 MS_ACTIVE = 0x40000000 MS_ASYNC = 0x1 MS_BIND = 0x1000 @@ -935,7 +1037,9 @@ const ( MS_SYNCHRONOUS = 0x10 MS_UNBINDABLE = 0x20000 MS_VERBOSE = 0x8000 + MTD_INODE_FS_MAGIC = 0x11307854 NAME_MAX = 0xff + NCP_SUPER_MAGIC = 0x564c NETLINK_ADD_MEMBERSHIP = 0x1 NETLINK_AUDIT = 0x9 NETLINK_BROADCAST_ERROR = 0x4 @@ -970,6 +1074,37 @@ const ( NETLINK_UNUSED = 0x1 NETLINK_USERSOCK = 0x2 NETLINK_XFRM = 0x6 + NFNETLINK_V0 = 0x0 + NFNLGRP_ACCT_QUOTA = 0x8 + NFNLGRP_CONNTRACK_DESTROY = 0x3 + NFNLGRP_CONNTRACK_EXP_DESTROY = 0x6 + NFNLGRP_CONNTRACK_EXP_NEW = 0x4 + NFNLGRP_CONNTRACK_EXP_UPDATE = 0x5 + NFNLGRP_CONNTRACK_NEW = 0x1 + NFNLGRP_CONNTRACK_UPDATE = 0x2 + NFNLGRP_MAX = 0x9 + NFNLGRP_NFTABLES = 0x7 + NFNLGRP_NFTRACE = 0x9 + NFNLGRP_NONE = 0x0 + NFNL_BATCH_MAX = 0x1 + NFNL_MSG_BATCH_BEGIN = 0x10 + NFNL_MSG_BATCH_END = 0x11 + NFNL_NFA_NEST = 0x8000 + NFNL_SUBSYS_ACCT = 0x7 + NFNL_SUBSYS_COUNT = 0xc + NFNL_SUBSYS_CTHELPER = 0x9 + NFNL_SUBSYS_CTNETLINK = 0x1 + NFNL_SUBSYS_CTNETLINK_EXP = 0x2 + NFNL_SUBSYS_CTNETLINK_TIMEOUT = 0x8 + NFNL_SUBSYS_IPSET = 0x6 + NFNL_SUBSYS_NFTABLES = 0xa + NFNL_SUBSYS_NFT_COMPAT = 0xb + NFNL_SUBSYS_NONE = 0x0 + NFNL_SUBSYS_OSF = 0x5 + NFNL_SUBSYS_QUEUE = 0x3 + NFNL_SUBSYS_ULOG = 0x4 + NFS_SUPER_MAGIC = 0x6969 + NILFS_SUPER_MAGIC = 0x3434 NL0 = 0x0 NL1 = 0x100 NL2 = 0x200 @@ -999,10 +1134,13 @@ const ( NLM_F_EXCL = 0x200 NLM_F_MATCH = 0x200 NLM_F_MULTI = 0x2 + NLM_F_NONREC = 0x100 NLM_F_REPLACE = 0x100 NLM_F_REQUEST = 0x1 NLM_F_ROOT = 0x100 NOFLSH = 0x80000000 + NSFS_MAGIC = 0x6e736673 + OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 OFILL = 0x40 @@ -1010,7 +1148,9 @@ const ( ONLCR = 0x2 ONLRET = 0x20 ONOCR = 0x10 + OPENPROM_SUPER_MAGIC = 0x9fa1 OPOST = 0x1 + OVERLAYFS_SUPER_MAGIC = 0x794c7630 O_ACCMODE = 0x3 O_APPEND = 0x400 O_ASYNC = 0x2000 @@ -1095,16 +1235,20 @@ const ( PERF_EVENT_IOC_DISABLE = 0x20002401 PERF_EVENT_IOC_ENABLE = 0x20002400 PERF_EVENT_IOC_ID = 0x40082407 + PERF_EVENT_IOC_MODIFY_ATTRIBUTES = 0x8008240b PERF_EVENT_IOC_PAUSE_OUTPUT = 0x80042409 PERF_EVENT_IOC_PERIOD = 0x80082404 + PERF_EVENT_IOC_QUERY_BPF = 0xc008240a PERF_EVENT_IOC_REFRESH = 0x20002402 PERF_EVENT_IOC_RESET = 0x20002403 PERF_EVENT_IOC_SET_BPF = 0x80042408 PERF_EVENT_IOC_SET_FILTER = 0x80082406 PERF_EVENT_IOC_SET_OUTPUT = 0x20002405 + PIPEFS_MAGIC = 0x50495045 PRIO_PGRP = 0x1 PRIO_PROCESS = 0x0 PRIO_USER = 0x2 + PROC_SUPER_MAGIC = 0x9fa0 PROT_EXEC = 0x4 PROT_GROWSDOWN = 0x1000000 PROT_GROWSUP = 0x2000000 @@ -1148,6 +1292,7 @@ const ( PR_GET_PDEATHSIG = 0x2 PR_GET_SECCOMP = 0x15 PR_GET_SECUREBITS = 0x1b + PR_GET_SPECULATION_CTRL = 0x34 PR_GET_THP_DISABLE = 0x2a PR_GET_TID_ADDRESS = 0x28 PR_GET_TIMERSLACK = 0x1e @@ -1193,11 +1338,23 @@ const ( PR_SET_PTRACER_ANY = 0xffffffffffffffff PR_SET_SECCOMP = 0x16 PR_SET_SECUREBITS = 0x1c + PR_SET_SPECULATION_CTRL = 0x35 PR_SET_THP_DISABLE = 0x29 PR_SET_TIMERSLACK = 0x1d PR_SET_TIMING = 0xe PR_SET_TSC = 0x1a PR_SET_UNALIGN = 0x6 + PR_SPEC_DISABLE = 0x4 + PR_SPEC_ENABLE = 0x2 + PR_SPEC_FORCE_DISABLE = 0x8 + PR_SPEC_NOT_AFFECTED = 0x0 + PR_SPEC_PRCTL = 0x1 + PR_SPEC_STORE_BYPASS = 0x0 + PR_SVE_GET_VL = 0x33 + PR_SVE_SET_VL = 0x32 + PR_SVE_SET_VL_ONEXEC = 0x40000 + PR_SVE_VL_INHERIT = 0x20000 + PR_SVE_VL_LEN_MASK = 0xffff PR_TASK_PERF_EVENTS_DISABLE = 0x1f PR_TASK_PERF_EVENTS_ENABLE = 0x20 PR_TIMING_STATISTICAL = 0x0 @@ -1206,6 +1363,7 @@ const ( PR_TSC_SIGSEGV = 0x2 PR_UNALIGN_NOPRINT = 0x1 PR_UNALIGN_SIGBUS = 0x2 + PSTOREFS_MAGIC = 0x6165676c PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 @@ -1251,6 +1409,7 @@ const ( PTRACE_POKETEXT = 0x4 PTRACE_POKEUSR = 0x6 PTRACE_SECCOMP_GET_FILTER = 0x420c + PTRACE_SECCOMP_GET_METADATA = 0x420d PTRACE_SEIZE = 0x4206 PTRACE_SETEVRREGS = 0x15 PTRACE_SETFPREGS = 0xf @@ -1320,6 +1479,11 @@ const ( PT_VSR0 = 0x96 PT_VSR31 = 0xd4 PT_XER = 0x25 + QNX4_SUPER_MAGIC = 0x2f + QNX6_SUPER_MAGIC = 0x68191122 + RAMFS_MAGIC = 0x858458f6 + RDTGROUP_SUPER_MAGIC = 0x7655821 + REISERFS_SUPER_MAGIC = 0x52654973 RLIMIT_AS = 0x9 RLIMIT_CORE = 0x4 RLIMIT_CPU = 0x0 @@ -1340,6 +1504,7 @@ const ( RTAX_ADVMSS = 0x8 RTAX_CC_ALGO = 0x10 RTAX_CWND = 0x7 + RTAX_FASTOPEN_NO_COOKIE = 0x11 RTAX_FEATURES = 0xc RTAX_FEATURE_ALLFRAG = 0x8 RTAX_FEATURE_ECN = 0x1 @@ -1350,7 +1515,7 @@ const ( RTAX_INITCWND = 0xb RTAX_INITRWND = 0xe RTAX_LOCK = 0x1 - RTAX_MAX = 0x10 + RTAX_MAX = 0x11 RTAX_MTU = 0x2 RTAX_QUICKACK = 0xf RTAX_REORDERING = 0x9 @@ -1368,6 +1533,33 @@ const ( RTCF_MASQ = 0x400000 RTCF_NAT = 0x800000 RTCF_VALVE = 0x200000 + RTC_AF = 0x20 + RTC_AIE_OFF = 0x20007002 + RTC_AIE_ON = 0x20007001 + RTC_ALM_READ = 0x40247008 + RTC_ALM_SET = 0x80247007 + RTC_EPOCH_READ = 0x4008700d + RTC_EPOCH_SET = 0x8008700e + RTC_IRQF = 0x80 + RTC_IRQP_READ = 0x4008700b + RTC_IRQP_SET = 0x8008700c + RTC_MAX_FREQ = 0x2000 + RTC_PF = 0x40 + RTC_PIE_OFF = 0x20007006 + RTC_PIE_ON = 0x20007005 + RTC_PLL_GET = 0x40207011 + RTC_PLL_SET = 0x80207012 + RTC_RD_TIME = 0x40247009 + RTC_SET_TIME = 0x8024700a + RTC_UF = 0x10 + RTC_UIE_OFF = 0x20007004 + RTC_UIE_ON = 0x20007003 + RTC_VL_CLR = 0x20007014 + RTC_VL_READ = 0x40047013 + RTC_WIE_OFF = 0x20007010 + RTC_WIE_ON = 0x2000700f + RTC_WKALM_RD = 0x40287010 + RTC_WKALM_SET = 0x8028700f RTF_ADDRCLASSMASK = 0xf8000000 RTF_ADDRCONF = 0x40000 RTF_ALLONLINK = 0x20000 @@ -1504,6 +1696,8 @@ const ( SECCOMP_MODE_DISABLED = 0x0 SECCOMP_MODE_FILTER = 0x2 SECCOMP_MODE_STRICT = 0x1 + SECURITYFS_MAGIC = 0x73636673 + SELINUX_MAGIC = 0xf97cff8c SHUT_RD = 0x0 SHUT_RDWR = 0x2 SHUT_WR = 0x1 @@ -1588,6 +1782,23 @@ const ( SIOCSPGRP = 0x8902 SIOCSRARP = 0x8962 SIOCWANDEV = 0x894a + SMACK_MAGIC = 0x43415d53 + SMART_AUTOSAVE = 0xd2 + SMART_AUTO_OFFLINE = 0xdb + SMART_DISABLE = 0xd9 + SMART_ENABLE = 0xd8 + SMART_HCYL_PASS = 0xc2 + SMART_IMMEDIATE_OFFLINE = 0xd4 + SMART_LCYL_PASS = 0x4f + SMART_READ_LOG_SECTOR = 0xd5 + SMART_READ_THRESHOLDS = 0xd1 + SMART_READ_VALUES = 0xd0 + SMART_SAVE = 0xd3 + SMART_STATUS = 0xda + SMART_WRITE_LOG_SECTOR = 0xd6 + SMART_WRITE_THRESHOLDS = 0xd7 + SMB_SUPER_MAGIC = 0x517b + SOCKFS_MAGIC = 0x534f434b SOCK_CLOEXEC = 0x80000 SOCK_DCCP = 0x6 SOCK_DGRAM = 0x2 @@ -1624,6 +1835,7 @@ const ( SOL_SOCKET = 0x1 SOL_TCP = 0x6 SOL_TIPC = 0x10f + SOL_TLS = 0x11a SOL_X25 = 0x106 SOMAXCONN = 0x80 SO_ACCEPTCONN = 0x1e @@ -1692,10 +1904,13 @@ const ( SO_VM_SOCKETS_PEER_HOST_VM_ID = 0x3 SO_VM_SOCKETS_TRUSTED = 0x5 SO_WIFI_STATUS = 0x29 + SO_ZEROCOPY = 0x3c SPLICE_F_GIFT = 0x8 SPLICE_F_MORE = 0x4 SPLICE_F_MOVE = 0x1 SPLICE_F_NONBLOCK = 0x2 + SQUASHFS_MAGIC = 0x73717368 + STACK_END_MAGIC = 0x57ac6e9d STATX_ALL = 0xfff STATX_ATIME = 0x20 STATX_ATTR_APPEND = 0x20 @@ -1717,6 +1932,7 @@ const ( STATX_TYPE = 0x1 STATX_UID = 0x8 STATX__RESERVED = 0x80000000 + SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 S_IFBLK = 0x6000 @@ -1786,6 +2002,8 @@ const ( TCP_MAXWIN = 0xffff TCP_MAX_WINSHIFT = 0xe TCP_MD5SIG = 0xe + TCP_MD5SIG_EXT = 0x20 + TCP_MD5SIG_FLAG_PREFIX = 0x1 TCP_MD5SIG_MAXKEYLEN = 0x50 TCP_MSS = 0x200 TCP_MSS_DEFAULT = 0x218 @@ -1806,6 +2024,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa TCSAFLUSH = 0x2 @@ -1899,7 +2118,27 @@ const ( TIOCSTOP = 0x2000746f TIOCSWINSZ = 0x80087467 TIOCVHANGUP = 0x5437 + TMPFS_MAGIC = 0x1021994 TOSTOP = 0x400000 + TPACKET_ALIGNMENT = 0x10 + TPACKET_HDRLEN = 0x34 + TP_STATUS_AVAILABLE = 0x0 + TP_STATUS_BLK_TMO = 0x20 + TP_STATUS_COPY = 0x2 + TP_STATUS_CSUMNOTREADY = 0x8 + TP_STATUS_CSUM_VALID = 0x80 + TP_STATUS_KERNEL = 0x0 + TP_STATUS_LOSING = 0x4 + TP_STATUS_SENDING = 0x2 + TP_STATUS_SEND_REQUEST = 0x1 + TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_SOFTWARE = 0x20000000 + TP_STATUS_TS_SYS_HARDWARE = 0x40000000 + TP_STATUS_USER = 0x1 + TP_STATUS_VLAN_TPID_VALID = 0x40 + TP_STATUS_VLAN_VALID = 0x10 + TP_STATUS_WRONG_FORMAT = 0x4 + TRACEFS_MAGIC = 0x74726163 TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x801054d5 TUNDETACHFILTER = 0x801054d6 @@ -1911,6 +2150,7 @@ const ( TUNGETVNETHDRSZ = 0x400454d7 TUNGETVNETLE = 0x400454dd TUNSETDEBUG = 0x800454c9 + TUNSETFILTEREBPF = 0x400454e1 TUNSETGROUP = 0x800454ce TUNSETIFF = 0x800454ca TUNSETIFINDEX = 0x800454da @@ -1921,13 +2161,17 @@ const ( TUNSETPERSIST = 0x800454cb TUNSETQUEUE = 0x800454d9 TUNSETSNDBUF = 0x800454d4 + TUNSETSTEERINGEBPF = 0x400454e0 TUNSETTXFILTER = 0x800454d1 TUNSETVNETBE = 0x800454de TUNSETVNETHDRSZ = 0x800454d8 TUNSETVNETLE = 0x800454dc + UDF_SUPER_MAGIC = 0x15013346 UMOUNT_NOFOLLOW = 0x8 + USBDEVICE_SUPER_MAGIC = 0x9fa2 UTIME_NOW = 0x3fffffff UTIME_OMIT = 0x3ffffffe + V9FS_MAGIC = 0x1021997 VDISCARD = 0x10 VEOF = 0x4 VEOL = 0x6 @@ -1969,6 +2213,86 @@ const ( WDIOC_SETPRETIMEOUT = 0xc0045708 WDIOC_SETTIMEOUT = 0xc0045706 WEXITED = 0x4 + WIN_ACKMEDIACHANGE = 0xdb + WIN_CHECKPOWERMODE1 = 0xe5 + WIN_CHECKPOWERMODE2 = 0x98 + WIN_DEVICE_RESET = 0x8 + WIN_DIAGNOSE = 0x90 + WIN_DOORLOCK = 0xde + WIN_DOORUNLOCK = 0xdf + WIN_DOWNLOAD_MICROCODE = 0x92 + WIN_FLUSH_CACHE = 0xe7 + WIN_FLUSH_CACHE_EXT = 0xea + WIN_FORMAT = 0x50 + WIN_GETMEDIASTATUS = 0xda + WIN_IDENTIFY = 0xec + WIN_IDENTIFY_DMA = 0xee + WIN_IDLEIMMEDIATE = 0xe1 + WIN_INIT = 0x60 + WIN_MEDIAEJECT = 0xed + WIN_MULTREAD = 0xc4 + WIN_MULTREAD_EXT = 0x29 + WIN_MULTWRITE = 0xc5 + WIN_MULTWRITE_EXT = 0x39 + WIN_NOP = 0x0 + WIN_PACKETCMD = 0xa0 + WIN_PIDENTIFY = 0xa1 + WIN_POSTBOOT = 0xdc + WIN_PREBOOT = 0xdd + WIN_QUEUED_SERVICE = 0xa2 + WIN_READ = 0x20 + WIN_READDMA = 0xc8 + WIN_READDMA_EXT = 0x25 + WIN_READDMA_ONCE = 0xc9 + WIN_READDMA_QUEUED = 0xc7 + WIN_READDMA_QUEUED_EXT = 0x26 + WIN_READ_BUFFER = 0xe4 + WIN_READ_EXT = 0x24 + WIN_READ_LONG = 0x22 + WIN_READ_LONG_ONCE = 0x23 + WIN_READ_NATIVE_MAX = 0xf8 + WIN_READ_NATIVE_MAX_EXT = 0x27 + WIN_READ_ONCE = 0x21 + WIN_RECAL = 0x10 + WIN_RESTORE = 0x10 + WIN_SECURITY_DISABLE = 0xf6 + WIN_SECURITY_ERASE_PREPARE = 0xf3 + WIN_SECURITY_ERASE_UNIT = 0xf4 + WIN_SECURITY_FREEZE_LOCK = 0xf5 + WIN_SECURITY_SET_PASS = 0xf1 + WIN_SECURITY_UNLOCK = 0xf2 + WIN_SEEK = 0x70 + WIN_SETFEATURES = 0xef + WIN_SETIDLE1 = 0xe3 + WIN_SETIDLE2 = 0x97 + WIN_SETMULT = 0xc6 + WIN_SET_MAX = 0xf9 + WIN_SET_MAX_EXT = 0x37 + WIN_SLEEPNOW1 = 0xe6 + WIN_SLEEPNOW2 = 0x99 + WIN_SMART = 0xb0 + WIN_SPECIFY = 0x91 + WIN_SRST = 0x8 + WIN_STANDBY = 0xe2 + WIN_STANDBY2 = 0x96 + WIN_STANDBYNOW1 = 0xe0 + WIN_STANDBYNOW2 = 0x94 + WIN_VERIFY = 0x40 + WIN_VERIFY_EXT = 0x42 + WIN_VERIFY_ONCE = 0x41 + WIN_WRITE = 0x30 + WIN_WRITEDMA = 0xca + WIN_WRITEDMA_EXT = 0x35 + WIN_WRITEDMA_ONCE = 0xcb + WIN_WRITEDMA_QUEUED = 0xcc + WIN_WRITEDMA_QUEUED_EXT = 0x36 + WIN_WRITE_BUFFER = 0xe8 + WIN_WRITE_EXT = 0x34 + WIN_WRITE_LONG = 0x32 + WIN_WRITE_LONG_ONCE = 0x33 + WIN_WRITE_ONCE = 0x31 + WIN_WRITE_SAME = 0xe9 + WIN_WRITE_VERIFY = 0x3c WNOHANG = 0x1 WNOTHREAD = 0x20000000 WNOWAIT = 0x1000000 @@ -1978,7 +2302,9 @@ const ( XATTR_CREATE = 0x1 XATTR_REPLACE = 0x2 XCASE = 0x4000 + XENFS_SUPER_MAGIC = 0xabba1974 XTABS = 0xc00 + ZSMALLOC_MAGIC = 0x58295829 ) // Errors @@ -2158,172 +2484,180 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "no such device or address", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource temporarily unavailable", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device or resource busy", - 17: "file exists", - 18: "invalid cross-device link", - 19: "no such device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "numerical result out of range", - 35: "resource deadlock avoided", - 36: "file name too long", - 37: "no locks available", - 38: "function not implemented", - 39: "directory not empty", - 40: "too many levels of symbolic links", - 42: "no message of desired type", - 43: "identifier removed", - 44: "channel number out of range", - 45: "level 2 not synchronized", - 46: "level 3 halted", - 47: "level 3 reset", - 48: "link number out of range", - 49: "protocol driver not attached", - 50: "no CSI structure available", - 51: "level 2 halted", - 52: "invalid exchange", - 53: "invalid request descriptor", - 54: "exchange full", - 55: "no anode", - 56: "invalid request code", - 57: "invalid slot", - 58: "file locking deadlock error", - 59: "bad font file format", - 60: "device not a stream", - 61: "no data available", - 62: "timer expired", - 63: "out of streams resources", - 64: "machine is not on the network", - 65: "package not installed", - 66: "object is remote", - 67: "link has been severed", - 68: "advertise error", - 69: "srmount error", - 70: "communication error on send", - 71: "protocol error", - 72: "multihop attempted", - 73: "RFS specific error", - 74: "bad message", - 75: "value too large for defined data type", - 76: "name not unique on network", - 77: "file descriptor in bad state", - 78: "remote address changed", - 79: "can not access a needed shared library", - 80: "accessing a corrupted shared library", - 81: ".lib section in a.out corrupted", - 82: "attempting to link in too many shared libraries", - 83: "cannot exec a shared library directly", - 84: "invalid or incomplete multibyte or wide character", - 85: "interrupted system call should be restarted", - 86: "streams pipe error", - 87: "too many users", - 88: "socket operation on non-socket", - 89: "destination address required", - 90: "message too long", - 91: "protocol wrong type for socket", - 92: "protocol not available", - 93: "protocol not supported", - 94: "socket type not supported", - 95: "operation not supported", - 96: "protocol family not supported", - 97: "address family not supported by protocol", - 98: "address already in use", - 99: "cannot assign requested address", - 100: "network is down", - 101: "network is unreachable", - 102: "network dropped connection on reset", - 103: "software caused connection abort", - 104: "connection reset by peer", - 105: "no buffer space available", - 106: "transport endpoint is already connected", - 107: "transport endpoint is not connected", - 108: "cannot send after transport endpoint shutdown", - 109: "too many references: cannot splice", - 110: "connection timed out", - 111: "connection refused", - 112: "host is down", - 113: "no route to host", - 114: "operation already in progress", - 115: "operation now in progress", - 116: "stale file handle", - 117: "structure needs cleaning", - 118: "not a XENIX named type file", - 119: "no XENIX semaphores available", - 120: "is a named type file", - 121: "remote I/O error", - 122: "disk quota exceeded", - 123: "no medium found", - 124: "wrong medium type", - 125: "operation canceled", - 126: "required key not available", - 127: "key has expired", - 128: "key has been revoked", - 129: "key was rejected by service", - 130: "owner died", - 131: "state not recoverable", - 132: "operation not possible due to RF-kill", - 133: "memory page has hardware error", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "no such device or address"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EAGAIN", "resource temporarily unavailable"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device or resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "invalid cross-device link"}, + {19, "ENODEV", "no such device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "numerical result out of range"}, + {35, "EDEADLK", "resource deadlock avoided"}, + {36, "ENAMETOOLONG", "file name too long"}, + {37, "ENOLCK", "no locks available"}, + {38, "ENOSYS", "function not implemented"}, + {39, "ENOTEMPTY", "directory not empty"}, + {40, "ELOOP", "too many levels of symbolic links"}, + {42, "ENOMSG", "no message of desired type"}, + {43, "EIDRM", "identifier removed"}, + {44, "ECHRNG", "channel number out of range"}, + {45, "EL2NSYNC", "level 2 not synchronized"}, + {46, "EL3HLT", "level 3 halted"}, + {47, "EL3RST", "level 3 reset"}, + {48, "ELNRNG", "link number out of range"}, + {49, "EUNATCH", "protocol driver not attached"}, + {50, "ENOCSI", "no CSI structure available"}, + {51, "EL2HLT", "level 2 halted"}, + {52, "EBADE", "invalid exchange"}, + {53, "EBADR", "invalid request descriptor"}, + {54, "EXFULL", "exchange full"}, + {55, "ENOANO", "no anode"}, + {56, "EBADRQC", "invalid request code"}, + {57, "EBADSLT", "invalid slot"}, + {58, "EDEADLOCK", "file locking deadlock error"}, + {59, "EBFONT", "bad font file format"}, + {60, "ENOSTR", "device not a stream"}, + {61, "ENODATA", "no data available"}, + {62, "ETIME", "timer expired"}, + {63, "ENOSR", "out of streams resources"}, + {64, "ENONET", "machine is not on the network"}, + {65, "ENOPKG", "package not installed"}, + {66, "EREMOTE", "object is remote"}, + {67, "ENOLINK", "link has been severed"}, + {68, "EADV", "advertise error"}, + {69, "ESRMNT", "srmount error"}, + {70, "ECOMM", "communication error on send"}, + {71, "EPROTO", "protocol error"}, + {72, "EMULTIHOP", "multihop attempted"}, + {73, "EDOTDOT", "RFS specific error"}, + {74, "EBADMSG", "bad message"}, + {75, "EOVERFLOW", "value too large for defined data type"}, + {76, "ENOTUNIQ", "name not unique on network"}, + {77, "EBADFD", "file descriptor in bad state"}, + {78, "EREMCHG", "remote address changed"}, + {79, "ELIBACC", "can not access a needed shared library"}, + {80, "ELIBBAD", "accessing a corrupted shared library"}, + {81, "ELIBSCN", ".lib section in a.out corrupted"}, + {82, "ELIBMAX", "attempting to link in too many shared libraries"}, + {83, "ELIBEXEC", "cannot exec a shared library directly"}, + {84, "EILSEQ", "invalid or incomplete multibyte or wide character"}, + {85, "ERESTART", "interrupted system call should be restarted"}, + {86, "ESTRPIPE", "streams pipe error"}, + {87, "EUSERS", "too many users"}, + {88, "ENOTSOCK", "socket operation on non-socket"}, + {89, "EDESTADDRREQ", "destination address required"}, + {90, "EMSGSIZE", "message too long"}, + {91, "EPROTOTYPE", "protocol wrong type for socket"}, + {92, "ENOPROTOOPT", "protocol not available"}, + {93, "EPROTONOSUPPORT", "protocol not supported"}, + {94, "ESOCKTNOSUPPORT", "socket type not supported"}, + {95, "ENOTSUP", "operation not supported"}, + {96, "EPFNOSUPPORT", "protocol family not supported"}, + {97, "EAFNOSUPPORT", "address family not supported by protocol"}, + {98, "EADDRINUSE", "address already in use"}, + {99, "EADDRNOTAVAIL", "cannot assign requested address"}, + {100, "ENETDOWN", "network is down"}, + {101, "ENETUNREACH", "network is unreachable"}, + {102, "ENETRESET", "network dropped connection on reset"}, + {103, "ECONNABORTED", "software caused connection abort"}, + {104, "ECONNRESET", "connection reset by peer"}, + {105, "ENOBUFS", "no buffer space available"}, + {106, "EISCONN", "transport endpoint is already connected"}, + {107, "ENOTCONN", "transport endpoint is not connected"}, + {108, "ESHUTDOWN", "cannot send after transport endpoint shutdown"}, + {109, "ETOOMANYREFS", "too many references: cannot splice"}, + {110, "ETIMEDOUT", "connection timed out"}, + {111, "ECONNREFUSED", "connection refused"}, + {112, "EHOSTDOWN", "host is down"}, + {113, "EHOSTUNREACH", "no route to host"}, + {114, "EALREADY", "operation already in progress"}, + {115, "EINPROGRESS", "operation now in progress"}, + {116, "ESTALE", "stale file handle"}, + {117, "EUCLEAN", "structure needs cleaning"}, + {118, "ENOTNAM", "not a XENIX named type file"}, + {119, "ENAVAIL", "no XENIX semaphores available"}, + {120, "EISNAM", "is a named type file"}, + {121, "EREMOTEIO", "remote I/O error"}, + {122, "EDQUOT", "disk quota exceeded"}, + {123, "ENOMEDIUM", "no medium found"}, + {124, "EMEDIUMTYPE", "wrong medium type"}, + {125, "ECANCELED", "operation canceled"}, + {126, "ENOKEY", "required key not available"}, + {127, "EKEYEXPIRED", "key has expired"}, + {128, "EKEYREVOKED", "key has been revoked"}, + {129, "EKEYREJECTED", "key was rejected by service"}, + {130, "EOWNERDEAD", "owner died"}, + {131, "ENOTRECOVERABLE", "state not recoverable"}, + {132, "ERFKILL", "operation not possible due to RF-kill"}, + {133, "EHWPOISON", "memory page has hardware error"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/breakpoint trap", - 6: "aborted", - 7: "bus error", - 8: "floating point exception", - 9: "killed", - 10: "user defined signal 1", - 11: "segmentation fault", - 12: "user defined signal 2", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "stack fault", - 17: "child exited", - 18: "continued", - 19: "stopped (signal)", - 20: "stopped", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "urgent I/O condition", - 24: "CPU time limit exceeded", - 25: "file size limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window changed", - 29: "I/O possible", - 30: "power failure", - 31: "bad system call", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/breakpoint trap"}, + {6, "SIGABRT", "aborted"}, + {7, "SIGBUS", "bus error"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGUSR1", "user defined signal 1"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGUSR2", "user defined signal 2"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGSTKFLT", "stack fault"}, + {17, "SIGCHLD", "child exited"}, + {18, "SIGCONT", "continued"}, + {19, "SIGSTOP", "stopped (signal)"}, + {20, "SIGTSTP", "stopped"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGURG", "urgent I/O condition"}, + {24, "SIGXCPU", "CPU time limit exceeded"}, + {25, "SIGXFSZ", "file size limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window changed"}, + {29, "SIGIO", "I/O possible"}, + {30, "SIGPWR", "power failure"}, + {31, "SIGSYS", "bad system call"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go b/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go index af5a89502a..3814df8549 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_s390x.go @@ -3,7 +3,7 @@ // +build s390x,linux -// Created by cgo -godefs - DO NOT EDIT +// Code generated by cmd/cgo -godefs; DO NOT EDIT. // cgo -godefs -- -Wall -Werror -static -I/tmp/include -fsigned-char _const.go package unix @@ -11,6 +11,11 @@ package unix import "syscall" const ( + AAFS_MAGIC = 0x5a3c69f0 + ADFS_SUPER_MAGIC = 0xadf5 + AFFS_SUPER_MAGIC = 0xadff + AFS_FS_MAGIC = 0x6b414653 + AFS_SUPER_MAGIC = 0x5346414f AF_ALG = 0x26 AF_APPLETALK = 0x5 AF_ASH = 0x12 @@ -66,6 +71,7 @@ const ( ALG_SET_IV = 0x2 ALG_SET_KEY = 0x1 ALG_SET_OP = 0x3 + ANON_INODE_FS_MAGIC = 0x9041934 ARPHRD_6LOWPAN = 0x339 ARPHRD_ADAPT = 0x108 ARPHRD_APPLETLK = 0x8 @@ -121,6 +127,7 @@ const ( ARPHRD_PPP = 0x200 ARPHRD_PRONET = 0x4 ARPHRD_RAWHDLC = 0x206 + ARPHRD_RAWIP = 0x207 ARPHRD_ROSE = 0x10e ARPHRD_RSRVD = 0x104 ARPHRD_SIT = 0x308 @@ -132,6 +139,7 @@ const ( ARPHRD_VOID = 0xffff ARPHRD_VSOCKMON = 0x33a ARPHRD_X25 = 0x10f + AUTOFS_SUPER_MAGIC = 0x187 B0 = 0x0 B1000000 = 0x1008 B110 = 0x3 @@ -163,6 +171,9 @@ const ( B75 = 0x2 B921600 = 0x1007 B9600 = 0xd + BALLOON_KVM_MAGIC = 0x13661366 + BDEVFS_MAGIC = 0x62646576 + BINFMTFS_MAGIC = 0x42494e4d BLKBSZGET = 0x80081270 BLKBSZSET = 0x40081271 BLKFLSBUF = 0x1261 @@ -187,6 +198,7 @@ const ( BPF_AND = 0x50 BPF_B = 0x10 BPF_DIV = 0x30 + BPF_FS_MAGIC = 0xcafe4a11 BPF_H = 0x8 BPF_IMM = 0x0 BPF_IND = 0x40 @@ -228,6 +240,8 @@ const ( BS0 = 0x0 BS1 = 0x2000 BSDLY = 0x2000 + BTRFS_SUPER_MAGIC = 0x9123683e + BTRFS_TEST_MAGIC = 0x73727279 CAN_BCM = 0x2 CAN_EFF_FLAG = 0x80000000 CAN_EFF_ID_BITS = 0x1d @@ -251,6 +265,8 @@ const ( CBAUD = 0x100f CBAUDEX = 0x1000 CFLUSH = 0xf + CGROUP2_SUPER_MAGIC = 0x63677270 + CGROUP_SUPER_MAGIC = 0x27e0eb CIBAUD = 0x100f0000 CLOCAL = 0x800 CLOCK_BOOTTIME = 0x7 @@ -293,10 +309,12 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CMSPAR = 0x40000000 + CODA_SUPER_MAGIC = 0x73757245 CR0 = 0x0 CR1 = 0x200 CR2 = 0x400 CR3 = 0x600 + CRAMFS_MAGIC = 0x28cd3d45 CRDLY = 0x600 CREAD = 0x80 CRTSCTS = 0x80000000 @@ -311,6 +329,9 @@ const ( CSTOP = 0x13 CSTOPB = 0x40 CSUSP = 0x1a + DAXFS_MAGIC = 0x64646178 + DEBUGFS_MAGIC = 0x64626720 + DEVPTS_SUPER_MAGIC = 0x1cd1 DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -327,9 +348,12 @@ const ( ECHOKE = 0x800 ECHONL = 0x40 ECHOPRT = 0x400 + ECRYPTFS_SUPER_MAGIC = 0xf15f EFD_CLOEXEC = 0x80000 EFD_NONBLOCK = 0x800 EFD_SEMAPHORE = 0x1 + EFIVARFS_MAGIC = 0xde5e81e4 + EFS_SUPER_MAGIC = 0x414a53 ENCODING_DEFAULT = 0x0 ENCODING_FM_MARK = 0x3 ENCODING_FM_SPACE = 0x4 @@ -390,6 +414,8 @@ const ( ETH_P_DSA = 0x1b ETH_P_ECONET = 0x18 ETH_P_EDSA = 0xdada + ETH_P_ERSPAN = 0x88be + ETH_P_ERSPAN2 = 0x22eb ETH_P_FCOE = 0x8906 ETH_P_FIP = 0x8914 ETH_P_HDLC = 0x19 @@ -398,6 +424,7 @@ const ( ETH_P_IEEE802154 = 0xf6 ETH_P_IEEEPUP = 0xa00 ETH_P_IEEEPUPAT = 0xa01 + ETH_P_IFE = 0xed3e ETH_P_IP = 0x800 ETH_P_IPV6 = 0x86dd ETH_P_IPX = 0x8137 @@ -408,11 +435,13 @@ const ( ETH_P_LOOP = 0x60 ETH_P_LOOPBACK = 0x9000 ETH_P_MACSEC = 0x88e5 + ETH_P_MAP = 0xf9 ETH_P_MOBITEX = 0x15 ETH_P_MPLS_MC = 0x8848 ETH_P_MPLS_UC = 0x8847 ETH_P_MVRP = 0x88f5 ETH_P_NCSI = 0x88f8 + ETH_P_NSH = 0x894f ETH_P_PAE = 0x888e ETH_P_PAUSE = 0x8808 ETH_P_PHONET = 0xf5 @@ -420,6 +449,7 @@ const ( ETH_P_PPP_DISC = 0x8863 ETH_P_PPP_MP = 0x8 ETH_P_PPP_SES = 0x8864 + ETH_P_PREAUTH = 0x88c7 ETH_P_PRP = 0x88fb ETH_P_PUP = 0x200 ETH_P_PUPAT = 0x201 @@ -440,9 +470,14 @@ const ( ETH_P_WCCP = 0x883e ETH_P_X25 = 0x805 ETH_P_XDSA = 0xf8 + EXABYTE_ENABLE_NEST = 0xf0 + EXT2_SUPER_MAGIC = 0xef53 + EXT3_SUPER_MAGIC = 0xef53 + EXT4_SUPER_MAGIC = 0xef53 EXTA = 0xe EXTB = 0xf EXTPROC = 0x10000 + F2FS_SUPER_MAGIC = 0xf2f52010 FALLOC_FL_COLLAPSE_RANGE = 0x8 FALLOC_FL_INSERT_RANGE = 0x20 FALLOC_FL_KEEP_SIZE = 0x1 @@ -476,6 +511,8 @@ const ( FS_POLICY_FLAGS_PAD_8 = 0x1 FS_POLICY_FLAGS_PAD_MASK = 0x3 FS_POLICY_FLAGS_VALID = 0x3 + FUTEXFS_SUPER_MAGIC = 0xbad1dea + F_ADD_SEALS = 0x409 F_DUPFD = 0x0 F_DUPFD_CLOEXEC = 0x406 F_EXLCK = 0x4 @@ -488,6 +525,9 @@ const ( F_GETOWN_EX = 0x10 F_GETPIPE_SZ = 0x408 F_GETSIG = 0xb + F_GET_FILE_RW_HINT = 0x40d + F_GET_RW_HINT = 0x40b + F_GET_SEALS = 0x40a F_LOCK = 0x1 F_NOTIFY = 0x402 F_OFD_GETLK = 0x24 @@ -495,6 +535,10 @@ const ( F_OFD_SETLKW = 0x26 F_OK = 0x0 F_RDLCK = 0x0 + F_SEAL_GROW = 0x4 + F_SEAL_SEAL = 0x1 + F_SEAL_SHRINK = 0x2 + F_SEAL_WRITE = 0x8 F_SETFD = 0x2 F_SETFL = 0x4 F_SETLEASE = 0x400 @@ -506,6 +550,8 @@ const ( F_SETOWN_EX = 0xf F_SETPIPE_SZ = 0x407 F_SETSIG = 0xa + F_SET_FILE_RW_HINT = 0x40e + F_SET_RW_HINT = 0x40c F_SHLCK = 0x8 F_TEST = 0x3 F_TLOCK = 0x2 @@ -527,6 +573,49 @@ const ( GENL_UNS_ADMIN_PERM = 0x10 GRND_NONBLOCK = 0x1 GRND_RANDOM = 0x2 + HDIO_DRIVE_CMD = 0x31f + HDIO_DRIVE_CMD_AEB = 0x31e + HDIO_DRIVE_CMD_HDR_SIZE = 0x4 + HDIO_DRIVE_HOB_HDR_SIZE = 0x8 + HDIO_DRIVE_RESET = 0x31c + HDIO_DRIVE_TASK = 0x31e + HDIO_DRIVE_TASKFILE = 0x31d + HDIO_DRIVE_TASK_HDR_SIZE = 0x8 + HDIO_GETGEO = 0x301 + HDIO_GET_32BIT = 0x309 + HDIO_GET_ACOUSTIC = 0x30f + HDIO_GET_ADDRESS = 0x310 + HDIO_GET_BUSSTATE = 0x31a + HDIO_GET_DMA = 0x30b + HDIO_GET_IDENTITY = 0x30d + HDIO_GET_KEEPSETTINGS = 0x308 + HDIO_GET_MULTCOUNT = 0x304 + HDIO_GET_NICE = 0x30c + HDIO_GET_NOWERR = 0x30a + HDIO_GET_QDMA = 0x305 + HDIO_GET_UNMASKINTR = 0x302 + HDIO_GET_WCACHE = 0x30e + HDIO_OBSOLETE_IDENTITY = 0x307 + HDIO_SCAN_HWIF = 0x328 + HDIO_SET_32BIT = 0x324 + HDIO_SET_ACOUSTIC = 0x32c + HDIO_SET_ADDRESS = 0x32f + HDIO_SET_BUSSTATE = 0x32d + HDIO_SET_DMA = 0x326 + HDIO_SET_KEEPSETTINGS = 0x323 + HDIO_SET_MULTCOUNT = 0x321 + HDIO_SET_NICE = 0x329 + HDIO_SET_NOWERR = 0x325 + HDIO_SET_PIO_MODE = 0x327 + HDIO_SET_QDMA = 0x32e + HDIO_SET_UNMASKINTR = 0x322 + HDIO_SET_WCACHE = 0x32b + HDIO_SET_XFER = 0x306 + HDIO_TRISTATE_HWIF = 0x31b + HDIO_UNREGISTER_HWIF = 0x32a + HOSTFS_SUPER_MAGIC = 0xc0ffee + HPFS_SUPER_MAGIC = 0xf995e849 + HUGETLBFS_MAGIC = 0x958458f6 HUPCL = 0x400 IBSHIFT = 0x10 ICANON = 0x2 @@ -561,6 +650,8 @@ const ( IFF_MASTER = 0x400 IFF_MULTICAST = 0x1000 IFF_MULTI_QUEUE = 0x100 + IFF_NAPI = 0x10 + IFF_NAPI_FRAGS = 0x20 IFF_NOARP = 0x80 IFF_NOFILTER = 0x1000 IFF_NOTRAILERS = 0x20 @@ -775,12 +866,14 @@ const ( IP_UNICAST_IF = 0x32 IP_XFRM_POLICY = 0x11 ISIG = 0x1 + ISOFS_SUPER_MAGIC = 0x9660 ISTRIP = 0x20 IUCLC = 0x200 IUTF8 = 0x4000 IXANY = 0x800 IXOFF = 0x1000 IXON = 0x400 + JFFS2_SUPER_MAGIC = 0x72b6 KEYCTL_ASSUME_AUTHORITY = 0x10 KEYCTL_CHOWN = 0x4 KEYCTL_CLEAR = 0x7 @@ -845,6 +938,7 @@ const ( MADV_FREE = 0x8 MADV_HUGEPAGE = 0xe MADV_HWPOISON = 0x64 + MADV_KEEPONFORK = 0x13 MADV_MERGEABLE = 0xc MADV_NOHUGEPAGE = 0xf MADV_NORMAL = 0x0 @@ -853,6 +947,7 @@ const ( MADV_SEQUENTIAL = 0x2 MADV_UNMERGEABLE = 0xd MADV_WILLNEED = 0x3 + MADV_WIPEONFORK = 0x12 MAP_ANON = 0x20 MAP_ANONYMOUS = 0x20 MAP_DENYWRITE = 0x800 @@ -874,9 +969,15 @@ const ( MCL_CURRENT = 0x1 MCL_FUTURE = 0x2 MCL_ONFAULT = 0x4 + MINIX2_SUPER_MAGIC = 0x2468 + MINIX2_SUPER_MAGIC2 = 0x2478 + MINIX3_SUPER_MAGIC = 0x4d5a + MINIX_SUPER_MAGIC = 0x137f + MINIX_SUPER_MAGIC2 = 0x138f MNT_DETACH = 0x2 MNT_EXPIRE = 0x4 MNT_FORCE = 0x1 + MSDOS_SUPER_MAGIC = 0x4d44 MSG_BATCH = 0x40000 MSG_CMSG_CLOEXEC = 0x40000000 MSG_CONFIRM = 0x800 @@ -898,6 +999,7 @@ const ( MSG_TRYHARD = 0x4 MSG_WAITALL = 0x100 MSG_WAITFORONE = 0x10000 + MSG_ZEROCOPY = 0x4000000 MS_ACTIVE = 0x40000000 MS_ASYNC = 0x1 MS_BIND = 0x1000 @@ -935,7 +1037,9 @@ const ( MS_SYNCHRONOUS = 0x10 MS_UNBINDABLE = 0x20000 MS_VERBOSE = 0x8000 + MTD_INODE_FS_MAGIC = 0x11307854 NAME_MAX = 0xff + NCP_SUPER_MAGIC = 0x564c NETLINK_ADD_MEMBERSHIP = 0x1 NETLINK_AUDIT = 0x9 NETLINK_BROADCAST_ERROR = 0x4 @@ -970,6 +1074,37 @@ const ( NETLINK_UNUSED = 0x1 NETLINK_USERSOCK = 0x2 NETLINK_XFRM = 0x6 + NFNETLINK_V0 = 0x0 + NFNLGRP_ACCT_QUOTA = 0x8 + NFNLGRP_CONNTRACK_DESTROY = 0x3 + NFNLGRP_CONNTRACK_EXP_DESTROY = 0x6 + NFNLGRP_CONNTRACK_EXP_NEW = 0x4 + NFNLGRP_CONNTRACK_EXP_UPDATE = 0x5 + NFNLGRP_CONNTRACK_NEW = 0x1 + NFNLGRP_CONNTRACK_UPDATE = 0x2 + NFNLGRP_MAX = 0x9 + NFNLGRP_NFTABLES = 0x7 + NFNLGRP_NFTRACE = 0x9 + NFNLGRP_NONE = 0x0 + NFNL_BATCH_MAX = 0x1 + NFNL_MSG_BATCH_BEGIN = 0x10 + NFNL_MSG_BATCH_END = 0x11 + NFNL_NFA_NEST = 0x8000 + NFNL_SUBSYS_ACCT = 0x7 + NFNL_SUBSYS_COUNT = 0xc + NFNL_SUBSYS_CTHELPER = 0x9 + NFNL_SUBSYS_CTNETLINK = 0x1 + NFNL_SUBSYS_CTNETLINK_EXP = 0x2 + NFNL_SUBSYS_CTNETLINK_TIMEOUT = 0x8 + NFNL_SUBSYS_IPSET = 0x6 + NFNL_SUBSYS_NFTABLES = 0xa + NFNL_SUBSYS_NFT_COMPAT = 0xb + NFNL_SUBSYS_NONE = 0x0 + NFNL_SUBSYS_OSF = 0x5 + NFNL_SUBSYS_QUEUE = 0x3 + NFNL_SUBSYS_ULOG = 0x4 + NFS_SUPER_MAGIC = 0x6969 + NILFS_SUPER_MAGIC = 0x3434 NL0 = 0x0 NL1 = 0x100 NLA_ALIGNTO = 0x4 @@ -997,10 +1132,13 @@ const ( NLM_F_EXCL = 0x200 NLM_F_MATCH = 0x200 NLM_F_MULTI = 0x2 + NLM_F_NONREC = 0x100 NLM_F_REPLACE = 0x100 NLM_F_REQUEST = 0x1 NLM_F_ROOT = 0x100 NOFLSH = 0x80 + NSFS_MAGIC = 0x6e736673 + OCFS2_SUPER_MAGIC = 0x7461636f OCRNL = 0x8 OFDEL = 0x80 OFILL = 0x40 @@ -1008,7 +1146,9 @@ const ( ONLCR = 0x4 ONLRET = 0x20 ONOCR = 0x10 + OPENPROM_SUPER_MAGIC = 0x9fa1 OPOST = 0x1 + OVERLAYFS_SUPER_MAGIC = 0x794c7630 O_ACCMODE = 0x3 O_APPEND = 0x400 O_ASYNC = 0x2000 @@ -1093,16 +1233,20 @@ const ( PERF_EVENT_IOC_DISABLE = 0x2401 PERF_EVENT_IOC_ENABLE = 0x2400 PERF_EVENT_IOC_ID = 0x80082407 + PERF_EVENT_IOC_MODIFY_ATTRIBUTES = 0x4008240b PERF_EVENT_IOC_PAUSE_OUTPUT = 0x40042409 PERF_EVENT_IOC_PERIOD = 0x40082404 + PERF_EVENT_IOC_QUERY_BPF = 0xc008240a PERF_EVENT_IOC_REFRESH = 0x2402 PERF_EVENT_IOC_RESET = 0x2403 PERF_EVENT_IOC_SET_BPF = 0x40042408 PERF_EVENT_IOC_SET_FILTER = 0x40082406 PERF_EVENT_IOC_SET_OUTPUT = 0x2405 + PIPEFS_MAGIC = 0x50495045 PRIO_PGRP = 0x1 PRIO_PROCESS = 0x0 PRIO_USER = 0x2 + PROC_SUPER_MAGIC = 0x9fa0 PROT_EXEC = 0x4 PROT_GROWSDOWN = 0x1000000 PROT_GROWSUP = 0x2000000 @@ -1145,6 +1289,7 @@ const ( PR_GET_PDEATHSIG = 0x2 PR_GET_SECCOMP = 0x15 PR_GET_SECUREBITS = 0x1b + PR_GET_SPECULATION_CTRL = 0x34 PR_GET_THP_DISABLE = 0x2a PR_GET_TID_ADDRESS = 0x28 PR_GET_TIMERSLACK = 0x1e @@ -1190,11 +1335,23 @@ const ( PR_SET_PTRACER_ANY = 0xffffffffffffffff PR_SET_SECCOMP = 0x16 PR_SET_SECUREBITS = 0x1c + PR_SET_SPECULATION_CTRL = 0x35 PR_SET_THP_DISABLE = 0x29 PR_SET_TIMERSLACK = 0x1d PR_SET_TIMING = 0xe PR_SET_TSC = 0x1a PR_SET_UNALIGN = 0x6 + PR_SPEC_DISABLE = 0x4 + PR_SPEC_ENABLE = 0x2 + PR_SPEC_FORCE_DISABLE = 0x8 + PR_SPEC_NOT_AFFECTED = 0x0 + PR_SPEC_PRCTL = 0x1 + PR_SPEC_STORE_BYPASS = 0x0 + PR_SVE_GET_VL = 0x33 + PR_SVE_SET_VL = 0x32 + PR_SVE_SET_VL_ONEXEC = 0x40000 + PR_SVE_VL_INHERIT = 0x20000 + PR_SVE_VL_LEN_MASK = 0xffff PR_TASK_PERF_EVENTS_DISABLE = 0x1f PR_TASK_PERF_EVENTS_ENABLE = 0x20 PR_TIMING_STATISTICAL = 0x0 @@ -1203,6 +1360,7 @@ const ( PR_TSC_SIGSEGV = 0x2 PR_UNALIGN_NOPRINT = 0x1 PR_UNALIGN_SIGBUS = 0x2 + PSTOREFS_MAGIC = 0x6165676c PTRACE_ATTACH = 0x10 PTRACE_CONT = 0x7 PTRACE_DETACH = 0x11 @@ -1255,6 +1413,7 @@ const ( PTRACE_POKE_SYSTEM_CALL = 0x5008 PTRACE_PROT = 0x15 PTRACE_SECCOMP_GET_FILTER = 0x420c + PTRACE_SECCOMP_GET_METADATA = 0x420d PTRACE_SEIZE = 0x4206 PTRACE_SETOPTIONS = 0x4200 PTRACE_SETREGS = 0xd @@ -1324,6 +1483,11 @@ const ( PT_ORIGGPR2 = 0xd0 PT_PSWADDR = 0x8 PT_PSWMASK = 0x0 + QNX4_SUPER_MAGIC = 0x2f + QNX6_SUPER_MAGIC = 0x68191122 + RAMFS_MAGIC = 0x858458f6 + RDTGROUP_SUPER_MAGIC = 0x7655821 + REISERFS_SUPER_MAGIC = 0x52654973 RLIMIT_AS = 0x9 RLIMIT_CORE = 0x4 RLIMIT_CPU = 0x0 @@ -1344,6 +1508,7 @@ const ( RTAX_ADVMSS = 0x8 RTAX_CC_ALGO = 0x10 RTAX_CWND = 0x7 + RTAX_FASTOPEN_NO_COOKIE = 0x11 RTAX_FEATURES = 0xc RTAX_FEATURE_ALLFRAG = 0x8 RTAX_FEATURE_ECN = 0x1 @@ -1354,7 +1519,7 @@ const ( RTAX_INITCWND = 0xb RTAX_INITRWND = 0xe RTAX_LOCK = 0x1 - RTAX_MAX = 0x10 + RTAX_MAX = 0x11 RTAX_MTU = 0x2 RTAX_QUICKACK = 0xf RTAX_REORDERING = 0x9 @@ -1372,6 +1537,33 @@ const ( RTCF_MASQ = 0x400000 RTCF_NAT = 0x800000 RTCF_VALVE = 0x200000 + RTC_AF = 0x20 + RTC_AIE_OFF = 0x7002 + RTC_AIE_ON = 0x7001 + RTC_ALM_READ = 0x80247008 + RTC_ALM_SET = 0x40247007 + RTC_EPOCH_READ = 0x8008700d + RTC_EPOCH_SET = 0x4008700e + RTC_IRQF = 0x80 + RTC_IRQP_READ = 0x8008700b + RTC_IRQP_SET = 0x4008700c + RTC_MAX_FREQ = 0x2000 + RTC_PF = 0x40 + RTC_PIE_OFF = 0x7006 + RTC_PIE_ON = 0x7005 + RTC_PLL_GET = 0x80207011 + RTC_PLL_SET = 0x40207012 + RTC_RD_TIME = 0x80247009 + RTC_SET_TIME = 0x4024700a + RTC_UF = 0x10 + RTC_UIE_OFF = 0x7004 + RTC_UIE_ON = 0x7003 + RTC_VL_CLR = 0x7014 + RTC_VL_READ = 0x80047013 + RTC_WIE_OFF = 0x7010 + RTC_WIE_ON = 0x700f + RTC_WKALM_RD = 0x80287010 + RTC_WKALM_SET = 0x4028700f RTF_ADDRCLASSMASK = 0xf8000000 RTF_ADDRCONF = 0x40000 RTF_ALLONLINK = 0x20000 @@ -1508,6 +1700,8 @@ const ( SECCOMP_MODE_DISABLED = 0x0 SECCOMP_MODE_FILTER = 0x2 SECCOMP_MODE_STRICT = 0x1 + SECURITYFS_MAGIC = 0x73636673 + SELINUX_MAGIC = 0xf97cff8c SHUT_RD = 0x0 SHUT_RDWR = 0x2 SHUT_WR = 0x1 @@ -1592,6 +1786,23 @@ const ( SIOCSPGRP = 0x8902 SIOCSRARP = 0x8962 SIOCWANDEV = 0x894a + SMACK_MAGIC = 0x43415d53 + SMART_AUTOSAVE = 0xd2 + SMART_AUTO_OFFLINE = 0xdb + SMART_DISABLE = 0xd9 + SMART_ENABLE = 0xd8 + SMART_HCYL_PASS = 0xc2 + SMART_IMMEDIATE_OFFLINE = 0xd4 + SMART_LCYL_PASS = 0x4f + SMART_READ_LOG_SECTOR = 0xd5 + SMART_READ_THRESHOLDS = 0xd1 + SMART_READ_VALUES = 0xd0 + SMART_SAVE = 0xd3 + SMART_STATUS = 0xda + SMART_WRITE_LOG_SECTOR = 0xd6 + SMART_WRITE_THRESHOLDS = 0xd7 + SMB_SUPER_MAGIC = 0x517b + SOCKFS_MAGIC = 0x534f434b SOCK_CLOEXEC = 0x80000 SOCK_DCCP = 0x6 SOCK_DGRAM = 0x2 @@ -1628,6 +1839,7 @@ const ( SOL_SOCKET = 0x1 SOL_TCP = 0x6 SOL_TIPC = 0x10f + SOL_TLS = 0x11a SOL_X25 = 0x106 SOMAXCONN = 0x80 SO_ACCEPTCONN = 0x1e @@ -1696,10 +1908,13 @@ const ( SO_VM_SOCKETS_PEER_HOST_VM_ID = 0x3 SO_VM_SOCKETS_TRUSTED = 0x5 SO_WIFI_STATUS = 0x29 + SO_ZEROCOPY = 0x3c SPLICE_F_GIFT = 0x8 SPLICE_F_MORE = 0x4 SPLICE_F_MOVE = 0x1 SPLICE_F_NONBLOCK = 0x2 + SQUASHFS_MAGIC = 0x73717368 + STACK_END_MAGIC = 0x57ac6e9d STATX_ALL = 0xfff STATX_ATIME = 0x20 STATX_ATTR_APPEND = 0x20 @@ -1721,6 +1936,7 @@ const ( STATX_TYPE = 0x1 STATX_UID = 0x8 STATX__RESERVED = 0x80000000 + SYSFS_MAGIC = 0x62656572 S_BLKSIZE = 0x200 S_IEXEC = 0x40 S_IFBLK = 0x6000 @@ -1792,6 +2008,8 @@ const ( TCP_MAXWIN = 0xffff TCP_MAX_WINSHIFT = 0xe TCP_MD5SIG = 0xe + TCP_MD5SIG_EXT = 0x20 + TCP_MD5SIG_FLAG_PREFIX = 0x1 TCP_MD5SIG_MAXKEYLEN = 0x50 TCP_MSS = 0x200 TCP_MSS_DEFAULT = 0x218 @@ -1812,6 +2030,7 @@ const ( TCP_THIN_DUPACK = 0x11 TCP_THIN_LINEAR_TIMEOUTS = 0x10 TCP_TIMESTAMP = 0x18 + TCP_ULP = 0x1f TCP_USER_TIMEOUT = 0x12 TCP_WINDOW_CLAMP = 0xa TCSAFLUSH = 0x2 @@ -1899,7 +2118,27 @@ const ( TIOCSTI = 0x5412 TIOCSWINSZ = 0x5414 TIOCVHANGUP = 0x5437 + TMPFS_MAGIC = 0x1021994 TOSTOP = 0x100 + TPACKET_ALIGNMENT = 0x10 + TPACKET_HDRLEN = 0x34 + TP_STATUS_AVAILABLE = 0x0 + TP_STATUS_BLK_TMO = 0x20 + TP_STATUS_COPY = 0x2 + TP_STATUS_CSUMNOTREADY = 0x8 + TP_STATUS_CSUM_VALID = 0x80 + TP_STATUS_KERNEL = 0x0 + TP_STATUS_LOSING = 0x4 + TP_STATUS_SENDING = 0x2 + TP_STATUS_SEND_REQUEST = 0x1 + TP_STATUS_TS_RAW_HARDWARE = -0x80000000 + TP_STATUS_TS_SOFTWARE = 0x20000000 + TP_STATUS_TS_SYS_HARDWARE = 0x40000000 + TP_STATUS_USER = 0x1 + TP_STATUS_VLAN_TPID_VALID = 0x40 + TP_STATUS_VLAN_VALID = 0x10 + TP_STATUS_WRONG_FORMAT = 0x4 + TRACEFS_MAGIC = 0x74726163 TS_COMM_LEN = 0x20 TUNATTACHFILTER = 0x401054d5 TUNDETACHFILTER = 0x401054d6 @@ -1911,6 +2150,7 @@ const ( TUNGETVNETHDRSZ = 0x800454d7 TUNGETVNETLE = 0x800454dd TUNSETDEBUG = 0x400454c9 + TUNSETFILTEREBPF = 0x800454e1 TUNSETGROUP = 0x400454ce TUNSETIFF = 0x400454ca TUNSETIFINDEX = 0x400454da @@ -1921,13 +2161,17 @@ const ( TUNSETPERSIST = 0x400454cb TUNSETQUEUE = 0x400454d9 TUNSETSNDBUF = 0x400454d4 + TUNSETSTEERINGEBPF = 0x800454e0 TUNSETTXFILTER = 0x400454d1 TUNSETVNETBE = 0x400454de TUNSETVNETHDRSZ = 0x400454d8 TUNSETVNETLE = 0x400454dc + UDF_SUPER_MAGIC = 0x15013346 UMOUNT_NOFOLLOW = 0x8 + USBDEVICE_SUPER_MAGIC = 0x9fa2 UTIME_NOW = 0x3fffffff UTIME_OMIT = 0x3ffffffe + V9FS_MAGIC = 0x1021997 VDISCARD = 0xd VEOF = 0x4 VEOL = 0xb @@ -1969,6 +2213,86 @@ const ( WDIOC_SETPRETIMEOUT = 0xc0045708 WDIOC_SETTIMEOUT = 0xc0045706 WEXITED = 0x4 + WIN_ACKMEDIACHANGE = 0xdb + WIN_CHECKPOWERMODE1 = 0xe5 + WIN_CHECKPOWERMODE2 = 0x98 + WIN_DEVICE_RESET = 0x8 + WIN_DIAGNOSE = 0x90 + WIN_DOORLOCK = 0xde + WIN_DOORUNLOCK = 0xdf + WIN_DOWNLOAD_MICROCODE = 0x92 + WIN_FLUSH_CACHE = 0xe7 + WIN_FLUSH_CACHE_EXT = 0xea + WIN_FORMAT = 0x50 + WIN_GETMEDIASTATUS = 0xda + WIN_IDENTIFY = 0xec + WIN_IDENTIFY_DMA = 0xee + WIN_IDLEIMMEDIATE = 0xe1 + WIN_INIT = 0x60 + WIN_MEDIAEJECT = 0xed + WIN_MULTREAD = 0xc4 + WIN_MULTREAD_EXT = 0x29 + WIN_MULTWRITE = 0xc5 + WIN_MULTWRITE_EXT = 0x39 + WIN_NOP = 0x0 + WIN_PACKETCMD = 0xa0 + WIN_PIDENTIFY = 0xa1 + WIN_POSTBOOT = 0xdc + WIN_PREBOOT = 0xdd + WIN_QUEUED_SERVICE = 0xa2 + WIN_READ = 0x20 + WIN_READDMA = 0xc8 + WIN_READDMA_EXT = 0x25 + WIN_READDMA_ONCE = 0xc9 + WIN_READDMA_QUEUED = 0xc7 + WIN_READDMA_QUEUED_EXT = 0x26 + WIN_READ_BUFFER = 0xe4 + WIN_READ_EXT = 0x24 + WIN_READ_LONG = 0x22 + WIN_READ_LONG_ONCE = 0x23 + WIN_READ_NATIVE_MAX = 0xf8 + WIN_READ_NATIVE_MAX_EXT = 0x27 + WIN_READ_ONCE = 0x21 + WIN_RECAL = 0x10 + WIN_RESTORE = 0x10 + WIN_SECURITY_DISABLE = 0xf6 + WIN_SECURITY_ERASE_PREPARE = 0xf3 + WIN_SECURITY_ERASE_UNIT = 0xf4 + WIN_SECURITY_FREEZE_LOCK = 0xf5 + WIN_SECURITY_SET_PASS = 0xf1 + WIN_SECURITY_UNLOCK = 0xf2 + WIN_SEEK = 0x70 + WIN_SETFEATURES = 0xef + WIN_SETIDLE1 = 0xe3 + WIN_SETIDLE2 = 0x97 + WIN_SETMULT = 0xc6 + WIN_SET_MAX = 0xf9 + WIN_SET_MAX_EXT = 0x37 + WIN_SLEEPNOW1 = 0xe6 + WIN_SLEEPNOW2 = 0x99 + WIN_SMART = 0xb0 + WIN_SPECIFY = 0x91 + WIN_SRST = 0x8 + WIN_STANDBY = 0xe2 + WIN_STANDBY2 = 0x96 + WIN_STANDBYNOW1 = 0xe0 + WIN_STANDBYNOW2 = 0x94 + WIN_VERIFY = 0x40 + WIN_VERIFY_EXT = 0x42 + WIN_VERIFY_ONCE = 0x41 + WIN_WRITE = 0x30 + WIN_WRITEDMA = 0xca + WIN_WRITEDMA_EXT = 0x35 + WIN_WRITEDMA_ONCE = 0xcb + WIN_WRITEDMA_QUEUED = 0xcc + WIN_WRITEDMA_QUEUED_EXT = 0x36 + WIN_WRITE_BUFFER = 0xe8 + WIN_WRITE_EXT = 0x34 + WIN_WRITE_LONG = 0x32 + WIN_WRITE_LONG_ONCE = 0x33 + WIN_WRITE_ONCE = 0x31 + WIN_WRITE_SAME = 0xe9 + WIN_WRITE_VERIFY = 0x3c WNOHANG = 0x1 WNOTHREAD = 0x20000000 WNOWAIT = 0x1000000 @@ -1978,7 +2302,9 @@ const ( XATTR_CREATE = 0x1 XATTR_REPLACE = 0x2 XCASE = 0x4 + XENFS_SUPER_MAGIC = 0xabba1974 XTABS = 0x1800 + ZSMALLOC_MAGIC = 0x58295829 ) // Errors @@ -2158,171 +2484,179 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "no such device or address", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource temporarily unavailable", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device or resource busy", - 17: "file exists", - 18: "invalid cross-device link", - 19: "no such device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "numerical result out of range", - 35: "resource deadlock avoided", - 36: "file name too long", - 37: "no locks available", - 38: "function not implemented", - 39: "directory not empty", - 40: "too many levels of symbolic links", - 42: "no message of desired type", - 43: "identifier removed", - 44: "channel number out of range", - 45: "level 2 not synchronized", - 46: "level 3 halted", - 47: "level 3 reset", - 48: "link number out of range", - 49: "protocol driver not attached", - 50: "no CSI structure available", - 51: "level 2 halted", - 52: "invalid exchange", - 53: "invalid request descriptor", - 54: "exchange full", - 55: "no anode", - 56: "invalid request code", - 57: "invalid slot", - 59: "bad font file format", - 60: "device not a stream", - 61: "no data available", - 62: "timer expired", - 63: "out of streams resources", - 64: "machine is not on the network", - 65: "package not installed", - 66: "object is remote", - 67: "link has been severed", - 68: "advertise error", - 69: "srmount error", - 70: "communication error on send", - 71: "protocol error", - 72: "multihop attempted", - 73: "RFS specific error", - 74: "bad message", - 75: "value too large for defined data type", - 76: "name not unique on network", - 77: "file descriptor in bad state", - 78: "remote address changed", - 79: "can not access a needed shared library", - 80: "accessing a corrupted shared library", - 81: ".lib section in a.out corrupted", - 82: "attempting to link in too many shared libraries", - 83: "cannot exec a shared library directly", - 84: "invalid or incomplete multibyte or wide character", - 85: "interrupted system call should be restarted", - 86: "streams pipe error", - 87: "too many users", - 88: "socket operation on non-socket", - 89: "destination address required", - 90: "message too long", - 91: "protocol wrong type for socket", - 92: "protocol not available", - 93: "protocol not supported", - 94: "socket type not supported", - 95: "operation not supported", - 96: "protocol family not supported", - 97: "address family not supported by protocol", - 98: "address already in use", - 99: "cannot assign requested address", - 100: "network is down", - 101: "network is unreachable", - 102: "network dropped connection on reset", - 103: "software caused connection abort", - 104: "connection reset by peer", - 105: "no buffer space available", - 106: "transport endpoint is already connected", - 107: "transport endpoint is not connected", - 108: "cannot send after transport endpoint shutdown", - 109: "too many references: cannot splice", - 110: "connection timed out", - 111: "connection refused", - 112: "host is down", - 113: "no route to host", - 114: "operation already in progress", - 115: "operation now in progress", - 116: "stale file handle", - 117: "structure needs cleaning", - 118: "not a XENIX named type file", - 119: "no XENIX semaphores available", - 120: "is a named type file", - 121: "remote I/O error", - 122: "disk quota exceeded", - 123: "no medium found", - 124: "wrong medium type", - 125: "operation canceled", - 126: "required key not available", - 127: "key has expired", - 128: "key has been revoked", - 129: "key was rejected by service", - 130: "owner died", - 131: "state not recoverable", - 132: "operation not possible due to RF-kill", - 133: "memory page has hardware error", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "no such device or address"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EAGAIN", "resource temporarily unavailable"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device or resource busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "invalid cross-device link"}, + {19, "ENODEV", "no such device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "numerical result out of range"}, + {35, "EDEADLK", "resource deadlock avoided"}, + {36, "ENAMETOOLONG", "file name too long"}, + {37, "ENOLCK", "no locks available"}, + {38, "ENOSYS", "function not implemented"}, + {39, "ENOTEMPTY", "directory not empty"}, + {40, "ELOOP", "too many levels of symbolic links"}, + {42, "ENOMSG", "no message of desired type"}, + {43, "EIDRM", "identifier removed"}, + {44, "ECHRNG", "channel number out of range"}, + {45, "EL2NSYNC", "level 2 not synchronized"}, + {46, "EL3HLT", "level 3 halted"}, + {47, "EL3RST", "level 3 reset"}, + {48, "ELNRNG", "link number out of range"}, + {49, "EUNATCH", "protocol driver not attached"}, + {50, "ENOCSI", "no CSI structure available"}, + {51, "EL2HLT", "level 2 halted"}, + {52, "EBADE", "invalid exchange"}, + {53, "EBADR", "invalid request descriptor"}, + {54, "EXFULL", "exchange full"}, + {55, "ENOANO", "no anode"}, + {56, "EBADRQC", "invalid request code"}, + {57, "EBADSLT", "invalid slot"}, + {59, "EBFONT", "bad font file format"}, + {60, "ENOSTR", "device not a stream"}, + {61, "ENODATA", "no data available"}, + {62, "ETIME", "timer expired"}, + {63, "ENOSR", "out of streams resources"}, + {64, "ENONET", "machine is not on the network"}, + {65, "ENOPKG", "package not installed"}, + {66, "EREMOTE", "object is remote"}, + {67, "ENOLINK", "link has been severed"}, + {68, "EADV", "advertise error"}, + {69, "ESRMNT", "srmount error"}, + {70, "ECOMM", "communication error on send"}, + {71, "EPROTO", "protocol error"}, + {72, "EMULTIHOP", "multihop attempted"}, + {73, "EDOTDOT", "RFS specific error"}, + {74, "EBADMSG", "bad message"}, + {75, "EOVERFLOW", "value too large for defined data type"}, + {76, "ENOTUNIQ", "name not unique on network"}, + {77, "EBADFD", "file descriptor in bad state"}, + {78, "EREMCHG", "remote address changed"}, + {79, "ELIBACC", "can not access a needed shared library"}, + {80, "ELIBBAD", "accessing a corrupted shared library"}, + {81, "ELIBSCN", ".lib section in a.out corrupted"}, + {82, "ELIBMAX", "attempting to link in too many shared libraries"}, + {83, "ELIBEXEC", "cannot exec a shared library directly"}, + {84, "EILSEQ", "invalid or incomplete multibyte or wide character"}, + {85, "ERESTART", "interrupted system call should be restarted"}, + {86, "ESTRPIPE", "streams pipe error"}, + {87, "EUSERS", "too many users"}, + {88, "ENOTSOCK", "socket operation on non-socket"}, + {89, "EDESTADDRREQ", "destination address required"}, + {90, "EMSGSIZE", "message too long"}, + {91, "EPROTOTYPE", "protocol wrong type for socket"}, + {92, "ENOPROTOOPT", "protocol not available"}, + {93, "EPROTONOSUPPORT", "protocol not supported"}, + {94, "ESOCKTNOSUPPORT", "socket type not supported"}, + {95, "ENOTSUP", "operation not supported"}, + {96, "EPFNOSUPPORT", "protocol family not supported"}, + {97, "EAFNOSUPPORT", "address family not supported by protocol"}, + {98, "EADDRINUSE", "address already in use"}, + {99, "EADDRNOTAVAIL", "cannot assign requested address"}, + {100, "ENETDOWN", "network is down"}, + {101, "ENETUNREACH", "network is unreachable"}, + {102, "ENETRESET", "network dropped connection on reset"}, + {103, "ECONNABORTED", "software caused connection abort"}, + {104, "ECONNRESET", "connection reset by peer"}, + {105, "ENOBUFS", "no buffer space available"}, + {106, "EISCONN", "transport endpoint is already connected"}, + {107, "ENOTCONN", "transport endpoint is not connected"}, + {108, "ESHUTDOWN", "cannot send after transport endpoint shutdown"}, + {109, "ETOOMANYREFS", "too many references: cannot splice"}, + {110, "ETIMEDOUT", "connection timed out"}, + {111, "ECONNREFUSED", "connection refused"}, + {112, "EHOSTDOWN", "host is down"}, + {113, "EHOSTUNREACH", "no route to host"}, + {114, "EALREADY", "operation already in progress"}, + {115, "EINPROGRESS", "operation now in progress"}, + {116, "ESTALE", "stale file handle"}, + {117, "EUCLEAN", "structure needs cleaning"}, + {118, "ENOTNAM", "not a XENIX named type file"}, + {119, "ENAVAIL", "no XENIX semaphores available"}, + {120, "EISNAM", "is a named type file"}, + {121, "EREMOTEIO", "remote I/O error"}, + {122, "EDQUOT", "disk quota exceeded"}, + {123, "ENOMEDIUM", "no medium found"}, + {124, "EMEDIUMTYPE", "wrong medium type"}, + {125, "ECANCELED", "operation canceled"}, + {126, "ENOKEY", "required key not available"}, + {127, "EKEYEXPIRED", "key has expired"}, + {128, "EKEYREVOKED", "key has been revoked"}, + {129, "EKEYREJECTED", "key was rejected by service"}, + {130, "EOWNERDEAD", "owner died"}, + {131, "ENOTRECOVERABLE", "state not recoverable"}, + {132, "ERFKILL", "operation not possible due to RF-kill"}, + {133, "EHWPOISON", "memory page has hardware error"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/breakpoint trap", - 6: "aborted", - 7: "bus error", - 8: "floating point exception", - 9: "killed", - 10: "user defined signal 1", - 11: "segmentation fault", - 12: "user defined signal 2", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "stack fault", - 17: "child exited", - 18: "continued", - 19: "stopped (signal)", - 20: "stopped", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "urgent I/O condition", - 24: "CPU time limit exceeded", - 25: "file size limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window changed", - 29: "I/O possible", - 30: "power failure", - 31: "bad system call", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/breakpoint trap"}, + {6, "SIGABRT", "aborted"}, + {7, "SIGBUS", "bus error"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGUSR1", "user defined signal 1"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGUSR2", "user defined signal 2"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGSTKFLT", "stack fault"}, + {17, "SIGCHLD", "child exited"}, + {18, "SIGCONT", "continued"}, + {19, "SIGSTOP", "stopped (signal)"}, + {20, "SIGTSTP", "stopped"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGURG", "urgent I/O condition"}, + {24, "SIGXCPU", "CPU time limit exceeded"}, + {25, "SIGXFSZ", "file size limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window changed"}, + {29, "SIGIO", "I/O possible"}, + {30, "SIGPWR", "power failure"}, + {31, "SIGSYS", "bad system call"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go index 95de199fc4..7fdc85b172 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_linux_sparc64.go @@ -1,5 +1,5 @@ // mkerrors.sh -m64 -// MACHINE GENERATED BY THE COMMAND ABOVE; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. // +build sparc64,linux diff --git a/vendor/golang.org/x/sys/unix/zerrors_netbsd_386.go b/vendor/golang.org/x/sys/unix/zerrors_netbsd_386.go index 1612b66091..cd93ce0d85 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_netbsd_386.go +++ b/vendor/golang.org/x/sys/unix/zerrors_netbsd_386.go @@ -159,6 +159,7 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CREAD = 0x800 + CRTSCTS = 0x10000 CS5 = 0x0 CS6 = 0x100 CS7 = 0x200 @@ -1583,137 +1584,145 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large or too small", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol option not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "connection timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "identifier removed", - 83: "no message of desired type", - 84: "value too large to be stored in data type", - 85: "illegal byte sequence", - 86: "not supported", - 87: "operation Canceled", - 88: "bad or Corrupt message", - 89: "no message available", - 90: "no STREAM resources", - 91: "not a STREAM", - 92: "STREAM ioctl timeout", - 93: "attribute not found", - 94: "multihop attempted", - 95: "link has been severed", - 96: "protocol error", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large or too small"}, + {35, "EAGAIN", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol option not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "EOPNOTSUPP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "connection timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disc quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC prog. not avail"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EIDRM", "identifier removed"}, + {83, "ENOMSG", "no message of desired type"}, + {84, "EOVERFLOW", "value too large to be stored in data type"}, + {85, "EILSEQ", "illegal byte sequence"}, + {86, "ENOTSUP", "not supported"}, + {87, "ECANCELED", "operation Canceled"}, + {88, "EBADMSG", "bad or Corrupt message"}, + {89, "ENODATA", "no message available"}, + {90, "ENOSR", "no STREAM resources"}, + {91, "ENOSTR", "not a STREAM"}, + {92, "ETIME", "STREAM ioctl timeout"}, + {93, "ENOATTR", "attribute not found"}, + {94, "EMULTIHOP", "multihop attempted"}, + {95, "ENOLINK", "link has been severed"}, + {96, "ELAST", "protocol error"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "stopped (signal)", - 18: "stopped", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", - 32: "power fail/restart", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGIOT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "stopped (signal)"}, + {18, "SIGTSTP", "stopped"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, + {32, "SIGPWR", "power fail/restart"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_netbsd_amd64.go b/vendor/golang.org/x/sys/unix/zerrors_netbsd_amd64.go index c994ab610c..071701c411 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_netbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_netbsd_amd64.go @@ -159,6 +159,7 @@ const ( CLONE_VFORK = 0x4000 CLONE_VM = 0x100 CREAD = 0x800 + CRTSCTS = 0x10000 CS5 = 0x0 CS6 = 0x100 CS7 = 0x200 @@ -1573,137 +1574,145 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large or too small", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol option not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "connection timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "identifier removed", - 83: "no message of desired type", - 84: "value too large to be stored in data type", - 85: "illegal byte sequence", - 86: "not supported", - 87: "operation Canceled", - 88: "bad or Corrupt message", - 89: "no message available", - 90: "no STREAM resources", - 91: "not a STREAM", - 92: "STREAM ioctl timeout", - 93: "attribute not found", - 94: "multihop attempted", - 95: "link has been severed", - 96: "protocol error", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large or too small"}, + {35, "EAGAIN", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol option not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "EOPNOTSUPP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "connection timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disc quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC prog. not avail"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EIDRM", "identifier removed"}, + {83, "ENOMSG", "no message of desired type"}, + {84, "EOVERFLOW", "value too large to be stored in data type"}, + {85, "EILSEQ", "illegal byte sequence"}, + {86, "ENOTSUP", "not supported"}, + {87, "ECANCELED", "operation Canceled"}, + {88, "EBADMSG", "bad or Corrupt message"}, + {89, "ENODATA", "no message available"}, + {90, "ENOSR", "no STREAM resources"}, + {91, "ENOSTR", "not a STREAM"}, + {92, "ETIME", "STREAM ioctl timeout"}, + {93, "ENOATTR", "attribute not found"}, + {94, "EMULTIHOP", "multihop attempted"}, + {95, "ENOLINK", "link has been severed"}, + {96, "ELAST", "protocol error"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "stopped (signal)", - 18: "stopped", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", - 32: "power fail/restart", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGIOT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "stopped (signal)"}, + {18, "SIGTSTP", "stopped"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, + {32, "SIGPWR", "power fail/restart"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_netbsd_arm.go b/vendor/golang.org/x/sys/unix/zerrors_netbsd_arm.go index a8f9efedec..5fe56ae8c7 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_netbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zerrors_netbsd_arm.go @@ -151,6 +151,7 @@ const ( CFLUSH = 0xf CLOCAL = 0x8000 CREAD = 0x800 + CRTSCTS = 0x10000 CS5 = 0x0 CS6 = 0x100 CS7 = 0x200 @@ -1562,137 +1563,145 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large or too small", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol option not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "connection timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "identifier removed", - 83: "no message of desired type", - 84: "value too large to be stored in data type", - 85: "illegal byte sequence", - 86: "not supported", - 87: "operation Canceled", - 88: "bad or Corrupt message", - 89: "no message available", - 90: "no STREAM resources", - 91: "not a STREAM", - 92: "STREAM ioctl timeout", - 93: "attribute not found", - 94: "multihop attempted", - 95: "link has been severed", - 96: "protocol error", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large or too small"}, + {35, "EAGAIN", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol option not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "EOPNOTSUPP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "connection timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disc quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC prog. not avail"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EIDRM", "identifier removed"}, + {83, "ENOMSG", "no message of desired type"}, + {84, "EOVERFLOW", "value too large to be stored in data type"}, + {85, "EILSEQ", "illegal byte sequence"}, + {86, "ENOTSUP", "not supported"}, + {87, "ECANCELED", "operation Canceled"}, + {88, "EBADMSG", "bad or Corrupt message"}, + {89, "ENODATA", "no message available"}, + {90, "ENOSR", "no STREAM resources"}, + {91, "ENOSTR", "not a STREAM"}, + {92, "ETIME", "STREAM ioctl timeout"}, + {93, "ENOATTR", "attribute not found"}, + {94, "EMULTIHOP", "multihop attempted"}, + {95, "ENOLINK", "link has been severed"}, + {96, "ELAST", "protocol error"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "stopped (signal)", - 18: "stopped", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", - 32: "power fail/restart", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGIOT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "stopped (signal)"}, + {18, "SIGTSTP", "stopped"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, + {32, "SIGPWR", "power fail/restart"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_openbsd_386.go b/vendor/golang.org/x/sys/unix/zerrors_openbsd_386.go index 04e4f33198..0a1c3e7e8c 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_openbsd_386.go +++ b/vendor/golang.org/x/sys/unix/zerrors_openbsd_386.go @@ -147,6 +147,7 @@ const ( CFLUSH = 0xf CLOCAL = 0x8000 CREAD = 0x800 + CRTSCTS = 0x10000 CS5 = 0x0 CS6 = 0x100 CS7 = 0x200 @@ -1460,132 +1461,140 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "connection timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "IPsec processing failure", - 83: "attribute not found", - 84: "illegal byte sequence", - 85: "no medium found", - 86: "wrong medium type", - 87: "value too large to be stored in data type", - 88: "operation canceled", - 89: "identifier removed", - 90: "no message of desired type", - 91: "not supported", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large"}, + {35, "EWOULDBLOCK", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "EOPNOTSUPP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "operation timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disk quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC program not available"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EIPSEC", "IPsec processing failure"}, + {83, "ENOATTR", "attribute not found"}, + {84, "EILSEQ", "illegal byte sequence"}, + {85, "ENOMEDIUM", "no medium found"}, + {86, "EMEDIUMTYPE", "wrong medium type"}, + {87, "EOVERFLOW", "value too large to be stored in data type"}, + {88, "ECANCELED", "operation canceled"}, + {89, "EIDRM", "identifier removed"}, + {90, "ENOMSG", "no message of desired type"}, + {91, "ELAST", "not supported"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "stopped (signal)", - 18: "stopped", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", - 32: "thread AST", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGABRT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "suspended (signal)"}, + {18, "SIGTSTP", "suspended"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, + {32, "SIGTHR", "thread AST"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/zerrors_openbsd_amd64.go index c80ff98120..acfc664691 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_openbsd_amd64.go @@ -45,6 +45,7 @@ const ( AF_SNA = 0xb AF_UNIX = 0x1 AF_UNSPEC = 0x0 + ALTWERASE = 0x200 ARPHRD_ETHER = 0x1 ARPHRD_FRELAY = 0xf ARPHRD_IEEE1394 = 0x18 @@ -146,7 +147,14 @@ const ( BRKINT = 0x2 CFLUSH = 0xf CLOCAL = 0x8000 + CLOCK_BOOTTIME = 0x6 + CLOCK_MONOTONIC = 0x3 + CLOCK_PROCESS_CPUTIME_ID = 0x2 + CLOCK_REALTIME = 0x0 + CLOCK_THREAD_CPUTIME_ID = 0x4 + CLOCK_UPTIME = 0x5 CREAD = 0x800 + CRTSCTS = 0x10000 CS5 = 0x0 CS6 = 0x100 CS7 = 0x200 @@ -177,6 +185,7 @@ const ( DLT_LOOP = 0xc DLT_MPLS = 0xdb DLT_NULL = 0x0 + DLT_OPENFLOW = 0x10b DLT_PFLOG = 0x75 DLT_PFSYNC = 0x12 DLT_PPP = 0x9 @@ -187,6 +196,23 @@ const ( DLT_RAW = 0xe DLT_SLIP = 0x8 DLT_SLIP_BSDOS = 0xf + DLT_USBPCAP = 0xf9 + DLT_USER0 = 0x93 + DLT_USER1 = 0x94 + DLT_USER10 = 0x9d + DLT_USER11 = 0x9e + DLT_USER12 = 0x9f + DLT_USER13 = 0xa0 + DLT_USER14 = 0xa1 + DLT_USER15 = 0xa2 + DLT_USER2 = 0x95 + DLT_USER3 = 0x96 + DLT_USER4 = 0x97 + DLT_USER5 = 0x98 + DLT_USER6 = 0x99 + DLT_USER7 = 0x9a + DLT_USER8 = 0x9b + DLT_USER9 = 0x9c DT_BLK = 0x6 DT_CHR = 0x2 DT_DIR = 0x4 @@ -400,27 +426,38 @@ const ( ETHER_CRC_POLY_LE = 0xedb88320 ETHER_HDR_LEN = 0xe ETHER_MAX_DIX_LEN = 0x600 + ETHER_MAX_HARDMTU_LEN = 0xff9b ETHER_MAX_LEN = 0x5ee ETHER_MIN_LEN = 0x40 ETHER_TYPE_LEN = 0x2 ETHER_VLAN_ENCAP_LEN = 0x4 EVFILT_AIO = -0x3 + EVFILT_DEVICE = -0x8 EVFILT_PROC = -0x5 EVFILT_READ = -0x1 EVFILT_SIGNAL = -0x6 - EVFILT_SYSCOUNT = 0x7 + EVFILT_SYSCOUNT = 0x8 EVFILT_TIMER = -0x7 EVFILT_VNODE = -0x4 EVFILT_WRITE = -0x2 + EVL_ENCAPLEN = 0x4 + EVL_PRIO_BITS = 0xd + EVL_PRIO_MAX = 0x7 + EVL_VLID_MASK = 0xfff + EVL_VLID_MAX = 0xffe + EVL_VLID_MIN = 0x1 + EVL_VLID_NULL = 0x0 EV_ADD = 0x1 EV_CLEAR = 0x20 EV_DELETE = 0x2 EV_DISABLE = 0x8 + EV_DISPATCH = 0x80 EV_ENABLE = 0x4 EV_EOF = 0x8000 EV_ERROR = 0x4000 EV_FLAG1 = 0x2000 EV_ONESHOT = 0x10 + EV_RECEIPT = 0x40 EV_SYSFLAGS = 0xf000 EXTA = 0x4b00 EXTB = 0x9600 @@ -434,7 +471,7 @@ const ( F_GETFL = 0x3 F_GETLK = 0x7 F_GETOWN = 0x5 - F_OK = 0x0 + F_ISATTY = 0xb F_RDLCK = 0x1 F_SETFD = 0x2 F_SETFL = 0x4 @@ -451,7 +488,6 @@ const ( IEXTEN = 0x400 IFAN_ARRIVAL = 0x0 IFAN_DEPARTURE = 0x1 - IFA_ROUTE = 0x1 IFF_ALLMULTI = 0x200 IFF_BROADCAST = 0x2 IFF_CANTCHANGE = 0x8e52 @@ -462,12 +498,12 @@ const ( IFF_LOOPBACK = 0x8 IFF_MULTICAST = 0x8000 IFF_NOARP = 0x80 - IFF_NOTRAILERS = 0x20 IFF_OACTIVE = 0x400 IFF_POINTOPOINT = 0x10 IFF_PROMISC = 0x100 IFF_RUNNING = 0x40 IFF_SIMPLEX = 0x800 + IFF_STATICARP = 0x20 IFF_UP = 0x1 IFNAMSIZ = 0x10 IFT_1822 = 0x2 @@ -596,6 +632,7 @@ const ( IFT_LINEGROUP = 0xd2 IFT_LOCALTALK = 0x2a IFT_LOOP = 0x18 + IFT_MBIM = 0xfa IFT_MEDIAMAILOVERIP = 0x8b IFT_MFSIGLINK = 0xa7 IFT_MIOX25 = 0x26 @@ -720,8 +757,6 @@ const ( IPPROTO_AH = 0x33 IPPROTO_CARP = 0x70 IPPROTO_DIVERT = 0x102 - IPPROTO_DIVERT_INIT = 0x2 - IPPROTO_DIVERT_RESP = 0x1 IPPROTO_DONE = 0x101 IPPROTO_DSTOPTS = 0x3c IPPROTO_EGP = 0x8 @@ -778,6 +813,7 @@ const ( IPV6_LEAVE_GROUP = 0xd IPV6_MAXHLIM = 0xff IPV6_MAXPACKET = 0xffff + IPV6_MINHOPCOUNT = 0x41 IPV6_MMTU = 0x500 IPV6_MULTICAST_HOPS = 0xa IPV6_MULTICAST_IF = 0x9 @@ -817,12 +853,12 @@ const ( IP_DEFAULT_MULTICAST_LOOP = 0x1 IP_DEFAULT_MULTICAST_TTL = 0x1 IP_DF = 0x4000 - IP_DIVERTFL = 0x1022 IP_DROP_MEMBERSHIP = 0xd IP_ESP_NETWORK_LEVEL = 0x16 IP_ESP_TRANS_LEVEL = 0x15 IP_HDRINCL = 0x2 IP_IPCOMP_LEVEL = 0x1d + IP_IPDEFTTL = 0x25 IP_IPSECFLOWINFO = 0x24 IP_IPSEC_LOCAL_AUTH = 0x1b IP_IPSEC_LOCAL_CRED = 0x19 @@ -856,10 +892,12 @@ const ( IP_RETOPTS = 0x8 IP_RF = 0x8000 IP_RTABLE = 0x1021 + IP_SENDSRCADDR = 0x7 IP_TOS = 0x3 IP_TTL = 0x4 ISIG = 0x80 ISTRIP = 0x20 + IUCLC = 0x1000 IXANY = 0x800 IXOFF = 0x400 IXON = 0x200 @@ -880,25 +918,28 @@ const ( MADV_SPACEAVAIL = 0x5 MADV_WILLNEED = 0x3 MAP_ANON = 0x1000 - MAP_COPY = 0x4 + MAP_ANONYMOUS = 0x1000 + MAP_COPY = 0x2 MAP_FILE = 0x0 MAP_FIXED = 0x10 - MAP_FLAGMASK = 0x1ff7 - MAP_HASSEMAPHORE = 0x200 - MAP_INHERIT = 0x80 + MAP_FLAGMASK = 0x7ff7 + MAP_HASSEMAPHORE = 0x0 + MAP_INHERIT = 0x0 MAP_INHERIT_COPY = 0x1 - MAP_INHERIT_DONATE_COPY = 0x3 MAP_INHERIT_NONE = 0x2 MAP_INHERIT_SHARE = 0x0 - MAP_NOEXTEND = 0x100 - MAP_NORESERVE = 0x40 + MAP_INHERIT_ZERO = 0x3 + MAP_NOEXTEND = 0x0 + MAP_NORESERVE = 0x0 MAP_PRIVATE = 0x2 - MAP_RENAME = 0x20 + MAP_RENAME = 0x0 MAP_SHARED = 0x1 - MAP_TRYFIXED = 0x400 + MAP_STACK = 0x4000 + MAP_TRYFIXED = 0x0 MCL_CURRENT = 0x1 MCL_FUTURE = 0x2 MSG_BCAST = 0x100 + MSG_CMSG_CLOEXEC = 0x800 MSG_CTRUNC = 0x20 MSG_DONTROUTE = 0x4 MSG_DONTWAIT = 0x80 @@ -916,11 +957,14 @@ const ( NET_RT_DUMP = 0x1 NET_RT_FLAGS = 0x2 NET_RT_IFLIST = 0x3 - NET_RT_MAXID = 0x6 + NET_RT_IFNAMES = 0x6 + NET_RT_MAXID = 0x7 NET_RT_STATS = 0x4 NET_RT_TABLE = 0x5 NOFLSH = 0x80000000 + NOKERNINFO = 0x2000000 NOTE_ATTRIB = 0x8 + NOTE_CHANGE = 0x1 NOTE_CHILD = 0x4 NOTE_DELETE = 0x1 NOTE_EOF = 0x2 @@ -939,11 +983,13 @@ const ( NOTE_TRUNCATE = 0x80 NOTE_WRITE = 0x2 OCRNL = 0x10 + OLCUC = 0x20 ONLCR = 0x2 ONLRET = 0x80 ONOCR = 0x40 ONOEOT = 0x8 OPOST = 0x1 + OXTABS = 0x4 O_ACCMODE = 0x3 O_APPEND = 0x8 O_ASYNC = 0x40 @@ -981,23 +1027,32 @@ const ( RLIMIT_CPU = 0x0 RLIMIT_DATA = 0x2 RLIMIT_FSIZE = 0x1 + RLIMIT_MEMLOCK = 0x6 RLIMIT_NOFILE = 0x8 + RLIMIT_NPROC = 0x7 + RLIMIT_RSS = 0x5 RLIMIT_STACK = 0x3 RLIM_INFINITY = 0x7fffffffffffffff RTAX_AUTHOR = 0x6 + RTAX_BFD = 0xb RTAX_BRD = 0x7 + RTAX_DNS = 0xc RTAX_DST = 0x0 RTAX_GATEWAY = 0x1 RTAX_GENMASK = 0x3 RTAX_IFA = 0x5 RTAX_IFP = 0x4 RTAX_LABEL = 0xa - RTAX_MAX = 0xb + RTAX_MAX = 0xf RTAX_NETMASK = 0x2 + RTAX_SEARCH = 0xe RTAX_SRC = 0x8 RTAX_SRCMASK = 0x9 + RTAX_STATIC = 0xd RTA_AUTHOR = 0x40 + RTA_BFD = 0x800 RTA_BRD = 0x80 + RTA_DNS = 0x1000 RTA_DST = 0x1 RTA_GATEWAY = 0x2 RTA_GENMASK = 0x8 @@ -1005,34 +1060,39 @@ const ( RTA_IFP = 0x10 RTA_LABEL = 0x400 RTA_NETMASK = 0x4 + RTA_SEARCH = 0x4000 RTA_SRC = 0x100 RTA_SRCMASK = 0x200 + RTA_STATIC = 0x2000 RTF_ANNOUNCE = 0x4000 + RTF_BFD = 0x1000000 RTF_BLACKHOLE = 0x1000 + RTF_BROADCAST = 0x400000 + RTF_CACHED = 0x20000 RTF_CLONED = 0x10000 RTF_CLONING = 0x100 + RTF_CONNECTED = 0x800000 RTF_DONE = 0x40 RTF_DYNAMIC = 0x10 - RTF_FMASK = 0x10f808 + RTF_FMASK = 0x110fc08 RTF_GATEWAY = 0x2 RTF_HOST = 0x4 RTF_LLINFO = 0x400 - RTF_MASK = 0x80 + RTF_LOCAL = 0x200000 RTF_MODIFIED = 0x20 RTF_MPATH = 0x40000 RTF_MPLS = 0x100000 + RTF_MULTICAST = 0x200 RTF_PERMANENT_ARP = 0x2000 RTF_PROTO1 = 0x8000 RTF_PROTO2 = 0x4000 RTF_PROTO3 = 0x2000 RTF_REJECT = 0x8 - RTF_SOURCE = 0x20000 RTF_STATIC = 0x800 - RTF_TUNNEL = 0x100000 RTF_UP = 0x1 RTF_USETRAILERS = 0x8000 - RTF_XRESOLVE = 0x200 RTM_ADD = 0x1 + RTM_BFD = 0x12 RTM_CHANGE = 0x3 RTM_DELADDR = 0xd RTM_DELETE = 0x2 @@ -1040,11 +1100,13 @@ const ( RTM_GET = 0x4 RTM_IFANNOUNCE = 0xf RTM_IFINFO = 0xe + RTM_INVALIDATE = 0x11 RTM_LOCK = 0x8 RTM_LOSING = 0x5 RTM_MAXSIZE = 0x800 RTM_MISS = 0x7 RTM_NEWADDR = 0xc + RTM_PROPOSAL = 0x13 RTM_REDIRECT = 0x6 RTM_RESOLVE = 0xb RTM_RTTUNIT = 0xf4240 @@ -1057,6 +1119,8 @@ const ( RTV_RTTVAR = 0x80 RTV_SPIPE = 0x10 RTV_SSTHRESH = 0x20 + RT_TABLEID_BITS = 0x8 + RT_TABLEID_MASK = 0xff RT_TABLEID_MAX = 0xff RUSAGE_CHILDREN = -0x1 RUSAGE_SELF = 0x0 @@ -1069,55 +1133,55 @@ const ( SIOCADDMULTI = 0x80206931 SIOCAIFADDR = 0x8040691a SIOCAIFGROUP = 0x80286987 - SIOCALIFADDR = 0x8218691c SIOCATMARK = 0x40047307 - SIOCBRDGADD = 0x8058693c - SIOCBRDGADDS = 0x80586941 - SIOCBRDGARL = 0x806e694d + SIOCBRDGADD = 0x8060693c + SIOCBRDGADDL = 0x80606949 + SIOCBRDGADDS = 0x80606941 + SIOCBRDGARL = 0x808c694d SIOCBRDGDADDR = 0x81286947 - SIOCBRDGDEL = 0x8058693d - SIOCBRDGDELS = 0x80586942 - SIOCBRDGFLUSH = 0x80586948 - SIOCBRDGFRL = 0x806e694e - SIOCBRDGGCACHE = 0xc0146941 - SIOCBRDGGFD = 0xc0146952 - SIOCBRDGGHT = 0xc0146951 - SIOCBRDGGIFFLGS = 0xc058693e - SIOCBRDGGMA = 0xc0146953 + SIOCBRDGDEL = 0x8060693d + SIOCBRDGDELS = 0x80606942 + SIOCBRDGFLUSH = 0x80606948 + SIOCBRDGFRL = 0x808c694e + SIOCBRDGGCACHE = 0xc0186941 + SIOCBRDGGFD = 0xc0186952 + SIOCBRDGGHT = 0xc0186951 + SIOCBRDGGIFFLGS = 0xc060693e + SIOCBRDGGMA = 0xc0186953 SIOCBRDGGPARAM = 0xc0406958 - SIOCBRDGGPRI = 0xc0146950 + SIOCBRDGGPRI = 0xc0186950 SIOCBRDGGRL = 0xc030694f - SIOCBRDGGSIFS = 0xc058693c - SIOCBRDGGTO = 0xc0146946 - SIOCBRDGIFS = 0xc0586942 + SIOCBRDGGTO = 0xc0186946 + SIOCBRDGIFS = 0xc0606942 SIOCBRDGRTS = 0xc0206943 SIOCBRDGSADDR = 0xc1286944 - SIOCBRDGSCACHE = 0x80146940 - SIOCBRDGSFD = 0x80146952 - SIOCBRDGSHT = 0x80146951 - SIOCBRDGSIFCOST = 0x80586955 - SIOCBRDGSIFFLGS = 0x8058693f - SIOCBRDGSIFPRIO = 0x80586954 - SIOCBRDGSMA = 0x80146953 - SIOCBRDGSPRI = 0x80146950 - SIOCBRDGSPROTO = 0x8014695a - SIOCBRDGSTO = 0x80146945 - SIOCBRDGSTXHC = 0x80146959 + SIOCBRDGSCACHE = 0x80186940 + SIOCBRDGSFD = 0x80186952 + SIOCBRDGSHT = 0x80186951 + SIOCBRDGSIFCOST = 0x80606955 + SIOCBRDGSIFFLGS = 0x8060693f + SIOCBRDGSIFPRIO = 0x80606954 + SIOCBRDGSIFPROT = 0x8060694a + SIOCBRDGSMA = 0x80186953 + SIOCBRDGSPRI = 0x80186950 + SIOCBRDGSPROTO = 0x8018695a + SIOCBRDGSTO = 0x80186945 + SIOCBRDGSTXHC = 0x80186959 SIOCDELMULTI = 0x80206932 SIOCDIFADDR = 0x80206919 SIOCDIFGROUP = 0x80286989 + SIOCDIFPARENT = 0x802069b4 SIOCDIFPHYADDR = 0x80206949 - SIOCDLIFADDR = 0x8218691e + SIOCDVNETID = 0x802069af SIOCGETKALIVE = 0xc01869a4 SIOCGETLABEL = 0x8020699a + SIOCGETMPWCFG = 0xc02069ae SIOCGETPFLOW = 0xc02069fe SIOCGETPFSYNC = 0xc02069f8 SIOCGETSGCNT = 0xc0207534 SIOCGETVIFCNT = 0xc0287533 SIOCGETVLAN = 0xc0206990 - SIOCGHIWAT = 0x40047301 SIOCGIFADDR = 0xc0206921 - SIOCGIFASYNCMAP = 0xc020697c SIOCGIFBRDADDR = 0xc0206923 SIOCGIFCONF = 0xc0106924 SIOCGIFDATA = 0xc020691b @@ -1129,37 +1193,41 @@ const ( SIOCGIFGMEMB = 0xc028698a SIOCGIFGROUP = 0xc0286988 SIOCGIFHARDMTU = 0xc02069a5 - SIOCGIFMEDIA = 0xc0306936 + SIOCGIFLLPRIO = 0xc02069b6 + SIOCGIFMEDIA = 0xc0406938 SIOCGIFMETRIC = 0xc0206917 SIOCGIFMTU = 0xc020697e SIOCGIFNETMASK = 0xc0206925 - SIOCGIFPDSTADDR = 0xc0206948 + SIOCGIFPAIR = 0xc02069b1 + SIOCGIFPARENT = 0xc02069b3 SIOCGIFPRIORITY = 0xc020699c - SIOCGIFPSRCADDR = 0xc0206947 SIOCGIFRDOMAIN = 0xc02069a0 SIOCGIFRTLABEL = 0xc0206983 - SIOCGIFTIMESLOT = 0xc0206986 + SIOCGIFRXR = 0x802069aa SIOCGIFXFLAGS = 0xc020699e - SIOCGLIFADDR = 0xc218691d SIOCGLIFPHYADDR = 0xc218694b + SIOCGLIFPHYDF = 0xc02069c2 SIOCGLIFPHYRTABLE = 0xc02069a2 SIOCGLIFPHYTTL = 0xc02069a9 - SIOCGLOWAT = 0x40047303 SIOCGPGRP = 0x40047309 SIOCGSPPPPARAMS = 0xc0206994 + SIOCGUMBINFO = 0xc02069be + SIOCGUMBPARAM = 0xc02069c0 SIOCGVH = 0xc02069f6 + SIOCGVNETFLOWID = 0xc02069c4 SIOCGVNETID = 0xc02069a7 + SIOCIFAFATTACH = 0x801169ab + SIOCIFAFDETACH = 0x801169ac SIOCIFCREATE = 0x8020697a SIOCIFDESTROY = 0x80206979 SIOCIFGCLONERS = 0xc0106978 SIOCSETKALIVE = 0x801869a3 SIOCSETLABEL = 0x80206999 + SIOCSETMPWCFG = 0x802069ad SIOCSETPFLOW = 0x802069fd SIOCSETPFSYNC = 0x802069f7 SIOCSETVLAN = 0x8020698f - SIOCSHIWAT = 0x80047300 SIOCSIFADDR = 0x8020690c - SIOCSIFASYNCMAP = 0x8020697d SIOCSIFBRDADDR = 0x80206913 SIOCSIFDESCR = 0x80206980 SIOCSIFDSTADDR = 0x8020690e @@ -1167,25 +1235,36 @@ const ( SIOCSIFGATTR = 0x8028698c SIOCSIFGENERIC = 0x80206939 SIOCSIFLLADDR = 0x8020691f - SIOCSIFMEDIA = 0xc0206935 + SIOCSIFLLPRIO = 0x802069b5 + SIOCSIFMEDIA = 0xc0206937 SIOCSIFMETRIC = 0x80206918 SIOCSIFMTU = 0x8020697f SIOCSIFNETMASK = 0x80206916 - SIOCSIFPHYADDR = 0x80406946 + SIOCSIFPAIR = 0x802069b0 + SIOCSIFPARENT = 0x802069b2 SIOCSIFPRIORITY = 0x8020699b SIOCSIFRDOMAIN = 0x8020699f SIOCSIFRTLABEL = 0x80206982 - SIOCSIFTIMESLOT = 0x80206985 SIOCSIFXFLAGS = 0x8020699d SIOCSLIFPHYADDR = 0x8218694a + SIOCSLIFPHYDF = 0x802069c1 SIOCSLIFPHYRTABLE = 0x802069a1 SIOCSLIFPHYTTL = 0x802069a8 - SIOCSLOWAT = 0x80047302 SIOCSPGRP = 0x80047308 SIOCSSPPPPARAMS = 0x80206993 + SIOCSUMBPARAM = 0x802069bf SIOCSVH = 0xc02069f5 + SIOCSVNETFLOWID = 0x802069c3 SIOCSVNETID = 0x802069a6 + SIOCSWGDPID = 0xc018695b + SIOCSWGMAXFLOW = 0xc0186960 + SIOCSWGMAXGROUP = 0xc018695d + SIOCSWSDPID = 0x8018695c + SIOCSWSPORTNO = 0xc060695f + SOCK_CLOEXEC = 0x8000 SOCK_DGRAM = 0x2 + SOCK_DNS = 0x1000 + SOCK_NONBLOCK = 0x4000 SOCK_RAW = 0x3 SOCK_RDM = 0x4 SOCK_SEQPACKET = 0x5 @@ -1216,9 +1295,14 @@ const ( SO_TIMESTAMP = 0x800 SO_TYPE = 0x1008 SO_USELOOPBACK = 0x40 + SO_ZEROIZE = 0x2000 TCIFLUSH = 0x1 + TCIOFF = 0x3 TCIOFLUSH = 0x3 + TCION = 0x4 TCOFLUSH = 0x2 + TCOOFF = 0x1 + TCOON = 0x2 TCP_MAXBURST = 0x4 TCP_MAXSEG = 0x2 TCP_MAXWIN = 0xffff @@ -1228,11 +1312,12 @@ const ( TCP_MSS = 0x200 TCP_NODELAY = 0x1 TCP_NOPUSH = 0x10 - TCP_NSTATES = 0xb TCP_SACK_ENABLE = 0x8 TCSAFLUSH = 0x2 TIOCCBRK = 0x2000747a TIOCCDTR = 0x20007478 + TIOCCHKVERAUTH = 0x2000741e + TIOCCLRVERAUTH = 0x2000741d TIOCCONS = 0x80047462 TIOCDRAIN = 0x2000745e TIOCEXCL = 0x2000740d @@ -1287,16 +1372,19 @@ const ( TIOCSETAF = 0x802c7416 TIOCSETAW = 0x802c7415 TIOCSETD = 0x8004741b + TIOCSETVERAUTH = 0x8004741c TIOCSFLAGS = 0x8004745c TIOCSIG = 0x8004745f TIOCSPGRP = 0x80047476 TIOCSTART = 0x2000746e - TIOCSTAT = 0x80047465 + TIOCSTAT = 0x20007465 TIOCSTI = 0x80017472 TIOCSTOP = 0x2000746f TIOCSTSTAMP = 0x8008745a TIOCSWINSZ = 0x80087467 TIOCUCNTL = 0x80047466 + TIOCUCNTL_CBRK = 0x7a + TIOCUCNTL_SBRK = 0x7b TOSTOP = 0x400000 VDISCARD = 0xf VDSUSP = 0xb @@ -1308,6 +1396,18 @@ const ( VKILL = 0x5 VLNEXT = 0xe VMIN = 0x10 + VM_ANONMIN = 0x7 + VM_LOADAVG = 0x2 + VM_MAXID = 0xc + VM_MAXSLP = 0xa + VM_METER = 0x1 + VM_NKMEMPAGES = 0x6 + VM_PSSTRINGS = 0x3 + VM_SWAPENCRYPT = 0x5 + VM_USPACE = 0xb + VM_UVMEXP = 0x4 + VM_VNODEMIN = 0x9 + VM_VTEXTMIN = 0x8 VQUIT = 0x9 VREPRINT = 0x6 VSTART = 0xc @@ -1320,8 +1420,8 @@ const ( WCONTINUED = 0x8 WCOREFLAG = 0x80 WNOHANG = 0x1 - WSTOPPED = 0x7f WUNTRACED = 0x2 + XCASE = 0x1000000 ) // Errors @@ -1335,6 +1435,7 @@ const ( EALREADY = syscall.Errno(0x25) EAUTH = syscall.Errno(0x50) EBADF = syscall.Errno(0x9) + EBADMSG = syscall.Errno(0x5c) EBADRPC = syscall.Errno(0x48) EBUSY = syscall.Errno(0x10) ECANCELED = syscall.Errno(0x58) @@ -1361,7 +1462,7 @@ const ( EIPSEC = syscall.Errno(0x52) EISCONN = syscall.Errno(0x38) EISDIR = syscall.Errno(0x15) - ELAST = syscall.Errno(0x5b) + ELAST = syscall.Errno(0x5f) ELOOP = syscall.Errno(0x3e) EMEDIUMTYPE = syscall.Errno(0x56) EMFILE = syscall.Errno(0x18) @@ -1389,12 +1490,14 @@ const ( ENOTCONN = syscall.Errno(0x39) ENOTDIR = syscall.Errno(0x14) ENOTEMPTY = syscall.Errno(0x42) + ENOTRECOVERABLE = syscall.Errno(0x5d) ENOTSOCK = syscall.Errno(0x26) ENOTSUP = syscall.Errno(0x5b) ENOTTY = syscall.Errno(0x19) ENXIO = syscall.Errno(0x6) EOPNOTSUPP = syscall.Errno(0x2d) EOVERFLOW = syscall.Errno(0x57) + EOWNERDEAD = syscall.Errno(0x5e) EPERM = syscall.Errno(0x1) EPFNOSUPPORT = syscall.Errno(0x2e) EPIPE = syscall.Errno(0x20) @@ -1402,6 +1505,7 @@ const ( EPROCUNAVAIL = syscall.Errno(0x4c) EPROGMISMATCH = syscall.Errno(0x4b) EPROGUNAVAIL = syscall.Errno(0x4a) + EPROTO = syscall.Errno(0x5f) EPROTONOSUPPORT = syscall.Errno(0x2b) EPROTOTYPE = syscall.Errno(0x29) ERANGE = syscall.Errno(0x22) @@ -1459,132 +1563,144 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "connection timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "IPsec processing failure", - 83: "attribute not found", - 84: "illegal byte sequence", - 85: "no medium found", - 86: "wrong medium type", - 87: "value too large to be stored in data type", - 88: "operation canceled", - 89: "identifier removed", - 90: "no message of desired type", - 91: "not supported", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large"}, + {35, "EAGAIN", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "EOPNOTSUPP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "operation timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disk quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC program not available"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EIPSEC", "IPsec processing failure"}, + {83, "ENOATTR", "attribute not found"}, + {84, "EILSEQ", "illegal byte sequence"}, + {85, "ENOMEDIUM", "no medium found"}, + {86, "EMEDIUMTYPE", "wrong medium type"}, + {87, "EOVERFLOW", "value too large to be stored in data type"}, + {88, "ECANCELED", "operation canceled"}, + {89, "EIDRM", "identifier removed"}, + {90, "ENOMSG", "no message of desired type"}, + {91, "ENOTSUP", "not supported"}, + {92, "EBADMSG", "bad message"}, + {93, "ENOTRECOVERABLE", "state not recoverable"}, + {94, "EOWNERDEAD", "previous owner died"}, + {95, "ELAST", "protocol error"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "stopped (signal)", - 18: "stopped", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", - 32: "thread AST", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGABRT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "suspended (signal)"}, + {18, "SIGTSTP", "suspended"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, + {32, "SIGTHR", "thread AST"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_openbsd_arm.go b/vendor/golang.org/x/sys/unix/zerrors_openbsd_arm.go index 4c320495cc..93e37c4b28 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_openbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zerrors_openbsd_arm.go @@ -147,6 +147,7 @@ const ( CFLUSH = 0xf CLOCAL = 0x8000 CREAD = 0x800 + CRTSCTS = 0x10000 CS5 = 0x0 CS6 = 0x100 CS7 = 0x200 @@ -1462,132 +1463,140 @@ const ( ) // Error table -var errors = [...]string{ - 1: "operation not permitted", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "input/output error", - 6: "device not configured", - 7: "argument list too long", - 8: "exec format error", - 9: "bad file descriptor", - 10: "no child processes", - 11: "resource deadlock avoided", - 12: "cannot allocate memory", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device busy", - 17: "file exists", - 18: "cross-device link", - 19: "operation not supported by device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "too many open files in system", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "numerical argument out of domain", - 34: "result too large", - 35: "resource temporarily unavailable", - 36: "operation now in progress", - 37: "operation already in progress", - 38: "socket operation on non-socket", - 39: "destination address required", - 40: "message too long", - 41: "protocol wrong type for socket", - 42: "protocol not available", - 43: "protocol not supported", - 44: "socket type not supported", - 45: "operation not supported", - 46: "protocol family not supported", - 47: "address family not supported by protocol family", - 48: "address already in use", - 49: "can't assign requested address", - 50: "network is down", - 51: "network is unreachable", - 52: "network dropped connection on reset", - 53: "software caused connection abort", - 54: "connection reset by peer", - 55: "no buffer space available", - 56: "socket is already connected", - 57: "socket is not connected", - 58: "can't send after socket shutdown", - 59: "too many references: can't splice", - 60: "connection timed out", - 61: "connection refused", - 62: "too many levels of symbolic links", - 63: "file name too long", - 64: "host is down", - 65: "no route to host", - 66: "directory not empty", - 67: "too many processes", - 68: "too many users", - 69: "disc quota exceeded", - 70: "stale NFS file handle", - 71: "too many levels of remote in path", - 72: "RPC struct is bad", - 73: "RPC version wrong", - 74: "RPC prog. not avail", - 75: "program version wrong", - 76: "bad procedure for program", - 77: "no locks available", - 78: "function not implemented", - 79: "inappropriate file type or format", - 80: "authentication error", - 81: "need authenticator", - 82: "IPsec processing failure", - 83: "attribute not found", - 84: "illegal byte sequence", - 85: "no medium found", - 86: "wrong medium type", - 87: "value too large to be stored in data type", - 88: "operation canceled", - 89: "identifier removed", - 90: "no message of desired type", - 91: "not supported", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "operation not permitted"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "input/output error"}, + {6, "ENXIO", "device not configured"}, + {7, "E2BIG", "argument list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file descriptor"}, + {10, "ECHILD", "no child processes"}, + {11, "EDEADLK", "resource deadlock avoided"}, + {12, "ENOMEM", "cannot allocate memory"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "operation not supported by device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "too many open files in system"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "numerical argument out of domain"}, + {34, "ERANGE", "result too large"}, + {35, "EWOULDBLOCK", "resource temporarily unavailable"}, + {36, "EINPROGRESS", "operation now in progress"}, + {37, "EALREADY", "operation already in progress"}, + {38, "ENOTSOCK", "socket operation on non-socket"}, + {39, "EDESTADDRREQ", "destination address required"}, + {40, "EMSGSIZE", "message too long"}, + {41, "EPROTOTYPE", "protocol wrong type for socket"}, + {42, "ENOPROTOOPT", "protocol not available"}, + {43, "EPROTONOSUPPORT", "protocol not supported"}, + {44, "ESOCKTNOSUPPORT", "socket type not supported"}, + {45, "EOPNOTSUPP", "operation not supported"}, + {46, "EPFNOSUPPORT", "protocol family not supported"}, + {47, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {48, "EADDRINUSE", "address already in use"}, + {49, "EADDRNOTAVAIL", "can't assign requested address"}, + {50, "ENETDOWN", "network is down"}, + {51, "ENETUNREACH", "network is unreachable"}, + {52, "ENETRESET", "network dropped connection on reset"}, + {53, "ECONNABORTED", "software caused connection abort"}, + {54, "ECONNRESET", "connection reset by peer"}, + {55, "ENOBUFS", "no buffer space available"}, + {56, "EISCONN", "socket is already connected"}, + {57, "ENOTCONN", "socket is not connected"}, + {58, "ESHUTDOWN", "can't send after socket shutdown"}, + {59, "ETOOMANYREFS", "too many references: can't splice"}, + {60, "ETIMEDOUT", "operation timed out"}, + {61, "ECONNREFUSED", "connection refused"}, + {62, "ELOOP", "too many levels of symbolic links"}, + {63, "ENAMETOOLONG", "file name too long"}, + {64, "EHOSTDOWN", "host is down"}, + {65, "EHOSTUNREACH", "no route to host"}, + {66, "ENOTEMPTY", "directory not empty"}, + {67, "EPROCLIM", "too many processes"}, + {68, "EUSERS", "too many users"}, + {69, "EDQUOT", "disk quota exceeded"}, + {70, "ESTALE", "stale NFS file handle"}, + {71, "EREMOTE", "too many levels of remote in path"}, + {72, "EBADRPC", "RPC struct is bad"}, + {73, "ERPCMISMATCH", "RPC version wrong"}, + {74, "EPROGUNAVAIL", "RPC program not available"}, + {75, "EPROGMISMATCH", "program version wrong"}, + {76, "EPROCUNAVAIL", "bad procedure for program"}, + {77, "ENOLCK", "no locks available"}, + {78, "ENOSYS", "function not implemented"}, + {79, "EFTYPE", "inappropriate file type or format"}, + {80, "EAUTH", "authentication error"}, + {81, "ENEEDAUTH", "need authenticator"}, + {82, "EIPSEC", "IPsec processing failure"}, + {83, "ENOATTR", "attribute not found"}, + {84, "EILSEQ", "illegal byte sequence"}, + {85, "ENOMEDIUM", "no medium found"}, + {86, "EMEDIUMTYPE", "wrong medium type"}, + {87, "EOVERFLOW", "value too large to be stored in data type"}, + {88, "ECANCELED", "operation canceled"}, + {89, "EIDRM", "identifier removed"}, + {90, "ENOMSG", "no message of desired type"}, + {91, "ELAST", "not supported"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal instruction", - 5: "trace/BPT trap", - 6: "abort trap", - 7: "EMT trap", - 8: "floating point exception", - 9: "killed", - 10: "bus error", - 11: "segmentation fault", - 12: "bad system call", - 13: "broken pipe", - 14: "alarm clock", - 15: "terminated", - 16: "urgent I/O condition", - 17: "stopped (signal)", - 18: "stopped", - 19: "continued", - 20: "child exited", - 21: "stopped (tty input)", - 22: "stopped (tty output)", - 23: "I/O possible", - 24: "cputime limit exceeded", - 25: "filesize limit exceeded", - 26: "virtual timer expired", - 27: "profiling timer expired", - 28: "window size changes", - 29: "information request", - 30: "user defined signal 1", - 31: "user defined signal 2", - 32: "thread AST", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal instruction"}, + {5, "SIGTRAP", "trace/BPT trap"}, + {6, "SIGABRT", "abort trap"}, + {7, "SIGEMT", "EMT trap"}, + {8, "SIGFPE", "floating point exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus error"}, + {11, "SIGSEGV", "segmentation fault"}, + {12, "SIGSYS", "bad system call"}, + {13, "SIGPIPE", "broken pipe"}, + {14, "SIGALRM", "alarm clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGURG", "urgent I/O condition"}, + {17, "SIGSTOP", "suspended (signal)"}, + {18, "SIGTSTP", "suspended"}, + {19, "SIGCONT", "continued"}, + {20, "SIGCHLD", "child exited"}, + {21, "SIGTTIN", "stopped (tty input)"}, + {22, "SIGTTOU", "stopped (tty output)"}, + {23, "SIGIO", "I/O possible"}, + {24, "SIGXCPU", "cputime limit exceeded"}, + {25, "SIGXFSZ", "filesize limit exceeded"}, + {26, "SIGVTALRM", "virtual timer expired"}, + {27, "SIGPROF", "profiling timer expired"}, + {28, "SIGWINCH", "window size changes"}, + {29, "SIGINFO", "information request"}, + {30, "SIGUSR1", "user defined signal 1"}, + {31, "SIGUSR2", "user defined signal 2"}, + {32, "SIGTHR", "thread AST"}, } diff --git a/vendor/golang.org/x/sys/unix/zerrors_solaris_amd64.go b/vendor/golang.org/x/sys/unix/zerrors_solaris_amd64.go index 09eedb0093..be42830cf3 100644 --- a/vendor/golang.org/x/sys/unix/zerrors_solaris_amd64.go +++ b/vendor/golang.org/x/sys/unix/zerrors_solaris_amd64.go @@ -1319,171 +1319,179 @@ const ( ) // Error table -var errors = [...]string{ - 1: "not owner", - 2: "no such file or directory", - 3: "no such process", - 4: "interrupted system call", - 5: "I/O error", - 6: "no such device or address", - 7: "arg list too long", - 8: "exec format error", - 9: "bad file number", - 10: "no child processes", - 11: "resource temporarily unavailable", - 12: "not enough space", - 13: "permission denied", - 14: "bad address", - 15: "block device required", - 16: "device busy", - 17: "file exists", - 18: "cross-device link", - 19: "no such device", - 20: "not a directory", - 21: "is a directory", - 22: "invalid argument", - 23: "file table overflow", - 24: "too many open files", - 25: "inappropriate ioctl for device", - 26: "text file busy", - 27: "file too large", - 28: "no space left on device", - 29: "illegal seek", - 30: "read-only file system", - 31: "too many links", - 32: "broken pipe", - 33: "argument out of domain", - 34: "result too large", - 35: "no message of desired type", - 36: "identifier removed", - 37: "channel number out of range", - 38: "level 2 not synchronized", - 39: "level 3 halted", - 40: "level 3 reset", - 41: "link number out of range", - 42: "protocol driver not attached", - 43: "no CSI structure available", - 44: "level 2 halted", - 45: "deadlock situation detected/avoided", - 46: "no record locks available", - 47: "operation canceled", - 48: "operation not supported", - 49: "disc quota exceeded", - 50: "bad exchange descriptor", - 51: "bad request descriptor", - 52: "message tables full", - 53: "anode table overflow", - 54: "bad request code", - 55: "invalid slot", - 56: "file locking deadlock", - 57: "bad font file format", - 58: "owner of the lock died", - 59: "lock is not recoverable", - 60: "not a stream device", - 61: "no data available", - 62: "timer expired", - 63: "out of stream resources", - 64: "machine is not on the network", - 65: "package not installed", - 66: "object is remote", - 67: "link has been severed", - 68: "advertise error", - 69: "srmount error", - 70: "communication error on send", - 71: "protocol error", - 72: "locked lock was unmapped ", - 73: "facility is not active", - 74: "multihop attempted", - 77: "not a data message", - 78: "file name too long", - 79: "value too large for defined data type", - 80: "name not unique on network", - 81: "file descriptor in bad state", - 82: "remote address changed", - 83: "can not access a needed shared library", - 84: "accessing a corrupted shared library", - 85: ".lib section in a.out corrupted", - 86: "attempting to link in more shared libraries than system limit", - 87: "can not exec a shared library directly", - 88: "illegal byte sequence", - 89: "operation not applicable", - 90: "number of symbolic links encountered during path name traversal exceeds MAXSYMLINKS", - 91: "error 91", - 92: "error 92", - 93: "directory not empty", - 94: "too many users", - 95: "socket operation on non-socket", - 96: "destination address required", - 97: "message too long", - 98: "protocol wrong type for socket", - 99: "option not supported by protocol", - 120: "protocol not supported", - 121: "socket type not supported", - 122: "operation not supported on transport endpoint", - 123: "protocol family not supported", - 124: "address family not supported by protocol family", - 125: "address already in use", - 126: "cannot assign requested address", - 127: "network is down", - 128: "network is unreachable", - 129: "network dropped connection because of reset", - 130: "software caused connection abort", - 131: "connection reset by peer", - 132: "no buffer space available", - 133: "transport endpoint is already connected", - 134: "transport endpoint is not connected", - 143: "cannot send after socket shutdown", - 144: "too many references: cannot splice", - 145: "connection timed out", - 146: "connection refused", - 147: "host is down", - 148: "no route to host", - 149: "operation already in progress", - 150: "operation now in progress", - 151: "stale NFS file handle", +var errorList = [...]struct { + num syscall.Errno + name string + desc string +}{ + {1, "EPERM", "not owner"}, + {2, "ENOENT", "no such file or directory"}, + {3, "ESRCH", "no such process"}, + {4, "EINTR", "interrupted system call"}, + {5, "EIO", "I/O error"}, + {6, "ENXIO", "no such device or address"}, + {7, "E2BIG", "arg list too long"}, + {8, "ENOEXEC", "exec format error"}, + {9, "EBADF", "bad file number"}, + {10, "ECHILD", "no child processes"}, + {11, "EAGAIN", "resource temporarily unavailable"}, + {12, "ENOMEM", "not enough space"}, + {13, "EACCES", "permission denied"}, + {14, "EFAULT", "bad address"}, + {15, "ENOTBLK", "block device required"}, + {16, "EBUSY", "device busy"}, + {17, "EEXIST", "file exists"}, + {18, "EXDEV", "cross-device link"}, + {19, "ENODEV", "no such device"}, + {20, "ENOTDIR", "not a directory"}, + {21, "EISDIR", "is a directory"}, + {22, "EINVAL", "invalid argument"}, + {23, "ENFILE", "file table overflow"}, + {24, "EMFILE", "too many open files"}, + {25, "ENOTTY", "inappropriate ioctl for device"}, + {26, "ETXTBSY", "text file busy"}, + {27, "EFBIG", "file too large"}, + {28, "ENOSPC", "no space left on device"}, + {29, "ESPIPE", "illegal seek"}, + {30, "EROFS", "read-only file system"}, + {31, "EMLINK", "too many links"}, + {32, "EPIPE", "broken pipe"}, + {33, "EDOM", "argument out of domain"}, + {34, "ERANGE", "result too large"}, + {35, "ENOMSG", "no message of desired type"}, + {36, "EIDRM", "identifier removed"}, + {37, "ECHRNG", "channel number out of range"}, + {38, "EL2NSYNC", "level 2 not synchronized"}, + {39, "EL3HLT", "level 3 halted"}, + {40, "EL3RST", "level 3 reset"}, + {41, "ELNRNG", "link number out of range"}, + {42, "EUNATCH", "protocol driver not attached"}, + {43, "ENOCSI", "no CSI structure available"}, + {44, "EL2HLT", "level 2 halted"}, + {45, "EDEADLK", "deadlock situation detected/avoided"}, + {46, "ENOLCK", "no record locks available"}, + {47, "ECANCELED", "operation canceled"}, + {48, "ENOTSUP", "operation not supported"}, + {49, "EDQUOT", "disc quota exceeded"}, + {50, "EBADE", "bad exchange descriptor"}, + {51, "EBADR", "bad request descriptor"}, + {52, "EXFULL", "message tables full"}, + {53, "ENOANO", "anode table overflow"}, + {54, "EBADRQC", "bad request code"}, + {55, "EBADSLT", "invalid slot"}, + {56, "EDEADLOCK", "file locking deadlock"}, + {57, "EBFONT", "bad font file format"}, + {58, "EOWNERDEAD", "owner of the lock died"}, + {59, "ENOTRECOVERABLE", "lock is not recoverable"}, + {60, "ENOSTR", "not a stream device"}, + {61, "ENODATA", "no data available"}, + {62, "ETIME", "timer expired"}, + {63, "ENOSR", "out of stream resources"}, + {64, "ENONET", "machine is not on the network"}, + {65, "ENOPKG", "package not installed"}, + {66, "EREMOTE", "object is remote"}, + {67, "ENOLINK", "link has been severed"}, + {68, "EADV", "advertise error"}, + {69, "ESRMNT", "srmount error"}, + {70, "ECOMM", "communication error on send"}, + {71, "EPROTO", "protocol error"}, + {72, "ELOCKUNMAPPED", "locked lock was unmapped "}, + {73, "ENOTACTIVE", "facility is not active"}, + {74, "EMULTIHOP", "multihop attempted"}, + {77, "EBADMSG", "not a data message"}, + {78, "ENAMETOOLONG", "file name too long"}, + {79, "EOVERFLOW", "value too large for defined data type"}, + {80, "ENOTUNIQ", "name not unique on network"}, + {81, "EBADFD", "file descriptor in bad state"}, + {82, "EREMCHG", "remote address changed"}, + {83, "ELIBACC", "can not access a needed shared library"}, + {84, "ELIBBAD", "accessing a corrupted shared library"}, + {85, "ELIBSCN", ".lib section in a.out corrupted"}, + {86, "ELIBMAX", "attempting to link in more shared libraries than system limit"}, + {87, "ELIBEXEC", "can not exec a shared library directly"}, + {88, "EILSEQ", "illegal byte sequence"}, + {89, "ENOSYS", "operation not applicable"}, + {90, "ELOOP", "number of symbolic links encountered during path name traversal exceeds MAXSYMLINKS"}, + {91, "ERESTART", "error 91"}, + {92, "ESTRPIPE", "error 92"}, + {93, "ENOTEMPTY", "directory not empty"}, + {94, "EUSERS", "too many users"}, + {95, "ENOTSOCK", "socket operation on non-socket"}, + {96, "EDESTADDRREQ", "destination address required"}, + {97, "EMSGSIZE", "message too long"}, + {98, "EPROTOTYPE", "protocol wrong type for socket"}, + {99, "ENOPROTOOPT", "option not supported by protocol"}, + {120, "EPROTONOSUPPORT", "protocol not supported"}, + {121, "ESOCKTNOSUPPORT", "socket type not supported"}, + {122, "EOPNOTSUPP", "operation not supported on transport endpoint"}, + {123, "EPFNOSUPPORT", "protocol family not supported"}, + {124, "EAFNOSUPPORT", "address family not supported by protocol family"}, + {125, "EADDRINUSE", "address already in use"}, + {126, "EADDRNOTAVAIL", "cannot assign requested address"}, + {127, "ENETDOWN", "network is down"}, + {128, "ENETUNREACH", "network is unreachable"}, + {129, "ENETRESET", "network dropped connection because of reset"}, + {130, "ECONNABORTED", "software caused connection abort"}, + {131, "ECONNRESET", "connection reset by peer"}, + {132, "ENOBUFS", "no buffer space available"}, + {133, "EISCONN", "transport endpoint is already connected"}, + {134, "ENOTCONN", "transport endpoint is not connected"}, + {143, "ESHUTDOWN", "cannot send after socket shutdown"}, + {144, "ETOOMANYREFS", "too many references: cannot splice"}, + {145, "ETIMEDOUT", "connection timed out"}, + {146, "ECONNREFUSED", "connection refused"}, + {147, "EHOSTDOWN", "host is down"}, + {148, "EHOSTUNREACH", "no route to host"}, + {149, "EALREADY", "operation already in progress"}, + {150, "EINPROGRESS", "operation now in progress"}, + {151, "ESTALE", "stale NFS file handle"}, } // Signal table -var signals = [...]string{ - 1: "hangup", - 2: "interrupt", - 3: "quit", - 4: "illegal Instruction", - 5: "trace/Breakpoint Trap", - 6: "abort", - 7: "emulation Trap", - 8: "arithmetic Exception", - 9: "killed", - 10: "bus Error", - 11: "segmentation Fault", - 12: "bad System Call", - 13: "broken Pipe", - 14: "alarm Clock", - 15: "terminated", - 16: "user Signal 1", - 17: "user Signal 2", - 18: "child Status Changed", - 19: "power-Fail/Restart", - 20: "window Size Change", - 21: "urgent Socket Condition", - 22: "pollable Event", - 23: "stopped (signal)", - 24: "stopped (user)", - 25: "continued", - 26: "stopped (tty input)", - 27: "stopped (tty output)", - 28: "virtual Timer Expired", - 29: "profiling Timer Expired", - 30: "cpu Limit Exceeded", - 31: "file Size Limit Exceeded", - 32: "no runnable lwp", - 33: "inter-lwp signal", - 34: "checkpoint Freeze", - 35: "checkpoint Thaw", - 36: "thread Cancellation", - 37: "resource Lost", - 38: "resource Control Exceeded", - 39: "reserved for JVM 1", - 40: "reserved for JVM 2", - 41: "information Request", +var signalList = [...]struct { + num syscall.Signal + name string + desc string +}{ + {1, "SIGHUP", "hangup"}, + {2, "SIGINT", "interrupt"}, + {3, "SIGQUIT", "quit"}, + {4, "SIGILL", "illegal Instruction"}, + {5, "SIGTRAP", "trace/Breakpoint Trap"}, + {6, "SIGABRT", "abort"}, + {7, "SIGEMT", "emulation Trap"}, + {8, "SIGFPE", "arithmetic Exception"}, + {9, "SIGKILL", "killed"}, + {10, "SIGBUS", "bus Error"}, + {11, "SIGSEGV", "segmentation Fault"}, + {12, "SIGSYS", "bad System Call"}, + {13, "SIGPIPE", "broken Pipe"}, + {14, "SIGALRM", "alarm Clock"}, + {15, "SIGTERM", "terminated"}, + {16, "SIGUSR1", "user Signal 1"}, + {17, "SIGUSR2", "user Signal 2"}, + {18, "SIGCHLD", "child Status Changed"}, + {19, "SIGPWR", "power-Fail/Restart"}, + {20, "SIGWINCH", "window Size Change"}, + {21, "SIGURG", "urgent Socket Condition"}, + {22, "SIGIO", "pollable Event"}, + {23, "SIGSTOP", "stopped (signal)"}, + {24, "SIGTSTP", "stopped (user)"}, + {25, "SIGCONT", "continued"}, + {26, "SIGTTIN", "stopped (tty input)"}, + {27, "SIGTTOU", "stopped (tty output)"}, + {28, "SIGVTALRM", "virtual Timer Expired"}, + {29, "SIGPROF", "profiling Timer Expired"}, + {30, "SIGXCPU", "cpu Limit Exceeded"}, + {31, "SIGXFSZ", "file Size Limit Exceeded"}, + {32, "SIGWAITING", "no runnable lwp"}, + {33, "SIGLWP", "inter-lwp signal"}, + {34, "SIGFREEZE", "checkpoint Freeze"}, + {35, "SIGTHAW", "checkpoint Thaw"}, + {36, "SIGCANCEL", "thread Cancellation"}, + {37, "SIGLOST", "resource Lost"}, + {38, "SIGXRES", "resource Control Exceeded"}, + {39, "SIGJVM1", "reserved for JVM 1"}, + {40, "SIGJVM2", "reserved for JVM 2"}, + {41, "SIGINFO", "information Request"}, } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go index 763ae4fbb9..ac02d4d841 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_386.go @@ -399,6 +399,83 @@ func pipe() (r int, w int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func getxattr(path string, attr string, dest *byte, size int, position uint32, options int) (sz int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + r0, _, e1 := Syscall6(SYS_GETXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(unsafe.Pointer(dest)), uintptr(size), uintptr(position), uintptr(options)) + sz = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func setxattr(path string, attr string, data *byte, size int, position uint32, options int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_SETXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(unsafe.Pointer(data)), uintptr(size), uintptr(position), uintptr(options)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func removexattr(path string, attr string, options int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_REMOVEXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(options)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func listxattr(path string, dest *byte, size int, options int) (sz int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + r0, _, e1 := Syscall6(SYS_LISTXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(dest)), uintptr(size), uintptr(options), 0, 0) + sz = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func kill(pid int, signum int, posix int) (err error) { _, _, e1 := Syscall(SYS_KILL, uintptr(pid), uintptr(signum), uintptr(posix)) if e1 != 0 { @@ -693,6 +770,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT64, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fstatfs(fd int, stat *Statfs_t) (err error) { _, _, e1 := Syscall(SYS_FSTATFS64, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go index d6808e072d..1dd3cfa0e1 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_amd64.go @@ -399,6 +399,83 @@ func pipe() (r int, w int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func getxattr(path string, attr string, dest *byte, size int, position uint32, options int) (sz int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + r0, _, e1 := Syscall6(SYS_GETXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(unsafe.Pointer(dest)), uintptr(size), uintptr(position), uintptr(options)) + sz = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func setxattr(path string, attr string, data *byte, size int, position uint32, options int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_SETXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(unsafe.Pointer(data)), uintptr(size), uintptr(position), uintptr(options)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func removexattr(path string, attr string, options int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_REMOVEXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(options)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func listxattr(path string, dest *byte, size int, options int) (sz int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + r0, _, e1 := Syscall6(SYS_LISTXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(dest)), uintptr(size), uintptr(options), 0, 0) + sz = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func kill(pid int, signum int, posix int) (err error) { _, _, e1 := Syscall(SYS_KILL, uintptr(pid), uintptr(signum), uintptr(posix)) if e1 != 0 { @@ -693,6 +770,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT64, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fstatfs(fd int, stat *Statfs_t) (err error) { _, _, e1 := Syscall(SYS_FSTATFS64, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go index 6ae95e6b9a..cab46e74ba 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm.go @@ -1,4 +1,4 @@ -// mksyscall.pl -tags darwin,arm syscall_bsd.go syscall_darwin.go syscall_darwin_arm.go +// mksyscall.pl -l32 -tags darwin,arm syscall_bsd.go syscall_darwin.go syscall_darwin_arm.go // Code generated by the command above; see README.md. DO NOT EDIT. // +build darwin,arm @@ -399,6 +399,83 @@ func pipe() (r int, w int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func getxattr(path string, attr string, dest *byte, size int, position uint32, options int) (sz int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + r0, _, e1 := Syscall6(SYS_GETXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(unsafe.Pointer(dest)), uintptr(size), uintptr(position), uintptr(options)) + sz = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func setxattr(path string, attr string, data *byte, size int, position uint32, options int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_SETXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(unsafe.Pointer(data)), uintptr(size), uintptr(position), uintptr(options)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func removexattr(path string, attr string, options int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_REMOVEXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(options)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func listxattr(path string, dest *byte, size int, options int) (sz int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + r0, _, e1 := Syscall6(SYS_LISTXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(dest)), uintptr(size), uintptr(options), 0, 0) + sz = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func kill(pid int, signum int, posix int) (err error) { _, _, e1 := Syscall(SYS_KILL, uintptr(pid), uintptr(signum), uintptr(posix)) if e1 != 0 { @@ -693,6 +770,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT64, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fstatfs(fd int, stat *Statfs_t) (err error) { _, _, e1 := Syscall(SYS_FSTATFS64, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go index ca6a7ea8b7..13478dd0bc 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_darwin_arm64.go @@ -399,6 +399,83 @@ func pipe() (r int, w int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func getxattr(path string, attr string, dest *byte, size int, position uint32, options int) (sz int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + r0, _, e1 := Syscall6(SYS_GETXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(unsafe.Pointer(dest)), uintptr(size), uintptr(position), uintptr(options)) + sz = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func setxattr(path string, attr string, data *byte, size int, position uint32, options int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_SETXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(unsafe.Pointer(data)), uintptr(size), uintptr(position), uintptr(options)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func removexattr(path string, attr string, options int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_REMOVEXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(options)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func listxattr(path string, dest *byte, size int, options int) (sz int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + r0, _, e1 := Syscall6(SYS_LISTXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(dest)), uintptr(size), uintptr(options), 0, 0) + sz = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func kill(pid int, signum int, posix int) (err error) { _, _, e1 := Syscall(SYS_KILL, uintptr(pid), uintptr(signum), uintptr(posix)) if e1 != 0 { @@ -693,6 +770,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT64, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fstatfs(fd int, stat *Statfs_t) (err error) { _, _, e1 := Syscall(SYS_FSTATFS64, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_dragonfly_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_dragonfly_amd64.go index a0241de195..91f36e9ec3 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_dragonfly_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_dragonfly_amd64.go @@ -618,6 +618,21 @@ func Fchmod(fd int, mode uint32) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FCHMODAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { @@ -659,6 +674,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fstatfs(fd int, stat *Statfs_t) (err error) { _, _, e1 := Syscall(SYS_FSTATFS, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_386.go b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_386.go index fd9ca5a4a6..a86434a7ba 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_386.go @@ -924,6 +924,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fstatfs(fd int, stat *Statfs_t) (err error) { _, _, e1 := Syscall(SYS_FSTATFS, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_amd64.go index a9f18b22d3..040e2f760c 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_amd64.go @@ -924,6 +924,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fstatfs(fd int, stat *Statfs_t) (err error) { _, _, e1 := Syscall(SYS_FSTATFS, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_arm.go index 9823e18a17..cddc5e86b1 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_freebsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_freebsd_arm.go @@ -924,6 +924,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fstatfs(fd int, stat *Statfs_t) (err error) { _, _, e1 := Syscall(SYS_FSTATFS, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_386.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_386.go index ef9602c1eb..237e960959 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_386.go @@ -143,21 +143,6 @@ func Unlinkat(dirfd int, path string, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimes(path string, times *[2]Timeval) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -173,16 +158,6 @@ func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { - _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(times))) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -494,17 +469,6 @@ func Dup3(oldfd int, newfd int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate(size int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) - fd = int(r0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func EpollCreate1(flag int) (fd int, err error) { r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) fd = int(r0) @@ -544,21 +508,6 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Fallocate(fd int, mode uint32, off int64, len int64) (err error) { _, _, e1 := Syscall6(SYS_FALLOCATE, uintptr(fd), uintptr(mode), uintptr(off), uintptr(off>>32), uintptr(len), uintptr(len>>32)) if e1 != 0 { @@ -995,6 +944,17 @@ func Nanosleep(time *Timespec, leftover *Timespec) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) { + r0, _, e1 := Syscall6(SYS_PERF_EVENT_OPEN, uintptr(unsafe.Pointer(attr)), uintptr(pid), uintptr(cpu), uintptr(groupFd), uintptr(flags), 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func PivotRoot(newroot string, putold string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(newroot) @@ -1355,16 +1315,6 @@ func Unshare(flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Ustat(dev int, ubuf *Ustat_t) (err error) { - _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func write(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -1524,6 +1474,21 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func faccessat(dirfd int, path string, mode uint32) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func pipe(p *[2]_C_int) (err error) { _, _, e1 := RawSyscall(SYS_PIPE, uintptr(unsafe.Pointer(p)), 0, 0) if e1 != 0 { @@ -1554,6 +1519,34 @@ func Dup2(oldfd int, newfd int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func EpollCreate(size int) (fd int, err error) { + r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { + var _p0 unsafe.Pointer + if len(events) > 0 { + _p0 = unsafe.Pointer(&events[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + r0, _, e1 := Syscall6(SYS_EPOLL_WAIT, uintptr(epfd), uintptr(_p0), uintptr(len(events)), uintptr(msec), 0, 0) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fadvise(fd int, offset int64, length int64, advice int) (err error) { _, _, e1 := Syscall6(SYS_FADVISE64_64, uintptr(fd), uintptr(offset), uintptr(offset>>32), uintptr(length), uintptr(length>>32), uintptr(advice)) if e1 != 0 { @@ -1858,6 +1851,16 @@ func Truncate(path string, length int64) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Ustat(dev int, ubuf *Ustat_t) (err error) { + _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func getgroups(n int, list *_Gid_t) (nn int, err error) { r0, _, e1 := RawSyscall(SYS_GETGROUPS32, uintptr(n), uintptr(unsafe.Pointer(list)), 0) nn = int(r0) @@ -1901,15 +1904,8 @@ func mmap2(addr uintptr, length uintptr, prot int, flags int, fd int, pageOffset // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { - var _p0 unsafe.Pointer - if len(events) > 0 { - _p0 = unsafe.Pointer(&events[0]) - } else { - _p0 = unsafe.Pointer(&_zero) - } - r0, _, e1 := Syscall6(SYS_EPOLL_WAIT, uintptr(epfd), uintptr(_p0), uintptr(len(events)), uintptr(msec), 0, 0) - n = int(r0) +func Pause() (err error) { + _, _, e1 := Syscall(SYS_PAUSE, 0, 0, 0) if e1 != 0 { err = errnoErr(e1) } @@ -1918,8 +1914,8 @@ func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Pause() (err error) { - _, _, e1 := Syscall(SYS_PAUSE, 0, 0, 0) +func getrlimit(resource int, rlim *rlimit32) (err error) { + _, _, e1 := RawSyscall(SYS_GETRLIMIT, uintptr(resource), uintptr(unsafe.Pointer(rlim)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -1928,8 +1924,8 @@ func Pause() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func getrlimit(resource int, rlim *rlimit32) (err error) { - _, _, e1 := RawSyscall(SYS_GETRLIMIT, uintptr(resource), uintptr(unsafe.Pointer(rlim)), 0) +func setrlimit(resource int, rlim *rlimit32) (err error) { + _, _, e1 := RawSyscall(SYS_SETRLIMIT, uintptr(resource), uintptr(unsafe.Pointer(rlim)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -1938,8 +1934,13 @@ func getrlimit(resource int, rlim *rlimit32) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func setrlimit(resource int, rlim *rlimit32) (err error) { - _, _, e1 := RawSyscall(SYS_SETRLIMIT, uintptr(resource), uintptr(unsafe.Pointer(rlim)), 0) +func futimesat(dirfd int, path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times))) if e1 != 0 { err = errnoErr(e1) } @@ -1984,6 +1985,21 @@ func Utime(path string, buf *Utimbuf) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func utimes(path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func poll(fds *PollFd, nfds int, timeout int) (n int, err error) { r0, _, e1 := Syscall(SYS_POLL, uintptr(unsafe.Pointer(fds)), uintptr(nfds), uintptr(timeout)) n = int(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_amd64.go index 63054b3585..9b40f580b0 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_amd64.go @@ -143,21 +143,6 @@ func Unlinkat(dirfd int, path string, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimes(path string, times *[2]Timeval) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -173,16 +158,6 @@ func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { - _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(times))) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -494,17 +469,6 @@ func Dup3(oldfd int, newfd int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate(size int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) - fd = int(r0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func EpollCreate1(flag int) (fd int, err error) { r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) fd = int(r0) @@ -544,21 +508,6 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Fallocate(fd int, mode uint32, off int64, len int64) (err error) { _, _, e1 := Syscall6(SYS_FALLOCATE, uintptr(fd), uintptr(mode), uintptr(off), uintptr(len), 0, 0) if e1 != 0 { @@ -995,6 +944,17 @@ func Nanosleep(time *Timespec, leftover *Timespec) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) { + r0, _, e1 := Syscall6(SYS_PERF_EVENT_OPEN, uintptr(unsafe.Pointer(attr)), uintptr(pid), uintptr(cpu), uintptr(groupFd), uintptr(flags), 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func PivotRoot(newroot string, putold string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(newroot) @@ -1355,16 +1315,6 @@ func Unshare(flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Ustat(dev int, ubuf *Ustat_t) (err error) { - _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func write(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -1524,6 +1474,21 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func faccessat(dirfd int, path string, mode uint32) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Dup2(oldfd int, newfd int) (err error) { _, _, e1 := Syscall(SYS_DUP2, uintptr(oldfd), uintptr(newfd), 0) if e1 != 0 { @@ -1534,6 +1499,17 @@ func Dup2(oldfd int, newfd int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func EpollCreate(size int) (fd int, err error) { + r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { var _p0 unsafe.Pointer if len(events) > 0 { @@ -1784,17 +1760,6 @@ func Seek(fd int, offset int64, whence int) (off int64, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Select(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timeval) (n int, err error) { - r0, _, e1 := Syscall6(SYS_SELECT, uintptr(nfd), uintptr(unsafe.Pointer(r)), uintptr(unsafe.Pointer(w)), uintptr(unsafe.Pointer(e)), uintptr(unsafe.Pointer(timeout)), 0) - n = int(r0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) { r0, _, e1 := Syscall6(SYS_SENDFILE, uintptr(outfd), uintptr(infd), uintptr(unsafe.Pointer(offset)), uintptr(count), 0, 0) written = int(r0) @@ -1897,21 +1862,6 @@ func Splice(rfd int, roff *int64, wfd int, woff *int64, len int, flags int) (n i // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Stat(path string, stat *Stat_t) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_STAT, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Statfs(path string, buf *Statfs_t) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -1952,6 +1902,16 @@ func Truncate(path string, length int64) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Ustat(dev int, ubuf *Ustat_t) (err error) { + _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) { r0, _, e1 := Syscall(SYS_ACCEPT, uintptr(s), uintptr(unsafe.Pointer(rsa)), uintptr(unsafe.Pointer(addrlen))) fd = int(r0) @@ -2142,6 +2102,21 @@ func mmap(addr uintptr, length uintptr, prot int, flags int, fd int, offset int6 // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func futimesat(dirfd int, path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times))) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Utime(path string, buf *Utimbuf) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -2157,6 +2132,21 @@ func Utime(path string, buf *Utimbuf) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func utimes(path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func pipe(p *[2]_C_int) (err error) { _, _, e1 := RawSyscall(SYS_PIPE, uintptr(unsafe.Pointer(p)), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_arm.go index 8b10ee1445..d93cc2f3b1 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_arm.go @@ -143,21 +143,6 @@ func Unlinkat(dirfd int, path string, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimes(path string, times *[2]Timeval) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -173,16 +158,6 @@ func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { - _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(times))) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -494,17 +469,6 @@ func Dup3(oldfd int, newfd int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate(size int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) - fd = int(r0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func EpollCreate1(flag int) (fd int, err error) { r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) fd = int(r0) @@ -544,21 +508,6 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Fallocate(fd int, mode uint32, off int64, len int64) (err error) { _, _, e1 := Syscall6(SYS_FALLOCATE, uintptr(fd), uintptr(mode), uintptr(off), uintptr(off>>32), uintptr(len), uintptr(len>>32)) if e1 != 0 { @@ -995,6 +944,17 @@ func Nanosleep(time *Timespec, leftover *Timespec) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) { + r0, _, e1 := Syscall6(SYS_PERF_EVENT_OPEN, uintptr(unsafe.Pointer(attr)), uintptr(pid), uintptr(cpu), uintptr(groupFd), uintptr(flags), 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func PivotRoot(newroot string, putold string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(newroot) @@ -1355,16 +1315,6 @@ func Unshare(flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Ustat(dev int, ubuf *Ustat_t) (err error) { - _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func write(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -1524,6 +1474,21 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func faccessat(dirfd int, path string, mode uint32) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func pipe2(p *[2]_C_int, flags int) (err error) { _, _, e1 := RawSyscall(SYS_PIPE2, uintptr(unsafe.Pointer(p)), uintptr(flags), 0) if e1 != 0 { @@ -1723,6 +1688,34 @@ func Dup2(oldfd int, newfd int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func EpollCreate(size int) (fd int, err error) { + r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { + var _p0 unsafe.Pointer + if len(events) > 0 { + _p0 = unsafe.Pointer(&events[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + r0, _, e1 := Syscall6(SYS_EPOLL_WAIT, uintptr(epfd), uintptr(_p0), uintptr(len(events)), uintptr(msec), 0, 0) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN32, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { @@ -1841,6 +1834,16 @@ func Lstat(path string, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Pause() (err error) { + _, _, e1 := Syscall(SYS_PAUSE, 0, 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) { r0, _, e1 := Syscall6(SYS_SENDFILE64, uintptr(outfd), uintptr(infd), uintptr(unsafe.Pointer(offset)), uintptr(count), 0, 0) written = int(r0) @@ -1959,8 +1962,8 @@ func Stat(path string, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Gettimeofday(tv *Timeval) (err error) { - _, _, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tv)), 0, 0) +func Ustat(dev int, ubuf *Ustat_t) (err error) { + _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -1969,15 +1972,13 @@ func Gettimeofday(tv *Timeval) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { - var _p0 unsafe.Pointer - if len(events) > 0 { - _p0 = unsafe.Pointer(&events[0]) - } else { - _p0 = unsafe.Pointer(&_zero) +func futimesat(dirfd int, path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return } - r0, _, e1 := Syscall6(SYS_EPOLL_WAIT, uintptr(epfd), uintptr(_p0), uintptr(len(events)), uintptr(msec), 0, 0) - n = int(r0) + _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times))) if e1 != 0 { err = errnoErr(e1) } @@ -1986,8 +1987,23 @@ func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Pause() (err error) { - _, _, e1 := Syscall(SYS_PAUSE, 0, 0, 0) +func Gettimeofday(tv *Timeval) (err error) { + _, _, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tv)), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func utimes(path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_arm64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_arm64.go index 8f276d65ff..5f7d0213b2 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_arm64.go @@ -143,21 +143,6 @@ func Unlinkat(dirfd int, path string, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimes(path string, times *[2]Timeval) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -173,16 +158,6 @@ func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { - _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(times))) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -494,17 +469,6 @@ func Dup3(oldfd int, newfd int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate(size int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) - fd = int(r0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func EpollCreate1(flag int) (fd int, err error) { r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) fd = int(r0) @@ -544,21 +508,6 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Fallocate(fd int, mode uint32, off int64, len int64) (err error) { _, _, e1 := Syscall6(SYS_FALLOCATE, uintptr(fd), uintptr(mode), uintptr(off), uintptr(len), 0, 0) if e1 != 0 { @@ -995,6 +944,17 @@ func Nanosleep(time *Timespec, leftover *Timespec) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) { + r0, _, e1 := Syscall6(SYS_PERF_EVENT_OPEN, uintptr(unsafe.Pointer(attr)), uintptr(pid), uintptr(cpu), uintptr(groupFd), uintptr(flags), 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func PivotRoot(newroot string, putold string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(newroot) @@ -1355,16 +1315,6 @@ func Unshare(flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Ustat(dev int, ubuf *Ustat_t) (err error) { - _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func write(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -1524,6 +1474,21 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func faccessat(dirfd int, path string, mode uint32) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { var _p0 unsafe.Pointer if len(events) > 0 { @@ -1541,6 +1506,16 @@ func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fadvise(fd int, offset int64, length int64, advice int) (err error) { + _, _, e1 := Syscall6(SYS_FADVISE64, uintptr(fd), uintptr(offset), uintptr(length), uintptr(advice), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips.go index 61169b331b..e761705282 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips.go @@ -143,21 +143,6 @@ func Unlinkat(dirfd int, path string, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimes(path string, times *[2]Timeval) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -173,16 +158,6 @@ func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { - _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(times))) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -494,17 +469,6 @@ func Dup3(oldfd int, newfd int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate(size int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) - fd = int(r0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func EpollCreate1(flag int) (fd int, err error) { r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) fd = int(r0) @@ -544,21 +508,6 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Fallocate(fd int, mode uint32, off int64, len int64) (err error) { _, _, e1 := Syscall6(SYS_FALLOCATE, uintptr(fd), uintptr(mode), uintptr(off>>32), uintptr(off), uintptr(len>>32), uintptr(len)) if e1 != 0 { @@ -995,6 +944,17 @@ func Nanosleep(time *Timespec, leftover *Timespec) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) { + r0, _, e1 := Syscall6(SYS_PERF_EVENT_OPEN, uintptr(unsafe.Pointer(attr)), uintptr(pid), uintptr(cpu), uintptr(groupFd), uintptr(flags), 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func PivotRoot(newroot string, putold string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(newroot) @@ -1355,16 +1315,6 @@ func Unshare(flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Ustat(dev int, ubuf *Ustat_t) (err error) { - _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func write(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -1524,6 +1474,21 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func faccessat(dirfd int, path string, mode uint32) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Dup2(oldfd int, newfd int) (err error) { _, _, e1 := Syscall(SYS_DUP2, uintptr(oldfd), uintptr(newfd), 0) if e1 != 0 { @@ -1534,6 +1499,44 @@ func Dup2(oldfd int, newfd int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func EpollCreate(size int) (fd int, err error) { + r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { + var _p0 unsafe.Pointer + if len(events) > 0 { + _p0 = unsafe.Pointer(&events[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + r0, _, e1 := Syscall6(SYS_EPOLL_WAIT, uintptr(epfd), uintptr(_p0), uintptr(len(events)), uintptr(msec), 0, 0) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Fadvise(fd int, offset int64, length int64, advice int) (err error) { + _, _, e1 := Syscall9(SYS_FADVISE64, uintptr(fd), 0, uintptr(offset>>32), uintptr(offset), uintptr(length>>32), uintptr(length), uintptr(advice), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { @@ -1737,9 +1740,9 @@ func Shutdown(fd int, how int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Splice(rfd int, roff *int64, wfd int, woff *int64, len int, flags int) (n int64, err error) { - r0, r1, e1 := Syscall6(SYS_SPLICE, uintptr(rfd), uintptr(unsafe.Pointer(roff)), uintptr(wfd), uintptr(unsafe.Pointer(woff)), uintptr(len), uintptr(flags)) - n = int64(int64(r0)<<32 | int64(r1)) +func Splice(rfd int, roff *int64, wfd int, woff *int64, len int, flags int) (n int, err error) { + r0, _, e1 := Syscall6(SYS_SPLICE, uintptr(rfd), uintptr(unsafe.Pointer(roff)), uintptr(wfd), uintptr(unsafe.Pointer(woff)), uintptr(len), uintptr(flags)) + n = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -1773,6 +1776,16 @@ func Truncate(path string, length int64) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Ustat(dev int, ubuf *Ustat_t) (err error) { + _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) { r0, _, e1 := Syscall(SYS_ACCEPT, uintptr(s), uintptr(unsafe.Pointer(rsa)), uintptr(unsafe.Pointer(addrlen))) fd = int(r0) @@ -1983,6 +1996,21 @@ func Iopl(level int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func futimesat(dirfd int, path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times))) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Gettimeofday(tv *Timeval) (err error) { _, _, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tv)), 0, 0) if e1 != 0 { @@ -2004,13 +2032,13 @@ func Time(t *Time_t) (tt Time_t, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Lstat(path string, stat *Stat_t) (err error) { +func Utime(path string, buf *Utimbuf) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) if err != nil { return } - _, _, e1 := Syscall(SYS_LSTAT64, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), 0) + _, _, e1 := Syscall(SYS_UTIME, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(buf)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2019,8 +2047,13 @@ func Lstat(path string, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Fstat(fd int, stat *Stat_t) (err error) { - _, _, e1 := Syscall(SYS_FSTAT64, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) +func utimes(path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2029,13 +2062,13 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Fstatat(dirfd int, path string, stat *Stat_t, flags int) (err error) { +func Lstat(path string, stat *Stat_t) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) if err != nil { return } - _, _, e1 := Syscall6(SYS_FSTATAT64, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + _, _, e1 := Syscall(SYS_LSTAT64, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2044,13 +2077,8 @@ func Fstatat(dirfd int, path string, stat *Stat_t, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Stat(path string, stat *Stat_t) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_STAT64, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), 0) +func Fstat(fd int, stat *Stat_t) (err error) { + _, _, e1 := Syscall(SYS_FSTAT64, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2059,13 +2087,13 @@ func Stat(path string, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Utime(path string, buf *Utimbuf) (err error) { +func Fstatat(dirfd int, path string, stat *Stat_t, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) if err != nil { return } - _, _, e1 := Syscall(SYS_UTIME, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(buf)), 0) + _, _, e1 := Syscall6(SYS_FSTATAT64, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) if e1 != 0 { err = errnoErr(e1) } @@ -2074,15 +2102,13 @@ func Utime(path string, buf *Utimbuf) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { - var _p0 unsafe.Pointer - if len(events) > 0 { - _p0 = unsafe.Pointer(&events[0]) - } else { - _p0 = unsafe.Pointer(&_zero) +func Stat(path string, stat *Stat_t) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return } - r0, _, e1 := Syscall6(SYS_EPOLL_WAIT, uintptr(epfd), uintptr(_p0), uintptr(len(events)), uintptr(msec), 0, 0) - n = int(r0) + _, _, e1 := Syscall(SYS_STAT64, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64.go index 4cb59b4a5c..382e072f5e 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64.go @@ -143,21 +143,6 @@ func Unlinkat(dirfd int, path string, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimes(path string, times *[2]Timeval) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -173,16 +158,6 @@ func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { - _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(times))) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -494,17 +469,6 @@ func Dup3(oldfd int, newfd int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate(size int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) - fd = int(r0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func EpollCreate1(flag int) (fd int, err error) { r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) fd = int(r0) @@ -544,21 +508,6 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Fallocate(fd int, mode uint32, off int64, len int64) (err error) { _, _, e1 := Syscall6(SYS_FALLOCATE, uintptr(fd), uintptr(mode), uintptr(off), uintptr(len), 0, 0) if e1 != 0 { @@ -995,6 +944,17 @@ func Nanosleep(time *Timespec, leftover *Timespec) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) { + r0, _, e1 := Syscall6(SYS_PERF_EVENT_OPEN, uintptr(unsafe.Pointer(attr)), uintptr(pid), uintptr(cpu), uintptr(groupFd), uintptr(flags), 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func PivotRoot(newroot string, putold string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(newroot) @@ -1355,16 +1315,6 @@ func Unshare(flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Ustat(dev int, ubuf *Ustat_t) (err error) { - _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func write(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -1524,6 +1474,21 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func faccessat(dirfd int, path string, mode uint32) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Dup2(oldfd int, newfd int) (err error) { _, _, e1 := Syscall(SYS_DUP2, uintptr(oldfd), uintptr(newfd), 0) if e1 != 0 { @@ -1534,6 +1499,17 @@ func Dup2(oldfd int, newfd int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func EpollCreate(size int) (fd int, err error) { + r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { var _p0 unsafe.Pointer if len(events) > 0 { @@ -1551,6 +1527,16 @@ func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fadvise(fd int, offset int64, length int64, advice int) (err error) { + _, _, e1 := Syscall6(SYS_FADVISE64, uintptr(fd), uintptr(offset), uintptr(length), uintptr(advice), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { @@ -1860,6 +1846,16 @@ func Truncate(path string, length int64) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Ustat(dev int, ubuf *Ustat_t) (err error) { + _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) { r0, _, e1 := Syscall(SYS_ACCEPT, uintptr(s), uintptr(unsafe.Pointer(rsa)), uintptr(unsafe.Pointer(addrlen))) fd = int(r0) @@ -2050,6 +2046,21 @@ func mmap(addr uintptr, length uintptr, prot int, flags int, fd int, offset int6 // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func futimesat(dirfd int, path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times))) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Gettimeofday(tv *Timeval) (err error) { _, _, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tv)), 0, 0) if e1 != 0 { @@ -2075,6 +2086,21 @@ func Utime(path string, buf *Utimbuf) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func utimes(path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func pipe2(p *[2]_C_int, flags int) (err error) { _, _, e1 := RawSyscall(SYS_PIPE2, uintptr(unsafe.Pointer(p)), uintptr(flags), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64le.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64le.go index 0b547ae301..da33eb12b0 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_mips64le.go @@ -143,21 +143,6 @@ func Unlinkat(dirfd int, path string, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimes(path string, times *[2]Timeval) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -173,16 +158,6 @@ func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { - _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(times))) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -494,17 +469,6 @@ func Dup3(oldfd int, newfd int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate(size int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) - fd = int(r0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func EpollCreate1(flag int) (fd int, err error) { r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) fd = int(r0) @@ -544,21 +508,6 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Fallocate(fd int, mode uint32, off int64, len int64) (err error) { _, _, e1 := Syscall6(SYS_FALLOCATE, uintptr(fd), uintptr(mode), uintptr(off), uintptr(len), 0, 0) if e1 != 0 { @@ -995,6 +944,17 @@ func Nanosleep(time *Timespec, leftover *Timespec) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) { + r0, _, e1 := Syscall6(SYS_PERF_EVENT_OPEN, uintptr(unsafe.Pointer(attr)), uintptr(pid), uintptr(cpu), uintptr(groupFd), uintptr(flags), 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func PivotRoot(newroot string, putold string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(newroot) @@ -1355,16 +1315,6 @@ func Unshare(flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Ustat(dev int, ubuf *Ustat_t) (err error) { - _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func write(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -1524,6 +1474,21 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func faccessat(dirfd int, path string, mode uint32) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Dup2(oldfd int, newfd int) (err error) { _, _, e1 := Syscall(SYS_DUP2, uintptr(oldfd), uintptr(newfd), 0) if e1 != 0 { @@ -1534,6 +1499,17 @@ func Dup2(oldfd int, newfd int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func EpollCreate(size int) (fd int, err error) { + r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { var _p0 unsafe.Pointer if len(events) > 0 { @@ -1551,6 +1527,16 @@ func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fadvise(fd int, offset int64, length int64, advice int) (err error) { + _, _, e1 := Syscall6(SYS_FADVISE64, uintptr(fd), uintptr(offset), uintptr(length), uintptr(advice), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { @@ -1860,6 +1846,16 @@ func Truncate(path string, length int64) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Ustat(dev int, ubuf *Ustat_t) (err error) { + _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) { r0, _, e1 := Syscall(SYS_ACCEPT, uintptr(s), uintptr(unsafe.Pointer(rsa)), uintptr(unsafe.Pointer(addrlen))) fd = int(r0) @@ -2050,6 +2046,21 @@ func mmap(addr uintptr, length uintptr, prot int, flags int, fd int, offset int6 // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func futimesat(dirfd int, path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times))) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Gettimeofday(tv *Timeval) (err error) { _, _, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tv)), 0, 0) if e1 != 0 { @@ -2075,6 +2086,21 @@ func Utime(path string, buf *Utimbuf) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func utimes(path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func pipe2(p *[2]_C_int, flags int) (err error) { _, _, e1 := RawSyscall(SYS_PIPE2, uintptr(unsafe.Pointer(p)), uintptr(flags), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_mipsle.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_mipsle.go index cd94d3a832..f6e45189ae 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_mipsle.go @@ -143,21 +143,6 @@ func Unlinkat(dirfd int, path string, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimes(path string, times *[2]Timeval) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -173,16 +158,6 @@ func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { - _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(times))) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -494,17 +469,6 @@ func Dup3(oldfd int, newfd int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate(size int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) - fd = int(r0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func EpollCreate1(flag int) (fd int, err error) { r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) fd = int(r0) @@ -544,21 +508,6 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Fallocate(fd int, mode uint32, off int64, len int64) (err error) { _, _, e1 := Syscall6(SYS_FALLOCATE, uintptr(fd), uintptr(mode), uintptr(off), uintptr(off>>32), uintptr(len), uintptr(len>>32)) if e1 != 0 { @@ -995,6 +944,17 @@ func Nanosleep(time *Timespec, leftover *Timespec) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) { + r0, _, e1 := Syscall6(SYS_PERF_EVENT_OPEN, uintptr(unsafe.Pointer(attr)), uintptr(pid), uintptr(cpu), uintptr(groupFd), uintptr(flags), 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func PivotRoot(newroot string, putold string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(newroot) @@ -1355,16 +1315,6 @@ func Unshare(flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Ustat(dev int, ubuf *Ustat_t) (err error) { - _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func write(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -1524,6 +1474,21 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func faccessat(dirfd int, path string, mode uint32) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Dup2(oldfd int, newfd int) (err error) { _, _, e1 := Syscall(SYS_DUP2, uintptr(oldfd), uintptr(newfd), 0) if e1 != 0 { @@ -1534,6 +1499,44 @@ func Dup2(oldfd int, newfd int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func EpollCreate(size int) (fd int, err error) { + r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { + var _p0 unsafe.Pointer + if len(events) > 0 { + _p0 = unsafe.Pointer(&events[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + r0, _, e1 := Syscall6(SYS_EPOLL_WAIT, uintptr(epfd), uintptr(_p0), uintptr(len(events)), uintptr(msec), 0, 0) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Fadvise(fd int, offset int64, length int64, advice int) (err error) { + _, _, e1 := Syscall9(SYS_FADVISE64, uintptr(fd), 0, uintptr(offset), uintptr(offset>>32), uintptr(length), uintptr(length>>32), uintptr(advice), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { @@ -1737,9 +1740,9 @@ func Shutdown(fd int, how int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Splice(rfd int, roff *int64, wfd int, woff *int64, len int, flags int) (n int64, err error) { - r0, r1, e1 := Syscall6(SYS_SPLICE, uintptr(rfd), uintptr(unsafe.Pointer(roff)), uintptr(wfd), uintptr(unsafe.Pointer(woff)), uintptr(len), uintptr(flags)) - n = int64(int64(r1)<<32 | int64(r0)) +func Splice(rfd int, roff *int64, wfd int, woff *int64, len int, flags int) (n int, err error) { + r0, _, e1 := Syscall6(SYS_SPLICE, uintptr(rfd), uintptr(unsafe.Pointer(roff)), uintptr(wfd), uintptr(unsafe.Pointer(woff)), uintptr(len), uintptr(flags)) + n = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -1773,6 +1776,16 @@ func Truncate(path string, length int64) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Ustat(dev int, ubuf *Ustat_t) (err error) { + _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) { r0, _, e1 := Syscall(SYS_ACCEPT, uintptr(s), uintptr(unsafe.Pointer(rsa)), uintptr(unsafe.Pointer(addrlen))) fd = int(r0) @@ -1983,6 +1996,21 @@ func Iopl(level int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func futimesat(dirfd int, path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times))) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Gettimeofday(tv *Timeval) (err error) { _, _, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tv)), 0, 0) if e1 != 0 { @@ -2004,13 +2032,13 @@ func Time(t *Time_t) (tt Time_t, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Lstat(path string, stat *Stat_t) (err error) { +func Utime(path string, buf *Utimbuf) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) if err != nil { return } - _, _, e1 := Syscall(SYS_LSTAT64, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), 0) + _, _, e1 := Syscall(SYS_UTIME, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(buf)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2019,8 +2047,13 @@ func Lstat(path string, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Fstat(fd int, stat *Stat_t) (err error) { - _, _, e1 := Syscall(SYS_FSTAT64, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) +func utimes(path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2029,13 +2062,13 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Fstatat(dirfd int, path string, stat *Stat_t, flags int) (err error) { +func Lstat(path string, stat *Stat_t) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) if err != nil { return } - _, _, e1 := Syscall6(SYS_FSTATAT64, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + _, _, e1 := Syscall(SYS_LSTAT64, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2044,13 +2077,8 @@ func Fstatat(dirfd int, path string, stat *Stat_t, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Stat(path string, stat *Stat_t) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_STAT64, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), 0) +func Fstat(fd int, stat *Stat_t) (err error) { + _, _, e1 := Syscall(SYS_FSTAT64, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -2059,13 +2087,13 @@ func Stat(path string, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Utime(path string, buf *Utimbuf) (err error) { +func Fstatat(dirfd int, path string, stat *Stat_t, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) if err != nil { return } - _, _, e1 := Syscall(SYS_UTIME, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(buf)), 0) + _, _, e1 := Syscall6(SYS_FSTATAT64, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) if e1 != 0 { err = errnoErr(e1) } @@ -2074,15 +2102,13 @@ func Utime(path string, buf *Utimbuf) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { - var _p0 unsafe.Pointer - if len(events) > 0 { - _p0 = unsafe.Pointer(&events[0]) - } else { - _p0 = unsafe.Pointer(&_zero) +func Stat(path string, stat *Stat_t) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return } - r0, _, e1 := Syscall6(SYS_EPOLL_WAIT, uintptr(epfd), uintptr(_p0), uintptr(len(events)), uintptr(msec), 0, 0) - n = int(r0) + _, _, e1 := Syscall(SYS_STAT64, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { err = errnoErr(e1) } diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64.go index cdad555a5d..7cc1bfd129 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64.go @@ -143,21 +143,6 @@ func Unlinkat(dirfd int, path string, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimes(path string, times *[2]Timeval) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -173,16 +158,6 @@ func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { - _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(times))) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -494,17 +469,6 @@ func Dup3(oldfd int, newfd int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate(size int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) - fd = int(r0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func EpollCreate1(flag int) (fd int, err error) { r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) fd = int(r0) @@ -544,21 +508,6 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Fallocate(fd int, mode uint32, off int64, len int64) (err error) { _, _, e1 := Syscall6(SYS_FALLOCATE, uintptr(fd), uintptr(mode), uintptr(off), uintptr(len), 0, 0) if e1 != 0 { @@ -995,6 +944,17 @@ func Nanosleep(time *Timespec, leftover *Timespec) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) { + r0, _, e1 := Syscall6(SYS_PERF_EVENT_OPEN, uintptr(unsafe.Pointer(attr)), uintptr(pid), uintptr(cpu), uintptr(groupFd), uintptr(flags), 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func PivotRoot(newroot string, putold string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(newroot) @@ -1355,16 +1315,6 @@ func Unshare(flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Ustat(dev int, ubuf *Ustat_t) (err error) { - _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func write(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -1524,6 +1474,42 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func faccessat(dirfd int, path string, mode uint32) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Dup2(oldfd int, newfd int) (err error) { + _, _, e1 := Syscall(SYS_DUP2, uintptr(oldfd), uintptr(newfd), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func EpollCreate(size int) (fd int, err error) { + r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { var _p0 unsafe.Pointer if len(events) > 0 { @@ -1541,8 +1527,8 @@ func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Dup2(oldfd int, newfd int) (err error) { - _, _, e1 := Syscall(SYS_DUP2, uintptr(oldfd), uintptr(newfd), 0) +func Fadvise(fd int, offset int64, length int64, advice int) (err error) { + _, _, e1 := Syscall6(SYS_FADVISE64, uintptr(fd), uintptr(offset), uintptr(length), uintptr(advice), 0, 0) if e1 != 0 { err = errnoErr(e1) } @@ -1942,6 +1928,16 @@ func Truncate(path string, length int64) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Ustat(dev int, ubuf *Ustat_t) (err error) { + _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) { r0, _, e1 := Syscall(SYS_ACCEPT, uintptr(s), uintptr(unsafe.Pointer(rsa)), uintptr(unsafe.Pointer(addrlen))) fd = int(r0) @@ -2132,6 +2128,21 @@ func mmap(addr uintptr, length uintptr, prot int, flags int, fd int, offset int6 // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func futimesat(dirfd int, path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times))) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Gettimeofday(tv *Timeval) (err error) { _, _, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tv)), 0, 0) if e1 != 0 { @@ -2168,6 +2179,21 @@ func Utime(path string, buf *Utimbuf) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func utimes(path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func pipe(p *[2]_C_int) (err error) { _, _, e1 := RawSyscall(SYS_PIPE, uintptr(unsafe.Pointer(p)), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64le.go index 38f4e44b62..c3dcb38186 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_ppc64le.go @@ -143,21 +143,6 @@ func Unlinkat(dirfd int, path string, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimes(path string, times *[2]Timeval) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -173,16 +158,6 @@ func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { - _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(times))) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -494,17 +469,6 @@ func Dup3(oldfd int, newfd int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate(size int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) - fd = int(r0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func EpollCreate1(flag int) (fd int, err error) { r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) fd = int(r0) @@ -544,21 +508,6 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Fallocate(fd int, mode uint32, off int64, len int64) (err error) { _, _, e1 := Syscall6(SYS_FALLOCATE, uintptr(fd), uintptr(mode), uintptr(off), uintptr(len), 0, 0) if e1 != 0 { @@ -995,6 +944,17 @@ func Nanosleep(time *Timespec, leftover *Timespec) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) { + r0, _, e1 := Syscall6(SYS_PERF_EVENT_OPEN, uintptr(unsafe.Pointer(attr)), uintptr(pid), uintptr(cpu), uintptr(groupFd), uintptr(flags), 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func PivotRoot(newroot string, putold string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(newroot) @@ -1355,16 +1315,6 @@ func Unshare(flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Ustat(dev int, ubuf *Ustat_t) (err error) { - _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func write(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -1524,6 +1474,42 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func faccessat(dirfd int, path string, mode uint32) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Dup2(oldfd int, newfd int) (err error) { + _, _, e1 := Syscall(SYS_DUP2, uintptr(oldfd), uintptr(newfd), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func EpollCreate(size int) (fd int, err error) { + r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { var _p0 unsafe.Pointer if len(events) > 0 { @@ -1541,8 +1527,8 @@ func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Dup2(oldfd int, newfd int) (err error) { - _, _, e1 := Syscall(SYS_DUP2, uintptr(oldfd), uintptr(newfd), 0) +func Fadvise(fd int, offset int64, length int64, advice int) (err error) { + _, _, e1 := Syscall6(SYS_FADVISE64, uintptr(fd), uintptr(offset), uintptr(length), uintptr(advice), 0, 0) if e1 != 0 { err = errnoErr(e1) } @@ -1942,6 +1928,16 @@ func Truncate(path string, length int64) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Ustat(dev int, ubuf *Ustat_t) (err error) { + _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func accept(s int, rsa *RawSockaddrAny, addrlen *_Socklen) (fd int, err error) { r0, _, e1 := Syscall(SYS_ACCEPT, uintptr(s), uintptr(unsafe.Pointer(rsa)), uintptr(unsafe.Pointer(addrlen))) fd = int(r0) @@ -2132,6 +2128,21 @@ func mmap(addr uintptr, length uintptr, prot int, flags int, fd int, offset int6 // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func futimesat(dirfd int, path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times))) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Gettimeofday(tv *Timeval) (err error) { _, _, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tv)), 0, 0) if e1 != 0 { @@ -2168,6 +2179,21 @@ func Utime(path string, buf *Utimbuf) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func utimes(path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func pipe(p *[2]_C_int) (err error) { _, _, e1 := RawSyscall(SYS_PIPE, uintptr(unsafe.Pointer(p)), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_s390x.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_s390x.go index c443baf63f..38f903cd3e 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_s390x.go @@ -143,21 +143,6 @@ func Unlinkat(dirfd int, path string, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimes(path string, times *[2]Timeval) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -173,16 +158,6 @@ func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { - _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(times))) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Getcwd(buf []byte) (n int, err error) { var _p0 unsafe.Pointer if len(buf) > 0 { @@ -494,17 +469,6 @@ func Dup3(oldfd int, newfd int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate(size int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) - fd = int(r0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func EpollCreate1(flag int) (fd int, err error) { r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) fd = int(r0) @@ -544,21 +508,6 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Fallocate(fd int, mode uint32, off int64, len int64) (err error) { _, _, e1 := Syscall6(SYS_FALLOCATE, uintptr(fd), uintptr(mode), uintptr(off), uintptr(len), 0, 0) if e1 != 0 { @@ -995,6 +944,17 @@ func Nanosleep(time *Timespec, leftover *Timespec) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) { + r0, _, e1 := Syscall6(SYS_PERF_EVENT_OPEN, uintptr(unsafe.Pointer(attr)), uintptr(pid), uintptr(cpu), uintptr(groupFd), uintptr(flags), 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func PivotRoot(newroot string, putold string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(newroot) @@ -1355,16 +1315,6 @@ func Unshare(flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Ustat(dev int, ubuf *Ustat_t) (err error) { - _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func write(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -1524,6 +1474,21 @@ func Munlockall() (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func faccessat(dirfd int, path string, mode uint32) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Dup2(oldfd int, newfd int) (err error) { _, _, e1 := Syscall(SYS_DUP2, uintptr(oldfd), uintptr(newfd), 0) if e1 != 0 { @@ -1534,6 +1499,17 @@ func Dup2(oldfd int, newfd int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func EpollCreate(size int) (fd int, err error) { + r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { var _p0 unsafe.Pointer if len(events) > 0 { @@ -1912,6 +1888,16 @@ func Truncate(path string, length int64) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Ustat(dev int, ubuf *Ustat_t) (err error) { + _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func getgroups(n int, list *_Gid_t) (nn int, err error) { r0, _, e1 := RawSyscall(SYS_GETGROUPS, uintptr(n), uintptr(unsafe.Pointer(list)), 0) nn = int(r0) @@ -1933,6 +1919,21 @@ func setgroups(n int, list *_Gid_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func futimesat(dirfd int, path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times))) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Gettimeofday(tv *Timeval) (err error) { _, _, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tv)), 0, 0) if e1 != 0 { @@ -1958,6 +1959,21 @@ func Utime(path string, buf *Utimbuf) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func utimes(path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func pipe2(p *[2]_C_int, flags int) (err error) { _, _, e1 := RawSyscall(SYS_PIPE2, uintptr(unsafe.Pointer(p)), uintptr(flags), 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zsyscall_linux_sparc64.go index 2dd98434ea..b26aee9579 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_linux_sparc64.go @@ -14,6 +14,31 @@ var _ syscall.Errno // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func fchmodat(dirfd int, path string, mode uint32) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FCHMODAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func ioctl(fd int, req uint, arg uintptr) (err error) { + _, _, e1 := Syscall(SYS_IOCTL, uintptr(fd), uintptr(req), uintptr(arg)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Linkat(olddirfd int, oldpath string, newdirfd int, newpath string, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(oldpath) @@ -118,13 +143,13 @@ func Unlinkat(dirfd int, path string, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimes(path string, times *[2]Timeval) (err error) { +func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) if err != nil { return } - _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) + _, _, e1 := Syscall6(SYS_UTIMENSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), uintptr(flags), 0, 0) if e1 != 0 { err = errnoErr(e1) } @@ -133,13 +158,70 @@ func utimes(path string, times *[2]Timeval) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error) { +func Getcwd(buf []byte) (n int, err error) { + var _p0 unsafe.Pointer + if len(buf) > 0 { + _p0 = unsafe.Pointer(&buf[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + r0, _, e1 := Syscall(SYS_GETCWD, uintptr(_p0), uintptr(len(buf)), 0) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func wait4(pid int, wstatus *_C_int, options int, rusage *Rusage) (wpid int, err error) { + r0, _, e1 := Syscall6(SYS_WAIT4, uintptr(pid), uintptr(unsafe.Pointer(wstatus)), uintptr(options), uintptr(unsafe.Pointer(rusage)), 0, 0) + wpid = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func KeyctlInt(cmd int, arg2 int, arg3 int, arg4 int, arg5 int) (ret int, err error) { + r0, _, e1 := Syscall6(SYS_KEYCTL, uintptr(cmd), uintptr(arg2), uintptr(arg3), uintptr(arg4), uintptr(arg5), 0) + ret = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func KeyctlBuffer(cmd int, arg2 int, buf []byte, arg5 int) (ret int, err error) { + var _p0 unsafe.Pointer + if len(buf) > 0 { + _p0 = unsafe.Pointer(&buf[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + r0, _, e1 := Syscall6(SYS_KEYCTL, uintptr(cmd), uintptr(arg2), uintptr(_p0), uintptr(len(buf)), uintptr(arg5), 0) + ret = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func keyctlJoin(cmd int, arg2 string) (ret int, err error) { var _p0 *byte - _p0, err = BytePtrFromString(path) + _p0, err = BytePtrFromString(arg2) if err != nil { return } - _, _, e1 := Syscall6(SYS_UTIMENSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), uintptr(flags), 0, 0) + r0, _, e1 := Syscall(SYS_KEYCTL, uintptr(cmd), uintptr(unsafe.Pointer(_p0)), 0) + ret = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -148,8 +230,19 @@ func utimensat(dirfd int, path string, times *[2]Timespec, flags int) (err error // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { - _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(times))) +func keyctlSearch(cmd int, arg2 int, arg3 string, arg4 string, arg5 int) (ret int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(arg3) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(arg4) + if err != nil { + return + } + r0, _, e1 := Syscall6(SYS_KEYCTL, uintptr(cmd), uintptr(arg2), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(arg5), 0) + ret = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -158,15 +251,14 @@ func futimesat(dirfd int, path *byte, times *[2]Timeval) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Getcwd(buf []byte) (n int, err error) { +func keyctlIOV(cmd int, arg2 int, payload []Iovec, arg5 int) (err error) { var _p0 unsafe.Pointer - if len(buf) > 0 { - _p0 = unsafe.Pointer(&buf[0]) + if len(payload) > 0 { + _p0 = unsafe.Pointer(&payload[0]) } else { _p0 = unsafe.Pointer(&_zero) } - r0, _, e1 := Syscall(SYS_GETCWD, uintptr(_p0), uintptr(len(buf)), 0) - n = int(r0) + _, _, e1 := Syscall6(SYS_KEYCTL, uintptr(cmd), uintptr(arg2), uintptr(_p0), uintptr(len(payload)), uintptr(arg5), 0) if e1 != 0 { err = errnoErr(e1) } @@ -175,9 +267,15 @@ func Getcwd(buf []byte) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func wait4(pid int, wstatus *_C_int, options int, rusage *Rusage) (wpid int, err error) { - r0, _, e1 := Syscall6(SYS_WAIT4, uintptr(pid), uintptr(unsafe.Pointer(wstatus)), uintptr(options), uintptr(unsafe.Pointer(rusage)), 0, 0) - wpid = int(r0) +func keyctlDH(cmd int, arg2 *KeyctlDHParams, buf []byte) (ret int, err error) { + var _p0 unsafe.Pointer + if len(buf) > 0 { + _p0 = unsafe.Pointer(&buf[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + r0, _, e1 := Syscall6(SYS_KEYCTL, uintptr(cmd), uintptr(unsafe.Pointer(arg2)), uintptr(_p0), uintptr(len(buf)), 0, 0) + ret = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -251,6 +349,33 @@ func Acct(path string) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func AddKey(keyType string, description string, payload []byte, ringid int) (id int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(keyType) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(description) + if err != nil { + return + } + var _p2 unsafe.Pointer + if len(payload) > 0 { + _p2 = unsafe.Pointer(&payload[0]) + } else { + _p2 = unsafe.Pointer(&_zero) + } + r0, _, e1 := Syscall6(SYS_ADD_KEY, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(_p2), uintptr(len(payload)), uintptr(ringid), 0) + id = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Adjtimex(buf *Timex) (state int, err error) { r0, _, e1 := Syscall(SYS_ADJTIMEX, uintptr(unsafe.Pointer(buf)), 0, 0) state = int(r0) @@ -344,8 +469,8 @@ func Dup3(oldfd int, newfd int, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate(size int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE, uintptr(size), 0, 0) +func EpollCreate1(flag int) (fd int, err error) { + r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) fd = int(r0) if e1 != 0 { err = errnoErr(e1) @@ -355,9 +480,8 @@ func EpollCreate(size int) (fd int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCreate1(flag int) (fd int, err error) { - r0, _, e1 := RawSyscall(SYS_EPOLL_CREATE1, uintptr(flag), 0, 0) - fd = int(r0) +func EpollCtl(epfd int, op int, fd int, event *EpollEvent) (err error) { + _, _, e1 := RawSyscall6(SYS_EPOLL_CTL, uintptr(epfd), uintptr(op), uintptr(fd), uintptr(unsafe.Pointer(event)), 0, 0) if e1 != 0 { err = errnoErr(e1) } @@ -366,8 +490,9 @@ func EpollCreate1(flag int) (fd int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func EpollCtl(epfd int, op int, fd int, event *EpollEvent) (err error) { - _, _, e1 := RawSyscall6(SYS_EPOLL_CTL, uintptr(epfd), uintptr(op), uintptr(fd), uintptr(unsafe.Pointer(event)), 0, 0) +func Eventfd(initval uint, flags int) (fd int, err error) { + r0, _, e1 := Syscall(SYS_EVENTFD2, uintptr(initval), uintptr(flags), 0) + fd = int(r0) if e1 != 0 { err = errnoErr(e1) } @@ -377,7 +502,7 @@ func EpollCtl(epfd int, op int, fd int, event *EpollEvent) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Exit(code int) { - Syscall(SYS_EXIT_GROUP, uintptr(code), 0, 0) + SyscallNoError(SYS_EXIT_GROUP, uintptr(code), 0, 0) return } @@ -428,21 +553,6 @@ func Fchmod(fd int, mode uint32) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) { - var _p0 *byte - _p0, err = BytePtrFromString(path) - if err != nil { - return - } - _, _, e1 := Syscall6(SYS_FCHMODAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func Fchownat(dirfd int, path string, uid int, gid int, flags int) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -528,7 +638,7 @@ func Getpgid(pid int) (pgid int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Getpid() (pid int) { - r0, _, _ := RawSyscall(SYS_GETPID, 0, 0, 0) + r0, _ := RawSyscallNoError(SYS_GETPID, 0, 0, 0) pid = int(r0) return } @@ -536,7 +646,7 @@ func Getpid() (pid int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Getppid() (ppid int) { - r0, _, _ := RawSyscall(SYS_GETPPID, 0, 0, 0) + r0, _ := RawSyscallNoError(SYS_GETPPID, 0, 0, 0) ppid = int(r0) return } @@ -593,7 +703,7 @@ func Getsid(pid int) (sid int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Gettid() (tid int) { - r0, _, _ := RawSyscall(SYS_GETTID, 0, 0, 0) + r0, _ := RawSyscallNoError(SYS_GETTID, 0, 0, 0) tid = int(r0) return } @@ -692,6 +802,33 @@ func Klogctl(typ int, buf []byte) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Lgetxattr(path string, attr string, dest []byte) (sz int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + var _p2 unsafe.Pointer + if len(dest) > 0 { + _p2 = unsafe.Pointer(&dest[0]) + } else { + _p2 = unsafe.Pointer(&_zero) + } + r0, _, e1 := Syscall6(SYS_LGETXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(_p2), uintptr(len(dest)), 0, 0) + sz = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Listxattr(path string, dest []byte) (sz int, err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -714,6 +851,74 @@ func Listxattr(path string, dest []byte) (sz int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Llistxattr(path string, dest []byte) (sz int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 unsafe.Pointer + if len(dest) > 0 { + _p1 = unsafe.Pointer(&dest[0]) + } else { + _p1 = unsafe.Pointer(&_zero) + } + r0, _, e1 := Syscall(SYS_LLISTXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(_p1), uintptr(len(dest))) + sz = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Lremovexattr(path string, attr string) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_LREMOVEXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Lsetxattr(path string, attr string, data []byte, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(attr) + if err != nil { + return + } + var _p2 unsafe.Pointer + if len(data) > 0 { + _p2 = unsafe.Pointer(&data[0]) + } else { + _p2 = unsafe.Pointer(&_zero) + } + _, _, e1 := Syscall6(SYS_LSETXATTR, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(_p2), uintptr(len(data)), uintptr(flags), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Mkdirat(dirfd int, path string, mode uint32) (err error) { var _p0 *byte _p0, err = BytePtrFromString(path) @@ -754,6 +959,17 @@ func Nanosleep(time *Timespec, leftover *Timespec) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func PerfEventOpen(attr *PerfEventAttr, pid int, cpu int, groupFd int, flags int) (fd int, err error) { + r0, _, e1 := Syscall6(SYS_PERF_EVENT_OPEN, uintptr(unsafe.Pointer(attr)), uintptr(pid), uintptr(cpu), uintptr(groupFd), uintptr(flags), 0) + fd = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func PivotRoot(newroot string, putold string) (err error) { var _p0 *byte _p0, err = BytePtrFromString(newroot) @@ -794,6 +1010,17 @@ func Prctl(option int, arg2 uintptr, arg3 uintptr, arg4 uintptr, arg5 uintptr) ( // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Pselect(nfd int, r *FdSet, w *FdSet, e *FdSet, timeout *Timespec, sigmask *Sigset_t) (n int, err error) { + r0, _, e1 := Syscall6(SYS_PSELECT6, uintptr(nfd), uintptr(unsafe.Pointer(r)), uintptr(unsafe.Pointer(w)), uintptr(unsafe.Pointer(e)), uintptr(unsafe.Pointer(timeout)), uintptr(unsafe.Pointer(sigmask))) + n = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func read(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -851,6 +1078,32 @@ func Renameat(olddirfd int, oldpath string, newdirfd int, newpath string) (err e // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func RequestKey(keyType string, description string, callback string, destRingid int) (id int, err error) { + var _p0 *byte + _p0, err = BytePtrFromString(keyType) + if err != nil { + return + } + var _p1 *byte + _p1, err = BytePtrFromString(description) + if err != nil { + return + } + var _p2 *byte + _p2, err = BytePtrFromString(callback) + if err != nil { + return + } + r0, _, e1 := Syscall6(SYS_REQUEST_KEY, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(_p1)), uintptr(unsafe.Pointer(_p2)), uintptr(destRingid), 0, 0) + id = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Setdomainname(p []byte) (err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -960,8 +1213,33 @@ func Setxattr(path string, attr string, data []byte, flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Statx(dirfd int, path string, flags int, mask int, stat *Statx_t) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_STATX, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(flags), uintptr(mask), uintptr(unsafe.Pointer(stat)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Sync() { - Syscall(SYS_SYNC, 0, 0, 0) + SyscallNoError(SYS_SYNC, 0, 0, 0) + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Syncfs(fd int) (err error) { + _, _, e1 := Syscall(SYS_SYNCFS, uintptr(fd), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } return } @@ -1010,7 +1288,7 @@ func Times(tms *Tms) (ticks uintptr, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Umask(mask int) (oldmask int) { - r0, _, _ := RawSyscall(SYS_UMASK, uintptr(mask), 0, 0) + r0, _ := RawSyscallNoError(SYS_UMASK, uintptr(mask), 0, 0) oldmask = int(r0) return } @@ -1052,16 +1330,6 @@ func Unshare(flags int) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Ustat(dev int, ubuf *Ustat_t) (err error) { - _, _, e1 := Syscall(SYS_USTAT, uintptr(dev), uintptr(unsafe.Pointer(ubuf)), 0) - if e1 != 0 { - err = errnoErr(e1) - } - return -} - -// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT - func write(fd int, p []byte) (n int, err error) { var _p0 unsafe.Pointer if len(p) > 0 { @@ -1169,14 +1437,24 @@ func Mlock(b []byte) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Munlock(b []byte) (err error) { +func Mlockall(flags int) (err error) { + _, _, e1 := Syscall(SYS_MLOCKALL, uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Msync(b []byte, flags int) (err error) { var _p0 unsafe.Pointer if len(b) > 0 { _p0 = unsafe.Pointer(&b[0]) } else { _p0 = unsafe.Pointer(&_zero) } - _, _, e1 := Syscall(SYS_MUNLOCK, uintptr(_p0), uintptr(len(b)), 0) + _, _, e1 := Syscall(SYS_MSYNC, uintptr(_p0), uintptr(len(b)), uintptr(flags)) if e1 != 0 { err = errnoErr(e1) } @@ -1185,8 +1463,14 @@ func Munlock(b []byte) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT -func Mlockall(flags int) (err error) { - _, _, e1 := Syscall(SYS_MLOCKALL, uintptr(flags), 0, 0) +func Munlock(b []byte) (err error) { + var _p0 unsafe.Pointer + if len(b) > 0 { + _p0 = unsafe.Pointer(&b[0]) + } else { + _p0 = unsafe.Pointer(&_zero) + } + _, _, e1 := Syscall(SYS_MUNLOCK, uintptr(_p0), uintptr(len(b)), 0) if e1 != 0 { err = errnoErr(e1) } @@ -1222,6 +1506,16 @@ func EpollWait(epfd int, events []EpollEvent, msec int) (n int, err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fadvise(fd int, offset int64, length int64, advice int) (err error) { + _, _, e1 := Syscall6(SYS_FADVISE64, uintptr(fd), uintptr(offset), uintptr(length), uintptr(advice), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Dup2(oldfd int, newfd int) (err error) { _, _, e1 := Syscall(SYS_DUP2, uintptr(oldfd), uintptr(newfd), 0) if e1 != 0 { @@ -1252,6 +1546,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(dirfd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT64, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fstatfs(fd int, buf *Statfs_t) (err error) { _, _, e1 := Syscall(SYS_FSTATFS, uintptr(fd), uintptr(unsafe.Pointer(buf)), 0) if e1 != 0 { @@ -1273,7 +1582,7 @@ func Ftruncate(fd int, length int64) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Getegid() (egid int) { - r0, _, _ := RawSyscall(SYS_GETEGID, 0, 0, 0) + r0, _ := RawSyscallNoError(SYS_GETEGID, 0, 0, 0) egid = int(r0) return } @@ -1281,7 +1590,7 @@ func Getegid() (egid int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Geteuid() (euid int) { - r0, _, _ := RawSyscall(SYS_GETEUID, 0, 0, 0) + r0, _ := RawSyscallNoError(SYS_GETEUID, 0, 0, 0) euid = int(r0) return } @@ -1289,7 +1598,7 @@ func Geteuid() (euid int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Getgid() (gid int) { - r0, _, _ := RawSyscall(SYS_GETGID, 0, 0, 0) + r0, _ := RawSyscallNoError(SYS_GETGID, 0, 0, 0) gid = int(r0) return } @@ -1307,7 +1616,7 @@ func Getrlimit(resource int, rlim *Rlimit) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT func Getuid() (uid int) { - r0, _, _ := RawSyscall(SYS_GETUID, 0, 0, 0) + r0, _ := RawSyscallNoError(SYS_GETUID, 0, 0, 0) uid = int(r0) return } @@ -1778,6 +2087,21 @@ func mmap(addr uintptr, length uintptr, prot int, flags int, fd int, offset int6 // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func futimesat(dirfd int, path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_FUTIMESAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times))) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Gettimeofday(tv *Timeval) (err error) { _, _, e1 := RawSyscall(SYS_GETTIMEOFDAY, uintptr(unsafe.Pointer(tv)), 0, 0) if e1 != 0 { @@ -1803,6 +2127,21 @@ func Utime(path string, buf *Utimbuf) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func utimes(path string, times *[2]Timeval) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall(SYS_UTIMES, uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(times)), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func pipe(p *[2]_C_int) (err error) { _, _, e1 := RawSyscall(SYS_PIPE, uintptr(unsafe.Pointer(p)), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_386.go b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_386.go index 62eadff1c9..b3298930e7 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_386.go @@ -571,6 +571,31 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Fadvise(fd int, offset int64, length int64, advice int) (err error) { + _, _, e1 := Syscall9(SYS_POSIX_FADVISE, uintptr(fd), 0, uintptr(offset), uintptr(offset>>32), 0, uintptr(length), uintptr(length>>32), uintptr(advice), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchdir(fd int) (err error) { _, _, e1 := Syscall(SYS_FCHDIR, uintptr(fd), 0, 0) if e1 != 0 { @@ -601,6 +626,21 @@ func Fchmod(fd int, mode uint32) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FCHMODAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { @@ -642,6 +682,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fsync(fd int) (err error) { _, _, e1 := Syscall(SYS_FSYNC, uintptr(fd), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_amd64.go index 307f4e99e9..5096ef07e4 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_amd64.go @@ -571,6 +571,31 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Fadvise(fd int, offset int64, length int64, advice int) (err error) { + _, _, e1 := Syscall6(SYS_POSIX_FADVISE, uintptr(fd), 0, uintptr(offset), 0, uintptr(length), uintptr(advice)) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchdir(fd int) (err error) { _, _, e1 := Syscall(SYS_FCHDIR, uintptr(fd), 0, 0) if e1 != 0 { @@ -601,6 +626,21 @@ func Fchmod(fd int, mode uint32) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FCHMODAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { @@ -642,6 +682,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fsync(fd int) (err error) { _, _, e1 := Syscall(SYS_FSYNC, uintptr(fd), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm.go index 61109313c8..b7141c63f9 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_netbsd_arm.go @@ -571,6 +571,31 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + +func Fadvise(fd int, offset int64, length int64, advice int) (err error) { + _, _, e1 := Syscall9(SYS_POSIX_FADVISE, uintptr(fd), 0, uintptr(offset), uintptr(offset>>32), 0, uintptr(length), uintptr(length>>32), uintptr(advice), 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchdir(fd int) (err error) { _, _, e1 := Syscall(SYS_FCHDIR, uintptr(fd), 0, 0) if e1 != 0 { @@ -601,6 +626,21 @@ func Fchmod(fd int, mode uint32) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FCHMODAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { @@ -642,6 +682,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fsync(fd int) (err error) { _, _, e1 := Syscall(SYS_FSYNC, uintptr(fd), 0, 0) if e1 != 0 { diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go index 003f820e67..1942049b0f 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_386.go @@ -569,6 +569,21 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchdir(fd int) (err error) { _, _, e1 := Syscall(SYS_FCHDIR, uintptr(fd), 0, 0) if e1 != 0 { @@ -599,6 +614,21 @@ func Fchmod(fd int, mode uint32) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FCHMODAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { @@ -640,6 +670,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fstatfs(fd int, stat *Statfs_t) (err error) { _, _, e1 := Syscall(SYS_FSTATFS, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { @@ -750,6 +795,17 @@ func Getrlimit(which int, lim *Rlimit) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Getrtable() (rtable int, err error) { + r0, _, e1 := RawSyscall(SYS_GETRTABLE, 0, 0, 0) + rtable = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Getrusage(who int, rusage *Rusage) (err error) { _, _, e1 := RawSyscall(SYS_GETRUSAGE, uintptr(who), uintptr(unsafe.Pointer(rusage)), 0) if e1 != 0 { @@ -1224,6 +1280,16 @@ func Setrlimit(which int, lim *Rlimit) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Setrtable(rtable int) (err error) { + _, _, e1 := RawSyscall(SYS_SETRTABLE, uintptr(rtable), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Setsid() (pid int, err error) { r0, _, e1 := RawSyscall(SYS_SETSID, 0, 0, 0) pid = int(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go index ba0e8f3299..d351c72cb7 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_amd64.go @@ -569,6 +569,21 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchdir(fd int) (err error) { _, _, e1 := Syscall(SYS_FCHDIR, uintptr(fd), 0, 0) if e1 != 0 { @@ -599,6 +614,21 @@ func Fchmod(fd int, mode uint32) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FCHMODAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { @@ -640,6 +670,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fstatfs(fd int, stat *Statfs_t) (err error) { _, _, e1 := Syscall(SYS_FSTATFS, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { @@ -750,6 +795,17 @@ func Getrlimit(which int, lim *Rlimit) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Getrtable() (rtable int, err error) { + r0, _, e1 := RawSyscall(SYS_GETRTABLE, 0, 0, 0) + rtable = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Getrusage(who int, rusage *Rusage) (err error) { _, _, e1 := RawSyscall(SYS_GETRUSAGE, uintptr(who), uintptr(unsafe.Pointer(rusage)), 0) if e1 != 0 { @@ -1224,6 +1280,16 @@ func Setrlimit(which int, lim *Rlimit) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Setrtable(rtable int) (err error) { + _, _, e1 := RawSyscall(SYS_SETRTABLE, uintptr(rtable), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Setsid() (pid int, err error) { r0, _, e1 := RawSyscall(SYS_SETSID, 0, 0, 0) pid = int(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go index 2ce02c7c4e..617d47f0f3 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_openbsd_arm.go @@ -569,6 +569,21 @@ func Exit(code int) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FACCESSAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchdir(fd int) (err error) { _, _, e1 := Syscall(SYS_FCHDIR, uintptr(fd), 0, 0) if e1 != 0 { @@ -599,6 +614,21 @@ func Fchmod(fd int, mode uint32) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fchmodat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FCHMODAT, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fchown(fd int, uid int, gid int) (err error) { _, _, e1 := Syscall(SYS_FCHOWN, uintptr(fd), uintptr(uid), uintptr(gid)) if e1 != 0 { @@ -640,6 +670,21 @@ func Fstat(fd int, stat *Stat_t) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := Syscall6(SYS_FSTATAT, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Fstatfs(fd int, stat *Statfs_t) (err error) { _, _, e1 := Syscall(SYS_FSTATFS, uintptr(fd), uintptr(unsafe.Pointer(stat)), 0) if e1 != 0 { @@ -750,6 +795,17 @@ func Getrlimit(which int, lim *Rlimit) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Getrtable() (rtable int, err error) { + r0, _, e1 := RawSyscall(SYS_GETRTABLE, 0, 0, 0) + rtable = int(r0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Getrusage(who int, rusage *Rusage) (err error) { _, _, e1 := RawSyscall(SYS_GETRUSAGE, uintptr(who), uintptr(unsafe.Pointer(rusage)), 0) if e1 != 0 { @@ -1224,6 +1280,16 @@ func Setrlimit(which int, lim *Rlimit) (err error) { // THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT +func Setrtable(rtable int) (err error) { + _, _, e1 := RawSyscall(SYS_SETRTABLE, uintptr(rtable), 0, 0) + if e1 != 0 { + err = errnoErr(e1) + } + return +} + +// THIS FILE IS GENERATED BY THE COMMAND AT THE TOP; DO NOT EDIT + func Setsid() (pid int, err error) { r0, _, e1 := RawSyscall(SYS_SETSID, 0, 0, 0) pid = int(r0) diff --git a/vendor/golang.org/x/sys/unix/zsyscall_solaris_amd64.go b/vendor/golang.org/x/sys/unix/zsyscall_solaris_amd64.go index f5d01b3a88..e2e5fc5e0a 100644 --- a/vendor/golang.org/x/sys/unix/zsyscall_solaris_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsyscall_solaris_amd64.go @@ -41,6 +41,7 @@ import ( //go:cgo_import_dynamic libc_dup dup "libc.so" //go:cgo_import_dynamic libc_dup2 dup2 "libc.so" //go:cgo_import_dynamic libc_exit exit "libc.so" +//go:cgo_import_dynamic libc_faccessat faccessat "libc.so" //go:cgo_import_dynamic libc_fchdir fchdir "libc.so" //go:cgo_import_dynamic libc_fchmod fchmod "libc.so" //go:cgo_import_dynamic libc_fchmodat fchmodat "libc.so" @@ -50,6 +51,7 @@ import ( //go:cgo_import_dynamic libc_flock flock "libc.so" //go:cgo_import_dynamic libc_fpathconf fpathconf "libc.so" //go:cgo_import_dynamic libc_fstat fstat "libc.so" +//go:cgo_import_dynamic libc_fstatat fstatat "libc.so" //go:cgo_import_dynamic libc_fstatvfs fstatvfs "libc.so" //go:cgo_import_dynamic libc_getdents getdents "libc.so" //go:cgo_import_dynamic libc_getgid getgid "libc.so" @@ -127,6 +129,7 @@ import ( //go:cgo_import_dynamic libc___xnet_connect __xnet_connect "libsocket.so" //go:cgo_import_dynamic libc_mmap mmap "libc.so" //go:cgo_import_dynamic libc_munmap munmap "libc.so" +//go:cgo_import_dynamic libc_sendfile sendfile "libsendfile.so" //go:cgo_import_dynamic libc___xnet_sendto __xnet_sendto "libsocket.so" //go:cgo_import_dynamic libc___xnet_socket __xnet_socket "libsocket.so" //go:cgo_import_dynamic libc___xnet_socketpair __xnet_socketpair "libsocket.so" @@ -167,6 +170,7 @@ import ( //go:linkname procDup libc_dup //go:linkname procDup2 libc_dup2 //go:linkname procExit libc_exit +//go:linkname procFaccessat libc_faccessat //go:linkname procFchdir libc_fchdir //go:linkname procFchmod libc_fchmod //go:linkname procFchmodat libc_fchmodat @@ -176,6 +180,7 @@ import ( //go:linkname procFlock libc_flock //go:linkname procFpathconf libc_fpathconf //go:linkname procFstat libc_fstat +//go:linkname procFstatat libc_fstatat //go:linkname procFstatvfs libc_fstatvfs //go:linkname procGetdents libc_getdents //go:linkname procGetgid libc_getgid @@ -253,6 +258,7 @@ import ( //go:linkname proc__xnet_connect libc___xnet_connect //go:linkname procmmap libc_mmap //go:linkname procmunmap libc_munmap +//go:linkname procsendfile libc_sendfile //go:linkname proc__xnet_sendto libc___xnet_sendto //go:linkname proc__xnet_socket libc___xnet_socket //go:linkname proc__xnet_socketpair libc___xnet_socketpair @@ -294,6 +300,7 @@ var ( procDup, procDup2, procExit, + procFaccessat, procFchdir, procFchmod, procFchmodat, @@ -303,6 +310,7 @@ var ( procFlock, procFpathconf, procFstat, + procFstatat, procFstatvfs, procGetdents, procGetgid, @@ -380,6 +388,7 @@ var ( proc__xnet_connect, procmmap, procmunmap, + procsendfile, proc__xnet_sendto, proc__xnet_socket, proc__xnet_socketpair, @@ -689,6 +698,19 @@ func Exit(code int) { return } +func Faccessat(dirfd int, path string, mode uint32, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := sysvicall6(uintptr(unsafe.Pointer(&procFaccessat)), 4, uintptr(dirfd), uintptr(unsafe.Pointer(_p0)), uintptr(mode), uintptr(flags), 0, 0) + if e1 != 0 { + err = e1 + } + return +} + func Fchdir(fd int) (err error) { _, _, e1 := sysvicall6(uintptr(unsafe.Pointer(&procFchdir)), 1, uintptr(fd), 0, 0, 0, 0, 0) if e1 != 0 { @@ -772,6 +794,19 @@ func Fstat(fd int, stat *Stat_t) (err error) { return } +func Fstatat(fd int, path string, stat *Stat_t, flags int) (err error) { + var _p0 *byte + _p0, err = BytePtrFromString(path) + if err != nil { + return + } + _, _, e1 := sysvicall6(uintptr(unsafe.Pointer(&procFstatat)), 4, uintptr(fd), uintptr(unsafe.Pointer(_p0)), uintptr(unsafe.Pointer(stat)), uintptr(flags), 0, 0) + if e1 != 0 { + err = e1 + } + return +} + func Fstatvfs(fd int, vfsstat *Statvfs_t) (err error) { _, _, e1 := sysvicall6(uintptr(unsafe.Pointer(&procFstatvfs)), 2, uintptr(fd), uintptr(unsafe.Pointer(vfsstat)), 0, 0, 0, 0) if e1 != 0 { @@ -1573,6 +1608,15 @@ func munmap(addr uintptr, length uintptr) (err error) { return } +func sendfile(outfd int, infd int, offset *int64, count int) (written int, err error) { + r0, _, e1 := sysvicall6(uintptr(unsafe.Pointer(&procsendfile)), 4, uintptr(outfd), uintptr(infd), uintptr(unsafe.Pointer(offset)), uintptr(count), 0, 0) + written = int(r0) + if e1 != 0 { + err = e1 + } + return +} + func sendto(s int, buf []byte, flags int, to unsafe.Pointer, addrlen _Socklen) (err error) { var _p0 *byte if len(buf) > 0 { diff --git a/vendor/golang.org/x/sys/unix/zsysctl_openbsd_386.go b/vendor/golang.org/x/sys/unix/zsysctl_openbsd_386.go index 83bb935b91..b005031abe 100644 --- a/vendor/golang.org/x/sys/unix/zsysctl_openbsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsysctl_openbsd_386.go @@ -1,5 +1,5 @@ // mksysctl_openbsd.pl -// MACHINE GENERATED BY THE ABOVE COMMAND; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. package unix diff --git a/vendor/golang.org/x/sys/unix/zsysctl_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/zsysctl_openbsd_amd64.go index 83bb935b91..90c95c2c75 100644 --- a/vendor/golang.org/x/sys/unix/zsysctl_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsysctl_openbsd_amd64.go @@ -1,5 +1,7 @@ // mksysctl_openbsd.pl -// MACHINE GENERATED BY THE ABOVE COMMAND; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. + +// +build amd64,openbsd package unix @@ -14,6 +16,7 @@ var sysctlMib = []mibentry{ {"ddb.max_line", []_C_int{9, 3}}, {"ddb.max_width", []_C_int{9, 2}}, {"ddb.panic", []_C_int{9, 5}}, + {"ddb.profile", []_C_int{9, 9}}, {"ddb.radix", []_C_int{9, 1}}, {"ddb.tab_stop_width", []_C_int{9, 4}}, {"ddb.trigger", []_C_int{9, 8}}, @@ -29,6 +32,7 @@ var sysctlMib = []mibentry{ {"hw.ncpu", []_C_int{6, 3}}, {"hw.ncpufound", []_C_int{6, 21}}, {"hw.pagesize", []_C_int{6, 7}}, + {"hw.perfpolicy", []_C_int{6, 23}}, {"hw.physmem", []_C_int{6, 19}}, {"hw.product", []_C_int{6, 15}}, {"hw.serialno", []_C_int{6, 17}}, @@ -37,7 +41,7 @@ var sysctlMib = []mibentry{ {"hw.uuid", []_C_int{6, 18}}, {"hw.vendor", []_C_int{6, 14}}, {"hw.version", []_C_int{6, 16}}, - {"kern.arandom", []_C_int{1, 37}}, + {"kern.allowkmem", []_C_int{1, 52}}, {"kern.argmax", []_C_int{1, 8}}, {"kern.boottime", []_C_int{1, 21}}, {"kern.bufcachepercent", []_C_int{1, 72}}, @@ -46,12 +50,13 @@ var sysctlMib = []mibentry{ {"kern.consdev", []_C_int{1, 75}}, {"kern.cp_time", []_C_int{1, 40}}, {"kern.cp_time2", []_C_int{1, 71}}, - {"kern.cryptodevallowsoft", []_C_int{1, 53}}, + {"kern.dnsjackport", []_C_int{1, 13}}, {"kern.domainname", []_C_int{1, 22}}, {"kern.file", []_C_int{1, 73}}, {"kern.forkstat", []_C_int{1, 42}}, {"kern.fscale", []_C_int{1, 46}}, {"kern.fsync", []_C_int{1, 33}}, + {"kern.global_ptrace", []_C_int{1, 81}}, {"kern.hostid", []_C_int{1, 11}}, {"kern.hostname", []_C_int{1, 10}}, {"kern.intrcnt.nintrcnt", []_C_int{1, 63, 1}}, @@ -84,7 +89,6 @@ var sysctlMib = []mibentry{ {"kern.pool_debug", []_C_int{1, 77}}, {"kern.posix1version", []_C_int{1, 17}}, {"kern.proc", []_C_int{1, 66}}, - {"kern.random", []_C_int{1, 31}}, {"kern.rawpartition", []_C_int{1, 24}}, {"kern.saved_ids", []_C_int{1, 20}}, {"kern.securelevel", []_C_int{1, 9}}, @@ -102,21 +106,16 @@ var sysctlMib = []mibentry{ {"kern.timecounter.hardware", []_C_int{1, 69, 3}}, {"kern.timecounter.tick", []_C_int{1, 69, 1}}, {"kern.timecounter.timestepwarnings", []_C_int{1, 69, 2}}, - {"kern.tty.maxptys", []_C_int{1, 44, 6}}, - {"kern.tty.nptys", []_C_int{1, 44, 7}}, {"kern.tty.tk_cancc", []_C_int{1, 44, 4}}, {"kern.tty.tk_nin", []_C_int{1, 44, 1}}, {"kern.tty.tk_nout", []_C_int{1, 44, 2}}, {"kern.tty.tk_rawcc", []_C_int{1, 44, 3}}, {"kern.tty.ttyinfo", []_C_int{1, 44, 5}}, {"kern.ttycount", []_C_int{1, 57}}, - {"kern.userasymcrypto", []_C_int{1, 60}}, - {"kern.usercrypto", []_C_int{1, 52}}, - {"kern.usermount", []_C_int{1, 30}}, {"kern.version", []_C_int{1, 4}}, - {"kern.vnode", []_C_int{1, 13}}, {"kern.watchdog.auto", []_C_int{1, 64, 2}}, {"kern.watchdog.period", []_C_int{1, 64, 1}}, + {"kern.wxabort", []_C_int{1, 74}}, {"net.bpf.bufsize", []_C_int{4, 31, 1}}, {"net.bpf.maxbufsize", []_C_int{4, 31, 2}}, {"net.inet.ah.enable", []_C_int{4, 2, 51, 1}}, @@ -144,7 +143,9 @@ var sysctlMib = []mibentry{ {"net.inet.icmp.stats", []_C_int{4, 2, 1, 7}}, {"net.inet.icmp.tstamprepl", []_C_int{4, 2, 1, 6}}, {"net.inet.igmp.stats", []_C_int{4, 2, 2, 1}}, + {"net.inet.ip.arpdown", []_C_int{4, 2, 0, 40}}, {"net.inet.ip.arpqueued", []_C_int{4, 2, 0, 36}}, + {"net.inet.ip.arptimeout", []_C_int{4, 2, 0, 39}}, {"net.inet.ip.encdebug", []_C_int{4, 2, 0, 12}}, {"net.inet.ip.forwarding", []_C_int{4, 2, 0, 1}}, {"net.inet.ip.ifq.congestion", []_C_int{4, 2, 0, 30, 4}}, @@ -153,8 +154,10 @@ var sysctlMib = []mibentry{ {"net.inet.ip.ifq.maxlen", []_C_int{4, 2, 0, 30, 2}}, {"net.inet.ip.maxqueue", []_C_int{4, 2, 0, 11}}, {"net.inet.ip.mforwarding", []_C_int{4, 2, 0, 31}}, + {"net.inet.ip.mrtmfc", []_C_int{4, 2, 0, 37}}, {"net.inet.ip.mrtproto", []_C_int{4, 2, 0, 34}}, {"net.inet.ip.mrtstats", []_C_int{4, 2, 0, 35}}, + {"net.inet.ip.mrtvif", []_C_int{4, 2, 0, 38}}, {"net.inet.ip.mtu", []_C_int{4, 2, 0, 4}}, {"net.inet.ip.mtudisc", []_C_int{4, 2, 0, 27}}, {"net.inet.ip.mtudisctimeout", []_C_int{4, 2, 0, 28}}, @@ -173,7 +176,6 @@ var sysctlMib = []mibentry{ {"net.inet.ipip.stats", []_C_int{4, 2, 4, 2}}, {"net.inet.mobileip.allow", []_C_int{4, 2, 55, 1}}, {"net.inet.pfsync.stats", []_C_int{4, 2, 240, 1}}, - {"net.inet.pim.stats", []_C_int{4, 2, 103, 1}}, {"net.inet.tcp.ackonpush", []_C_int{4, 2, 6, 13}}, {"net.inet.tcp.always_keepalive", []_C_int{4, 2, 6, 22}}, {"net.inet.tcp.baddynamic", []_C_int{4, 2, 6, 6}}, @@ -187,6 +189,7 @@ var sysctlMib = []mibentry{ {"net.inet.tcp.reasslimit", []_C_int{4, 2, 6, 18}}, {"net.inet.tcp.rfc1323", []_C_int{4, 2, 6, 1}}, {"net.inet.tcp.rfc3390", []_C_int{4, 2, 6, 17}}, + {"net.inet.tcp.rootonly", []_C_int{4, 2, 6, 24}}, {"net.inet.tcp.rstppslimit", []_C_int{4, 2, 6, 12}}, {"net.inet.tcp.sack", []_C_int{4, 2, 6, 10}}, {"net.inet.tcp.sackholelimit", []_C_int{4, 2, 6, 20}}, @@ -194,9 +197,12 @@ var sysctlMib = []mibentry{ {"net.inet.tcp.stats", []_C_int{4, 2, 6, 21}}, {"net.inet.tcp.synbucketlimit", []_C_int{4, 2, 6, 16}}, {"net.inet.tcp.syncachelimit", []_C_int{4, 2, 6, 15}}, + {"net.inet.tcp.synhashsize", []_C_int{4, 2, 6, 25}}, + {"net.inet.tcp.synuselimit", []_C_int{4, 2, 6, 23}}, {"net.inet.udp.baddynamic", []_C_int{4, 2, 17, 2}}, {"net.inet.udp.checksum", []_C_int{4, 2, 17, 1}}, {"net.inet.udp.recvspace", []_C_int{4, 2, 17, 3}}, + {"net.inet.udp.rootonly", []_C_int{4, 2, 17, 6}}, {"net.inet.udp.sendspace", []_C_int{4, 2, 17, 4}}, {"net.inet.udp.stats", []_C_int{4, 2, 17, 5}}, {"net.inet6.divert.recvspace", []_C_int{4, 24, 86, 1}}, @@ -209,13 +215,8 @@ var sysctlMib = []mibentry{ {"net.inet6.icmp6.nd6_delay", []_C_int{4, 24, 30, 8}}, {"net.inet6.icmp6.nd6_maxnudhint", []_C_int{4, 24, 30, 15}}, {"net.inet6.icmp6.nd6_mmaxtries", []_C_int{4, 24, 30, 10}}, - {"net.inet6.icmp6.nd6_prune", []_C_int{4, 24, 30, 6}}, {"net.inet6.icmp6.nd6_umaxtries", []_C_int{4, 24, 30, 9}}, - {"net.inet6.icmp6.nd6_useloopback", []_C_int{4, 24, 30, 11}}, - {"net.inet6.icmp6.nodeinfo", []_C_int{4, 24, 30, 13}}, - {"net.inet6.icmp6.rediraccept", []_C_int{4, 24, 30, 2}}, {"net.inet6.icmp6.redirtimeout", []_C_int{4, 24, 30, 3}}, - {"net.inet6.ip6.accept_rtadv", []_C_int{4, 24, 17, 12}}, {"net.inet6.ip6.auto_flowlabel", []_C_int{4, 24, 17, 17}}, {"net.inet6.ip6.dad_count", []_C_int{4, 24, 17, 16}}, {"net.inet6.ip6.dad_pending", []_C_int{4, 24, 17, 49}}, @@ -228,20 +229,19 @@ var sysctlMib = []mibentry{ {"net.inet6.ip6.maxdynroutes", []_C_int{4, 24, 17, 48}}, {"net.inet6.ip6.maxfragpackets", []_C_int{4, 24, 17, 9}}, {"net.inet6.ip6.maxfrags", []_C_int{4, 24, 17, 41}}, - {"net.inet6.ip6.maxifdefrouters", []_C_int{4, 24, 17, 47}}, - {"net.inet6.ip6.maxifprefixes", []_C_int{4, 24, 17, 46}}, {"net.inet6.ip6.mforwarding", []_C_int{4, 24, 17, 42}}, + {"net.inet6.ip6.mrtmfc", []_C_int{4, 24, 17, 53}}, + {"net.inet6.ip6.mrtmif", []_C_int{4, 24, 17, 52}}, {"net.inet6.ip6.mrtproto", []_C_int{4, 24, 17, 8}}, {"net.inet6.ip6.mtudisctimeout", []_C_int{4, 24, 17, 50}}, {"net.inet6.ip6.multicast_mtudisc", []_C_int{4, 24, 17, 44}}, {"net.inet6.ip6.multipath", []_C_int{4, 24, 17, 43}}, {"net.inet6.ip6.neighborgcthresh", []_C_int{4, 24, 17, 45}}, {"net.inet6.ip6.redirect", []_C_int{4, 24, 17, 2}}, - {"net.inet6.ip6.rr_prune", []_C_int{4, 24, 17, 22}}, + {"net.inet6.ip6.soiikey", []_C_int{4, 24, 17, 54}}, {"net.inet6.ip6.sourcecheck", []_C_int{4, 24, 17, 10}}, {"net.inet6.ip6.sourcecheck_logint", []_C_int{4, 24, 17, 11}}, {"net.inet6.ip6.use_deprecated", []_C_int{4, 24, 17, 21}}, - {"net.inet6.ip6.v6only", []_C_int{4, 24, 17, 24}}, {"net.key.sadb_dump", []_C_int{4, 30, 1}}, {"net.key.spd_dump", []_C_int{4, 30, 2}}, {"net.mpls.ifq.congestion", []_C_int{4, 33, 3, 4}}, @@ -254,17 +254,4 @@ var sysctlMib = []mibentry{ {"net.mpls.ttl", []_C_int{4, 33, 2}}, {"net.pflow.stats", []_C_int{4, 34, 1}}, {"net.pipex.enable", []_C_int{4, 35, 1}}, - {"vm.anonmin", []_C_int{2, 7}}, - {"vm.loadavg", []_C_int{2, 2}}, - {"vm.maxslp", []_C_int{2, 10}}, - {"vm.nkmempages", []_C_int{2, 6}}, - {"vm.psstrings", []_C_int{2, 3}}, - {"vm.swapencrypt.enable", []_C_int{2, 5, 0}}, - {"vm.swapencrypt.keyscreated", []_C_int{2, 5, 1}}, - {"vm.swapencrypt.keysdeleted", []_C_int{2, 5, 2}}, - {"vm.uspace", []_C_int{2, 11}}, - {"vm.uvmexp", []_C_int{2, 4}}, - {"vm.vmmeter", []_C_int{2, 1}}, - {"vm.vnodemin", []_C_int{2, 9}}, - {"vm.vtextmin", []_C_int{2, 8}}, } diff --git a/vendor/golang.org/x/sys/unix/zsysctl_openbsd_arm.go b/vendor/golang.org/x/sys/unix/zsysctl_openbsd_arm.go index 83bb935b91..b005031abe 100644 --- a/vendor/golang.org/x/sys/unix/zsysctl_openbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsysctl_openbsd_arm.go @@ -1,5 +1,5 @@ // mksysctl_openbsd.pl -// MACHINE GENERATED BY THE ABOVE COMMAND; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. package unix diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go index dfe5dab67e..384d49bfa5 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64.go @@ -367,4 +367,7 @@ const ( SYS_PWRITEV2 = 381 SYS_KEXEC_FILE_LOAD = 382 SYS_STATX = 383 + SYS_PKEY_ALLOC = 384 + SYS_PKEY_FREE = 385 + SYS_PKEY_MPROTECT = 386 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go index eca97f738b..9623248a5e 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_ppc64le.go @@ -367,4 +367,7 @@ const ( SYS_PWRITEV2 = 381 SYS_KEXEC_FILE_LOAD = 382 SYS_STATX = 383 + SYS_PKEY_ALLOC = 384 + SYS_PKEY_FREE = 385 + SYS_PKEY_MPROTECT = 386 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go index 8ea18e6c25..c061d6f1d3 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_s390x.go @@ -109,6 +109,7 @@ const ( SYS_PERSONALITY = 136 SYS_AFS_SYSCALL = 137 SYS_GETDENTS = 141 + SYS_SELECT = 142 SYS_FLOCK = 143 SYS_MSYNC = 144 SYS_READV = 145 @@ -151,6 +152,26 @@ const ( SYS_GETPMSG = 188 SYS_PUTPMSG = 189 SYS_VFORK = 190 + SYS_GETRLIMIT = 191 + SYS_LCHOWN = 198 + SYS_GETUID = 199 + SYS_GETGID = 200 + SYS_GETEUID = 201 + SYS_GETEGID = 202 + SYS_SETREUID = 203 + SYS_SETREGID = 204 + SYS_GETGROUPS = 205 + SYS_SETGROUPS = 206 + SYS_FCHOWN = 207 + SYS_SETRESUID = 208 + SYS_GETRESUID = 209 + SYS_SETRESGID = 210 + SYS_GETRESGID = 211 + SYS_CHOWN = 212 + SYS_SETUID = 213 + SYS_SETGID = 214 + SYS_SETFSUID = 215 + SYS_SETFSGID = 216 SYS_PIVOT_ROOT = 217 SYS_MINCORE = 218 SYS_MADVISE = 219 @@ -222,6 +243,7 @@ const ( SYS_MKNODAT = 290 SYS_FCHOWNAT = 291 SYS_FUTIMESAT = 292 + SYS_NEWFSTATAT = 293 SYS_UNLINKAT = 294 SYS_RENAMEAT = 295 SYS_LINKAT = 296 @@ -308,26 +330,6 @@ const ( SYS_PWRITEV2 = 377 SYS_S390_GUARDED_STORAGE = 378 SYS_STATX = 379 - SYS_SELECT = 142 - SYS_GETRLIMIT = 191 - SYS_LCHOWN = 198 - SYS_GETUID = 199 - SYS_GETGID = 200 - SYS_GETEUID = 201 - SYS_GETEGID = 202 - SYS_SETREUID = 203 - SYS_SETREGID = 204 - SYS_GETGROUPS = 205 - SYS_SETGROUPS = 206 - SYS_FCHOWN = 207 - SYS_SETRESUID = 208 - SYS_GETRESUID = 209 - SYS_SETRESGID = 210 - SYS_GETRESGID = 211 - SYS_CHOWN = 212 - SYS_SETUID = 213 - SYS_SETGID = 214 - SYS_SETFSUID = 215 - SYS_SETFSGID = 216 - SYS_NEWFSTATAT = 293 + SYS_S390_STHYI = 380 + SYS_KEXEC_FILE_LOAD = 381 ) diff --git a/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go b/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go index c9c129dc42..2d09936721 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_linux_sparc64.go @@ -1,5 +1,5 @@ // mksysnum_linux.pl -Ilinux/usr/include -m64 -D__arch64__ linux/usr/include/asm/unistd.h -// MACHINE GENERATED BY THE ABOVE COMMAND; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. // +build sparc64,linux diff --git a/vendor/golang.org/x/sys/unix/zsysnum_netbsd_386.go b/vendor/golang.org/x/sys/unix/zsysnum_netbsd_386.go index 8afda9c451..f0daa05a9c 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_netbsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_netbsd_386.go @@ -1,5 +1,5 @@ // mksysnum_netbsd.pl -// MACHINE GENERATED BY THE ABOVE COMMAND; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. // +build 386,netbsd diff --git a/vendor/golang.org/x/sys/unix/zsysnum_netbsd_amd64.go b/vendor/golang.org/x/sys/unix/zsysnum_netbsd_amd64.go index aea8dbec43..ddb25b94f3 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_netbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_netbsd_amd64.go @@ -1,5 +1,5 @@ // mksysnum_netbsd.pl -// MACHINE GENERATED BY THE ABOVE COMMAND; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. // +build amd64,netbsd diff --git a/vendor/golang.org/x/sys/unix/zsysnum_netbsd_arm.go b/vendor/golang.org/x/sys/unix/zsysnum_netbsd_arm.go index c6158a7ef9..315bd63f89 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_netbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_netbsd_arm.go @@ -1,5 +1,5 @@ // mksysnum_netbsd.pl -// MACHINE GENERATED BY THE ABOVE COMMAND; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. // +build arm,netbsd diff --git a/vendor/golang.org/x/sys/unix/zsysnum_openbsd_386.go b/vendor/golang.org/x/sys/unix/zsysnum_openbsd_386.go index 3e8ce2a1dd..07787301f0 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_openbsd_386.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_openbsd_386.go @@ -1,5 +1,5 @@ // mksysnum_openbsd.pl -// MACHINE GENERATED BY THE ABOVE COMMAND; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. // +build 386,openbsd diff --git a/vendor/golang.org/x/sys/unix/zsysnum_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/zsysnum_openbsd_amd64.go index bd28146ddd..10edff07d5 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_openbsd_amd64.go @@ -1,5 +1,5 @@ // mksysnum_openbsd.pl -// MACHINE GENERATED BY THE ABOVE COMMAND; DO NOT EDIT +// Code generated by the command above; see README.md. DO NOT EDIT. // +build amd64,openbsd @@ -12,6 +12,7 @@ const ( SYS_WRITE = 4 // { ssize_t sys_write(int fd, const void *buf, \ SYS_OPEN = 5 // { int sys_open(const char *path, \ SYS_CLOSE = 6 // { int sys_close(int fd); } + SYS_GETENTROPY = 7 // { int sys_getentropy(void *buf, size_t nbyte); } SYS___TFORK = 8 // { int sys___tfork(const struct __tfork *param, \ SYS_LINK = 9 // { int sys_link(const char *path, const char *link); } SYS_UNLINK = 10 // { int sys_unlink(const char *path); } @@ -37,11 +38,10 @@ const ( SYS_ACCEPT = 30 // { int sys_accept(int s, struct sockaddr *name, \ SYS_GETPEERNAME = 31 // { int sys_getpeername(int fdes, struct sockaddr *asa, \ SYS_GETSOCKNAME = 32 // { int sys_getsockname(int fdes, struct sockaddr *asa, \ - SYS_ACCESS = 33 // { int sys_access(const char *path, int flags); } + SYS_ACCESS = 33 // { int sys_access(const char *path, int amode); } SYS_CHFLAGS = 34 // { int sys_chflags(const char *path, u_int flags); } SYS_FCHFLAGS = 35 // { int sys_fchflags(int fd, u_int flags); } SYS_SYNC = 36 // { void sys_sync(void); } - SYS_KILL = 37 // { int sys_kill(int pid, int signum); } SYS_STAT = 38 // { int sys_stat(const char *path, struct stat *ub); } SYS_GETPPID = 39 // { pid_t sys_getppid(void); } SYS_LSTAT = 40 // { int sys_lstat(const char *path, struct stat *ub); } @@ -53,7 +53,6 @@ const ( SYS_SIGACTION = 46 // { int sys_sigaction(int signum, \ SYS_GETGID = 47 // { gid_t sys_getgid(void); } SYS_SIGPROCMASK = 48 // { int sys_sigprocmask(int how, sigset_t mask); } - SYS_GETLOGIN = 49 // { int sys_getlogin(char *namebuf, u_int namelen); } SYS_SETLOGIN = 50 // { int sys_setlogin(const char *namebuf); } SYS_ACCT = 51 // { int sys_acct(const char *path); } SYS_SIGPENDING = 52 // { int sys_sigpending(void); } @@ -62,7 +61,7 @@ const ( SYS_REBOOT = 55 // { int sys_reboot(int opt); } SYS_REVOKE = 56 // { int sys_revoke(const char *path); } SYS_SYMLINK = 57 // { int sys_symlink(const char *path, \ - SYS_READLINK = 58 // { int sys_readlink(const char *path, char *buf, \ + SYS_READLINK = 58 // { ssize_t sys_readlink(const char *path, \ SYS_EXECVE = 59 // { int sys_execve(const char *path, \ SYS_UMASK = 60 // { mode_t sys_umask(mode_t newmask); } SYS_CHROOT = 61 // { int sys_chroot(const char *path); } @@ -86,15 +85,18 @@ const ( SYS_GETGROUPS = 79 // { int sys_getgroups(int gidsetsize, \ SYS_SETGROUPS = 80 // { int sys_setgroups(int gidsetsize, \ SYS_GETPGRP = 81 // { int sys_getpgrp(void); } - SYS_SETPGID = 82 // { int sys_setpgid(pid_t pid, int pgid); } + SYS_SETPGID = 82 // { int sys_setpgid(pid_t pid, pid_t pgid); } + SYS_FUTEX = 83 // { int sys_futex(uint32_t *f, int op, int val, \ SYS_UTIMENSAT = 84 // { int sys_utimensat(int fd, const char *path, \ SYS_FUTIMENS = 85 // { int sys_futimens(int fd, \ + SYS_KBIND = 86 // { int sys_kbind(const struct __kbind *param, \ SYS_CLOCK_GETTIME = 87 // { int sys_clock_gettime(clockid_t clock_id, \ SYS_CLOCK_SETTIME = 88 // { int sys_clock_settime(clockid_t clock_id, \ SYS_CLOCK_GETRES = 89 // { int sys_clock_getres(clockid_t clock_id, \ SYS_DUP2 = 90 // { int sys_dup2(int from, int to); } SYS_NANOSLEEP = 91 // { int sys_nanosleep(const struct timespec *rqtp, \ SYS_FCNTL = 92 // { int sys_fcntl(int fd, int cmd, ... void *arg); } + SYS_ACCEPT4 = 93 // { int sys_accept4(int s, struct sockaddr *name, \ SYS___THRSLEEP = 94 // { int sys___thrsleep(const volatile void *ident, \ SYS_FSYNC = 95 // { int sys_fsync(int fd); } SYS_SETPRIORITY = 96 // { int sys_setpriority(int which, id_t who, int prio); } @@ -102,16 +104,23 @@ const ( SYS_CONNECT = 98 // { int sys_connect(int s, const struct sockaddr *name, \ SYS_GETDENTS = 99 // { int sys_getdents(int fd, void *buf, size_t buflen); } SYS_GETPRIORITY = 100 // { int sys_getpriority(int which, id_t who); } + SYS_PIPE2 = 101 // { int sys_pipe2(int *fdp, int flags); } + SYS_DUP3 = 102 // { int sys_dup3(int from, int to, int flags); } SYS_SIGRETURN = 103 // { int sys_sigreturn(struct sigcontext *sigcntxp); } SYS_BIND = 104 // { int sys_bind(int s, const struct sockaddr *name, \ SYS_SETSOCKOPT = 105 // { int sys_setsockopt(int s, int level, int name, \ SYS_LISTEN = 106 // { int sys_listen(int s, int backlog); } + SYS_CHFLAGSAT = 107 // { int sys_chflagsat(int fd, const char *path, \ + SYS_PLEDGE = 108 // { int sys_pledge(const char *promises, \ SYS_PPOLL = 109 // { int sys_ppoll(struct pollfd *fds, \ SYS_PSELECT = 110 // { int sys_pselect(int nd, fd_set *in, fd_set *ou, \ SYS_SIGSUSPEND = 111 // { int sys_sigsuspend(int mask); } + SYS_SENDSYSLOG = 112 // { int sys_sendsyslog(const char *buf, size_t nbyte, \ SYS_GETSOCKOPT = 118 // { int sys_getsockopt(int s, int level, int name, \ + SYS_THRKILL = 119 // { int sys_thrkill(pid_t tid, int signum, void *tcb); } SYS_READV = 120 // { ssize_t sys_readv(int fd, \ SYS_WRITEV = 121 // { ssize_t sys_writev(int fd, \ + SYS_KILL = 122 // { int sys_kill(int pid, int signum); } SYS_FCHOWN = 123 // { int sys_fchown(int fd, uid_t uid, gid_t gid); } SYS_FCHMOD = 124 // { int sys_fchmod(int fd, mode_t mode); } SYS_SETREUID = 126 // { int sys_setreuid(uid_t ruid, uid_t euid); } @@ -125,6 +134,7 @@ const ( SYS_MKDIR = 136 // { int sys_mkdir(const char *path, mode_t mode); } SYS_RMDIR = 137 // { int sys_rmdir(const char *path); } SYS_ADJTIME = 140 // { int sys_adjtime(const struct timeval *delta, \ + SYS_GETLOGIN_R = 141 // { int sys_getlogin_r(char *namebuf, u_int namelen); } SYS_SETSID = 147 // { int sys_setsid(void); } SYS_QUOTACTL = 148 // { int sys_quotactl(const char *path, int cmd, \ SYS_NFSSVC = 155 // { int sys_nfssvc(int flag, void *argp); } @@ -144,7 +154,7 @@ const ( SYS_LSEEK = 199 // { off_t sys_lseek(int fd, int pad, off_t offset, \ SYS_TRUNCATE = 200 // { int sys_truncate(const char *path, int pad, \ SYS_FTRUNCATE = 201 // { int sys_ftruncate(int fd, int pad, off_t length); } - SYS___SYSCTL = 202 // { int sys___sysctl(const int *name, u_int namelen, \ + SYS_SYSCTL = 202 // { int sys_sysctl(const int *name, u_int namelen, \ SYS_MLOCK = 203 // { int sys_mlock(const void *addr, size_t len); } SYS_MUNLOCK = 204 // { int sys_munlock(const void *addr, size_t len); } SYS_GETPGID = 207 // { pid_t sys_getpgid(pid_t pid); } diff --git a/vendor/golang.org/x/sys/unix/zsysnum_openbsd_arm.go b/vendor/golang.org/x/sys/unix/zsysnum_openbsd_arm.go index 32653e53c7..7a1693acbc 100644 --- a/vendor/golang.org/x/sys/unix/zsysnum_openbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/zsysnum_openbsd_arm.go @@ -1,5 +1,5 @@ // mksysnum_openbsd.pl -// MACHINE GENERATED BY THE ABOVE COMMAND; DO NOT EDIT +// Code generated by the command above; DO NOT EDIT. // +build arm,openbsd diff --git a/vendor/golang.org/x/sys/unix/ztypes_darwin_386.go b/vendor/golang.org/x/sys/unix/ztypes_darwin_386.go index bc4bc89f84..327af5fba1 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_darwin_386.go +++ b/vendor/golang.org/x/sys/unix/ztypes_darwin_386.go @@ -136,13 +136,13 @@ type Fsid struct { } type Dirent struct { - Ino uint64 - Seekoff uint64 - Reclen uint16 - Namlen uint16 - Type uint8 - Name [1024]int8 - Pad_cgo_0 [3]byte + Ino uint64 + Seekoff uint64 + Reclen uint16 + Namlen uint16 + Type uint8 + Name [1024]int8 + _ [3]byte } type RawSockaddrInet4 struct { @@ -295,14 +295,14 @@ const ( ) type IfMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Data IfData + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Data IfData } type IfData struct { @@ -338,51 +338,51 @@ type IfData struct { } type IfaMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Metric int32 + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Metric int32 } type IfmaMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte } type IfmaMsghdr2 struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Refcount int32 + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Refcount int32 } type RtMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Index uint16 - Pad_cgo_0 [2]byte - Flags int32 - Addrs int32 - Pid int32 - Seq int32 - Errno int32 - Use int32 - Inits uint32 - Rmx RtMetrics + Msglen uint16 + Version uint8 + Type uint8 + Index uint16 + _ [2]byte + Flags int32 + Addrs int32 + Pid int32 + Seq int32 + Errno int32 + Use int32 + Inits uint32 + Rmx RtMetrics } type RtMetrics struct { @@ -430,11 +430,11 @@ type BpfInsn struct { } type BpfHdr struct { - Tstamp Timeval - Caplen uint32 - Datalen uint32 - Hdrlen uint16 - Pad_cgo_0 [2]byte + Tstamp Timeval + Caplen uint32 + Datalen uint32 + Hdrlen uint16 + _ [2]byte } type Termios struct { diff --git a/vendor/golang.org/x/sys/unix/ztypes_darwin_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_darwin_amd64.go index d8abcab121..116e6e0757 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_darwin_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_darwin_amd64.go @@ -26,9 +26,9 @@ type Timespec struct { } type Timeval struct { - Sec int64 - Usec int32 - Pad_cgo_0 [4]byte + Sec int64 + Usec int32 + _ [4]byte } type Timeval32 struct { @@ -70,7 +70,7 @@ type Stat_t struct { Uid uint32 Gid uint32 Rdev int32 - Pad_cgo_0 [4]byte + _ [4]byte Atimespec Timespec Mtimespec Timespec Ctimespec Timespec @@ -120,9 +120,9 @@ type Fstore_t struct { } type Radvisory_t struct { - Offset int64 - Count int32 - Pad_cgo_0 [4]byte + Offset int64 + Count int32 + _ [4]byte } type Fbootstraptransfer_t struct { @@ -132,9 +132,9 @@ type Fbootstraptransfer_t struct { } type Log2phys_t struct { - Flags uint32 - Pad_cgo_0 [8]byte - Pad_cgo_1 [8]byte + Flags uint32 + _ [8]byte + _ [8]byte } type Fsid struct { @@ -142,13 +142,13 @@ type Fsid struct { } type Dirent struct { - Ino uint64 - Seekoff uint64 - Reclen uint16 - Namlen uint16 - Type uint8 - Name [1024]int8 - Pad_cgo_0 [3]byte + Ino uint64 + Seekoff uint64 + Reclen uint16 + Namlen uint16 + Type uint8 + Name [1024]int8 + _ [3]byte } type RawSockaddrInet4 struct { @@ -221,10 +221,10 @@ type IPv6Mreq struct { type Msghdr struct { Name *byte Namelen uint32 - Pad_cgo_0 [4]byte + _ [4]byte Iov *Iovec Iovlen int32 - Pad_cgo_1 [4]byte + _ [4]byte Control *byte Controllen uint32 Flags int32 @@ -303,14 +303,14 @@ const ( ) type IfMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Data IfData + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Data IfData } type IfData struct { @@ -346,51 +346,51 @@ type IfData struct { } type IfaMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Metric int32 + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Metric int32 } type IfmaMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte } type IfmaMsghdr2 struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Refcount int32 + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Refcount int32 } type RtMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Index uint16 - Pad_cgo_0 [2]byte - Flags int32 - Addrs int32 - Pid int32 - Seq int32 - Errno int32 - Use int32 - Inits uint32 - Rmx RtMetrics + Msglen uint16 + Version uint8 + Type uint8 + Index uint16 + _ [2]byte + Flags int32 + Addrs int32 + Pid int32 + Seq int32 + Errno int32 + Use int32 + Inits uint32 + Rmx RtMetrics } type RtMetrics struct { @@ -426,9 +426,9 @@ type BpfStat struct { } type BpfProgram struct { - Len uint32 - Pad_cgo_0 [4]byte - Insns *BpfInsn + Len uint32 + _ [4]byte + Insns *BpfInsn } type BpfInsn struct { @@ -439,22 +439,22 @@ type BpfInsn struct { } type BpfHdr struct { - Tstamp Timeval32 - Caplen uint32 - Datalen uint32 - Hdrlen uint16 - Pad_cgo_0 [2]byte + Tstamp Timeval32 + Caplen uint32 + Datalen uint32 + Hdrlen uint16 + _ [2]byte } type Termios struct { - Iflag uint64 - Oflag uint64 - Cflag uint64 - Lflag uint64 - Cc [20]uint8 - Pad_cgo_0 [4]byte - Ispeed uint64 - Ospeed uint64 + Iflag uint64 + Oflag uint64 + Cflag uint64 + Lflag uint64 + Cc [20]uint8 + _ [4]byte + Ispeed uint64 + Ospeed uint64 } type Winsize struct { diff --git a/vendor/golang.org/x/sys/unix/ztypes_darwin_arm.go b/vendor/golang.org/x/sys/unix/ztypes_darwin_arm.go index 9749c9f7d1..2750ad7607 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_darwin_arm.go +++ b/vendor/golang.org/x/sys/unix/ztypes_darwin_arm.go @@ -137,13 +137,13 @@ type Fsid struct { } type Dirent struct { - Ino uint64 - Seekoff uint64 - Reclen uint16 - Namlen uint16 - Type uint8 - Name [1024]int8 - Pad_cgo_0 [3]byte + Ino uint64 + Seekoff uint64 + Reclen uint16 + Namlen uint16 + Type uint8 + Name [1024]int8 + _ [3]byte } type RawSockaddrInet4 struct { @@ -296,14 +296,14 @@ const ( ) type IfMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Data IfData + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Data IfData } type IfData struct { @@ -339,51 +339,51 @@ type IfData struct { } type IfaMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Metric int32 + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Metric int32 } type IfmaMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte } type IfmaMsghdr2 struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Refcount int32 + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Refcount int32 } type RtMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Index uint16 - Pad_cgo_0 [2]byte - Flags int32 - Addrs int32 - Pid int32 - Seq int32 - Errno int32 - Use int32 - Inits uint32 - Rmx RtMetrics + Msglen uint16 + Version uint8 + Type uint8 + Index uint16 + _ [2]byte + Flags int32 + Addrs int32 + Pid int32 + Seq int32 + Errno int32 + Use int32 + Inits uint32 + Rmx RtMetrics } type RtMetrics struct { @@ -431,11 +431,11 @@ type BpfInsn struct { } type BpfHdr struct { - Tstamp Timeval - Caplen uint32 - Datalen uint32 - Hdrlen uint16 - Pad_cgo_0 [2]byte + Tstamp Timeval + Caplen uint32 + Datalen uint32 + Hdrlen uint16 + _ [2]byte } type Termios struct { diff --git a/vendor/golang.org/x/sys/unix/ztypes_darwin_arm64.go b/vendor/golang.org/x/sys/unix/ztypes_darwin_arm64.go index 810b0bd4f6..8cead0996c 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_darwin_arm64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_darwin_arm64.go @@ -26,9 +26,9 @@ type Timespec struct { } type Timeval struct { - Sec int64 - Usec int32 - Pad_cgo_0 [4]byte + Sec int64 + Usec int32 + _ [4]byte } type Timeval32 struct { @@ -70,7 +70,7 @@ type Stat_t struct { Uid uint32 Gid uint32 Rdev int32 - Pad_cgo_0 [4]byte + _ [4]byte Atimespec Timespec Mtimespec Timespec Ctimespec Timespec @@ -120,9 +120,9 @@ type Fstore_t struct { } type Radvisory_t struct { - Offset int64 - Count int32 - Pad_cgo_0 [4]byte + Offset int64 + Count int32 + _ [4]byte } type Fbootstraptransfer_t struct { @@ -132,9 +132,9 @@ type Fbootstraptransfer_t struct { } type Log2phys_t struct { - Flags uint32 - Pad_cgo_0 [8]byte - Pad_cgo_1 [8]byte + Flags uint32 + _ [8]byte + _ [8]byte } type Fsid struct { @@ -142,13 +142,13 @@ type Fsid struct { } type Dirent struct { - Ino uint64 - Seekoff uint64 - Reclen uint16 - Namlen uint16 - Type uint8 - Name [1024]int8 - Pad_cgo_0 [3]byte + Ino uint64 + Seekoff uint64 + Reclen uint16 + Namlen uint16 + Type uint8 + Name [1024]int8 + _ [3]byte } type RawSockaddrInet4 struct { @@ -221,10 +221,10 @@ type IPv6Mreq struct { type Msghdr struct { Name *byte Namelen uint32 - Pad_cgo_0 [4]byte + _ [4]byte Iov *Iovec Iovlen int32 - Pad_cgo_1 [4]byte + _ [4]byte Control *byte Controllen uint32 Flags int32 @@ -303,14 +303,14 @@ const ( ) type IfMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Data IfData + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Data IfData } type IfData struct { @@ -346,51 +346,51 @@ type IfData struct { } type IfaMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Metric int32 + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Metric int32 } type IfmaMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte } type IfmaMsghdr2 struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Refcount int32 + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Refcount int32 } type RtMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Index uint16 - Pad_cgo_0 [2]byte - Flags int32 - Addrs int32 - Pid int32 - Seq int32 - Errno int32 - Use int32 - Inits uint32 - Rmx RtMetrics + Msglen uint16 + Version uint8 + Type uint8 + Index uint16 + _ [2]byte + Flags int32 + Addrs int32 + Pid int32 + Seq int32 + Errno int32 + Use int32 + Inits uint32 + Rmx RtMetrics } type RtMetrics struct { @@ -426,9 +426,9 @@ type BpfStat struct { } type BpfProgram struct { - Len uint32 - Pad_cgo_0 [4]byte - Insns *BpfInsn + Len uint32 + _ [4]byte + Insns *BpfInsn } type BpfInsn struct { @@ -439,22 +439,22 @@ type BpfInsn struct { } type BpfHdr struct { - Tstamp Timeval32 - Caplen uint32 - Datalen uint32 - Hdrlen uint16 - Pad_cgo_0 [2]byte + Tstamp Timeval32 + Caplen uint32 + Datalen uint32 + Hdrlen uint16 + _ [2]byte } type Termios struct { - Iflag uint64 - Oflag uint64 - Cflag uint64 - Lflag uint64 - Cc [20]uint8 - Pad_cgo_0 [4]byte - Ispeed uint64 - Ospeed uint64 + Iflag uint64 + Oflag uint64 + Cflag uint64 + Lflag uint64 + Cc [20]uint8 + _ [4]byte + Ispeed uint64 + Ospeed uint64 } type Winsize struct { diff --git a/vendor/golang.org/x/sys/unix/ztypes_dragonfly_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_dragonfly_amd64.go index e3b8ebb016..315a553bd5 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_dragonfly_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_dragonfly_amd64.go @@ -108,7 +108,7 @@ type Statfs_t struct { Owner uint32 Type int32 Flags int32 - Pad_cgo_0 [4]byte + _ [4]byte Syncwrites int64 Asyncwrites int64 Fstypename [16]int8 @@ -118,7 +118,7 @@ type Statfs_t struct { Spares1 int16 Mntfromname [80]int8 Spares2 int16 - Pad_cgo_1 [4]byte + _ [4]byte Spare [2]int64 } @@ -219,10 +219,10 @@ type IPv6Mreq struct { type Msghdr struct { Name *byte Namelen uint32 - Pad_cgo_0 [4]byte + _ [4]byte Iov *Iovec Iovlen int32 - Pad_cgo_1 [4]byte + _ [4]byte Control *byte Controllen uint32 Flags int32 @@ -294,14 +294,14 @@ const ( ) type IfMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Data IfData + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Data IfData } type IfData struct { @@ -311,7 +311,7 @@ type IfData struct { Hdrlen uint8 Recvquota uint8 Xmitquota uint8 - Pad_cgo_0 [2]byte + _ [2]byte Mtu uint64 Metric uint64 Link_state uint64 @@ -333,24 +333,24 @@ type IfData struct { } type IfaMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Metric int32 + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Metric int32 } type IfmaMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte } type IfAnnounceMsghdr struct { @@ -363,19 +363,19 @@ type IfAnnounceMsghdr struct { } type RtMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Index uint16 - Pad_cgo_0 [2]byte - Flags int32 - Addrs int32 - Pid int32 - Seq int32 - Errno int32 - Use int32 - Inits uint64 - Rmx RtMetrics + Msglen uint16 + Version uint8 + Type uint8 + Index uint16 + _ [2]byte + Flags int32 + Addrs int32 + Pid int32 + Seq int32 + Errno int32 + Use int32 + Inits uint64 + Rmx RtMetrics } type RtMetrics struct { @@ -391,7 +391,7 @@ type RtMetrics struct { Hopcount uint64 Mssopt uint16 Pad uint16 - Pad_cgo_0 [4]byte + _ [4]byte Msl uint64 Iwmaxsegs uint64 Iwcapsegs uint64 @@ -416,9 +416,9 @@ type BpfStat struct { } type BpfProgram struct { - Len uint32 - Pad_cgo_0 [4]byte - Insns *BpfInsn + Len uint32 + _ [4]byte + Insns *BpfInsn } type BpfInsn struct { @@ -429,11 +429,11 @@ type BpfInsn struct { } type BpfHdr struct { - Tstamp Timeval - Caplen uint32 - Datalen uint32 - Hdrlen uint16 - Pad_cgo_0 [6]byte + Tstamp Timeval + Caplen uint32 + Datalen uint32 + Hdrlen uint16 + _ [6]byte } type Termios struct { diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_386.go b/vendor/golang.org/x/sys/unix/ztypes_linux_386.go index 7aa206e3d5..4c250033fa 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_386.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_386.go @@ -96,45 +96,30 @@ type Rlimit struct { type _Gid_t uint32 type Stat_t struct { - Dev uint64 - X__pad1 uint16 - _ [2]byte - X__st_ino uint32 - Mode uint32 - Nlink uint32 - Uid uint32 - Gid uint32 - Rdev uint64 - X__pad2 uint16 - _ [2]byte - Size int64 - Blksize int32 - Blocks int64 - Atim Timespec - Mtim Timespec - Ctim Timespec - Ino uint64 -} - -type Statfs_t struct { - Type int32 - Bsize int32 - Blocks uint64 - Bfree uint64 - Bavail uint64 - Files uint64 - Ffree uint64 - Fsid Fsid - Namelen int32 - Frsize int32 - Flags int32 - Spare [4]int32 + Dev uint64 + _ uint16 + _ [2]byte + _ uint32 + Mode uint32 + Nlink uint32 + Uid uint32 + Gid uint32 + Rdev uint64 + _ uint16 + _ [2]byte + Size int64 + Blksize int32 + Blocks int64 + Atim Timespec + Mtim Timespec + Ctim Timespec + Ino uint64 } type StatxTimestamp struct { - Sec int64 - Nsec uint32 - X__reserved int32 + Sec int64 + Nsec uint32 + _ int32 } type Statx_t struct { @@ -171,7 +156,7 @@ type Dirent struct { } type Fsid struct { - X__val [2]int32 + Val [2]int32 } type Flock_t struct { @@ -263,6 +248,13 @@ type RawSockaddrL2 struct { _ [1]byte } +type RawSockaddrRFCOMM struct { + Family uint16 + Bdaddr [6]uint8 + Channel uint8 + _ [1]byte +} + type RawSockaddrCAN struct { Family uint16 _ [2]byte @@ -416,6 +408,7 @@ const ( SizeofSockaddrNetlink = 0xc SizeofSockaddrHCI = 0x6 SizeofSockaddrL2 = 0xe + SizeofSockaddrRFCOMM = 0xa SizeofSockaddrCAN = 0x10 SizeofSockaddrALG = 0x58 SizeofSockaddrVM = 0x10 @@ -436,97 +429,123 @@ const ( ) const ( - IFA_UNSPEC = 0x0 - IFA_ADDRESS = 0x1 - IFA_LOCAL = 0x2 - IFA_LABEL = 0x3 - IFA_BROADCAST = 0x4 - IFA_ANYCAST = 0x5 - IFA_CACHEINFO = 0x6 - IFA_MULTICAST = 0x7 - IFLA_UNSPEC = 0x0 - IFLA_ADDRESS = 0x1 - IFLA_BROADCAST = 0x2 - IFLA_IFNAME = 0x3 - IFLA_MTU = 0x4 - IFLA_LINK = 0x5 - IFLA_QDISC = 0x6 - IFLA_STATS = 0x7 - IFLA_COST = 0x8 - IFLA_PRIORITY = 0x9 - IFLA_MASTER = 0xa - IFLA_WIRELESS = 0xb - IFLA_PROTINFO = 0xc - IFLA_TXQLEN = 0xd - IFLA_MAP = 0xe - IFLA_WEIGHT = 0xf - IFLA_OPERSTATE = 0x10 - IFLA_LINKMODE = 0x11 - IFLA_LINKINFO = 0x12 - IFLA_NET_NS_PID = 0x13 - IFLA_IFALIAS = 0x14 - IFLA_MAX = 0x2c - RT_SCOPE_UNIVERSE = 0x0 - RT_SCOPE_SITE = 0xc8 - RT_SCOPE_LINK = 0xfd - RT_SCOPE_HOST = 0xfe - RT_SCOPE_NOWHERE = 0xff - RT_TABLE_UNSPEC = 0x0 - RT_TABLE_COMPAT = 0xfc - RT_TABLE_DEFAULT = 0xfd - RT_TABLE_MAIN = 0xfe - RT_TABLE_LOCAL = 0xff - RT_TABLE_MAX = 0xffffffff - RTA_UNSPEC = 0x0 - RTA_DST = 0x1 - RTA_SRC = 0x2 - RTA_IIF = 0x3 - RTA_OIF = 0x4 - RTA_GATEWAY = 0x5 - RTA_PRIORITY = 0x6 - RTA_PREFSRC = 0x7 - RTA_METRICS = 0x8 - RTA_MULTIPATH = 0x9 - RTA_FLOW = 0xb - RTA_CACHEINFO = 0xc - RTA_TABLE = 0xf - RTN_UNSPEC = 0x0 - RTN_UNICAST = 0x1 - RTN_LOCAL = 0x2 - RTN_BROADCAST = 0x3 - RTN_ANYCAST = 0x4 - RTN_MULTICAST = 0x5 - RTN_BLACKHOLE = 0x6 - RTN_UNREACHABLE = 0x7 - RTN_PROHIBIT = 0x8 - RTN_THROW = 0x9 - RTN_NAT = 0xa - RTN_XRESOLVE = 0xb - RTNLGRP_NONE = 0x0 - RTNLGRP_LINK = 0x1 - RTNLGRP_NOTIFY = 0x2 - RTNLGRP_NEIGH = 0x3 - RTNLGRP_TC = 0x4 - RTNLGRP_IPV4_IFADDR = 0x5 - RTNLGRP_IPV4_MROUTE = 0x6 - RTNLGRP_IPV4_ROUTE = 0x7 - RTNLGRP_IPV4_RULE = 0x8 - RTNLGRP_IPV6_IFADDR = 0x9 - RTNLGRP_IPV6_MROUTE = 0xa - RTNLGRP_IPV6_ROUTE = 0xb - RTNLGRP_IPV6_IFINFO = 0xc - RTNLGRP_IPV6_PREFIX = 0x12 - RTNLGRP_IPV6_RULE = 0x13 - RTNLGRP_ND_USEROPT = 0x14 - SizeofNlMsghdr = 0x10 - SizeofNlMsgerr = 0x14 - SizeofRtGenmsg = 0x1 - SizeofNlAttr = 0x4 - SizeofRtAttr = 0x4 - SizeofIfInfomsg = 0x10 - SizeofIfAddrmsg = 0x8 - SizeofRtMsg = 0xc - SizeofRtNexthop = 0x8 + IFA_UNSPEC = 0x0 + IFA_ADDRESS = 0x1 + IFA_LOCAL = 0x2 + IFA_LABEL = 0x3 + IFA_BROADCAST = 0x4 + IFA_ANYCAST = 0x5 + IFA_CACHEINFO = 0x6 + IFA_MULTICAST = 0x7 + IFLA_UNSPEC = 0x0 + IFLA_ADDRESS = 0x1 + IFLA_BROADCAST = 0x2 + IFLA_IFNAME = 0x3 + IFLA_MTU = 0x4 + IFLA_LINK = 0x5 + IFLA_QDISC = 0x6 + IFLA_STATS = 0x7 + IFLA_COST = 0x8 + IFLA_PRIORITY = 0x9 + IFLA_MASTER = 0xa + IFLA_WIRELESS = 0xb + IFLA_PROTINFO = 0xc + IFLA_TXQLEN = 0xd + IFLA_MAP = 0xe + IFLA_WEIGHT = 0xf + IFLA_OPERSTATE = 0x10 + IFLA_LINKMODE = 0x11 + IFLA_LINKINFO = 0x12 + IFLA_NET_NS_PID = 0x13 + IFLA_IFALIAS = 0x14 + IFLA_NUM_VF = 0x15 + IFLA_VFINFO_LIST = 0x16 + IFLA_STATS64 = 0x17 + IFLA_VF_PORTS = 0x18 + IFLA_PORT_SELF = 0x19 + IFLA_AF_SPEC = 0x1a + IFLA_GROUP = 0x1b + IFLA_NET_NS_FD = 0x1c + IFLA_EXT_MASK = 0x1d + IFLA_PROMISCUITY = 0x1e + IFLA_NUM_TX_QUEUES = 0x1f + IFLA_NUM_RX_QUEUES = 0x20 + IFLA_CARRIER = 0x21 + IFLA_PHYS_PORT_ID = 0x22 + IFLA_CARRIER_CHANGES = 0x23 + IFLA_PHYS_SWITCH_ID = 0x24 + IFLA_LINK_NETNSID = 0x25 + IFLA_PHYS_PORT_NAME = 0x26 + IFLA_PROTO_DOWN = 0x27 + IFLA_GSO_MAX_SEGS = 0x28 + IFLA_GSO_MAX_SIZE = 0x29 + IFLA_PAD = 0x2a + IFLA_XDP = 0x2b + IFLA_EVENT = 0x2c + IFLA_NEW_NETNSID = 0x2d + IFLA_IF_NETNSID = 0x2e + IFLA_MAX = 0x31 + RT_SCOPE_UNIVERSE = 0x0 + RT_SCOPE_SITE = 0xc8 + RT_SCOPE_LINK = 0xfd + RT_SCOPE_HOST = 0xfe + RT_SCOPE_NOWHERE = 0xff + RT_TABLE_UNSPEC = 0x0 + RT_TABLE_COMPAT = 0xfc + RT_TABLE_DEFAULT = 0xfd + RT_TABLE_MAIN = 0xfe + RT_TABLE_LOCAL = 0xff + RT_TABLE_MAX = 0xffffffff + RTA_UNSPEC = 0x0 + RTA_DST = 0x1 + RTA_SRC = 0x2 + RTA_IIF = 0x3 + RTA_OIF = 0x4 + RTA_GATEWAY = 0x5 + RTA_PRIORITY = 0x6 + RTA_PREFSRC = 0x7 + RTA_METRICS = 0x8 + RTA_MULTIPATH = 0x9 + RTA_FLOW = 0xb + RTA_CACHEINFO = 0xc + RTA_TABLE = 0xf + RTN_UNSPEC = 0x0 + RTN_UNICAST = 0x1 + RTN_LOCAL = 0x2 + RTN_BROADCAST = 0x3 + RTN_ANYCAST = 0x4 + RTN_MULTICAST = 0x5 + RTN_BLACKHOLE = 0x6 + RTN_UNREACHABLE = 0x7 + RTN_PROHIBIT = 0x8 + RTN_THROW = 0x9 + RTN_NAT = 0xa + RTN_XRESOLVE = 0xb + RTNLGRP_NONE = 0x0 + RTNLGRP_LINK = 0x1 + RTNLGRP_NOTIFY = 0x2 + RTNLGRP_NEIGH = 0x3 + RTNLGRP_TC = 0x4 + RTNLGRP_IPV4_IFADDR = 0x5 + RTNLGRP_IPV4_MROUTE = 0x6 + RTNLGRP_IPV4_ROUTE = 0x7 + RTNLGRP_IPV4_RULE = 0x8 + RTNLGRP_IPV6_IFADDR = 0x9 + RTNLGRP_IPV6_MROUTE = 0xa + RTNLGRP_IPV6_ROUTE = 0xb + RTNLGRP_IPV6_IFINFO = 0xc + RTNLGRP_IPV6_PREFIX = 0x12 + RTNLGRP_IPV6_RULE = 0x13 + RTNLGRP_ND_USEROPT = 0x14 + SizeofNlMsghdr = 0x10 + SizeofNlMsgerr = 0x14 + SizeofRtGenmsg = 0x1 + SizeofNlAttr = 0x4 + SizeofRtAttr = 0x4 + SizeofIfInfomsg = 0x10 + SizeofIfAddrmsg = 0x8 + SizeofRtMsg = 0xc + SizeofRtNexthop = 0x8 ) type NlMsghdr struct { @@ -557,12 +576,12 @@ type RtAttr struct { } type IfInfomsg struct { - Family uint8 - X__ifi_pad uint8 - Type uint16 - Index int32 - Flags uint32 - Change uint32 + Family uint8 + _ uint8 + Type uint16 + Index int32 + Flags uint32 + Change uint32 } type IfAddrmsg struct { @@ -657,7 +676,7 @@ type Sysinfo_t struct { Totalhigh uint32 Freehigh uint32 Unit uint32 - X_f [8]int8 + _ [8]int8 } type Utsname struct { @@ -694,6 +713,8 @@ const ( AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x100 + + AT_EACCESS = 0x200 ) type PollFd struct { @@ -713,7 +734,7 @@ const ( ) type Sigset_t struct { - X__val [32]uint32 + Val [32]uint32 } const RNDGETENTCNT = 0x80045200 @@ -869,3 +890,965 @@ const ( BDADDR_LE_PUBLIC = 0x1 BDADDR_LE_RANDOM = 0x2 ) + +type PerfEventAttr struct { + Type uint32 + Size uint32 + Config uint64 + Sample uint64 + Sample_type uint64 + Read_format uint64 + Bits uint64 + Wakeup uint32 + Bp_type uint32 + Ext1 uint64 + Ext2 uint64 + Branch_sample_type uint64 + Sample_regs_user uint64 + Sample_stack_user uint32 + Clockid int32 + Sample_regs_intr uint64 + Aux_watermark uint32 + _ uint32 +} + +type PerfEventMmapPage struct { + Version uint32 + Compat_version uint32 + Lock uint32 + Index uint32 + Offset int64 + Time_enabled uint64 + Time_running uint64 + Capabilities uint64 + Pmc_width uint16 + Time_shift uint16 + Time_mult uint32 + Time_offset uint64 + Time_zero uint64 + Size uint32 + _ [948]uint8 + Data_head uint64 + Data_tail uint64 + Data_offset uint64 + Data_size uint64 + Aux_head uint64 + Aux_tail uint64 + Aux_offset uint64 + Aux_size uint64 +} + +const ( + PerfBitDisabled uint64 = CBitFieldMaskBit0 + PerfBitInherit = CBitFieldMaskBit1 + PerfBitPinned = CBitFieldMaskBit2 + PerfBitExclusive = CBitFieldMaskBit3 + PerfBitExcludeUser = CBitFieldMaskBit4 + PerfBitExcludeKernel = CBitFieldMaskBit5 + PerfBitExcludeHv = CBitFieldMaskBit6 + PerfBitExcludeIdle = CBitFieldMaskBit7 + PerfBitMmap = CBitFieldMaskBit8 + PerfBitComm = CBitFieldMaskBit9 + PerfBitFreq = CBitFieldMaskBit10 + PerfBitInheritStat = CBitFieldMaskBit11 + PerfBitEnableOnExec = CBitFieldMaskBit12 + PerfBitTask = CBitFieldMaskBit13 + PerfBitWatermark = CBitFieldMaskBit14 + PerfBitPreciseIPBit1 = CBitFieldMaskBit15 + PerfBitPreciseIPBit2 = CBitFieldMaskBit16 + PerfBitMmapData = CBitFieldMaskBit17 + PerfBitSampleIDAll = CBitFieldMaskBit18 + PerfBitExcludeHost = CBitFieldMaskBit19 + PerfBitExcludeGuest = CBitFieldMaskBit20 + PerfBitExcludeCallchainKernel = CBitFieldMaskBit21 + PerfBitExcludeCallchainUser = CBitFieldMaskBit22 + PerfBitMmap2 = CBitFieldMaskBit23 + PerfBitCommExec = CBitFieldMaskBit24 + PerfBitUseClockID = CBitFieldMaskBit25 + PerfBitContextSwitch = CBitFieldMaskBit26 +) + +const ( + PERF_TYPE_HARDWARE = 0x0 + PERF_TYPE_SOFTWARE = 0x1 + PERF_TYPE_TRACEPOINT = 0x2 + PERF_TYPE_HW_CACHE = 0x3 + PERF_TYPE_RAW = 0x4 + PERF_TYPE_BREAKPOINT = 0x5 + + PERF_COUNT_HW_CPU_CYCLES = 0x0 + PERF_COUNT_HW_INSTRUCTIONS = 0x1 + PERF_COUNT_HW_CACHE_REFERENCES = 0x2 + PERF_COUNT_HW_CACHE_MISSES = 0x3 + PERF_COUNT_HW_BRANCH_INSTRUCTIONS = 0x4 + PERF_COUNT_HW_BRANCH_MISSES = 0x5 + PERF_COUNT_HW_BUS_CYCLES = 0x6 + PERF_COUNT_HW_STALLED_CYCLES_FRONTEND = 0x7 + PERF_COUNT_HW_STALLED_CYCLES_BACKEND = 0x8 + PERF_COUNT_HW_REF_CPU_CYCLES = 0x9 + + PERF_COUNT_HW_CACHE_L1D = 0x0 + PERF_COUNT_HW_CACHE_L1I = 0x1 + PERF_COUNT_HW_CACHE_LL = 0x2 + PERF_COUNT_HW_CACHE_DTLB = 0x3 + PERF_COUNT_HW_CACHE_ITLB = 0x4 + PERF_COUNT_HW_CACHE_BPU = 0x5 + PERF_COUNT_HW_CACHE_NODE = 0x6 + + PERF_COUNT_HW_CACHE_OP_READ = 0x0 + PERF_COUNT_HW_CACHE_OP_WRITE = 0x1 + PERF_COUNT_HW_CACHE_OP_PREFETCH = 0x2 + + PERF_COUNT_HW_CACHE_RESULT_ACCESS = 0x0 + PERF_COUNT_HW_CACHE_RESULT_MISS = 0x1 + + PERF_COUNT_SW_CPU_CLOCK = 0x0 + PERF_COUNT_SW_TASK_CLOCK = 0x1 + PERF_COUNT_SW_PAGE_FAULTS = 0x2 + PERF_COUNT_SW_CONTEXT_SWITCHES = 0x3 + PERF_COUNT_SW_CPU_MIGRATIONS = 0x4 + PERF_COUNT_SW_PAGE_FAULTS_MIN = 0x5 + PERF_COUNT_SW_PAGE_FAULTS_MAJ = 0x6 + PERF_COUNT_SW_ALIGNMENT_FAULTS = 0x7 + PERF_COUNT_SW_EMULATION_FAULTS = 0x8 + PERF_COUNT_SW_DUMMY = 0x9 + + PERF_SAMPLE_IP = 0x1 + PERF_SAMPLE_TID = 0x2 + PERF_SAMPLE_TIME = 0x4 + PERF_SAMPLE_ADDR = 0x8 + PERF_SAMPLE_READ = 0x10 + PERF_SAMPLE_CALLCHAIN = 0x20 + PERF_SAMPLE_ID = 0x40 + PERF_SAMPLE_CPU = 0x80 + PERF_SAMPLE_PERIOD = 0x100 + PERF_SAMPLE_STREAM_ID = 0x200 + PERF_SAMPLE_RAW = 0x400 + PERF_SAMPLE_BRANCH_STACK = 0x800 + + PERF_SAMPLE_BRANCH_USER = 0x1 + PERF_SAMPLE_BRANCH_KERNEL = 0x2 + PERF_SAMPLE_BRANCH_HV = 0x4 + PERF_SAMPLE_BRANCH_ANY = 0x8 + PERF_SAMPLE_BRANCH_ANY_CALL = 0x10 + PERF_SAMPLE_BRANCH_ANY_RETURN = 0x20 + PERF_SAMPLE_BRANCH_IND_CALL = 0x40 + + PERF_FORMAT_TOTAL_TIME_ENABLED = 0x1 + PERF_FORMAT_TOTAL_TIME_RUNNING = 0x2 + PERF_FORMAT_ID = 0x4 + PERF_FORMAT_GROUP = 0x8 + + PERF_RECORD_MMAP = 0x1 + PERF_RECORD_LOST = 0x2 + PERF_RECORD_COMM = 0x3 + PERF_RECORD_EXIT = 0x4 + PERF_RECORD_THROTTLE = 0x5 + PERF_RECORD_UNTHROTTLE = 0x6 + PERF_RECORD_FORK = 0x7 + PERF_RECORD_READ = 0x8 + PERF_RECORD_SAMPLE = 0x9 + + PERF_CONTEXT_HV = -0x20 + PERF_CONTEXT_KERNEL = -0x80 + PERF_CONTEXT_USER = -0x200 + + PERF_CONTEXT_GUEST = -0x800 + PERF_CONTEXT_GUEST_KERNEL = -0x880 + PERF_CONTEXT_GUEST_USER = -0xa00 + + PERF_FLAG_FD_NO_GROUP = 0x1 + PERF_FLAG_FD_OUTPUT = 0x2 + PERF_FLAG_PID_CGROUP = 0x4 +) + +const ( + CBitFieldMaskBit0 = 0x1 + CBitFieldMaskBit1 = 0x2 + CBitFieldMaskBit2 = 0x4 + CBitFieldMaskBit3 = 0x8 + CBitFieldMaskBit4 = 0x10 + CBitFieldMaskBit5 = 0x20 + CBitFieldMaskBit6 = 0x40 + CBitFieldMaskBit7 = 0x80 + CBitFieldMaskBit8 = 0x100 + CBitFieldMaskBit9 = 0x200 + CBitFieldMaskBit10 = 0x400 + CBitFieldMaskBit11 = 0x800 + CBitFieldMaskBit12 = 0x1000 + CBitFieldMaskBit13 = 0x2000 + CBitFieldMaskBit14 = 0x4000 + CBitFieldMaskBit15 = 0x8000 + CBitFieldMaskBit16 = 0x10000 + CBitFieldMaskBit17 = 0x20000 + CBitFieldMaskBit18 = 0x40000 + CBitFieldMaskBit19 = 0x80000 + CBitFieldMaskBit20 = 0x100000 + CBitFieldMaskBit21 = 0x200000 + CBitFieldMaskBit22 = 0x400000 + CBitFieldMaskBit23 = 0x800000 + CBitFieldMaskBit24 = 0x1000000 + CBitFieldMaskBit25 = 0x2000000 + CBitFieldMaskBit26 = 0x4000000 + CBitFieldMaskBit27 = 0x8000000 + CBitFieldMaskBit28 = 0x10000000 + CBitFieldMaskBit29 = 0x20000000 + CBitFieldMaskBit30 = 0x40000000 + CBitFieldMaskBit31 = 0x80000000 + CBitFieldMaskBit32 = 0x100000000 + CBitFieldMaskBit33 = 0x200000000 + CBitFieldMaskBit34 = 0x400000000 + CBitFieldMaskBit35 = 0x800000000 + CBitFieldMaskBit36 = 0x1000000000 + CBitFieldMaskBit37 = 0x2000000000 + CBitFieldMaskBit38 = 0x4000000000 + CBitFieldMaskBit39 = 0x8000000000 + CBitFieldMaskBit40 = 0x10000000000 + CBitFieldMaskBit41 = 0x20000000000 + CBitFieldMaskBit42 = 0x40000000000 + CBitFieldMaskBit43 = 0x80000000000 + CBitFieldMaskBit44 = 0x100000000000 + CBitFieldMaskBit45 = 0x200000000000 + CBitFieldMaskBit46 = 0x400000000000 + CBitFieldMaskBit47 = 0x800000000000 + CBitFieldMaskBit48 = 0x1000000000000 + CBitFieldMaskBit49 = 0x2000000000000 + CBitFieldMaskBit50 = 0x4000000000000 + CBitFieldMaskBit51 = 0x8000000000000 + CBitFieldMaskBit52 = 0x10000000000000 + CBitFieldMaskBit53 = 0x20000000000000 + CBitFieldMaskBit54 = 0x40000000000000 + CBitFieldMaskBit55 = 0x80000000000000 + CBitFieldMaskBit56 = 0x100000000000000 + CBitFieldMaskBit57 = 0x200000000000000 + CBitFieldMaskBit58 = 0x400000000000000 + CBitFieldMaskBit59 = 0x800000000000000 + CBitFieldMaskBit60 = 0x1000000000000000 + CBitFieldMaskBit61 = 0x2000000000000000 + CBitFieldMaskBit62 = 0x4000000000000000 + CBitFieldMaskBit63 = 0x8000000000000000 +) + +type SockaddrStorage struct { + Family uint16 + _ [122]int8 + _ uint32 +} + +type TCPMD5Sig struct { + Addr SockaddrStorage + Flags uint8 + Prefixlen uint8 + Keylen uint16 + _ uint32 + Key [80]uint8 +} + +type HDDriveCmdHdr struct { + Command uint8 + Number uint8 + Feature uint8 + Count uint8 +} + +type HDGeometry struct { + Heads uint8 + Sectors uint8 + Cylinders uint16 + Start uint32 +} + +type HDDriveID struct { + Config uint16 + Cyls uint16 + Reserved2 uint16 + Heads uint16 + Track_bytes uint16 + Sector_bytes uint16 + Sectors uint16 + Vendor0 uint16 + Vendor1 uint16 + Vendor2 uint16 + Serial_no [20]uint8 + Buf_type uint16 + Buf_size uint16 + Ecc_bytes uint16 + Fw_rev [8]uint8 + Model [40]uint8 + Max_multsect uint8 + Vendor3 uint8 + Dword_io uint16 + Vendor4 uint8 + Capability uint8 + Reserved50 uint16 + Vendor5 uint8 + TPIO uint8 + Vendor6 uint8 + TDMA uint8 + Field_valid uint16 + Cur_cyls uint16 + Cur_heads uint16 + Cur_sectors uint16 + Cur_capacity0 uint16 + Cur_capacity1 uint16 + Multsect uint8 + Multsect_valid uint8 + Lba_capacity uint32 + Dma_1word uint16 + Dma_mword uint16 + Eide_pio_modes uint16 + Eide_dma_min uint16 + Eide_dma_time uint16 + Eide_pio uint16 + Eide_pio_iordy uint16 + Words69_70 [2]uint16 + Words71_74 [4]uint16 + Queue_depth uint16 + Words76_79 [4]uint16 + Major_rev_num uint16 + Minor_rev_num uint16 + Command_set_1 uint16 + Command_set_2 uint16 + Cfsse uint16 + Cfs_enable_1 uint16 + Cfs_enable_2 uint16 + Csf_default uint16 + Dma_ultra uint16 + Trseuc uint16 + TrsEuc uint16 + CurAPMvalues uint16 + Mprc uint16 + Hw_config uint16 + Acoustic uint16 + Msrqs uint16 + Sxfert uint16 + Sal uint16 + Spg uint32 + Lba_capacity_2 uint64 + Words104_125 [22]uint16 + Last_lun uint16 + Word127 uint16 + Dlf uint16 + Csfo uint16 + Words130_155 [26]uint16 + Word156 uint16 + Words157_159 [3]uint16 + Cfa_power uint16 + Words161_175 [15]uint16 + Words176_205 [30]uint16 + Words206_254 [49]uint16 + Integrity_word uint16 +} + +type Statfs_t struct { + Type int32 + Bsize int32 + Blocks uint64 + Bfree uint64 + Bavail uint64 + Files uint64 + Ffree uint64 + Fsid Fsid + Namelen int32 + Frsize int32 + Flags int32 + Spare [4]int32 +} + +const ( + ST_MANDLOCK = 0x40 + ST_NOATIME = 0x400 + ST_NODEV = 0x4 + ST_NODIRATIME = 0x800 + ST_NOEXEC = 0x8 + ST_NOSUID = 0x2 + ST_RDONLY = 0x1 + ST_RELATIME = 0x1000 + ST_SYNCHRONOUS = 0x10 +) + +type TpacketHdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Usec uint32 +} + +type Tpacket2Hdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Nsec uint32 + Vlan_tci uint16 + Vlan_tpid uint16 + _ [4]uint8 +} + +type Tpacket3Hdr struct { + Next_offset uint32 + Sec uint32 + Nsec uint32 + Snaplen uint32 + Len uint32 + Status uint32 + Mac uint16 + Net uint16 + Hv1 TpacketHdrVariant1 + _ [8]uint8 +} + +type TpacketHdrVariant1 struct { + Rxhash uint32 + Vlan_tci uint32 + Vlan_tpid uint16 + _ uint16 +} + +type TpacketBlockDesc struct { + Version uint32 + To_priv uint32 + Hdr [40]byte +} + +type TpacketReq struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 +} + +type TpacketReq3 struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 + Retire_blk_tov uint32 + Sizeof_priv uint32 + Feature_req_word uint32 +} + +type TpacketStats struct { + Packets uint32 + Drops uint32 +} + +type TpacketStatsV3 struct { + Packets uint32 + Drops uint32 + Freeze_q_cnt uint32 +} + +type TpacketAuxdata struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Vlan_tci uint16 + Vlan_tpid uint16 +} + +const ( + TPACKET_V1 = 0x0 + TPACKET_V2 = 0x1 + TPACKET_V3 = 0x2 +) + +const ( + SizeofTpacketHdr = 0x18 + SizeofTpacket2Hdr = 0x20 + SizeofTpacket3Hdr = 0x30 +) + +const ( + NF_INET_PRE_ROUTING = 0x0 + NF_INET_LOCAL_IN = 0x1 + NF_INET_FORWARD = 0x2 + NF_INET_LOCAL_OUT = 0x3 + NF_INET_POST_ROUTING = 0x4 + NF_INET_NUMHOOKS = 0x5 +) + +const ( + NF_NETDEV_INGRESS = 0x0 + NF_NETDEV_NUMHOOKS = 0x1 +) + +const ( + NFPROTO_UNSPEC = 0x0 + NFPROTO_INET = 0x1 + NFPROTO_IPV4 = 0x2 + NFPROTO_ARP = 0x3 + NFPROTO_NETDEV = 0x5 + NFPROTO_BRIDGE = 0x7 + NFPROTO_IPV6 = 0xa + NFPROTO_DECNET = 0xc + NFPROTO_NUMPROTO = 0xd +) + +type Nfgenmsg struct { + Nfgen_family uint8 + Version uint8 + Res_id uint16 +} + +const ( + NFNL_BATCH_UNSPEC = 0x0 + NFNL_BATCH_GENID = 0x1 +) + +const ( + NFT_REG_VERDICT = 0x0 + NFT_REG_1 = 0x1 + NFT_REG_2 = 0x2 + NFT_REG_3 = 0x3 + NFT_REG_4 = 0x4 + NFT_REG32_00 = 0x8 + NFT_REG32_01 = 0x9 + NFT_REG32_02 = 0xa + NFT_REG32_03 = 0xb + NFT_REG32_04 = 0xc + NFT_REG32_05 = 0xd + NFT_REG32_06 = 0xe + NFT_REG32_07 = 0xf + NFT_REG32_08 = 0x10 + NFT_REG32_09 = 0x11 + NFT_REG32_10 = 0x12 + NFT_REG32_11 = 0x13 + NFT_REG32_12 = 0x14 + NFT_REG32_13 = 0x15 + NFT_REG32_14 = 0x16 + NFT_REG32_15 = 0x17 + NFT_CONTINUE = -0x1 + NFT_BREAK = -0x2 + NFT_JUMP = -0x3 + NFT_GOTO = -0x4 + NFT_RETURN = -0x5 + NFT_MSG_NEWTABLE = 0x0 + NFT_MSG_GETTABLE = 0x1 + NFT_MSG_DELTABLE = 0x2 + NFT_MSG_NEWCHAIN = 0x3 + NFT_MSG_GETCHAIN = 0x4 + NFT_MSG_DELCHAIN = 0x5 + NFT_MSG_NEWRULE = 0x6 + NFT_MSG_GETRULE = 0x7 + NFT_MSG_DELRULE = 0x8 + NFT_MSG_NEWSET = 0x9 + NFT_MSG_GETSET = 0xa + NFT_MSG_DELSET = 0xb + NFT_MSG_NEWSETELEM = 0xc + NFT_MSG_GETSETELEM = 0xd + NFT_MSG_DELSETELEM = 0xe + NFT_MSG_NEWGEN = 0xf + NFT_MSG_GETGEN = 0x10 + NFT_MSG_TRACE = 0x11 + NFT_MSG_NEWOBJ = 0x12 + NFT_MSG_GETOBJ = 0x13 + NFT_MSG_DELOBJ = 0x14 + NFT_MSG_GETOBJ_RESET = 0x15 + NFT_MSG_MAX = 0x19 + NFTA_LIST_UNPEC = 0x0 + NFTA_LIST_ELEM = 0x1 + NFTA_HOOK_UNSPEC = 0x0 + NFTA_HOOK_HOOKNUM = 0x1 + NFTA_HOOK_PRIORITY = 0x2 + NFTA_HOOK_DEV = 0x3 + NFT_TABLE_F_DORMANT = 0x1 + NFTA_TABLE_UNSPEC = 0x0 + NFTA_TABLE_NAME = 0x1 + NFTA_TABLE_FLAGS = 0x2 + NFTA_TABLE_USE = 0x3 + NFTA_CHAIN_UNSPEC = 0x0 + NFTA_CHAIN_TABLE = 0x1 + NFTA_CHAIN_HANDLE = 0x2 + NFTA_CHAIN_NAME = 0x3 + NFTA_CHAIN_HOOK = 0x4 + NFTA_CHAIN_POLICY = 0x5 + NFTA_CHAIN_USE = 0x6 + NFTA_CHAIN_TYPE = 0x7 + NFTA_CHAIN_COUNTERS = 0x8 + NFTA_CHAIN_PAD = 0x9 + NFTA_RULE_UNSPEC = 0x0 + NFTA_RULE_TABLE = 0x1 + NFTA_RULE_CHAIN = 0x2 + NFTA_RULE_HANDLE = 0x3 + NFTA_RULE_EXPRESSIONS = 0x4 + NFTA_RULE_COMPAT = 0x5 + NFTA_RULE_POSITION = 0x6 + NFTA_RULE_USERDATA = 0x7 + NFTA_RULE_PAD = 0x8 + NFTA_RULE_ID = 0x9 + NFT_RULE_COMPAT_F_INV = 0x2 + NFT_RULE_COMPAT_F_MASK = 0x2 + NFTA_RULE_COMPAT_UNSPEC = 0x0 + NFTA_RULE_COMPAT_PROTO = 0x1 + NFTA_RULE_COMPAT_FLAGS = 0x2 + NFT_SET_ANONYMOUS = 0x1 + NFT_SET_CONSTANT = 0x2 + NFT_SET_INTERVAL = 0x4 + NFT_SET_MAP = 0x8 + NFT_SET_TIMEOUT = 0x10 + NFT_SET_EVAL = 0x20 + NFT_SET_OBJECT = 0x40 + NFT_SET_POL_PERFORMANCE = 0x0 + NFT_SET_POL_MEMORY = 0x1 + NFTA_SET_DESC_UNSPEC = 0x0 + NFTA_SET_DESC_SIZE = 0x1 + NFTA_SET_UNSPEC = 0x0 + NFTA_SET_TABLE = 0x1 + NFTA_SET_NAME = 0x2 + NFTA_SET_FLAGS = 0x3 + NFTA_SET_KEY_TYPE = 0x4 + NFTA_SET_KEY_LEN = 0x5 + NFTA_SET_DATA_TYPE = 0x6 + NFTA_SET_DATA_LEN = 0x7 + NFTA_SET_POLICY = 0x8 + NFTA_SET_DESC = 0x9 + NFTA_SET_ID = 0xa + NFTA_SET_TIMEOUT = 0xb + NFTA_SET_GC_INTERVAL = 0xc + NFTA_SET_USERDATA = 0xd + NFTA_SET_PAD = 0xe + NFTA_SET_OBJ_TYPE = 0xf + NFT_SET_ELEM_INTERVAL_END = 0x1 + NFTA_SET_ELEM_UNSPEC = 0x0 + NFTA_SET_ELEM_KEY = 0x1 + NFTA_SET_ELEM_DATA = 0x2 + NFTA_SET_ELEM_FLAGS = 0x3 + NFTA_SET_ELEM_TIMEOUT = 0x4 + NFTA_SET_ELEM_EXPIRATION = 0x5 + NFTA_SET_ELEM_USERDATA = 0x6 + NFTA_SET_ELEM_EXPR = 0x7 + NFTA_SET_ELEM_PAD = 0x8 + NFTA_SET_ELEM_OBJREF = 0x9 + NFTA_SET_ELEM_LIST_UNSPEC = 0x0 + NFTA_SET_ELEM_LIST_TABLE = 0x1 + NFTA_SET_ELEM_LIST_SET = 0x2 + NFTA_SET_ELEM_LIST_ELEMENTS = 0x3 + NFTA_SET_ELEM_LIST_SET_ID = 0x4 + NFT_DATA_VALUE = 0x0 + NFT_DATA_VERDICT = 0xffffff00 + NFTA_DATA_UNSPEC = 0x0 + NFTA_DATA_VALUE = 0x1 + NFTA_DATA_VERDICT = 0x2 + NFTA_VERDICT_UNSPEC = 0x0 + NFTA_VERDICT_CODE = 0x1 + NFTA_VERDICT_CHAIN = 0x2 + NFTA_EXPR_UNSPEC = 0x0 + NFTA_EXPR_NAME = 0x1 + NFTA_EXPR_DATA = 0x2 + NFTA_IMMEDIATE_UNSPEC = 0x0 + NFTA_IMMEDIATE_DREG = 0x1 + NFTA_IMMEDIATE_DATA = 0x2 + NFTA_BITWISE_UNSPEC = 0x0 + NFTA_BITWISE_SREG = 0x1 + NFTA_BITWISE_DREG = 0x2 + NFTA_BITWISE_LEN = 0x3 + NFTA_BITWISE_MASK = 0x4 + NFTA_BITWISE_XOR = 0x5 + NFT_BYTEORDER_NTOH = 0x0 + NFT_BYTEORDER_HTON = 0x1 + NFTA_BYTEORDER_UNSPEC = 0x0 + NFTA_BYTEORDER_SREG = 0x1 + NFTA_BYTEORDER_DREG = 0x2 + NFTA_BYTEORDER_OP = 0x3 + NFTA_BYTEORDER_LEN = 0x4 + NFTA_BYTEORDER_SIZE = 0x5 + NFT_CMP_EQ = 0x0 + NFT_CMP_NEQ = 0x1 + NFT_CMP_LT = 0x2 + NFT_CMP_LTE = 0x3 + NFT_CMP_GT = 0x4 + NFT_CMP_GTE = 0x5 + NFTA_CMP_UNSPEC = 0x0 + NFTA_CMP_SREG = 0x1 + NFTA_CMP_OP = 0x2 + NFTA_CMP_DATA = 0x3 + NFT_RANGE_EQ = 0x0 + NFT_RANGE_NEQ = 0x1 + NFTA_RANGE_UNSPEC = 0x0 + NFTA_RANGE_SREG = 0x1 + NFTA_RANGE_OP = 0x2 + NFTA_RANGE_FROM_DATA = 0x3 + NFTA_RANGE_TO_DATA = 0x4 + NFT_LOOKUP_F_INV = 0x1 + NFTA_LOOKUP_UNSPEC = 0x0 + NFTA_LOOKUP_SET = 0x1 + NFTA_LOOKUP_SREG = 0x2 + NFTA_LOOKUP_DREG = 0x3 + NFTA_LOOKUP_SET_ID = 0x4 + NFTA_LOOKUP_FLAGS = 0x5 + NFT_DYNSET_OP_ADD = 0x0 + NFT_DYNSET_OP_UPDATE = 0x1 + NFT_DYNSET_F_INV = 0x1 + NFTA_DYNSET_UNSPEC = 0x0 + NFTA_DYNSET_SET_NAME = 0x1 + NFTA_DYNSET_SET_ID = 0x2 + NFTA_DYNSET_OP = 0x3 + NFTA_DYNSET_SREG_KEY = 0x4 + NFTA_DYNSET_SREG_DATA = 0x5 + NFTA_DYNSET_TIMEOUT = 0x6 + NFTA_DYNSET_EXPR = 0x7 + NFTA_DYNSET_PAD = 0x8 + NFTA_DYNSET_FLAGS = 0x9 + NFT_PAYLOAD_LL_HEADER = 0x0 + NFT_PAYLOAD_NETWORK_HEADER = 0x1 + NFT_PAYLOAD_TRANSPORT_HEADER = 0x2 + NFT_PAYLOAD_CSUM_NONE = 0x0 + NFT_PAYLOAD_CSUM_INET = 0x1 + NFT_PAYLOAD_L4CSUM_PSEUDOHDR = 0x1 + NFTA_PAYLOAD_UNSPEC = 0x0 + NFTA_PAYLOAD_DREG = 0x1 + NFTA_PAYLOAD_BASE = 0x2 + NFTA_PAYLOAD_OFFSET = 0x3 + NFTA_PAYLOAD_LEN = 0x4 + NFTA_PAYLOAD_SREG = 0x5 + NFTA_PAYLOAD_CSUM_TYPE = 0x6 + NFTA_PAYLOAD_CSUM_OFFSET = 0x7 + NFTA_PAYLOAD_CSUM_FLAGS = 0x8 + NFT_EXTHDR_F_PRESENT = 0x1 + NFT_EXTHDR_OP_IPV6 = 0x0 + NFT_EXTHDR_OP_TCPOPT = 0x1 + NFTA_EXTHDR_UNSPEC = 0x0 + NFTA_EXTHDR_DREG = 0x1 + NFTA_EXTHDR_TYPE = 0x2 + NFTA_EXTHDR_OFFSET = 0x3 + NFTA_EXTHDR_LEN = 0x4 + NFTA_EXTHDR_FLAGS = 0x5 + NFTA_EXTHDR_OP = 0x6 + NFTA_EXTHDR_SREG = 0x7 + NFT_META_LEN = 0x0 + NFT_META_PROTOCOL = 0x1 + NFT_META_PRIORITY = 0x2 + NFT_META_MARK = 0x3 + NFT_META_IIF = 0x4 + NFT_META_OIF = 0x5 + NFT_META_IIFNAME = 0x6 + NFT_META_OIFNAME = 0x7 + NFT_META_IIFTYPE = 0x8 + NFT_META_OIFTYPE = 0x9 + NFT_META_SKUID = 0xa + NFT_META_SKGID = 0xb + NFT_META_NFTRACE = 0xc + NFT_META_RTCLASSID = 0xd + NFT_META_SECMARK = 0xe + NFT_META_NFPROTO = 0xf + NFT_META_L4PROTO = 0x10 + NFT_META_BRI_IIFNAME = 0x11 + NFT_META_BRI_OIFNAME = 0x12 + NFT_META_PKTTYPE = 0x13 + NFT_META_CPU = 0x14 + NFT_META_IIFGROUP = 0x15 + NFT_META_OIFGROUP = 0x16 + NFT_META_CGROUP = 0x17 + NFT_META_PRANDOM = 0x18 + NFT_RT_CLASSID = 0x0 + NFT_RT_NEXTHOP4 = 0x1 + NFT_RT_NEXTHOP6 = 0x2 + NFT_RT_TCPMSS = 0x3 + NFT_HASH_JENKINS = 0x0 + NFT_HASH_SYM = 0x1 + NFTA_HASH_UNSPEC = 0x0 + NFTA_HASH_SREG = 0x1 + NFTA_HASH_DREG = 0x2 + NFTA_HASH_LEN = 0x3 + NFTA_HASH_MODULUS = 0x4 + NFTA_HASH_SEED = 0x5 + NFTA_HASH_OFFSET = 0x6 + NFTA_HASH_TYPE = 0x7 + NFTA_META_UNSPEC = 0x0 + NFTA_META_DREG = 0x1 + NFTA_META_KEY = 0x2 + NFTA_META_SREG = 0x3 + NFTA_RT_UNSPEC = 0x0 + NFTA_RT_DREG = 0x1 + NFTA_RT_KEY = 0x2 + NFT_CT_STATE = 0x0 + NFT_CT_DIRECTION = 0x1 + NFT_CT_STATUS = 0x2 + NFT_CT_MARK = 0x3 + NFT_CT_SECMARK = 0x4 + NFT_CT_EXPIRATION = 0x5 + NFT_CT_HELPER = 0x6 + NFT_CT_L3PROTOCOL = 0x7 + NFT_CT_SRC = 0x8 + NFT_CT_DST = 0x9 + NFT_CT_PROTOCOL = 0xa + NFT_CT_PROTO_SRC = 0xb + NFT_CT_PROTO_DST = 0xc + NFT_CT_LABELS = 0xd + NFT_CT_PKTS = 0xe + NFT_CT_BYTES = 0xf + NFT_CT_AVGPKT = 0x10 + NFT_CT_ZONE = 0x11 + NFT_CT_EVENTMASK = 0x12 + NFTA_CT_UNSPEC = 0x0 + NFTA_CT_DREG = 0x1 + NFTA_CT_KEY = 0x2 + NFTA_CT_DIRECTION = 0x3 + NFTA_CT_SREG = 0x4 + NFT_LIMIT_PKTS = 0x0 + NFT_LIMIT_PKT_BYTES = 0x1 + NFT_LIMIT_F_INV = 0x1 + NFTA_LIMIT_UNSPEC = 0x0 + NFTA_LIMIT_RATE = 0x1 + NFTA_LIMIT_UNIT = 0x2 + NFTA_LIMIT_BURST = 0x3 + NFTA_LIMIT_TYPE = 0x4 + NFTA_LIMIT_FLAGS = 0x5 + NFTA_LIMIT_PAD = 0x6 + NFTA_COUNTER_UNSPEC = 0x0 + NFTA_COUNTER_BYTES = 0x1 + NFTA_COUNTER_PACKETS = 0x2 + NFTA_COUNTER_PAD = 0x3 + NFTA_LOG_UNSPEC = 0x0 + NFTA_LOG_GROUP = 0x1 + NFTA_LOG_PREFIX = 0x2 + NFTA_LOG_SNAPLEN = 0x3 + NFTA_LOG_QTHRESHOLD = 0x4 + NFTA_LOG_LEVEL = 0x5 + NFTA_LOG_FLAGS = 0x6 + NFTA_QUEUE_UNSPEC = 0x0 + NFTA_QUEUE_NUM = 0x1 + NFTA_QUEUE_TOTAL = 0x2 + NFTA_QUEUE_FLAGS = 0x3 + NFTA_QUEUE_SREG_QNUM = 0x4 + NFT_QUOTA_F_INV = 0x1 + NFT_QUOTA_F_DEPLETED = 0x2 + NFTA_QUOTA_UNSPEC = 0x0 + NFTA_QUOTA_BYTES = 0x1 + NFTA_QUOTA_FLAGS = 0x2 + NFTA_QUOTA_PAD = 0x3 + NFTA_QUOTA_CONSUMED = 0x4 + NFT_REJECT_ICMP_UNREACH = 0x0 + NFT_REJECT_TCP_RST = 0x1 + NFT_REJECT_ICMPX_UNREACH = 0x2 + NFT_REJECT_ICMPX_NO_ROUTE = 0x0 + NFT_REJECT_ICMPX_PORT_UNREACH = 0x1 + NFT_REJECT_ICMPX_HOST_UNREACH = 0x2 + NFT_REJECT_ICMPX_ADMIN_PROHIBITED = 0x3 + NFTA_REJECT_UNSPEC = 0x0 + NFTA_REJECT_TYPE = 0x1 + NFTA_REJECT_ICMP_CODE = 0x2 + NFT_NAT_SNAT = 0x0 + NFT_NAT_DNAT = 0x1 + NFTA_NAT_UNSPEC = 0x0 + NFTA_NAT_TYPE = 0x1 + NFTA_NAT_FAMILY = 0x2 + NFTA_NAT_REG_ADDR_MIN = 0x3 + NFTA_NAT_REG_ADDR_MAX = 0x4 + NFTA_NAT_REG_PROTO_MIN = 0x5 + NFTA_NAT_REG_PROTO_MAX = 0x6 + NFTA_NAT_FLAGS = 0x7 + NFTA_MASQ_UNSPEC = 0x0 + NFTA_MASQ_FLAGS = 0x1 + NFTA_MASQ_REG_PROTO_MIN = 0x2 + NFTA_MASQ_REG_PROTO_MAX = 0x3 + NFTA_REDIR_UNSPEC = 0x0 + NFTA_REDIR_REG_PROTO_MIN = 0x1 + NFTA_REDIR_REG_PROTO_MAX = 0x2 + NFTA_REDIR_FLAGS = 0x3 + NFTA_DUP_UNSPEC = 0x0 + NFTA_DUP_SREG_ADDR = 0x1 + NFTA_DUP_SREG_DEV = 0x2 + NFTA_FWD_UNSPEC = 0x0 + NFTA_FWD_SREG_DEV = 0x1 + NFTA_OBJREF_UNSPEC = 0x0 + NFTA_OBJREF_IMM_TYPE = 0x1 + NFTA_OBJREF_IMM_NAME = 0x2 + NFTA_OBJREF_SET_SREG = 0x3 + NFTA_OBJREF_SET_NAME = 0x4 + NFTA_OBJREF_SET_ID = 0x5 + NFTA_GEN_UNSPEC = 0x0 + NFTA_GEN_ID = 0x1 + NFTA_GEN_PROC_PID = 0x2 + NFTA_GEN_PROC_NAME = 0x3 + NFTA_FIB_UNSPEC = 0x0 + NFTA_FIB_DREG = 0x1 + NFTA_FIB_RESULT = 0x2 + NFTA_FIB_FLAGS = 0x3 + NFT_FIB_RESULT_UNSPEC = 0x0 + NFT_FIB_RESULT_OIF = 0x1 + NFT_FIB_RESULT_OIFNAME = 0x2 + NFT_FIB_RESULT_ADDRTYPE = 0x3 + NFTA_FIB_F_SADDR = 0x1 + NFTA_FIB_F_DADDR = 0x2 + NFTA_FIB_F_MARK = 0x4 + NFTA_FIB_F_IIF = 0x8 + NFTA_FIB_F_OIF = 0x10 + NFTA_FIB_F_PRESENT = 0x20 + NFTA_CT_HELPER_UNSPEC = 0x0 + NFTA_CT_HELPER_NAME = 0x1 + NFTA_CT_HELPER_L3PROTO = 0x2 + NFTA_CT_HELPER_L4PROTO = 0x3 + NFTA_OBJ_UNSPEC = 0x0 + NFTA_OBJ_TABLE = 0x1 + NFTA_OBJ_NAME = 0x2 + NFTA_OBJ_TYPE = 0x3 + NFTA_OBJ_DATA = 0x4 + NFTA_OBJ_USE = 0x5 + NFTA_TRACE_UNSPEC = 0x0 + NFTA_TRACE_TABLE = 0x1 + NFTA_TRACE_CHAIN = 0x2 + NFTA_TRACE_RULE_HANDLE = 0x3 + NFTA_TRACE_TYPE = 0x4 + NFTA_TRACE_VERDICT = 0x5 + NFTA_TRACE_ID = 0x6 + NFTA_TRACE_LL_HEADER = 0x7 + NFTA_TRACE_NETWORK_HEADER = 0x8 + NFTA_TRACE_TRANSPORT_HEADER = 0x9 + NFTA_TRACE_IIF = 0xa + NFTA_TRACE_IIFTYPE = 0xb + NFTA_TRACE_OIF = 0xc + NFTA_TRACE_OIFTYPE = 0xd + NFTA_TRACE_MARK = 0xe + NFTA_TRACE_NFPROTO = 0xf + NFTA_TRACE_POLICY = 0x10 + NFTA_TRACE_PAD = 0x11 + NFT_TRACETYPE_UNSPEC = 0x0 + NFT_TRACETYPE_POLICY = 0x1 + NFT_TRACETYPE_RETURN = 0x2 + NFT_TRACETYPE_RULE = 0x3 + NFTA_NG_UNSPEC = 0x0 + NFTA_NG_DREG = 0x1 + NFTA_NG_MODULUS = 0x2 + NFTA_NG_TYPE = 0x3 + NFTA_NG_OFFSET = 0x4 + NFT_NG_INCREMENTAL = 0x0 + NFT_NG_RANDOM = 0x1 +) + +type RTCTime struct { + Sec int32 + Min int32 + Hour int32 + Mday int32 + Mon int32 + Year int32 + Wday int32 + Yday int32 + Isdst int32 +} + +type RTCWkAlrm struct { + Enabled uint8 + Pending uint8 + _ [2]byte + Time RTCTime +} + +type RTCPLLInfo struct { + Ctrl int32 + Value int32 + Max int32 + Min int32 + Posmult int32 + Negmult int32 + Clock int32 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go index abb3d89ae5..2e4d709b4f 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_amd64.go @@ -105,7 +105,7 @@ type Stat_t struct { Mode uint32 Uid uint32 Gid uint32 - X__pad0 int32 + _ int32 Rdev uint64 Size int64 Blksize int64 @@ -116,25 +116,10 @@ type Stat_t struct { _ [3]int64 } -type Statfs_t struct { - Type int64 - Bsize int64 - Blocks uint64 - Bfree uint64 - Bavail uint64 - Files uint64 - Ffree uint64 - Fsid Fsid - Namelen int64 - Frsize int64 - Flags int64 - Spare [4]int64 -} - type StatxTimestamp struct { - Sec int64 - Nsec uint32 - X__reserved int32 + Sec int64 + Nsec uint32 + _ int32 } type Statx_t struct { @@ -171,7 +156,7 @@ type Dirent struct { } type Fsid struct { - X__val [2]int32 + Val [2]int32 } type Flock_t struct { @@ -265,6 +250,13 @@ type RawSockaddrL2 struct { _ [1]byte } +type RawSockaddrRFCOMM struct { + Family uint16 + Bdaddr [6]uint8 + Channel uint8 + _ [1]byte +} + type RawSockaddrCAN struct { Family uint16 _ [2]byte @@ -420,6 +412,7 @@ const ( SizeofSockaddrNetlink = 0xc SizeofSockaddrHCI = 0x6 SizeofSockaddrL2 = 0xe + SizeofSockaddrRFCOMM = 0xa SizeofSockaddrCAN = 0x10 SizeofSockaddrALG = 0x58 SizeofSockaddrVM = 0x10 @@ -440,97 +433,123 @@ const ( ) const ( - IFA_UNSPEC = 0x0 - IFA_ADDRESS = 0x1 - IFA_LOCAL = 0x2 - IFA_LABEL = 0x3 - IFA_BROADCAST = 0x4 - IFA_ANYCAST = 0x5 - IFA_CACHEINFO = 0x6 - IFA_MULTICAST = 0x7 - IFLA_UNSPEC = 0x0 - IFLA_ADDRESS = 0x1 - IFLA_BROADCAST = 0x2 - IFLA_IFNAME = 0x3 - IFLA_MTU = 0x4 - IFLA_LINK = 0x5 - IFLA_QDISC = 0x6 - IFLA_STATS = 0x7 - IFLA_COST = 0x8 - IFLA_PRIORITY = 0x9 - IFLA_MASTER = 0xa - IFLA_WIRELESS = 0xb - IFLA_PROTINFO = 0xc - IFLA_TXQLEN = 0xd - IFLA_MAP = 0xe - IFLA_WEIGHT = 0xf - IFLA_OPERSTATE = 0x10 - IFLA_LINKMODE = 0x11 - IFLA_LINKINFO = 0x12 - IFLA_NET_NS_PID = 0x13 - IFLA_IFALIAS = 0x14 - IFLA_MAX = 0x2c - RT_SCOPE_UNIVERSE = 0x0 - RT_SCOPE_SITE = 0xc8 - RT_SCOPE_LINK = 0xfd - RT_SCOPE_HOST = 0xfe - RT_SCOPE_NOWHERE = 0xff - RT_TABLE_UNSPEC = 0x0 - RT_TABLE_COMPAT = 0xfc - RT_TABLE_DEFAULT = 0xfd - RT_TABLE_MAIN = 0xfe - RT_TABLE_LOCAL = 0xff - RT_TABLE_MAX = 0xffffffff - RTA_UNSPEC = 0x0 - RTA_DST = 0x1 - RTA_SRC = 0x2 - RTA_IIF = 0x3 - RTA_OIF = 0x4 - RTA_GATEWAY = 0x5 - RTA_PRIORITY = 0x6 - RTA_PREFSRC = 0x7 - RTA_METRICS = 0x8 - RTA_MULTIPATH = 0x9 - RTA_FLOW = 0xb - RTA_CACHEINFO = 0xc - RTA_TABLE = 0xf - RTN_UNSPEC = 0x0 - RTN_UNICAST = 0x1 - RTN_LOCAL = 0x2 - RTN_BROADCAST = 0x3 - RTN_ANYCAST = 0x4 - RTN_MULTICAST = 0x5 - RTN_BLACKHOLE = 0x6 - RTN_UNREACHABLE = 0x7 - RTN_PROHIBIT = 0x8 - RTN_THROW = 0x9 - RTN_NAT = 0xa - RTN_XRESOLVE = 0xb - RTNLGRP_NONE = 0x0 - RTNLGRP_LINK = 0x1 - RTNLGRP_NOTIFY = 0x2 - RTNLGRP_NEIGH = 0x3 - RTNLGRP_TC = 0x4 - RTNLGRP_IPV4_IFADDR = 0x5 - RTNLGRP_IPV4_MROUTE = 0x6 - RTNLGRP_IPV4_ROUTE = 0x7 - RTNLGRP_IPV4_RULE = 0x8 - RTNLGRP_IPV6_IFADDR = 0x9 - RTNLGRP_IPV6_MROUTE = 0xa - RTNLGRP_IPV6_ROUTE = 0xb - RTNLGRP_IPV6_IFINFO = 0xc - RTNLGRP_IPV6_PREFIX = 0x12 - RTNLGRP_IPV6_RULE = 0x13 - RTNLGRP_ND_USEROPT = 0x14 - SizeofNlMsghdr = 0x10 - SizeofNlMsgerr = 0x14 - SizeofRtGenmsg = 0x1 - SizeofNlAttr = 0x4 - SizeofRtAttr = 0x4 - SizeofIfInfomsg = 0x10 - SizeofIfAddrmsg = 0x8 - SizeofRtMsg = 0xc - SizeofRtNexthop = 0x8 + IFA_UNSPEC = 0x0 + IFA_ADDRESS = 0x1 + IFA_LOCAL = 0x2 + IFA_LABEL = 0x3 + IFA_BROADCAST = 0x4 + IFA_ANYCAST = 0x5 + IFA_CACHEINFO = 0x6 + IFA_MULTICAST = 0x7 + IFLA_UNSPEC = 0x0 + IFLA_ADDRESS = 0x1 + IFLA_BROADCAST = 0x2 + IFLA_IFNAME = 0x3 + IFLA_MTU = 0x4 + IFLA_LINK = 0x5 + IFLA_QDISC = 0x6 + IFLA_STATS = 0x7 + IFLA_COST = 0x8 + IFLA_PRIORITY = 0x9 + IFLA_MASTER = 0xa + IFLA_WIRELESS = 0xb + IFLA_PROTINFO = 0xc + IFLA_TXQLEN = 0xd + IFLA_MAP = 0xe + IFLA_WEIGHT = 0xf + IFLA_OPERSTATE = 0x10 + IFLA_LINKMODE = 0x11 + IFLA_LINKINFO = 0x12 + IFLA_NET_NS_PID = 0x13 + IFLA_IFALIAS = 0x14 + IFLA_NUM_VF = 0x15 + IFLA_VFINFO_LIST = 0x16 + IFLA_STATS64 = 0x17 + IFLA_VF_PORTS = 0x18 + IFLA_PORT_SELF = 0x19 + IFLA_AF_SPEC = 0x1a + IFLA_GROUP = 0x1b + IFLA_NET_NS_FD = 0x1c + IFLA_EXT_MASK = 0x1d + IFLA_PROMISCUITY = 0x1e + IFLA_NUM_TX_QUEUES = 0x1f + IFLA_NUM_RX_QUEUES = 0x20 + IFLA_CARRIER = 0x21 + IFLA_PHYS_PORT_ID = 0x22 + IFLA_CARRIER_CHANGES = 0x23 + IFLA_PHYS_SWITCH_ID = 0x24 + IFLA_LINK_NETNSID = 0x25 + IFLA_PHYS_PORT_NAME = 0x26 + IFLA_PROTO_DOWN = 0x27 + IFLA_GSO_MAX_SEGS = 0x28 + IFLA_GSO_MAX_SIZE = 0x29 + IFLA_PAD = 0x2a + IFLA_XDP = 0x2b + IFLA_EVENT = 0x2c + IFLA_NEW_NETNSID = 0x2d + IFLA_IF_NETNSID = 0x2e + IFLA_MAX = 0x31 + RT_SCOPE_UNIVERSE = 0x0 + RT_SCOPE_SITE = 0xc8 + RT_SCOPE_LINK = 0xfd + RT_SCOPE_HOST = 0xfe + RT_SCOPE_NOWHERE = 0xff + RT_TABLE_UNSPEC = 0x0 + RT_TABLE_COMPAT = 0xfc + RT_TABLE_DEFAULT = 0xfd + RT_TABLE_MAIN = 0xfe + RT_TABLE_LOCAL = 0xff + RT_TABLE_MAX = 0xffffffff + RTA_UNSPEC = 0x0 + RTA_DST = 0x1 + RTA_SRC = 0x2 + RTA_IIF = 0x3 + RTA_OIF = 0x4 + RTA_GATEWAY = 0x5 + RTA_PRIORITY = 0x6 + RTA_PREFSRC = 0x7 + RTA_METRICS = 0x8 + RTA_MULTIPATH = 0x9 + RTA_FLOW = 0xb + RTA_CACHEINFO = 0xc + RTA_TABLE = 0xf + RTN_UNSPEC = 0x0 + RTN_UNICAST = 0x1 + RTN_LOCAL = 0x2 + RTN_BROADCAST = 0x3 + RTN_ANYCAST = 0x4 + RTN_MULTICAST = 0x5 + RTN_BLACKHOLE = 0x6 + RTN_UNREACHABLE = 0x7 + RTN_PROHIBIT = 0x8 + RTN_THROW = 0x9 + RTN_NAT = 0xa + RTN_XRESOLVE = 0xb + RTNLGRP_NONE = 0x0 + RTNLGRP_LINK = 0x1 + RTNLGRP_NOTIFY = 0x2 + RTNLGRP_NEIGH = 0x3 + RTNLGRP_TC = 0x4 + RTNLGRP_IPV4_IFADDR = 0x5 + RTNLGRP_IPV4_MROUTE = 0x6 + RTNLGRP_IPV4_ROUTE = 0x7 + RTNLGRP_IPV4_RULE = 0x8 + RTNLGRP_IPV6_IFADDR = 0x9 + RTNLGRP_IPV6_MROUTE = 0xa + RTNLGRP_IPV6_ROUTE = 0xb + RTNLGRP_IPV6_IFINFO = 0xc + RTNLGRP_IPV6_PREFIX = 0x12 + RTNLGRP_IPV6_RULE = 0x13 + RTNLGRP_ND_USEROPT = 0x14 + SizeofNlMsghdr = 0x10 + SizeofNlMsgerr = 0x14 + SizeofRtGenmsg = 0x1 + SizeofNlAttr = 0x4 + SizeofRtAttr = 0x4 + SizeofIfInfomsg = 0x10 + SizeofIfAddrmsg = 0x8 + SizeofRtMsg = 0xc + SizeofRtNexthop = 0x8 ) type NlMsghdr struct { @@ -561,12 +580,12 @@ type RtAttr struct { } type IfInfomsg struct { - Family uint8 - X__ifi_pad uint8 - Type uint16 - Index int32 - Flags uint32 - Change uint32 + Family uint8 + _ uint8 + Type uint16 + Index int32 + Flags uint32 + Change uint32 } type IfAddrmsg struct { @@ -672,7 +691,7 @@ type Sysinfo_t struct { Totalhigh uint64 Freehigh uint64 Unit uint32 - X_f [0]int8 + _ [0]int8 _ [4]byte } @@ -712,6 +731,8 @@ const ( AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x100 + + AT_EACCESS = 0x200 ) type PollFd struct { @@ -731,7 +752,7 @@ const ( ) type Sigset_t struct { - X__val [16]uint64 + Val [16]uint64 } const RNDGETENTCNT = 0x80045200 @@ -887,3 +908,967 @@ const ( BDADDR_LE_PUBLIC = 0x1 BDADDR_LE_RANDOM = 0x2 ) + +type PerfEventAttr struct { + Type uint32 + Size uint32 + Config uint64 + Sample uint64 + Sample_type uint64 + Read_format uint64 + Bits uint64 + Wakeup uint32 + Bp_type uint32 + Ext1 uint64 + Ext2 uint64 + Branch_sample_type uint64 + Sample_regs_user uint64 + Sample_stack_user uint32 + Clockid int32 + Sample_regs_intr uint64 + Aux_watermark uint32 + _ uint32 +} + +type PerfEventMmapPage struct { + Version uint32 + Compat_version uint32 + Lock uint32 + Index uint32 + Offset int64 + Time_enabled uint64 + Time_running uint64 + Capabilities uint64 + Pmc_width uint16 + Time_shift uint16 + Time_mult uint32 + Time_offset uint64 + Time_zero uint64 + Size uint32 + _ [948]uint8 + Data_head uint64 + Data_tail uint64 + Data_offset uint64 + Data_size uint64 + Aux_head uint64 + Aux_tail uint64 + Aux_offset uint64 + Aux_size uint64 +} + +const ( + PerfBitDisabled uint64 = CBitFieldMaskBit0 + PerfBitInherit = CBitFieldMaskBit1 + PerfBitPinned = CBitFieldMaskBit2 + PerfBitExclusive = CBitFieldMaskBit3 + PerfBitExcludeUser = CBitFieldMaskBit4 + PerfBitExcludeKernel = CBitFieldMaskBit5 + PerfBitExcludeHv = CBitFieldMaskBit6 + PerfBitExcludeIdle = CBitFieldMaskBit7 + PerfBitMmap = CBitFieldMaskBit8 + PerfBitComm = CBitFieldMaskBit9 + PerfBitFreq = CBitFieldMaskBit10 + PerfBitInheritStat = CBitFieldMaskBit11 + PerfBitEnableOnExec = CBitFieldMaskBit12 + PerfBitTask = CBitFieldMaskBit13 + PerfBitWatermark = CBitFieldMaskBit14 + PerfBitPreciseIPBit1 = CBitFieldMaskBit15 + PerfBitPreciseIPBit2 = CBitFieldMaskBit16 + PerfBitMmapData = CBitFieldMaskBit17 + PerfBitSampleIDAll = CBitFieldMaskBit18 + PerfBitExcludeHost = CBitFieldMaskBit19 + PerfBitExcludeGuest = CBitFieldMaskBit20 + PerfBitExcludeCallchainKernel = CBitFieldMaskBit21 + PerfBitExcludeCallchainUser = CBitFieldMaskBit22 + PerfBitMmap2 = CBitFieldMaskBit23 + PerfBitCommExec = CBitFieldMaskBit24 + PerfBitUseClockID = CBitFieldMaskBit25 + PerfBitContextSwitch = CBitFieldMaskBit26 +) + +const ( + PERF_TYPE_HARDWARE = 0x0 + PERF_TYPE_SOFTWARE = 0x1 + PERF_TYPE_TRACEPOINT = 0x2 + PERF_TYPE_HW_CACHE = 0x3 + PERF_TYPE_RAW = 0x4 + PERF_TYPE_BREAKPOINT = 0x5 + + PERF_COUNT_HW_CPU_CYCLES = 0x0 + PERF_COUNT_HW_INSTRUCTIONS = 0x1 + PERF_COUNT_HW_CACHE_REFERENCES = 0x2 + PERF_COUNT_HW_CACHE_MISSES = 0x3 + PERF_COUNT_HW_BRANCH_INSTRUCTIONS = 0x4 + PERF_COUNT_HW_BRANCH_MISSES = 0x5 + PERF_COUNT_HW_BUS_CYCLES = 0x6 + PERF_COUNT_HW_STALLED_CYCLES_FRONTEND = 0x7 + PERF_COUNT_HW_STALLED_CYCLES_BACKEND = 0x8 + PERF_COUNT_HW_REF_CPU_CYCLES = 0x9 + + PERF_COUNT_HW_CACHE_L1D = 0x0 + PERF_COUNT_HW_CACHE_L1I = 0x1 + PERF_COUNT_HW_CACHE_LL = 0x2 + PERF_COUNT_HW_CACHE_DTLB = 0x3 + PERF_COUNT_HW_CACHE_ITLB = 0x4 + PERF_COUNT_HW_CACHE_BPU = 0x5 + PERF_COUNT_HW_CACHE_NODE = 0x6 + + PERF_COUNT_HW_CACHE_OP_READ = 0x0 + PERF_COUNT_HW_CACHE_OP_WRITE = 0x1 + PERF_COUNT_HW_CACHE_OP_PREFETCH = 0x2 + + PERF_COUNT_HW_CACHE_RESULT_ACCESS = 0x0 + PERF_COUNT_HW_CACHE_RESULT_MISS = 0x1 + + PERF_COUNT_SW_CPU_CLOCK = 0x0 + PERF_COUNT_SW_TASK_CLOCK = 0x1 + PERF_COUNT_SW_PAGE_FAULTS = 0x2 + PERF_COUNT_SW_CONTEXT_SWITCHES = 0x3 + PERF_COUNT_SW_CPU_MIGRATIONS = 0x4 + PERF_COUNT_SW_PAGE_FAULTS_MIN = 0x5 + PERF_COUNT_SW_PAGE_FAULTS_MAJ = 0x6 + PERF_COUNT_SW_ALIGNMENT_FAULTS = 0x7 + PERF_COUNT_SW_EMULATION_FAULTS = 0x8 + PERF_COUNT_SW_DUMMY = 0x9 + + PERF_SAMPLE_IP = 0x1 + PERF_SAMPLE_TID = 0x2 + PERF_SAMPLE_TIME = 0x4 + PERF_SAMPLE_ADDR = 0x8 + PERF_SAMPLE_READ = 0x10 + PERF_SAMPLE_CALLCHAIN = 0x20 + PERF_SAMPLE_ID = 0x40 + PERF_SAMPLE_CPU = 0x80 + PERF_SAMPLE_PERIOD = 0x100 + PERF_SAMPLE_STREAM_ID = 0x200 + PERF_SAMPLE_RAW = 0x400 + PERF_SAMPLE_BRANCH_STACK = 0x800 + + PERF_SAMPLE_BRANCH_USER = 0x1 + PERF_SAMPLE_BRANCH_KERNEL = 0x2 + PERF_SAMPLE_BRANCH_HV = 0x4 + PERF_SAMPLE_BRANCH_ANY = 0x8 + PERF_SAMPLE_BRANCH_ANY_CALL = 0x10 + PERF_SAMPLE_BRANCH_ANY_RETURN = 0x20 + PERF_SAMPLE_BRANCH_IND_CALL = 0x40 + + PERF_FORMAT_TOTAL_TIME_ENABLED = 0x1 + PERF_FORMAT_TOTAL_TIME_RUNNING = 0x2 + PERF_FORMAT_ID = 0x4 + PERF_FORMAT_GROUP = 0x8 + + PERF_RECORD_MMAP = 0x1 + PERF_RECORD_LOST = 0x2 + PERF_RECORD_COMM = 0x3 + PERF_RECORD_EXIT = 0x4 + PERF_RECORD_THROTTLE = 0x5 + PERF_RECORD_UNTHROTTLE = 0x6 + PERF_RECORD_FORK = 0x7 + PERF_RECORD_READ = 0x8 + PERF_RECORD_SAMPLE = 0x9 + + PERF_CONTEXT_HV = -0x20 + PERF_CONTEXT_KERNEL = -0x80 + PERF_CONTEXT_USER = -0x200 + + PERF_CONTEXT_GUEST = -0x800 + PERF_CONTEXT_GUEST_KERNEL = -0x880 + PERF_CONTEXT_GUEST_USER = -0xa00 + + PERF_FLAG_FD_NO_GROUP = 0x1 + PERF_FLAG_FD_OUTPUT = 0x2 + PERF_FLAG_PID_CGROUP = 0x4 +) + +const ( + CBitFieldMaskBit0 = 0x1 + CBitFieldMaskBit1 = 0x2 + CBitFieldMaskBit2 = 0x4 + CBitFieldMaskBit3 = 0x8 + CBitFieldMaskBit4 = 0x10 + CBitFieldMaskBit5 = 0x20 + CBitFieldMaskBit6 = 0x40 + CBitFieldMaskBit7 = 0x80 + CBitFieldMaskBit8 = 0x100 + CBitFieldMaskBit9 = 0x200 + CBitFieldMaskBit10 = 0x400 + CBitFieldMaskBit11 = 0x800 + CBitFieldMaskBit12 = 0x1000 + CBitFieldMaskBit13 = 0x2000 + CBitFieldMaskBit14 = 0x4000 + CBitFieldMaskBit15 = 0x8000 + CBitFieldMaskBit16 = 0x10000 + CBitFieldMaskBit17 = 0x20000 + CBitFieldMaskBit18 = 0x40000 + CBitFieldMaskBit19 = 0x80000 + CBitFieldMaskBit20 = 0x100000 + CBitFieldMaskBit21 = 0x200000 + CBitFieldMaskBit22 = 0x400000 + CBitFieldMaskBit23 = 0x800000 + CBitFieldMaskBit24 = 0x1000000 + CBitFieldMaskBit25 = 0x2000000 + CBitFieldMaskBit26 = 0x4000000 + CBitFieldMaskBit27 = 0x8000000 + CBitFieldMaskBit28 = 0x10000000 + CBitFieldMaskBit29 = 0x20000000 + CBitFieldMaskBit30 = 0x40000000 + CBitFieldMaskBit31 = 0x80000000 + CBitFieldMaskBit32 = 0x100000000 + CBitFieldMaskBit33 = 0x200000000 + CBitFieldMaskBit34 = 0x400000000 + CBitFieldMaskBit35 = 0x800000000 + CBitFieldMaskBit36 = 0x1000000000 + CBitFieldMaskBit37 = 0x2000000000 + CBitFieldMaskBit38 = 0x4000000000 + CBitFieldMaskBit39 = 0x8000000000 + CBitFieldMaskBit40 = 0x10000000000 + CBitFieldMaskBit41 = 0x20000000000 + CBitFieldMaskBit42 = 0x40000000000 + CBitFieldMaskBit43 = 0x80000000000 + CBitFieldMaskBit44 = 0x100000000000 + CBitFieldMaskBit45 = 0x200000000000 + CBitFieldMaskBit46 = 0x400000000000 + CBitFieldMaskBit47 = 0x800000000000 + CBitFieldMaskBit48 = 0x1000000000000 + CBitFieldMaskBit49 = 0x2000000000000 + CBitFieldMaskBit50 = 0x4000000000000 + CBitFieldMaskBit51 = 0x8000000000000 + CBitFieldMaskBit52 = 0x10000000000000 + CBitFieldMaskBit53 = 0x20000000000000 + CBitFieldMaskBit54 = 0x40000000000000 + CBitFieldMaskBit55 = 0x80000000000000 + CBitFieldMaskBit56 = 0x100000000000000 + CBitFieldMaskBit57 = 0x200000000000000 + CBitFieldMaskBit58 = 0x400000000000000 + CBitFieldMaskBit59 = 0x800000000000000 + CBitFieldMaskBit60 = 0x1000000000000000 + CBitFieldMaskBit61 = 0x2000000000000000 + CBitFieldMaskBit62 = 0x4000000000000000 + CBitFieldMaskBit63 = 0x8000000000000000 +) + +type SockaddrStorage struct { + Family uint16 + _ [118]int8 + _ uint64 +} + +type TCPMD5Sig struct { + Addr SockaddrStorage + Flags uint8 + Prefixlen uint8 + Keylen uint16 + _ uint32 + Key [80]uint8 +} + +type HDDriveCmdHdr struct { + Command uint8 + Number uint8 + Feature uint8 + Count uint8 +} + +type HDGeometry struct { + Heads uint8 + Sectors uint8 + Cylinders uint16 + _ [4]byte + Start uint64 +} + +type HDDriveID struct { + Config uint16 + Cyls uint16 + Reserved2 uint16 + Heads uint16 + Track_bytes uint16 + Sector_bytes uint16 + Sectors uint16 + Vendor0 uint16 + Vendor1 uint16 + Vendor2 uint16 + Serial_no [20]uint8 + Buf_type uint16 + Buf_size uint16 + Ecc_bytes uint16 + Fw_rev [8]uint8 + Model [40]uint8 + Max_multsect uint8 + Vendor3 uint8 + Dword_io uint16 + Vendor4 uint8 + Capability uint8 + Reserved50 uint16 + Vendor5 uint8 + TPIO uint8 + Vendor6 uint8 + TDMA uint8 + Field_valid uint16 + Cur_cyls uint16 + Cur_heads uint16 + Cur_sectors uint16 + Cur_capacity0 uint16 + Cur_capacity1 uint16 + Multsect uint8 + Multsect_valid uint8 + Lba_capacity uint32 + Dma_1word uint16 + Dma_mword uint16 + Eide_pio_modes uint16 + Eide_dma_min uint16 + Eide_dma_time uint16 + Eide_pio uint16 + Eide_pio_iordy uint16 + Words69_70 [2]uint16 + Words71_74 [4]uint16 + Queue_depth uint16 + Words76_79 [4]uint16 + Major_rev_num uint16 + Minor_rev_num uint16 + Command_set_1 uint16 + Command_set_2 uint16 + Cfsse uint16 + Cfs_enable_1 uint16 + Cfs_enable_2 uint16 + Csf_default uint16 + Dma_ultra uint16 + Trseuc uint16 + TrsEuc uint16 + CurAPMvalues uint16 + Mprc uint16 + Hw_config uint16 + Acoustic uint16 + Msrqs uint16 + Sxfert uint16 + Sal uint16 + Spg uint32 + Lba_capacity_2 uint64 + Words104_125 [22]uint16 + Last_lun uint16 + Word127 uint16 + Dlf uint16 + Csfo uint16 + Words130_155 [26]uint16 + Word156 uint16 + Words157_159 [3]uint16 + Cfa_power uint16 + Words161_175 [15]uint16 + Words176_205 [30]uint16 + Words206_254 [49]uint16 + Integrity_word uint16 +} + +type Statfs_t struct { + Type int64 + Bsize int64 + Blocks uint64 + Bfree uint64 + Bavail uint64 + Files uint64 + Ffree uint64 + Fsid Fsid + Namelen int64 + Frsize int64 + Flags int64 + Spare [4]int64 +} + +const ( + ST_MANDLOCK = 0x40 + ST_NOATIME = 0x400 + ST_NODEV = 0x4 + ST_NODIRATIME = 0x800 + ST_NOEXEC = 0x8 + ST_NOSUID = 0x2 + ST_RDONLY = 0x1 + ST_RELATIME = 0x1000 + ST_SYNCHRONOUS = 0x10 +) + +type TpacketHdr struct { + Status uint64 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Usec uint32 + _ [4]byte +} + +type Tpacket2Hdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Nsec uint32 + Vlan_tci uint16 + Vlan_tpid uint16 + _ [4]uint8 +} + +type Tpacket3Hdr struct { + Next_offset uint32 + Sec uint32 + Nsec uint32 + Snaplen uint32 + Len uint32 + Status uint32 + Mac uint16 + Net uint16 + Hv1 TpacketHdrVariant1 + _ [8]uint8 +} + +type TpacketHdrVariant1 struct { + Rxhash uint32 + Vlan_tci uint32 + Vlan_tpid uint16 + _ uint16 +} + +type TpacketBlockDesc struct { + Version uint32 + To_priv uint32 + Hdr [40]byte +} + +type TpacketReq struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 +} + +type TpacketReq3 struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 + Retire_blk_tov uint32 + Sizeof_priv uint32 + Feature_req_word uint32 +} + +type TpacketStats struct { + Packets uint32 + Drops uint32 +} + +type TpacketStatsV3 struct { + Packets uint32 + Drops uint32 + Freeze_q_cnt uint32 +} + +type TpacketAuxdata struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Vlan_tci uint16 + Vlan_tpid uint16 +} + +const ( + TPACKET_V1 = 0x0 + TPACKET_V2 = 0x1 + TPACKET_V3 = 0x2 +) + +const ( + SizeofTpacketHdr = 0x20 + SizeofTpacket2Hdr = 0x20 + SizeofTpacket3Hdr = 0x30 +) + +const ( + NF_INET_PRE_ROUTING = 0x0 + NF_INET_LOCAL_IN = 0x1 + NF_INET_FORWARD = 0x2 + NF_INET_LOCAL_OUT = 0x3 + NF_INET_POST_ROUTING = 0x4 + NF_INET_NUMHOOKS = 0x5 +) + +const ( + NF_NETDEV_INGRESS = 0x0 + NF_NETDEV_NUMHOOKS = 0x1 +) + +const ( + NFPROTO_UNSPEC = 0x0 + NFPROTO_INET = 0x1 + NFPROTO_IPV4 = 0x2 + NFPROTO_ARP = 0x3 + NFPROTO_NETDEV = 0x5 + NFPROTO_BRIDGE = 0x7 + NFPROTO_IPV6 = 0xa + NFPROTO_DECNET = 0xc + NFPROTO_NUMPROTO = 0xd +) + +type Nfgenmsg struct { + Nfgen_family uint8 + Version uint8 + Res_id uint16 +} + +const ( + NFNL_BATCH_UNSPEC = 0x0 + NFNL_BATCH_GENID = 0x1 +) + +const ( + NFT_REG_VERDICT = 0x0 + NFT_REG_1 = 0x1 + NFT_REG_2 = 0x2 + NFT_REG_3 = 0x3 + NFT_REG_4 = 0x4 + NFT_REG32_00 = 0x8 + NFT_REG32_01 = 0x9 + NFT_REG32_02 = 0xa + NFT_REG32_03 = 0xb + NFT_REG32_04 = 0xc + NFT_REG32_05 = 0xd + NFT_REG32_06 = 0xe + NFT_REG32_07 = 0xf + NFT_REG32_08 = 0x10 + NFT_REG32_09 = 0x11 + NFT_REG32_10 = 0x12 + NFT_REG32_11 = 0x13 + NFT_REG32_12 = 0x14 + NFT_REG32_13 = 0x15 + NFT_REG32_14 = 0x16 + NFT_REG32_15 = 0x17 + NFT_CONTINUE = -0x1 + NFT_BREAK = -0x2 + NFT_JUMP = -0x3 + NFT_GOTO = -0x4 + NFT_RETURN = -0x5 + NFT_MSG_NEWTABLE = 0x0 + NFT_MSG_GETTABLE = 0x1 + NFT_MSG_DELTABLE = 0x2 + NFT_MSG_NEWCHAIN = 0x3 + NFT_MSG_GETCHAIN = 0x4 + NFT_MSG_DELCHAIN = 0x5 + NFT_MSG_NEWRULE = 0x6 + NFT_MSG_GETRULE = 0x7 + NFT_MSG_DELRULE = 0x8 + NFT_MSG_NEWSET = 0x9 + NFT_MSG_GETSET = 0xa + NFT_MSG_DELSET = 0xb + NFT_MSG_NEWSETELEM = 0xc + NFT_MSG_GETSETELEM = 0xd + NFT_MSG_DELSETELEM = 0xe + NFT_MSG_NEWGEN = 0xf + NFT_MSG_GETGEN = 0x10 + NFT_MSG_TRACE = 0x11 + NFT_MSG_NEWOBJ = 0x12 + NFT_MSG_GETOBJ = 0x13 + NFT_MSG_DELOBJ = 0x14 + NFT_MSG_GETOBJ_RESET = 0x15 + NFT_MSG_MAX = 0x19 + NFTA_LIST_UNPEC = 0x0 + NFTA_LIST_ELEM = 0x1 + NFTA_HOOK_UNSPEC = 0x0 + NFTA_HOOK_HOOKNUM = 0x1 + NFTA_HOOK_PRIORITY = 0x2 + NFTA_HOOK_DEV = 0x3 + NFT_TABLE_F_DORMANT = 0x1 + NFTA_TABLE_UNSPEC = 0x0 + NFTA_TABLE_NAME = 0x1 + NFTA_TABLE_FLAGS = 0x2 + NFTA_TABLE_USE = 0x3 + NFTA_CHAIN_UNSPEC = 0x0 + NFTA_CHAIN_TABLE = 0x1 + NFTA_CHAIN_HANDLE = 0x2 + NFTA_CHAIN_NAME = 0x3 + NFTA_CHAIN_HOOK = 0x4 + NFTA_CHAIN_POLICY = 0x5 + NFTA_CHAIN_USE = 0x6 + NFTA_CHAIN_TYPE = 0x7 + NFTA_CHAIN_COUNTERS = 0x8 + NFTA_CHAIN_PAD = 0x9 + NFTA_RULE_UNSPEC = 0x0 + NFTA_RULE_TABLE = 0x1 + NFTA_RULE_CHAIN = 0x2 + NFTA_RULE_HANDLE = 0x3 + NFTA_RULE_EXPRESSIONS = 0x4 + NFTA_RULE_COMPAT = 0x5 + NFTA_RULE_POSITION = 0x6 + NFTA_RULE_USERDATA = 0x7 + NFTA_RULE_PAD = 0x8 + NFTA_RULE_ID = 0x9 + NFT_RULE_COMPAT_F_INV = 0x2 + NFT_RULE_COMPAT_F_MASK = 0x2 + NFTA_RULE_COMPAT_UNSPEC = 0x0 + NFTA_RULE_COMPAT_PROTO = 0x1 + NFTA_RULE_COMPAT_FLAGS = 0x2 + NFT_SET_ANONYMOUS = 0x1 + NFT_SET_CONSTANT = 0x2 + NFT_SET_INTERVAL = 0x4 + NFT_SET_MAP = 0x8 + NFT_SET_TIMEOUT = 0x10 + NFT_SET_EVAL = 0x20 + NFT_SET_OBJECT = 0x40 + NFT_SET_POL_PERFORMANCE = 0x0 + NFT_SET_POL_MEMORY = 0x1 + NFTA_SET_DESC_UNSPEC = 0x0 + NFTA_SET_DESC_SIZE = 0x1 + NFTA_SET_UNSPEC = 0x0 + NFTA_SET_TABLE = 0x1 + NFTA_SET_NAME = 0x2 + NFTA_SET_FLAGS = 0x3 + NFTA_SET_KEY_TYPE = 0x4 + NFTA_SET_KEY_LEN = 0x5 + NFTA_SET_DATA_TYPE = 0x6 + NFTA_SET_DATA_LEN = 0x7 + NFTA_SET_POLICY = 0x8 + NFTA_SET_DESC = 0x9 + NFTA_SET_ID = 0xa + NFTA_SET_TIMEOUT = 0xb + NFTA_SET_GC_INTERVAL = 0xc + NFTA_SET_USERDATA = 0xd + NFTA_SET_PAD = 0xe + NFTA_SET_OBJ_TYPE = 0xf + NFT_SET_ELEM_INTERVAL_END = 0x1 + NFTA_SET_ELEM_UNSPEC = 0x0 + NFTA_SET_ELEM_KEY = 0x1 + NFTA_SET_ELEM_DATA = 0x2 + NFTA_SET_ELEM_FLAGS = 0x3 + NFTA_SET_ELEM_TIMEOUT = 0x4 + NFTA_SET_ELEM_EXPIRATION = 0x5 + NFTA_SET_ELEM_USERDATA = 0x6 + NFTA_SET_ELEM_EXPR = 0x7 + NFTA_SET_ELEM_PAD = 0x8 + NFTA_SET_ELEM_OBJREF = 0x9 + NFTA_SET_ELEM_LIST_UNSPEC = 0x0 + NFTA_SET_ELEM_LIST_TABLE = 0x1 + NFTA_SET_ELEM_LIST_SET = 0x2 + NFTA_SET_ELEM_LIST_ELEMENTS = 0x3 + NFTA_SET_ELEM_LIST_SET_ID = 0x4 + NFT_DATA_VALUE = 0x0 + NFT_DATA_VERDICT = 0xffffff00 + NFTA_DATA_UNSPEC = 0x0 + NFTA_DATA_VALUE = 0x1 + NFTA_DATA_VERDICT = 0x2 + NFTA_VERDICT_UNSPEC = 0x0 + NFTA_VERDICT_CODE = 0x1 + NFTA_VERDICT_CHAIN = 0x2 + NFTA_EXPR_UNSPEC = 0x0 + NFTA_EXPR_NAME = 0x1 + NFTA_EXPR_DATA = 0x2 + NFTA_IMMEDIATE_UNSPEC = 0x0 + NFTA_IMMEDIATE_DREG = 0x1 + NFTA_IMMEDIATE_DATA = 0x2 + NFTA_BITWISE_UNSPEC = 0x0 + NFTA_BITWISE_SREG = 0x1 + NFTA_BITWISE_DREG = 0x2 + NFTA_BITWISE_LEN = 0x3 + NFTA_BITWISE_MASK = 0x4 + NFTA_BITWISE_XOR = 0x5 + NFT_BYTEORDER_NTOH = 0x0 + NFT_BYTEORDER_HTON = 0x1 + NFTA_BYTEORDER_UNSPEC = 0x0 + NFTA_BYTEORDER_SREG = 0x1 + NFTA_BYTEORDER_DREG = 0x2 + NFTA_BYTEORDER_OP = 0x3 + NFTA_BYTEORDER_LEN = 0x4 + NFTA_BYTEORDER_SIZE = 0x5 + NFT_CMP_EQ = 0x0 + NFT_CMP_NEQ = 0x1 + NFT_CMP_LT = 0x2 + NFT_CMP_LTE = 0x3 + NFT_CMP_GT = 0x4 + NFT_CMP_GTE = 0x5 + NFTA_CMP_UNSPEC = 0x0 + NFTA_CMP_SREG = 0x1 + NFTA_CMP_OP = 0x2 + NFTA_CMP_DATA = 0x3 + NFT_RANGE_EQ = 0x0 + NFT_RANGE_NEQ = 0x1 + NFTA_RANGE_UNSPEC = 0x0 + NFTA_RANGE_SREG = 0x1 + NFTA_RANGE_OP = 0x2 + NFTA_RANGE_FROM_DATA = 0x3 + NFTA_RANGE_TO_DATA = 0x4 + NFT_LOOKUP_F_INV = 0x1 + NFTA_LOOKUP_UNSPEC = 0x0 + NFTA_LOOKUP_SET = 0x1 + NFTA_LOOKUP_SREG = 0x2 + NFTA_LOOKUP_DREG = 0x3 + NFTA_LOOKUP_SET_ID = 0x4 + NFTA_LOOKUP_FLAGS = 0x5 + NFT_DYNSET_OP_ADD = 0x0 + NFT_DYNSET_OP_UPDATE = 0x1 + NFT_DYNSET_F_INV = 0x1 + NFTA_DYNSET_UNSPEC = 0x0 + NFTA_DYNSET_SET_NAME = 0x1 + NFTA_DYNSET_SET_ID = 0x2 + NFTA_DYNSET_OP = 0x3 + NFTA_DYNSET_SREG_KEY = 0x4 + NFTA_DYNSET_SREG_DATA = 0x5 + NFTA_DYNSET_TIMEOUT = 0x6 + NFTA_DYNSET_EXPR = 0x7 + NFTA_DYNSET_PAD = 0x8 + NFTA_DYNSET_FLAGS = 0x9 + NFT_PAYLOAD_LL_HEADER = 0x0 + NFT_PAYLOAD_NETWORK_HEADER = 0x1 + NFT_PAYLOAD_TRANSPORT_HEADER = 0x2 + NFT_PAYLOAD_CSUM_NONE = 0x0 + NFT_PAYLOAD_CSUM_INET = 0x1 + NFT_PAYLOAD_L4CSUM_PSEUDOHDR = 0x1 + NFTA_PAYLOAD_UNSPEC = 0x0 + NFTA_PAYLOAD_DREG = 0x1 + NFTA_PAYLOAD_BASE = 0x2 + NFTA_PAYLOAD_OFFSET = 0x3 + NFTA_PAYLOAD_LEN = 0x4 + NFTA_PAYLOAD_SREG = 0x5 + NFTA_PAYLOAD_CSUM_TYPE = 0x6 + NFTA_PAYLOAD_CSUM_OFFSET = 0x7 + NFTA_PAYLOAD_CSUM_FLAGS = 0x8 + NFT_EXTHDR_F_PRESENT = 0x1 + NFT_EXTHDR_OP_IPV6 = 0x0 + NFT_EXTHDR_OP_TCPOPT = 0x1 + NFTA_EXTHDR_UNSPEC = 0x0 + NFTA_EXTHDR_DREG = 0x1 + NFTA_EXTHDR_TYPE = 0x2 + NFTA_EXTHDR_OFFSET = 0x3 + NFTA_EXTHDR_LEN = 0x4 + NFTA_EXTHDR_FLAGS = 0x5 + NFTA_EXTHDR_OP = 0x6 + NFTA_EXTHDR_SREG = 0x7 + NFT_META_LEN = 0x0 + NFT_META_PROTOCOL = 0x1 + NFT_META_PRIORITY = 0x2 + NFT_META_MARK = 0x3 + NFT_META_IIF = 0x4 + NFT_META_OIF = 0x5 + NFT_META_IIFNAME = 0x6 + NFT_META_OIFNAME = 0x7 + NFT_META_IIFTYPE = 0x8 + NFT_META_OIFTYPE = 0x9 + NFT_META_SKUID = 0xa + NFT_META_SKGID = 0xb + NFT_META_NFTRACE = 0xc + NFT_META_RTCLASSID = 0xd + NFT_META_SECMARK = 0xe + NFT_META_NFPROTO = 0xf + NFT_META_L4PROTO = 0x10 + NFT_META_BRI_IIFNAME = 0x11 + NFT_META_BRI_OIFNAME = 0x12 + NFT_META_PKTTYPE = 0x13 + NFT_META_CPU = 0x14 + NFT_META_IIFGROUP = 0x15 + NFT_META_OIFGROUP = 0x16 + NFT_META_CGROUP = 0x17 + NFT_META_PRANDOM = 0x18 + NFT_RT_CLASSID = 0x0 + NFT_RT_NEXTHOP4 = 0x1 + NFT_RT_NEXTHOP6 = 0x2 + NFT_RT_TCPMSS = 0x3 + NFT_HASH_JENKINS = 0x0 + NFT_HASH_SYM = 0x1 + NFTA_HASH_UNSPEC = 0x0 + NFTA_HASH_SREG = 0x1 + NFTA_HASH_DREG = 0x2 + NFTA_HASH_LEN = 0x3 + NFTA_HASH_MODULUS = 0x4 + NFTA_HASH_SEED = 0x5 + NFTA_HASH_OFFSET = 0x6 + NFTA_HASH_TYPE = 0x7 + NFTA_META_UNSPEC = 0x0 + NFTA_META_DREG = 0x1 + NFTA_META_KEY = 0x2 + NFTA_META_SREG = 0x3 + NFTA_RT_UNSPEC = 0x0 + NFTA_RT_DREG = 0x1 + NFTA_RT_KEY = 0x2 + NFT_CT_STATE = 0x0 + NFT_CT_DIRECTION = 0x1 + NFT_CT_STATUS = 0x2 + NFT_CT_MARK = 0x3 + NFT_CT_SECMARK = 0x4 + NFT_CT_EXPIRATION = 0x5 + NFT_CT_HELPER = 0x6 + NFT_CT_L3PROTOCOL = 0x7 + NFT_CT_SRC = 0x8 + NFT_CT_DST = 0x9 + NFT_CT_PROTOCOL = 0xa + NFT_CT_PROTO_SRC = 0xb + NFT_CT_PROTO_DST = 0xc + NFT_CT_LABELS = 0xd + NFT_CT_PKTS = 0xe + NFT_CT_BYTES = 0xf + NFT_CT_AVGPKT = 0x10 + NFT_CT_ZONE = 0x11 + NFT_CT_EVENTMASK = 0x12 + NFTA_CT_UNSPEC = 0x0 + NFTA_CT_DREG = 0x1 + NFTA_CT_KEY = 0x2 + NFTA_CT_DIRECTION = 0x3 + NFTA_CT_SREG = 0x4 + NFT_LIMIT_PKTS = 0x0 + NFT_LIMIT_PKT_BYTES = 0x1 + NFT_LIMIT_F_INV = 0x1 + NFTA_LIMIT_UNSPEC = 0x0 + NFTA_LIMIT_RATE = 0x1 + NFTA_LIMIT_UNIT = 0x2 + NFTA_LIMIT_BURST = 0x3 + NFTA_LIMIT_TYPE = 0x4 + NFTA_LIMIT_FLAGS = 0x5 + NFTA_LIMIT_PAD = 0x6 + NFTA_COUNTER_UNSPEC = 0x0 + NFTA_COUNTER_BYTES = 0x1 + NFTA_COUNTER_PACKETS = 0x2 + NFTA_COUNTER_PAD = 0x3 + NFTA_LOG_UNSPEC = 0x0 + NFTA_LOG_GROUP = 0x1 + NFTA_LOG_PREFIX = 0x2 + NFTA_LOG_SNAPLEN = 0x3 + NFTA_LOG_QTHRESHOLD = 0x4 + NFTA_LOG_LEVEL = 0x5 + NFTA_LOG_FLAGS = 0x6 + NFTA_QUEUE_UNSPEC = 0x0 + NFTA_QUEUE_NUM = 0x1 + NFTA_QUEUE_TOTAL = 0x2 + NFTA_QUEUE_FLAGS = 0x3 + NFTA_QUEUE_SREG_QNUM = 0x4 + NFT_QUOTA_F_INV = 0x1 + NFT_QUOTA_F_DEPLETED = 0x2 + NFTA_QUOTA_UNSPEC = 0x0 + NFTA_QUOTA_BYTES = 0x1 + NFTA_QUOTA_FLAGS = 0x2 + NFTA_QUOTA_PAD = 0x3 + NFTA_QUOTA_CONSUMED = 0x4 + NFT_REJECT_ICMP_UNREACH = 0x0 + NFT_REJECT_TCP_RST = 0x1 + NFT_REJECT_ICMPX_UNREACH = 0x2 + NFT_REJECT_ICMPX_NO_ROUTE = 0x0 + NFT_REJECT_ICMPX_PORT_UNREACH = 0x1 + NFT_REJECT_ICMPX_HOST_UNREACH = 0x2 + NFT_REJECT_ICMPX_ADMIN_PROHIBITED = 0x3 + NFTA_REJECT_UNSPEC = 0x0 + NFTA_REJECT_TYPE = 0x1 + NFTA_REJECT_ICMP_CODE = 0x2 + NFT_NAT_SNAT = 0x0 + NFT_NAT_DNAT = 0x1 + NFTA_NAT_UNSPEC = 0x0 + NFTA_NAT_TYPE = 0x1 + NFTA_NAT_FAMILY = 0x2 + NFTA_NAT_REG_ADDR_MIN = 0x3 + NFTA_NAT_REG_ADDR_MAX = 0x4 + NFTA_NAT_REG_PROTO_MIN = 0x5 + NFTA_NAT_REG_PROTO_MAX = 0x6 + NFTA_NAT_FLAGS = 0x7 + NFTA_MASQ_UNSPEC = 0x0 + NFTA_MASQ_FLAGS = 0x1 + NFTA_MASQ_REG_PROTO_MIN = 0x2 + NFTA_MASQ_REG_PROTO_MAX = 0x3 + NFTA_REDIR_UNSPEC = 0x0 + NFTA_REDIR_REG_PROTO_MIN = 0x1 + NFTA_REDIR_REG_PROTO_MAX = 0x2 + NFTA_REDIR_FLAGS = 0x3 + NFTA_DUP_UNSPEC = 0x0 + NFTA_DUP_SREG_ADDR = 0x1 + NFTA_DUP_SREG_DEV = 0x2 + NFTA_FWD_UNSPEC = 0x0 + NFTA_FWD_SREG_DEV = 0x1 + NFTA_OBJREF_UNSPEC = 0x0 + NFTA_OBJREF_IMM_TYPE = 0x1 + NFTA_OBJREF_IMM_NAME = 0x2 + NFTA_OBJREF_SET_SREG = 0x3 + NFTA_OBJREF_SET_NAME = 0x4 + NFTA_OBJREF_SET_ID = 0x5 + NFTA_GEN_UNSPEC = 0x0 + NFTA_GEN_ID = 0x1 + NFTA_GEN_PROC_PID = 0x2 + NFTA_GEN_PROC_NAME = 0x3 + NFTA_FIB_UNSPEC = 0x0 + NFTA_FIB_DREG = 0x1 + NFTA_FIB_RESULT = 0x2 + NFTA_FIB_FLAGS = 0x3 + NFT_FIB_RESULT_UNSPEC = 0x0 + NFT_FIB_RESULT_OIF = 0x1 + NFT_FIB_RESULT_OIFNAME = 0x2 + NFT_FIB_RESULT_ADDRTYPE = 0x3 + NFTA_FIB_F_SADDR = 0x1 + NFTA_FIB_F_DADDR = 0x2 + NFTA_FIB_F_MARK = 0x4 + NFTA_FIB_F_IIF = 0x8 + NFTA_FIB_F_OIF = 0x10 + NFTA_FIB_F_PRESENT = 0x20 + NFTA_CT_HELPER_UNSPEC = 0x0 + NFTA_CT_HELPER_NAME = 0x1 + NFTA_CT_HELPER_L3PROTO = 0x2 + NFTA_CT_HELPER_L4PROTO = 0x3 + NFTA_OBJ_UNSPEC = 0x0 + NFTA_OBJ_TABLE = 0x1 + NFTA_OBJ_NAME = 0x2 + NFTA_OBJ_TYPE = 0x3 + NFTA_OBJ_DATA = 0x4 + NFTA_OBJ_USE = 0x5 + NFTA_TRACE_UNSPEC = 0x0 + NFTA_TRACE_TABLE = 0x1 + NFTA_TRACE_CHAIN = 0x2 + NFTA_TRACE_RULE_HANDLE = 0x3 + NFTA_TRACE_TYPE = 0x4 + NFTA_TRACE_VERDICT = 0x5 + NFTA_TRACE_ID = 0x6 + NFTA_TRACE_LL_HEADER = 0x7 + NFTA_TRACE_NETWORK_HEADER = 0x8 + NFTA_TRACE_TRANSPORT_HEADER = 0x9 + NFTA_TRACE_IIF = 0xa + NFTA_TRACE_IIFTYPE = 0xb + NFTA_TRACE_OIF = 0xc + NFTA_TRACE_OIFTYPE = 0xd + NFTA_TRACE_MARK = 0xe + NFTA_TRACE_NFPROTO = 0xf + NFTA_TRACE_POLICY = 0x10 + NFTA_TRACE_PAD = 0x11 + NFT_TRACETYPE_UNSPEC = 0x0 + NFT_TRACETYPE_POLICY = 0x1 + NFT_TRACETYPE_RETURN = 0x2 + NFT_TRACETYPE_RULE = 0x3 + NFTA_NG_UNSPEC = 0x0 + NFTA_NG_DREG = 0x1 + NFTA_NG_MODULUS = 0x2 + NFTA_NG_TYPE = 0x3 + NFTA_NG_OFFSET = 0x4 + NFT_NG_INCREMENTAL = 0x0 + NFT_NG_RANDOM = 0x1 +) + +type RTCTime struct { + Sec int32 + Min int32 + Hour int32 + Mday int32 + Mon int32 + Year int32 + Wday int32 + Yday int32 + Isdst int32 +} + +type RTCWkAlrm struct { + Enabled uint8 + Pending uint8 + _ [2]byte + Time RTCTime +} + +type RTCPLLInfo struct { + Ctrl int32 + Value int32 + Max int32 + Min int32 + Posmult int32 + Negmult int32 + Clock int64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go b/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go index 11654174dd..bf38e5e2cd 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_arm.go @@ -96,47 +96,31 @@ type Rlimit struct { type _Gid_t uint32 type Stat_t struct { - Dev uint64 - X__pad1 uint16 - _ [2]byte - X__st_ino uint32 - Mode uint32 - Nlink uint32 - Uid uint32 - Gid uint32 - Rdev uint64 - X__pad2 uint16 - _ [6]byte - Size int64 - Blksize int32 - _ [4]byte - Blocks int64 - Atim Timespec - Mtim Timespec - Ctim Timespec - Ino uint64 -} - -type Statfs_t struct { - Type int32 - Bsize int32 - Blocks uint64 - Bfree uint64 - Bavail uint64 - Files uint64 - Ffree uint64 - Fsid Fsid - Namelen int32 - Frsize int32 - Flags int32 - Spare [4]int32 + Dev uint64 + _ uint16 + _ [2]byte + _ uint32 + Mode uint32 + Nlink uint32 + Uid uint32 + Gid uint32 + Rdev uint64 + _ uint16 + _ [6]byte + Size int64 + Blksize int32 _ [4]byte + Blocks int64 + Atim Timespec + Mtim Timespec + Ctim Timespec + Ino uint64 } type StatxTimestamp struct { - Sec int64 - Nsec uint32 - X__reserved int32 + Sec int64 + Nsec uint32 + _ int32 } type Statx_t struct { @@ -173,7 +157,7 @@ type Dirent struct { } type Fsid struct { - X__val [2]int32 + Val [2]int32 } type Flock_t struct { @@ -267,6 +251,13 @@ type RawSockaddrL2 struct { _ [1]byte } +type RawSockaddrRFCOMM struct { + Family uint16 + Bdaddr [6]uint8 + Channel uint8 + _ [1]byte +} + type RawSockaddrCAN struct { Family uint16 _ [2]byte @@ -420,6 +411,7 @@ const ( SizeofSockaddrNetlink = 0xc SizeofSockaddrHCI = 0x6 SizeofSockaddrL2 = 0xe + SizeofSockaddrRFCOMM = 0xa SizeofSockaddrCAN = 0x10 SizeofSockaddrALG = 0x58 SizeofSockaddrVM = 0x10 @@ -440,97 +432,123 @@ const ( ) const ( - IFA_UNSPEC = 0x0 - IFA_ADDRESS = 0x1 - IFA_LOCAL = 0x2 - IFA_LABEL = 0x3 - IFA_BROADCAST = 0x4 - IFA_ANYCAST = 0x5 - IFA_CACHEINFO = 0x6 - IFA_MULTICAST = 0x7 - IFLA_UNSPEC = 0x0 - IFLA_ADDRESS = 0x1 - IFLA_BROADCAST = 0x2 - IFLA_IFNAME = 0x3 - IFLA_MTU = 0x4 - IFLA_LINK = 0x5 - IFLA_QDISC = 0x6 - IFLA_STATS = 0x7 - IFLA_COST = 0x8 - IFLA_PRIORITY = 0x9 - IFLA_MASTER = 0xa - IFLA_WIRELESS = 0xb - IFLA_PROTINFO = 0xc - IFLA_TXQLEN = 0xd - IFLA_MAP = 0xe - IFLA_WEIGHT = 0xf - IFLA_OPERSTATE = 0x10 - IFLA_LINKMODE = 0x11 - IFLA_LINKINFO = 0x12 - IFLA_NET_NS_PID = 0x13 - IFLA_IFALIAS = 0x14 - IFLA_MAX = 0x2c - RT_SCOPE_UNIVERSE = 0x0 - RT_SCOPE_SITE = 0xc8 - RT_SCOPE_LINK = 0xfd - RT_SCOPE_HOST = 0xfe - RT_SCOPE_NOWHERE = 0xff - RT_TABLE_UNSPEC = 0x0 - RT_TABLE_COMPAT = 0xfc - RT_TABLE_DEFAULT = 0xfd - RT_TABLE_MAIN = 0xfe - RT_TABLE_LOCAL = 0xff - RT_TABLE_MAX = 0xffffffff - RTA_UNSPEC = 0x0 - RTA_DST = 0x1 - RTA_SRC = 0x2 - RTA_IIF = 0x3 - RTA_OIF = 0x4 - RTA_GATEWAY = 0x5 - RTA_PRIORITY = 0x6 - RTA_PREFSRC = 0x7 - RTA_METRICS = 0x8 - RTA_MULTIPATH = 0x9 - RTA_FLOW = 0xb - RTA_CACHEINFO = 0xc - RTA_TABLE = 0xf - RTN_UNSPEC = 0x0 - RTN_UNICAST = 0x1 - RTN_LOCAL = 0x2 - RTN_BROADCAST = 0x3 - RTN_ANYCAST = 0x4 - RTN_MULTICAST = 0x5 - RTN_BLACKHOLE = 0x6 - RTN_UNREACHABLE = 0x7 - RTN_PROHIBIT = 0x8 - RTN_THROW = 0x9 - RTN_NAT = 0xa - RTN_XRESOLVE = 0xb - RTNLGRP_NONE = 0x0 - RTNLGRP_LINK = 0x1 - RTNLGRP_NOTIFY = 0x2 - RTNLGRP_NEIGH = 0x3 - RTNLGRP_TC = 0x4 - RTNLGRP_IPV4_IFADDR = 0x5 - RTNLGRP_IPV4_MROUTE = 0x6 - RTNLGRP_IPV4_ROUTE = 0x7 - RTNLGRP_IPV4_RULE = 0x8 - RTNLGRP_IPV6_IFADDR = 0x9 - RTNLGRP_IPV6_MROUTE = 0xa - RTNLGRP_IPV6_ROUTE = 0xb - RTNLGRP_IPV6_IFINFO = 0xc - RTNLGRP_IPV6_PREFIX = 0x12 - RTNLGRP_IPV6_RULE = 0x13 - RTNLGRP_ND_USEROPT = 0x14 - SizeofNlMsghdr = 0x10 - SizeofNlMsgerr = 0x14 - SizeofRtGenmsg = 0x1 - SizeofNlAttr = 0x4 - SizeofRtAttr = 0x4 - SizeofIfInfomsg = 0x10 - SizeofIfAddrmsg = 0x8 - SizeofRtMsg = 0xc - SizeofRtNexthop = 0x8 + IFA_UNSPEC = 0x0 + IFA_ADDRESS = 0x1 + IFA_LOCAL = 0x2 + IFA_LABEL = 0x3 + IFA_BROADCAST = 0x4 + IFA_ANYCAST = 0x5 + IFA_CACHEINFO = 0x6 + IFA_MULTICAST = 0x7 + IFLA_UNSPEC = 0x0 + IFLA_ADDRESS = 0x1 + IFLA_BROADCAST = 0x2 + IFLA_IFNAME = 0x3 + IFLA_MTU = 0x4 + IFLA_LINK = 0x5 + IFLA_QDISC = 0x6 + IFLA_STATS = 0x7 + IFLA_COST = 0x8 + IFLA_PRIORITY = 0x9 + IFLA_MASTER = 0xa + IFLA_WIRELESS = 0xb + IFLA_PROTINFO = 0xc + IFLA_TXQLEN = 0xd + IFLA_MAP = 0xe + IFLA_WEIGHT = 0xf + IFLA_OPERSTATE = 0x10 + IFLA_LINKMODE = 0x11 + IFLA_LINKINFO = 0x12 + IFLA_NET_NS_PID = 0x13 + IFLA_IFALIAS = 0x14 + IFLA_NUM_VF = 0x15 + IFLA_VFINFO_LIST = 0x16 + IFLA_STATS64 = 0x17 + IFLA_VF_PORTS = 0x18 + IFLA_PORT_SELF = 0x19 + IFLA_AF_SPEC = 0x1a + IFLA_GROUP = 0x1b + IFLA_NET_NS_FD = 0x1c + IFLA_EXT_MASK = 0x1d + IFLA_PROMISCUITY = 0x1e + IFLA_NUM_TX_QUEUES = 0x1f + IFLA_NUM_RX_QUEUES = 0x20 + IFLA_CARRIER = 0x21 + IFLA_PHYS_PORT_ID = 0x22 + IFLA_CARRIER_CHANGES = 0x23 + IFLA_PHYS_SWITCH_ID = 0x24 + IFLA_LINK_NETNSID = 0x25 + IFLA_PHYS_PORT_NAME = 0x26 + IFLA_PROTO_DOWN = 0x27 + IFLA_GSO_MAX_SEGS = 0x28 + IFLA_GSO_MAX_SIZE = 0x29 + IFLA_PAD = 0x2a + IFLA_XDP = 0x2b + IFLA_EVENT = 0x2c + IFLA_NEW_NETNSID = 0x2d + IFLA_IF_NETNSID = 0x2e + IFLA_MAX = 0x31 + RT_SCOPE_UNIVERSE = 0x0 + RT_SCOPE_SITE = 0xc8 + RT_SCOPE_LINK = 0xfd + RT_SCOPE_HOST = 0xfe + RT_SCOPE_NOWHERE = 0xff + RT_TABLE_UNSPEC = 0x0 + RT_TABLE_COMPAT = 0xfc + RT_TABLE_DEFAULT = 0xfd + RT_TABLE_MAIN = 0xfe + RT_TABLE_LOCAL = 0xff + RT_TABLE_MAX = 0xffffffff + RTA_UNSPEC = 0x0 + RTA_DST = 0x1 + RTA_SRC = 0x2 + RTA_IIF = 0x3 + RTA_OIF = 0x4 + RTA_GATEWAY = 0x5 + RTA_PRIORITY = 0x6 + RTA_PREFSRC = 0x7 + RTA_METRICS = 0x8 + RTA_MULTIPATH = 0x9 + RTA_FLOW = 0xb + RTA_CACHEINFO = 0xc + RTA_TABLE = 0xf + RTN_UNSPEC = 0x0 + RTN_UNICAST = 0x1 + RTN_LOCAL = 0x2 + RTN_BROADCAST = 0x3 + RTN_ANYCAST = 0x4 + RTN_MULTICAST = 0x5 + RTN_BLACKHOLE = 0x6 + RTN_UNREACHABLE = 0x7 + RTN_PROHIBIT = 0x8 + RTN_THROW = 0x9 + RTN_NAT = 0xa + RTN_XRESOLVE = 0xb + RTNLGRP_NONE = 0x0 + RTNLGRP_LINK = 0x1 + RTNLGRP_NOTIFY = 0x2 + RTNLGRP_NEIGH = 0x3 + RTNLGRP_TC = 0x4 + RTNLGRP_IPV4_IFADDR = 0x5 + RTNLGRP_IPV4_MROUTE = 0x6 + RTNLGRP_IPV4_ROUTE = 0x7 + RTNLGRP_IPV4_RULE = 0x8 + RTNLGRP_IPV6_IFADDR = 0x9 + RTNLGRP_IPV6_MROUTE = 0xa + RTNLGRP_IPV6_ROUTE = 0xb + RTNLGRP_IPV6_IFINFO = 0xc + RTNLGRP_IPV6_PREFIX = 0x12 + RTNLGRP_IPV6_RULE = 0x13 + RTNLGRP_ND_USEROPT = 0x14 + SizeofNlMsghdr = 0x10 + SizeofNlMsgerr = 0x14 + SizeofRtGenmsg = 0x1 + SizeofNlAttr = 0x4 + SizeofRtAttr = 0x4 + SizeofIfInfomsg = 0x10 + SizeofIfAddrmsg = 0x8 + SizeofRtMsg = 0xc + SizeofRtNexthop = 0x8 ) type NlMsghdr struct { @@ -561,12 +579,12 @@ type RtAttr struct { } type IfInfomsg struct { - Family uint8 - X__ifi_pad uint8 - Type uint16 - Index int32 - Flags uint32 - Change uint32 + Family uint8 + _ uint8 + Type uint16 + Index int32 + Flags uint32 + Change uint32 } type IfAddrmsg struct { @@ -645,7 +663,7 @@ type Sysinfo_t struct { Totalhigh uint32 Freehigh uint32 Unit uint32 - X_f [8]uint8 + _ [8]uint8 } type Utsname struct { @@ -683,6 +701,8 @@ const ( AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x100 + + AT_EACCESS = 0x200 ) type PollFd struct { @@ -702,7 +722,7 @@ const ( ) type Sigset_t struct { - X__val [32]uint32 + Val [32]uint32 } const RNDGETENTCNT = 0x80045200 @@ -858,3 +878,966 @@ const ( BDADDR_LE_PUBLIC = 0x1 BDADDR_LE_RANDOM = 0x2 ) + +type PerfEventAttr struct { + Type uint32 + Size uint32 + Config uint64 + Sample uint64 + Sample_type uint64 + Read_format uint64 + Bits uint64 + Wakeup uint32 + Bp_type uint32 + Ext1 uint64 + Ext2 uint64 + Branch_sample_type uint64 + Sample_regs_user uint64 + Sample_stack_user uint32 + Clockid int32 + Sample_regs_intr uint64 + Aux_watermark uint32 + _ uint32 +} + +type PerfEventMmapPage struct { + Version uint32 + Compat_version uint32 + Lock uint32 + Index uint32 + Offset int64 + Time_enabled uint64 + Time_running uint64 + Capabilities uint64 + Pmc_width uint16 + Time_shift uint16 + Time_mult uint32 + Time_offset uint64 + Time_zero uint64 + Size uint32 + _ [948]uint8 + Data_head uint64 + Data_tail uint64 + Data_offset uint64 + Data_size uint64 + Aux_head uint64 + Aux_tail uint64 + Aux_offset uint64 + Aux_size uint64 +} + +const ( + PerfBitDisabled uint64 = CBitFieldMaskBit0 + PerfBitInherit = CBitFieldMaskBit1 + PerfBitPinned = CBitFieldMaskBit2 + PerfBitExclusive = CBitFieldMaskBit3 + PerfBitExcludeUser = CBitFieldMaskBit4 + PerfBitExcludeKernel = CBitFieldMaskBit5 + PerfBitExcludeHv = CBitFieldMaskBit6 + PerfBitExcludeIdle = CBitFieldMaskBit7 + PerfBitMmap = CBitFieldMaskBit8 + PerfBitComm = CBitFieldMaskBit9 + PerfBitFreq = CBitFieldMaskBit10 + PerfBitInheritStat = CBitFieldMaskBit11 + PerfBitEnableOnExec = CBitFieldMaskBit12 + PerfBitTask = CBitFieldMaskBit13 + PerfBitWatermark = CBitFieldMaskBit14 + PerfBitPreciseIPBit1 = CBitFieldMaskBit15 + PerfBitPreciseIPBit2 = CBitFieldMaskBit16 + PerfBitMmapData = CBitFieldMaskBit17 + PerfBitSampleIDAll = CBitFieldMaskBit18 + PerfBitExcludeHost = CBitFieldMaskBit19 + PerfBitExcludeGuest = CBitFieldMaskBit20 + PerfBitExcludeCallchainKernel = CBitFieldMaskBit21 + PerfBitExcludeCallchainUser = CBitFieldMaskBit22 + PerfBitMmap2 = CBitFieldMaskBit23 + PerfBitCommExec = CBitFieldMaskBit24 + PerfBitUseClockID = CBitFieldMaskBit25 + PerfBitContextSwitch = CBitFieldMaskBit26 +) + +const ( + PERF_TYPE_HARDWARE = 0x0 + PERF_TYPE_SOFTWARE = 0x1 + PERF_TYPE_TRACEPOINT = 0x2 + PERF_TYPE_HW_CACHE = 0x3 + PERF_TYPE_RAW = 0x4 + PERF_TYPE_BREAKPOINT = 0x5 + + PERF_COUNT_HW_CPU_CYCLES = 0x0 + PERF_COUNT_HW_INSTRUCTIONS = 0x1 + PERF_COUNT_HW_CACHE_REFERENCES = 0x2 + PERF_COUNT_HW_CACHE_MISSES = 0x3 + PERF_COUNT_HW_BRANCH_INSTRUCTIONS = 0x4 + PERF_COUNT_HW_BRANCH_MISSES = 0x5 + PERF_COUNT_HW_BUS_CYCLES = 0x6 + PERF_COUNT_HW_STALLED_CYCLES_FRONTEND = 0x7 + PERF_COUNT_HW_STALLED_CYCLES_BACKEND = 0x8 + PERF_COUNT_HW_REF_CPU_CYCLES = 0x9 + + PERF_COUNT_HW_CACHE_L1D = 0x0 + PERF_COUNT_HW_CACHE_L1I = 0x1 + PERF_COUNT_HW_CACHE_LL = 0x2 + PERF_COUNT_HW_CACHE_DTLB = 0x3 + PERF_COUNT_HW_CACHE_ITLB = 0x4 + PERF_COUNT_HW_CACHE_BPU = 0x5 + PERF_COUNT_HW_CACHE_NODE = 0x6 + + PERF_COUNT_HW_CACHE_OP_READ = 0x0 + PERF_COUNT_HW_CACHE_OP_WRITE = 0x1 + PERF_COUNT_HW_CACHE_OP_PREFETCH = 0x2 + + PERF_COUNT_HW_CACHE_RESULT_ACCESS = 0x0 + PERF_COUNT_HW_CACHE_RESULT_MISS = 0x1 + + PERF_COUNT_SW_CPU_CLOCK = 0x0 + PERF_COUNT_SW_TASK_CLOCK = 0x1 + PERF_COUNT_SW_PAGE_FAULTS = 0x2 + PERF_COUNT_SW_CONTEXT_SWITCHES = 0x3 + PERF_COUNT_SW_CPU_MIGRATIONS = 0x4 + PERF_COUNT_SW_PAGE_FAULTS_MIN = 0x5 + PERF_COUNT_SW_PAGE_FAULTS_MAJ = 0x6 + PERF_COUNT_SW_ALIGNMENT_FAULTS = 0x7 + PERF_COUNT_SW_EMULATION_FAULTS = 0x8 + PERF_COUNT_SW_DUMMY = 0x9 + + PERF_SAMPLE_IP = 0x1 + PERF_SAMPLE_TID = 0x2 + PERF_SAMPLE_TIME = 0x4 + PERF_SAMPLE_ADDR = 0x8 + PERF_SAMPLE_READ = 0x10 + PERF_SAMPLE_CALLCHAIN = 0x20 + PERF_SAMPLE_ID = 0x40 + PERF_SAMPLE_CPU = 0x80 + PERF_SAMPLE_PERIOD = 0x100 + PERF_SAMPLE_STREAM_ID = 0x200 + PERF_SAMPLE_RAW = 0x400 + PERF_SAMPLE_BRANCH_STACK = 0x800 + + PERF_SAMPLE_BRANCH_USER = 0x1 + PERF_SAMPLE_BRANCH_KERNEL = 0x2 + PERF_SAMPLE_BRANCH_HV = 0x4 + PERF_SAMPLE_BRANCH_ANY = 0x8 + PERF_SAMPLE_BRANCH_ANY_CALL = 0x10 + PERF_SAMPLE_BRANCH_ANY_RETURN = 0x20 + PERF_SAMPLE_BRANCH_IND_CALL = 0x40 + + PERF_FORMAT_TOTAL_TIME_ENABLED = 0x1 + PERF_FORMAT_TOTAL_TIME_RUNNING = 0x2 + PERF_FORMAT_ID = 0x4 + PERF_FORMAT_GROUP = 0x8 + + PERF_RECORD_MMAP = 0x1 + PERF_RECORD_LOST = 0x2 + PERF_RECORD_COMM = 0x3 + PERF_RECORD_EXIT = 0x4 + PERF_RECORD_THROTTLE = 0x5 + PERF_RECORD_UNTHROTTLE = 0x6 + PERF_RECORD_FORK = 0x7 + PERF_RECORD_READ = 0x8 + PERF_RECORD_SAMPLE = 0x9 + + PERF_CONTEXT_HV = -0x20 + PERF_CONTEXT_KERNEL = -0x80 + PERF_CONTEXT_USER = -0x200 + + PERF_CONTEXT_GUEST = -0x800 + PERF_CONTEXT_GUEST_KERNEL = -0x880 + PERF_CONTEXT_GUEST_USER = -0xa00 + + PERF_FLAG_FD_NO_GROUP = 0x1 + PERF_FLAG_FD_OUTPUT = 0x2 + PERF_FLAG_PID_CGROUP = 0x4 +) + +const ( + CBitFieldMaskBit0 = 0x1 + CBitFieldMaskBit1 = 0x2 + CBitFieldMaskBit2 = 0x4 + CBitFieldMaskBit3 = 0x8 + CBitFieldMaskBit4 = 0x10 + CBitFieldMaskBit5 = 0x20 + CBitFieldMaskBit6 = 0x40 + CBitFieldMaskBit7 = 0x80 + CBitFieldMaskBit8 = 0x100 + CBitFieldMaskBit9 = 0x200 + CBitFieldMaskBit10 = 0x400 + CBitFieldMaskBit11 = 0x800 + CBitFieldMaskBit12 = 0x1000 + CBitFieldMaskBit13 = 0x2000 + CBitFieldMaskBit14 = 0x4000 + CBitFieldMaskBit15 = 0x8000 + CBitFieldMaskBit16 = 0x10000 + CBitFieldMaskBit17 = 0x20000 + CBitFieldMaskBit18 = 0x40000 + CBitFieldMaskBit19 = 0x80000 + CBitFieldMaskBit20 = 0x100000 + CBitFieldMaskBit21 = 0x200000 + CBitFieldMaskBit22 = 0x400000 + CBitFieldMaskBit23 = 0x800000 + CBitFieldMaskBit24 = 0x1000000 + CBitFieldMaskBit25 = 0x2000000 + CBitFieldMaskBit26 = 0x4000000 + CBitFieldMaskBit27 = 0x8000000 + CBitFieldMaskBit28 = 0x10000000 + CBitFieldMaskBit29 = 0x20000000 + CBitFieldMaskBit30 = 0x40000000 + CBitFieldMaskBit31 = 0x80000000 + CBitFieldMaskBit32 = 0x100000000 + CBitFieldMaskBit33 = 0x200000000 + CBitFieldMaskBit34 = 0x400000000 + CBitFieldMaskBit35 = 0x800000000 + CBitFieldMaskBit36 = 0x1000000000 + CBitFieldMaskBit37 = 0x2000000000 + CBitFieldMaskBit38 = 0x4000000000 + CBitFieldMaskBit39 = 0x8000000000 + CBitFieldMaskBit40 = 0x10000000000 + CBitFieldMaskBit41 = 0x20000000000 + CBitFieldMaskBit42 = 0x40000000000 + CBitFieldMaskBit43 = 0x80000000000 + CBitFieldMaskBit44 = 0x100000000000 + CBitFieldMaskBit45 = 0x200000000000 + CBitFieldMaskBit46 = 0x400000000000 + CBitFieldMaskBit47 = 0x800000000000 + CBitFieldMaskBit48 = 0x1000000000000 + CBitFieldMaskBit49 = 0x2000000000000 + CBitFieldMaskBit50 = 0x4000000000000 + CBitFieldMaskBit51 = 0x8000000000000 + CBitFieldMaskBit52 = 0x10000000000000 + CBitFieldMaskBit53 = 0x20000000000000 + CBitFieldMaskBit54 = 0x40000000000000 + CBitFieldMaskBit55 = 0x80000000000000 + CBitFieldMaskBit56 = 0x100000000000000 + CBitFieldMaskBit57 = 0x200000000000000 + CBitFieldMaskBit58 = 0x400000000000000 + CBitFieldMaskBit59 = 0x800000000000000 + CBitFieldMaskBit60 = 0x1000000000000000 + CBitFieldMaskBit61 = 0x2000000000000000 + CBitFieldMaskBit62 = 0x4000000000000000 + CBitFieldMaskBit63 = 0x8000000000000000 +) + +type SockaddrStorage struct { + Family uint16 + _ [122]uint8 + _ uint32 +} + +type TCPMD5Sig struct { + Addr SockaddrStorage + Flags uint8 + Prefixlen uint8 + Keylen uint16 + _ uint32 + Key [80]uint8 +} + +type HDDriveCmdHdr struct { + Command uint8 + Number uint8 + Feature uint8 + Count uint8 +} + +type HDGeometry struct { + Heads uint8 + Sectors uint8 + Cylinders uint16 + Start uint32 +} + +type HDDriveID struct { + Config uint16 + Cyls uint16 + Reserved2 uint16 + Heads uint16 + Track_bytes uint16 + Sector_bytes uint16 + Sectors uint16 + Vendor0 uint16 + Vendor1 uint16 + Vendor2 uint16 + Serial_no [20]uint8 + Buf_type uint16 + Buf_size uint16 + Ecc_bytes uint16 + Fw_rev [8]uint8 + Model [40]uint8 + Max_multsect uint8 + Vendor3 uint8 + Dword_io uint16 + Vendor4 uint8 + Capability uint8 + Reserved50 uint16 + Vendor5 uint8 + TPIO uint8 + Vendor6 uint8 + TDMA uint8 + Field_valid uint16 + Cur_cyls uint16 + Cur_heads uint16 + Cur_sectors uint16 + Cur_capacity0 uint16 + Cur_capacity1 uint16 + Multsect uint8 + Multsect_valid uint8 + Lba_capacity uint32 + Dma_1word uint16 + Dma_mword uint16 + Eide_pio_modes uint16 + Eide_dma_min uint16 + Eide_dma_time uint16 + Eide_pio uint16 + Eide_pio_iordy uint16 + Words69_70 [2]uint16 + Words71_74 [4]uint16 + Queue_depth uint16 + Words76_79 [4]uint16 + Major_rev_num uint16 + Minor_rev_num uint16 + Command_set_1 uint16 + Command_set_2 uint16 + Cfsse uint16 + Cfs_enable_1 uint16 + Cfs_enable_2 uint16 + Csf_default uint16 + Dma_ultra uint16 + Trseuc uint16 + TrsEuc uint16 + CurAPMvalues uint16 + Mprc uint16 + Hw_config uint16 + Acoustic uint16 + Msrqs uint16 + Sxfert uint16 + Sal uint16 + Spg uint32 + Lba_capacity_2 uint64 + Words104_125 [22]uint16 + Last_lun uint16 + Word127 uint16 + Dlf uint16 + Csfo uint16 + Words130_155 [26]uint16 + Word156 uint16 + Words157_159 [3]uint16 + Cfa_power uint16 + Words161_175 [15]uint16 + Words176_205 [30]uint16 + Words206_254 [49]uint16 + Integrity_word uint16 +} + +type Statfs_t struct { + Type int32 + Bsize int32 + Blocks uint64 + Bfree uint64 + Bavail uint64 + Files uint64 + Ffree uint64 + Fsid Fsid + Namelen int32 + Frsize int32 + Flags int32 + Spare [4]int32 + _ [4]byte +} + +const ( + ST_MANDLOCK = 0x40 + ST_NOATIME = 0x400 + ST_NODEV = 0x4 + ST_NODIRATIME = 0x800 + ST_NOEXEC = 0x8 + ST_NOSUID = 0x2 + ST_RDONLY = 0x1 + ST_RELATIME = 0x1000 + ST_SYNCHRONOUS = 0x10 +) + +type TpacketHdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Usec uint32 +} + +type Tpacket2Hdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Nsec uint32 + Vlan_tci uint16 + Vlan_tpid uint16 + _ [4]uint8 +} + +type Tpacket3Hdr struct { + Next_offset uint32 + Sec uint32 + Nsec uint32 + Snaplen uint32 + Len uint32 + Status uint32 + Mac uint16 + Net uint16 + Hv1 TpacketHdrVariant1 + _ [8]uint8 +} + +type TpacketHdrVariant1 struct { + Rxhash uint32 + Vlan_tci uint32 + Vlan_tpid uint16 + _ uint16 +} + +type TpacketBlockDesc struct { + Version uint32 + To_priv uint32 + Hdr [40]byte +} + +type TpacketReq struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 +} + +type TpacketReq3 struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 + Retire_blk_tov uint32 + Sizeof_priv uint32 + Feature_req_word uint32 +} + +type TpacketStats struct { + Packets uint32 + Drops uint32 +} + +type TpacketStatsV3 struct { + Packets uint32 + Drops uint32 + Freeze_q_cnt uint32 +} + +type TpacketAuxdata struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Vlan_tci uint16 + Vlan_tpid uint16 +} + +const ( + TPACKET_V1 = 0x0 + TPACKET_V2 = 0x1 + TPACKET_V3 = 0x2 +) + +const ( + SizeofTpacketHdr = 0x18 + SizeofTpacket2Hdr = 0x20 + SizeofTpacket3Hdr = 0x30 +) + +const ( + NF_INET_PRE_ROUTING = 0x0 + NF_INET_LOCAL_IN = 0x1 + NF_INET_FORWARD = 0x2 + NF_INET_LOCAL_OUT = 0x3 + NF_INET_POST_ROUTING = 0x4 + NF_INET_NUMHOOKS = 0x5 +) + +const ( + NF_NETDEV_INGRESS = 0x0 + NF_NETDEV_NUMHOOKS = 0x1 +) + +const ( + NFPROTO_UNSPEC = 0x0 + NFPROTO_INET = 0x1 + NFPROTO_IPV4 = 0x2 + NFPROTO_ARP = 0x3 + NFPROTO_NETDEV = 0x5 + NFPROTO_BRIDGE = 0x7 + NFPROTO_IPV6 = 0xa + NFPROTO_DECNET = 0xc + NFPROTO_NUMPROTO = 0xd +) + +type Nfgenmsg struct { + Nfgen_family uint8 + Version uint8 + Res_id uint16 +} + +const ( + NFNL_BATCH_UNSPEC = 0x0 + NFNL_BATCH_GENID = 0x1 +) + +const ( + NFT_REG_VERDICT = 0x0 + NFT_REG_1 = 0x1 + NFT_REG_2 = 0x2 + NFT_REG_3 = 0x3 + NFT_REG_4 = 0x4 + NFT_REG32_00 = 0x8 + NFT_REG32_01 = 0x9 + NFT_REG32_02 = 0xa + NFT_REG32_03 = 0xb + NFT_REG32_04 = 0xc + NFT_REG32_05 = 0xd + NFT_REG32_06 = 0xe + NFT_REG32_07 = 0xf + NFT_REG32_08 = 0x10 + NFT_REG32_09 = 0x11 + NFT_REG32_10 = 0x12 + NFT_REG32_11 = 0x13 + NFT_REG32_12 = 0x14 + NFT_REG32_13 = 0x15 + NFT_REG32_14 = 0x16 + NFT_REG32_15 = 0x17 + NFT_CONTINUE = -0x1 + NFT_BREAK = -0x2 + NFT_JUMP = -0x3 + NFT_GOTO = -0x4 + NFT_RETURN = -0x5 + NFT_MSG_NEWTABLE = 0x0 + NFT_MSG_GETTABLE = 0x1 + NFT_MSG_DELTABLE = 0x2 + NFT_MSG_NEWCHAIN = 0x3 + NFT_MSG_GETCHAIN = 0x4 + NFT_MSG_DELCHAIN = 0x5 + NFT_MSG_NEWRULE = 0x6 + NFT_MSG_GETRULE = 0x7 + NFT_MSG_DELRULE = 0x8 + NFT_MSG_NEWSET = 0x9 + NFT_MSG_GETSET = 0xa + NFT_MSG_DELSET = 0xb + NFT_MSG_NEWSETELEM = 0xc + NFT_MSG_GETSETELEM = 0xd + NFT_MSG_DELSETELEM = 0xe + NFT_MSG_NEWGEN = 0xf + NFT_MSG_GETGEN = 0x10 + NFT_MSG_TRACE = 0x11 + NFT_MSG_NEWOBJ = 0x12 + NFT_MSG_GETOBJ = 0x13 + NFT_MSG_DELOBJ = 0x14 + NFT_MSG_GETOBJ_RESET = 0x15 + NFT_MSG_MAX = 0x19 + NFTA_LIST_UNPEC = 0x0 + NFTA_LIST_ELEM = 0x1 + NFTA_HOOK_UNSPEC = 0x0 + NFTA_HOOK_HOOKNUM = 0x1 + NFTA_HOOK_PRIORITY = 0x2 + NFTA_HOOK_DEV = 0x3 + NFT_TABLE_F_DORMANT = 0x1 + NFTA_TABLE_UNSPEC = 0x0 + NFTA_TABLE_NAME = 0x1 + NFTA_TABLE_FLAGS = 0x2 + NFTA_TABLE_USE = 0x3 + NFTA_CHAIN_UNSPEC = 0x0 + NFTA_CHAIN_TABLE = 0x1 + NFTA_CHAIN_HANDLE = 0x2 + NFTA_CHAIN_NAME = 0x3 + NFTA_CHAIN_HOOK = 0x4 + NFTA_CHAIN_POLICY = 0x5 + NFTA_CHAIN_USE = 0x6 + NFTA_CHAIN_TYPE = 0x7 + NFTA_CHAIN_COUNTERS = 0x8 + NFTA_CHAIN_PAD = 0x9 + NFTA_RULE_UNSPEC = 0x0 + NFTA_RULE_TABLE = 0x1 + NFTA_RULE_CHAIN = 0x2 + NFTA_RULE_HANDLE = 0x3 + NFTA_RULE_EXPRESSIONS = 0x4 + NFTA_RULE_COMPAT = 0x5 + NFTA_RULE_POSITION = 0x6 + NFTA_RULE_USERDATA = 0x7 + NFTA_RULE_PAD = 0x8 + NFTA_RULE_ID = 0x9 + NFT_RULE_COMPAT_F_INV = 0x2 + NFT_RULE_COMPAT_F_MASK = 0x2 + NFTA_RULE_COMPAT_UNSPEC = 0x0 + NFTA_RULE_COMPAT_PROTO = 0x1 + NFTA_RULE_COMPAT_FLAGS = 0x2 + NFT_SET_ANONYMOUS = 0x1 + NFT_SET_CONSTANT = 0x2 + NFT_SET_INTERVAL = 0x4 + NFT_SET_MAP = 0x8 + NFT_SET_TIMEOUT = 0x10 + NFT_SET_EVAL = 0x20 + NFT_SET_OBJECT = 0x40 + NFT_SET_POL_PERFORMANCE = 0x0 + NFT_SET_POL_MEMORY = 0x1 + NFTA_SET_DESC_UNSPEC = 0x0 + NFTA_SET_DESC_SIZE = 0x1 + NFTA_SET_UNSPEC = 0x0 + NFTA_SET_TABLE = 0x1 + NFTA_SET_NAME = 0x2 + NFTA_SET_FLAGS = 0x3 + NFTA_SET_KEY_TYPE = 0x4 + NFTA_SET_KEY_LEN = 0x5 + NFTA_SET_DATA_TYPE = 0x6 + NFTA_SET_DATA_LEN = 0x7 + NFTA_SET_POLICY = 0x8 + NFTA_SET_DESC = 0x9 + NFTA_SET_ID = 0xa + NFTA_SET_TIMEOUT = 0xb + NFTA_SET_GC_INTERVAL = 0xc + NFTA_SET_USERDATA = 0xd + NFTA_SET_PAD = 0xe + NFTA_SET_OBJ_TYPE = 0xf + NFT_SET_ELEM_INTERVAL_END = 0x1 + NFTA_SET_ELEM_UNSPEC = 0x0 + NFTA_SET_ELEM_KEY = 0x1 + NFTA_SET_ELEM_DATA = 0x2 + NFTA_SET_ELEM_FLAGS = 0x3 + NFTA_SET_ELEM_TIMEOUT = 0x4 + NFTA_SET_ELEM_EXPIRATION = 0x5 + NFTA_SET_ELEM_USERDATA = 0x6 + NFTA_SET_ELEM_EXPR = 0x7 + NFTA_SET_ELEM_PAD = 0x8 + NFTA_SET_ELEM_OBJREF = 0x9 + NFTA_SET_ELEM_LIST_UNSPEC = 0x0 + NFTA_SET_ELEM_LIST_TABLE = 0x1 + NFTA_SET_ELEM_LIST_SET = 0x2 + NFTA_SET_ELEM_LIST_ELEMENTS = 0x3 + NFTA_SET_ELEM_LIST_SET_ID = 0x4 + NFT_DATA_VALUE = 0x0 + NFT_DATA_VERDICT = 0xffffff00 + NFTA_DATA_UNSPEC = 0x0 + NFTA_DATA_VALUE = 0x1 + NFTA_DATA_VERDICT = 0x2 + NFTA_VERDICT_UNSPEC = 0x0 + NFTA_VERDICT_CODE = 0x1 + NFTA_VERDICT_CHAIN = 0x2 + NFTA_EXPR_UNSPEC = 0x0 + NFTA_EXPR_NAME = 0x1 + NFTA_EXPR_DATA = 0x2 + NFTA_IMMEDIATE_UNSPEC = 0x0 + NFTA_IMMEDIATE_DREG = 0x1 + NFTA_IMMEDIATE_DATA = 0x2 + NFTA_BITWISE_UNSPEC = 0x0 + NFTA_BITWISE_SREG = 0x1 + NFTA_BITWISE_DREG = 0x2 + NFTA_BITWISE_LEN = 0x3 + NFTA_BITWISE_MASK = 0x4 + NFTA_BITWISE_XOR = 0x5 + NFT_BYTEORDER_NTOH = 0x0 + NFT_BYTEORDER_HTON = 0x1 + NFTA_BYTEORDER_UNSPEC = 0x0 + NFTA_BYTEORDER_SREG = 0x1 + NFTA_BYTEORDER_DREG = 0x2 + NFTA_BYTEORDER_OP = 0x3 + NFTA_BYTEORDER_LEN = 0x4 + NFTA_BYTEORDER_SIZE = 0x5 + NFT_CMP_EQ = 0x0 + NFT_CMP_NEQ = 0x1 + NFT_CMP_LT = 0x2 + NFT_CMP_LTE = 0x3 + NFT_CMP_GT = 0x4 + NFT_CMP_GTE = 0x5 + NFTA_CMP_UNSPEC = 0x0 + NFTA_CMP_SREG = 0x1 + NFTA_CMP_OP = 0x2 + NFTA_CMP_DATA = 0x3 + NFT_RANGE_EQ = 0x0 + NFT_RANGE_NEQ = 0x1 + NFTA_RANGE_UNSPEC = 0x0 + NFTA_RANGE_SREG = 0x1 + NFTA_RANGE_OP = 0x2 + NFTA_RANGE_FROM_DATA = 0x3 + NFTA_RANGE_TO_DATA = 0x4 + NFT_LOOKUP_F_INV = 0x1 + NFTA_LOOKUP_UNSPEC = 0x0 + NFTA_LOOKUP_SET = 0x1 + NFTA_LOOKUP_SREG = 0x2 + NFTA_LOOKUP_DREG = 0x3 + NFTA_LOOKUP_SET_ID = 0x4 + NFTA_LOOKUP_FLAGS = 0x5 + NFT_DYNSET_OP_ADD = 0x0 + NFT_DYNSET_OP_UPDATE = 0x1 + NFT_DYNSET_F_INV = 0x1 + NFTA_DYNSET_UNSPEC = 0x0 + NFTA_DYNSET_SET_NAME = 0x1 + NFTA_DYNSET_SET_ID = 0x2 + NFTA_DYNSET_OP = 0x3 + NFTA_DYNSET_SREG_KEY = 0x4 + NFTA_DYNSET_SREG_DATA = 0x5 + NFTA_DYNSET_TIMEOUT = 0x6 + NFTA_DYNSET_EXPR = 0x7 + NFTA_DYNSET_PAD = 0x8 + NFTA_DYNSET_FLAGS = 0x9 + NFT_PAYLOAD_LL_HEADER = 0x0 + NFT_PAYLOAD_NETWORK_HEADER = 0x1 + NFT_PAYLOAD_TRANSPORT_HEADER = 0x2 + NFT_PAYLOAD_CSUM_NONE = 0x0 + NFT_PAYLOAD_CSUM_INET = 0x1 + NFT_PAYLOAD_L4CSUM_PSEUDOHDR = 0x1 + NFTA_PAYLOAD_UNSPEC = 0x0 + NFTA_PAYLOAD_DREG = 0x1 + NFTA_PAYLOAD_BASE = 0x2 + NFTA_PAYLOAD_OFFSET = 0x3 + NFTA_PAYLOAD_LEN = 0x4 + NFTA_PAYLOAD_SREG = 0x5 + NFTA_PAYLOAD_CSUM_TYPE = 0x6 + NFTA_PAYLOAD_CSUM_OFFSET = 0x7 + NFTA_PAYLOAD_CSUM_FLAGS = 0x8 + NFT_EXTHDR_F_PRESENT = 0x1 + NFT_EXTHDR_OP_IPV6 = 0x0 + NFT_EXTHDR_OP_TCPOPT = 0x1 + NFTA_EXTHDR_UNSPEC = 0x0 + NFTA_EXTHDR_DREG = 0x1 + NFTA_EXTHDR_TYPE = 0x2 + NFTA_EXTHDR_OFFSET = 0x3 + NFTA_EXTHDR_LEN = 0x4 + NFTA_EXTHDR_FLAGS = 0x5 + NFTA_EXTHDR_OP = 0x6 + NFTA_EXTHDR_SREG = 0x7 + NFT_META_LEN = 0x0 + NFT_META_PROTOCOL = 0x1 + NFT_META_PRIORITY = 0x2 + NFT_META_MARK = 0x3 + NFT_META_IIF = 0x4 + NFT_META_OIF = 0x5 + NFT_META_IIFNAME = 0x6 + NFT_META_OIFNAME = 0x7 + NFT_META_IIFTYPE = 0x8 + NFT_META_OIFTYPE = 0x9 + NFT_META_SKUID = 0xa + NFT_META_SKGID = 0xb + NFT_META_NFTRACE = 0xc + NFT_META_RTCLASSID = 0xd + NFT_META_SECMARK = 0xe + NFT_META_NFPROTO = 0xf + NFT_META_L4PROTO = 0x10 + NFT_META_BRI_IIFNAME = 0x11 + NFT_META_BRI_OIFNAME = 0x12 + NFT_META_PKTTYPE = 0x13 + NFT_META_CPU = 0x14 + NFT_META_IIFGROUP = 0x15 + NFT_META_OIFGROUP = 0x16 + NFT_META_CGROUP = 0x17 + NFT_META_PRANDOM = 0x18 + NFT_RT_CLASSID = 0x0 + NFT_RT_NEXTHOP4 = 0x1 + NFT_RT_NEXTHOP6 = 0x2 + NFT_RT_TCPMSS = 0x3 + NFT_HASH_JENKINS = 0x0 + NFT_HASH_SYM = 0x1 + NFTA_HASH_UNSPEC = 0x0 + NFTA_HASH_SREG = 0x1 + NFTA_HASH_DREG = 0x2 + NFTA_HASH_LEN = 0x3 + NFTA_HASH_MODULUS = 0x4 + NFTA_HASH_SEED = 0x5 + NFTA_HASH_OFFSET = 0x6 + NFTA_HASH_TYPE = 0x7 + NFTA_META_UNSPEC = 0x0 + NFTA_META_DREG = 0x1 + NFTA_META_KEY = 0x2 + NFTA_META_SREG = 0x3 + NFTA_RT_UNSPEC = 0x0 + NFTA_RT_DREG = 0x1 + NFTA_RT_KEY = 0x2 + NFT_CT_STATE = 0x0 + NFT_CT_DIRECTION = 0x1 + NFT_CT_STATUS = 0x2 + NFT_CT_MARK = 0x3 + NFT_CT_SECMARK = 0x4 + NFT_CT_EXPIRATION = 0x5 + NFT_CT_HELPER = 0x6 + NFT_CT_L3PROTOCOL = 0x7 + NFT_CT_SRC = 0x8 + NFT_CT_DST = 0x9 + NFT_CT_PROTOCOL = 0xa + NFT_CT_PROTO_SRC = 0xb + NFT_CT_PROTO_DST = 0xc + NFT_CT_LABELS = 0xd + NFT_CT_PKTS = 0xe + NFT_CT_BYTES = 0xf + NFT_CT_AVGPKT = 0x10 + NFT_CT_ZONE = 0x11 + NFT_CT_EVENTMASK = 0x12 + NFTA_CT_UNSPEC = 0x0 + NFTA_CT_DREG = 0x1 + NFTA_CT_KEY = 0x2 + NFTA_CT_DIRECTION = 0x3 + NFTA_CT_SREG = 0x4 + NFT_LIMIT_PKTS = 0x0 + NFT_LIMIT_PKT_BYTES = 0x1 + NFT_LIMIT_F_INV = 0x1 + NFTA_LIMIT_UNSPEC = 0x0 + NFTA_LIMIT_RATE = 0x1 + NFTA_LIMIT_UNIT = 0x2 + NFTA_LIMIT_BURST = 0x3 + NFTA_LIMIT_TYPE = 0x4 + NFTA_LIMIT_FLAGS = 0x5 + NFTA_LIMIT_PAD = 0x6 + NFTA_COUNTER_UNSPEC = 0x0 + NFTA_COUNTER_BYTES = 0x1 + NFTA_COUNTER_PACKETS = 0x2 + NFTA_COUNTER_PAD = 0x3 + NFTA_LOG_UNSPEC = 0x0 + NFTA_LOG_GROUP = 0x1 + NFTA_LOG_PREFIX = 0x2 + NFTA_LOG_SNAPLEN = 0x3 + NFTA_LOG_QTHRESHOLD = 0x4 + NFTA_LOG_LEVEL = 0x5 + NFTA_LOG_FLAGS = 0x6 + NFTA_QUEUE_UNSPEC = 0x0 + NFTA_QUEUE_NUM = 0x1 + NFTA_QUEUE_TOTAL = 0x2 + NFTA_QUEUE_FLAGS = 0x3 + NFTA_QUEUE_SREG_QNUM = 0x4 + NFT_QUOTA_F_INV = 0x1 + NFT_QUOTA_F_DEPLETED = 0x2 + NFTA_QUOTA_UNSPEC = 0x0 + NFTA_QUOTA_BYTES = 0x1 + NFTA_QUOTA_FLAGS = 0x2 + NFTA_QUOTA_PAD = 0x3 + NFTA_QUOTA_CONSUMED = 0x4 + NFT_REJECT_ICMP_UNREACH = 0x0 + NFT_REJECT_TCP_RST = 0x1 + NFT_REJECT_ICMPX_UNREACH = 0x2 + NFT_REJECT_ICMPX_NO_ROUTE = 0x0 + NFT_REJECT_ICMPX_PORT_UNREACH = 0x1 + NFT_REJECT_ICMPX_HOST_UNREACH = 0x2 + NFT_REJECT_ICMPX_ADMIN_PROHIBITED = 0x3 + NFTA_REJECT_UNSPEC = 0x0 + NFTA_REJECT_TYPE = 0x1 + NFTA_REJECT_ICMP_CODE = 0x2 + NFT_NAT_SNAT = 0x0 + NFT_NAT_DNAT = 0x1 + NFTA_NAT_UNSPEC = 0x0 + NFTA_NAT_TYPE = 0x1 + NFTA_NAT_FAMILY = 0x2 + NFTA_NAT_REG_ADDR_MIN = 0x3 + NFTA_NAT_REG_ADDR_MAX = 0x4 + NFTA_NAT_REG_PROTO_MIN = 0x5 + NFTA_NAT_REG_PROTO_MAX = 0x6 + NFTA_NAT_FLAGS = 0x7 + NFTA_MASQ_UNSPEC = 0x0 + NFTA_MASQ_FLAGS = 0x1 + NFTA_MASQ_REG_PROTO_MIN = 0x2 + NFTA_MASQ_REG_PROTO_MAX = 0x3 + NFTA_REDIR_UNSPEC = 0x0 + NFTA_REDIR_REG_PROTO_MIN = 0x1 + NFTA_REDIR_REG_PROTO_MAX = 0x2 + NFTA_REDIR_FLAGS = 0x3 + NFTA_DUP_UNSPEC = 0x0 + NFTA_DUP_SREG_ADDR = 0x1 + NFTA_DUP_SREG_DEV = 0x2 + NFTA_FWD_UNSPEC = 0x0 + NFTA_FWD_SREG_DEV = 0x1 + NFTA_OBJREF_UNSPEC = 0x0 + NFTA_OBJREF_IMM_TYPE = 0x1 + NFTA_OBJREF_IMM_NAME = 0x2 + NFTA_OBJREF_SET_SREG = 0x3 + NFTA_OBJREF_SET_NAME = 0x4 + NFTA_OBJREF_SET_ID = 0x5 + NFTA_GEN_UNSPEC = 0x0 + NFTA_GEN_ID = 0x1 + NFTA_GEN_PROC_PID = 0x2 + NFTA_GEN_PROC_NAME = 0x3 + NFTA_FIB_UNSPEC = 0x0 + NFTA_FIB_DREG = 0x1 + NFTA_FIB_RESULT = 0x2 + NFTA_FIB_FLAGS = 0x3 + NFT_FIB_RESULT_UNSPEC = 0x0 + NFT_FIB_RESULT_OIF = 0x1 + NFT_FIB_RESULT_OIFNAME = 0x2 + NFT_FIB_RESULT_ADDRTYPE = 0x3 + NFTA_FIB_F_SADDR = 0x1 + NFTA_FIB_F_DADDR = 0x2 + NFTA_FIB_F_MARK = 0x4 + NFTA_FIB_F_IIF = 0x8 + NFTA_FIB_F_OIF = 0x10 + NFTA_FIB_F_PRESENT = 0x20 + NFTA_CT_HELPER_UNSPEC = 0x0 + NFTA_CT_HELPER_NAME = 0x1 + NFTA_CT_HELPER_L3PROTO = 0x2 + NFTA_CT_HELPER_L4PROTO = 0x3 + NFTA_OBJ_UNSPEC = 0x0 + NFTA_OBJ_TABLE = 0x1 + NFTA_OBJ_NAME = 0x2 + NFTA_OBJ_TYPE = 0x3 + NFTA_OBJ_DATA = 0x4 + NFTA_OBJ_USE = 0x5 + NFTA_TRACE_UNSPEC = 0x0 + NFTA_TRACE_TABLE = 0x1 + NFTA_TRACE_CHAIN = 0x2 + NFTA_TRACE_RULE_HANDLE = 0x3 + NFTA_TRACE_TYPE = 0x4 + NFTA_TRACE_VERDICT = 0x5 + NFTA_TRACE_ID = 0x6 + NFTA_TRACE_LL_HEADER = 0x7 + NFTA_TRACE_NETWORK_HEADER = 0x8 + NFTA_TRACE_TRANSPORT_HEADER = 0x9 + NFTA_TRACE_IIF = 0xa + NFTA_TRACE_IIFTYPE = 0xb + NFTA_TRACE_OIF = 0xc + NFTA_TRACE_OIFTYPE = 0xd + NFTA_TRACE_MARK = 0xe + NFTA_TRACE_NFPROTO = 0xf + NFTA_TRACE_POLICY = 0x10 + NFTA_TRACE_PAD = 0x11 + NFT_TRACETYPE_UNSPEC = 0x0 + NFT_TRACETYPE_POLICY = 0x1 + NFT_TRACETYPE_RETURN = 0x2 + NFT_TRACETYPE_RULE = 0x3 + NFTA_NG_UNSPEC = 0x0 + NFTA_NG_DREG = 0x1 + NFTA_NG_MODULUS = 0x2 + NFTA_NG_TYPE = 0x3 + NFTA_NG_OFFSET = 0x4 + NFT_NG_INCREMENTAL = 0x0 + NFT_NG_RANDOM = 0x1 +) + +type RTCTime struct { + Sec int32 + Min int32 + Hour int32 + Mday int32 + Mon int32 + Year int32 + Wday int32 + Yday int32 + Isdst int32 +} + +type RTCWkAlrm struct { + Enabled uint8 + Pending uint8 + _ [2]byte + Time RTCTime +} + +type RTCPLLInfo struct { + Ctrl int32 + Value int32 + Max int32 + Min int32 + Posmult int32 + Negmult int32 + Clock int32 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go index 0d0de46f6d..972c1b8723 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_arm64.go @@ -106,10 +106,10 @@ type Stat_t struct { Uid uint32 Gid uint32 Rdev uint64 - X__pad1 uint64 + _ uint64 Size int64 Blksize int32 - X__pad2 int32 + _ int32 Blocks int64 Atim Timespec Mtim Timespec @@ -117,25 +117,10 @@ type Stat_t struct { _ [2]int32 } -type Statfs_t struct { - Type int64 - Bsize int64 - Blocks uint64 - Bfree uint64 - Bavail uint64 - Files uint64 - Ffree uint64 - Fsid Fsid - Namelen int64 - Frsize int64 - Flags int64 - Spare [4]int64 -} - type StatxTimestamp struct { - Sec int64 - Nsec uint32 - X__reserved int32 + Sec int64 + Nsec uint32 + _ int32 } type Statx_t struct { @@ -172,7 +157,7 @@ type Dirent struct { } type Fsid struct { - X__val [2]int32 + Val [2]int32 } type Flock_t struct { @@ -266,6 +251,13 @@ type RawSockaddrL2 struct { _ [1]byte } +type RawSockaddrRFCOMM struct { + Family uint16 + Bdaddr [6]uint8 + Channel uint8 + _ [1]byte +} + type RawSockaddrCAN struct { Family uint16 _ [2]byte @@ -421,6 +413,7 @@ const ( SizeofSockaddrNetlink = 0xc SizeofSockaddrHCI = 0x6 SizeofSockaddrL2 = 0xe + SizeofSockaddrRFCOMM = 0xa SizeofSockaddrCAN = 0x10 SizeofSockaddrALG = 0x58 SizeofSockaddrVM = 0x10 @@ -441,97 +434,123 @@ const ( ) const ( - IFA_UNSPEC = 0x0 - IFA_ADDRESS = 0x1 - IFA_LOCAL = 0x2 - IFA_LABEL = 0x3 - IFA_BROADCAST = 0x4 - IFA_ANYCAST = 0x5 - IFA_CACHEINFO = 0x6 - IFA_MULTICAST = 0x7 - IFLA_UNSPEC = 0x0 - IFLA_ADDRESS = 0x1 - IFLA_BROADCAST = 0x2 - IFLA_IFNAME = 0x3 - IFLA_MTU = 0x4 - IFLA_LINK = 0x5 - IFLA_QDISC = 0x6 - IFLA_STATS = 0x7 - IFLA_COST = 0x8 - IFLA_PRIORITY = 0x9 - IFLA_MASTER = 0xa - IFLA_WIRELESS = 0xb - IFLA_PROTINFO = 0xc - IFLA_TXQLEN = 0xd - IFLA_MAP = 0xe - IFLA_WEIGHT = 0xf - IFLA_OPERSTATE = 0x10 - IFLA_LINKMODE = 0x11 - IFLA_LINKINFO = 0x12 - IFLA_NET_NS_PID = 0x13 - IFLA_IFALIAS = 0x14 - IFLA_MAX = 0x2c - RT_SCOPE_UNIVERSE = 0x0 - RT_SCOPE_SITE = 0xc8 - RT_SCOPE_LINK = 0xfd - RT_SCOPE_HOST = 0xfe - RT_SCOPE_NOWHERE = 0xff - RT_TABLE_UNSPEC = 0x0 - RT_TABLE_COMPAT = 0xfc - RT_TABLE_DEFAULT = 0xfd - RT_TABLE_MAIN = 0xfe - RT_TABLE_LOCAL = 0xff - RT_TABLE_MAX = 0xffffffff - RTA_UNSPEC = 0x0 - RTA_DST = 0x1 - RTA_SRC = 0x2 - RTA_IIF = 0x3 - RTA_OIF = 0x4 - RTA_GATEWAY = 0x5 - RTA_PRIORITY = 0x6 - RTA_PREFSRC = 0x7 - RTA_METRICS = 0x8 - RTA_MULTIPATH = 0x9 - RTA_FLOW = 0xb - RTA_CACHEINFO = 0xc - RTA_TABLE = 0xf - RTN_UNSPEC = 0x0 - RTN_UNICAST = 0x1 - RTN_LOCAL = 0x2 - RTN_BROADCAST = 0x3 - RTN_ANYCAST = 0x4 - RTN_MULTICAST = 0x5 - RTN_BLACKHOLE = 0x6 - RTN_UNREACHABLE = 0x7 - RTN_PROHIBIT = 0x8 - RTN_THROW = 0x9 - RTN_NAT = 0xa - RTN_XRESOLVE = 0xb - RTNLGRP_NONE = 0x0 - RTNLGRP_LINK = 0x1 - RTNLGRP_NOTIFY = 0x2 - RTNLGRP_NEIGH = 0x3 - RTNLGRP_TC = 0x4 - RTNLGRP_IPV4_IFADDR = 0x5 - RTNLGRP_IPV4_MROUTE = 0x6 - RTNLGRP_IPV4_ROUTE = 0x7 - RTNLGRP_IPV4_RULE = 0x8 - RTNLGRP_IPV6_IFADDR = 0x9 - RTNLGRP_IPV6_MROUTE = 0xa - RTNLGRP_IPV6_ROUTE = 0xb - RTNLGRP_IPV6_IFINFO = 0xc - RTNLGRP_IPV6_PREFIX = 0x12 - RTNLGRP_IPV6_RULE = 0x13 - RTNLGRP_ND_USEROPT = 0x14 - SizeofNlMsghdr = 0x10 - SizeofNlMsgerr = 0x14 - SizeofRtGenmsg = 0x1 - SizeofNlAttr = 0x4 - SizeofRtAttr = 0x4 - SizeofIfInfomsg = 0x10 - SizeofIfAddrmsg = 0x8 - SizeofRtMsg = 0xc - SizeofRtNexthop = 0x8 + IFA_UNSPEC = 0x0 + IFA_ADDRESS = 0x1 + IFA_LOCAL = 0x2 + IFA_LABEL = 0x3 + IFA_BROADCAST = 0x4 + IFA_ANYCAST = 0x5 + IFA_CACHEINFO = 0x6 + IFA_MULTICAST = 0x7 + IFLA_UNSPEC = 0x0 + IFLA_ADDRESS = 0x1 + IFLA_BROADCAST = 0x2 + IFLA_IFNAME = 0x3 + IFLA_MTU = 0x4 + IFLA_LINK = 0x5 + IFLA_QDISC = 0x6 + IFLA_STATS = 0x7 + IFLA_COST = 0x8 + IFLA_PRIORITY = 0x9 + IFLA_MASTER = 0xa + IFLA_WIRELESS = 0xb + IFLA_PROTINFO = 0xc + IFLA_TXQLEN = 0xd + IFLA_MAP = 0xe + IFLA_WEIGHT = 0xf + IFLA_OPERSTATE = 0x10 + IFLA_LINKMODE = 0x11 + IFLA_LINKINFO = 0x12 + IFLA_NET_NS_PID = 0x13 + IFLA_IFALIAS = 0x14 + IFLA_NUM_VF = 0x15 + IFLA_VFINFO_LIST = 0x16 + IFLA_STATS64 = 0x17 + IFLA_VF_PORTS = 0x18 + IFLA_PORT_SELF = 0x19 + IFLA_AF_SPEC = 0x1a + IFLA_GROUP = 0x1b + IFLA_NET_NS_FD = 0x1c + IFLA_EXT_MASK = 0x1d + IFLA_PROMISCUITY = 0x1e + IFLA_NUM_TX_QUEUES = 0x1f + IFLA_NUM_RX_QUEUES = 0x20 + IFLA_CARRIER = 0x21 + IFLA_PHYS_PORT_ID = 0x22 + IFLA_CARRIER_CHANGES = 0x23 + IFLA_PHYS_SWITCH_ID = 0x24 + IFLA_LINK_NETNSID = 0x25 + IFLA_PHYS_PORT_NAME = 0x26 + IFLA_PROTO_DOWN = 0x27 + IFLA_GSO_MAX_SEGS = 0x28 + IFLA_GSO_MAX_SIZE = 0x29 + IFLA_PAD = 0x2a + IFLA_XDP = 0x2b + IFLA_EVENT = 0x2c + IFLA_NEW_NETNSID = 0x2d + IFLA_IF_NETNSID = 0x2e + IFLA_MAX = 0x31 + RT_SCOPE_UNIVERSE = 0x0 + RT_SCOPE_SITE = 0xc8 + RT_SCOPE_LINK = 0xfd + RT_SCOPE_HOST = 0xfe + RT_SCOPE_NOWHERE = 0xff + RT_TABLE_UNSPEC = 0x0 + RT_TABLE_COMPAT = 0xfc + RT_TABLE_DEFAULT = 0xfd + RT_TABLE_MAIN = 0xfe + RT_TABLE_LOCAL = 0xff + RT_TABLE_MAX = 0xffffffff + RTA_UNSPEC = 0x0 + RTA_DST = 0x1 + RTA_SRC = 0x2 + RTA_IIF = 0x3 + RTA_OIF = 0x4 + RTA_GATEWAY = 0x5 + RTA_PRIORITY = 0x6 + RTA_PREFSRC = 0x7 + RTA_METRICS = 0x8 + RTA_MULTIPATH = 0x9 + RTA_FLOW = 0xb + RTA_CACHEINFO = 0xc + RTA_TABLE = 0xf + RTN_UNSPEC = 0x0 + RTN_UNICAST = 0x1 + RTN_LOCAL = 0x2 + RTN_BROADCAST = 0x3 + RTN_ANYCAST = 0x4 + RTN_MULTICAST = 0x5 + RTN_BLACKHOLE = 0x6 + RTN_UNREACHABLE = 0x7 + RTN_PROHIBIT = 0x8 + RTN_THROW = 0x9 + RTN_NAT = 0xa + RTN_XRESOLVE = 0xb + RTNLGRP_NONE = 0x0 + RTNLGRP_LINK = 0x1 + RTNLGRP_NOTIFY = 0x2 + RTNLGRP_NEIGH = 0x3 + RTNLGRP_TC = 0x4 + RTNLGRP_IPV4_IFADDR = 0x5 + RTNLGRP_IPV4_MROUTE = 0x6 + RTNLGRP_IPV4_ROUTE = 0x7 + RTNLGRP_IPV4_RULE = 0x8 + RTNLGRP_IPV6_IFADDR = 0x9 + RTNLGRP_IPV6_MROUTE = 0xa + RTNLGRP_IPV6_ROUTE = 0xb + RTNLGRP_IPV6_IFINFO = 0xc + RTNLGRP_IPV6_PREFIX = 0x12 + RTNLGRP_IPV6_RULE = 0x13 + RTNLGRP_ND_USEROPT = 0x14 + SizeofNlMsghdr = 0x10 + SizeofNlMsgerr = 0x14 + SizeofRtGenmsg = 0x1 + SizeofNlAttr = 0x4 + SizeofRtAttr = 0x4 + SizeofIfInfomsg = 0x10 + SizeofIfAddrmsg = 0x8 + SizeofRtMsg = 0xc + SizeofRtNexthop = 0x8 ) type NlMsghdr struct { @@ -562,12 +581,12 @@ type RtAttr struct { } type IfInfomsg struct { - Family uint8 - X__ifi_pad uint8 - Type uint16 - Index int32 - Flags uint32 - Change uint32 + Family uint8 + _ uint8 + Type uint16 + Index int32 + Flags uint32 + Change uint32 } type IfAddrmsg struct { @@ -650,7 +669,7 @@ type Sysinfo_t struct { Totalhigh uint64 Freehigh uint64 Unit uint32 - X_f [0]int8 + _ [0]int8 _ [4]byte } @@ -691,6 +710,8 @@ const ( AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x100 + + AT_EACCESS = 0x200 ) type PollFd struct { @@ -710,7 +731,7 @@ const ( ) type Sigset_t struct { - X__val [16]uint64 + Val [16]uint64 } const RNDGETENTCNT = 0x80045200 @@ -866,3 +887,967 @@ const ( BDADDR_LE_PUBLIC = 0x1 BDADDR_LE_RANDOM = 0x2 ) + +type PerfEventAttr struct { + Type uint32 + Size uint32 + Config uint64 + Sample uint64 + Sample_type uint64 + Read_format uint64 + Bits uint64 + Wakeup uint32 + Bp_type uint32 + Ext1 uint64 + Ext2 uint64 + Branch_sample_type uint64 + Sample_regs_user uint64 + Sample_stack_user uint32 + Clockid int32 + Sample_regs_intr uint64 + Aux_watermark uint32 + _ uint32 +} + +type PerfEventMmapPage struct { + Version uint32 + Compat_version uint32 + Lock uint32 + Index uint32 + Offset int64 + Time_enabled uint64 + Time_running uint64 + Capabilities uint64 + Pmc_width uint16 + Time_shift uint16 + Time_mult uint32 + Time_offset uint64 + Time_zero uint64 + Size uint32 + _ [948]uint8 + Data_head uint64 + Data_tail uint64 + Data_offset uint64 + Data_size uint64 + Aux_head uint64 + Aux_tail uint64 + Aux_offset uint64 + Aux_size uint64 +} + +const ( + PerfBitDisabled uint64 = CBitFieldMaskBit0 + PerfBitInherit = CBitFieldMaskBit1 + PerfBitPinned = CBitFieldMaskBit2 + PerfBitExclusive = CBitFieldMaskBit3 + PerfBitExcludeUser = CBitFieldMaskBit4 + PerfBitExcludeKernel = CBitFieldMaskBit5 + PerfBitExcludeHv = CBitFieldMaskBit6 + PerfBitExcludeIdle = CBitFieldMaskBit7 + PerfBitMmap = CBitFieldMaskBit8 + PerfBitComm = CBitFieldMaskBit9 + PerfBitFreq = CBitFieldMaskBit10 + PerfBitInheritStat = CBitFieldMaskBit11 + PerfBitEnableOnExec = CBitFieldMaskBit12 + PerfBitTask = CBitFieldMaskBit13 + PerfBitWatermark = CBitFieldMaskBit14 + PerfBitPreciseIPBit1 = CBitFieldMaskBit15 + PerfBitPreciseIPBit2 = CBitFieldMaskBit16 + PerfBitMmapData = CBitFieldMaskBit17 + PerfBitSampleIDAll = CBitFieldMaskBit18 + PerfBitExcludeHost = CBitFieldMaskBit19 + PerfBitExcludeGuest = CBitFieldMaskBit20 + PerfBitExcludeCallchainKernel = CBitFieldMaskBit21 + PerfBitExcludeCallchainUser = CBitFieldMaskBit22 + PerfBitMmap2 = CBitFieldMaskBit23 + PerfBitCommExec = CBitFieldMaskBit24 + PerfBitUseClockID = CBitFieldMaskBit25 + PerfBitContextSwitch = CBitFieldMaskBit26 +) + +const ( + PERF_TYPE_HARDWARE = 0x0 + PERF_TYPE_SOFTWARE = 0x1 + PERF_TYPE_TRACEPOINT = 0x2 + PERF_TYPE_HW_CACHE = 0x3 + PERF_TYPE_RAW = 0x4 + PERF_TYPE_BREAKPOINT = 0x5 + + PERF_COUNT_HW_CPU_CYCLES = 0x0 + PERF_COUNT_HW_INSTRUCTIONS = 0x1 + PERF_COUNT_HW_CACHE_REFERENCES = 0x2 + PERF_COUNT_HW_CACHE_MISSES = 0x3 + PERF_COUNT_HW_BRANCH_INSTRUCTIONS = 0x4 + PERF_COUNT_HW_BRANCH_MISSES = 0x5 + PERF_COUNT_HW_BUS_CYCLES = 0x6 + PERF_COUNT_HW_STALLED_CYCLES_FRONTEND = 0x7 + PERF_COUNT_HW_STALLED_CYCLES_BACKEND = 0x8 + PERF_COUNT_HW_REF_CPU_CYCLES = 0x9 + + PERF_COUNT_HW_CACHE_L1D = 0x0 + PERF_COUNT_HW_CACHE_L1I = 0x1 + PERF_COUNT_HW_CACHE_LL = 0x2 + PERF_COUNT_HW_CACHE_DTLB = 0x3 + PERF_COUNT_HW_CACHE_ITLB = 0x4 + PERF_COUNT_HW_CACHE_BPU = 0x5 + PERF_COUNT_HW_CACHE_NODE = 0x6 + + PERF_COUNT_HW_CACHE_OP_READ = 0x0 + PERF_COUNT_HW_CACHE_OP_WRITE = 0x1 + PERF_COUNT_HW_CACHE_OP_PREFETCH = 0x2 + + PERF_COUNT_HW_CACHE_RESULT_ACCESS = 0x0 + PERF_COUNT_HW_CACHE_RESULT_MISS = 0x1 + + PERF_COUNT_SW_CPU_CLOCK = 0x0 + PERF_COUNT_SW_TASK_CLOCK = 0x1 + PERF_COUNT_SW_PAGE_FAULTS = 0x2 + PERF_COUNT_SW_CONTEXT_SWITCHES = 0x3 + PERF_COUNT_SW_CPU_MIGRATIONS = 0x4 + PERF_COUNT_SW_PAGE_FAULTS_MIN = 0x5 + PERF_COUNT_SW_PAGE_FAULTS_MAJ = 0x6 + PERF_COUNT_SW_ALIGNMENT_FAULTS = 0x7 + PERF_COUNT_SW_EMULATION_FAULTS = 0x8 + PERF_COUNT_SW_DUMMY = 0x9 + + PERF_SAMPLE_IP = 0x1 + PERF_SAMPLE_TID = 0x2 + PERF_SAMPLE_TIME = 0x4 + PERF_SAMPLE_ADDR = 0x8 + PERF_SAMPLE_READ = 0x10 + PERF_SAMPLE_CALLCHAIN = 0x20 + PERF_SAMPLE_ID = 0x40 + PERF_SAMPLE_CPU = 0x80 + PERF_SAMPLE_PERIOD = 0x100 + PERF_SAMPLE_STREAM_ID = 0x200 + PERF_SAMPLE_RAW = 0x400 + PERF_SAMPLE_BRANCH_STACK = 0x800 + + PERF_SAMPLE_BRANCH_USER = 0x1 + PERF_SAMPLE_BRANCH_KERNEL = 0x2 + PERF_SAMPLE_BRANCH_HV = 0x4 + PERF_SAMPLE_BRANCH_ANY = 0x8 + PERF_SAMPLE_BRANCH_ANY_CALL = 0x10 + PERF_SAMPLE_BRANCH_ANY_RETURN = 0x20 + PERF_SAMPLE_BRANCH_IND_CALL = 0x40 + + PERF_FORMAT_TOTAL_TIME_ENABLED = 0x1 + PERF_FORMAT_TOTAL_TIME_RUNNING = 0x2 + PERF_FORMAT_ID = 0x4 + PERF_FORMAT_GROUP = 0x8 + + PERF_RECORD_MMAP = 0x1 + PERF_RECORD_LOST = 0x2 + PERF_RECORD_COMM = 0x3 + PERF_RECORD_EXIT = 0x4 + PERF_RECORD_THROTTLE = 0x5 + PERF_RECORD_UNTHROTTLE = 0x6 + PERF_RECORD_FORK = 0x7 + PERF_RECORD_READ = 0x8 + PERF_RECORD_SAMPLE = 0x9 + + PERF_CONTEXT_HV = -0x20 + PERF_CONTEXT_KERNEL = -0x80 + PERF_CONTEXT_USER = -0x200 + + PERF_CONTEXT_GUEST = -0x800 + PERF_CONTEXT_GUEST_KERNEL = -0x880 + PERF_CONTEXT_GUEST_USER = -0xa00 + + PERF_FLAG_FD_NO_GROUP = 0x1 + PERF_FLAG_FD_OUTPUT = 0x2 + PERF_FLAG_PID_CGROUP = 0x4 +) + +const ( + CBitFieldMaskBit0 = 0x1 + CBitFieldMaskBit1 = 0x2 + CBitFieldMaskBit2 = 0x4 + CBitFieldMaskBit3 = 0x8 + CBitFieldMaskBit4 = 0x10 + CBitFieldMaskBit5 = 0x20 + CBitFieldMaskBit6 = 0x40 + CBitFieldMaskBit7 = 0x80 + CBitFieldMaskBit8 = 0x100 + CBitFieldMaskBit9 = 0x200 + CBitFieldMaskBit10 = 0x400 + CBitFieldMaskBit11 = 0x800 + CBitFieldMaskBit12 = 0x1000 + CBitFieldMaskBit13 = 0x2000 + CBitFieldMaskBit14 = 0x4000 + CBitFieldMaskBit15 = 0x8000 + CBitFieldMaskBit16 = 0x10000 + CBitFieldMaskBit17 = 0x20000 + CBitFieldMaskBit18 = 0x40000 + CBitFieldMaskBit19 = 0x80000 + CBitFieldMaskBit20 = 0x100000 + CBitFieldMaskBit21 = 0x200000 + CBitFieldMaskBit22 = 0x400000 + CBitFieldMaskBit23 = 0x800000 + CBitFieldMaskBit24 = 0x1000000 + CBitFieldMaskBit25 = 0x2000000 + CBitFieldMaskBit26 = 0x4000000 + CBitFieldMaskBit27 = 0x8000000 + CBitFieldMaskBit28 = 0x10000000 + CBitFieldMaskBit29 = 0x20000000 + CBitFieldMaskBit30 = 0x40000000 + CBitFieldMaskBit31 = 0x80000000 + CBitFieldMaskBit32 = 0x100000000 + CBitFieldMaskBit33 = 0x200000000 + CBitFieldMaskBit34 = 0x400000000 + CBitFieldMaskBit35 = 0x800000000 + CBitFieldMaskBit36 = 0x1000000000 + CBitFieldMaskBit37 = 0x2000000000 + CBitFieldMaskBit38 = 0x4000000000 + CBitFieldMaskBit39 = 0x8000000000 + CBitFieldMaskBit40 = 0x10000000000 + CBitFieldMaskBit41 = 0x20000000000 + CBitFieldMaskBit42 = 0x40000000000 + CBitFieldMaskBit43 = 0x80000000000 + CBitFieldMaskBit44 = 0x100000000000 + CBitFieldMaskBit45 = 0x200000000000 + CBitFieldMaskBit46 = 0x400000000000 + CBitFieldMaskBit47 = 0x800000000000 + CBitFieldMaskBit48 = 0x1000000000000 + CBitFieldMaskBit49 = 0x2000000000000 + CBitFieldMaskBit50 = 0x4000000000000 + CBitFieldMaskBit51 = 0x8000000000000 + CBitFieldMaskBit52 = 0x10000000000000 + CBitFieldMaskBit53 = 0x20000000000000 + CBitFieldMaskBit54 = 0x40000000000000 + CBitFieldMaskBit55 = 0x80000000000000 + CBitFieldMaskBit56 = 0x100000000000000 + CBitFieldMaskBit57 = 0x200000000000000 + CBitFieldMaskBit58 = 0x400000000000000 + CBitFieldMaskBit59 = 0x800000000000000 + CBitFieldMaskBit60 = 0x1000000000000000 + CBitFieldMaskBit61 = 0x2000000000000000 + CBitFieldMaskBit62 = 0x4000000000000000 + CBitFieldMaskBit63 = 0x8000000000000000 +) + +type SockaddrStorage struct { + Family uint16 + _ [118]int8 + _ uint64 +} + +type TCPMD5Sig struct { + Addr SockaddrStorage + Flags uint8 + Prefixlen uint8 + Keylen uint16 + _ uint32 + Key [80]uint8 +} + +type HDDriveCmdHdr struct { + Command uint8 + Number uint8 + Feature uint8 + Count uint8 +} + +type HDGeometry struct { + Heads uint8 + Sectors uint8 + Cylinders uint16 + _ [4]byte + Start uint64 +} + +type HDDriveID struct { + Config uint16 + Cyls uint16 + Reserved2 uint16 + Heads uint16 + Track_bytes uint16 + Sector_bytes uint16 + Sectors uint16 + Vendor0 uint16 + Vendor1 uint16 + Vendor2 uint16 + Serial_no [20]uint8 + Buf_type uint16 + Buf_size uint16 + Ecc_bytes uint16 + Fw_rev [8]uint8 + Model [40]uint8 + Max_multsect uint8 + Vendor3 uint8 + Dword_io uint16 + Vendor4 uint8 + Capability uint8 + Reserved50 uint16 + Vendor5 uint8 + TPIO uint8 + Vendor6 uint8 + TDMA uint8 + Field_valid uint16 + Cur_cyls uint16 + Cur_heads uint16 + Cur_sectors uint16 + Cur_capacity0 uint16 + Cur_capacity1 uint16 + Multsect uint8 + Multsect_valid uint8 + Lba_capacity uint32 + Dma_1word uint16 + Dma_mword uint16 + Eide_pio_modes uint16 + Eide_dma_min uint16 + Eide_dma_time uint16 + Eide_pio uint16 + Eide_pio_iordy uint16 + Words69_70 [2]uint16 + Words71_74 [4]uint16 + Queue_depth uint16 + Words76_79 [4]uint16 + Major_rev_num uint16 + Minor_rev_num uint16 + Command_set_1 uint16 + Command_set_2 uint16 + Cfsse uint16 + Cfs_enable_1 uint16 + Cfs_enable_2 uint16 + Csf_default uint16 + Dma_ultra uint16 + Trseuc uint16 + TrsEuc uint16 + CurAPMvalues uint16 + Mprc uint16 + Hw_config uint16 + Acoustic uint16 + Msrqs uint16 + Sxfert uint16 + Sal uint16 + Spg uint32 + Lba_capacity_2 uint64 + Words104_125 [22]uint16 + Last_lun uint16 + Word127 uint16 + Dlf uint16 + Csfo uint16 + Words130_155 [26]uint16 + Word156 uint16 + Words157_159 [3]uint16 + Cfa_power uint16 + Words161_175 [15]uint16 + Words176_205 [30]uint16 + Words206_254 [49]uint16 + Integrity_word uint16 +} + +type Statfs_t struct { + Type int64 + Bsize int64 + Blocks uint64 + Bfree uint64 + Bavail uint64 + Files uint64 + Ffree uint64 + Fsid Fsid + Namelen int64 + Frsize int64 + Flags int64 + Spare [4]int64 +} + +const ( + ST_MANDLOCK = 0x40 + ST_NOATIME = 0x400 + ST_NODEV = 0x4 + ST_NODIRATIME = 0x800 + ST_NOEXEC = 0x8 + ST_NOSUID = 0x2 + ST_RDONLY = 0x1 + ST_RELATIME = 0x1000 + ST_SYNCHRONOUS = 0x10 +) + +type TpacketHdr struct { + Status uint64 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Usec uint32 + _ [4]byte +} + +type Tpacket2Hdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Nsec uint32 + Vlan_tci uint16 + Vlan_tpid uint16 + _ [4]uint8 +} + +type Tpacket3Hdr struct { + Next_offset uint32 + Sec uint32 + Nsec uint32 + Snaplen uint32 + Len uint32 + Status uint32 + Mac uint16 + Net uint16 + Hv1 TpacketHdrVariant1 + _ [8]uint8 +} + +type TpacketHdrVariant1 struct { + Rxhash uint32 + Vlan_tci uint32 + Vlan_tpid uint16 + _ uint16 +} + +type TpacketBlockDesc struct { + Version uint32 + To_priv uint32 + Hdr [40]byte +} + +type TpacketReq struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 +} + +type TpacketReq3 struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 + Retire_blk_tov uint32 + Sizeof_priv uint32 + Feature_req_word uint32 +} + +type TpacketStats struct { + Packets uint32 + Drops uint32 +} + +type TpacketStatsV3 struct { + Packets uint32 + Drops uint32 + Freeze_q_cnt uint32 +} + +type TpacketAuxdata struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Vlan_tci uint16 + Vlan_tpid uint16 +} + +const ( + TPACKET_V1 = 0x0 + TPACKET_V2 = 0x1 + TPACKET_V3 = 0x2 +) + +const ( + SizeofTpacketHdr = 0x20 + SizeofTpacket2Hdr = 0x20 + SizeofTpacket3Hdr = 0x30 +) + +const ( + NF_INET_PRE_ROUTING = 0x0 + NF_INET_LOCAL_IN = 0x1 + NF_INET_FORWARD = 0x2 + NF_INET_LOCAL_OUT = 0x3 + NF_INET_POST_ROUTING = 0x4 + NF_INET_NUMHOOKS = 0x5 +) + +const ( + NF_NETDEV_INGRESS = 0x0 + NF_NETDEV_NUMHOOKS = 0x1 +) + +const ( + NFPROTO_UNSPEC = 0x0 + NFPROTO_INET = 0x1 + NFPROTO_IPV4 = 0x2 + NFPROTO_ARP = 0x3 + NFPROTO_NETDEV = 0x5 + NFPROTO_BRIDGE = 0x7 + NFPROTO_IPV6 = 0xa + NFPROTO_DECNET = 0xc + NFPROTO_NUMPROTO = 0xd +) + +type Nfgenmsg struct { + Nfgen_family uint8 + Version uint8 + Res_id uint16 +} + +const ( + NFNL_BATCH_UNSPEC = 0x0 + NFNL_BATCH_GENID = 0x1 +) + +const ( + NFT_REG_VERDICT = 0x0 + NFT_REG_1 = 0x1 + NFT_REG_2 = 0x2 + NFT_REG_3 = 0x3 + NFT_REG_4 = 0x4 + NFT_REG32_00 = 0x8 + NFT_REG32_01 = 0x9 + NFT_REG32_02 = 0xa + NFT_REG32_03 = 0xb + NFT_REG32_04 = 0xc + NFT_REG32_05 = 0xd + NFT_REG32_06 = 0xe + NFT_REG32_07 = 0xf + NFT_REG32_08 = 0x10 + NFT_REG32_09 = 0x11 + NFT_REG32_10 = 0x12 + NFT_REG32_11 = 0x13 + NFT_REG32_12 = 0x14 + NFT_REG32_13 = 0x15 + NFT_REG32_14 = 0x16 + NFT_REG32_15 = 0x17 + NFT_CONTINUE = -0x1 + NFT_BREAK = -0x2 + NFT_JUMP = -0x3 + NFT_GOTO = -0x4 + NFT_RETURN = -0x5 + NFT_MSG_NEWTABLE = 0x0 + NFT_MSG_GETTABLE = 0x1 + NFT_MSG_DELTABLE = 0x2 + NFT_MSG_NEWCHAIN = 0x3 + NFT_MSG_GETCHAIN = 0x4 + NFT_MSG_DELCHAIN = 0x5 + NFT_MSG_NEWRULE = 0x6 + NFT_MSG_GETRULE = 0x7 + NFT_MSG_DELRULE = 0x8 + NFT_MSG_NEWSET = 0x9 + NFT_MSG_GETSET = 0xa + NFT_MSG_DELSET = 0xb + NFT_MSG_NEWSETELEM = 0xc + NFT_MSG_GETSETELEM = 0xd + NFT_MSG_DELSETELEM = 0xe + NFT_MSG_NEWGEN = 0xf + NFT_MSG_GETGEN = 0x10 + NFT_MSG_TRACE = 0x11 + NFT_MSG_NEWOBJ = 0x12 + NFT_MSG_GETOBJ = 0x13 + NFT_MSG_DELOBJ = 0x14 + NFT_MSG_GETOBJ_RESET = 0x15 + NFT_MSG_MAX = 0x19 + NFTA_LIST_UNPEC = 0x0 + NFTA_LIST_ELEM = 0x1 + NFTA_HOOK_UNSPEC = 0x0 + NFTA_HOOK_HOOKNUM = 0x1 + NFTA_HOOK_PRIORITY = 0x2 + NFTA_HOOK_DEV = 0x3 + NFT_TABLE_F_DORMANT = 0x1 + NFTA_TABLE_UNSPEC = 0x0 + NFTA_TABLE_NAME = 0x1 + NFTA_TABLE_FLAGS = 0x2 + NFTA_TABLE_USE = 0x3 + NFTA_CHAIN_UNSPEC = 0x0 + NFTA_CHAIN_TABLE = 0x1 + NFTA_CHAIN_HANDLE = 0x2 + NFTA_CHAIN_NAME = 0x3 + NFTA_CHAIN_HOOK = 0x4 + NFTA_CHAIN_POLICY = 0x5 + NFTA_CHAIN_USE = 0x6 + NFTA_CHAIN_TYPE = 0x7 + NFTA_CHAIN_COUNTERS = 0x8 + NFTA_CHAIN_PAD = 0x9 + NFTA_RULE_UNSPEC = 0x0 + NFTA_RULE_TABLE = 0x1 + NFTA_RULE_CHAIN = 0x2 + NFTA_RULE_HANDLE = 0x3 + NFTA_RULE_EXPRESSIONS = 0x4 + NFTA_RULE_COMPAT = 0x5 + NFTA_RULE_POSITION = 0x6 + NFTA_RULE_USERDATA = 0x7 + NFTA_RULE_PAD = 0x8 + NFTA_RULE_ID = 0x9 + NFT_RULE_COMPAT_F_INV = 0x2 + NFT_RULE_COMPAT_F_MASK = 0x2 + NFTA_RULE_COMPAT_UNSPEC = 0x0 + NFTA_RULE_COMPAT_PROTO = 0x1 + NFTA_RULE_COMPAT_FLAGS = 0x2 + NFT_SET_ANONYMOUS = 0x1 + NFT_SET_CONSTANT = 0x2 + NFT_SET_INTERVAL = 0x4 + NFT_SET_MAP = 0x8 + NFT_SET_TIMEOUT = 0x10 + NFT_SET_EVAL = 0x20 + NFT_SET_OBJECT = 0x40 + NFT_SET_POL_PERFORMANCE = 0x0 + NFT_SET_POL_MEMORY = 0x1 + NFTA_SET_DESC_UNSPEC = 0x0 + NFTA_SET_DESC_SIZE = 0x1 + NFTA_SET_UNSPEC = 0x0 + NFTA_SET_TABLE = 0x1 + NFTA_SET_NAME = 0x2 + NFTA_SET_FLAGS = 0x3 + NFTA_SET_KEY_TYPE = 0x4 + NFTA_SET_KEY_LEN = 0x5 + NFTA_SET_DATA_TYPE = 0x6 + NFTA_SET_DATA_LEN = 0x7 + NFTA_SET_POLICY = 0x8 + NFTA_SET_DESC = 0x9 + NFTA_SET_ID = 0xa + NFTA_SET_TIMEOUT = 0xb + NFTA_SET_GC_INTERVAL = 0xc + NFTA_SET_USERDATA = 0xd + NFTA_SET_PAD = 0xe + NFTA_SET_OBJ_TYPE = 0xf + NFT_SET_ELEM_INTERVAL_END = 0x1 + NFTA_SET_ELEM_UNSPEC = 0x0 + NFTA_SET_ELEM_KEY = 0x1 + NFTA_SET_ELEM_DATA = 0x2 + NFTA_SET_ELEM_FLAGS = 0x3 + NFTA_SET_ELEM_TIMEOUT = 0x4 + NFTA_SET_ELEM_EXPIRATION = 0x5 + NFTA_SET_ELEM_USERDATA = 0x6 + NFTA_SET_ELEM_EXPR = 0x7 + NFTA_SET_ELEM_PAD = 0x8 + NFTA_SET_ELEM_OBJREF = 0x9 + NFTA_SET_ELEM_LIST_UNSPEC = 0x0 + NFTA_SET_ELEM_LIST_TABLE = 0x1 + NFTA_SET_ELEM_LIST_SET = 0x2 + NFTA_SET_ELEM_LIST_ELEMENTS = 0x3 + NFTA_SET_ELEM_LIST_SET_ID = 0x4 + NFT_DATA_VALUE = 0x0 + NFT_DATA_VERDICT = 0xffffff00 + NFTA_DATA_UNSPEC = 0x0 + NFTA_DATA_VALUE = 0x1 + NFTA_DATA_VERDICT = 0x2 + NFTA_VERDICT_UNSPEC = 0x0 + NFTA_VERDICT_CODE = 0x1 + NFTA_VERDICT_CHAIN = 0x2 + NFTA_EXPR_UNSPEC = 0x0 + NFTA_EXPR_NAME = 0x1 + NFTA_EXPR_DATA = 0x2 + NFTA_IMMEDIATE_UNSPEC = 0x0 + NFTA_IMMEDIATE_DREG = 0x1 + NFTA_IMMEDIATE_DATA = 0x2 + NFTA_BITWISE_UNSPEC = 0x0 + NFTA_BITWISE_SREG = 0x1 + NFTA_BITWISE_DREG = 0x2 + NFTA_BITWISE_LEN = 0x3 + NFTA_BITWISE_MASK = 0x4 + NFTA_BITWISE_XOR = 0x5 + NFT_BYTEORDER_NTOH = 0x0 + NFT_BYTEORDER_HTON = 0x1 + NFTA_BYTEORDER_UNSPEC = 0x0 + NFTA_BYTEORDER_SREG = 0x1 + NFTA_BYTEORDER_DREG = 0x2 + NFTA_BYTEORDER_OP = 0x3 + NFTA_BYTEORDER_LEN = 0x4 + NFTA_BYTEORDER_SIZE = 0x5 + NFT_CMP_EQ = 0x0 + NFT_CMP_NEQ = 0x1 + NFT_CMP_LT = 0x2 + NFT_CMP_LTE = 0x3 + NFT_CMP_GT = 0x4 + NFT_CMP_GTE = 0x5 + NFTA_CMP_UNSPEC = 0x0 + NFTA_CMP_SREG = 0x1 + NFTA_CMP_OP = 0x2 + NFTA_CMP_DATA = 0x3 + NFT_RANGE_EQ = 0x0 + NFT_RANGE_NEQ = 0x1 + NFTA_RANGE_UNSPEC = 0x0 + NFTA_RANGE_SREG = 0x1 + NFTA_RANGE_OP = 0x2 + NFTA_RANGE_FROM_DATA = 0x3 + NFTA_RANGE_TO_DATA = 0x4 + NFT_LOOKUP_F_INV = 0x1 + NFTA_LOOKUP_UNSPEC = 0x0 + NFTA_LOOKUP_SET = 0x1 + NFTA_LOOKUP_SREG = 0x2 + NFTA_LOOKUP_DREG = 0x3 + NFTA_LOOKUP_SET_ID = 0x4 + NFTA_LOOKUP_FLAGS = 0x5 + NFT_DYNSET_OP_ADD = 0x0 + NFT_DYNSET_OP_UPDATE = 0x1 + NFT_DYNSET_F_INV = 0x1 + NFTA_DYNSET_UNSPEC = 0x0 + NFTA_DYNSET_SET_NAME = 0x1 + NFTA_DYNSET_SET_ID = 0x2 + NFTA_DYNSET_OP = 0x3 + NFTA_DYNSET_SREG_KEY = 0x4 + NFTA_DYNSET_SREG_DATA = 0x5 + NFTA_DYNSET_TIMEOUT = 0x6 + NFTA_DYNSET_EXPR = 0x7 + NFTA_DYNSET_PAD = 0x8 + NFTA_DYNSET_FLAGS = 0x9 + NFT_PAYLOAD_LL_HEADER = 0x0 + NFT_PAYLOAD_NETWORK_HEADER = 0x1 + NFT_PAYLOAD_TRANSPORT_HEADER = 0x2 + NFT_PAYLOAD_CSUM_NONE = 0x0 + NFT_PAYLOAD_CSUM_INET = 0x1 + NFT_PAYLOAD_L4CSUM_PSEUDOHDR = 0x1 + NFTA_PAYLOAD_UNSPEC = 0x0 + NFTA_PAYLOAD_DREG = 0x1 + NFTA_PAYLOAD_BASE = 0x2 + NFTA_PAYLOAD_OFFSET = 0x3 + NFTA_PAYLOAD_LEN = 0x4 + NFTA_PAYLOAD_SREG = 0x5 + NFTA_PAYLOAD_CSUM_TYPE = 0x6 + NFTA_PAYLOAD_CSUM_OFFSET = 0x7 + NFTA_PAYLOAD_CSUM_FLAGS = 0x8 + NFT_EXTHDR_F_PRESENT = 0x1 + NFT_EXTHDR_OP_IPV6 = 0x0 + NFT_EXTHDR_OP_TCPOPT = 0x1 + NFTA_EXTHDR_UNSPEC = 0x0 + NFTA_EXTHDR_DREG = 0x1 + NFTA_EXTHDR_TYPE = 0x2 + NFTA_EXTHDR_OFFSET = 0x3 + NFTA_EXTHDR_LEN = 0x4 + NFTA_EXTHDR_FLAGS = 0x5 + NFTA_EXTHDR_OP = 0x6 + NFTA_EXTHDR_SREG = 0x7 + NFT_META_LEN = 0x0 + NFT_META_PROTOCOL = 0x1 + NFT_META_PRIORITY = 0x2 + NFT_META_MARK = 0x3 + NFT_META_IIF = 0x4 + NFT_META_OIF = 0x5 + NFT_META_IIFNAME = 0x6 + NFT_META_OIFNAME = 0x7 + NFT_META_IIFTYPE = 0x8 + NFT_META_OIFTYPE = 0x9 + NFT_META_SKUID = 0xa + NFT_META_SKGID = 0xb + NFT_META_NFTRACE = 0xc + NFT_META_RTCLASSID = 0xd + NFT_META_SECMARK = 0xe + NFT_META_NFPROTO = 0xf + NFT_META_L4PROTO = 0x10 + NFT_META_BRI_IIFNAME = 0x11 + NFT_META_BRI_OIFNAME = 0x12 + NFT_META_PKTTYPE = 0x13 + NFT_META_CPU = 0x14 + NFT_META_IIFGROUP = 0x15 + NFT_META_OIFGROUP = 0x16 + NFT_META_CGROUP = 0x17 + NFT_META_PRANDOM = 0x18 + NFT_RT_CLASSID = 0x0 + NFT_RT_NEXTHOP4 = 0x1 + NFT_RT_NEXTHOP6 = 0x2 + NFT_RT_TCPMSS = 0x3 + NFT_HASH_JENKINS = 0x0 + NFT_HASH_SYM = 0x1 + NFTA_HASH_UNSPEC = 0x0 + NFTA_HASH_SREG = 0x1 + NFTA_HASH_DREG = 0x2 + NFTA_HASH_LEN = 0x3 + NFTA_HASH_MODULUS = 0x4 + NFTA_HASH_SEED = 0x5 + NFTA_HASH_OFFSET = 0x6 + NFTA_HASH_TYPE = 0x7 + NFTA_META_UNSPEC = 0x0 + NFTA_META_DREG = 0x1 + NFTA_META_KEY = 0x2 + NFTA_META_SREG = 0x3 + NFTA_RT_UNSPEC = 0x0 + NFTA_RT_DREG = 0x1 + NFTA_RT_KEY = 0x2 + NFT_CT_STATE = 0x0 + NFT_CT_DIRECTION = 0x1 + NFT_CT_STATUS = 0x2 + NFT_CT_MARK = 0x3 + NFT_CT_SECMARK = 0x4 + NFT_CT_EXPIRATION = 0x5 + NFT_CT_HELPER = 0x6 + NFT_CT_L3PROTOCOL = 0x7 + NFT_CT_SRC = 0x8 + NFT_CT_DST = 0x9 + NFT_CT_PROTOCOL = 0xa + NFT_CT_PROTO_SRC = 0xb + NFT_CT_PROTO_DST = 0xc + NFT_CT_LABELS = 0xd + NFT_CT_PKTS = 0xe + NFT_CT_BYTES = 0xf + NFT_CT_AVGPKT = 0x10 + NFT_CT_ZONE = 0x11 + NFT_CT_EVENTMASK = 0x12 + NFTA_CT_UNSPEC = 0x0 + NFTA_CT_DREG = 0x1 + NFTA_CT_KEY = 0x2 + NFTA_CT_DIRECTION = 0x3 + NFTA_CT_SREG = 0x4 + NFT_LIMIT_PKTS = 0x0 + NFT_LIMIT_PKT_BYTES = 0x1 + NFT_LIMIT_F_INV = 0x1 + NFTA_LIMIT_UNSPEC = 0x0 + NFTA_LIMIT_RATE = 0x1 + NFTA_LIMIT_UNIT = 0x2 + NFTA_LIMIT_BURST = 0x3 + NFTA_LIMIT_TYPE = 0x4 + NFTA_LIMIT_FLAGS = 0x5 + NFTA_LIMIT_PAD = 0x6 + NFTA_COUNTER_UNSPEC = 0x0 + NFTA_COUNTER_BYTES = 0x1 + NFTA_COUNTER_PACKETS = 0x2 + NFTA_COUNTER_PAD = 0x3 + NFTA_LOG_UNSPEC = 0x0 + NFTA_LOG_GROUP = 0x1 + NFTA_LOG_PREFIX = 0x2 + NFTA_LOG_SNAPLEN = 0x3 + NFTA_LOG_QTHRESHOLD = 0x4 + NFTA_LOG_LEVEL = 0x5 + NFTA_LOG_FLAGS = 0x6 + NFTA_QUEUE_UNSPEC = 0x0 + NFTA_QUEUE_NUM = 0x1 + NFTA_QUEUE_TOTAL = 0x2 + NFTA_QUEUE_FLAGS = 0x3 + NFTA_QUEUE_SREG_QNUM = 0x4 + NFT_QUOTA_F_INV = 0x1 + NFT_QUOTA_F_DEPLETED = 0x2 + NFTA_QUOTA_UNSPEC = 0x0 + NFTA_QUOTA_BYTES = 0x1 + NFTA_QUOTA_FLAGS = 0x2 + NFTA_QUOTA_PAD = 0x3 + NFTA_QUOTA_CONSUMED = 0x4 + NFT_REJECT_ICMP_UNREACH = 0x0 + NFT_REJECT_TCP_RST = 0x1 + NFT_REJECT_ICMPX_UNREACH = 0x2 + NFT_REJECT_ICMPX_NO_ROUTE = 0x0 + NFT_REJECT_ICMPX_PORT_UNREACH = 0x1 + NFT_REJECT_ICMPX_HOST_UNREACH = 0x2 + NFT_REJECT_ICMPX_ADMIN_PROHIBITED = 0x3 + NFTA_REJECT_UNSPEC = 0x0 + NFTA_REJECT_TYPE = 0x1 + NFTA_REJECT_ICMP_CODE = 0x2 + NFT_NAT_SNAT = 0x0 + NFT_NAT_DNAT = 0x1 + NFTA_NAT_UNSPEC = 0x0 + NFTA_NAT_TYPE = 0x1 + NFTA_NAT_FAMILY = 0x2 + NFTA_NAT_REG_ADDR_MIN = 0x3 + NFTA_NAT_REG_ADDR_MAX = 0x4 + NFTA_NAT_REG_PROTO_MIN = 0x5 + NFTA_NAT_REG_PROTO_MAX = 0x6 + NFTA_NAT_FLAGS = 0x7 + NFTA_MASQ_UNSPEC = 0x0 + NFTA_MASQ_FLAGS = 0x1 + NFTA_MASQ_REG_PROTO_MIN = 0x2 + NFTA_MASQ_REG_PROTO_MAX = 0x3 + NFTA_REDIR_UNSPEC = 0x0 + NFTA_REDIR_REG_PROTO_MIN = 0x1 + NFTA_REDIR_REG_PROTO_MAX = 0x2 + NFTA_REDIR_FLAGS = 0x3 + NFTA_DUP_UNSPEC = 0x0 + NFTA_DUP_SREG_ADDR = 0x1 + NFTA_DUP_SREG_DEV = 0x2 + NFTA_FWD_UNSPEC = 0x0 + NFTA_FWD_SREG_DEV = 0x1 + NFTA_OBJREF_UNSPEC = 0x0 + NFTA_OBJREF_IMM_TYPE = 0x1 + NFTA_OBJREF_IMM_NAME = 0x2 + NFTA_OBJREF_SET_SREG = 0x3 + NFTA_OBJREF_SET_NAME = 0x4 + NFTA_OBJREF_SET_ID = 0x5 + NFTA_GEN_UNSPEC = 0x0 + NFTA_GEN_ID = 0x1 + NFTA_GEN_PROC_PID = 0x2 + NFTA_GEN_PROC_NAME = 0x3 + NFTA_FIB_UNSPEC = 0x0 + NFTA_FIB_DREG = 0x1 + NFTA_FIB_RESULT = 0x2 + NFTA_FIB_FLAGS = 0x3 + NFT_FIB_RESULT_UNSPEC = 0x0 + NFT_FIB_RESULT_OIF = 0x1 + NFT_FIB_RESULT_OIFNAME = 0x2 + NFT_FIB_RESULT_ADDRTYPE = 0x3 + NFTA_FIB_F_SADDR = 0x1 + NFTA_FIB_F_DADDR = 0x2 + NFTA_FIB_F_MARK = 0x4 + NFTA_FIB_F_IIF = 0x8 + NFTA_FIB_F_OIF = 0x10 + NFTA_FIB_F_PRESENT = 0x20 + NFTA_CT_HELPER_UNSPEC = 0x0 + NFTA_CT_HELPER_NAME = 0x1 + NFTA_CT_HELPER_L3PROTO = 0x2 + NFTA_CT_HELPER_L4PROTO = 0x3 + NFTA_OBJ_UNSPEC = 0x0 + NFTA_OBJ_TABLE = 0x1 + NFTA_OBJ_NAME = 0x2 + NFTA_OBJ_TYPE = 0x3 + NFTA_OBJ_DATA = 0x4 + NFTA_OBJ_USE = 0x5 + NFTA_TRACE_UNSPEC = 0x0 + NFTA_TRACE_TABLE = 0x1 + NFTA_TRACE_CHAIN = 0x2 + NFTA_TRACE_RULE_HANDLE = 0x3 + NFTA_TRACE_TYPE = 0x4 + NFTA_TRACE_VERDICT = 0x5 + NFTA_TRACE_ID = 0x6 + NFTA_TRACE_LL_HEADER = 0x7 + NFTA_TRACE_NETWORK_HEADER = 0x8 + NFTA_TRACE_TRANSPORT_HEADER = 0x9 + NFTA_TRACE_IIF = 0xa + NFTA_TRACE_IIFTYPE = 0xb + NFTA_TRACE_OIF = 0xc + NFTA_TRACE_OIFTYPE = 0xd + NFTA_TRACE_MARK = 0xe + NFTA_TRACE_NFPROTO = 0xf + NFTA_TRACE_POLICY = 0x10 + NFTA_TRACE_PAD = 0x11 + NFT_TRACETYPE_UNSPEC = 0x0 + NFT_TRACETYPE_POLICY = 0x1 + NFT_TRACETYPE_RETURN = 0x2 + NFT_TRACETYPE_RULE = 0x3 + NFTA_NG_UNSPEC = 0x0 + NFTA_NG_DREG = 0x1 + NFTA_NG_MODULUS = 0x2 + NFTA_NG_TYPE = 0x3 + NFTA_NG_OFFSET = 0x4 + NFT_NG_INCREMENTAL = 0x0 + NFT_NG_RANDOM = 0x1 +) + +type RTCTime struct { + Sec int32 + Min int32 + Hour int32 + Mday int32 + Mon int32 + Year int32 + Wday int32 + Yday int32 + Isdst int32 +} + +type RTCWkAlrm struct { + Enabled uint8 + Pending uint8 + _ [2]byte + Time RTCTime +} + +type RTCPLLInfo struct { + Ctrl int32 + Value int32 + Max int32 + Min int32 + Posmult int32 + Negmult int32 + Clock int64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go index a9087c52a0..783e70e87c 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips.go @@ -115,27 +115,10 @@ type Stat_t struct { Pad5 [14]int32 } -type Statfs_t struct { - Type int32 - Bsize int32 - Frsize int32 - _ [4]byte - Blocks uint64 - Bfree uint64 - Files uint64 - Ffree uint64 - Bavail uint64 - Fsid Fsid - Namelen int32 - Flags int32 - Spare [5]int32 - _ [4]byte -} - type StatxTimestamp struct { - Sec int64 - Nsec uint32 - X__reserved int32 + Sec int64 + Nsec uint32 + _ int32 } type Statx_t struct { @@ -172,7 +155,7 @@ type Dirent struct { } type Fsid struct { - X__val [2]int32 + Val [2]int32 } type Flock_t struct { @@ -266,6 +249,13 @@ type RawSockaddrL2 struct { _ [1]byte } +type RawSockaddrRFCOMM struct { + Family uint16 + Bdaddr [6]uint8 + Channel uint8 + _ [1]byte +} + type RawSockaddrCAN struct { Family uint16 _ [2]byte @@ -419,6 +409,7 @@ const ( SizeofSockaddrNetlink = 0xc SizeofSockaddrHCI = 0x6 SizeofSockaddrL2 = 0xe + SizeofSockaddrRFCOMM = 0xa SizeofSockaddrCAN = 0x10 SizeofSockaddrALG = 0x58 SizeofSockaddrVM = 0x10 @@ -439,97 +430,123 @@ const ( ) const ( - IFA_UNSPEC = 0x0 - IFA_ADDRESS = 0x1 - IFA_LOCAL = 0x2 - IFA_LABEL = 0x3 - IFA_BROADCAST = 0x4 - IFA_ANYCAST = 0x5 - IFA_CACHEINFO = 0x6 - IFA_MULTICAST = 0x7 - IFLA_UNSPEC = 0x0 - IFLA_ADDRESS = 0x1 - IFLA_BROADCAST = 0x2 - IFLA_IFNAME = 0x3 - IFLA_MTU = 0x4 - IFLA_LINK = 0x5 - IFLA_QDISC = 0x6 - IFLA_STATS = 0x7 - IFLA_COST = 0x8 - IFLA_PRIORITY = 0x9 - IFLA_MASTER = 0xa - IFLA_WIRELESS = 0xb - IFLA_PROTINFO = 0xc - IFLA_TXQLEN = 0xd - IFLA_MAP = 0xe - IFLA_WEIGHT = 0xf - IFLA_OPERSTATE = 0x10 - IFLA_LINKMODE = 0x11 - IFLA_LINKINFO = 0x12 - IFLA_NET_NS_PID = 0x13 - IFLA_IFALIAS = 0x14 - IFLA_MAX = 0x2c - RT_SCOPE_UNIVERSE = 0x0 - RT_SCOPE_SITE = 0xc8 - RT_SCOPE_LINK = 0xfd - RT_SCOPE_HOST = 0xfe - RT_SCOPE_NOWHERE = 0xff - RT_TABLE_UNSPEC = 0x0 - RT_TABLE_COMPAT = 0xfc - RT_TABLE_DEFAULT = 0xfd - RT_TABLE_MAIN = 0xfe - RT_TABLE_LOCAL = 0xff - RT_TABLE_MAX = 0xffffffff - RTA_UNSPEC = 0x0 - RTA_DST = 0x1 - RTA_SRC = 0x2 - RTA_IIF = 0x3 - RTA_OIF = 0x4 - RTA_GATEWAY = 0x5 - RTA_PRIORITY = 0x6 - RTA_PREFSRC = 0x7 - RTA_METRICS = 0x8 - RTA_MULTIPATH = 0x9 - RTA_FLOW = 0xb - RTA_CACHEINFO = 0xc - RTA_TABLE = 0xf - RTN_UNSPEC = 0x0 - RTN_UNICAST = 0x1 - RTN_LOCAL = 0x2 - RTN_BROADCAST = 0x3 - RTN_ANYCAST = 0x4 - RTN_MULTICAST = 0x5 - RTN_BLACKHOLE = 0x6 - RTN_UNREACHABLE = 0x7 - RTN_PROHIBIT = 0x8 - RTN_THROW = 0x9 - RTN_NAT = 0xa - RTN_XRESOLVE = 0xb - RTNLGRP_NONE = 0x0 - RTNLGRP_LINK = 0x1 - RTNLGRP_NOTIFY = 0x2 - RTNLGRP_NEIGH = 0x3 - RTNLGRP_TC = 0x4 - RTNLGRP_IPV4_IFADDR = 0x5 - RTNLGRP_IPV4_MROUTE = 0x6 - RTNLGRP_IPV4_ROUTE = 0x7 - RTNLGRP_IPV4_RULE = 0x8 - RTNLGRP_IPV6_IFADDR = 0x9 - RTNLGRP_IPV6_MROUTE = 0xa - RTNLGRP_IPV6_ROUTE = 0xb - RTNLGRP_IPV6_IFINFO = 0xc - RTNLGRP_IPV6_PREFIX = 0x12 - RTNLGRP_IPV6_RULE = 0x13 - RTNLGRP_ND_USEROPT = 0x14 - SizeofNlMsghdr = 0x10 - SizeofNlMsgerr = 0x14 - SizeofRtGenmsg = 0x1 - SizeofNlAttr = 0x4 - SizeofRtAttr = 0x4 - SizeofIfInfomsg = 0x10 - SizeofIfAddrmsg = 0x8 - SizeofRtMsg = 0xc - SizeofRtNexthop = 0x8 + IFA_UNSPEC = 0x0 + IFA_ADDRESS = 0x1 + IFA_LOCAL = 0x2 + IFA_LABEL = 0x3 + IFA_BROADCAST = 0x4 + IFA_ANYCAST = 0x5 + IFA_CACHEINFO = 0x6 + IFA_MULTICAST = 0x7 + IFLA_UNSPEC = 0x0 + IFLA_ADDRESS = 0x1 + IFLA_BROADCAST = 0x2 + IFLA_IFNAME = 0x3 + IFLA_MTU = 0x4 + IFLA_LINK = 0x5 + IFLA_QDISC = 0x6 + IFLA_STATS = 0x7 + IFLA_COST = 0x8 + IFLA_PRIORITY = 0x9 + IFLA_MASTER = 0xa + IFLA_WIRELESS = 0xb + IFLA_PROTINFO = 0xc + IFLA_TXQLEN = 0xd + IFLA_MAP = 0xe + IFLA_WEIGHT = 0xf + IFLA_OPERSTATE = 0x10 + IFLA_LINKMODE = 0x11 + IFLA_LINKINFO = 0x12 + IFLA_NET_NS_PID = 0x13 + IFLA_IFALIAS = 0x14 + IFLA_NUM_VF = 0x15 + IFLA_VFINFO_LIST = 0x16 + IFLA_STATS64 = 0x17 + IFLA_VF_PORTS = 0x18 + IFLA_PORT_SELF = 0x19 + IFLA_AF_SPEC = 0x1a + IFLA_GROUP = 0x1b + IFLA_NET_NS_FD = 0x1c + IFLA_EXT_MASK = 0x1d + IFLA_PROMISCUITY = 0x1e + IFLA_NUM_TX_QUEUES = 0x1f + IFLA_NUM_RX_QUEUES = 0x20 + IFLA_CARRIER = 0x21 + IFLA_PHYS_PORT_ID = 0x22 + IFLA_CARRIER_CHANGES = 0x23 + IFLA_PHYS_SWITCH_ID = 0x24 + IFLA_LINK_NETNSID = 0x25 + IFLA_PHYS_PORT_NAME = 0x26 + IFLA_PROTO_DOWN = 0x27 + IFLA_GSO_MAX_SEGS = 0x28 + IFLA_GSO_MAX_SIZE = 0x29 + IFLA_PAD = 0x2a + IFLA_XDP = 0x2b + IFLA_EVENT = 0x2c + IFLA_NEW_NETNSID = 0x2d + IFLA_IF_NETNSID = 0x2e + IFLA_MAX = 0x31 + RT_SCOPE_UNIVERSE = 0x0 + RT_SCOPE_SITE = 0xc8 + RT_SCOPE_LINK = 0xfd + RT_SCOPE_HOST = 0xfe + RT_SCOPE_NOWHERE = 0xff + RT_TABLE_UNSPEC = 0x0 + RT_TABLE_COMPAT = 0xfc + RT_TABLE_DEFAULT = 0xfd + RT_TABLE_MAIN = 0xfe + RT_TABLE_LOCAL = 0xff + RT_TABLE_MAX = 0xffffffff + RTA_UNSPEC = 0x0 + RTA_DST = 0x1 + RTA_SRC = 0x2 + RTA_IIF = 0x3 + RTA_OIF = 0x4 + RTA_GATEWAY = 0x5 + RTA_PRIORITY = 0x6 + RTA_PREFSRC = 0x7 + RTA_METRICS = 0x8 + RTA_MULTIPATH = 0x9 + RTA_FLOW = 0xb + RTA_CACHEINFO = 0xc + RTA_TABLE = 0xf + RTN_UNSPEC = 0x0 + RTN_UNICAST = 0x1 + RTN_LOCAL = 0x2 + RTN_BROADCAST = 0x3 + RTN_ANYCAST = 0x4 + RTN_MULTICAST = 0x5 + RTN_BLACKHOLE = 0x6 + RTN_UNREACHABLE = 0x7 + RTN_PROHIBIT = 0x8 + RTN_THROW = 0x9 + RTN_NAT = 0xa + RTN_XRESOLVE = 0xb + RTNLGRP_NONE = 0x0 + RTNLGRP_LINK = 0x1 + RTNLGRP_NOTIFY = 0x2 + RTNLGRP_NEIGH = 0x3 + RTNLGRP_TC = 0x4 + RTNLGRP_IPV4_IFADDR = 0x5 + RTNLGRP_IPV4_MROUTE = 0x6 + RTNLGRP_IPV4_ROUTE = 0x7 + RTNLGRP_IPV4_RULE = 0x8 + RTNLGRP_IPV6_IFADDR = 0x9 + RTNLGRP_IPV6_MROUTE = 0xa + RTNLGRP_IPV6_ROUTE = 0xb + RTNLGRP_IPV6_IFINFO = 0xc + RTNLGRP_IPV6_PREFIX = 0x12 + RTNLGRP_IPV6_RULE = 0x13 + RTNLGRP_ND_USEROPT = 0x14 + SizeofNlMsghdr = 0x10 + SizeofNlMsgerr = 0x14 + SizeofRtGenmsg = 0x1 + SizeofNlAttr = 0x4 + SizeofRtAttr = 0x4 + SizeofIfInfomsg = 0x10 + SizeofIfAddrmsg = 0x8 + SizeofRtMsg = 0xc + SizeofRtNexthop = 0x8 ) type NlMsghdr struct { @@ -560,12 +577,12 @@ type RtAttr struct { } type IfInfomsg struct { - Family uint8 - X__ifi_pad uint8 - Type uint16 - Index int32 - Flags uint32 - Change uint32 + Family uint8 + _ uint8 + Type uint16 + Index int32 + Flags uint32 + Change uint32 } type IfAddrmsg struct { @@ -650,7 +667,7 @@ type Sysinfo_t struct { Totalhigh uint32 Freehigh uint32 Unit uint32 - X_f [8]int8 + _ [8]int8 } type Utsname struct { @@ -688,6 +705,8 @@ const ( AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x100 + + AT_EACCESS = 0x200 ) type PollFd struct { @@ -707,7 +726,7 @@ const ( ) type Sigset_t struct { - X__val [32]uint32 + Val [32]uint32 } const RNDGETENTCNT = 0x40045200 @@ -863,3 +882,967 @@ const ( BDADDR_LE_PUBLIC = 0x1 BDADDR_LE_RANDOM = 0x2 ) + +type PerfEventAttr struct { + Type uint32 + Size uint32 + Config uint64 + Sample uint64 + Sample_type uint64 + Read_format uint64 + Bits uint64 + Wakeup uint32 + Bp_type uint32 + Ext1 uint64 + Ext2 uint64 + Branch_sample_type uint64 + Sample_regs_user uint64 + Sample_stack_user uint32 + Clockid int32 + Sample_regs_intr uint64 + Aux_watermark uint32 + _ uint32 +} + +type PerfEventMmapPage struct { + Version uint32 + Compat_version uint32 + Lock uint32 + Index uint32 + Offset int64 + Time_enabled uint64 + Time_running uint64 + Capabilities uint64 + Pmc_width uint16 + Time_shift uint16 + Time_mult uint32 + Time_offset uint64 + Time_zero uint64 + Size uint32 + _ [948]uint8 + Data_head uint64 + Data_tail uint64 + Data_offset uint64 + Data_size uint64 + Aux_head uint64 + Aux_tail uint64 + Aux_offset uint64 + Aux_size uint64 +} + +const ( + PerfBitDisabled uint64 = CBitFieldMaskBit0 + PerfBitInherit = CBitFieldMaskBit1 + PerfBitPinned = CBitFieldMaskBit2 + PerfBitExclusive = CBitFieldMaskBit3 + PerfBitExcludeUser = CBitFieldMaskBit4 + PerfBitExcludeKernel = CBitFieldMaskBit5 + PerfBitExcludeHv = CBitFieldMaskBit6 + PerfBitExcludeIdle = CBitFieldMaskBit7 + PerfBitMmap = CBitFieldMaskBit8 + PerfBitComm = CBitFieldMaskBit9 + PerfBitFreq = CBitFieldMaskBit10 + PerfBitInheritStat = CBitFieldMaskBit11 + PerfBitEnableOnExec = CBitFieldMaskBit12 + PerfBitTask = CBitFieldMaskBit13 + PerfBitWatermark = CBitFieldMaskBit14 + PerfBitPreciseIPBit1 = CBitFieldMaskBit15 + PerfBitPreciseIPBit2 = CBitFieldMaskBit16 + PerfBitMmapData = CBitFieldMaskBit17 + PerfBitSampleIDAll = CBitFieldMaskBit18 + PerfBitExcludeHost = CBitFieldMaskBit19 + PerfBitExcludeGuest = CBitFieldMaskBit20 + PerfBitExcludeCallchainKernel = CBitFieldMaskBit21 + PerfBitExcludeCallchainUser = CBitFieldMaskBit22 + PerfBitMmap2 = CBitFieldMaskBit23 + PerfBitCommExec = CBitFieldMaskBit24 + PerfBitUseClockID = CBitFieldMaskBit25 + PerfBitContextSwitch = CBitFieldMaskBit26 +) + +const ( + PERF_TYPE_HARDWARE = 0x0 + PERF_TYPE_SOFTWARE = 0x1 + PERF_TYPE_TRACEPOINT = 0x2 + PERF_TYPE_HW_CACHE = 0x3 + PERF_TYPE_RAW = 0x4 + PERF_TYPE_BREAKPOINT = 0x5 + + PERF_COUNT_HW_CPU_CYCLES = 0x0 + PERF_COUNT_HW_INSTRUCTIONS = 0x1 + PERF_COUNT_HW_CACHE_REFERENCES = 0x2 + PERF_COUNT_HW_CACHE_MISSES = 0x3 + PERF_COUNT_HW_BRANCH_INSTRUCTIONS = 0x4 + PERF_COUNT_HW_BRANCH_MISSES = 0x5 + PERF_COUNT_HW_BUS_CYCLES = 0x6 + PERF_COUNT_HW_STALLED_CYCLES_FRONTEND = 0x7 + PERF_COUNT_HW_STALLED_CYCLES_BACKEND = 0x8 + PERF_COUNT_HW_REF_CPU_CYCLES = 0x9 + + PERF_COUNT_HW_CACHE_L1D = 0x0 + PERF_COUNT_HW_CACHE_L1I = 0x1 + PERF_COUNT_HW_CACHE_LL = 0x2 + PERF_COUNT_HW_CACHE_DTLB = 0x3 + PERF_COUNT_HW_CACHE_ITLB = 0x4 + PERF_COUNT_HW_CACHE_BPU = 0x5 + PERF_COUNT_HW_CACHE_NODE = 0x6 + + PERF_COUNT_HW_CACHE_OP_READ = 0x0 + PERF_COUNT_HW_CACHE_OP_WRITE = 0x1 + PERF_COUNT_HW_CACHE_OP_PREFETCH = 0x2 + + PERF_COUNT_HW_CACHE_RESULT_ACCESS = 0x0 + PERF_COUNT_HW_CACHE_RESULT_MISS = 0x1 + + PERF_COUNT_SW_CPU_CLOCK = 0x0 + PERF_COUNT_SW_TASK_CLOCK = 0x1 + PERF_COUNT_SW_PAGE_FAULTS = 0x2 + PERF_COUNT_SW_CONTEXT_SWITCHES = 0x3 + PERF_COUNT_SW_CPU_MIGRATIONS = 0x4 + PERF_COUNT_SW_PAGE_FAULTS_MIN = 0x5 + PERF_COUNT_SW_PAGE_FAULTS_MAJ = 0x6 + PERF_COUNT_SW_ALIGNMENT_FAULTS = 0x7 + PERF_COUNT_SW_EMULATION_FAULTS = 0x8 + PERF_COUNT_SW_DUMMY = 0x9 + + PERF_SAMPLE_IP = 0x1 + PERF_SAMPLE_TID = 0x2 + PERF_SAMPLE_TIME = 0x4 + PERF_SAMPLE_ADDR = 0x8 + PERF_SAMPLE_READ = 0x10 + PERF_SAMPLE_CALLCHAIN = 0x20 + PERF_SAMPLE_ID = 0x40 + PERF_SAMPLE_CPU = 0x80 + PERF_SAMPLE_PERIOD = 0x100 + PERF_SAMPLE_STREAM_ID = 0x200 + PERF_SAMPLE_RAW = 0x400 + PERF_SAMPLE_BRANCH_STACK = 0x800 + + PERF_SAMPLE_BRANCH_USER = 0x1 + PERF_SAMPLE_BRANCH_KERNEL = 0x2 + PERF_SAMPLE_BRANCH_HV = 0x4 + PERF_SAMPLE_BRANCH_ANY = 0x8 + PERF_SAMPLE_BRANCH_ANY_CALL = 0x10 + PERF_SAMPLE_BRANCH_ANY_RETURN = 0x20 + PERF_SAMPLE_BRANCH_IND_CALL = 0x40 + + PERF_FORMAT_TOTAL_TIME_ENABLED = 0x1 + PERF_FORMAT_TOTAL_TIME_RUNNING = 0x2 + PERF_FORMAT_ID = 0x4 + PERF_FORMAT_GROUP = 0x8 + + PERF_RECORD_MMAP = 0x1 + PERF_RECORD_LOST = 0x2 + PERF_RECORD_COMM = 0x3 + PERF_RECORD_EXIT = 0x4 + PERF_RECORD_THROTTLE = 0x5 + PERF_RECORD_UNTHROTTLE = 0x6 + PERF_RECORD_FORK = 0x7 + PERF_RECORD_READ = 0x8 + PERF_RECORD_SAMPLE = 0x9 + + PERF_CONTEXT_HV = -0x20 + PERF_CONTEXT_KERNEL = -0x80 + PERF_CONTEXT_USER = -0x200 + + PERF_CONTEXT_GUEST = -0x800 + PERF_CONTEXT_GUEST_KERNEL = -0x880 + PERF_CONTEXT_GUEST_USER = -0xa00 + + PERF_FLAG_FD_NO_GROUP = 0x1 + PERF_FLAG_FD_OUTPUT = 0x2 + PERF_FLAG_PID_CGROUP = 0x4 +) + +const ( + CBitFieldMaskBit0 = 0x8000000000000000 + CBitFieldMaskBit1 = 0x4000000000000000 + CBitFieldMaskBit2 = 0x2000000000000000 + CBitFieldMaskBit3 = 0x1000000000000000 + CBitFieldMaskBit4 = 0x800000000000000 + CBitFieldMaskBit5 = 0x400000000000000 + CBitFieldMaskBit6 = 0x200000000000000 + CBitFieldMaskBit7 = 0x100000000000000 + CBitFieldMaskBit8 = 0x80000000000000 + CBitFieldMaskBit9 = 0x40000000000000 + CBitFieldMaskBit10 = 0x20000000000000 + CBitFieldMaskBit11 = 0x10000000000000 + CBitFieldMaskBit12 = 0x8000000000000 + CBitFieldMaskBit13 = 0x4000000000000 + CBitFieldMaskBit14 = 0x2000000000000 + CBitFieldMaskBit15 = 0x1000000000000 + CBitFieldMaskBit16 = 0x800000000000 + CBitFieldMaskBit17 = 0x400000000000 + CBitFieldMaskBit18 = 0x200000000000 + CBitFieldMaskBit19 = 0x100000000000 + CBitFieldMaskBit20 = 0x80000000000 + CBitFieldMaskBit21 = 0x40000000000 + CBitFieldMaskBit22 = 0x20000000000 + CBitFieldMaskBit23 = 0x10000000000 + CBitFieldMaskBit24 = 0x8000000000 + CBitFieldMaskBit25 = 0x4000000000 + CBitFieldMaskBit26 = 0x2000000000 + CBitFieldMaskBit27 = 0x1000000000 + CBitFieldMaskBit28 = 0x800000000 + CBitFieldMaskBit29 = 0x400000000 + CBitFieldMaskBit30 = 0x200000000 + CBitFieldMaskBit31 = 0x100000000 + CBitFieldMaskBit32 = 0x80000000 + CBitFieldMaskBit33 = 0x40000000 + CBitFieldMaskBit34 = 0x20000000 + CBitFieldMaskBit35 = 0x10000000 + CBitFieldMaskBit36 = 0x8000000 + CBitFieldMaskBit37 = 0x4000000 + CBitFieldMaskBit38 = 0x2000000 + CBitFieldMaskBit39 = 0x1000000 + CBitFieldMaskBit40 = 0x800000 + CBitFieldMaskBit41 = 0x400000 + CBitFieldMaskBit42 = 0x200000 + CBitFieldMaskBit43 = 0x100000 + CBitFieldMaskBit44 = 0x80000 + CBitFieldMaskBit45 = 0x40000 + CBitFieldMaskBit46 = 0x20000 + CBitFieldMaskBit47 = 0x10000 + CBitFieldMaskBit48 = 0x8000 + CBitFieldMaskBit49 = 0x4000 + CBitFieldMaskBit50 = 0x2000 + CBitFieldMaskBit51 = 0x1000 + CBitFieldMaskBit52 = 0x800 + CBitFieldMaskBit53 = 0x400 + CBitFieldMaskBit54 = 0x200 + CBitFieldMaskBit55 = 0x100 + CBitFieldMaskBit56 = 0x80 + CBitFieldMaskBit57 = 0x40 + CBitFieldMaskBit58 = 0x20 + CBitFieldMaskBit59 = 0x10 + CBitFieldMaskBit60 = 0x8 + CBitFieldMaskBit61 = 0x4 + CBitFieldMaskBit62 = 0x2 + CBitFieldMaskBit63 = 0x1 +) + +type SockaddrStorage struct { + Family uint16 + _ [122]int8 + _ uint32 +} + +type TCPMD5Sig struct { + Addr SockaddrStorage + Flags uint8 + Prefixlen uint8 + Keylen uint16 + _ uint32 + Key [80]uint8 +} + +type HDDriveCmdHdr struct { + Command uint8 + Number uint8 + Feature uint8 + Count uint8 +} + +type HDGeometry struct { + Heads uint8 + Sectors uint8 + Cylinders uint16 + Start uint32 +} + +type HDDriveID struct { + Config uint16 + Cyls uint16 + Reserved2 uint16 + Heads uint16 + Track_bytes uint16 + Sector_bytes uint16 + Sectors uint16 + Vendor0 uint16 + Vendor1 uint16 + Vendor2 uint16 + Serial_no [20]uint8 + Buf_type uint16 + Buf_size uint16 + Ecc_bytes uint16 + Fw_rev [8]uint8 + Model [40]uint8 + Max_multsect uint8 + Vendor3 uint8 + Dword_io uint16 + Vendor4 uint8 + Capability uint8 + Reserved50 uint16 + Vendor5 uint8 + TPIO uint8 + Vendor6 uint8 + TDMA uint8 + Field_valid uint16 + Cur_cyls uint16 + Cur_heads uint16 + Cur_sectors uint16 + Cur_capacity0 uint16 + Cur_capacity1 uint16 + Multsect uint8 + Multsect_valid uint8 + Lba_capacity uint32 + Dma_1word uint16 + Dma_mword uint16 + Eide_pio_modes uint16 + Eide_dma_min uint16 + Eide_dma_time uint16 + Eide_pio uint16 + Eide_pio_iordy uint16 + Words69_70 [2]uint16 + Words71_74 [4]uint16 + Queue_depth uint16 + Words76_79 [4]uint16 + Major_rev_num uint16 + Minor_rev_num uint16 + Command_set_1 uint16 + Command_set_2 uint16 + Cfsse uint16 + Cfs_enable_1 uint16 + Cfs_enable_2 uint16 + Csf_default uint16 + Dma_ultra uint16 + Trseuc uint16 + TrsEuc uint16 + CurAPMvalues uint16 + Mprc uint16 + Hw_config uint16 + Acoustic uint16 + Msrqs uint16 + Sxfert uint16 + Sal uint16 + Spg uint32 + Lba_capacity_2 uint64 + Words104_125 [22]uint16 + Last_lun uint16 + Word127 uint16 + Dlf uint16 + Csfo uint16 + Words130_155 [26]uint16 + Word156 uint16 + Words157_159 [3]uint16 + Cfa_power uint16 + Words161_175 [15]uint16 + Words176_205 [30]uint16 + Words206_254 [49]uint16 + Integrity_word uint16 +} + +type Statfs_t struct { + Type int32 + Bsize int32 + Frsize int32 + _ [4]byte + Blocks uint64 + Bfree uint64 + Files uint64 + Ffree uint64 + Bavail uint64 + Fsid Fsid + Namelen int32 + Flags int32 + Spare [5]int32 + _ [4]byte +} + +const ( + ST_MANDLOCK = 0x40 + ST_NOATIME = 0x400 + ST_NODEV = 0x4 + ST_NODIRATIME = 0x800 + ST_NOEXEC = 0x8 + ST_NOSUID = 0x2 + ST_RDONLY = 0x1 + ST_RELATIME = 0x1000 + ST_SYNCHRONOUS = 0x10 +) + +type TpacketHdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Usec uint32 +} + +type Tpacket2Hdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Nsec uint32 + Vlan_tci uint16 + Vlan_tpid uint16 + _ [4]uint8 +} + +type Tpacket3Hdr struct { + Next_offset uint32 + Sec uint32 + Nsec uint32 + Snaplen uint32 + Len uint32 + Status uint32 + Mac uint16 + Net uint16 + Hv1 TpacketHdrVariant1 + _ [8]uint8 +} + +type TpacketHdrVariant1 struct { + Rxhash uint32 + Vlan_tci uint32 + Vlan_tpid uint16 + _ uint16 +} + +type TpacketBlockDesc struct { + Version uint32 + To_priv uint32 + Hdr [40]byte +} + +type TpacketReq struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 +} + +type TpacketReq3 struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 + Retire_blk_tov uint32 + Sizeof_priv uint32 + Feature_req_word uint32 +} + +type TpacketStats struct { + Packets uint32 + Drops uint32 +} + +type TpacketStatsV3 struct { + Packets uint32 + Drops uint32 + Freeze_q_cnt uint32 +} + +type TpacketAuxdata struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Vlan_tci uint16 + Vlan_tpid uint16 +} + +const ( + TPACKET_V1 = 0x0 + TPACKET_V2 = 0x1 + TPACKET_V3 = 0x2 +) + +const ( + SizeofTpacketHdr = 0x18 + SizeofTpacket2Hdr = 0x20 + SizeofTpacket3Hdr = 0x30 +) + +const ( + NF_INET_PRE_ROUTING = 0x0 + NF_INET_LOCAL_IN = 0x1 + NF_INET_FORWARD = 0x2 + NF_INET_LOCAL_OUT = 0x3 + NF_INET_POST_ROUTING = 0x4 + NF_INET_NUMHOOKS = 0x5 +) + +const ( + NF_NETDEV_INGRESS = 0x0 + NF_NETDEV_NUMHOOKS = 0x1 +) + +const ( + NFPROTO_UNSPEC = 0x0 + NFPROTO_INET = 0x1 + NFPROTO_IPV4 = 0x2 + NFPROTO_ARP = 0x3 + NFPROTO_NETDEV = 0x5 + NFPROTO_BRIDGE = 0x7 + NFPROTO_IPV6 = 0xa + NFPROTO_DECNET = 0xc + NFPROTO_NUMPROTO = 0xd +) + +type Nfgenmsg struct { + Nfgen_family uint8 + Version uint8 + Res_id uint16 +} + +const ( + NFNL_BATCH_UNSPEC = 0x0 + NFNL_BATCH_GENID = 0x1 +) + +const ( + NFT_REG_VERDICT = 0x0 + NFT_REG_1 = 0x1 + NFT_REG_2 = 0x2 + NFT_REG_3 = 0x3 + NFT_REG_4 = 0x4 + NFT_REG32_00 = 0x8 + NFT_REG32_01 = 0x9 + NFT_REG32_02 = 0xa + NFT_REG32_03 = 0xb + NFT_REG32_04 = 0xc + NFT_REG32_05 = 0xd + NFT_REG32_06 = 0xe + NFT_REG32_07 = 0xf + NFT_REG32_08 = 0x10 + NFT_REG32_09 = 0x11 + NFT_REG32_10 = 0x12 + NFT_REG32_11 = 0x13 + NFT_REG32_12 = 0x14 + NFT_REG32_13 = 0x15 + NFT_REG32_14 = 0x16 + NFT_REG32_15 = 0x17 + NFT_CONTINUE = -0x1 + NFT_BREAK = -0x2 + NFT_JUMP = -0x3 + NFT_GOTO = -0x4 + NFT_RETURN = -0x5 + NFT_MSG_NEWTABLE = 0x0 + NFT_MSG_GETTABLE = 0x1 + NFT_MSG_DELTABLE = 0x2 + NFT_MSG_NEWCHAIN = 0x3 + NFT_MSG_GETCHAIN = 0x4 + NFT_MSG_DELCHAIN = 0x5 + NFT_MSG_NEWRULE = 0x6 + NFT_MSG_GETRULE = 0x7 + NFT_MSG_DELRULE = 0x8 + NFT_MSG_NEWSET = 0x9 + NFT_MSG_GETSET = 0xa + NFT_MSG_DELSET = 0xb + NFT_MSG_NEWSETELEM = 0xc + NFT_MSG_GETSETELEM = 0xd + NFT_MSG_DELSETELEM = 0xe + NFT_MSG_NEWGEN = 0xf + NFT_MSG_GETGEN = 0x10 + NFT_MSG_TRACE = 0x11 + NFT_MSG_NEWOBJ = 0x12 + NFT_MSG_GETOBJ = 0x13 + NFT_MSG_DELOBJ = 0x14 + NFT_MSG_GETOBJ_RESET = 0x15 + NFT_MSG_MAX = 0x19 + NFTA_LIST_UNPEC = 0x0 + NFTA_LIST_ELEM = 0x1 + NFTA_HOOK_UNSPEC = 0x0 + NFTA_HOOK_HOOKNUM = 0x1 + NFTA_HOOK_PRIORITY = 0x2 + NFTA_HOOK_DEV = 0x3 + NFT_TABLE_F_DORMANT = 0x1 + NFTA_TABLE_UNSPEC = 0x0 + NFTA_TABLE_NAME = 0x1 + NFTA_TABLE_FLAGS = 0x2 + NFTA_TABLE_USE = 0x3 + NFTA_CHAIN_UNSPEC = 0x0 + NFTA_CHAIN_TABLE = 0x1 + NFTA_CHAIN_HANDLE = 0x2 + NFTA_CHAIN_NAME = 0x3 + NFTA_CHAIN_HOOK = 0x4 + NFTA_CHAIN_POLICY = 0x5 + NFTA_CHAIN_USE = 0x6 + NFTA_CHAIN_TYPE = 0x7 + NFTA_CHAIN_COUNTERS = 0x8 + NFTA_CHAIN_PAD = 0x9 + NFTA_RULE_UNSPEC = 0x0 + NFTA_RULE_TABLE = 0x1 + NFTA_RULE_CHAIN = 0x2 + NFTA_RULE_HANDLE = 0x3 + NFTA_RULE_EXPRESSIONS = 0x4 + NFTA_RULE_COMPAT = 0x5 + NFTA_RULE_POSITION = 0x6 + NFTA_RULE_USERDATA = 0x7 + NFTA_RULE_PAD = 0x8 + NFTA_RULE_ID = 0x9 + NFT_RULE_COMPAT_F_INV = 0x2 + NFT_RULE_COMPAT_F_MASK = 0x2 + NFTA_RULE_COMPAT_UNSPEC = 0x0 + NFTA_RULE_COMPAT_PROTO = 0x1 + NFTA_RULE_COMPAT_FLAGS = 0x2 + NFT_SET_ANONYMOUS = 0x1 + NFT_SET_CONSTANT = 0x2 + NFT_SET_INTERVAL = 0x4 + NFT_SET_MAP = 0x8 + NFT_SET_TIMEOUT = 0x10 + NFT_SET_EVAL = 0x20 + NFT_SET_OBJECT = 0x40 + NFT_SET_POL_PERFORMANCE = 0x0 + NFT_SET_POL_MEMORY = 0x1 + NFTA_SET_DESC_UNSPEC = 0x0 + NFTA_SET_DESC_SIZE = 0x1 + NFTA_SET_UNSPEC = 0x0 + NFTA_SET_TABLE = 0x1 + NFTA_SET_NAME = 0x2 + NFTA_SET_FLAGS = 0x3 + NFTA_SET_KEY_TYPE = 0x4 + NFTA_SET_KEY_LEN = 0x5 + NFTA_SET_DATA_TYPE = 0x6 + NFTA_SET_DATA_LEN = 0x7 + NFTA_SET_POLICY = 0x8 + NFTA_SET_DESC = 0x9 + NFTA_SET_ID = 0xa + NFTA_SET_TIMEOUT = 0xb + NFTA_SET_GC_INTERVAL = 0xc + NFTA_SET_USERDATA = 0xd + NFTA_SET_PAD = 0xe + NFTA_SET_OBJ_TYPE = 0xf + NFT_SET_ELEM_INTERVAL_END = 0x1 + NFTA_SET_ELEM_UNSPEC = 0x0 + NFTA_SET_ELEM_KEY = 0x1 + NFTA_SET_ELEM_DATA = 0x2 + NFTA_SET_ELEM_FLAGS = 0x3 + NFTA_SET_ELEM_TIMEOUT = 0x4 + NFTA_SET_ELEM_EXPIRATION = 0x5 + NFTA_SET_ELEM_USERDATA = 0x6 + NFTA_SET_ELEM_EXPR = 0x7 + NFTA_SET_ELEM_PAD = 0x8 + NFTA_SET_ELEM_OBJREF = 0x9 + NFTA_SET_ELEM_LIST_UNSPEC = 0x0 + NFTA_SET_ELEM_LIST_TABLE = 0x1 + NFTA_SET_ELEM_LIST_SET = 0x2 + NFTA_SET_ELEM_LIST_ELEMENTS = 0x3 + NFTA_SET_ELEM_LIST_SET_ID = 0x4 + NFT_DATA_VALUE = 0x0 + NFT_DATA_VERDICT = 0xffffff00 + NFTA_DATA_UNSPEC = 0x0 + NFTA_DATA_VALUE = 0x1 + NFTA_DATA_VERDICT = 0x2 + NFTA_VERDICT_UNSPEC = 0x0 + NFTA_VERDICT_CODE = 0x1 + NFTA_VERDICT_CHAIN = 0x2 + NFTA_EXPR_UNSPEC = 0x0 + NFTA_EXPR_NAME = 0x1 + NFTA_EXPR_DATA = 0x2 + NFTA_IMMEDIATE_UNSPEC = 0x0 + NFTA_IMMEDIATE_DREG = 0x1 + NFTA_IMMEDIATE_DATA = 0x2 + NFTA_BITWISE_UNSPEC = 0x0 + NFTA_BITWISE_SREG = 0x1 + NFTA_BITWISE_DREG = 0x2 + NFTA_BITWISE_LEN = 0x3 + NFTA_BITWISE_MASK = 0x4 + NFTA_BITWISE_XOR = 0x5 + NFT_BYTEORDER_NTOH = 0x0 + NFT_BYTEORDER_HTON = 0x1 + NFTA_BYTEORDER_UNSPEC = 0x0 + NFTA_BYTEORDER_SREG = 0x1 + NFTA_BYTEORDER_DREG = 0x2 + NFTA_BYTEORDER_OP = 0x3 + NFTA_BYTEORDER_LEN = 0x4 + NFTA_BYTEORDER_SIZE = 0x5 + NFT_CMP_EQ = 0x0 + NFT_CMP_NEQ = 0x1 + NFT_CMP_LT = 0x2 + NFT_CMP_LTE = 0x3 + NFT_CMP_GT = 0x4 + NFT_CMP_GTE = 0x5 + NFTA_CMP_UNSPEC = 0x0 + NFTA_CMP_SREG = 0x1 + NFTA_CMP_OP = 0x2 + NFTA_CMP_DATA = 0x3 + NFT_RANGE_EQ = 0x0 + NFT_RANGE_NEQ = 0x1 + NFTA_RANGE_UNSPEC = 0x0 + NFTA_RANGE_SREG = 0x1 + NFTA_RANGE_OP = 0x2 + NFTA_RANGE_FROM_DATA = 0x3 + NFTA_RANGE_TO_DATA = 0x4 + NFT_LOOKUP_F_INV = 0x1 + NFTA_LOOKUP_UNSPEC = 0x0 + NFTA_LOOKUP_SET = 0x1 + NFTA_LOOKUP_SREG = 0x2 + NFTA_LOOKUP_DREG = 0x3 + NFTA_LOOKUP_SET_ID = 0x4 + NFTA_LOOKUP_FLAGS = 0x5 + NFT_DYNSET_OP_ADD = 0x0 + NFT_DYNSET_OP_UPDATE = 0x1 + NFT_DYNSET_F_INV = 0x1 + NFTA_DYNSET_UNSPEC = 0x0 + NFTA_DYNSET_SET_NAME = 0x1 + NFTA_DYNSET_SET_ID = 0x2 + NFTA_DYNSET_OP = 0x3 + NFTA_DYNSET_SREG_KEY = 0x4 + NFTA_DYNSET_SREG_DATA = 0x5 + NFTA_DYNSET_TIMEOUT = 0x6 + NFTA_DYNSET_EXPR = 0x7 + NFTA_DYNSET_PAD = 0x8 + NFTA_DYNSET_FLAGS = 0x9 + NFT_PAYLOAD_LL_HEADER = 0x0 + NFT_PAYLOAD_NETWORK_HEADER = 0x1 + NFT_PAYLOAD_TRANSPORT_HEADER = 0x2 + NFT_PAYLOAD_CSUM_NONE = 0x0 + NFT_PAYLOAD_CSUM_INET = 0x1 + NFT_PAYLOAD_L4CSUM_PSEUDOHDR = 0x1 + NFTA_PAYLOAD_UNSPEC = 0x0 + NFTA_PAYLOAD_DREG = 0x1 + NFTA_PAYLOAD_BASE = 0x2 + NFTA_PAYLOAD_OFFSET = 0x3 + NFTA_PAYLOAD_LEN = 0x4 + NFTA_PAYLOAD_SREG = 0x5 + NFTA_PAYLOAD_CSUM_TYPE = 0x6 + NFTA_PAYLOAD_CSUM_OFFSET = 0x7 + NFTA_PAYLOAD_CSUM_FLAGS = 0x8 + NFT_EXTHDR_F_PRESENT = 0x1 + NFT_EXTHDR_OP_IPV6 = 0x0 + NFT_EXTHDR_OP_TCPOPT = 0x1 + NFTA_EXTHDR_UNSPEC = 0x0 + NFTA_EXTHDR_DREG = 0x1 + NFTA_EXTHDR_TYPE = 0x2 + NFTA_EXTHDR_OFFSET = 0x3 + NFTA_EXTHDR_LEN = 0x4 + NFTA_EXTHDR_FLAGS = 0x5 + NFTA_EXTHDR_OP = 0x6 + NFTA_EXTHDR_SREG = 0x7 + NFT_META_LEN = 0x0 + NFT_META_PROTOCOL = 0x1 + NFT_META_PRIORITY = 0x2 + NFT_META_MARK = 0x3 + NFT_META_IIF = 0x4 + NFT_META_OIF = 0x5 + NFT_META_IIFNAME = 0x6 + NFT_META_OIFNAME = 0x7 + NFT_META_IIFTYPE = 0x8 + NFT_META_OIFTYPE = 0x9 + NFT_META_SKUID = 0xa + NFT_META_SKGID = 0xb + NFT_META_NFTRACE = 0xc + NFT_META_RTCLASSID = 0xd + NFT_META_SECMARK = 0xe + NFT_META_NFPROTO = 0xf + NFT_META_L4PROTO = 0x10 + NFT_META_BRI_IIFNAME = 0x11 + NFT_META_BRI_OIFNAME = 0x12 + NFT_META_PKTTYPE = 0x13 + NFT_META_CPU = 0x14 + NFT_META_IIFGROUP = 0x15 + NFT_META_OIFGROUP = 0x16 + NFT_META_CGROUP = 0x17 + NFT_META_PRANDOM = 0x18 + NFT_RT_CLASSID = 0x0 + NFT_RT_NEXTHOP4 = 0x1 + NFT_RT_NEXTHOP6 = 0x2 + NFT_RT_TCPMSS = 0x3 + NFT_HASH_JENKINS = 0x0 + NFT_HASH_SYM = 0x1 + NFTA_HASH_UNSPEC = 0x0 + NFTA_HASH_SREG = 0x1 + NFTA_HASH_DREG = 0x2 + NFTA_HASH_LEN = 0x3 + NFTA_HASH_MODULUS = 0x4 + NFTA_HASH_SEED = 0x5 + NFTA_HASH_OFFSET = 0x6 + NFTA_HASH_TYPE = 0x7 + NFTA_META_UNSPEC = 0x0 + NFTA_META_DREG = 0x1 + NFTA_META_KEY = 0x2 + NFTA_META_SREG = 0x3 + NFTA_RT_UNSPEC = 0x0 + NFTA_RT_DREG = 0x1 + NFTA_RT_KEY = 0x2 + NFT_CT_STATE = 0x0 + NFT_CT_DIRECTION = 0x1 + NFT_CT_STATUS = 0x2 + NFT_CT_MARK = 0x3 + NFT_CT_SECMARK = 0x4 + NFT_CT_EXPIRATION = 0x5 + NFT_CT_HELPER = 0x6 + NFT_CT_L3PROTOCOL = 0x7 + NFT_CT_SRC = 0x8 + NFT_CT_DST = 0x9 + NFT_CT_PROTOCOL = 0xa + NFT_CT_PROTO_SRC = 0xb + NFT_CT_PROTO_DST = 0xc + NFT_CT_LABELS = 0xd + NFT_CT_PKTS = 0xe + NFT_CT_BYTES = 0xf + NFT_CT_AVGPKT = 0x10 + NFT_CT_ZONE = 0x11 + NFT_CT_EVENTMASK = 0x12 + NFTA_CT_UNSPEC = 0x0 + NFTA_CT_DREG = 0x1 + NFTA_CT_KEY = 0x2 + NFTA_CT_DIRECTION = 0x3 + NFTA_CT_SREG = 0x4 + NFT_LIMIT_PKTS = 0x0 + NFT_LIMIT_PKT_BYTES = 0x1 + NFT_LIMIT_F_INV = 0x1 + NFTA_LIMIT_UNSPEC = 0x0 + NFTA_LIMIT_RATE = 0x1 + NFTA_LIMIT_UNIT = 0x2 + NFTA_LIMIT_BURST = 0x3 + NFTA_LIMIT_TYPE = 0x4 + NFTA_LIMIT_FLAGS = 0x5 + NFTA_LIMIT_PAD = 0x6 + NFTA_COUNTER_UNSPEC = 0x0 + NFTA_COUNTER_BYTES = 0x1 + NFTA_COUNTER_PACKETS = 0x2 + NFTA_COUNTER_PAD = 0x3 + NFTA_LOG_UNSPEC = 0x0 + NFTA_LOG_GROUP = 0x1 + NFTA_LOG_PREFIX = 0x2 + NFTA_LOG_SNAPLEN = 0x3 + NFTA_LOG_QTHRESHOLD = 0x4 + NFTA_LOG_LEVEL = 0x5 + NFTA_LOG_FLAGS = 0x6 + NFTA_QUEUE_UNSPEC = 0x0 + NFTA_QUEUE_NUM = 0x1 + NFTA_QUEUE_TOTAL = 0x2 + NFTA_QUEUE_FLAGS = 0x3 + NFTA_QUEUE_SREG_QNUM = 0x4 + NFT_QUOTA_F_INV = 0x1 + NFT_QUOTA_F_DEPLETED = 0x2 + NFTA_QUOTA_UNSPEC = 0x0 + NFTA_QUOTA_BYTES = 0x1 + NFTA_QUOTA_FLAGS = 0x2 + NFTA_QUOTA_PAD = 0x3 + NFTA_QUOTA_CONSUMED = 0x4 + NFT_REJECT_ICMP_UNREACH = 0x0 + NFT_REJECT_TCP_RST = 0x1 + NFT_REJECT_ICMPX_UNREACH = 0x2 + NFT_REJECT_ICMPX_NO_ROUTE = 0x0 + NFT_REJECT_ICMPX_PORT_UNREACH = 0x1 + NFT_REJECT_ICMPX_HOST_UNREACH = 0x2 + NFT_REJECT_ICMPX_ADMIN_PROHIBITED = 0x3 + NFTA_REJECT_UNSPEC = 0x0 + NFTA_REJECT_TYPE = 0x1 + NFTA_REJECT_ICMP_CODE = 0x2 + NFT_NAT_SNAT = 0x0 + NFT_NAT_DNAT = 0x1 + NFTA_NAT_UNSPEC = 0x0 + NFTA_NAT_TYPE = 0x1 + NFTA_NAT_FAMILY = 0x2 + NFTA_NAT_REG_ADDR_MIN = 0x3 + NFTA_NAT_REG_ADDR_MAX = 0x4 + NFTA_NAT_REG_PROTO_MIN = 0x5 + NFTA_NAT_REG_PROTO_MAX = 0x6 + NFTA_NAT_FLAGS = 0x7 + NFTA_MASQ_UNSPEC = 0x0 + NFTA_MASQ_FLAGS = 0x1 + NFTA_MASQ_REG_PROTO_MIN = 0x2 + NFTA_MASQ_REG_PROTO_MAX = 0x3 + NFTA_REDIR_UNSPEC = 0x0 + NFTA_REDIR_REG_PROTO_MIN = 0x1 + NFTA_REDIR_REG_PROTO_MAX = 0x2 + NFTA_REDIR_FLAGS = 0x3 + NFTA_DUP_UNSPEC = 0x0 + NFTA_DUP_SREG_ADDR = 0x1 + NFTA_DUP_SREG_DEV = 0x2 + NFTA_FWD_UNSPEC = 0x0 + NFTA_FWD_SREG_DEV = 0x1 + NFTA_OBJREF_UNSPEC = 0x0 + NFTA_OBJREF_IMM_TYPE = 0x1 + NFTA_OBJREF_IMM_NAME = 0x2 + NFTA_OBJREF_SET_SREG = 0x3 + NFTA_OBJREF_SET_NAME = 0x4 + NFTA_OBJREF_SET_ID = 0x5 + NFTA_GEN_UNSPEC = 0x0 + NFTA_GEN_ID = 0x1 + NFTA_GEN_PROC_PID = 0x2 + NFTA_GEN_PROC_NAME = 0x3 + NFTA_FIB_UNSPEC = 0x0 + NFTA_FIB_DREG = 0x1 + NFTA_FIB_RESULT = 0x2 + NFTA_FIB_FLAGS = 0x3 + NFT_FIB_RESULT_UNSPEC = 0x0 + NFT_FIB_RESULT_OIF = 0x1 + NFT_FIB_RESULT_OIFNAME = 0x2 + NFT_FIB_RESULT_ADDRTYPE = 0x3 + NFTA_FIB_F_SADDR = 0x1 + NFTA_FIB_F_DADDR = 0x2 + NFTA_FIB_F_MARK = 0x4 + NFTA_FIB_F_IIF = 0x8 + NFTA_FIB_F_OIF = 0x10 + NFTA_FIB_F_PRESENT = 0x20 + NFTA_CT_HELPER_UNSPEC = 0x0 + NFTA_CT_HELPER_NAME = 0x1 + NFTA_CT_HELPER_L3PROTO = 0x2 + NFTA_CT_HELPER_L4PROTO = 0x3 + NFTA_OBJ_UNSPEC = 0x0 + NFTA_OBJ_TABLE = 0x1 + NFTA_OBJ_NAME = 0x2 + NFTA_OBJ_TYPE = 0x3 + NFTA_OBJ_DATA = 0x4 + NFTA_OBJ_USE = 0x5 + NFTA_TRACE_UNSPEC = 0x0 + NFTA_TRACE_TABLE = 0x1 + NFTA_TRACE_CHAIN = 0x2 + NFTA_TRACE_RULE_HANDLE = 0x3 + NFTA_TRACE_TYPE = 0x4 + NFTA_TRACE_VERDICT = 0x5 + NFTA_TRACE_ID = 0x6 + NFTA_TRACE_LL_HEADER = 0x7 + NFTA_TRACE_NETWORK_HEADER = 0x8 + NFTA_TRACE_TRANSPORT_HEADER = 0x9 + NFTA_TRACE_IIF = 0xa + NFTA_TRACE_IIFTYPE = 0xb + NFTA_TRACE_OIF = 0xc + NFTA_TRACE_OIFTYPE = 0xd + NFTA_TRACE_MARK = 0xe + NFTA_TRACE_NFPROTO = 0xf + NFTA_TRACE_POLICY = 0x10 + NFTA_TRACE_PAD = 0x11 + NFT_TRACETYPE_UNSPEC = 0x0 + NFT_TRACETYPE_POLICY = 0x1 + NFT_TRACETYPE_RETURN = 0x2 + NFT_TRACETYPE_RULE = 0x3 + NFTA_NG_UNSPEC = 0x0 + NFTA_NG_DREG = 0x1 + NFTA_NG_MODULUS = 0x2 + NFTA_NG_TYPE = 0x3 + NFTA_NG_OFFSET = 0x4 + NFT_NG_INCREMENTAL = 0x0 + NFT_NG_RANDOM = 0x1 +) + +type RTCTime struct { + Sec int32 + Min int32 + Hour int32 + Mday int32 + Mon int32 + Year int32 + Wday int32 + Yday int32 + Isdst int32 +} + +type RTCWkAlrm struct { + Enabled uint8 + Pending uint8 + _ [2]byte + Time RTCTime +} + +type RTCPLLInfo struct { + Ctrl int32 + Value int32 + Max int32 + Min int32 + Posmult int32 + Negmult int32 + Clock int32 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go index 01e8f65ca6..5c6ea719da 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64.go @@ -117,25 +117,10 @@ type Stat_t struct { Blocks int64 } -type Statfs_t struct { - Type int64 - Bsize int64 - Frsize int64 - Blocks uint64 - Bfree uint64 - Files uint64 - Ffree uint64 - Bavail uint64 - Fsid Fsid - Namelen int64 - Flags int64 - Spare [5]int64 -} - type StatxTimestamp struct { - Sec int64 - Nsec uint32 - X__reserved int32 + Sec int64 + Nsec uint32 + _ int32 } type Statx_t struct { @@ -172,7 +157,7 @@ type Dirent struct { } type Fsid struct { - X__val [2]int32 + Val [2]int32 } type Flock_t struct { @@ -266,6 +251,13 @@ type RawSockaddrL2 struct { _ [1]byte } +type RawSockaddrRFCOMM struct { + Family uint16 + Bdaddr [6]uint8 + Channel uint8 + _ [1]byte +} + type RawSockaddrCAN struct { Family uint16 _ [2]byte @@ -421,6 +413,7 @@ const ( SizeofSockaddrNetlink = 0xc SizeofSockaddrHCI = 0x6 SizeofSockaddrL2 = 0xe + SizeofSockaddrRFCOMM = 0xa SizeofSockaddrCAN = 0x10 SizeofSockaddrALG = 0x58 SizeofSockaddrVM = 0x10 @@ -441,97 +434,123 @@ const ( ) const ( - IFA_UNSPEC = 0x0 - IFA_ADDRESS = 0x1 - IFA_LOCAL = 0x2 - IFA_LABEL = 0x3 - IFA_BROADCAST = 0x4 - IFA_ANYCAST = 0x5 - IFA_CACHEINFO = 0x6 - IFA_MULTICAST = 0x7 - IFLA_UNSPEC = 0x0 - IFLA_ADDRESS = 0x1 - IFLA_BROADCAST = 0x2 - IFLA_IFNAME = 0x3 - IFLA_MTU = 0x4 - IFLA_LINK = 0x5 - IFLA_QDISC = 0x6 - IFLA_STATS = 0x7 - IFLA_COST = 0x8 - IFLA_PRIORITY = 0x9 - IFLA_MASTER = 0xa - IFLA_WIRELESS = 0xb - IFLA_PROTINFO = 0xc - IFLA_TXQLEN = 0xd - IFLA_MAP = 0xe - IFLA_WEIGHT = 0xf - IFLA_OPERSTATE = 0x10 - IFLA_LINKMODE = 0x11 - IFLA_LINKINFO = 0x12 - IFLA_NET_NS_PID = 0x13 - IFLA_IFALIAS = 0x14 - IFLA_MAX = 0x2c - RT_SCOPE_UNIVERSE = 0x0 - RT_SCOPE_SITE = 0xc8 - RT_SCOPE_LINK = 0xfd - RT_SCOPE_HOST = 0xfe - RT_SCOPE_NOWHERE = 0xff - RT_TABLE_UNSPEC = 0x0 - RT_TABLE_COMPAT = 0xfc - RT_TABLE_DEFAULT = 0xfd - RT_TABLE_MAIN = 0xfe - RT_TABLE_LOCAL = 0xff - RT_TABLE_MAX = 0xffffffff - RTA_UNSPEC = 0x0 - RTA_DST = 0x1 - RTA_SRC = 0x2 - RTA_IIF = 0x3 - RTA_OIF = 0x4 - RTA_GATEWAY = 0x5 - RTA_PRIORITY = 0x6 - RTA_PREFSRC = 0x7 - RTA_METRICS = 0x8 - RTA_MULTIPATH = 0x9 - RTA_FLOW = 0xb - RTA_CACHEINFO = 0xc - RTA_TABLE = 0xf - RTN_UNSPEC = 0x0 - RTN_UNICAST = 0x1 - RTN_LOCAL = 0x2 - RTN_BROADCAST = 0x3 - RTN_ANYCAST = 0x4 - RTN_MULTICAST = 0x5 - RTN_BLACKHOLE = 0x6 - RTN_UNREACHABLE = 0x7 - RTN_PROHIBIT = 0x8 - RTN_THROW = 0x9 - RTN_NAT = 0xa - RTN_XRESOLVE = 0xb - RTNLGRP_NONE = 0x0 - RTNLGRP_LINK = 0x1 - RTNLGRP_NOTIFY = 0x2 - RTNLGRP_NEIGH = 0x3 - RTNLGRP_TC = 0x4 - RTNLGRP_IPV4_IFADDR = 0x5 - RTNLGRP_IPV4_MROUTE = 0x6 - RTNLGRP_IPV4_ROUTE = 0x7 - RTNLGRP_IPV4_RULE = 0x8 - RTNLGRP_IPV6_IFADDR = 0x9 - RTNLGRP_IPV6_MROUTE = 0xa - RTNLGRP_IPV6_ROUTE = 0xb - RTNLGRP_IPV6_IFINFO = 0xc - RTNLGRP_IPV6_PREFIX = 0x12 - RTNLGRP_IPV6_RULE = 0x13 - RTNLGRP_ND_USEROPT = 0x14 - SizeofNlMsghdr = 0x10 - SizeofNlMsgerr = 0x14 - SizeofRtGenmsg = 0x1 - SizeofNlAttr = 0x4 - SizeofRtAttr = 0x4 - SizeofIfInfomsg = 0x10 - SizeofIfAddrmsg = 0x8 - SizeofRtMsg = 0xc - SizeofRtNexthop = 0x8 + IFA_UNSPEC = 0x0 + IFA_ADDRESS = 0x1 + IFA_LOCAL = 0x2 + IFA_LABEL = 0x3 + IFA_BROADCAST = 0x4 + IFA_ANYCAST = 0x5 + IFA_CACHEINFO = 0x6 + IFA_MULTICAST = 0x7 + IFLA_UNSPEC = 0x0 + IFLA_ADDRESS = 0x1 + IFLA_BROADCAST = 0x2 + IFLA_IFNAME = 0x3 + IFLA_MTU = 0x4 + IFLA_LINK = 0x5 + IFLA_QDISC = 0x6 + IFLA_STATS = 0x7 + IFLA_COST = 0x8 + IFLA_PRIORITY = 0x9 + IFLA_MASTER = 0xa + IFLA_WIRELESS = 0xb + IFLA_PROTINFO = 0xc + IFLA_TXQLEN = 0xd + IFLA_MAP = 0xe + IFLA_WEIGHT = 0xf + IFLA_OPERSTATE = 0x10 + IFLA_LINKMODE = 0x11 + IFLA_LINKINFO = 0x12 + IFLA_NET_NS_PID = 0x13 + IFLA_IFALIAS = 0x14 + IFLA_NUM_VF = 0x15 + IFLA_VFINFO_LIST = 0x16 + IFLA_STATS64 = 0x17 + IFLA_VF_PORTS = 0x18 + IFLA_PORT_SELF = 0x19 + IFLA_AF_SPEC = 0x1a + IFLA_GROUP = 0x1b + IFLA_NET_NS_FD = 0x1c + IFLA_EXT_MASK = 0x1d + IFLA_PROMISCUITY = 0x1e + IFLA_NUM_TX_QUEUES = 0x1f + IFLA_NUM_RX_QUEUES = 0x20 + IFLA_CARRIER = 0x21 + IFLA_PHYS_PORT_ID = 0x22 + IFLA_CARRIER_CHANGES = 0x23 + IFLA_PHYS_SWITCH_ID = 0x24 + IFLA_LINK_NETNSID = 0x25 + IFLA_PHYS_PORT_NAME = 0x26 + IFLA_PROTO_DOWN = 0x27 + IFLA_GSO_MAX_SEGS = 0x28 + IFLA_GSO_MAX_SIZE = 0x29 + IFLA_PAD = 0x2a + IFLA_XDP = 0x2b + IFLA_EVENT = 0x2c + IFLA_NEW_NETNSID = 0x2d + IFLA_IF_NETNSID = 0x2e + IFLA_MAX = 0x31 + RT_SCOPE_UNIVERSE = 0x0 + RT_SCOPE_SITE = 0xc8 + RT_SCOPE_LINK = 0xfd + RT_SCOPE_HOST = 0xfe + RT_SCOPE_NOWHERE = 0xff + RT_TABLE_UNSPEC = 0x0 + RT_TABLE_COMPAT = 0xfc + RT_TABLE_DEFAULT = 0xfd + RT_TABLE_MAIN = 0xfe + RT_TABLE_LOCAL = 0xff + RT_TABLE_MAX = 0xffffffff + RTA_UNSPEC = 0x0 + RTA_DST = 0x1 + RTA_SRC = 0x2 + RTA_IIF = 0x3 + RTA_OIF = 0x4 + RTA_GATEWAY = 0x5 + RTA_PRIORITY = 0x6 + RTA_PREFSRC = 0x7 + RTA_METRICS = 0x8 + RTA_MULTIPATH = 0x9 + RTA_FLOW = 0xb + RTA_CACHEINFO = 0xc + RTA_TABLE = 0xf + RTN_UNSPEC = 0x0 + RTN_UNICAST = 0x1 + RTN_LOCAL = 0x2 + RTN_BROADCAST = 0x3 + RTN_ANYCAST = 0x4 + RTN_MULTICAST = 0x5 + RTN_BLACKHOLE = 0x6 + RTN_UNREACHABLE = 0x7 + RTN_PROHIBIT = 0x8 + RTN_THROW = 0x9 + RTN_NAT = 0xa + RTN_XRESOLVE = 0xb + RTNLGRP_NONE = 0x0 + RTNLGRP_LINK = 0x1 + RTNLGRP_NOTIFY = 0x2 + RTNLGRP_NEIGH = 0x3 + RTNLGRP_TC = 0x4 + RTNLGRP_IPV4_IFADDR = 0x5 + RTNLGRP_IPV4_MROUTE = 0x6 + RTNLGRP_IPV4_ROUTE = 0x7 + RTNLGRP_IPV4_RULE = 0x8 + RTNLGRP_IPV6_IFADDR = 0x9 + RTNLGRP_IPV6_MROUTE = 0xa + RTNLGRP_IPV6_ROUTE = 0xb + RTNLGRP_IPV6_IFINFO = 0xc + RTNLGRP_IPV6_PREFIX = 0x12 + RTNLGRP_IPV6_RULE = 0x13 + RTNLGRP_ND_USEROPT = 0x14 + SizeofNlMsghdr = 0x10 + SizeofNlMsgerr = 0x14 + SizeofRtGenmsg = 0x1 + SizeofNlAttr = 0x4 + SizeofRtAttr = 0x4 + SizeofIfInfomsg = 0x10 + SizeofIfAddrmsg = 0x8 + SizeofRtMsg = 0xc + SizeofRtNexthop = 0x8 ) type NlMsghdr struct { @@ -562,12 +581,12 @@ type RtAttr struct { } type IfInfomsg struct { - Family uint8 - X__ifi_pad uint8 - Type uint16 - Index int32 - Flags uint32 - Change uint32 + Family uint8 + _ uint8 + Type uint16 + Index int32 + Flags uint32 + Change uint32 } type IfAddrmsg struct { @@ -653,7 +672,7 @@ type Sysinfo_t struct { Totalhigh uint64 Freehigh uint64 Unit uint32 - X_f [0]int8 + _ [0]int8 _ [4]byte } @@ -693,6 +712,8 @@ const ( AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x100 + + AT_EACCESS = 0x200 ) type PollFd struct { @@ -712,7 +733,7 @@ const ( ) type Sigset_t struct { - X__val [16]uint64 + Val [16]uint64 } const RNDGETENTCNT = 0x40045200 @@ -868,3 +889,967 @@ const ( BDADDR_LE_PUBLIC = 0x1 BDADDR_LE_RANDOM = 0x2 ) + +type PerfEventAttr struct { + Type uint32 + Size uint32 + Config uint64 + Sample uint64 + Sample_type uint64 + Read_format uint64 + Bits uint64 + Wakeup uint32 + Bp_type uint32 + Ext1 uint64 + Ext2 uint64 + Branch_sample_type uint64 + Sample_regs_user uint64 + Sample_stack_user uint32 + Clockid int32 + Sample_regs_intr uint64 + Aux_watermark uint32 + _ uint32 +} + +type PerfEventMmapPage struct { + Version uint32 + Compat_version uint32 + Lock uint32 + Index uint32 + Offset int64 + Time_enabled uint64 + Time_running uint64 + Capabilities uint64 + Pmc_width uint16 + Time_shift uint16 + Time_mult uint32 + Time_offset uint64 + Time_zero uint64 + Size uint32 + _ [948]uint8 + Data_head uint64 + Data_tail uint64 + Data_offset uint64 + Data_size uint64 + Aux_head uint64 + Aux_tail uint64 + Aux_offset uint64 + Aux_size uint64 +} + +const ( + PerfBitDisabled uint64 = CBitFieldMaskBit0 + PerfBitInherit = CBitFieldMaskBit1 + PerfBitPinned = CBitFieldMaskBit2 + PerfBitExclusive = CBitFieldMaskBit3 + PerfBitExcludeUser = CBitFieldMaskBit4 + PerfBitExcludeKernel = CBitFieldMaskBit5 + PerfBitExcludeHv = CBitFieldMaskBit6 + PerfBitExcludeIdle = CBitFieldMaskBit7 + PerfBitMmap = CBitFieldMaskBit8 + PerfBitComm = CBitFieldMaskBit9 + PerfBitFreq = CBitFieldMaskBit10 + PerfBitInheritStat = CBitFieldMaskBit11 + PerfBitEnableOnExec = CBitFieldMaskBit12 + PerfBitTask = CBitFieldMaskBit13 + PerfBitWatermark = CBitFieldMaskBit14 + PerfBitPreciseIPBit1 = CBitFieldMaskBit15 + PerfBitPreciseIPBit2 = CBitFieldMaskBit16 + PerfBitMmapData = CBitFieldMaskBit17 + PerfBitSampleIDAll = CBitFieldMaskBit18 + PerfBitExcludeHost = CBitFieldMaskBit19 + PerfBitExcludeGuest = CBitFieldMaskBit20 + PerfBitExcludeCallchainKernel = CBitFieldMaskBit21 + PerfBitExcludeCallchainUser = CBitFieldMaskBit22 + PerfBitMmap2 = CBitFieldMaskBit23 + PerfBitCommExec = CBitFieldMaskBit24 + PerfBitUseClockID = CBitFieldMaskBit25 + PerfBitContextSwitch = CBitFieldMaskBit26 +) + +const ( + PERF_TYPE_HARDWARE = 0x0 + PERF_TYPE_SOFTWARE = 0x1 + PERF_TYPE_TRACEPOINT = 0x2 + PERF_TYPE_HW_CACHE = 0x3 + PERF_TYPE_RAW = 0x4 + PERF_TYPE_BREAKPOINT = 0x5 + + PERF_COUNT_HW_CPU_CYCLES = 0x0 + PERF_COUNT_HW_INSTRUCTIONS = 0x1 + PERF_COUNT_HW_CACHE_REFERENCES = 0x2 + PERF_COUNT_HW_CACHE_MISSES = 0x3 + PERF_COUNT_HW_BRANCH_INSTRUCTIONS = 0x4 + PERF_COUNT_HW_BRANCH_MISSES = 0x5 + PERF_COUNT_HW_BUS_CYCLES = 0x6 + PERF_COUNT_HW_STALLED_CYCLES_FRONTEND = 0x7 + PERF_COUNT_HW_STALLED_CYCLES_BACKEND = 0x8 + PERF_COUNT_HW_REF_CPU_CYCLES = 0x9 + + PERF_COUNT_HW_CACHE_L1D = 0x0 + PERF_COUNT_HW_CACHE_L1I = 0x1 + PERF_COUNT_HW_CACHE_LL = 0x2 + PERF_COUNT_HW_CACHE_DTLB = 0x3 + PERF_COUNT_HW_CACHE_ITLB = 0x4 + PERF_COUNT_HW_CACHE_BPU = 0x5 + PERF_COUNT_HW_CACHE_NODE = 0x6 + + PERF_COUNT_HW_CACHE_OP_READ = 0x0 + PERF_COUNT_HW_CACHE_OP_WRITE = 0x1 + PERF_COUNT_HW_CACHE_OP_PREFETCH = 0x2 + + PERF_COUNT_HW_CACHE_RESULT_ACCESS = 0x0 + PERF_COUNT_HW_CACHE_RESULT_MISS = 0x1 + + PERF_COUNT_SW_CPU_CLOCK = 0x0 + PERF_COUNT_SW_TASK_CLOCK = 0x1 + PERF_COUNT_SW_PAGE_FAULTS = 0x2 + PERF_COUNT_SW_CONTEXT_SWITCHES = 0x3 + PERF_COUNT_SW_CPU_MIGRATIONS = 0x4 + PERF_COUNT_SW_PAGE_FAULTS_MIN = 0x5 + PERF_COUNT_SW_PAGE_FAULTS_MAJ = 0x6 + PERF_COUNT_SW_ALIGNMENT_FAULTS = 0x7 + PERF_COUNT_SW_EMULATION_FAULTS = 0x8 + PERF_COUNT_SW_DUMMY = 0x9 + + PERF_SAMPLE_IP = 0x1 + PERF_SAMPLE_TID = 0x2 + PERF_SAMPLE_TIME = 0x4 + PERF_SAMPLE_ADDR = 0x8 + PERF_SAMPLE_READ = 0x10 + PERF_SAMPLE_CALLCHAIN = 0x20 + PERF_SAMPLE_ID = 0x40 + PERF_SAMPLE_CPU = 0x80 + PERF_SAMPLE_PERIOD = 0x100 + PERF_SAMPLE_STREAM_ID = 0x200 + PERF_SAMPLE_RAW = 0x400 + PERF_SAMPLE_BRANCH_STACK = 0x800 + + PERF_SAMPLE_BRANCH_USER = 0x1 + PERF_SAMPLE_BRANCH_KERNEL = 0x2 + PERF_SAMPLE_BRANCH_HV = 0x4 + PERF_SAMPLE_BRANCH_ANY = 0x8 + PERF_SAMPLE_BRANCH_ANY_CALL = 0x10 + PERF_SAMPLE_BRANCH_ANY_RETURN = 0x20 + PERF_SAMPLE_BRANCH_IND_CALL = 0x40 + + PERF_FORMAT_TOTAL_TIME_ENABLED = 0x1 + PERF_FORMAT_TOTAL_TIME_RUNNING = 0x2 + PERF_FORMAT_ID = 0x4 + PERF_FORMAT_GROUP = 0x8 + + PERF_RECORD_MMAP = 0x1 + PERF_RECORD_LOST = 0x2 + PERF_RECORD_COMM = 0x3 + PERF_RECORD_EXIT = 0x4 + PERF_RECORD_THROTTLE = 0x5 + PERF_RECORD_UNTHROTTLE = 0x6 + PERF_RECORD_FORK = 0x7 + PERF_RECORD_READ = 0x8 + PERF_RECORD_SAMPLE = 0x9 + + PERF_CONTEXT_HV = -0x20 + PERF_CONTEXT_KERNEL = -0x80 + PERF_CONTEXT_USER = -0x200 + + PERF_CONTEXT_GUEST = -0x800 + PERF_CONTEXT_GUEST_KERNEL = -0x880 + PERF_CONTEXT_GUEST_USER = -0xa00 + + PERF_FLAG_FD_NO_GROUP = 0x1 + PERF_FLAG_FD_OUTPUT = 0x2 + PERF_FLAG_PID_CGROUP = 0x4 +) + +const ( + CBitFieldMaskBit0 = 0x8000000000000000 + CBitFieldMaskBit1 = 0x4000000000000000 + CBitFieldMaskBit2 = 0x2000000000000000 + CBitFieldMaskBit3 = 0x1000000000000000 + CBitFieldMaskBit4 = 0x800000000000000 + CBitFieldMaskBit5 = 0x400000000000000 + CBitFieldMaskBit6 = 0x200000000000000 + CBitFieldMaskBit7 = 0x100000000000000 + CBitFieldMaskBit8 = 0x80000000000000 + CBitFieldMaskBit9 = 0x40000000000000 + CBitFieldMaskBit10 = 0x20000000000000 + CBitFieldMaskBit11 = 0x10000000000000 + CBitFieldMaskBit12 = 0x8000000000000 + CBitFieldMaskBit13 = 0x4000000000000 + CBitFieldMaskBit14 = 0x2000000000000 + CBitFieldMaskBit15 = 0x1000000000000 + CBitFieldMaskBit16 = 0x800000000000 + CBitFieldMaskBit17 = 0x400000000000 + CBitFieldMaskBit18 = 0x200000000000 + CBitFieldMaskBit19 = 0x100000000000 + CBitFieldMaskBit20 = 0x80000000000 + CBitFieldMaskBit21 = 0x40000000000 + CBitFieldMaskBit22 = 0x20000000000 + CBitFieldMaskBit23 = 0x10000000000 + CBitFieldMaskBit24 = 0x8000000000 + CBitFieldMaskBit25 = 0x4000000000 + CBitFieldMaskBit26 = 0x2000000000 + CBitFieldMaskBit27 = 0x1000000000 + CBitFieldMaskBit28 = 0x800000000 + CBitFieldMaskBit29 = 0x400000000 + CBitFieldMaskBit30 = 0x200000000 + CBitFieldMaskBit31 = 0x100000000 + CBitFieldMaskBit32 = 0x80000000 + CBitFieldMaskBit33 = 0x40000000 + CBitFieldMaskBit34 = 0x20000000 + CBitFieldMaskBit35 = 0x10000000 + CBitFieldMaskBit36 = 0x8000000 + CBitFieldMaskBit37 = 0x4000000 + CBitFieldMaskBit38 = 0x2000000 + CBitFieldMaskBit39 = 0x1000000 + CBitFieldMaskBit40 = 0x800000 + CBitFieldMaskBit41 = 0x400000 + CBitFieldMaskBit42 = 0x200000 + CBitFieldMaskBit43 = 0x100000 + CBitFieldMaskBit44 = 0x80000 + CBitFieldMaskBit45 = 0x40000 + CBitFieldMaskBit46 = 0x20000 + CBitFieldMaskBit47 = 0x10000 + CBitFieldMaskBit48 = 0x8000 + CBitFieldMaskBit49 = 0x4000 + CBitFieldMaskBit50 = 0x2000 + CBitFieldMaskBit51 = 0x1000 + CBitFieldMaskBit52 = 0x800 + CBitFieldMaskBit53 = 0x400 + CBitFieldMaskBit54 = 0x200 + CBitFieldMaskBit55 = 0x100 + CBitFieldMaskBit56 = 0x80 + CBitFieldMaskBit57 = 0x40 + CBitFieldMaskBit58 = 0x20 + CBitFieldMaskBit59 = 0x10 + CBitFieldMaskBit60 = 0x8 + CBitFieldMaskBit61 = 0x4 + CBitFieldMaskBit62 = 0x2 + CBitFieldMaskBit63 = 0x1 +) + +type SockaddrStorage struct { + Family uint16 + _ [118]int8 + _ uint64 +} + +type TCPMD5Sig struct { + Addr SockaddrStorage + Flags uint8 + Prefixlen uint8 + Keylen uint16 + _ uint32 + Key [80]uint8 +} + +type HDDriveCmdHdr struct { + Command uint8 + Number uint8 + Feature uint8 + Count uint8 +} + +type HDGeometry struct { + Heads uint8 + Sectors uint8 + Cylinders uint16 + _ [4]byte + Start uint64 +} + +type HDDriveID struct { + Config uint16 + Cyls uint16 + Reserved2 uint16 + Heads uint16 + Track_bytes uint16 + Sector_bytes uint16 + Sectors uint16 + Vendor0 uint16 + Vendor1 uint16 + Vendor2 uint16 + Serial_no [20]uint8 + Buf_type uint16 + Buf_size uint16 + Ecc_bytes uint16 + Fw_rev [8]uint8 + Model [40]uint8 + Max_multsect uint8 + Vendor3 uint8 + Dword_io uint16 + Vendor4 uint8 + Capability uint8 + Reserved50 uint16 + Vendor5 uint8 + TPIO uint8 + Vendor6 uint8 + TDMA uint8 + Field_valid uint16 + Cur_cyls uint16 + Cur_heads uint16 + Cur_sectors uint16 + Cur_capacity0 uint16 + Cur_capacity1 uint16 + Multsect uint8 + Multsect_valid uint8 + Lba_capacity uint32 + Dma_1word uint16 + Dma_mword uint16 + Eide_pio_modes uint16 + Eide_dma_min uint16 + Eide_dma_time uint16 + Eide_pio uint16 + Eide_pio_iordy uint16 + Words69_70 [2]uint16 + Words71_74 [4]uint16 + Queue_depth uint16 + Words76_79 [4]uint16 + Major_rev_num uint16 + Minor_rev_num uint16 + Command_set_1 uint16 + Command_set_2 uint16 + Cfsse uint16 + Cfs_enable_1 uint16 + Cfs_enable_2 uint16 + Csf_default uint16 + Dma_ultra uint16 + Trseuc uint16 + TrsEuc uint16 + CurAPMvalues uint16 + Mprc uint16 + Hw_config uint16 + Acoustic uint16 + Msrqs uint16 + Sxfert uint16 + Sal uint16 + Spg uint32 + Lba_capacity_2 uint64 + Words104_125 [22]uint16 + Last_lun uint16 + Word127 uint16 + Dlf uint16 + Csfo uint16 + Words130_155 [26]uint16 + Word156 uint16 + Words157_159 [3]uint16 + Cfa_power uint16 + Words161_175 [15]uint16 + Words176_205 [30]uint16 + Words206_254 [49]uint16 + Integrity_word uint16 +} + +type Statfs_t struct { + Type int64 + Bsize int64 + Frsize int64 + Blocks uint64 + Bfree uint64 + Files uint64 + Ffree uint64 + Bavail uint64 + Fsid Fsid + Namelen int64 + Flags int64 + Spare [5]int64 +} + +const ( + ST_MANDLOCK = 0x40 + ST_NOATIME = 0x400 + ST_NODEV = 0x4 + ST_NODIRATIME = 0x800 + ST_NOEXEC = 0x8 + ST_NOSUID = 0x2 + ST_RDONLY = 0x1 + ST_RELATIME = 0x1000 + ST_SYNCHRONOUS = 0x10 +) + +type TpacketHdr struct { + Status uint64 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Usec uint32 + _ [4]byte +} + +type Tpacket2Hdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Nsec uint32 + Vlan_tci uint16 + Vlan_tpid uint16 + _ [4]uint8 +} + +type Tpacket3Hdr struct { + Next_offset uint32 + Sec uint32 + Nsec uint32 + Snaplen uint32 + Len uint32 + Status uint32 + Mac uint16 + Net uint16 + Hv1 TpacketHdrVariant1 + _ [8]uint8 +} + +type TpacketHdrVariant1 struct { + Rxhash uint32 + Vlan_tci uint32 + Vlan_tpid uint16 + _ uint16 +} + +type TpacketBlockDesc struct { + Version uint32 + To_priv uint32 + Hdr [40]byte +} + +type TpacketReq struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 +} + +type TpacketReq3 struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 + Retire_blk_tov uint32 + Sizeof_priv uint32 + Feature_req_word uint32 +} + +type TpacketStats struct { + Packets uint32 + Drops uint32 +} + +type TpacketStatsV3 struct { + Packets uint32 + Drops uint32 + Freeze_q_cnt uint32 +} + +type TpacketAuxdata struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Vlan_tci uint16 + Vlan_tpid uint16 +} + +const ( + TPACKET_V1 = 0x0 + TPACKET_V2 = 0x1 + TPACKET_V3 = 0x2 +) + +const ( + SizeofTpacketHdr = 0x20 + SizeofTpacket2Hdr = 0x20 + SizeofTpacket3Hdr = 0x30 +) + +const ( + NF_INET_PRE_ROUTING = 0x0 + NF_INET_LOCAL_IN = 0x1 + NF_INET_FORWARD = 0x2 + NF_INET_LOCAL_OUT = 0x3 + NF_INET_POST_ROUTING = 0x4 + NF_INET_NUMHOOKS = 0x5 +) + +const ( + NF_NETDEV_INGRESS = 0x0 + NF_NETDEV_NUMHOOKS = 0x1 +) + +const ( + NFPROTO_UNSPEC = 0x0 + NFPROTO_INET = 0x1 + NFPROTO_IPV4 = 0x2 + NFPROTO_ARP = 0x3 + NFPROTO_NETDEV = 0x5 + NFPROTO_BRIDGE = 0x7 + NFPROTO_IPV6 = 0xa + NFPROTO_DECNET = 0xc + NFPROTO_NUMPROTO = 0xd +) + +type Nfgenmsg struct { + Nfgen_family uint8 + Version uint8 + Res_id uint16 +} + +const ( + NFNL_BATCH_UNSPEC = 0x0 + NFNL_BATCH_GENID = 0x1 +) + +const ( + NFT_REG_VERDICT = 0x0 + NFT_REG_1 = 0x1 + NFT_REG_2 = 0x2 + NFT_REG_3 = 0x3 + NFT_REG_4 = 0x4 + NFT_REG32_00 = 0x8 + NFT_REG32_01 = 0x9 + NFT_REG32_02 = 0xa + NFT_REG32_03 = 0xb + NFT_REG32_04 = 0xc + NFT_REG32_05 = 0xd + NFT_REG32_06 = 0xe + NFT_REG32_07 = 0xf + NFT_REG32_08 = 0x10 + NFT_REG32_09 = 0x11 + NFT_REG32_10 = 0x12 + NFT_REG32_11 = 0x13 + NFT_REG32_12 = 0x14 + NFT_REG32_13 = 0x15 + NFT_REG32_14 = 0x16 + NFT_REG32_15 = 0x17 + NFT_CONTINUE = -0x1 + NFT_BREAK = -0x2 + NFT_JUMP = -0x3 + NFT_GOTO = -0x4 + NFT_RETURN = -0x5 + NFT_MSG_NEWTABLE = 0x0 + NFT_MSG_GETTABLE = 0x1 + NFT_MSG_DELTABLE = 0x2 + NFT_MSG_NEWCHAIN = 0x3 + NFT_MSG_GETCHAIN = 0x4 + NFT_MSG_DELCHAIN = 0x5 + NFT_MSG_NEWRULE = 0x6 + NFT_MSG_GETRULE = 0x7 + NFT_MSG_DELRULE = 0x8 + NFT_MSG_NEWSET = 0x9 + NFT_MSG_GETSET = 0xa + NFT_MSG_DELSET = 0xb + NFT_MSG_NEWSETELEM = 0xc + NFT_MSG_GETSETELEM = 0xd + NFT_MSG_DELSETELEM = 0xe + NFT_MSG_NEWGEN = 0xf + NFT_MSG_GETGEN = 0x10 + NFT_MSG_TRACE = 0x11 + NFT_MSG_NEWOBJ = 0x12 + NFT_MSG_GETOBJ = 0x13 + NFT_MSG_DELOBJ = 0x14 + NFT_MSG_GETOBJ_RESET = 0x15 + NFT_MSG_MAX = 0x19 + NFTA_LIST_UNPEC = 0x0 + NFTA_LIST_ELEM = 0x1 + NFTA_HOOK_UNSPEC = 0x0 + NFTA_HOOK_HOOKNUM = 0x1 + NFTA_HOOK_PRIORITY = 0x2 + NFTA_HOOK_DEV = 0x3 + NFT_TABLE_F_DORMANT = 0x1 + NFTA_TABLE_UNSPEC = 0x0 + NFTA_TABLE_NAME = 0x1 + NFTA_TABLE_FLAGS = 0x2 + NFTA_TABLE_USE = 0x3 + NFTA_CHAIN_UNSPEC = 0x0 + NFTA_CHAIN_TABLE = 0x1 + NFTA_CHAIN_HANDLE = 0x2 + NFTA_CHAIN_NAME = 0x3 + NFTA_CHAIN_HOOK = 0x4 + NFTA_CHAIN_POLICY = 0x5 + NFTA_CHAIN_USE = 0x6 + NFTA_CHAIN_TYPE = 0x7 + NFTA_CHAIN_COUNTERS = 0x8 + NFTA_CHAIN_PAD = 0x9 + NFTA_RULE_UNSPEC = 0x0 + NFTA_RULE_TABLE = 0x1 + NFTA_RULE_CHAIN = 0x2 + NFTA_RULE_HANDLE = 0x3 + NFTA_RULE_EXPRESSIONS = 0x4 + NFTA_RULE_COMPAT = 0x5 + NFTA_RULE_POSITION = 0x6 + NFTA_RULE_USERDATA = 0x7 + NFTA_RULE_PAD = 0x8 + NFTA_RULE_ID = 0x9 + NFT_RULE_COMPAT_F_INV = 0x2 + NFT_RULE_COMPAT_F_MASK = 0x2 + NFTA_RULE_COMPAT_UNSPEC = 0x0 + NFTA_RULE_COMPAT_PROTO = 0x1 + NFTA_RULE_COMPAT_FLAGS = 0x2 + NFT_SET_ANONYMOUS = 0x1 + NFT_SET_CONSTANT = 0x2 + NFT_SET_INTERVAL = 0x4 + NFT_SET_MAP = 0x8 + NFT_SET_TIMEOUT = 0x10 + NFT_SET_EVAL = 0x20 + NFT_SET_OBJECT = 0x40 + NFT_SET_POL_PERFORMANCE = 0x0 + NFT_SET_POL_MEMORY = 0x1 + NFTA_SET_DESC_UNSPEC = 0x0 + NFTA_SET_DESC_SIZE = 0x1 + NFTA_SET_UNSPEC = 0x0 + NFTA_SET_TABLE = 0x1 + NFTA_SET_NAME = 0x2 + NFTA_SET_FLAGS = 0x3 + NFTA_SET_KEY_TYPE = 0x4 + NFTA_SET_KEY_LEN = 0x5 + NFTA_SET_DATA_TYPE = 0x6 + NFTA_SET_DATA_LEN = 0x7 + NFTA_SET_POLICY = 0x8 + NFTA_SET_DESC = 0x9 + NFTA_SET_ID = 0xa + NFTA_SET_TIMEOUT = 0xb + NFTA_SET_GC_INTERVAL = 0xc + NFTA_SET_USERDATA = 0xd + NFTA_SET_PAD = 0xe + NFTA_SET_OBJ_TYPE = 0xf + NFT_SET_ELEM_INTERVAL_END = 0x1 + NFTA_SET_ELEM_UNSPEC = 0x0 + NFTA_SET_ELEM_KEY = 0x1 + NFTA_SET_ELEM_DATA = 0x2 + NFTA_SET_ELEM_FLAGS = 0x3 + NFTA_SET_ELEM_TIMEOUT = 0x4 + NFTA_SET_ELEM_EXPIRATION = 0x5 + NFTA_SET_ELEM_USERDATA = 0x6 + NFTA_SET_ELEM_EXPR = 0x7 + NFTA_SET_ELEM_PAD = 0x8 + NFTA_SET_ELEM_OBJREF = 0x9 + NFTA_SET_ELEM_LIST_UNSPEC = 0x0 + NFTA_SET_ELEM_LIST_TABLE = 0x1 + NFTA_SET_ELEM_LIST_SET = 0x2 + NFTA_SET_ELEM_LIST_ELEMENTS = 0x3 + NFTA_SET_ELEM_LIST_SET_ID = 0x4 + NFT_DATA_VALUE = 0x0 + NFT_DATA_VERDICT = 0xffffff00 + NFTA_DATA_UNSPEC = 0x0 + NFTA_DATA_VALUE = 0x1 + NFTA_DATA_VERDICT = 0x2 + NFTA_VERDICT_UNSPEC = 0x0 + NFTA_VERDICT_CODE = 0x1 + NFTA_VERDICT_CHAIN = 0x2 + NFTA_EXPR_UNSPEC = 0x0 + NFTA_EXPR_NAME = 0x1 + NFTA_EXPR_DATA = 0x2 + NFTA_IMMEDIATE_UNSPEC = 0x0 + NFTA_IMMEDIATE_DREG = 0x1 + NFTA_IMMEDIATE_DATA = 0x2 + NFTA_BITWISE_UNSPEC = 0x0 + NFTA_BITWISE_SREG = 0x1 + NFTA_BITWISE_DREG = 0x2 + NFTA_BITWISE_LEN = 0x3 + NFTA_BITWISE_MASK = 0x4 + NFTA_BITWISE_XOR = 0x5 + NFT_BYTEORDER_NTOH = 0x0 + NFT_BYTEORDER_HTON = 0x1 + NFTA_BYTEORDER_UNSPEC = 0x0 + NFTA_BYTEORDER_SREG = 0x1 + NFTA_BYTEORDER_DREG = 0x2 + NFTA_BYTEORDER_OP = 0x3 + NFTA_BYTEORDER_LEN = 0x4 + NFTA_BYTEORDER_SIZE = 0x5 + NFT_CMP_EQ = 0x0 + NFT_CMP_NEQ = 0x1 + NFT_CMP_LT = 0x2 + NFT_CMP_LTE = 0x3 + NFT_CMP_GT = 0x4 + NFT_CMP_GTE = 0x5 + NFTA_CMP_UNSPEC = 0x0 + NFTA_CMP_SREG = 0x1 + NFTA_CMP_OP = 0x2 + NFTA_CMP_DATA = 0x3 + NFT_RANGE_EQ = 0x0 + NFT_RANGE_NEQ = 0x1 + NFTA_RANGE_UNSPEC = 0x0 + NFTA_RANGE_SREG = 0x1 + NFTA_RANGE_OP = 0x2 + NFTA_RANGE_FROM_DATA = 0x3 + NFTA_RANGE_TO_DATA = 0x4 + NFT_LOOKUP_F_INV = 0x1 + NFTA_LOOKUP_UNSPEC = 0x0 + NFTA_LOOKUP_SET = 0x1 + NFTA_LOOKUP_SREG = 0x2 + NFTA_LOOKUP_DREG = 0x3 + NFTA_LOOKUP_SET_ID = 0x4 + NFTA_LOOKUP_FLAGS = 0x5 + NFT_DYNSET_OP_ADD = 0x0 + NFT_DYNSET_OP_UPDATE = 0x1 + NFT_DYNSET_F_INV = 0x1 + NFTA_DYNSET_UNSPEC = 0x0 + NFTA_DYNSET_SET_NAME = 0x1 + NFTA_DYNSET_SET_ID = 0x2 + NFTA_DYNSET_OP = 0x3 + NFTA_DYNSET_SREG_KEY = 0x4 + NFTA_DYNSET_SREG_DATA = 0x5 + NFTA_DYNSET_TIMEOUT = 0x6 + NFTA_DYNSET_EXPR = 0x7 + NFTA_DYNSET_PAD = 0x8 + NFTA_DYNSET_FLAGS = 0x9 + NFT_PAYLOAD_LL_HEADER = 0x0 + NFT_PAYLOAD_NETWORK_HEADER = 0x1 + NFT_PAYLOAD_TRANSPORT_HEADER = 0x2 + NFT_PAYLOAD_CSUM_NONE = 0x0 + NFT_PAYLOAD_CSUM_INET = 0x1 + NFT_PAYLOAD_L4CSUM_PSEUDOHDR = 0x1 + NFTA_PAYLOAD_UNSPEC = 0x0 + NFTA_PAYLOAD_DREG = 0x1 + NFTA_PAYLOAD_BASE = 0x2 + NFTA_PAYLOAD_OFFSET = 0x3 + NFTA_PAYLOAD_LEN = 0x4 + NFTA_PAYLOAD_SREG = 0x5 + NFTA_PAYLOAD_CSUM_TYPE = 0x6 + NFTA_PAYLOAD_CSUM_OFFSET = 0x7 + NFTA_PAYLOAD_CSUM_FLAGS = 0x8 + NFT_EXTHDR_F_PRESENT = 0x1 + NFT_EXTHDR_OP_IPV6 = 0x0 + NFT_EXTHDR_OP_TCPOPT = 0x1 + NFTA_EXTHDR_UNSPEC = 0x0 + NFTA_EXTHDR_DREG = 0x1 + NFTA_EXTHDR_TYPE = 0x2 + NFTA_EXTHDR_OFFSET = 0x3 + NFTA_EXTHDR_LEN = 0x4 + NFTA_EXTHDR_FLAGS = 0x5 + NFTA_EXTHDR_OP = 0x6 + NFTA_EXTHDR_SREG = 0x7 + NFT_META_LEN = 0x0 + NFT_META_PROTOCOL = 0x1 + NFT_META_PRIORITY = 0x2 + NFT_META_MARK = 0x3 + NFT_META_IIF = 0x4 + NFT_META_OIF = 0x5 + NFT_META_IIFNAME = 0x6 + NFT_META_OIFNAME = 0x7 + NFT_META_IIFTYPE = 0x8 + NFT_META_OIFTYPE = 0x9 + NFT_META_SKUID = 0xa + NFT_META_SKGID = 0xb + NFT_META_NFTRACE = 0xc + NFT_META_RTCLASSID = 0xd + NFT_META_SECMARK = 0xe + NFT_META_NFPROTO = 0xf + NFT_META_L4PROTO = 0x10 + NFT_META_BRI_IIFNAME = 0x11 + NFT_META_BRI_OIFNAME = 0x12 + NFT_META_PKTTYPE = 0x13 + NFT_META_CPU = 0x14 + NFT_META_IIFGROUP = 0x15 + NFT_META_OIFGROUP = 0x16 + NFT_META_CGROUP = 0x17 + NFT_META_PRANDOM = 0x18 + NFT_RT_CLASSID = 0x0 + NFT_RT_NEXTHOP4 = 0x1 + NFT_RT_NEXTHOP6 = 0x2 + NFT_RT_TCPMSS = 0x3 + NFT_HASH_JENKINS = 0x0 + NFT_HASH_SYM = 0x1 + NFTA_HASH_UNSPEC = 0x0 + NFTA_HASH_SREG = 0x1 + NFTA_HASH_DREG = 0x2 + NFTA_HASH_LEN = 0x3 + NFTA_HASH_MODULUS = 0x4 + NFTA_HASH_SEED = 0x5 + NFTA_HASH_OFFSET = 0x6 + NFTA_HASH_TYPE = 0x7 + NFTA_META_UNSPEC = 0x0 + NFTA_META_DREG = 0x1 + NFTA_META_KEY = 0x2 + NFTA_META_SREG = 0x3 + NFTA_RT_UNSPEC = 0x0 + NFTA_RT_DREG = 0x1 + NFTA_RT_KEY = 0x2 + NFT_CT_STATE = 0x0 + NFT_CT_DIRECTION = 0x1 + NFT_CT_STATUS = 0x2 + NFT_CT_MARK = 0x3 + NFT_CT_SECMARK = 0x4 + NFT_CT_EXPIRATION = 0x5 + NFT_CT_HELPER = 0x6 + NFT_CT_L3PROTOCOL = 0x7 + NFT_CT_SRC = 0x8 + NFT_CT_DST = 0x9 + NFT_CT_PROTOCOL = 0xa + NFT_CT_PROTO_SRC = 0xb + NFT_CT_PROTO_DST = 0xc + NFT_CT_LABELS = 0xd + NFT_CT_PKTS = 0xe + NFT_CT_BYTES = 0xf + NFT_CT_AVGPKT = 0x10 + NFT_CT_ZONE = 0x11 + NFT_CT_EVENTMASK = 0x12 + NFTA_CT_UNSPEC = 0x0 + NFTA_CT_DREG = 0x1 + NFTA_CT_KEY = 0x2 + NFTA_CT_DIRECTION = 0x3 + NFTA_CT_SREG = 0x4 + NFT_LIMIT_PKTS = 0x0 + NFT_LIMIT_PKT_BYTES = 0x1 + NFT_LIMIT_F_INV = 0x1 + NFTA_LIMIT_UNSPEC = 0x0 + NFTA_LIMIT_RATE = 0x1 + NFTA_LIMIT_UNIT = 0x2 + NFTA_LIMIT_BURST = 0x3 + NFTA_LIMIT_TYPE = 0x4 + NFTA_LIMIT_FLAGS = 0x5 + NFTA_LIMIT_PAD = 0x6 + NFTA_COUNTER_UNSPEC = 0x0 + NFTA_COUNTER_BYTES = 0x1 + NFTA_COUNTER_PACKETS = 0x2 + NFTA_COUNTER_PAD = 0x3 + NFTA_LOG_UNSPEC = 0x0 + NFTA_LOG_GROUP = 0x1 + NFTA_LOG_PREFIX = 0x2 + NFTA_LOG_SNAPLEN = 0x3 + NFTA_LOG_QTHRESHOLD = 0x4 + NFTA_LOG_LEVEL = 0x5 + NFTA_LOG_FLAGS = 0x6 + NFTA_QUEUE_UNSPEC = 0x0 + NFTA_QUEUE_NUM = 0x1 + NFTA_QUEUE_TOTAL = 0x2 + NFTA_QUEUE_FLAGS = 0x3 + NFTA_QUEUE_SREG_QNUM = 0x4 + NFT_QUOTA_F_INV = 0x1 + NFT_QUOTA_F_DEPLETED = 0x2 + NFTA_QUOTA_UNSPEC = 0x0 + NFTA_QUOTA_BYTES = 0x1 + NFTA_QUOTA_FLAGS = 0x2 + NFTA_QUOTA_PAD = 0x3 + NFTA_QUOTA_CONSUMED = 0x4 + NFT_REJECT_ICMP_UNREACH = 0x0 + NFT_REJECT_TCP_RST = 0x1 + NFT_REJECT_ICMPX_UNREACH = 0x2 + NFT_REJECT_ICMPX_NO_ROUTE = 0x0 + NFT_REJECT_ICMPX_PORT_UNREACH = 0x1 + NFT_REJECT_ICMPX_HOST_UNREACH = 0x2 + NFT_REJECT_ICMPX_ADMIN_PROHIBITED = 0x3 + NFTA_REJECT_UNSPEC = 0x0 + NFTA_REJECT_TYPE = 0x1 + NFTA_REJECT_ICMP_CODE = 0x2 + NFT_NAT_SNAT = 0x0 + NFT_NAT_DNAT = 0x1 + NFTA_NAT_UNSPEC = 0x0 + NFTA_NAT_TYPE = 0x1 + NFTA_NAT_FAMILY = 0x2 + NFTA_NAT_REG_ADDR_MIN = 0x3 + NFTA_NAT_REG_ADDR_MAX = 0x4 + NFTA_NAT_REG_PROTO_MIN = 0x5 + NFTA_NAT_REG_PROTO_MAX = 0x6 + NFTA_NAT_FLAGS = 0x7 + NFTA_MASQ_UNSPEC = 0x0 + NFTA_MASQ_FLAGS = 0x1 + NFTA_MASQ_REG_PROTO_MIN = 0x2 + NFTA_MASQ_REG_PROTO_MAX = 0x3 + NFTA_REDIR_UNSPEC = 0x0 + NFTA_REDIR_REG_PROTO_MIN = 0x1 + NFTA_REDIR_REG_PROTO_MAX = 0x2 + NFTA_REDIR_FLAGS = 0x3 + NFTA_DUP_UNSPEC = 0x0 + NFTA_DUP_SREG_ADDR = 0x1 + NFTA_DUP_SREG_DEV = 0x2 + NFTA_FWD_UNSPEC = 0x0 + NFTA_FWD_SREG_DEV = 0x1 + NFTA_OBJREF_UNSPEC = 0x0 + NFTA_OBJREF_IMM_TYPE = 0x1 + NFTA_OBJREF_IMM_NAME = 0x2 + NFTA_OBJREF_SET_SREG = 0x3 + NFTA_OBJREF_SET_NAME = 0x4 + NFTA_OBJREF_SET_ID = 0x5 + NFTA_GEN_UNSPEC = 0x0 + NFTA_GEN_ID = 0x1 + NFTA_GEN_PROC_PID = 0x2 + NFTA_GEN_PROC_NAME = 0x3 + NFTA_FIB_UNSPEC = 0x0 + NFTA_FIB_DREG = 0x1 + NFTA_FIB_RESULT = 0x2 + NFTA_FIB_FLAGS = 0x3 + NFT_FIB_RESULT_UNSPEC = 0x0 + NFT_FIB_RESULT_OIF = 0x1 + NFT_FIB_RESULT_OIFNAME = 0x2 + NFT_FIB_RESULT_ADDRTYPE = 0x3 + NFTA_FIB_F_SADDR = 0x1 + NFTA_FIB_F_DADDR = 0x2 + NFTA_FIB_F_MARK = 0x4 + NFTA_FIB_F_IIF = 0x8 + NFTA_FIB_F_OIF = 0x10 + NFTA_FIB_F_PRESENT = 0x20 + NFTA_CT_HELPER_UNSPEC = 0x0 + NFTA_CT_HELPER_NAME = 0x1 + NFTA_CT_HELPER_L3PROTO = 0x2 + NFTA_CT_HELPER_L4PROTO = 0x3 + NFTA_OBJ_UNSPEC = 0x0 + NFTA_OBJ_TABLE = 0x1 + NFTA_OBJ_NAME = 0x2 + NFTA_OBJ_TYPE = 0x3 + NFTA_OBJ_DATA = 0x4 + NFTA_OBJ_USE = 0x5 + NFTA_TRACE_UNSPEC = 0x0 + NFTA_TRACE_TABLE = 0x1 + NFTA_TRACE_CHAIN = 0x2 + NFTA_TRACE_RULE_HANDLE = 0x3 + NFTA_TRACE_TYPE = 0x4 + NFTA_TRACE_VERDICT = 0x5 + NFTA_TRACE_ID = 0x6 + NFTA_TRACE_LL_HEADER = 0x7 + NFTA_TRACE_NETWORK_HEADER = 0x8 + NFTA_TRACE_TRANSPORT_HEADER = 0x9 + NFTA_TRACE_IIF = 0xa + NFTA_TRACE_IIFTYPE = 0xb + NFTA_TRACE_OIF = 0xc + NFTA_TRACE_OIFTYPE = 0xd + NFTA_TRACE_MARK = 0xe + NFTA_TRACE_NFPROTO = 0xf + NFTA_TRACE_POLICY = 0x10 + NFTA_TRACE_PAD = 0x11 + NFT_TRACETYPE_UNSPEC = 0x0 + NFT_TRACETYPE_POLICY = 0x1 + NFT_TRACETYPE_RETURN = 0x2 + NFT_TRACETYPE_RULE = 0x3 + NFTA_NG_UNSPEC = 0x0 + NFTA_NG_DREG = 0x1 + NFTA_NG_MODULUS = 0x2 + NFTA_NG_TYPE = 0x3 + NFTA_NG_OFFSET = 0x4 + NFT_NG_INCREMENTAL = 0x0 + NFT_NG_RANDOM = 0x1 +) + +type RTCTime struct { + Sec int32 + Min int32 + Hour int32 + Mday int32 + Mon int32 + Year int32 + Wday int32 + Yday int32 + Isdst int32 +} + +type RTCWkAlrm struct { + Enabled uint8 + Pending uint8 + _ [2]byte + Time RTCTime +} + +type RTCPLLInfo struct { + Ctrl int32 + Value int32 + Max int32 + Min int32 + Posmult int32 + Negmult int32 + Clock int64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go index 6f9452d89d..93effc8eca 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mips64le.go @@ -117,25 +117,10 @@ type Stat_t struct { Blocks int64 } -type Statfs_t struct { - Type int64 - Bsize int64 - Frsize int64 - Blocks uint64 - Bfree uint64 - Files uint64 - Ffree uint64 - Bavail uint64 - Fsid Fsid - Namelen int64 - Flags int64 - Spare [5]int64 -} - type StatxTimestamp struct { - Sec int64 - Nsec uint32 - X__reserved int32 + Sec int64 + Nsec uint32 + _ int32 } type Statx_t struct { @@ -172,7 +157,7 @@ type Dirent struct { } type Fsid struct { - X__val [2]int32 + Val [2]int32 } type Flock_t struct { @@ -266,6 +251,13 @@ type RawSockaddrL2 struct { _ [1]byte } +type RawSockaddrRFCOMM struct { + Family uint16 + Bdaddr [6]uint8 + Channel uint8 + _ [1]byte +} + type RawSockaddrCAN struct { Family uint16 _ [2]byte @@ -421,6 +413,7 @@ const ( SizeofSockaddrNetlink = 0xc SizeofSockaddrHCI = 0x6 SizeofSockaddrL2 = 0xe + SizeofSockaddrRFCOMM = 0xa SizeofSockaddrCAN = 0x10 SizeofSockaddrALG = 0x58 SizeofSockaddrVM = 0x10 @@ -441,97 +434,123 @@ const ( ) const ( - IFA_UNSPEC = 0x0 - IFA_ADDRESS = 0x1 - IFA_LOCAL = 0x2 - IFA_LABEL = 0x3 - IFA_BROADCAST = 0x4 - IFA_ANYCAST = 0x5 - IFA_CACHEINFO = 0x6 - IFA_MULTICAST = 0x7 - IFLA_UNSPEC = 0x0 - IFLA_ADDRESS = 0x1 - IFLA_BROADCAST = 0x2 - IFLA_IFNAME = 0x3 - IFLA_MTU = 0x4 - IFLA_LINK = 0x5 - IFLA_QDISC = 0x6 - IFLA_STATS = 0x7 - IFLA_COST = 0x8 - IFLA_PRIORITY = 0x9 - IFLA_MASTER = 0xa - IFLA_WIRELESS = 0xb - IFLA_PROTINFO = 0xc - IFLA_TXQLEN = 0xd - IFLA_MAP = 0xe - IFLA_WEIGHT = 0xf - IFLA_OPERSTATE = 0x10 - IFLA_LINKMODE = 0x11 - IFLA_LINKINFO = 0x12 - IFLA_NET_NS_PID = 0x13 - IFLA_IFALIAS = 0x14 - IFLA_MAX = 0x2c - RT_SCOPE_UNIVERSE = 0x0 - RT_SCOPE_SITE = 0xc8 - RT_SCOPE_LINK = 0xfd - RT_SCOPE_HOST = 0xfe - RT_SCOPE_NOWHERE = 0xff - RT_TABLE_UNSPEC = 0x0 - RT_TABLE_COMPAT = 0xfc - RT_TABLE_DEFAULT = 0xfd - RT_TABLE_MAIN = 0xfe - RT_TABLE_LOCAL = 0xff - RT_TABLE_MAX = 0xffffffff - RTA_UNSPEC = 0x0 - RTA_DST = 0x1 - RTA_SRC = 0x2 - RTA_IIF = 0x3 - RTA_OIF = 0x4 - RTA_GATEWAY = 0x5 - RTA_PRIORITY = 0x6 - RTA_PREFSRC = 0x7 - RTA_METRICS = 0x8 - RTA_MULTIPATH = 0x9 - RTA_FLOW = 0xb - RTA_CACHEINFO = 0xc - RTA_TABLE = 0xf - RTN_UNSPEC = 0x0 - RTN_UNICAST = 0x1 - RTN_LOCAL = 0x2 - RTN_BROADCAST = 0x3 - RTN_ANYCAST = 0x4 - RTN_MULTICAST = 0x5 - RTN_BLACKHOLE = 0x6 - RTN_UNREACHABLE = 0x7 - RTN_PROHIBIT = 0x8 - RTN_THROW = 0x9 - RTN_NAT = 0xa - RTN_XRESOLVE = 0xb - RTNLGRP_NONE = 0x0 - RTNLGRP_LINK = 0x1 - RTNLGRP_NOTIFY = 0x2 - RTNLGRP_NEIGH = 0x3 - RTNLGRP_TC = 0x4 - RTNLGRP_IPV4_IFADDR = 0x5 - RTNLGRP_IPV4_MROUTE = 0x6 - RTNLGRP_IPV4_ROUTE = 0x7 - RTNLGRP_IPV4_RULE = 0x8 - RTNLGRP_IPV6_IFADDR = 0x9 - RTNLGRP_IPV6_MROUTE = 0xa - RTNLGRP_IPV6_ROUTE = 0xb - RTNLGRP_IPV6_IFINFO = 0xc - RTNLGRP_IPV6_PREFIX = 0x12 - RTNLGRP_IPV6_RULE = 0x13 - RTNLGRP_ND_USEROPT = 0x14 - SizeofNlMsghdr = 0x10 - SizeofNlMsgerr = 0x14 - SizeofRtGenmsg = 0x1 - SizeofNlAttr = 0x4 - SizeofRtAttr = 0x4 - SizeofIfInfomsg = 0x10 - SizeofIfAddrmsg = 0x8 - SizeofRtMsg = 0xc - SizeofRtNexthop = 0x8 + IFA_UNSPEC = 0x0 + IFA_ADDRESS = 0x1 + IFA_LOCAL = 0x2 + IFA_LABEL = 0x3 + IFA_BROADCAST = 0x4 + IFA_ANYCAST = 0x5 + IFA_CACHEINFO = 0x6 + IFA_MULTICAST = 0x7 + IFLA_UNSPEC = 0x0 + IFLA_ADDRESS = 0x1 + IFLA_BROADCAST = 0x2 + IFLA_IFNAME = 0x3 + IFLA_MTU = 0x4 + IFLA_LINK = 0x5 + IFLA_QDISC = 0x6 + IFLA_STATS = 0x7 + IFLA_COST = 0x8 + IFLA_PRIORITY = 0x9 + IFLA_MASTER = 0xa + IFLA_WIRELESS = 0xb + IFLA_PROTINFO = 0xc + IFLA_TXQLEN = 0xd + IFLA_MAP = 0xe + IFLA_WEIGHT = 0xf + IFLA_OPERSTATE = 0x10 + IFLA_LINKMODE = 0x11 + IFLA_LINKINFO = 0x12 + IFLA_NET_NS_PID = 0x13 + IFLA_IFALIAS = 0x14 + IFLA_NUM_VF = 0x15 + IFLA_VFINFO_LIST = 0x16 + IFLA_STATS64 = 0x17 + IFLA_VF_PORTS = 0x18 + IFLA_PORT_SELF = 0x19 + IFLA_AF_SPEC = 0x1a + IFLA_GROUP = 0x1b + IFLA_NET_NS_FD = 0x1c + IFLA_EXT_MASK = 0x1d + IFLA_PROMISCUITY = 0x1e + IFLA_NUM_TX_QUEUES = 0x1f + IFLA_NUM_RX_QUEUES = 0x20 + IFLA_CARRIER = 0x21 + IFLA_PHYS_PORT_ID = 0x22 + IFLA_CARRIER_CHANGES = 0x23 + IFLA_PHYS_SWITCH_ID = 0x24 + IFLA_LINK_NETNSID = 0x25 + IFLA_PHYS_PORT_NAME = 0x26 + IFLA_PROTO_DOWN = 0x27 + IFLA_GSO_MAX_SEGS = 0x28 + IFLA_GSO_MAX_SIZE = 0x29 + IFLA_PAD = 0x2a + IFLA_XDP = 0x2b + IFLA_EVENT = 0x2c + IFLA_NEW_NETNSID = 0x2d + IFLA_IF_NETNSID = 0x2e + IFLA_MAX = 0x31 + RT_SCOPE_UNIVERSE = 0x0 + RT_SCOPE_SITE = 0xc8 + RT_SCOPE_LINK = 0xfd + RT_SCOPE_HOST = 0xfe + RT_SCOPE_NOWHERE = 0xff + RT_TABLE_UNSPEC = 0x0 + RT_TABLE_COMPAT = 0xfc + RT_TABLE_DEFAULT = 0xfd + RT_TABLE_MAIN = 0xfe + RT_TABLE_LOCAL = 0xff + RT_TABLE_MAX = 0xffffffff + RTA_UNSPEC = 0x0 + RTA_DST = 0x1 + RTA_SRC = 0x2 + RTA_IIF = 0x3 + RTA_OIF = 0x4 + RTA_GATEWAY = 0x5 + RTA_PRIORITY = 0x6 + RTA_PREFSRC = 0x7 + RTA_METRICS = 0x8 + RTA_MULTIPATH = 0x9 + RTA_FLOW = 0xb + RTA_CACHEINFO = 0xc + RTA_TABLE = 0xf + RTN_UNSPEC = 0x0 + RTN_UNICAST = 0x1 + RTN_LOCAL = 0x2 + RTN_BROADCAST = 0x3 + RTN_ANYCAST = 0x4 + RTN_MULTICAST = 0x5 + RTN_BLACKHOLE = 0x6 + RTN_UNREACHABLE = 0x7 + RTN_PROHIBIT = 0x8 + RTN_THROW = 0x9 + RTN_NAT = 0xa + RTN_XRESOLVE = 0xb + RTNLGRP_NONE = 0x0 + RTNLGRP_LINK = 0x1 + RTNLGRP_NOTIFY = 0x2 + RTNLGRP_NEIGH = 0x3 + RTNLGRP_TC = 0x4 + RTNLGRP_IPV4_IFADDR = 0x5 + RTNLGRP_IPV4_MROUTE = 0x6 + RTNLGRP_IPV4_ROUTE = 0x7 + RTNLGRP_IPV4_RULE = 0x8 + RTNLGRP_IPV6_IFADDR = 0x9 + RTNLGRP_IPV6_MROUTE = 0xa + RTNLGRP_IPV6_ROUTE = 0xb + RTNLGRP_IPV6_IFINFO = 0xc + RTNLGRP_IPV6_PREFIX = 0x12 + RTNLGRP_IPV6_RULE = 0x13 + RTNLGRP_ND_USEROPT = 0x14 + SizeofNlMsghdr = 0x10 + SizeofNlMsgerr = 0x14 + SizeofRtGenmsg = 0x1 + SizeofNlAttr = 0x4 + SizeofRtAttr = 0x4 + SizeofIfInfomsg = 0x10 + SizeofIfAddrmsg = 0x8 + SizeofRtMsg = 0xc + SizeofRtNexthop = 0x8 ) type NlMsghdr struct { @@ -562,12 +581,12 @@ type RtAttr struct { } type IfInfomsg struct { - Family uint8 - X__ifi_pad uint8 - Type uint16 - Index int32 - Flags uint32 - Change uint32 + Family uint8 + _ uint8 + Type uint16 + Index int32 + Flags uint32 + Change uint32 } type IfAddrmsg struct { @@ -653,7 +672,7 @@ type Sysinfo_t struct { Totalhigh uint64 Freehigh uint64 Unit uint32 - X_f [0]int8 + _ [0]int8 _ [4]byte } @@ -693,6 +712,8 @@ const ( AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x100 + + AT_EACCESS = 0x200 ) type PollFd struct { @@ -712,7 +733,7 @@ const ( ) type Sigset_t struct { - X__val [16]uint64 + Val [16]uint64 } const RNDGETENTCNT = 0x40045200 @@ -868,3 +889,967 @@ const ( BDADDR_LE_PUBLIC = 0x1 BDADDR_LE_RANDOM = 0x2 ) + +type PerfEventAttr struct { + Type uint32 + Size uint32 + Config uint64 + Sample uint64 + Sample_type uint64 + Read_format uint64 + Bits uint64 + Wakeup uint32 + Bp_type uint32 + Ext1 uint64 + Ext2 uint64 + Branch_sample_type uint64 + Sample_regs_user uint64 + Sample_stack_user uint32 + Clockid int32 + Sample_regs_intr uint64 + Aux_watermark uint32 + _ uint32 +} + +type PerfEventMmapPage struct { + Version uint32 + Compat_version uint32 + Lock uint32 + Index uint32 + Offset int64 + Time_enabled uint64 + Time_running uint64 + Capabilities uint64 + Pmc_width uint16 + Time_shift uint16 + Time_mult uint32 + Time_offset uint64 + Time_zero uint64 + Size uint32 + _ [948]uint8 + Data_head uint64 + Data_tail uint64 + Data_offset uint64 + Data_size uint64 + Aux_head uint64 + Aux_tail uint64 + Aux_offset uint64 + Aux_size uint64 +} + +const ( + PerfBitDisabled uint64 = CBitFieldMaskBit0 + PerfBitInherit = CBitFieldMaskBit1 + PerfBitPinned = CBitFieldMaskBit2 + PerfBitExclusive = CBitFieldMaskBit3 + PerfBitExcludeUser = CBitFieldMaskBit4 + PerfBitExcludeKernel = CBitFieldMaskBit5 + PerfBitExcludeHv = CBitFieldMaskBit6 + PerfBitExcludeIdle = CBitFieldMaskBit7 + PerfBitMmap = CBitFieldMaskBit8 + PerfBitComm = CBitFieldMaskBit9 + PerfBitFreq = CBitFieldMaskBit10 + PerfBitInheritStat = CBitFieldMaskBit11 + PerfBitEnableOnExec = CBitFieldMaskBit12 + PerfBitTask = CBitFieldMaskBit13 + PerfBitWatermark = CBitFieldMaskBit14 + PerfBitPreciseIPBit1 = CBitFieldMaskBit15 + PerfBitPreciseIPBit2 = CBitFieldMaskBit16 + PerfBitMmapData = CBitFieldMaskBit17 + PerfBitSampleIDAll = CBitFieldMaskBit18 + PerfBitExcludeHost = CBitFieldMaskBit19 + PerfBitExcludeGuest = CBitFieldMaskBit20 + PerfBitExcludeCallchainKernel = CBitFieldMaskBit21 + PerfBitExcludeCallchainUser = CBitFieldMaskBit22 + PerfBitMmap2 = CBitFieldMaskBit23 + PerfBitCommExec = CBitFieldMaskBit24 + PerfBitUseClockID = CBitFieldMaskBit25 + PerfBitContextSwitch = CBitFieldMaskBit26 +) + +const ( + PERF_TYPE_HARDWARE = 0x0 + PERF_TYPE_SOFTWARE = 0x1 + PERF_TYPE_TRACEPOINT = 0x2 + PERF_TYPE_HW_CACHE = 0x3 + PERF_TYPE_RAW = 0x4 + PERF_TYPE_BREAKPOINT = 0x5 + + PERF_COUNT_HW_CPU_CYCLES = 0x0 + PERF_COUNT_HW_INSTRUCTIONS = 0x1 + PERF_COUNT_HW_CACHE_REFERENCES = 0x2 + PERF_COUNT_HW_CACHE_MISSES = 0x3 + PERF_COUNT_HW_BRANCH_INSTRUCTIONS = 0x4 + PERF_COUNT_HW_BRANCH_MISSES = 0x5 + PERF_COUNT_HW_BUS_CYCLES = 0x6 + PERF_COUNT_HW_STALLED_CYCLES_FRONTEND = 0x7 + PERF_COUNT_HW_STALLED_CYCLES_BACKEND = 0x8 + PERF_COUNT_HW_REF_CPU_CYCLES = 0x9 + + PERF_COUNT_HW_CACHE_L1D = 0x0 + PERF_COUNT_HW_CACHE_L1I = 0x1 + PERF_COUNT_HW_CACHE_LL = 0x2 + PERF_COUNT_HW_CACHE_DTLB = 0x3 + PERF_COUNT_HW_CACHE_ITLB = 0x4 + PERF_COUNT_HW_CACHE_BPU = 0x5 + PERF_COUNT_HW_CACHE_NODE = 0x6 + + PERF_COUNT_HW_CACHE_OP_READ = 0x0 + PERF_COUNT_HW_CACHE_OP_WRITE = 0x1 + PERF_COUNT_HW_CACHE_OP_PREFETCH = 0x2 + + PERF_COUNT_HW_CACHE_RESULT_ACCESS = 0x0 + PERF_COUNT_HW_CACHE_RESULT_MISS = 0x1 + + PERF_COUNT_SW_CPU_CLOCK = 0x0 + PERF_COUNT_SW_TASK_CLOCK = 0x1 + PERF_COUNT_SW_PAGE_FAULTS = 0x2 + PERF_COUNT_SW_CONTEXT_SWITCHES = 0x3 + PERF_COUNT_SW_CPU_MIGRATIONS = 0x4 + PERF_COUNT_SW_PAGE_FAULTS_MIN = 0x5 + PERF_COUNT_SW_PAGE_FAULTS_MAJ = 0x6 + PERF_COUNT_SW_ALIGNMENT_FAULTS = 0x7 + PERF_COUNT_SW_EMULATION_FAULTS = 0x8 + PERF_COUNT_SW_DUMMY = 0x9 + + PERF_SAMPLE_IP = 0x1 + PERF_SAMPLE_TID = 0x2 + PERF_SAMPLE_TIME = 0x4 + PERF_SAMPLE_ADDR = 0x8 + PERF_SAMPLE_READ = 0x10 + PERF_SAMPLE_CALLCHAIN = 0x20 + PERF_SAMPLE_ID = 0x40 + PERF_SAMPLE_CPU = 0x80 + PERF_SAMPLE_PERIOD = 0x100 + PERF_SAMPLE_STREAM_ID = 0x200 + PERF_SAMPLE_RAW = 0x400 + PERF_SAMPLE_BRANCH_STACK = 0x800 + + PERF_SAMPLE_BRANCH_USER = 0x1 + PERF_SAMPLE_BRANCH_KERNEL = 0x2 + PERF_SAMPLE_BRANCH_HV = 0x4 + PERF_SAMPLE_BRANCH_ANY = 0x8 + PERF_SAMPLE_BRANCH_ANY_CALL = 0x10 + PERF_SAMPLE_BRANCH_ANY_RETURN = 0x20 + PERF_SAMPLE_BRANCH_IND_CALL = 0x40 + + PERF_FORMAT_TOTAL_TIME_ENABLED = 0x1 + PERF_FORMAT_TOTAL_TIME_RUNNING = 0x2 + PERF_FORMAT_ID = 0x4 + PERF_FORMAT_GROUP = 0x8 + + PERF_RECORD_MMAP = 0x1 + PERF_RECORD_LOST = 0x2 + PERF_RECORD_COMM = 0x3 + PERF_RECORD_EXIT = 0x4 + PERF_RECORD_THROTTLE = 0x5 + PERF_RECORD_UNTHROTTLE = 0x6 + PERF_RECORD_FORK = 0x7 + PERF_RECORD_READ = 0x8 + PERF_RECORD_SAMPLE = 0x9 + + PERF_CONTEXT_HV = -0x20 + PERF_CONTEXT_KERNEL = -0x80 + PERF_CONTEXT_USER = -0x200 + + PERF_CONTEXT_GUEST = -0x800 + PERF_CONTEXT_GUEST_KERNEL = -0x880 + PERF_CONTEXT_GUEST_USER = -0xa00 + + PERF_FLAG_FD_NO_GROUP = 0x1 + PERF_FLAG_FD_OUTPUT = 0x2 + PERF_FLAG_PID_CGROUP = 0x4 +) + +const ( + CBitFieldMaskBit0 = 0x1 + CBitFieldMaskBit1 = 0x2 + CBitFieldMaskBit2 = 0x4 + CBitFieldMaskBit3 = 0x8 + CBitFieldMaskBit4 = 0x10 + CBitFieldMaskBit5 = 0x20 + CBitFieldMaskBit6 = 0x40 + CBitFieldMaskBit7 = 0x80 + CBitFieldMaskBit8 = 0x100 + CBitFieldMaskBit9 = 0x200 + CBitFieldMaskBit10 = 0x400 + CBitFieldMaskBit11 = 0x800 + CBitFieldMaskBit12 = 0x1000 + CBitFieldMaskBit13 = 0x2000 + CBitFieldMaskBit14 = 0x4000 + CBitFieldMaskBit15 = 0x8000 + CBitFieldMaskBit16 = 0x10000 + CBitFieldMaskBit17 = 0x20000 + CBitFieldMaskBit18 = 0x40000 + CBitFieldMaskBit19 = 0x80000 + CBitFieldMaskBit20 = 0x100000 + CBitFieldMaskBit21 = 0x200000 + CBitFieldMaskBit22 = 0x400000 + CBitFieldMaskBit23 = 0x800000 + CBitFieldMaskBit24 = 0x1000000 + CBitFieldMaskBit25 = 0x2000000 + CBitFieldMaskBit26 = 0x4000000 + CBitFieldMaskBit27 = 0x8000000 + CBitFieldMaskBit28 = 0x10000000 + CBitFieldMaskBit29 = 0x20000000 + CBitFieldMaskBit30 = 0x40000000 + CBitFieldMaskBit31 = 0x80000000 + CBitFieldMaskBit32 = 0x100000000 + CBitFieldMaskBit33 = 0x200000000 + CBitFieldMaskBit34 = 0x400000000 + CBitFieldMaskBit35 = 0x800000000 + CBitFieldMaskBit36 = 0x1000000000 + CBitFieldMaskBit37 = 0x2000000000 + CBitFieldMaskBit38 = 0x4000000000 + CBitFieldMaskBit39 = 0x8000000000 + CBitFieldMaskBit40 = 0x10000000000 + CBitFieldMaskBit41 = 0x20000000000 + CBitFieldMaskBit42 = 0x40000000000 + CBitFieldMaskBit43 = 0x80000000000 + CBitFieldMaskBit44 = 0x100000000000 + CBitFieldMaskBit45 = 0x200000000000 + CBitFieldMaskBit46 = 0x400000000000 + CBitFieldMaskBit47 = 0x800000000000 + CBitFieldMaskBit48 = 0x1000000000000 + CBitFieldMaskBit49 = 0x2000000000000 + CBitFieldMaskBit50 = 0x4000000000000 + CBitFieldMaskBit51 = 0x8000000000000 + CBitFieldMaskBit52 = 0x10000000000000 + CBitFieldMaskBit53 = 0x20000000000000 + CBitFieldMaskBit54 = 0x40000000000000 + CBitFieldMaskBit55 = 0x80000000000000 + CBitFieldMaskBit56 = 0x100000000000000 + CBitFieldMaskBit57 = 0x200000000000000 + CBitFieldMaskBit58 = 0x400000000000000 + CBitFieldMaskBit59 = 0x800000000000000 + CBitFieldMaskBit60 = 0x1000000000000000 + CBitFieldMaskBit61 = 0x2000000000000000 + CBitFieldMaskBit62 = 0x4000000000000000 + CBitFieldMaskBit63 = 0x8000000000000000 +) + +type SockaddrStorage struct { + Family uint16 + _ [118]int8 + _ uint64 +} + +type TCPMD5Sig struct { + Addr SockaddrStorage + Flags uint8 + Prefixlen uint8 + Keylen uint16 + _ uint32 + Key [80]uint8 +} + +type HDDriveCmdHdr struct { + Command uint8 + Number uint8 + Feature uint8 + Count uint8 +} + +type HDGeometry struct { + Heads uint8 + Sectors uint8 + Cylinders uint16 + _ [4]byte + Start uint64 +} + +type HDDriveID struct { + Config uint16 + Cyls uint16 + Reserved2 uint16 + Heads uint16 + Track_bytes uint16 + Sector_bytes uint16 + Sectors uint16 + Vendor0 uint16 + Vendor1 uint16 + Vendor2 uint16 + Serial_no [20]uint8 + Buf_type uint16 + Buf_size uint16 + Ecc_bytes uint16 + Fw_rev [8]uint8 + Model [40]uint8 + Max_multsect uint8 + Vendor3 uint8 + Dword_io uint16 + Vendor4 uint8 + Capability uint8 + Reserved50 uint16 + Vendor5 uint8 + TPIO uint8 + Vendor6 uint8 + TDMA uint8 + Field_valid uint16 + Cur_cyls uint16 + Cur_heads uint16 + Cur_sectors uint16 + Cur_capacity0 uint16 + Cur_capacity1 uint16 + Multsect uint8 + Multsect_valid uint8 + Lba_capacity uint32 + Dma_1word uint16 + Dma_mword uint16 + Eide_pio_modes uint16 + Eide_dma_min uint16 + Eide_dma_time uint16 + Eide_pio uint16 + Eide_pio_iordy uint16 + Words69_70 [2]uint16 + Words71_74 [4]uint16 + Queue_depth uint16 + Words76_79 [4]uint16 + Major_rev_num uint16 + Minor_rev_num uint16 + Command_set_1 uint16 + Command_set_2 uint16 + Cfsse uint16 + Cfs_enable_1 uint16 + Cfs_enable_2 uint16 + Csf_default uint16 + Dma_ultra uint16 + Trseuc uint16 + TrsEuc uint16 + CurAPMvalues uint16 + Mprc uint16 + Hw_config uint16 + Acoustic uint16 + Msrqs uint16 + Sxfert uint16 + Sal uint16 + Spg uint32 + Lba_capacity_2 uint64 + Words104_125 [22]uint16 + Last_lun uint16 + Word127 uint16 + Dlf uint16 + Csfo uint16 + Words130_155 [26]uint16 + Word156 uint16 + Words157_159 [3]uint16 + Cfa_power uint16 + Words161_175 [15]uint16 + Words176_205 [30]uint16 + Words206_254 [49]uint16 + Integrity_word uint16 +} + +type Statfs_t struct { + Type int64 + Bsize int64 + Frsize int64 + Blocks uint64 + Bfree uint64 + Files uint64 + Ffree uint64 + Bavail uint64 + Fsid Fsid + Namelen int64 + Flags int64 + Spare [5]int64 +} + +const ( + ST_MANDLOCK = 0x40 + ST_NOATIME = 0x400 + ST_NODEV = 0x4 + ST_NODIRATIME = 0x800 + ST_NOEXEC = 0x8 + ST_NOSUID = 0x2 + ST_RDONLY = 0x1 + ST_RELATIME = 0x1000 + ST_SYNCHRONOUS = 0x10 +) + +type TpacketHdr struct { + Status uint64 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Usec uint32 + _ [4]byte +} + +type Tpacket2Hdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Nsec uint32 + Vlan_tci uint16 + Vlan_tpid uint16 + _ [4]uint8 +} + +type Tpacket3Hdr struct { + Next_offset uint32 + Sec uint32 + Nsec uint32 + Snaplen uint32 + Len uint32 + Status uint32 + Mac uint16 + Net uint16 + Hv1 TpacketHdrVariant1 + _ [8]uint8 +} + +type TpacketHdrVariant1 struct { + Rxhash uint32 + Vlan_tci uint32 + Vlan_tpid uint16 + _ uint16 +} + +type TpacketBlockDesc struct { + Version uint32 + To_priv uint32 + Hdr [40]byte +} + +type TpacketReq struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 +} + +type TpacketReq3 struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 + Retire_blk_tov uint32 + Sizeof_priv uint32 + Feature_req_word uint32 +} + +type TpacketStats struct { + Packets uint32 + Drops uint32 +} + +type TpacketStatsV3 struct { + Packets uint32 + Drops uint32 + Freeze_q_cnt uint32 +} + +type TpacketAuxdata struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Vlan_tci uint16 + Vlan_tpid uint16 +} + +const ( + TPACKET_V1 = 0x0 + TPACKET_V2 = 0x1 + TPACKET_V3 = 0x2 +) + +const ( + SizeofTpacketHdr = 0x20 + SizeofTpacket2Hdr = 0x20 + SizeofTpacket3Hdr = 0x30 +) + +const ( + NF_INET_PRE_ROUTING = 0x0 + NF_INET_LOCAL_IN = 0x1 + NF_INET_FORWARD = 0x2 + NF_INET_LOCAL_OUT = 0x3 + NF_INET_POST_ROUTING = 0x4 + NF_INET_NUMHOOKS = 0x5 +) + +const ( + NF_NETDEV_INGRESS = 0x0 + NF_NETDEV_NUMHOOKS = 0x1 +) + +const ( + NFPROTO_UNSPEC = 0x0 + NFPROTO_INET = 0x1 + NFPROTO_IPV4 = 0x2 + NFPROTO_ARP = 0x3 + NFPROTO_NETDEV = 0x5 + NFPROTO_BRIDGE = 0x7 + NFPROTO_IPV6 = 0xa + NFPROTO_DECNET = 0xc + NFPROTO_NUMPROTO = 0xd +) + +type Nfgenmsg struct { + Nfgen_family uint8 + Version uint8 + Res_id uint16 +} + +const ( + NFNL_BATCH_UNSPEC = 0x0 + NFNL_BATCH_GENID = 0x1 +) + +const ( + NFT_REG_VERDICT = 0x0 + NFT_REG_1 = 0x1 + NFT_REG_2 = 0x2 + NFT_REG_3 = 0x3 + NFT_REG_4 = 0x4 + NFT_REG32_00 = 0x8 + NFT_REG32_01 = 0x9 + NFT_REG32_02 = 0xa + NFT_REG32_03 = 0xb + NFT_REG32_04 = 0xc + NFT_REG32_05 = 0xd + NFT_REG32_06 = 0xe + NFT_REG32_07 = 0xf + NFT_REG32_08 = 0x10 + NFT_REG32_09 = 0x11 + NFT_REG32_10 = 0x12 + NFT_REG32_11 = 0x13 + NFT_REG32_12 = 0x14 + NFT_REG32_13 = 0x15 + NFT_REG32_14 = 0x16 + NFT_REG32_15 = 0x17 + NFT_CONTINUE = -0x1 + NFT_BREAK = -0x2 + NFT_JUMP = -0x3 + NFT_GOTO = -0x4 + NFT_RETURN = -0x5 + NFT_MSG_NEWTABLE = 0x0 + NFT_MSG_GETTABLE = 0x1 + NFT_MSG_DELTABLE = 0x2 + NFT_MSG_NEWCHAIN = 0x3 + NFT_MSG_GETCHAIN = 0x4 + NFT_MSG_DELCHAIN = 0x5 + NFT_MSG_NEWRULE = 0x6 + NFT_MSG_GETRULE = 0x7 + NFT_MSG_DELRULE = 0x8 + NFT_MSG_NEWSET = 0x9 + NFT_MSG_GETSET = 0xa + NFT_MSG_DELSET = 0xb + NFT_MSG_NEWSETELEM = 0xc + NFT_MSG_GETSETELEM = 0xd + NFT_MSG_DELSETELEM = 0xe + NFT_MSG_NEWGEN = 0xf + NFT_MSG_GETGEN = 0x10 + NFT_MSG_TRACE = 0x11 + NFT_MSG_NEWOBJ = 0x12 + NFT_MSG_GETOBJ = 0x13 + NFT_MSG_DELOBJ = 0x14 + NFT_MSG_GETOBJ_RESET = 0x15 + NFT_MSG_MAX = 0x19 + NFTA_LIST_UNPEC = 0x0 + NFTA_LIST_ELEM = 0x1 + NFTA_HOOK_UNSPEC = 0x0 + NFTA_HOOK_HOOKNUM = 0x1 + NFTA_HOOK_PRIORITY = 0x2 + NFTA_HOOK_DEV = 0x3 + NFT_TABLE_F_DORMANT = 0x1 + NFTA_TABLE_UNSPEC = 0x0 + NFTA_TABLE_NAME = 0x1 + NFTA_TABLE_FLAGS = 0x2 + NFTA_TABLE_USE = 0x3 + NFTA_CHAIN_UNSPEC = 0x0 + NFTA_CHAIN_TABLE = 0x1 + NFTA_CHAIN_HANDLE = 0x2 + NFTA_CHAIN_NAME = 0x3 + NFTA_CHAIN_HOOK = 0x4 + NFTA_CHAIN_POLICY = 0x5 + NFTA_CHAIN_USE = 0x6 + NFTA_CHAIN_TYPE = 0x7 + NFTA_CHAIN_COUNTERS = 0x8 + NFTA_CHAIN_PAD = 0x9 + NFTA_RULE_UNSPEC = 0x0 + NFTA_RULE_TABLE = 0x1 + NFTA_RULE_CHAIN = 0x2 + NFTA_RULE_HANDLE = 0x3 + NFTA_RULE_EXPRESSIONS = 0x4 + NFTA_RULE_COMPAT = 0x5 + NFTA_RULE_POSITION = 0x6 + NFTA_RULE_USERDATA = 0x7 + NFTA_RULE_PAD = 0x8 + NFTA_RULE_ID = 0x9 + NFT_RULE_COMPAT_F_INV = 0x2 + NFT_RULE_COMPAT_F_MASK = 0x2 + NFTA_RULE_COMPAT_UNSPEC = 0x0 + NFTA_RULE_COMPAT_PROTO = 0x1 + NFTA_RULE_COMPAT_FLAGS = 0x2 + NFT_SET_ANONYMOUS = 0x1 + NFT_SET_CONSTANT = 0x2 + NFT_SET_INTERVAL = 0x4 + NFT_SET_MAP = 0x8 + NFT_SET_TIMEOUT = 0x10 + NFT_SET_EVAL = 0x20 + NFT_SET_OBJECT = 0x40 + NFT_SET_POL_PERFORMANCE = 0x0 + NFT_SET_POL_MEMORY = 0x1 + NFTA_SET_DESC_UNSPEC = 0x0 + NFTA_SET_DESC_SIZE = 0x1 + NFTA_SET_UNSPEC = 0x0 + NFTA_SET_TABLE = 0x1 + NFTA_SET_NAME = 0x2 + NFTA_SET_FLAGS = 0x3 + NFTA_SET_KEY_TYPE = 0x4 + NFTA_SET_KEY_LEN = 0x5 + NFTA_SET_DATA_TYPE = 0x6 + NFTA_SET_DATA_LEN = 0x7 + NFTA_SET_POLICY = 0x8 + NFTA_SET_DESC = 0x9 + NFTA_SET_ID = 0xa + NFTA_SET_TIMEOUT = 0xb + NFTA_SET_GC_INTERVAL = 0xc + NFTA_SET_USERDATA = 0xd + NFTA_SET_PAD = 0xe + NFTA_SET_OBJ_TYPE = 0xf + NFT_SET_ELEM_INTERVAL_END = 0x1 + NFTA_SET_ELEM_UNSPEC = 0x0 + NFTA_SET_ELEM_KEY = 0x1 + NFTA_SET_ELEM_DATA = 0x2 + NFTA_SET_ELEM_FLAGS = 0x3 + NFTA_SET_ELEM_TIMEOUT = 0x4 + NFTA_SET_ELEM_EXPIRATION = 0x5 + NFTA_SET_ELEM_USERDATA = 0x6 + NFTA_SET_ELEM_EXPR = 0x7 + NFTA_SET_ELEM_PAD = 0x8 + NFTA_SET_ELEM_OBJREF = 0x9 + NFTA_SET_ELEM_LIST_UNSPEC = 0x0 + NFTA_SET_ELEM_LIST_TABLE = 0x1 + NFTA_SET_ELEM_LIST_SET = 0x2 + NFTA_SET_ELEM_LIST_ELEMENTS = 0x3 + NFTA_SET_ELEM_LIST_SET_ID = 0x4 + NFT_DATA_VALUE = 0x0 + NFT_DATA_VERDICT = 0xffffff00 + NFTA_DATA_UNSPEC = 0x0 + NFTA_DATA_VALUE = 0x1 + NFTA_DATA_VERDICT = 0x2 + NFTA_VERDICT_UNSPEC = 0x0 + NFTA_VERDICT_CODE = 0x1 + NFTA_VERDICT_CHAIN = 0x2 + NFTA_EXPR_UNSPEC = 0x0 + NFTA_EXPR_NAME = 0x1 + NFTA_EXPR_DATA = 0x2 + NFTA_IMMEDIATE_UNSPEC = 0x0 + NFTA_IMMEDIATE_DREG = 0x1 + NFTA_IMMEDIATE_DATA = 0x2 + NFTA_BITWISE_UNSPEC = 0x0 + NFTA_BITWISE_SREG = 0x1 + NFTA_BITWISE_DREG = 0x2 + NFTA_BITWISE_LEN = 0x3 + NFTA_BITWISE_MASK = 0x4 + NFTA_BITWISE_XOR = 0x5 + NFT_BYTEORDER_NTOH = 0x0 + NFT_BYTEORDER_HTON = 0x1 + NFTA_BYTEORDER_UNSPEC = 0x0 + NFTA_BYTEORDER_SREG = 0x1 + NFTA_BYTEORDER_DREG = 0x2 + NFTA_BYTEORDER_OP = 0x3 + NFTA_BYTEORDER_LEN = 0x4 + NFTA_BYTEORDER_SIZE = 0x5 + NFT_CMP_EQ = 0x0 + NFT_CMP_NEQ = 0x1 + NFT_CMP_LT = 0x2 + NFT_CMP_LTE = 0x3 + NFT_CMP_GT = 0x4 + NFT_CMP_GTE = 0x5 + NFTA_CMP_UNSPEC = 0x0 + NFTA_CMP_SREG = 0x1 + NFTA_CMP_OP = 0x2 + NFTA_CMP_DATA = 0x3 + NFT_RANGE_EQ = 0x0 + NFT_RANGE_NEQ = 0x1 + NFTA_RANGE_UNSPEC = 0x0 + NFTA_RANGE_SREG = 0x1 + NFTA_RANGE_OP = 0x2 + NFTA_RANGE_FROM_DATA = 0x3 + NFTA_RANGE_TO_DATA = 0x4 + NFT_LOOKUP_F_INV = 0x1 + NFTA_LOOKUP_UNSPEC = 0x0 + NFTA_LOOKUP_SET = 0x1 + NFTA_LOOKUP_SREG = 0x2 + NFTA_LOOKUP_DREG = 0x3 + NFTA_LOOKUP_SET_ID = 0x4 + NFTA_LOOKUP_FLAGS = 0x5 + NFT_DYNSET_OP_ADD = 0x0 + NFT_DYNSET_OP_UPDATE = 0x1 + NFT_DYNSET_F_INV = 0x1 + NFTA_DYNSET_UNSPEC = 0x0 + NFTA_DYNSET_SET_NAME = 0x1 + NFTA_DYNSET_SET_ID = 0x2 + NFTA_DYNSET_OP = 0x3 + NFTA_DYNSET_SREG_KEY = 0x4 + NFTA_DYNSET_SREG_DATA = 0x5 + NFTA_DYNSET_TIMEOUT = 0x6 + NFTA_DYNSET_EXPR = 0x7 + NFTA_DYNSET_PAD = 0x8 + NFTA_DYNSET_FLAGS = 0x9 + NFT_PAYLOAD_LL_HEADER = 0x0 + NFT_PAYLOAD_NETWORK_HEADER = 0x1 + NFT_PAYLOAD_TRANSPORT_HEADER = 0x2 + NFT_PAYLOAD_CSUM_NONE = 0x0 + NFT_PAYLOAD_CSUM_INET = 0x1 + NFT_PAYLOAD_L4CSUM_PSEUDOHDR = 0x1 + NFTA_PAYLOAD_UNSPEC = 0x0 + NFTA_PAYLOAD_DREG = 0x1 + NFTA_PAYLOAD_BASE = 0x2 + NFTA_PAYLOAD_OFFSET = 0x3 + NFTA_PAYLOAD_LEN = 0x4 + NFTA_PAYLOAD_SREG = 0x5 + NFTA_PAYLOAD_CSUM_TYPE = 0x6 + NFTA_PAYLOAD_CSUM_OFFSET = 0x7 + NFTA_PAYLOAD_CSUM_FLAGS = 0x8 + NFT_EXTHDR_F_PRESENT = 0x1 + NFT_EXTHDR_OP_IPV6 = 0x0 + NFT_EXTHDR_OP_TCPOPT = 0x1 + NFTA_EXTHDR_UNSPEC = 0x0 + NFTA_EXTHDR_DREG = 0x1 + NFTA_EXTHDR_TYPE = 0x2 + NFTA_EXTHDR_OFFSET = 0x3 + NFTA_EXTHDR_LEN = 0x4 + NFTA_EXTHDR_FLAGS = 0x5 + NFTA_EXTHDR_OP = 0x6 + NFTA_EXTHDR_SREG = 0x7 + NFT_META_LEN = 0x0 + NFT_META_PROTOCOL = 0x1 + NFT_META_PRIORITY = 0x2 + NFT_META_MARK = 0x3 + NFT_META_IIF = 0x4 + NFT_META_OIF = 0x5 + NFT_META_IIFNAME = 0x6 + NFT_META_OIFNAME = 0x7 + NFT_META_IIFTYPE = 0x8 + NFT_META_OIFTYPE = 0x9 + NFT_META_SKUID = 0xa + NFT_META_SKGID = 0xb + NFT_META_NFTRACE = 0xc + NFT_META_RTCLASSID = 0xd + NFT_META_SECMARK = 0xe + NFT_META_NFPROTO = 0xf + NFT_META_L4PROTO = 0x10 + NFT_META_BRI_IIFNAME = 0x11 + NFT_META_BRI_OIFNAME = 0x12 + NFT_META_PKTTYPE = 0x13 + NFT_META_CPU = 0x14 + NFT_META_IIFGROUP = 0x15 + NFT_META_OIFGROUP = 0x16 + NFT_META_CGROUP = 0x17 + NFT_META_PRANDOM = 0x18 + NFT_RT_CLASSID = 0x0 + NFT_RT_NEXTHOP4 = 0x1 + NFT_RT_NEXTHOP6 = 0x2 + NFT_RT_TCPMSS = 0x3 + NFT_HASH_JENKINS = 0x0 + NFT_HASH_SYM = 0x1 + NFTA_HASH_UNSPEC = 0x0 + NFTA_HASH_SREG = 0x1 + NFTA_HASH_DREG = 0x2 + NFTA_HASH_LEN = 0x3 + NFTA_HASH_MODULUS = 0x4 + NFTA_HASH_SEED = 0x5 + NFTA_HASH_OFFSET = 0x6 + NFTA_HASH_TYPE = 0x7 + NFTA_META_UNSPEC = 0x0 + NFTA_META_DREG = 0x1 + NFTA_META_KEY = 0x2 + NFTA_META_SREG = 0x3 + NFTA_RT_UNSPEC = 0x0 + NFTA_RT_DREG = 0x1 + NFTA_RT_KEY = 0x2 + NFT_CT_STATE = 0x0 + NFT_CT_DIRECTION = 0x1 + NFT_CT_STATUS = 0x2 + NFT_CT_MARK = 0x3 + NFT_CT_SECMARK = 0x4 + NFT_CT_EXPIRATION = 0x5 + NFT_CT_HELPER = 0x6 + NFT_CT_L3PROTOCOL = 0x7 + NFT_CT_SRC = 0x8 + NFT_CT_DST = 0x9 + NFT_CT_PROTOCOL = 0xa + NFT_CT_PROTO_SRC = 0xb + NFT_CT_PROTO_DST = 0xc + NFT_CT_LABELS = 0xd + NFT_CT_PKTS = 0xe + NFT_CT_BYTES = 0xf + NFT_CT_AVGPKT = 0x10 + NFT_CT_ZONE = 0x11 + NFT_CT_EVENTMASK = 0x12 + NFTA_CT_UNSPEC = 0x0 + NFTA_CT_DREG = 0x1 + NFTA_CT_KEY = 0x2 + NFTA_CT_DIRECTION = 0x3 + NFTA_CT_SREG = 0x4 + NFT_LIMIT_PKTS = 0x0 + NFT_LIMIT_PKT_BYTES = 0x1 + NFT_LIMIT_F_INV = 0x1 + NFTA_LIMIT_UNSPEC = 0x0 + NFTA_LIMIT_RATE = 0x1 + NFTA_LIMIT_UNIT = 0x2 + NFTA_LIMIT_BURST = 0x3 + NFTA_LIMIT_TYPE = 0x4 + NFTA_LIMIT_FLAGS = 0x5 + NFTA_LIMIT_PAD = 0x6 + NFTA_COUNTER_UNSPEC = 0x0 + NFTA_COUNTER_BYTES = 0x1 + NFTA_COUNTER_PACKETS = 0x2 + NFTA_COUNTER_PAD = 0x3 + NFTA_LOG_UNSPEC = 0x0 + NFTA_LOG_GROUP = 0x1 + NFTA_LOG_PREFIX = 0x2 + NFTA_LOG_SNAPLEN = 0x3 + NFTA_LOG_QTHRESHOLD = 0x4 + NFTA_LOG_LEVEL = 0x5 + NFTA_LOG_FLAGS = 0x6 + NFTA_QUEUE_UNSPEC = 0x0 + NFTA_QUEUE_NUM = 0x1 + NFTA_QUEUE_TOTAL = 0x2 + NFTA_QUEUE_FLAGS = 0x3 + NFTA_QUEUE_SREG_QNUM = 0x4 + NFT_QUOTA_F_INV = 0x1 + NFT_QUOTA_F_DEPLETED = 0x2 + NFTA_QUOTA_UNSPEC = 0x0 + NFTA_QUOTA_BYTES = 0x1 + NFTA_QUOTA_FLAGS = 0x2 + NFTA_QUOTA_PAD = 0x3 + NFTA_QUOTA_CONSUMED = 0x4 + NFT_REJECT_ICMP_UNREACH = 0x0 + NFT_REJECT_TCP_RST = 0x1 + NFT_REJECT_ICMPX_UNREACH = 0x2 + NFT_REJECT_ICMPX_NO_ROUTE = 0x0 + NFT_REJECT_ICMPX_PORT_UNREACH = 0x1 + NFT_REJECT_ICMPX_HOST_UNREACH = 0x2 + NFT_REJECT_ICMPX_ADMIN_PROHIBITED = 0x3 + NFTA_REJECT_UNSPEC = 0x0 + NFTA_REJECT_TYPE = 0x1 + NFTA_REJECT_ICMP_CODE = 0x2 + NFT_NAT_SNAT = 0x0 + NFT_NAT_DNAT = 0x1 + NFTA_NAT_UNSPEC = 0x0 + NFTA_NAT_TYPE = 0x1 + NFTA_NAT_FAMILY = 0x2 + NFTA_NAT_REG_ADDR_MIN = 0x3 + NFTA_NAT_REG_ADDR_MAX = 0x4 + NFTA_NAT_REG_PROTO_MIN = 0x5 + NFTA_NAT_REG_PROTO_MAX = 0x6 + NFTA_NAT_FLAGS = 0x7 + NFTA_MASQ_UNSPEC = 0x0 + NFTA_MASQ_FLAGS = 0x1 + NFTA_MASQ_REG_PROTO_MIN = 0x2 + NFTA_MASQ_REG_PROTO_MAX = 0x3 + NFTA_REDIR_UNSPEC = 0x0 + NFTA_REDIR_REG_PROTO_MIN = 0x1 + NFTA_REDIR_REG_PROTO_MAX = 0x2 + NFTA_REDIR_FLAGS = 0x3 + NFTA_DUP_UNSPEC = 0x0 + NFTA_DUP_SREG_ADDR = 0x1 + NFTA_DUP_SREG_DEV = 0x2 + NFTA_FWD_UNSPEC = 0x0 + NFTA_FWD_SREG_DEV = 0x1 + NFTA_OBJREF_UNSPEC = 0x0 + NFTA_OBJREF_IMM_TYPE = 0x1 + NFTA_OBJREF_IMM_NAME = 0x2 + NFTA_OBJREF_SET_SREG = 0x3 + NFTA_OBJREF_SET_NAME = 0x4 + NFTA_OBJREF_SET_ID = 0x5 + NFTA_GEN_UNSPEC = 0x0 + NFTA_GEN_ID = 0x1 + NFTA_GEN_PROC_PID = 0x2 + NFTA_GEN_PROC_NAME = 0x3 + NFTA_FIB_UNSPEC = 0x0 + NFTA_FIB_DREG = 0x1 + NFTA_FIB_RESULT = 0x2 + NFTA_FIB_FLAGS = 0x3 + NFT_FIB_RESULT_UNSPEC = 0x0 + NFT_FIB_RESULT_OIF = 0x1 + NFT_FIB_RESULT_OIFNAME = 0x2 + NFT_FIB_RESULT_ADDRTYPE = 0x3 + NFTA_FIB_F_SADDR = 0x1 + NFTA_FIB_F_DADDR = 0x2 + NFTA_FIB_F_MARK = 0x4 + NFTA_FIB_F_IIF = 0x8 + NFTA_FIB_F_OIF = 0x10 + NFTA_FIB_F_PRESENT = 0x20 + NFTA_CT_HELPER_UNSPEC = 0x0 + NFTA_CT_HELPER_NAME = 0x1 + NFTA_CT_HELPER_L3PROTO = 0x2 + NFTA_CT_HELPER_L4PROTO = 0x3 + NFTA_OBJ_UNSPEC = 0x0 + NFTA_OBJ_TABLE = 0x1 + NFTA_OBJ_NAME = 0x2 + NFTA_OBJ_TYPE = 0x3 + NFTA_OBJ_DATA = 0x4 + NFTA_OBJ_USE = 0x5 + NFTA_TRACE_UNSPEC = 0x0 + NFTA_TRACE_TABLE = 0x1 + NFTA_TRACE_CHAIN = 0x2 + NFTA_TRACE_RULE_HANDLE = 0x3 + NFTA_TRACE_TYPE = 0x4 + NFTA_TRACE_VERDICT = 0x5 + NFTA_TRACE_ID = 0x6 + NFTA_TRACE_LL_HEADER = 0x7 + NFTA_TRACE_NETWORK_HEADER = 0x8 + NFTA_TRACE_TRANSPORT_HEADER = 0x9 + NFTA_TRACE_IIF = 0xa + NFTA_TRACE_IIFTYPE = 0xb + NFTA_TRACE_OIF = 0xc + NFTA_TRACE_OIFTYPE = 0xd + NFTA_TRACE_MARK = 0xe + NFTA_TRACE_NFPROTO = 0xf + NFTA_TRACE_POLICY = 0x10 + NFTA_TRACE_PAD = 0x11 + NFT_TRACETYPE_UNSPEC = 0x0 + NFT_TRACETYPE_POLICY = 0x1 + NFT_TRACETYPE_RETURN = 0x2 + NFT_TRACETYPE_RULE = 0x3 + NFTA_NG_UNSPEC = 0x0 + NFTA_NG_DREG = 0x1 + NFTA_NG_MODULUS = 0x2 + NFTA_NG_TYPE = 0x3 + NFTA_NG_OFFSET = 0x4 + NFT_NG_INCREMENTAL = 0x0 + NFT_NG_RANDOM = 0x1 +) + +type RTCTime struct { + Sec int32 + Min int32 + Hour int32 + Mday int32 + Mon int32 + Year int32 + Wday int32 + Yday int32 + Isdst int32 +} + +type RTCWkAlrm struct { + Enabled uint8 + Pending uint8 + _ [2]byte + Time RTCTime +} + +type RTCPLLInfo struct { + Ctrl int32 + Value int32 + Max int32 + Min int32 + Posmult int32 + Negmult int32 + Clock int64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go b/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go index 6de721f78f..cc5ca242eb 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_mipsle.go @@ -115,27 +115,10 @@ type Stat_t struct { Pad5 [14]int32 } -type Statfs_t struct { - Type int32 - Bsize int32 - Frsize int32 - _ [4]byte - Blocks uint64 - Bfree uint64 - Files uint64 - Ffree uint64 - Bavail uint64 - Fsid Fsid - Namelen int32 - Flags int32 - Spare [5]int32 - _ [4]byte -} - type StatxTimestamp struct { - Sec int64 - Nsec uint32 - X__reserved int32 + Sec int64 + Nsec uint32 + _ int32 } type Statx_t struct { @@ -172,7 +155,7 @@ type Dirent struct { } type Fsid struct { - X__val [2]int32 + Val [2]int32 } type Flock_t struct { @@ -266,6 +249,13 @@ type RawSockaddrL2 struct { _ [1]byte } +type RawSockaddrRFCOMM struct { + Family uint16 + Bdaddr [6]uint8 + Channel uint8 + _ [1]byte +} + type RawSockaddrCAN struct { Family uint16 _ [2]byte @@ -419,6 +409,7 @@ const ( SizeofSockaddrNetlink = 0xc SizeofSockaddrHCI = 0x6 SizeofSockaddrL2 = 0xe + SizeofSockaddrRFCOMM = 0xa SizeofSockaddrCAN = 0x10 SizeofSockaddrALG = 0x58 SizeofSockaddrVM = 0x10 @@ -439,97 +430,123 @@ const ( ) const ( - IFA_UNSPEC = 0x0 - IFA_ADDRESS = 0x1 - IFA_LOCAL = 0x2 - IFA_LABEL = 0x3 - IFA_BROADCAST = 0x4 - IFA_ANYCAST = 0x5 - IFA_CACHEINFO = 0x6 - IFA_MULTICAST = 0x7 - IFLA_UNSPEC = 0x0 - IFLA_ADDRESS = 0x1 - IFLA_BROADCAST = 0x2 - IFLA_IFNAME = 0x3 - IFLA_MTU = 0x4 - IFLA_LINK = 0x5 - IFLA_QDISC = 0x6 - IFLA_STATS = 0x7 - IFLA_COST = 0x8 - IFLA_PRIORITY = 0x9 - IFLA_MASTER = 0xa - IFLA_WIRELESS = 0xb - IFLA_PROTINFO = 0xc - IFLA_TXQLEN = 0xd - IFLA_MAP = 0xe - IFLA_WEIGHT = 0xf - IFLA_OPERSTATE = 0x10 - IFLA_LINKMODE = 0x11 - IFLA_LINKINFO = 0x12 - IFLA_NET_NS_PID = 0x13 - IFLA_IFALIAS = 0x14 - IFLA_MAX = 0x2c - RT_SCOPE_UNIVERSE = 0x0 - RT_SCOPE_SITE = 0xc8 - RT_SCOPE_LINK = 0xfd - RT_SCOPE_HOST = 0xfe - RT_SCOPE_NOWHERE = 0xff - RT_TABLE_UNSPEC = 0x0 - RT_TABLE_COMPAT = 0xfc - RT_TABLE_DEFAULT = 0xfd - RT_TABLE_MAIN = 0xfe - RT_TABLE_LOCAL = 0xff - RT_TABLE_MAX = 0xffffffff - RTA_UNSPEC = 0x0 - RTA_DST = 0x1 - RTA_SRC = 0x2 - RTA_IIF = 0x3 - RTA_OIF = 0x4 - RTA_GATEWAY = 0x5 - RTA_PRIORITY = 0x6 - RTA_PREFSRC = 0x7 - RTA_METRICS = 0x8 - RTA_MULTIPATH = 0x9 - RTA_FLOW = 0xb - RTA_CACHEINFO = 0xc - RTA_TABLE = 0xf - RTN_UNSPEC = 0x0 - RTN_UNICAST = 0x1 - RTN_LOCAL = 0x2 - RTN_BROADCAST = 0x3 - RTN_ANYCAST = 0x4 - RTN_MULTICAST = 0x5 - RTN_BLACKHOLE = 0x6 - RTN_UNREACHABLE = 0x7 - RTN_PROHIBIT = 0x8 - RTN_THROW = 0x9 - RTN_NAT = 0xa - RTN_XRESOLVE = 0xb - RTNLGRP_NONE = 0x0 - RTNLGRP_LINK = 0x1 - RTNLGRP_NOTIFY = 0x2 - RTNLGRP_NEIGH = 0x3 - RTNLGRP_TC = 0x4 - RTNLGRP_IPV4_IFADDR = 0x5 - RTNLGRP_IPV4_MROUTE = 0x6 - RTNLGRP_IPV4_ROUTE = 0x7 - RTNLGRP_IPV4_RULE = 0x8 - RTNLGRP_IPV6_IFADDR = 0x9 - RTNLGRP_IPV6_MROUTE = 0xa - RTNLGRP_IPV6_ROUTE = 0xb - RTNLGRP_IPV6_IFINFO = 0xc - RTNLGRP_IPV6_PREFIX = 0x12 - RTNLGRP_IPV6_RULE = 0x13 - RTNLGRP_ND_USEROPT = 0x14 - SizeofNlMsghdr = 0x10 - SizeofNlMsgerr = 0x14 - SizeofRtGenmsg = 0x1 - SizeofNlAttr = 0x4 - SizeofRtAttr = 0x4 - SizeofIfInfomsg = 0x10 - SizeofIfAddrmsg = 0x8 - SizeofRtMsg = 0xc - SizeofRtNexthop = 0x8 + IFA_UNSPEC = 0x0 + IFA_ADDRESS = 0x1 + IFA_LOCAL = 0x2 + IFA_LABEL = 0x3 + IFA_BROADCAST = 0x4 + IFA_ANYCAST = 0x5 + IFA_CACHEINFO = 0x6 + IFA_MULTICAST = 0x7 + IFLA_UNSPEC = 0x0 + IFLA_ADDRESS = 0x1 + IFLA_BROADCAST = 0x2 + IFLA_IFNAME = 0x3 + IFLA_MTU = 0x4 + IFLA_LINK = 0x5 + IFLA_QDISC = 0x6 + IFLA_STATS = 0x7 + IFLA_COST = 0x8 + IFLA_PRIORITY = 0x9 + IFLA_MASTER = 0xa + IFLA_WIRELESS = 0xb + IFLA_PROTINFO = 0xc + IFLA_TXQLEN = 0xd + IFLA_MAP = 0xe + IFLA_WEIGHT = 0xf + IFLA_OPERSTATE = 0x10 + IFLA_LINKMODE = 0x11 + IFLA_LINKINFO = 0x12 + IFLA_NET_NS_PID = 0x13 + IFLA_IFALIAS = 0x14 + IFLA_NUM_VF = 0x15 + IFLA_VFINFO_LIST = 0x16 + IFLA_STATS64 = 0x17 + IFLA_VF_PORTS = 0x18 + IFLA_PORT_SELF = 0x19 + IFLA_AF_SPEC = 0x1a + IFLA_GROUP = 0x1b + IFLA_NET_NS_FD = 0x1c + IFLA_EXT_MASK = 0x1d + IFLA_PROMISCUITY = 0x1e + IFLA_NUM_TX_QUEUES = 0x1f + IFLA_NUM_RX_QUEUES = 0x20 + IFLA_CARRIER = 0x21 + IFLA_PHYS_PORT_ID = 0x22 + IFLA_CARRIER_CHANGES = 0x23 + IFLA_PHYS_SWITCH_ID = 0x24 + IFLA_LINK_NETNSID = 0x25 + IFLA_PHYS_PORT_NAME = 0x26 + IFLA_PROTO_DOWN = 0x27 + IFLA_GSO_MAX_SEGS = 0x28 + IFLA_GSO_MAX_SIZE = 0x29 + IFLA_PAD = 0x2a + IFLA_XDP = 0x2b + IFLA_EVENT = 0x2c + IFLA_NEW_NETNSID = 0x2d + IFLA_IF_NETNSID = 0x2e + IFLA_MAX = 0x31 + RT_SCOPE_UNIVERSE = 0x0 + RT_SCOPE_SITE = 0xc8 + RT_SCOPE_LINK = 0xfd + RT_SCOPE_HOST = 0xfe + RT_SCOPE_NOWHERE = 0xff + RT_TABLE_UNSPEC = 0x0 + RT_TABLE_COMPAT = 0xfc + RT_TABLE_DEFAULT = 0xfd + RT_TABLE_MAIN = 0xfe + RT_TABLE_LOCAL = 0xff + RT_TABLE_MAX = 0xffffffff + RTA_UNSPEC = 0x0 + RTA_DST = 0x1 + RTA_SRC = 0x2 + RTA_IIF = 0x3 + RTA_OIF = 0x4 + RTA_GATEWAY = 0x5 + RTA_PRIORITY = 0x6 + RTA_PREFSRC = 0x7 + RTA_METRICS = 0x8 + RTA_MULTIPATH = 0x9 + RTA_FLOW = 0xb + RTA_CACHEINFO = 0xc + RTA_TABLE = 0xf + RTN_UNSPEC = 0x0 + RTN_UNICAST = 0x1 + RTN_LOCAL = 0x2 + RTN_BROADCAST = 0x3 + RTN_ANYCAST = 0x4 + RTN_MULTICAST = 0x5 + RTN_BLACKHOLE = 0x6 + RTN_UNREACHABLE = 0x7 + RTN_PROHIBIT = 0x8 + RTN_THROW = 0x9 + RTN_NAT = 0xa + RTN_XRESOLVE = 0xb + RTNLGRP_NONE = 0x0 + RTNLGRP_LINK = 0x1 + RTNLGRP_NOTIFY = 0x2 + RTNLGRP_NEIGH = 0x3 + RTNLGRP_TC = 0x4 + RTNLGRP_IPV4_IFADDR = 0x5 + RTNLGRP_IPV4_MROUTE = 0x6 + RTNLGRP_IPV4_ROUTE = 0x7 + RTNLGRP_IPV4_RULE = 0x8 + RTNLGRP_IPV6_IFADDR = 0x9 + RTNLGRP_IPV6_MROUTE = 0xa + RTNLGRP_IPV6_ROUTE = 0xb + RTNLGRP_IPV6_IFINFO = 0xc + RTNLGRP_IPV6_PREFIX = 0x12 + RTNLGRP_IPV6_RULE = 0x13 + RTNLGRP_ND_USEROPT = 0x14 + SizeofNlMsghdr = 0x10 + SizeofNlMsgerr = 0x14 + SizeofRtGenmsg = 0x1 + SizeofNlAttr = 0x4 + SizeofRtAttr = 0x4 + SizeofIfInfomsg = 0x10 + SizeofIfAddrmsg = 0x8 + SizeofRtMsg = 0xc + SizeofRtNexthop = 0x8 ) type NlMsghdr struct { @@ -560,12 +577,12 @@ type RtAttr struct { } type IfInfomsg struct { - Family uint8 - X__ifi_pad uint8 - Type uint16 - Index int32 - Flags uint32 - Change uint32 + Family uint8 + _ uint8 + Type uint16 + Index int32 + Flags uint32 + Change uint32 } type IfAddrmsg struct { @@ -650,7 +667,7 @@ type Sysinfo_t struct { Totalhigh uint32 Freehigh uint32 Unit uint32 - X_f [8]int8 + _ [8]int8 } type Utsname struct { @@ -688,6 +705,8 @@ const ( AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x100 + + AT_EACCESS = 0x200 ) type PollFd struct { @@ -707,7 +726,7 @@ const ( ) type Sigset_t struct { - X__val [32]uint32 + Val [32]uint32 } const RNDGETENTCNT = 0x40045200 @@ -863,3 +882,967 @@ const ( BDADDR_LE_PUBLIC = 0x1 BDADDR_LE_RANDOM = 0x2 ) + +type PerfEventAttr struct { + Type uint32 + Size uint32 + Config uint64 + Sample uint64 + Sample_type uint64 + Read_format uint64 + Bits uint64 + Wakeup uint32 + Bp_type uint32 + Ext1 uint64 + Ext2 uint64 + Branch_sample_type uint64 + Sample_regs_user uint64 + Sample_stack_user uint32 + Clockid int32 + Sample_regs_intr uint64 + Aux_watermark uint32 + _ uint32 +} + +type PerfEventMmapPage struct { + Version uint32 + Compat_version uint32 + Lock uint32 + Index uint32 + Offset int64 + Time_enabled uint64 + Time_running uint64 + Capabilities uint64 + Pmc_width uint16 + Time_shift uint16 + Time_mult uint32 + Time_offset uint64 + Time_zero uint64 + Size uint32 + _ [948]uint8 + Data_head uint64 + Data_tail uint64 + Data_offset uint64 + Data_size uint64 + Aux_head uint64 + Aux_tail uint64 + Aux_offset uint64 + Aux_size uint64 +} + +const ( + PerfBitDisabled uint64 = CBitFieldMaskBit0 + PerfBitInherit = CBitFieldMaskBit1 + PerfBitPinned = CBitFieldMaskBit2 + PerfBitExclusive = CBitFieldMaskBit3 + PerfBitExcludeUser = CBitFieldMaskBit4 + PerfBitExcludeKernel = CBitFieldMaskBit5 + PerfBitExcludeHv = CBitFieldMaskBit6 + PerfBitExcludeIdle = CBitFieldMaskBit7 + PerfBitMmap = CBitFieldMaskBit8 + PerfBitComm = CBitFieldMaskBit9 + PerfBitFreq = CBitFieldMaskBit10 + PerfBitInheritStat = CBitFieldMaskBit11 + PerfBitEnableOnExec = CBitFieldMaskBit12 + PerfBitTask = CBitFieldMaskBit13 + PerfBitWatermark = CBitFieldMaskBit14 + PerfBitPreciseIPBit1 = CBitFieldMaskBit15 + PerfBitPreciseIPBit2 = CBitFieldMaskBit16 + PerfBitMmapData = CBitFieldMaskBit17 + PerfBitSampleIDAll = CBitFieldMaskBit18 + PerfBitExcludeHost = CBitFieldMaskBit19 + PerfBitExcludeGuest = CBitFieldMaskBit20 + PerfBitExcludeCallchainKernel = CBitFieldMaskBit21 + PerfBitExcludeCallchainUser = CBitFieldMaskBit22 + PerfBitMmap2 = CBitFieldMaskBit23 + PerfBitCommExec = CBitFieldMaskBit24 + PerfBitUseClockID = CBitFieldMaskBit25 + PerfBitContextSwitch = CBitFieldMaskBit26 +) + +const ( + PERF_TYPE_HARDWARE = 0x0 + PERF_TYPE_SOFTWARE = 0x1 + PERF_TYPE_TRACEPOINT = 0x2 + PERF_TYPE_HW_CACHE = 0x3 + PERF_TYPE_RAW = 0x4 + PERF_TYPE_BREAKPOINT = 0x5 + + PERF_COUNT_HW_CPU_CYCLES = 0x0 + PERF_COUNT_HW_INSTRUCTIONS = 0x1 + PERF_COUNT_HW_CACHE_REFERENCES = 0x2 + PERF_COUNT_HW_CACHE_MISSES = 0x3 + PERF_COUNT_HW_BRANCH_INSTRUCTIONS = 0x4 + PERF_COUNT_HW_BRANCH_MISSES = 0x5 + PERF_COUNT_HW_BUS_CYCLES = 0x6 + PERF_COUNT_HW_STALLED_CYCLES_FRONTEND = 0x7 + PERF_COUNT_HW_STALLED_CYCLES_BACKEND = 0x8 + PERF_COUNT_HW_REF_CPU_CYCLES = 0x9 + + PERF_COUNT_HW_CACHE_L1D = 0x0 + PERF_COUNT_HW_CACHE_L1I = 0x1 + PERF_COUNT_HW_CACHE_LL = 0x2 + PERF_COUNT_HW_CACHE_DTLB = 0x3 + PERF_COUNT_HW_CACHE_ITLB = 0x4 + PERF_COUNT_HW_CACHE_BPU = 0x5 + PERF_COUNT_HW_CACHE_NODE = 0x6 + + PERF_COUNT_HW_CACHE_OP_READ = 0x0 + PERF_COUNT_HW_CACHE_OP_WRITE = 0x1 + PERF_COUNT_HW_CACHE_OP_PREFETCH = 0x2 + + PERF_COUNT_HW_CACHE_RESULT_ACCESS = 0x0 + PERF_COUNT_HW_CACHE_RESULT_MISS = 0x1 + + PERF_COUNT_SW_CPU_CLOCK = 0x0 + PERF_COUNT_SW_TASK_CLOCK = 0x1 + PERF_COUNT_SW_PAGE_FAULTS = 0x2 + PERF_COUNT_SW_CONTEXT_SWITCHES = 0x3 + PERF_COUNT_SW_CPU_MIGRATIONS = 0x4 + PERF_COUNT_SW_PAGE_FAULTS_MIN = 0x5 + PERF_COUNT_SW_PAGE_FAULTS_MAJ = 0x6 + PERF_COUNT_SW_ALIGNMENT_FAULTS = 0x7 + PERF_COUNT_SW_EMULATION_FAULTS = 0x8 + PERF_COUNT_SW_DUMMY = 0x9 + + PERF_SAMPLE_IP = 0x1 + PERF_SAMPLE_TID = 0x2 + PERF_SAMPLE_TIME = 0x4 + PERF_SAMPLE_ADDR = 0x8 + PERF_SAMPLE_READ = 0x10 + PERF_SAMPLE_CALLCHAIN = 0x20 + PERF_SAMPLE_ID = 0x40 + PERF_SAMPLE_CPU = 0x80 + PERF_SAMPLE_PERIOD = 0x100 + PERF_SAMPLE_STREAM_ID = 0x200 + PERF_SAMPLE_RAW = 0x400 + PERF_SAMPLE_BRANCH_STACK = 0x800 + + PERF_SAMPLE_BRANCH_USER = 0x1 + PERF_SAMPLE_BRANCH_KERNEL = 0x2 + PERF_SAMPLE_BRANCH_HV = 0x4 + PERF_SAMPLE_BRANCH_ANY = 0x8 + PERF_SAMPLE_BRANCH_ANY_CALL = 0x10 + PERF_SAMPLE_BRANCH_ANY_RETURN = 0x20 + PERF_SAMPLE_BRANCH_IND_CALL = 0x40 + + PERF_FORMAT_TOTAL_TIME_ENABLED = 0x1 + PERF_FORMAT_TOTAL_TIME_RUNNING = 0x2 + PERF_FORMAT_ID = 0x4 + PERF_FORMAT_GROUP = 0x8 + + PERF_RECORD_MMAP = 0x1 + PERF_RECORD_LOST = 0x2 + PERF_RECORD_COMM = 0x3 + PERF_RECORD_EXIT = 0x4 + PERF_RECORD_THROTTLE = 0x5 + PERF_RECORD_UNTHROTTLE = 0x6 + PERF_RECORD_FORK = 0x7 + PERF_RECORD_READ = 0x8 + PERF_RECORD_SAMPLE = 0x9 + + PERF_CONTEXT_HV = -0x20 + PERF_CONTEXT_KERNEL = -0x80 + PERF_CONTEXT_USER = -0x200 + + PERF_CONTEXT_GUEST = -0x800 + PERF_CONTEXT_GUEST_KERNEL = -0x880 + PERF_CONTEXT_GUEST_USER = -0xa00 + + PERF_FLAG_FD_NO_GROUP = 0x1 + PERF_FLAG_FD_OUTPUT = 0x2 + PERF_FLAG_PID_CGROUP = 0x4 +) + +const ( + CBitFieldMaskBit0 = 0x1 + CBitFieldMaskBit1 = 0x2 + CBitFieldMaskBit2 = 0x4 + CBitFieldMaskBit3 = 0x8 + CBitFieldMaskBit4 = 0x10 + CBitFieldMaskBit5 = 0x20 + CBitFieldMaskBit6 = 0x40 + CBitFieldMaskBit7 = 0x80 + CBitFieldMaskBit8 = 0x100 + CBitFieldMaskBit9 = 0x200 + CBitFieldMaskBit10 = 0x400 + CBitFieldMaskBit11 = 0x800 + CBitFieldMaskBit12 = 0x1000 + CBitFieldMaskBit13 = 0x2000 + CBitFieldMaskBit14 = 0x4000 + CBitFieldMaskBit15 = 0x8000 + CBitFieldMaskBit16 = 0x10000 + CBitFieldMaskBit17 = 0x20000 + CBitFieldMaskBit18 = 0x40000 + CBitFieldMaskBit19 = 0x80000 + CBitFieldMaskBit20 = 0x100000 + CBitFieldMaskBit21 = 0x200000 + CBitFieldMaskBit22 = 0x400000 + CBitFieldMaskBit23 = 0x800000 + CBitFieldMaskBit24 = 0x1000000 + CBitFieldMaskBit25 = 0x2000000 + CBitFieldMaskBit26 = 0x4000000 + CBitFieldMaskBit27 = 0x8000000 + CBitFieldMaskBit28 = 0x10000000 + CBitFieldMaskBit29 = 0x20000000 + CBitFieldMaskBit30 = 0x40000000 + CBitFieldMaskBit31 = 0x80000000 + CBitFieldMaskBit32 = 0x100000000 + CBitFieldMaskBit33 = 0x200000000 + CBitFieldMaskBit34 = 0x400000000 + CBitFieldMaskBit35 = 0x800000000 + CBitFieldMaskBit36 = 0x1000000000 + CBitFieldMaskBit37 = 0x2000000000 + CBitFieldMaskBit38 = 0x4000000000 + CBitFieldMaskBit39 = 0x8000000000 + CBitFieldMaskBit40 = 0x10000000000 + CBitFieldMaskBit41 = 0x20000000000 + CBitFieldMaskBit42 = 0x40000000000 + CBitFieldMaskBit43 = 0x80000000000 + CBitFieldMaskBit44 = 0x100000000000 + CBitFieldMaskBit45 = 0x200000000000 + CBitFieldMaskBit46 = 0x400000000000 + CBitFieldMaskBit47 = 0x800000000000 + CBitFieldMaskBit48 = 0x1000000000000 + CBitFieldMaskBit49 = 0x2000000000000 + CBitFieldMaskBit50 = 0x4000000000000 + CBitFieldMaskBit51 = 0x8000000000000 + CBitFieldMaskBit52 = 0x10000000000000 + CBitFieldMaskBit53 = 0x20000000000000 + CBitFieldMaskBit54 = 0x40000000000000 + CBitFieldMaskBit55 = 0x80000000000000 + CBitFieldMaskBit56 = 0x100000000000000 + CBitFieldMaskBit57 = 0x200000000000000 + CBitFieldMaskBit58 = 0x400000000000000 + CBitFieldMaskBit59 = 0x800000000000000 + CBitFieldMaskBit60 = 0x1000000000000000 + CBitFieldMaskBit61 = 0x2000000000000000 + CBitFieldMaskBit62 = 0x4000000000000000 + CBitFieldMaskBit63 = 0x8000000000000000 +) + +type SockaddrStorage struct { + Family uint16 + _ [122]int8 + _ uint32 +} + +type TCPMD5Sig struct { + Addr SockaddrStorage + Flags uint8 + Prefixlen uint8 + Keylen uint16 + _ uint32 + Key [80]uint8 +} + +type HDDriveCmdHdr struct { + Command uint8 + Number uint8 + Feature uint8 + Count uint8 +} + +type HDGeometry struct { + Heads uint8 + Sectors uint8 + Cylinders uint16 + Start uint32 +} + +type HDDriveID struct { + Config uint16 + Cyls uint16 + Reserved2 uint16 + Heads uint16 + Track_bytes uint16 + Sector_bytes uint16 + Sectors uint16 + Vendor0 uint16 + Vendor1 uint16 + Vendor2 uint16 + Serial_no [20]uint8 + Buf_type uint16 + Buf_size uint16 + Ecc_bytes uint16 + Fw_rev [8]uint8 + Model [40]uint8 + Max_multsect uint8 + Vendor3 uint8 + Dword_io uint16 + Vendor4 uint8 + Capability uint8 + Reserved50 uint16 + Vendor5 uint8 + TPIO uint8 + Vendor6 uint8 + TDMA uint8 + Field_valid uint16 + Cur_cyls uint16 + Cur_heads uint16 + Cur_sectors uint16 + Cur_capacity0 uint16 + Cur_capacity1 uint16 + Multsect uint8 + Multsect_valid uint8 + Lba_capacity uint32 + Dma_1word uint16 + Dma_mword uint16 + Eide_pio_modes uint16 + Eide_dma_min uint16 + Eide_dma_time uint16 + Eide_pio uint16 + Eide_pio_iordy uint16 + Words69_70 [2]uint16 + Words71_74 [4]uint16 + Queue_depth uint16 + Words76_79 [4]uint16 + Major_rev_num uint16 + Minor_rev_num uint16 + Command_set_1 uint16 + Command_set_2 uint16 + Cfsse uint16 + Cfs_enable_1 uint16 + Cfs_enable_2 uint16 + Csf_default uint16 + Dma_ultra uint16 + Trseuc uint16 + TrsEuc uint16 + CurAPMvalues uint16 + Mprc uint16 + Hw_config uint16 + Acoustic uint16 + Msrqs uint16 + Sxfert uint16 + Sal uint16 + Spg uint32 + Lba_capacity_2 uint64 + Words104_125 [22]uint16 + Last_lun uint16 + Word127 uint16 + Dlf uint16 + Csfo uint16 + Words130_155 [26]uint16 + Word156 uint16 + Words157_159 [3]uint16 + Cfa_power uint16 + Words161_175 [15]uint16 + Words176_205 [30]uint16 + Words206_254 [49]uint16 + Integrity_word uint16 +} + +type Statfs_t struct { + Type int32 + Bsize int32 + Frsize int32 + _ [4]byte + Blocks uint64 + Bfree uint64 + Files uint64 + Ffree uint64 + Bavail uint64 + Fsid Fsid + Namelen int32 + Flags int32 + Spare [5]int32 + _ [4]byte +} + +const ( + ST_MANDLOCK = 0x40 + ST_NOATIME = 0x400 + ST_NODEV = 0x4 + ST_NODIRATIME = 0x800 + ST_NOEXEC = 0x8 + ST_NOSUID = 0x2 + ST_RDONLY = 0x1 + ST_RELATIME = 0x1000 + ST_SYNCHRONOUS = 0x10 +) + +type TpacketHdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Usec uint32 +} + +type Tpacket2Hdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Nsec uint32 + Vlan_tci uint16 + Vlan_tpid uint16 + _ [4]uint8 +} + +type Tpacket3Hdr struct { + Next_offset uint32 + Sec uint32 + Nsec uint32 + Snaplen uint32 + Len uint32 + Status uint32 + Mac uint16 + Net uint16 + Hv1 TpacketHdrVariant1 + _ [8]uint8 +} + +type TpacketHdrVariant1 struct { + Rxhash uint32 + Vlan_tci uint32 + Vlan_tpid uint16 + _ uint16 +} + +type TpacketBlockDesc struct { + Version uint32 + To_priv uint32 + Hdr [40]byte +} + +type TpacketReq struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 +} + +type TpacketReq3 struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 + Retire_blk_tov uint32 + Sizeof_priv uint32 + Feature_req_word uint32 +} + +type TpacketStats struct { + Packets uint32 + Drops uint32 +} + +type TpacketStatsV3 struct { + Packets uint32 + Drops uint32 + Freeze_q_cnt uint32 +} + +type TpacketAuxdata struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Vlan_tci uint16 + Vlan_tpid uint16 +} + +const ( + TPACKET_V1 = 0x0 + TPACKET_V2 = 0x1 + TPACKET_V3 = 0x2 +) + +const ( + SizeofTpacketHdr = 0x18 + SizeofTpacket2Hdr = 0x20 + SizeofTpacket3Hdr = 0x30 +) + +const ( + NF_INET_PRE_ROUTING = 0x0 + NF_INET_LOCAL_IN = 0x1 + NF_INET_FORWARD = 0x2 + NF_INET_LOCAL_OUT = 0x3 + NF_INET_POST_ROUTING = 0x4 + NF_INET_NUMHOOKS = 0x5 +) + +const ( + NF_NETDEV_INGRESS = 0x0 + NF_NETDEV_NUMHOOKS = 0x1 +) + +const ( + NFPROTO_UNSPEC = 0x0 + NFPROTO_INET = 0x1 + NFPROTO_IPV4 = 0x2 + NFPROTO_ARP = 0x3 + NFPROTO_NETDEV = 0x5 + NFPROTO_BRIDGE = 0x7 + NFPROTO_IPV6 = 0xa + NFPROTO_DECNET = 0xc + NFPROTO_NUMPROTO = 0xd +) + +type Nfgenmsg struct { + Nfgen_family uint8 + Version uint8 + Res_id uint16 +} + +const ( + NFNL_BATCH_UNSPEC = 0x0 + NFNL_BATCH_GENID = 0x1 +) + +const ( + NFT_REG_VERDICT = 0x0 + NFT_REG_1 = 0x1 + NFT_REG_2 = 0x2 + NFT_REG_3 = 0x3 + NFT_REG_4 = 0x4 + NFT_REG32_00 = 0x8 + NFT_REG32_01 = 0x9 + NFT_REG32_02 = 0xa + NFT_REG32_03 = 0xb + NFT_REG32_04 = 0xc + NFT_REG32_05 = 0xd + NFT_REG32_06 = 0xe + NFT_REG32_07 = 0xf + NFT_REG32_08 = 0x10 + NFT_REG32_09 = 0x11 + NFT_REG32_10 = 0x12 + NFT_REG32_11 = 0x13 + NFT_REG32_12 = 0x14 + NFT_REG32_13 = 0x15 + NFT_REG32_14 = 0x16 + NFT_REG32_15 = 0x17 + NFT_CONTINUE = -0x1 + NFT_BREAK = -0x2 + NFT_JUMP = -0x3 + NFT_GOTO = -0x4 + NFT_RETURN = -0x5 + NFT_MSG_NEWTABLE = 0x0 + NFT_MSG_GETTABLE = 0x1 + NFT_MSG_DELTABLE = 0x2 + NFT_MSG_NEWCHAIN = 0x3 + NFT_MSG_GETCHAIN = 0x4 + NFT_MSG_DELCHAIN = 0x5 + NFT_MSG_NEWRULE = 0x6 + NFT_MSG_GETRULE = 0x7 + NFT_MSG_DELRULE = 0x8 + NFT_MSG_NEWSET = 0x9 + NFT_MSG_GETSET = 0xa + NFT_MSG_DELSET = 0xb + NFT_MSG_NEWSETELEM = 0xc + NFT_MSG_GETSETELEM = 0xd + NFT_MSG_DELSETELEM = 0xe + NFT_MSG_NEWGEN = 0xf + NFT_MSG_GETGEN = 0x10 + NFT_MSG_TRACE = 0x11 + NFT_MSG_NEWOBJ = 0x12 + NFT_MSG_GETOBJ = 0x13 + NFT_MSG_DELOBJ = 0x14 + NFT_MSG_GETOBJ_RESET = 0x15 + NFT_MSG_MAX = 0x19 + NFTA_LIST_UNPEC = 0x0 + NFTA_LIST_ELEM = 0x1 + NFTA_HOOK_UNSPEC = 0x0 + NFTA_HOOK_HOOKNUM = 0x1 + NFTA_HOOK_PRIORITY = 0x2 + NFTA_HOOK_DEV = 0x3 + NFT_TABLE_F_DORMANT = 0x1 + NFTA_TABLE_UNSPEC = 0x0 + NFTA_TABLE_NAME = 0x1 + NFTA_TABLE_FLAGS = 0x2 + NFTA_TABLE_USE = 0x3 + NFTA_CHAIN_UNSPEC = 0x0 + NFTA_CHAIN_TABLE = 0x1 + NFTA_CHAIN_HANDLE = 0x2 + NFTA_CHAIN_NAME = 0x3 + NFTA_CHAIN_HOOK = 0x4 + NFTA_CHAIN_POLICY = 0x5 + NFTA_CHAIN_USE = 0x6 + NFTA_CHAIN_TYPE = 0x7 + NFTA_CHAIN_COUNTERS = 0x8 + NFTA_CHAIN_PAD = 0x9 + NFTA_RULE_UNSPEC = 0x0 + NFTA_RULE_TABLE = 0x1 + NFTA_RULE_CHAIN = 0x2 + NFTA_RULE_HANDLE = 0x3 + NFTA_RULE_EXPRESSIONS = 0x4 + NFTA_RULE_COMPAT = 0x5 + NFTA_RULE_POSITION = 0x6 + NFTA_RULE_USERDATA = 0x7 + NFTA_RULE_PAD = 0x8 + NFTA_RULE_ID = 0x9 + NFT_RULE_COMPAT_F_INV = 0x2 + NFT_RULE_COMPAT_F_MASK = 0x2 + NFTA_RULE_COMPAT_UNSPEC = 0x0 + NFTA_RULE_COMPAT_PROTO = 0x1 + NFTA_RULE_COMPAT_FLAGS = 0x2 + NFT_SET_ANONYMOUS = 0x1 + NFT_SET_CONSTANT = 0x2 + NFT_SET_INTERVAL = 0x4 + NFT_SET_MAP = 0x8 + NFT_SET_TIMEOUT = 0x10 + NFT_SET_EVAL = 0x20 + NFT_SET_OBJECT = 0x40 + NFT_SET_POL_PERFORMANCE = 0x0 + NFT_SET_POL_MEMORY = 0x1 + NFTA_SET_DESC_UNSPEC = 0x0 + NFTA_SET_DESC_SIZE = 0x1 + NFTA_SET_UNSPEC = 0x0 + NFTA_SET_TABLE = 0x1 + NFTA_SET_NAME = 0x2 + NFTA_SET_FLAGS = 0x3 + NFTA_SET_KEY_TYPE = 0x4 + NFTA_SET_KEY_LEN = 0x5 + NFTA_SET_DATA_TYPE = 0x6 + NFTA_SET_DATA_LEN = 0x7 + NFTA_SET_POLICY = 0x8 + NFTA_SET_DESC = 0x9 + NFTA_SET_ID = 0xa + NFTA_SET_TIMEOUT = 0xb + NFTA_SET_GC_INTERVAL = 0xc + NFTA_SET_USERDATA = 0xd + NFTA_SET_PAD = 0xe + NFTA_SET_OBJ_TYPE = 0xf + NFT_SET_ELEM_INTERVAL_END = 0x1 + NFTA_SET_ELEM_UNSPEC = 0x0 + NFTA_SET_ELEM_KEY = 0x1 + NFTA_SET_ELEM_DATA = 0x2 + NFTA_SET_ELEM_FLAGS = 0x3 + NFTA_SET_ELEM_TIMEOUT = 0x4 + NFTA_SET_ELEM_EXPIRATION = 0x5 + NFTA_SET_ELEM_USERDATA = 0x6 + NFTA_SET_ELEM_EXPR = 0x7 + NFTA_SET_ELEM_PAD = 0x8 + NFTA_SET_ELEM_OBJREF = 0x9 + NFTA_SET_ELEM_LIST_UNSPEC = 0x0 + NFTA_SET_ELEM_LIST_TABLE = 0x1 + NFTA_SET_ELEM_LIST_SET = 0x2 + NFTA_SET_ELEM_LIST_ELEMENTS = 0x3 + NFTA_SET_ELEM_LIST_SET_ID = 0x4 + NFT_DATA_VALUE = 0x0 + NFT_DATA_VERDICT = 0xffffff00 + NFTA_DATA_UNSPEC = 0x0 + NFTA_DATA_VALUE = 0x1 + NFTA_DATA_VERDICT = 0x2 + NFTA_VERDICT_UNSPEC = 0x0 + NFTA_VERDICT_CODE = 0x1 + NFTA_VERDICT_CHAIN = 0x2 + NFTA_EXPR_UNSPEC = 0x0 + NFTA_EXPR_NAME = 0x1 + NFTA_EXPR_DATA = 0x2 + NFTA_IMMEDIATE_UNSPEC = 0x0 + NFTA_IMMEDIATE_DREG = 0x1 + NFTA_IMMEDIATE_DATA = 0x2 + NFTA_BITWISE_UNSPEC = 0x0 + NFTA_BITWISE_SREG = 0x1 + NFTA_BITWISE_DREG = 0x2 + NFTA_BITWISE_LEN = 0x3 + NFTA_BITWISE_MASK = 0x4 + NFTA_BITWISE_XOR = 0x5 + NFT_BYTEORDER_NTOH = 0x0 + NFT_BYTEORDER_HTON = 0x1 + NFTA_BYTEORDER_UNSPEC = 0x0 + NFTA_BYTEORDER_SREG = 0x1 + NFTA_BYTEORDER_DREG = 0x2 + NFTA_BYTEORDER_OP = 0x3 + NFTA_BYTEORDER_LEN = 0x4 + NFTA_BYTEORDER_SIZE = 0x5 + NFT_CMP_EQ = 0x0 + NFT_CMP_NEQ = 0x1 + NFT_CMP_LT = 0x2 + NFT_CMP_LTE = 0x3 + NFT_CMP_GT = 0x4 + NFT_CMP_GTE = 0x5 + NFTA_CMP_UNSPEC = 0x0 + NFTA_CMP_SREG = 0x1 + NFTA_CMP_OP = 0x2 + NFTA_CMP_DATA = 0x3 + NFT_RANGE_EQ = 0x0 + NFT_RANGE_NEQ = 0x1 + NFTA_RANGE_UNSPEC = 0x0 + NFTA_RANGE_SREG = 0x1 + NFTA_RANGE_OP = 0x2 + NFTA_RANGE_FROM_DATA = 0x3 + NFTA_RANGE_TO_DATA = 0x4 + NFT_LOOKUP_F_INV = 0x1 + NFTA_LOOKUP_UNSPEC = 0x0 + NFTA_LOOKUP_SET = 0x1 + NFTA_LOOKUP_SREG = 0x2 + NFTA_LOOKUP_DREG = 0x3 + NFTA_LOOKUP_SET_ID = 0x4 + NFTA_LOOKUP_FLAGS = 0x5 + NFT_DYNSET_OP_ADD = 0x0 + NFT_DYNSET_OP_UPDATE = 0x1 + NFT_DYNSET_F_INV = 0x1 + NFTA_DYNSET_UNSPEC = 0x0 + NFTA_DYNSET_SET_NAME = 0x1 + NFTA_DYNSET_SET_ID = 0x2 + NFTA_DYNSET_OP = 0x3 + NFTA_DYNSET_SREG_KEY = 0x4 + NFTA_DYNSET_SREG_DATA = 0x5 + NFTA_DYNSET_TIMEOUT = 0x6 + NFTA_DYNSET_EXPR = 0x7 + NFTA_DYNSET_PAD = 0x8 + NFTA_DYNSET_FLAGS = 0x9 + NFT_PAYLOAD_LL_HEADER = 0x0 + NFT_PAYLOAD_NETWORK_HEADER = 0x1 + NFT_PAYLOAD_TRANSPORT_HEADER = 0x2 + NFT_PAYLOAD_CSUM_NONE = 0x0 + NFT_PAYLOAD_CSUM_INET = 0x1 + NFT_PAYLOAD_L4CSUM_PSEUDOHDR = 0x1 + NFTA_PAYLOAD_UNSPEC = 0x0 + NFTA_PAYLOAD_DREG = 0x1 + NFTA_PAYLOAD_BASE = 0x2 + NFTA_PAYLOAD_OFFSET = 0x3 + NFTA_PAYLOAD_LEN = 0x4 + NFTA_PAYLOAD_SREG = 0x5 + NFTA_PAYLOAD_CSUM_TYPE = 0x6 + NFTA_PAYLOAD_CSUM_OFFSET = 0x7 + NFTA_PAYLOAD_CSUM_FLAGS = 0x8 + NFT_EXTHDR_F_PRESENT = 0x1 + NFT_EXTHDR_OP_IPV6 = 0x0 + NFT_EXTHDR_OP_TCPOPT = 0x1 + NFTA_EXTHDR_UNSPEC = 0x0 + NFTA_EXTHDR_DREG = 0x1 + NFTA_EXTHDR_TYPE = 0x2 + NFTA_EXTHDR_OFFSET = 0x3 + NFTA_EXTHDR_LEN = 0x4 + NFTA_EXTHDR_FLAGS = 0x5 + NFTA_EXTHDR_OP = 0x6 + NFTA_EXTHDR_SREG = 0x7 + NFT_META_LEN = 0x0 + NFT_META_PROTOCOL = 0x1 + NFT_META_PRIORITY = 0x2 + NFT_META_MARK = 0x3 + NFT_META_IIF = 0x4 + NFT_META_OIF = 0x5 + NFT_META_IIFNAME = 0x6 + NFT_META_OIFNAME = 0x7 + NFT_META_IIFTYPE = 0x8 + NFT_META_OIFTYPE = 0x9 + NFT_META_SKUID = 0xa + NFT_META_SKGID = 0xb + NFT_META_NFTRACE = 0xc + NFT_META_RTCLASSID = 0xd + NFT_META_SECMARK = 0xe + NFT_META_NFPROTO = 0xf + NFT_META_L4PROTO = 0x10 + NFT_META_BRI_IIFNAME = 0x11 + NFT_META_BRI_OIFNAME = 0x12 + NFT_META_PKTTYPE = 0x13 + NFT_META_CPU = 0x14 + NFT_META_IIFGROUP = 0x15 + NFT_META_OIFGROUP = 0x16 + NFT_META_CGROUP = 0x17 + NFT_META_PRANDOM = 0x18 + NFT_RT_CLASSID = 0x0 + NFT_RT_NEXTHOP4 = 0x1 + NFT_RT_NEXTHOP6 = 0x2 + NFT_RT_TCPMSS = 0x3 + NFT_HASH_JENKINS = 0x0 + NFT_HASH_SYM = 0x1 + NFTA_HASH_UNSPEC = 0x0 + NFTA_HASH_SREG = 0x1 + NFTA_HASH_DREG = 0x2 + NFTA_HASH_LEN = 0x3 + NFTA_HASH_MODULUS = 0x4 + NFTA_HASH_SEED = 0x5 + NFTA_HASH_OFFSET = 0x6 + NFTA_HASH_TYPE = 0x7 + NFTA_META_UNSPEC = 0x0 + NFTA_META_DREG = 0x1 + NFTA_META_KEY = 0x2 + NFTA_META_SREG = 0x3 + NFTA_RT_UNSPEC = 0x0 + NFTA_RT_DREG = 0x1 + NFTA_RT_KEY = 0x2 + NFT_CT_STATE = 0x0 + NFT_CT_DIRECTION = 0x1 + NFT_CT_STATUS = 0x2 + NFT_CT_MARK = 0x3 + NFT_CT_SECMARK = 0x4 + NFT_CT_EXPIRATION = 0x5 + NFT_CT_HELPER = 0x6 + NFT_CT_L3PROTOCOL = 0x7 + NFT_CT_SRC = 0x8 + NFT_CT_DST = 0x9 + NFT_CT_PROTOCOL = 0xa + NFT_CT_PROTO_SRC = 0xb + NFT_CT_PROTO_DST = 0xc + NFT_CT_LABELS = 0xd + NFT_CT_PKTS = 0xe + NFT_CT_BYTES = 0xf + NFT_CT_AVGPKT = 0x10 + NFT_CT_ZONE = 0x11 + NFT_CT_EVENTMASK = 0x12 + NFTA_CT_UNSPEC = 0x0 + NFTA_CT_DREG = 0x1 + NFTA_CT_KEY = 0x2 + NFTA_CT_DIRECTION = 0x3 + NFTA_CT_SREG = 0x4 + NFT_LIMIT_PKTS = 0x0 + NFT_LIMIT_PKT_BYTES = 0x1 + NFT_LIMIT_F_INV = 0x1 + NFTA_LIMIT_UNSPEC = 0x0 + NFTA_LIMIT_RATE = 0x1 + NFTA_LIMIT_UNIT = 0x2 + NFTA_LIMIT_BURST = 0x3 + NFTA_LIMIT_TYPE = 0x4 + NFTA_LIMIT_FLAGS = 0x5 + NFTA_LIMIT_PAD = 0x6 + NFTA_COUNTER_UNSPEC = 0x0 + NFTA_COUNTER_BYTES = 0x1 + NFTA_COUNTER_PACKETS = 0x2 + NFTA_COUNTER_PAD = 0x3 + NFTA_LOG_UNSPEC = 0x0 + NFTA_LOG_GROUP = 0x1 + NFTA_LOG_PREFIX = 0x2 + NFTA_LOG_SNAPLEN = 0x3 + NFTA_LOG_QTHRESHOLD = 0x4 + NFTA_LOG_LEVEL = 0x5 + NFTA_LOG_FLAGS = 0x6 + NFTA_QUEUE_UNSPEC = 0x0 + NFTA_QUEUE_NUM = 0x1 + NFTA_QUEUE_TOTAL = 0x2 + NFTA_QUEUE_FLAGS = 0x3 + NFTA_QUEUE_SREG_QNUM = 0x4 + NFT_QUOTA_F_INV = 0x1 + NFT_QUOTA_F_DEPLETED = 0x2 + NFTA_QUOTA_UNSPEC = 0x0 + NFTA_QUOTA_BYTES = 0x1 + NFTA_QUOTA_FLAGS = 0x2 + NFTA_QUOTA_PAD = 0x3 + NFTA_QUOTA_CONSUMED = 0x4 + NFT_REJECT_ICMP_UNREACH = 0x0 + NFT_REJECT_TCP_RST = 0x1 + NFT_REJECT_ICMPX_UNREACH = 0x2 + NFT_REJECT_ICMPX_NO_ROUTE = 0x0 + NFT_REJECT_ICMPX_PORT_UNREACH = 0x1 + NFT_REJECT_ICMPX_HOST_UNREACH = 0x2 + NFT_REJECT_ICMPX_ADMIN_PROHIBITED = 0x3 + NFTA_REJECT_UNSPEC = 0x0 + NFTA_REJECT_TYPE = 0x1 + NFTA_REJECT_ICMP_CODE = 0x2 + NFT_NAT_SNAT = 0x0 + NFT_NAT_DNAT = 0x1 + NFTA_NAT_UNSPEC = 0x0 + NFTA_NAT_TYPE = 0x1 + NFTA_NAT_FAMILY = 0x2 + NFTA_NAT_REG_ADDR_MIN = 0x3 + NFTA_NAT_REG_ADDR_MAX = 0x4 + NFTA_NAT_REG_PROTO_MIN = 0x5 + NFTA_NAT_REG_PROTO_MAX = 0x6 + NFTA_NAT_FLAGS = 0x7 + NFTA_MASQ_UNSPEC = 0x0 + NFTA_MASQ_FLAGS = 0x1 + NFTA_MASQ_REG_PROTO_MIN = 0x2 + NFTA_MASQ_REG_PROTO_MAX = 0x3 + NFTA_REDIR_UNSPEC = 0x0 + NFTA_REDIR_REG_PROTO_MIN = 0x1 + NFTA_REDIR_REG_PROTO_MAX = 0x2 + NFTA_REDIR_FLAGS = 0x3 + NFTA_DUP_UNSPEC = 0x0 + NFTA_DUP_SREG_ADDR = 0x1 + NFTA_DUP_SREG_DEV = 0x2 + NFTA_FWD_UNSPEC = 0x0 + NFTA_FWD_SREG_DEV = 0x1 + NFTA_OBJREF_UNSPEC = 0x0 + NFTA_OBJREF_IMM_TYPE = 0x1 + NFTA_OBJREF_IMM_NAME = 0x2 + NFTA_OBJREF_SET_SREG = 0x3 + NFTA_OBJREF_SET_NAME = 0x4 + NFTA_OBJREF_SET_ID = 0x5 + NFTA_GEN_UNSPEC = 0x0 + NFTA_GEN_ID = 0x1 + NFTA_GEN_PROC_PID = 0x2 + NFTA_GEN_PROC_NAME = 0x3 + NFTA_FIB_UNSPEC = 0x0 + NFTA_FIB_DREG = 0x1 + NFTA_FIB_RESULT = 0x2 + NFTA_FIB_FLAGS = 0x3 + NFT_FIB_RESULT_UNSPEC = 0x0 + NFT_FIB_RESULT_OIF = 0x1 + NFT_FIB_RESULT_OIFNAME = 0x2 + NFT_FIB_RESULT_ADDRTYPE = 0x3 + NFTA_FIB_F_SADDR = 0x1 + NFTA_FIB_F_DADDR = 0x2 + NFTA_FIB_F_MARK = 0x4 + NFTA_FIB_F_IIF = 0x8 + NFTA_FIB_F_OIF = 0x10 + NFTA_FIB_F_PRESENT = 0x20 + NFTA_CT_HELPER_UNSPEC = 0x0 + NFTA_CT_HELPER_NAME = 0x1 + NFTA_CT_HELPER_L3PROTO = 0x2 + NFTA_CT_HELPER_L4PROTO = 0x3 + NFTA_OBJ_UNSPEC = 0x0 + NFTA_OBJ_TABLE = 0x1 + NFTA_OBJ_NAME = 0x2 + NFTA_OBJ_TYPE = 0x3 + NFTA_OBJ_DATA = 0x4 + NFTA_OBJ_USE = 0x5 + NFTA_TRACE_UNSPEC = 0x0 + NFTA_TRACE_TABLE = 0x1 + NFTA_TRACE_CHAIN = 0x2 + NFTA_TRACE_RULE_HANDLE = 0x3 + NFTA_TRACE_TYPE = 0x4 + NFTA_TRACE_VERDICT = 0x5 + NFTA_TRACE_ID = 0x6 + NFTA_TRACE_LL_HEADER = 0x7 + NFTA_TRACE_NETWORK_HEADER = 0x8 + NFTA_TRACE_TRANSPORT_HEADER = 0x9 + NFTA_TRACE_IIF = 0xa + NFTA_TRACE_IIFTYPE = 0xb + NFTA_TRACE_OIF = 0xc + NFTA_TRACE_OIFTYPE = 0xd + NFTA_TRACE_MARK = 0xe + NFTA_TRACE_NFPROTO = 0xf + NFTA_TRACE_POLICY = 0x10 + NFTA_TRACE_PAD = 0x11 + NFT_TRACETYPE_UNSPEC = 0x0 + NFT_TRACETYPE_POLICY = 0x1 + NFT_TRACETYPE_RETURN = 0x2 + NFT_TRACETYPE_RULE = 0x3 + NFTA_NG_UNSPEC = 0x0 + NFTA_NG_DREG = 0x1 + NFTA_NG_MODULUS = 0x2 + NFTA_NG_TYPE = 0x3 + NFTA_NG_OFFSET = 0x4 + NFT_NG_INCREMENTAL = 0x0 + NFT_NG_RANDOM = 0x1 +) + +type RTCTime struct { + Sec int32 + Min int32 + Hour int32 + Mday int32 + Mon int32 + Year int32 + Wday int32 + Yday int32 + Isdst int32 +} + +type RTCWkAlrm struct { + Enabled uint8 + Pending uint8 + _ [2]byte + Time RTCTime +} + +type RTCPLLInfo struct { + Ctrl int32 + Value int32 + Max int32 + Min int32 + Posmult int32 + Negmult int32 + Clock int32 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go index cb2701fd2b..712f640295 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64.go @@ -105,7 +105,7 @@ type Stat_t struct { Mode uint32 Uid uint32 Gid uint32 - X__pad2 int32 + _ int32 Rdev uint64 Size int64 Blksize int64 @@ -118,25 +118,10 @@ type Stat_t struct { _ uint64 } -type Statfs_t struct { - Type int64 - Bsize int64 - Blocks uint64 - Bfree uint64 - Bavail uint64 - Files uint64 - Ffree uint64 - Fsid Fsid - Namelen int64 - Frsize int64 - Flags int64 - Spare [4]int64 -} - type StatxTimestamp struct { - Sec int64 - Nsec uint32 - X__reserved int32 + Sec int64 + Nsec uint32 + _ int32 } type Statx_t struct { @@ -173,7 +158,7 @@ type Dirent struct { } type Fsid struct { - X__val [2]int32 + Val [2]int32 } type Flock_t struct { @@ -267,6 +252,13 @@ type RawSockaddrL2 struct { _ [1]byte } +type RawSockaddrRFCOMM struct { + Family uint16 + Bdaddr [6]uint8 + Channel uint8 + _ [1]byte +} + type RawSockaddrCAN struct { Family uint16 _ [2]byte @@ -422,6 +414,7 @@ const ( SizeofSockaddrNetlink = 0xc SizeofSockaddrHCI = 0x6 SizeofSockaddrL2 = 0xe + SizeofSockaddrRFCOMM = 0xa SizeofSockaddrCAN = 0x10 SizeofSockaddrALG = 0x58 SizeofSockaddrVM = 0x10 @@ -442,97 +435,123 @@ const ( ) const ( - IFA_UNSPEC = 0x0 - IFA_ADDRESS = 0x1 - IFA_LOCAL = 0x2 - IFA_LABEL = 0x3 - IFA_BROADCAST = 0x4 - IFA_ANYCAST = 0x5 - IFA_CACHEINFO = 0x6 - IFA_MULTICAST = 0x7 - IFLA_UNSPEC = 0x0 - IFLA_ADDRESS = 0x1 - IFLA_BROADCAST = 0x2 - IFLA_IFNAME = 0x3 - IFLA_MTU = 0x4 - IFLA_LINK = 0x5 - IFLA_QDISC = 0x6 - IFLA_STATS = 0x7 - IFLA_COST = 0x8 - IFLA_PRIORITY = 0x9 - IFLA_MASTER = 0xa - IFLA_WIRELESS = 0xb - IFLA_PROTINFO = 0xc - IFLA_TXQLEN = 0xd - IFLA_MAP = 0xe - IFLA_WEIGHT = 0xf - IFLA_OPERSTATE = 0x10 - IFLA_LINKMODE = 0x11 - IFLA_LINKINFO = 0x12 - IFLA_NET_NS_PID = 0x13 - IFLA_IFALIAS = 0x14 - IFLA_MAX = 0x2c - RT_SCOPE_UNIVERSE = 0x0 - RT_SCOPE_SITE = 0xc8 - RT_SCOPE_LINK = 0xfd - RT_SCOPE_HOST = 0xfe - RT_SCOPE_NOWHERE = 0xff - RT_TABLE_UNSPEC = 0x0 - RT_TABLE_COMPAT = 0xfc - RT_TABLE_DEFAULT = 0xfd - RT_TABLE_MAIN = 0xfe - RT_TABLE_LOCAL = 0xff - RT_TABLE_MAX = 0xffffffff - RTA_UNSPEC = 0x0 - RTA_DST = 0x1 - RTA_SRC = 0x2 - RTA_IIF = 0x3 - RTA_OIF = 0x4 - RTA_GATEWAY = 0x5 - RTA_PRIORITY = 0x6 - RTA_PREFSRC = 0x7 - RTA_METRICS = 0x8 - RTA_MULTIPATH = 0x9 - RTA_FLOW = 0xb - RTA_CACHEINFO = 0xc - RTA_TABLE = 0xf - RTN_UNSPEC = 0x0 - RTN_UNICAST = 0x1 - RTN_LOCAL = 0x2 - RTN_BROADCAST = 0x3 - RTN_ANYCAST = 0x4 - RTN_MULTICAST = 0x5 - RTN_BLACKHOLE = 0x6 - RTN_UNREACHABLE = 0x7 - RTN_PROHIBIT = 0x8 - RTN_THROW = 0x9 - RTN_NAT = 0xa - RTN_XRESOLVE = 0xb - RTNLGRP_NONE = 0x0 - RTNLGRP_LINK = 0x1 - RTNLGRP_NOTIFY = 0x2 - RTNLGRP_NEIGH = 0x3 - RTNLGRP_TC = 0x4 - RTNLGRP_IPV4_IFADDR = 0x5 - RTNLGRP_IPV4_MROUTE = 0x6 - RTNLGRP_IPV4_ROUTE = 0x7 - RTNLGRP_IPV4_RULE = 0x8 - RTNLGRP_IPV6_IFADDR = 0x9 - RTNLGRP_IPV6_MROUTE = 0xa - RTNLGRP_IPV6_ROUTE = 0xb - RTNLGRP_IPV6_IFINFO = 0xc - RTNLGRP_IPV6_PREFIX = 0x12 - RTNLGRP_IPV6_RULE = 0x13 - RTNLGRP_ND_USEROPT = 0x14 - SizeofNlMsghdr = 0x10 - SizeofNlMsgerr = 0x14 - SizeofRtGenmsg = 0x1 - SizeofNlAttr = 0x4 - SizeofRtAttr = 0x4 - SizeofIfInfomsg = 0x10 - SizeofIfAddrmsg = 0x8 - SizeofRtMsg = 0xc - SizeofRtNexthop = 0x8 + IFA_UNSPEC = 0x0 + IFA_ADDRESS = 0x1 + IFA_LOCAL = 0x2 + IFA_LABEL = 0x3 + IFA_BROADCAST = 0x4 + IFA_ANYCAST = 0x5 + IFA_CACHEINFO = 0x6 + IFA_MULTICAST = 0x7 + IFLA_UNSPEC = 0x0 + IFLA_ADDRESS = 0x1 + IFLA_BROADCAST = 0x2 + IFLA_IFNAME = 0x3 + IFLA_MTU = 0x4 + IFLA_LINK = 0x5 + IFLA_QDISC = 0x6 + IFLA_STATS = 0x7 + IFLA_COST = 0x8 + IFLA_PRIORITY = 0x9 + IFLA_MASTER = 0xa + IFLA_WIRELESS = 0xb + IFLA_PROTINFO = 0xc + IFLA_TXQLEN = 0xd + IFLA_MAP = 0xe + IFLA_WEIGHT = 0xf + IFLA_OPERSTATE = 0x10 + IFLA_LINKMODE = 0x11 + IFLA_LINKINFO = 0x12 + IFLA_NET_NS_PID = 0x13 + IFLA_IFALIAS = 0x14 + IFLA_NUM_VF = 0x15 + IFLA_VFINFO_LIST = 0x16 + IFLA_STATS64 = 0x17 + IFLA_VF_PORTS = 0x18 + IFLA_PORT_SELF = 0x19 + IFLA_AF_SPEC = 0x1a + IFLA_GROUP = 0x1b + IFLA_NET_NS_FD = 0x1c + IFLA_EXT_MASK = 0x1d + IFLA_PROMISCUITY = 0x1e + IFLA_NUM_TX_QUEUES = 0x1f + IFLA_NUM_RX_QUEUES = 0x20 + IFLA_CARRIER = 0x21 + IFLA_PHYS_PORT_ID = 0x22 + IFLA_CARRIER_CHANGES = 0x23 + IFLA_PHYS_SWITCH_ID = 0x24 + IFLA_LINK_NETNSID = 0x25 + IFLA_PHYS_PORT_NAME = 0x26 + IFLA_PROTO_DOWN = 0x27 + IFLA_GSO_MAX_SEGS = 0x28 + IFLA_GSO_MAX_SIZE = 0x29 + IFLA_PAD = 0x2a + IFLA_XDP = 0x2b + IFLA_EVENT = 0x2c + IFLA_NEW_NETNSID = 0x2d + IFLA_IF_NETNSID = 0x2e + IFLA_MAX = 0x31 + RT_SCOPE_UNIVERSE = 0x0 + RT_SCOPE_SITE = 0xc8 + RT_SCOPE_LINK = 0xfd + RT_SCOPE_HOST = 0xfe + RT_SCOPE_NOWHERE = 0xff + RT_TABLE_UNSPEC = 0x0 + RT_TABLE_COMPAT = 0xfc + RT_TABLE_DEFAULT = 0xfd + RT_TABLE_MAIN = 0xfe + RT_TABLE_LOCAL = 0xff + RT_TABLE_MAX = 0xffffffff + RTA_UNSPEC = 0x0 + RTA_DST = 0x1 + RTA_SRC = 0x2 + RTA_IIF = 0x3 + RTA_OIF = 0x4 + RTA_GATEWAY = 0x5 + RTA_PRIORITY = 0x6 + RTA_PREFSRC = 0x7 + RTA_METRICS = 0x8 + RTA_MULTIPATH = 0x9 + RTA_FLOW = 0xb + RTA_CACHEINFO = 0xc + RTA_TABLE = 0xf + RTN_UNSPEC = 0x0 + RTN_UNICAST = 0x1 + RTN_LOCAL = 0x2 + RTN_BROADCAST = 0x3 + RTN_ANYCAST = 0x4 + RTN_MULTICAST = 0x5 + RTN_BLACKHOLE = 0x6 + RTN_UNREACHABLE = 0x7 + RTN_PROHIBIT = 0x8 + RTN_THROW = 0x9 + RTN_NAT = 0xa + RTN_XRESOLVE = 0xb + RTNLGRP_NONE = 0x0 + RTNLGRP_LINK = 0x1 + RTNLGRP_NOTIFY = 0x2 + RTNLGRP_NEIGH = 0x3 + RTNLGRP_TC = 0x4 + RTNLGRP_IPV4_IFADDR = 0x5 + RTNLGRP_IPV4_MROUTE = 0x6 + RTNLGRP_IPV4_ROUTE = 0x7 + RTNLGRP_IPV4_RULE = 0x8 + RTNLGRP_IPV6_IFADDR = 0x9 + RTNLGRP_IPV6_MROUTE = 0xa + RTNLGRP_IPV6_ROUTE = 0xb + RTNLGRP_IPV6_IFINFO = 0xc + RTNLGRP_IPV6_PREFIX = 0x12 + RTNLGRP_IPV6_RULE = 0x13 + RTNLGRP_ND_USEROPT = 0x14 + SizeofNlMsghdr = 0x10 + SizeofNlMsgerr = 0x14 + SizeofRtGenmsg = 0x1 + SizeofNlAttr = 0x4 + SizeofRtAttr = 0x4 + SizeofIfInfomsg = 0x10 + SizeofIfAddrmsg = 0x8 + SizeofRtMsg = 0xc + SizeofRtNexthop = 0x8 ) type NlMsghdr struct { @@ -563,12 +582,12 @@ type RtAttr struct { } type IfInfomsg struct { - Family uint8 - X__ifi_pad uint8 - Type uint16 - Index int32 - Flags uint32 - Change uint32 + Family uint8 + _ uint8 + Type uint16 + Index int32 + Flags uint32 + Change uint32 } type IfAddrmsg struct { @@ -660,7 +679,7 @@ type Sysinfo_t struct { Totalhigh uint64 Freehigh uint64 Unit uint32 - X_f [0]uint8 + _ [0]uint8 _ [4]byte } @@ -683,10 +702,10 @@ type Ustat_t struct { } type EpollEvent struct { - Events uint32 - X_padFd int32 - Fd int32 - Pad int32 + Events uint32 + _ int32 + Fd int32 + Pad int32 } const ( @@ -701,6 +720,8 @@ const ( AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x100 + + AT_EACCESS = 0x200 ) type PollFd struct { @@ -720,7 +741,7 @@ const ( ) type Sigset_t struct { - X__val [16]uint64 + Val [16]uint64 } const RNDGETENTCNT = 0x40045200 @@ -876,3 +897,967 @@ const ( BDADDR_LE_PUBLIC = 0x1 BDADDR_LE_RANDOM = 0x2 ) + +type PerfEventAttr struct { + Type uint32 + Size uint32 + Config uint64 + Sample uint64 + Sample_type uint64 + Read_format uint64 + Bits uint64 + Wakeup uint32 + Bp_type uint32 + Ext1 uint64 + Ext2 uint64 + Branch_sample_type uint64 + Sample_regs_user uint64 + Sample_stack_user uint32 + Clockid int32 + Sample_regs_intr uint64 + Aux_watermark uint32 + _ uint32 +} + +type PerfEventMmapPage struct { + Version uint32 + Compat_version uint32 + Lock uint32 + Index uint32 + Offset int64 + Time_enabled uint64 + Time_running uint64 + Capabilities uint64 + Pmc_width uint16 + Time_shift uint16 + Time_mult uint32 + Time_offset uint64 + Time_zero uint64 + Size uint32 + _ [948]uint8 + Data_head uint64 + Data_tail uint64 + Data_offset uint64 + Data_size uint64 + Aux_head uint64 + Aux_tail uint64 + Aux_offset uint64 + Aux_size uint64 +} + +const ( + PerfBitDisabled uint64 = CBitFieldMaskBit0 + PerfBitInherit = CBitFieldMaskBit1 + PerfBitPinned = CBitFieldMaskBit2 + PerfBitExclusive = CBitFieldMaskBit3 + PerfBitExcludeUser = CBitFieldMaskBit4 + PerfBitExcludeKernel = CBitFieldMaskBit5 + PerfBitExcludeHv = CBitFieldMaskBit6 + PerfBitExcludeIdle = CBitFieldMaskBit7 + PerfBitMmap = CBitFieldMaskBit8 + PerfBitComm = CBitFieldMaskBit9 + PerfBitFreq = CBitFieldMaskBit10 + PerfBitInheritStat = CBitFieldMaskBit11 + PerfBitEnableOnExec = CBitFieldMaskBit12 + PerfBitTask = CBitFieldMaskBit13 + PerfBitWatermark = CBitFieldMaskBit14 + PerfBitPreciseIPBit1 = CBitFieldMaskBit15 + PerfBitPreciseIPBit2 = CBitFieldMaskBit16 + PerfBitMmapData = CBitFieldMaskBit17 + PerfBitSampleIDAll = CBitFieldMaskBit18 + PerfBitExcludeHost = CBitFieldMaskBit19 + PerfBitExcludeGuest = CBitFieldMaskBit20 + PerfBitExcludeCallchainKernel = CBitFieldMaskBit21 + PerfBitExcludeCallchainUser = CBitFieldMaskBit22 + PerfBitMmap2 = CBitFieldMaskBit23 + PerfBitCommExec = CBitFieldMaskBit24 + PerfBitUseClockID = CBitFieldMaskBit25 + PerfBitContextSwitch = CBitFieldMaskBit26 +) + +const ( + PERF_TYPE_HARDWARE = 0x0 + PERF_TYPE_SOFTWARE = 0x1 + PERF_TYPE_TRACEPOINT = 0x2 + PERF_TYPE_HW_CACHE = 0x3 + PERF_TYPE_RAW = 0x4 + PERF_TYPE_BREAKPOINT = 0x5 + + PERF_COUNT_HW_CPU_CYCLES = 0x0 + PERF_COUNT_HW_INSTRUCTIONS = 0x1 + PERF_COUNT_HW_CACHE_REFERENCES = 0x2 + PERF_COUNT_HW_CACHE_MISSES = 0x3 + PERF_COUNT_HW_BRANCH_INSTRUCTIONS = 0x4 + PERF_COUNT_HW_BRANCH_MISSES = 0x5 + PERF_COUNT_HW_BUS_CYCLES = 0x6 + PERF_COUNT_HW_STALLED_CYCLES_FRONTEND = 0x7 + PERF_COUNT_HW_STALLED_CYCLES_BACKEND = 0x8 + PERF_COUNT_HW_REF_CPU_CYCLES = 0x9 + + PERF_COUNT_HW_CACHE_L1D = 0x0 + PERF_COUNT_HW_CACHE_L1I = 0x1 + PERF_COUNT_HW_CACHE_LL = 0x2 + PERF_COUNT_HW_CACHE_DTLB = 0x3 + PERF_COUNT_HW_CACHE_ITLB = 0x4 + PERF_COUNT_HW_CACHE_BPU = 0x5 + PERF_COUNT_HW_CACHE_NODE = 0x6 + + PERF_COUNT_HW_CACHE_OP_READ = 0x0 + PERF_COUNT_HW_CACHE_OP_WRITE = 0x1 + PERF_COUNT_HW_CACHE_OP_PREFETCH = 0x2 + + PERF_COUNT_HW_CACHE_RESULT_ACCESS = 0x0 + PERF_COUNT_HW_CACHE_RESULT_MISS = 0x1 + + PERF_COUNT_SW_CPU_CLOCK = 0x0 + PERF_COUNT_SW_TASK_CLOCK = 0x1 + PERF_COUNT_SW_PAGE_FAULTS = 0x2 + PERF_COUNT_SW_CONTEXT_SWITCHES = 0x3 + PERF_COUNT_SW_CPU_MIGRATIONS = 0x4 + PERF_COUNT_SW_PAGE_FAULTS_MIN = 0x5 + PERF_COUNT_SW_PAGE_FAULTS_MAJ = 0x6 + PERF_COUNT_SW_ALIGNMENT_FAULTS = 0x7 + PERF_COUNT_SW_EMULATION_FAULTS = 0x8 + PERF_COUNT_SW_DUMMY = 0x9 + + PERF_SAMPLE_IP = 0x1 + PERF_SAMPLE_TID = 0x2 + PERF_SAMPLE_TIME = 0x4 + PERF_SAMPLE_ADDR = 0x8 + PERF_SAMPLE_READ = 0x10 + PERF_SAMPLE_CALLCHAIN = 0x20 + PERF_SAMPLE_ID = 0x40 + PERF_SAMPLE_CPU = 0x80 + PERF_SAMPLE_PERIOD = 0x100 + PERF_SAMPLE_STREAM_ID = 0x200 + PERF_SAMPLE_RAW = 0x400 + PERF_SAMPLE_BRANCH_STACK = 0x800 + + PERF_SAMPLE_BRANCH_USER = 0x1 + PERF_SAMPLE_BRANCH_KERNEL = 0x2 + PERF_SAMPLE_BRANCH_HV = 0x4 + PERF_SAMPLE_BRANCH_ANY = 0x8 + PERF_SAMPLE_BRANCH_ANY_CALL = 0x10 + PERF_SAMPLE_BRANCH_ANY_RETURN = 0x20 + PERF_SAMPLE_BRANCH_IND_CALL = 0x40 + + PERF_FORMAT_TOTAL_TIME_ENABLED = 0x1 + PERF_FORMAT_TOTAL_TIME_RUNNING = 0x2 + PERF_FORMAT_ID = 0x4 + PERF_FORMAT_GROUP = 0x8 + + PERF_RECORD_MMAP = 0x1 + PERF_RECORD_LOST = 0x2 + PERF_RECORD_COMM = 0x3 + PERF_RECORD_EXIT = 0x4 + PERF_RECORD_THROTTLE = 0x5 + PERF_RECORD_UNTHROTTLE = 0x6 + PERF_RECORD_FORK = 0x7 + PERF_RECORD_READ = 0x8 + PERF_RECORD_SAMPLE = 0x9 + + PERF_CONTEXT_HV = -0x20 + PERF_CONTEXT_KERNEL = -0x80 + PERF_CONTEXT_USER = -0x200 + + PERF_CONTEXT_GUEST = -0x800 + PERF_CONTEXT_GUEST_KERNEL = -0x880 + PERF_CONTEXT_GUEST_USER = -0xa00 + + PERF_FLAG_FD_NO_GROUP = 0x1 + PERF_FLAG_FD_OUTPUT = 0x2 + PERF_FLAG_PID_CGROUP = 0x4 +) + +const ( + CBitFieldMaskBit0 = 0x8000000000000000 + CBitFieldMaskBit1 = 0x4000000000000000 + CBitFieldMaskBit2 = 0x2000000000000000 + CBitFieldMaskBit3 = 0x1000000000000000 + CBitFieldMaskBit4 = 0x800000000000000 + CBitFieldMaskBit5 = 0x400000000000000 + CBitFieldMaskBit6 = 0x200000000000000 + CBitFieldMaskBit7 = 0x100000000000000 + CBitFieldMaskBit8 = 0x80000000000000 + CBitFieldMaskBit9 = 0x40000000000000 + CBitFieldMaskBit10 = 0x20000000000000 + CBitFieldMaskBit11 = 0x10000000000000 + CBitFieldMaskBit12 = 0x8000000000000 + CBitFieldMaskBit13 = 0x4000000000000 + CBitFieldMaskBit14 = 0x2000000000000 + CBitFieldMaskBit15 = 0x1000000000000 + CBitFieldMaskBit16 = 0x800000000000 + CBitFieldMaskBit17 = 0x400000000000 + CBitFieldMaskBit18 = 0x200000000000 + CBitFieldMaskBit19 = 0x100000000000 + CBitFieldMaskBit20 = 0x80000000000 + CBitFieldMaskBit21 = 0x40000000000 + CBitFieldMaskBit22 = 0x20000000000 + CBitFieldMaskBit23 = 0x10000000000 + CBitFieldMaskBit24 = 0x8000000000 + CBitFieldMaskBit25 = 0x4000000000 + CBitFieldMaskBit26 = 0x2000000000 + CBitFieldMaskBit27 = 0x1000000000 + CBitFieldMaskBit28 = 0x800000000 + CBitFieldMaskBit29 = 0x400000000 + CBitFieldMaskBit30 = 0x200000000 + CBitFieldMaskBit31 = 0x100000000 + CBitFieldMaskBit32 = 0x80000000 + CBitFieldMaskBit33 = 0x40000000 + CBitFieldMaskBit34 = 0x20000000 + CBitFieldMaskBit35 = 0x10000000 + CBitFieldMaskBit36 = 0x8000000 + CBitFieldMaskBit37 = 0x4000000 + CBitFieldMaskBit38 = 0x2000000 + CBitFieldMaskBit39 = 0x1000000 + CBitFieldMaskBit40 = 0x800000 + CBitFieldMaskBit41 = 0x400000 + CBitFieldMaskBit42 = 0x200000 + CBitFieldMaskBit43 = 0x100000 + CBitFieldMaskBit44 = 0x80000 + CBitFieldMaskBit45 = 0x40000 + CBitFieldMaskBit46 = 0x20000 + CBitFieldMaskBit47 = 0x10000 + CBitFieldMaskBit48 = 0x8000 + CBitFieldMaskBit49 = 0x4000 + CBitFieldMaskBit50 = 0x2000 + CBitFieldMaskBit51 = 0x1000 + CBitFieldMaskBit52 = 0x800 + CBitFieldMaskBit53 = 0x400 + CBitFieldMaskBit54 = 0x200 + CBitFieldMaskBit55 = 0x100 + CBitFieldMaskBit56 = 0x80 + CBitFieldMaskBit57 = 0x40 + CBitFieldMaskBit58 = 0x20 + CBitFieldMaskBit59 = 0x10 + CBitFieldMaskBit60 = 0x8 + CBitFieldMaskBit61 = 0x4 + CBitFieldMaskBit62 = 0x2 + CBitFieldMaskBit63 = 0x1 +) + +type SockaddrStorage struct { + Family uint16 + _ [118]uint8 + _ uint64 +} + +type TCPMD5Sig struct { + Addr SockaddrStorage + Flags uint8 + Prefixlen uint8 + Keylen uint16 + _ uint32 + Key [80]uint8 +} + +type HDDriveCmdHdr struct { + Command uint8 + Number uint8 + Feature uint8 + Count uint8 +} + +type HDGeometry struct { + Heads uint8 + Sectors uint8 + Cylinders uint16 + _ [4]byte + Start uint64 +} + +type HDDriveID struct { + Config uint16 + Cyls uint16 + Reserved2 uint16 + Heads uint16 + Track_bytes uint16 + Sector_bytes uint16 + Sectors uint16 + Vendor0 uint16 + Vendor1 uint16 + Vendor2 uint16 + Serial_no [20]uint8 + Buf_type uint16 + Buf_size uint16 + Ecc_bytes uint16 + Fw_rev [8]uint8 + Model [40]uint8 + Max_multsect uint8 + Vendor3 uint8 + Dword_io uint16 + Vendor4 uint8 + Capability uint8 + Reserved50 uint16 + Vendor5 uint8 + TPIO uint8 + Vendor6 uint8 + TDMA uint8 + Field_valid uint16 + Cur_cyls uint16 + Cur_heads uint16 + Cur_sectors uint16 + Cur_capacity0 uint16 + Cur_capacity1 uint16 + Multsect uint8 + Multsect_valid uint8 + Lba_capacity uint32 + Dma_1word uint16 + Dma_mword uint16 + Eide_pio_modes uint16 + Eide_dma_min uint16 + Eide_dma_time uint16 + Eide_pio uint16 + Eide_pio_iordy uint16 + Words69_70 [2]uint16 + Words71_74 [4]uint16 + Queue_depth uint16 + Words76_79 [4]uint16 + Major_rev_num uint16 + Minor_rev_num uint16 + Command_set_1 uint16 + Command_set_2 uint16 + Cfsse uint16 + Cfs_enable_1 uint16 + Cfs_enable_2 uint16 + Csf_default uint16 + Dma_ultra uint16 + Trseuc uint16 + TrsEuc uint16 + CurAPMvalues uint16 + Mprc uint16 + Hw_config uint16 + Acoustic uint16 + Msrqs uint16 + Sxfert uint16 + Sal uint16 + Spg uint32 + Lba_capacity_2 uint64 + Words104_125 [22]uint16 + Last_lun uint16 + Word127 uint16 + Dlf uint16 + Csfo uint16 + Words130_155 [26]uint16 + Word156 uint16 + Words157_159 [3]uint16 + Cfa_power uint16 + Words161_175 [15]uint16 + Words176_205 [30]uint16 + Words206_254 [49]uint16 + Integrity_word uint16 +} + +type Statfs_t struct { + Type int64 + Bsize int64 + Blocks uint64 + Bfree uint64 + Bavail uint64 + Files uint64 + Ffree uint64 + Fsid Fsid + Namelen int64 + Frsize int64 + Flags int64 + Spare [4]int64 +} + +const ( + ST_MANDLOCK = 0x40 + ST_NOATIME = 0x400 + ST_NODEV = 0x4 + ST_NODIRATIME = 0x800 + ST_NOEXEC = 0x8 + ST_NOSUID = 0x2 + ST_RDONLY = 0x1 + ST_RELATIME = 0x1000 + ST_SYNCHRONOUS = 0x10 +) + +type TpacketHdr struct { + Status uint64 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Usec uint32 + _ [4]byte +} + +type Tpacket2Hdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Nsec uint32 + Vlan_tci uint16 + Vlan_tpid uint16 + _ [4]uint8 +} + +type Tpacket3Hdr struct { + Next_offset uint32 + Sec uint32 + Nsec uint32 + Snaplen uint32 + Len uint32 + Status uint32 + Mac uint16 + Net uint16 + Hv1 TpacketHdrVariant1 + _ [8]uint8 +} + +type TpacketHdrVariant1 struct { + Rxhash uint32 + Vlan_tci uint32 + Vlan_tpid uint16 + _ uint16 +} + +type TpacketBlockDesc struct { + Version uint32 + To_priv uint32 + Hdr [40]byte +} + +type TpacketReq struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 +} + +type TpacketReq3 struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 + Retire_blk_tov uint32 + Sizeof_priv uint32 + Feature_req_word uint32 +} + +type TpacketStats struct { + Packets uint32 + Drops uint32 +} + +type TpacketStatsV3 struct { + Packets uint32 + Drops uint32 + Freeze_q_cnt uint32 +} + +type TpacketAuxdata struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Vlan_tci uint16 + Vlan_tpid uint16 +} + +const ( + TPACKET_V1 = 0x0 + TPACKET_V2 = 0x1 + TPACKET_V3 = 0x2 +) + +const ( + SizeofTpacketHdr = 0x20 + SizeofTpacket2Hdr = 0x20 + SizeofTpacket3Hdr = 0x30 +) + +const ( + NF_INET_PRE_ROUTING = 0x0 + NF_INET_LOCAL_IN = 0x1 + NF_INET_FORWARD = 0x2 + NF_INET_LOCAL_OUT = 0x3 + NF_INET_POST_ROUTING = 0x4 + NF_INET_NUMHOOKS = 0x5 +) + +const ( + NF_NETDEV_INGRESS = 0x0 + NF_NETDEV_NUMHOOKS = 0x1 +) + +const ( + NFPROTO_UNSPEC = 0x0 + NFPROTO_INET = 0x1 + NFPROTO_IPV4 = 0x2 + NFPROTO_ARP = 0x3 + NFPROTO_NETDEV = 0x5 + NFPROTO_BRIDGE = 0x7 + NFPROTO_IPV6 = 0xa + NFPROTO_DECNET = 0xc + NFPROTO_NUMPROTO = 0xd +) + +type Nfgenmsg struct { + Nfgen_family uint8 + Version uint8 + Res_id uint16 +} + +const ( + NFNL_BATCH_UNSPEC = 0x0 + NFNL_BATCH_GENID = 0x1 +) + +const ( + NFT_REG_VERDICT = 0x0 + NFT_REG_1 = 0x1 + NFT_REG_2 = 0x2 + NFT_REG_3 = 0x3 + NFT_REG_4 = 0x4 + NFT_REG32_00 = 0x8 + NFT_REG32_01 = 0x9 + NFT_REG32_02 = 0xa + NFT_REG32_03 = 0xb + NFT_REG32_04 = 0xc + NFT_REG32_05 = 0xd + NFT_REG32_06 = 0xe + NFT_REG32_07 = 0xf + NFT_REG32_08 = 0x10 + NFT_REG32_09 = 0x11 + NFT_REG32_10 = 0x12 + NFT_REG32_11 = 0x13 + NFT_REG32_12 = 0x14 + NFT_REG32_13 = 0x15 + NFT_REG32_14 = 0x16 + NFT_REG32_15 = 0x17 + NFT_CONTINUE = -0x1 + NFT_BREAK = -0x2 + NFT_JUMP = -0x3 + NFT_GOTO = -0x4 + NFT_RETURN = -0x5 + NFT_MSG_NEWTABLE = 0x0 + NFT_MSG_GETTABLE = 0x1 + NFT_MSG_DELTABLE = 0x2 + NFT_MSG_NEWCHAIN = 0x3 + NFT_MSG_GETCHAIN = 0x4 + NFT_MSG_DELCHAIN = 0x5 + NFT_MSG_NEWRULE = 0x6 + NFT_MSG_GETRULE = 0x7 + NFT_MSG_DELRULE = 0x8 + NFT_MSG_NEWSET = 0x9 + NFT_MSG_GETSET = 0xa + NFT_MSG_DELSET = 0xb + NFT_MSG_NEWSETELEM = 0xc + NFT_MSG_GETSETELEM = 0xd + NFT_MSG_DELSETELEM = 0xe + NFT_MSG_NEWGEN = 0xf + NFT_MSG_GETGEN = 0x10 + NFT_MSG_TRACE = 0x11 + NFT_MSG_NEWOBJ = 0x12 + NFT_MSG_GETOBJ = 0x13 + NFT_MSG_DELOBJ = 0x14 + NFT_MSG_GETOBJ_RESET = 0x15 + NFT_MSG_MAX = 0x19 + NFTA_LIST_UNPEC = 0x0 + NFTA_LIST_ELEM = 0x1 + NFTA_HOOK_UNSPEC = 0x0 + NFTA_HOOK_HOOKNUM = 0x1 + NFTA_HOOK_PRIORITY = 0x2 + NFTA_HOOK_DEV = 0x3 + NFT_TABLE_F_DORMANT = 0x1 + NFTA_TABLE_UNSPEC = 0x0 + NFTA_TABLE_NAME = 0x1 + NFTA_TABLE_FLAGS = 0x2 + NFTA_TABLE_USE = 0x3 + NFTA_CHAIN_UNSPEC = 0x0 + NFTA_CHAIN_TABLE = 0x1 + NFTA_CHAIN_HANDLE = 0x2 + NFTA_CHAIN_NAME = 0x3 + NFTA_CHAIN_HOOK = 0x4 + NFTA_CHAIN_POLICY = 0x5 + NFTA_CHAIN_USE = 0x6 + NFTA_CHAIN_TYPE = 0x7 + NFTA_CHAIN_COUNTERS = 0x8 + NFTA_CHAIN_PAD = 0x9 + NFTA_RULE_UNSPEC = 0x0 + NFTA_RULE_TABLE = 0x1 + NFTA_RULE_CHAIN = 0x2 + NFTA_RULE_HANDLE = 0x3 + NFTA_RULE_EXPRESSIONS = 0x4 + NFTA_RULE_COMPAT = 0x5 + NFTA_RULE_POSITION = 0x6 + NFTA_RULE_USERDATA = 0x7 + NFTA_RULE_PAD = 0x8 + NFTA_RULE_ID = 0x9 + NFT_RULE_COMPAT_F_INV = 0x2 + NFT_RULE_COMPAT_F_MASK = 0x2 + NFTA_RULE_COMPAT_UNSPEC = 0x0 + NFTA_RULE_COMPAT_PROTO = 0x1 + NFTA_RULE_COMPAT_FLAGS = 0x2 + NFT_SET_ANONYMOUS = 0x1 + NFT_SET_CONSTANT = 0x2 + NFT_SET_INTERVAL = 0x4 + NFT_SET_MAP = 0x8 + NFT_SET_TIMEOUT = 0x10 + NFT_SET_EVAL = 0x20 + NFT_SET_OBJECT = 0x40 + NFT_SET_POL_PERFORMANCE = 0x0 + NFT_SET_POL_MEMORY = 0x1 + NFTA_SET_DESC_UNSPEC = 0x0 + NFTA_SET_DESC_SIZE = 0x1 + NFTA_SET_UNSPEC = 0x0 + NFTA_SET_TABLE = 0x1 + NFTA_SET_NAME = 0x2 + NFTA_SET_FLAGS = 0x3 + NFTA_SET_KEY_TYPE = 0x4 + NFTA_SET_KEY_LEN = 0x5 + NFTA_SET_DATA_TYPE = 0x6 + NFTA_SET_DATA_LEN = 0x7 + NFTA_SET_POLICY = 0x8 + NFTA_SET_DESC = 0x9 + NFTA_SET_ID = 0xa + NFTA_SET_TIMEOUT = 0xb + NFTA_SET_GC_INTERVAL = 0xc + NFTA_SET_USERDATA = 0xd + NFTA_SET_PAD = 0xe + NFTA_SET_OBJ_TYPE = 0xf + NFT_SET_ELEM_INTERVAL_END = 0x1 + NFTA_SET_ELEM_UNSPEC = 0x0 + NFTA_SET_ELEM_KEY = 0x1 + NFTA_SET_ELEM_DATA = 0x2 + NFTA_SET_ELEM_FLAGS = 0x3 + NFTA_SET_ELEM_TIMEOUT = 0x4 + NFTA_SET_ELEM_EXPIRATION = 0x5 + NFTA_SET_ELEM_USERDATA = 0x6 + NFTA_SET_ELEM_EXPR = 0x7 + NFTA_SET_ELEM_PAD = 0x8 + NFTA_SET_ELEM_OBJREF = 0x9 + NFTA_SET_ELEM_LIST_UNSPEC = 0x0 + NFTA_SET_ELEM_LIST_TABLE = 0x1 + NFTA_SET_ELEM_LIST_SET = 0x2 + NFTA_SET_ELEM_LIST_ELEMENTS = 0x3 + NFTA_SET_ELEM_LIST_SET_ID = 0x4 + NFT_DATA_VALUE = 0x0 + NFT_DATA_VERDICT = 0xffffff00 + NFTA_DATA_UNSPEC = 0x0 + NFTA_DATA_VALUE = 0x1 + NFTA_DATA_VERDICT = 0x2 + NFTA_VERDICT_UNSPEC = 0x0 + NFTA_VERDICT_CODE = 0x1 + NFTA_VERDICT_CHAIN = 0x2 + NFTA_EXPR_UNSPEC = 0x0 + NFTA_EXPR_NAME = 0x1 + NFTA_EXPR_DATA = 0x2 + NFTA_IMMEDIATE_UNSPEC = 0x0 + NFTA_IMMEDIATE_DREG = 0x1 + NFTA_IMMEDIATE_DATA = 0x2 + NFTA_BITWISE_UNSPEC = 0x0 + NFTA_BITWISE_SREG = 0x1 + NFTA_BITWISE_DREG = 0x2 + NFTA_BITWISE_LEN = 0x3 + NFTA_BITWISE_MASK = 0x4 + NFTA_BITWISE_XOR = 0x5 + NFT_BYTEORDER_NTOH = 0x0 + NFT_BYTEORDER_HTON = 0x1 + NFTA_BYTEORDER_UNSPEC = 0x0 + NFTA_BYTEORDER_SREG = 0x1 + NFTA_BYTEORDER_DREG = 0x2 + NFTA_BYTEORDER_OP = 0x3 + NFTA_BYTEORDER_LEN = 0x4 + NFTA_BYTEORDER_SIZE = 0x5 + NFT_CMP_EQ = 0x0 + NFT_CMP_NEQ = 0x1 + NFT_CMP_LT = 0x2 + NFT_CMP_LTE = 0x3 + NFT_CMP_GT = 0x4 + NFT_CMP_GTE = 0x5 + NFTA_CMP_UNSPEC = 0x0 + NFTA_CMP_SREG = 0x1 + NFTA_CMP_OP = 0x2 + NFTA_CMP_DATA = 0x3 + NFT_RANGE_EQ = 0x0 + NFT_RANGE_NEQ = 0x1 + NFTA_RANGE_UNSPEC = 0x0 + NFTA_RANGE_SREG = 0x1 + NFTA_RANGE_OP = 0x2 + NFTA_RANGE_FROM_DATA = 0x3 + NFTA_RANGE_TO_DATA = 0x4 + NFT_LOOKUP_F_INV = 0x1 + NFTA_LOOKUP_UNSPEC = 0x0 + NFTA_LOOKUP_SET = 0x1 + NFTA_LOOKUP_SREG = 0x2 + NFTA_LOOKUP_DREG = 0x3 + NFTA_LOOKUP_SET_ID = 0x4 + NFTA_LOOKUP_FLAGS = 0x5 + NFT_DYNSET_OP_ADD = 0x0 + NFT_DYNSET_OP_UPDATE = 0x1 + NFT_DYNSET_F_INV = 0x1 + NFTA_DYNSET_UNSPEC = 0x0 + NFTA_DYNSET_SET_NAME = 0x1 + NFTA_DYNSET_SET_ID = 0x2 + NFTA_DYNSET_OP = 0x3 + NFTA_DYNSET_SREG_KEY = 0x4 + NFTA_DYNSET_SREG_DATA = 0x5 + NFTA_DYNSET_TIMEOUT = 0x6 + NFTA_DYNSET_EXPR = 0x7 + NFTA_DYNSET_PAD = 0x8 + NFTA_DYNSET_FLAGS = 0x9 + NFT_PAYLOAD_LL_HEADER = 0x0 + NFT_PAYLOAD_NETWORK_HEADER = 0x1 + NFT_PAYLOAD_TRANSPORT_HEADER = 0x2 + NFT_PAYLOAD_CSUM_NONE = 0x0 + NFT_PAYLOAD_CSUM_INET = 0x1 + NFT_PAYLOAD_L4CSUM_PSEUDOHDR = 0x1 + NFTA_PAYLOAD_UNSPEC = 0x0 + NFTA_PAYLOAD_DREG = 0x1 + NFTA_PAYLOAD_BASE = 0x2 + NFTA_PAYLOAD_OFFSET = 0x3 + NFTA_PAYLOAD_LEN = 0x4 + NFTA_PAYLOAD_SREG = 0x5 + NFTA_PAYLOAD_CSUM_TYPE = 0x6 + NFTA_PAYLOAD_CSUM_OFFSET = 0x7 + NFTA_PAYLOAD_CSUM_FLAGS = 0x8 + NFT_EXTHDR_F_PRESENT = 0x1 + NFT_EXTHDR_OP_IPV6 = 0x0 + NFT_EXTHDR_OP_TCPOPT = 0x1 + NFTA_EXTHDR_UNSPEC = 0x0 + NFTA_EXTHDR_DREG = 0x1 + NFTA_EXTHDR_TYPE = 0x2 + NFTA_EXTHDR_OFFSET = 0x3 + NFTA_EXTHDR_LEN = 0x4 + NFTA_EXTHDR_FLAGS = 0x5 + NFTA_EXTHDR_OP = 0x6 + NFTA_EXTHDR_SREG = 0x7 + NFT_META_LEN = 0x0 + NFT_META_PROTOCOL = 0x1 + NFT_META_PRIORITY = 0x2 + NFT_META_MARK = 0x3 + NFT_META_IIF = 0x4 + NFT_META_OIF = 0x5 + NFT_META_IIFNAME = 0x6 + NFT_META_OIFNAME = 0x7 + NFT_META_IIFTYPE = 0x8 + NFT_META_OIFTYPE = 0x9 + NFT_META_SKUID = 0xa + NFT_META_SKGID = 0xb + NFT_META_NFTRACE = 0xc + NFT_META_RTCLASSID = 0xd + NFT_META_SECMARK = 0xe + NFT_META_NFPROTO = 0xf + NFT_META_L4PROTO = 0x10 + NFT_META_BRI_IIFNAME = 0x11 + NFT_META_BRI_OIFNAME = 0x12 + NFT_META_PKTTYPE = 0x13 + NFT_META_CPU = 0x14 + NFT_META_IIFGROUP = 0x15 + NFT_META_OIFGROUP = 0x16 + NFT_META_CGROUP = 0x17 + NFT_META_PRANDOM = 0x18 + NFT_RT_CLASSID = 0x0 + NFT_RT_NEXTHOP4 = 0x1 + NFT_RT_NEXTHOP6 = 0x2 + NFT_RT_TCPMSS = 0x3 + NFT_HASH_JENKINS = 0x0 + NFT_HASH_SYM = 0x1 + NFTA_HASH_UNSPEC = 0x0 + NFTA_HASH_SREG = 0x1 + NFTA_HASH_DREG = 0x2 + NFTA_HASH_LEN = 0x3 + NFTA_HASH_MODULUS = 0x4 + NFTA_HASH_SEED = 0x5 + NFTA_HASH_OFFSET = 0x6 + NFTA_HASH_TYPE = 0x7 + NFTA_META_UNSPEC = 0x0 + NFTA_META_DREG = 0x1 + NFTA_META_KEY = 0x2 + NFTA_META_SREG = 0x3 + NFTA_RT_UNSPEC = 0x0 + NFTA_RT_DREG = 0x1 + NFTA_RT_KEY = 0x2 + NFT_CT_STATE = 0x0 + NFT_CT_DIRECTION = 0x1 + NFT_CT_STATUS = 0x2 + NFT_CT_MARK = 0x3 + NFT_CT_SECMARK = 0x4 + NFT_CT_EXPIRATION = 0x5 + NFT_CT_HELPER = 0x6 + NFT_CT_L3PROTOCOL = 0x7 + NFT_CT_SRC = 0x8 + NFT_CT_DST = 0x9 + NFT_CT_PROTOCOL = 0xa + NFT_CT_PROTO_SRC = 0xb + NFT_CT_PROTO_DST = 0xc + NFT_CT_LABELS = 0xd + NFT_CT_PKTS = 0xe + NFT_CT_BYTES = 0xf + NFT_CT_AVGPKT = 0x10 + NFT_CT_ZONE = 0x11 + NFT_CT_EVENTMASK = 0x12 + NFTA_CT_UNSPEC = 0x0 + NFTA_CT_DREG = 0x1 + NFTA_CT_KEY = 0x2 + NFTA_CT_DIRECTION = 0x3 + NFTA_CT_SREG = 0x4 + NFT_LIMIT_PKTS = 0x0 + NFT_LIMIT_PKT_BYTES = 0x1 + NFT_LIMIT_F_INV = 0x1 + NFTA_LIMIT_UNSPEC = 0x0 + NFTA_LIMIT_RATE = 0x1 + NFTA_LIMIT_UNIT = 0x2 + NFTA_LIMIT_BURST = 0x3 + NFTA_LIMIT_TYPE = 0x4 + NFTA_LIMIT_FLAGS = 0x5 + NFTA_LIMIT_PAD = 0x6 + NFTA_COUNTER_UNSPEC = 0x0 + NFTA_COUNTER_BYTES = 0x1 + NFTA_COUNTER_PACKETS = 0x2 + NFTA_COUNTER_PAD = 0x3 + NFTA_LOG_UNSPEC = 0x0 + NFTA_LOG_GROUP = 0x1 + NFTA_LOG_PREFIX = 0x2 + NFTA_LOG_SNAPLEN = 0x3 + NFTA_LOG_QTHRESHOLD = 0x4 + NFTA_LOG_LEVEL = 0x5 + NFTA_LOG_FLAGS = 0x6 + NFTA_QUEUE_UNSPEC = 0x0 + NFTA_QUEUE_NUM = 0x1 + NFTA_QUEUE_TOTAL = 0x2 + NFTA_QUEUE_FLAGS = 0x3 + NFTA_QUEUE_SREG_QNUM = 0x4 + NFT_QUOTA_F_INV = 0x1 + NFT_QUOTA_F_DEPLETED = 0x2 + NFTA_QUOTA_UNSPEC = 0x0 + NFTA_QUOTA_BYTES = 0x1 + NFTA_QUOTA_FLAGS = 0x2 + NFTA_QUOTA_PAD = 0x3 + NFTA_QUOTA_CONSUMED = 0x4 + NFT_REJECT_ICMP_UNREACH = 0x0 + NFT_REJECT_TCP_RST = 0x1 + NFT_REJECT_ICMPX_UNREACH = 0x2 + NFT_REJECT_ICMPX_NO_ROUTE = 0x0 + NFT_REJECT_ICMPX_PORT_UNREACH = 0x1 + NFT_REJECT_ICMPX_HOST_UNREACH = 0x2 + NFT_REJECT_ICMPX_ADMIN_PROHIBITED = 0x3 + NFTA_REJECT_UNSPEC = 0x0 + NFTA_REJECT_TYPE = 0x1 + NFTA_REJECT_ICMP_CODE = 0x2 + NFT_NAT_SNAT = 0x0 + NFT_NAT_DNAT = 0x1 + NFTA_NAT_UNSPEC = 0x0 + NFTA_NAT_TYPE = 0x1 + NFTA_NAT_FAMILY = 0x2 + NFTA_NAT_REG_ADDR_MIN = 0x3 + NFTA_NAT_REG_ADDR_MAX = 0x4 + NFTA_NAT_REG_PROTO_MIN = 0x5 + NFTA_NAT_REG_PROTO_MAX = 0x6 + NFTA_NAT_FLAGS = 0x7 + NFTA_MASQ_UNSPEC = 0x0 + NFTA_MASQ_FLAGS = 0x1 + NFTA_MASQ_REG_PROTO_MIN = 0x2 + NFTA_MASQ_REG_PROTO_MAX = 0x3 + NFTA_REDIR_UNSPEC = 0x0 + NFTA_REDIR_REG_PROTO_MIN = 0x1 + NFTA_REDIR_REG_PROTO_MAX = 0x2 + NFTA_REDIR_FLAGS = 0x3 + NFTA_DUP_UNSPEC = 0x0 + NFTA_DUP_SREG_ADDR = 0x1 + NFTA_DUP_SREG_DEV = 0x2 + NFTA_FWD_UNSPEC = 0x0 + NFTA_FWD_SREG_DEV = 0x1 + NFTA_OBJREF_UNSPEC = 0x0 + NFTA_OBJREF_IMM_TYPE = 0x1 + NFTA_OBJREF_IMM_NAME = 0x2 + NFTA_OBJREF_SET_SREG = 0x3 + NFTA_OBJREF_SET_NAME = 0x4 + NFTA_OBJREF_SET_ID = 0x5 + NFTA_GEN_UNSPEC = 0x0 + NFTA_GEN_ID = 0x1 + NFTA_GEN_PROC_PID = 0x2 + NFTA_GEN_PROC_NAME = 0x3 + NFTA_FIB_UNSPEC = 0x0 + NFTA_FIB_DREG = 0x1 + NFTA_FIB_RESULT = 0x2 + NFTA_FIB_FLAGS = 0x3 + NFT_FIB_RESULT_UNSPEC = 0x0 + NFT_FIB_RESULT_OIF = 0x1 + NFT_FIB_RESULT_OIFNAME = 0x2 + NFT_FIB_RESULT_ADDRTYPE = 0x3 + NFTA_FIB_F_SADDR = 0x1 + NFTA_FIB_F_DADDR = 0x2 + NFTA_FIB_F_MARK = 0x4 + NFTA_FIB_F_IIF = 0x8 + NFTA_FIB_F_OIF = 0x10 + NFTA_FIB_F_PRESENT = 0x20 + NFTA_CT_HELPER_UNSPEC = 0x0 + NFTA_CT_HELPER_NAME = 0x1 + NFTA_CT_HELPER_L3PROTO = 0x2 + NFTA_CT_HELPER_L4PROTO = 0x3 + NFTA_OBJ_UNSPEC = 0x0 + NFTA_OBJ_TABLE = 0x1 + NFTA_OBJ_NAME = 0x2 + NFTA_OBJ_TYPE = 0x3 + NFTA_OBJ_DATA = 0x4 + NFTA_OBJ_USE = 0x5 + NFTA_TRACE_UNSPEC = 0x0 + NFTA_TRACE_TABLE = 0x1 + NFTA_TRACE_CHAIN = 0x2 + NFTA_TRACE_RULE_HANDLE = 0x3 + NFTA_TRACE_TYPE = 0x4 + NFTA_TRACE_VERDICT = 0x5 + NFTA_TRACE_ID = 0x6 + NFTA_TRACE_LL_HEADER = 0x7 + NFTA_TRACE_NETWORK_HEADER = 0x8 + NFTA_TRACE_TRANSPORT_HEADER = 0x9 + NFTA_TRACE_IIF = 0xa + NFTA_TRACE_IIFTYPE = 0xb + NFTA_TRACE_OIF = 0xc + NFTA_TRACE_OIFTYPE = 0xd + NFTA_TRACE_MARK = 0xe + NFTA_TRACE_NFPROTO = 0xf + NFTA_TRACE_POLICY = 0x10 + NFTA_TRACE_PAD = 0x11 + NFT_TRACETYPE_UNSPEC = 0x0 + NFT_TRACETYPE_POLICY = 0x1 + NFT_TRACETYPE_RETURN = 0x2 + NFT_TRACETYPE_RULE = 0x3 + NFTA_NG_UNSPEC = 0x0 + NFTA_NG_DREG = 0x1 + NFTA_NG_MODULUS = 0x2 + NFTA_NG_TYPE = 0x3 + NFTA_NG_OFFSET = 0x4 + NFT_NG_INCREMENTAL = 0x0 + NFT_NG_RANDOM = 0x1 +) + +type RTCTime struct { + Sec int32 + Min int32 + Hour int32 + Mday int32 + Mon int32 + Year int32 + Wday int32 + Yday int32 + Isdst int32 +} + +type RTCWkAlrm struct { + Enabled uint8 + Pending uint8 + _ [2]byte + Time RTCTime +} + +type RTCPLLInfo struct { + Ctrl int32 + Value int32 + Max int32 + Min int32 + Posmult int32 + Negmult int32 + Clock int64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go index fa5b15be0f..1be45320ab 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_ppc64le.go @@ -105,7 +105,7 @@ type Stat_t struct { Mode uint32 Uid uint32 Gid uint32 - X__pad2 int32 + _ int32 Rdev uint64 Size int64 Blksize int64 @@ -118,25 +118,10 @@ type Stat_t struct { _ uint64 } -type Statfs_t struct { - Type int64 - Bsize int64 - Blocks uint64 - Bfree uint64 - Bavail uint64 - Files uint64 - Ffree uint64 - Fsid Fsid - Namelen int64 - Frsize int64 - Flags int64 - Spare [4]int64 -} - type StatxTimestamp struct { - Sec int64 - Nsec uint32 - X__reserved int32 + Sec int64 + Nsec uint32 + _ int32 } type Statx_t struct { @@ -173,7 +158,7 @@ type Dirent struct { } type Fsid struct { - X__val [2]int32 + Val [2]int32 } type Flock_t struct { @@ -267,6 +252,13 @@ type RawSockaddrL2 struct { _ [1]byte } +type RawSockaddrRFCOMM struct { + Family uint16 + Bdaddr [6]uint8 + Channel uint8 + _ [1]byte +} + type RawSockaddrCAN struct { Family uint16 _ [2]byte @@ -422,6 +414,7 @@ const ( SizeofSockaddrNetlink = 0xc SizeofSockaddrHCI = 0x6 SizeofSockaddrL2 = 0xe + SizeofSockaddrRFCOMM = 0xa SizeofSockaddrCAN = 0x10 SizeofSockaddrALG = 0x58 SizeofSockaddrVM = 0x10 @@ -442,97 +435,123 @@ const ( ) const ( - IFA_UNSPEC = 0x0 - IFA_ADDRESS = 0x1 - IFA_LOCAL = 0x2 - IFA_LABEL = 0x3 - IFA_BROADCAST = 0x4 - IFA_ANYCAST = 0x5 - IFA_CACHEINFO = 0x6 - IFA_MULTICAST = 0x7 - IFLA_UNSPEC = 0x0 - IFLA_ADDRESS = 0x1 - IFLA_BROADCAST = 0x2 - IFLA_IFNAME = 0x3 - IFLA_MTU = 0x4 - IFLA_LINK = 0x5 - IFLA_QDISC = 0x6 - IFLA_STATS = 0x7 - IFLA_COST = 0x8 - IFLA_PRIORITY = 0x9 - IFLA_MASTER = 0xa - IFLA_WIRELESS = 0xb - IFLA_PROTINFO = 0xc - IFLA_TXQLEN = 0xd - IFLA_MAP = 0xe - IFLA_WEIGHT = 0xf - IFLA_OPERSTATE = 0x10 - IFLA_LINKMODE = 0x11 - IFLA_LINKINFO = 0x12 - IFLA_NET_NS_PID = 0x13 - IFLA_IFALIAS = 0x14 - IFLA_MAX = 0x2c - RT_SCOPE_UNIVERSE = 0x0 - RT_SCOPE_SITE = 0xc8 - RT_SCOPE_LINK = 0xfd - RT_SCOPE_HOST = 0xfe - RT_SCOPE_NOWHERE = 0xff - RT_TABLE_UNSPEC = 0x0 - RT_TABLE_COMPAT = 0xfc - RT_TABLE_DEFAULT = 0xfd - RT_TABLE_MAIN = 0xfe - RT_TABLE_LOCAL = 0xff - RT_TABLE_MAX = 0xffffffff - RTA_UNSPEC = 0x0 - RTA_DST = 0x1 - RTA_SRC = 0x2 - RTA_IIF = 0x3 - RTA_OIF = 0x4 - RTA_GATEWAY = 0x5 - RTA_PRIORITY = 0x6 - RTA_PREFSRC = 0x7 - RTA_METRICS = 0x8 - RTA_MULTIPATH = 0x9 - RTA_FLOW = 0xb - RTA_CACHEINFO = 0xc - RTA_TABLE = 0xf - RTN_UNSPEC = 0x0 - RTN_UNICAST = 0x1 - RTN_LOCAL = 0x2 - RTN_BROADCAST = 0x3 - RTN_ANYCAST = 0x4 - RTN_MULTICAST = 0x5 - RTN_BLACKHOLE = 0x6 - RTN_UNREACHABLE = 0x7 - RTN_PROHIBIT = 0x8 - RTN_THROW = 0x9 - RTN_NAT = 0xa - RTN_XRESOLVE = 0xb - RTNLGRP_NONE = 0x0 - RTNLGRP_LINK = 0x1 - RTNLGRP_NOTIFY = 0x2 - RTNLGRP_NEIGH = 0x3 - RTNLGRP_TC = 0x4 - RTNLGRP_IPV4_IFADDR = 0x5 - RTNLGRP_IPV4_MROUTE = 0x6 - RTNLGRP_IPV4_ROUTE = 0x7 - RTNLGRP_IPV4_RULE = 0x8 - RTNLGRP_IPV6_IFADDR = 0x9 - RTNLGRP_IPV6_MROUTE = 0xa - RTNLGRP_IPV6_ROUTE = 0xb - RTNLGRP_IPV6_IFINFO = 0xc - RTNLGRP_IPV6_PREFIX = 0x12 - RTNLGRP_IPV6_RULE = 0x13 - RTNLGRP_ND_USEROPT = 0x14 - SizeofNlMsghdr = 0x10 - SizeofNlMsgerr = 0x14 - SizeofRtGenmsg = 0x1 - SizeofNlAttr = 0x4 - SizeofRtAttr = 0x4 - SizeofIfInfomsg = 0x10 - SizeofIfAddrmsg = 0x8 - SizeofRtMsg = 0xc - SizeofRtNexthop = 0x8 + IFA_UNSPEC = 0x0 + IFA_ADDRESS = 0x1 + IFA_LOCAL = 0x2 + IFA_LABEL = 0x3 + IFA_BROADCAST = 0x4 + IFA_ANYCAST = 0x5 + IFA_CACHEINFO = 0x6 + IFA_MULTICAST = 0x7 + IFLA_UNSPEC = 0x0 + IFLA_ADDRESS = 0x1 + IFLA_BROADCAST = 0x2 + IFLA_IFNAME = 0x3 + IFLA_MTU = 0x4 + IFLA_LINK = 0x5 + IFLA_QDISC = 0x6 + IFLA_STATS = 0x7 + IFLA_COST = 0x8 + IFLA_PRIORITY = 0x9 + IFLA_MASTER = 0xa + IFLA_WIRELESS = 0xb + IFLA_PROTINFO = 0xc + IFLA_TXQLEN = 0xd + IFLA_MAP = 0xe + IFLA_WEIGHT = 0xf + IFLA_OPERSTATE = 0x10 + IFLA_LINKMODE = 0x11 + IFLA_LINKINFO = 0x12 + IFLA_NET_NS_PID = 0x13 + IFLA_IFALIAS = 0x14 + IFLA_NUM_VF = 0x15 + IFLA_VFINFO_LIST = 0x16 + IFLA_STATS64 = 0x17 + IFLA_VF_PORTS = 0x18 + IFLA_PORT_SELF = 0x19 + IFLA_AF_SPEC = 0x1a + IFLA_GROUP = 0x1b + IFLA_NET_NS_FD = 0x1c + IFLA_EXT_MASK = 0x1d + IFLA_PROMISCUITY = 0x1e + IFLA_NUM_TX_QUEUES = 0x1f + IFLA_NUM_RX_QUEUES = 0x20 + IFLA_CARRIER = 0x21 + IFLA_PHYS_PORT_ID = 0x22 + IFLA_CARRIER_CHANGES = 0x23 + IFLA_PHYS_SWITCH_ID = 0x24 + IFLA_LINK_NETNSID = 0x25 + IFLA_PHYS_PORT_NAME = 0x26 + IFLA_PROTO_DOWN = 0x27 + IFLA_GSO_MAX_SEGS = 0x28 + IFLA_GSO_MAX_SIZE = 0x29 + IFLA_PAD = 0x2a + IFLA_XDP = 0x2b + IFLA_EVENT = 0x2c + IFLA_NEW_NETNSID = 0x2d + IFLA_IF_NETNSID = 0x2e + IFLA_MAX = 0x31 + RT_SCOPE_UNIVERSE = 0x0 + RT_SCOPE_SITE = 0xc8 + RT_SCOPE_LINK = 0xfd + RT_SCOPE_HOST = 0xfe + RT_SCOPE_NOWHERE = 0xff + RT_TABLE_UNSPEC = 0x0 + RT_TABLE_COMPAT = 0xfc + RT_TABLE_DEFAULT = 0xfd + RT_TABLE_MAIN = 0xfe + RT_TABLE_LOCAL = 0xff + RT_TABLE_MAX = 0xffffffff + RTA_UNSPEC = 0x0 + RTA_DST = 0x1 + RTA_SRC = 0x2 + RTA_IIF = 0x3 + RTA_OIF = 0x4 + RTA_GATEWAY = 0x5 + RTA_PRIORITY = 0x6 + RTA_PREFSRC = 0x7 + RTA_METRICS = 0x8 + RTA_MULTIPATH = 0x9 + RTA_FLOW = 0xb + RTA_CACHEINFO = 0xc + RTA_TABLE = 0xf + RTN_UNSPEC = 0x0 + RTN_UNICAST = 0x1 + RTN_LOCAL = 0x2 + RTN_BROADCAST = 0x3 + RTN_ANYCAST = 0x4 + RTN_MULTICAST = 0x5 + RTN_BLACKHOLE = 0x6 + RTN_UNREACHABLE = 0x7 + RTN_PROHIBIT = 0x8 + RTN_THROW = 0x9 + RTN_NAT = 0xa + RTN_XRESOLVE = 0xb + RTNLGRP_NONE = 0x0 + RTNLGRP_LINK = 0x1 + RTNLGRP_NOTIFY = 0x2 + RTNLGRP_NEIGH = 0x3 + RTNLGRP_TC = 0x4 + RTNLGRP_IPV4_IFADDR = 0x5 + RTNLGRP_IPV4_MROUTE = 0x6 + RTNLGRP_IPV4_ROUTE = 0x7 + RTNLGRP_IPV4_RULE = 0x8 + RTNLGRP_IPV6_IFADDR = 0x9 + RTNLGRP_IPV6_MROUTE = 0xa + RTNLGRP_IPV6_ROUTE = 0xb + RTNLGRP_IPV6_IFINFO = 0xc + RTNLGRP_IPV6_PREFIX = 0x12 + RTNLGRP_IPV6_RULE = 0x13 + RTNLGRP_ND_USEROPT = 0x14 + SizeofNlMsghdr = 0x10 + SizeofNlMsgerr = 0x14 + SizeofRtGenmsg = 0x1 + SizeofNlAttr = 0x4 + SizeofRtAttr = 0x4 + SizeofIfInfomsg = 0x10 + SizeofIfAddrmsg = 0x8 + SizeofRtMsg = 0xc + SizeofRtNexthop = 0x8 ) type NlMsghdr struct { @@ -563,12 +582,12 @@ type RtAttr struct { } type IfInfomsg struct { - Family uint8 - X__ifi_pad uint8 - Type uint16 - Index int32 - Flags uint32 - Change uint32 + Family uint8 + _ uint8 + Type uint16 + Index int32 + Flags uint32 + Change uint32 } type IfAddrmsg struct { @@ -660,7 +679,7 @@ type Sysinfo_t struct { Totalhigh uint64 Freehigh uint64 Unit uint32 - X_f [0]uint8 + _ [0]uint8 _ [4]byte } @@ -683,10 +702,10 @@ type Ustat_t struct { } type EpollEvent struct { - Events uint32 - X_padFd int32 - Fd int32 - Pad int32 + Events uint32 + _ int32 + Fd int32 + Pad int32 } const ( @@ -701,6 +720,8 @@ const ( AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x100 + + AT_EACCESS = 0x200 ) type PollFd struct { @@ -720,7 +741,7 @@ const ( ) type Sigset_t struct { - X__val [16]uint64 + Val [16]uint64 } const RNDGETENTCNT = 0x40045200 @@ -876,3 +897,967 @@ const ( BDADDR_LE_PUBLIC = 0x1 BDADDR_LE_RANDOM = 0x2 ) + +type PerfEventAttr struct { + Type uint32 + Size uint32 + Config uint64 + Sample uint64 + Sample_type uint64 + Read_format uint64 + Bits uint64 + Wakeup uint32 + Bp_type uint32 + Ext1 uint64 + Ext2 uint64 + Branch_sample_type uint64 + Sample_regs_user uint64 + Sample_stack_user uint32 + Clockid int32 + Sample_regs_intr uint64 + Aux_watermark uint32 + _ uint32 +} + +type PerfEventMmapPage struct { + Version uint32 + Compat_version uint32 + Lock uint32 + Index uint32 + Offset int64 + Time_enabled uint64 + Time_running uint64 + Capabilities uint64 + Pmc_width uint16 + Time_shift uint16 + Time_mult uint32 + Time_offset uint64 + Time_zero uint64 + Size uint32 + _ [948]uint8 + Data_head uint64 + Data_tail uint64 + Data_offset uint64 + Data_size uint64 + Aux_head uint64 + Aux_tail uint64 + Aux_offset uint64 + Aux_size uint64 +} + +const ( + PerfBitDisabled uint64 = CBitFieldMaskBit0 + PerfBitInherit = CBitFieldMaskBit1 + PerfBitPinned = CBitFieldMaskBit2 + PerfBitExclusive = CBitFieldMaskBit3 + PerfBitExcludeUser = CBitFieldMaskBit4 + PerfBitExcludeKernel = CBitFieldMaskBit5 + PerfBitExcludeHv = CBitFieldMaskBit6 + PerfBitExcludeIdle = CBitFieldMaskBit7 + PerfBitMmap = CBitFieldMaskBit8 + PerfBitComm = CBitFieldMaskBit9 + PerfBitFreq = CBitFieldMaskBit10 + PerfBitInheritStat = CBitFieldMaskBit11 + PerfBitEnableOnExec = CBitFieldMaskBit12 + PerfBitTask = CBitFieldMaskBit13 + PerfBitWatermark = CBitFieldMaskBit14 + PerfBitPreciseIPBit1 = CBitFieldMaskBit15 + PerfBitPreciseIPBit2 = CBitFieldMaskBit16 + PerfBitMmapData = CBitFieldMaskBit17 + PerfBitSampleIDAll = CBitFieldMaskBit18 + PerfBitExcludeHost = CBitFieldMaskBit19 + PerfBitExcludeGuest = CBitFieldMaskBit20 + PerfBitExcludeCallchainKernel = CBitFieldMaskBit21 + PerfBitExcludeCallchainUser = CBitFieldMaskBit22 + PerfBitMmap2 = CBitFieldMaskBit23 + PerfBitCommExec = CBitFieldMaskBit24 + PerfBitUseClockID = CBitFieldMaskBit25 + PerfBitContextSwitch = CBitFieldMaskBit26 +) + +const ( + PERF_TYPE_HARDWARE = 0x0 + PERF_TYPE_SOFTWARE = 0x1 + PERF_TYPE_TRACEPOINT = 0x2 + PERF_TYPE_HW_CACHE = 0x3 + PERF_TYPE_RAW = 0x4 + PERF_TYPE_BREAKPOINT = 0x5 + + PERF_COUNT_HW_CPU_CYCLES = 0x0 + PERF_COUNT_HW_INSTRUCTIONS = 0x1 + PERF_COUNT_HW_CACHE_REFERENCES = 0x2 + PERF_COUNT_HW_CACHE_MISSES = 0x3 + PERF_COUNT_HW_BRANCH_INSTRUCTIONS = 0x4 + PERF_COUNT_HW_BRANCH_MISSES = 0x5 + PERF_COUNT_HW_BUS_CYCLES = 0x6 + PERF_COUNT_HW_STALLED_CYCLES_FRONTEND = 0x7 + PERF_COUNT_HW_STALLED_CYCLES_BACKEND = 0x8 + PERF_COUNT_HW_REF_CPU_CYCLES = 0x9 + + PERF_COUNT_HW_CACHE_L1D = 0x0 + PERF_COUNT_HW_CACHE_L1I = 0x1 + PERF_COUNT_HW_CACHE_LL = 0x2 + PERF_COUNT_HW_CACHE_DTLB = 0x3 + PERF_COUNT_HW_CACHE_ITLB = 0x4 + PERF_COUNT_HW_CACHE_BPU = 0x5 + PERF_COUNT_HW_CACHE_NODE = 0x6 + + PERF_COUNT_HW_CACHE_OP_READ = 0x0 + PERF_COUNT_HW_CACHE_OP_WRITE = 0x1 + PERF_COUNT_HW_CACHE_OP_PREFETCH = 0x2 + + PERF_COUNT_HW_CACHE_RESULT_ACCESS = 0x0 + PERF_COUNT_HW_CACHE_RESULT_MISS = 0x1 + + PERF_COUNT_SW_CPU_CLOCK = 0x0 + PERF_COUNT_SW_TASK_CLOCK = 0x1 + PERF_COUNT_SW_PAGE_FAULTS = 0x2 + PERF_COUNT_SW_CONTEXT_SWITCHES = 0x3 + PERF_COUNT_SW_CPU_MIGRATIONS = 0x4 + PERF_COUNT_SW_PAGE_FAULTS_MIN = 0x5 + PERF_COUNT_SW_PAGE_FAULTS_MAJ = 0x6 + PERF_COUNT_SW_ALIGNMENT_FAULTS = 0x7 + PERF_COUNT_SW_EMULATION_FAULTS = 0x8 + PERF_COUNT_SW_DUMMY = 0x9 + + PERF_SAMPLE_IP = 0x1 + PERF_SAMPLE_TID = 0x2 + PERF_SAMPLE_TIME = 0x4 + PERF_SAMPLE_ADDR = 0x8 + PERF_SAMPLE_READ = 0x10 + PERF_SAMPLE_CALLCHAIN = 0x20 + PERF_SAMPLE_ID = 0x40 + PERF_SAMPLE_CPU = 0x80 + PERF_SAMPLE_PERIOD = 0x100 + PERF_SAMPLE_STREAM_ID = 0x200 + PERF_SAMPLE_RAW = 0x400 + PERF_SAMPLE_BRANCH_STACK = 0x800 + + PERF_SAMPLE_BRANCH_USER = 0x1 + PERF_SAMPLE_BRANCH_KERNEL = 0x2 + PERF_SAMPLE_BRANCH_HV = 0x4 + PERF_SAMPLE_BRANCH_ANY = 0x8 + PERF_SAMPLE_BRANCH_ANY_CALL = 0x10 + PERF_SAMPLE_BRANCH_ANY_RETURN = 0x20 + PERF_SAMPLE_BRANCH_IND_CALL = 0x40 + + PERF_FORMAT_TOTAL_TIME_ENABLED = 0x1 + PERF_FORMAT_TOTAL_TIME_RUNNING = 0x2 + PERF_FORMAT_ID = 0x4 + PERF_FORMAT_GROUP = 0x8 + + PERF_RECORD_MMAP = 0x1 + PERF_RECORD_LOST = 0x2 + PERF_RECORD_COMM = 0x3 + PERF_RECORD_EXIT = 0x4 + PERF_RECORD_THROTTLE = 0x5 + PERF_RECORD_UNTHROTTLE = 0x6 + PERF_RECORD_FORK = 0x7 + PERF_RECORD_READ = 0x8 + PERF_RECORD_SAMPLE = 0x9 + + PERF_CONTEXT_HV = -0x20 + PERF_CONTEXT_KERNEL = -0x80 + PERF_CONTEXT_USER = -0x200 + + PERF_CONTEXT_GUEST = -0x800 + PERF_CONTEXT_GUEST_KERNEL = -0x880 + PERF_CONTEXT_GUEST_USER = -0xa00 + + PERF_FLAG_FD_NO_GROUP = 0x1 + PERF_FLAG_FD_OUTPUT = 0x2 + PERF_FLAG_PID_CGROUP = 0x4 +) + +const ( + CBitFieldMaskBit0 = 0x1 + CBitFieldMaskBit1 = 0x2 + CBitFieldMaskBit2 = 0x4 + CBitFieldMaskBit3 = 0x8 + CBitFieldMaskBit4 = 0x10 + CBitFieldMaskBit5 = 0x20 + CBitFieldMaskBit6 = 0x40 + CBitFieldMaskBit7 = 0x80 + CBitFieldMaskBit8 = 0x100 + CBitFieldMaskBit9 = 0x200 + CBitFieldMaskBit10 = 0x400 + CBitFieldMaskBit11 = 0x800 + CBitFieldMaskBit12 = 0x1000 + CBitFieldMaskBit13 = 0x2000 + CBitFieldMaskBit14 = 0x4000 + CBitFieldMaskBit15 = 0x8000 + CBitFieldMaskBit16 = 0x10000 + CBitFieldMaskBit17 = 0x20000 + CBitFieldMaskBit18 = 0x40000 + CBitFieldMaskBit19 = 0x80000 + CBitFieldMaskBit20 = 0x100000 + CBitFieldMaskBit21 = 0x200000 + CBitFieldMaskBit22 = 0x400000 + CBitFieldMaskBit23 = 0x800000 + CBitFieldMaskBit24 = 0x1000000 + CBitFieldMaskBit25 = 0x2000000 + CBitFieldMaskBit26 = 0x4000000 + CBitFieldMaskBit27 = 0x8000000 + CBitFieldMaskBit28 = 0x10000000 + CBitFieldMaskBit29 = 0x20000000 + CBitFieldMaskBit30 = 0x40000000 + CBitFieldMaskBit31 = 0x80000000 + CBitFieldMaskBit32 = 0x100000000 + CBitFieldMaskBit33 = 0x200000000 + CBitFieldMaskBit34 = 0x400000000 + CBitFieldMaskBit35 = 0x800000000 + CBitFieldMaskBit36 = 0x1000000000 + CBitFieldMaskBit37 = 0x2000000000 + CBitFieldMaskBit38 = 0x4000000000 + CBitFieldMaskBit39 = 0x8000000000 + CBitFieldMaskBit40 = 0x10000000000 + CBitFieldMaskBit41 = 0x20000000000 + CBitFieldMaskBit42 = 0x40000000000 + CBitFieldMaskBit43 = 0x80000000000 + CBitFieldMaskBit44 = 0x100000000000 + CBitFieldMaskBit45 = 0x200000000000 + CBitFieldMaskBit46 = 0x400000000000 + CBitFieldMaskBit47 = 0x800000000000 + CBitFieldMaskBit48 = 0x1000000000000 + CBitFieldMaskBit49 = 0x2000000000000 + CBitFieldMaskBit50 = 0x4000000000000 + CBitFieldMaskBit51 = 0x8000000000000 + CBitFieldMaskBit52 = 0x10000000000000 + CBitFieldMaskBit53 = 0x20000000000000 + CBitFieldMaskBit54 = 0x40000000000000 + CBitFieldMaskBit55 = 0x80000000000000 + CBitFieldMaskBit56 = 0x100000000000000 + CBitFieldMaskBit57 = 0x200000000000000 + CBitFieldMaskBit58 = 0x400000000000000 + CBitFieldMaskBit59 = 0x800000000000000 + CBitFieldMaskBit60 = 0x1000000000000000 + CBitFieldMaskBit61 = 0x2000000000000000 + CBitFieldMaskBit62 = 0x4000000000000000 + CBitFieldMaskBit63 = 0x8000000000000000 +) + +type SockaddrStorage struct { + Family uint16 + _ [118]uint8 + _ uint64 +} + +type TCPMD5Sig struct { + Addr SockaddrStorage + Flags uint8 + Prefixlen uint8 + Keylen uint16 + _ uint32 + Key [80]uint8 +} + +type HDDriveCmdHdr struct { + Command uint8 + Number uint8 + Feature uint8 + Count uint8 +} + +type HDGeometry struct { + Heads uint8 + Sectors uint8 + Cylinders uint16 + _ [4]byte + Start uint64 +} + +type HDDriveID struct { + Config uint16 + Cyls uint16 + Reserved2 uint16 + Heads uint16 + Track_bytes uint16 + Sector_bytes uint16 + Sectors uint16 + Vendor0 uint16 + Vendor1 uint16 + Vendor2 uint16 + Serial_no [20]uint8 + Buf_type uint16 + Buf_size uint16 + Ecc_bytes uint16 + Fw_rev [8]uint8 + Model [40]uint8 + Max_multsect uint8 + Vendor3 uint8 + Dword_io uint16 + Vendor4 uint8 + Capability uint8 + Reserved50 uint16 + Vendor5 uint8 + TPIO uint8 + Vendor6 uint8 + TDMA uint8 + Field_valid uint16 + Cur_cyls uint16 + Cur_heads uint16 + Cur_sectors uint16 + Cur_capacity0 uint16 + Cur_capacity1 uint16 + Multsect uint8 + Multsect_valid uint8 + Lba_capacity uint32 + Dma_1word uint16 + Dma_mword uint16 + Eide_pio_modes uint16 + Eide_dma_min uint16 + Eide_dma_time uint16 + Eide_pio uint16 + Eide_pio_iordy uint16 + Words69_70 [2]uint16 + Words71_74 [4]uint16 + Queue_depth uint16 + Words76_79 [4]uint16 + Major_rev_num uint16 + Minor_rev_num uint16 + Command_set_1 uint16 + Command_set_2 uint16 + Cfsse uint16 + Cfs_enable_1 uint16 + Cfs_enable_2 uint16 + Csf_default uint16 + Dma_ultra uint16 + Trseuc uint16 + TrsEuc uint16 + CurAPMvalues uint16 + Mprc uint16 + Hw_config uint16 + Acoustic uint16 + Msrqs uint16 + Sxfert uint16 + Sal uint16 + Spg uint32 + Lba_capacity_2 uint64 + Words104_125 [22]uint16 + Last_lun uint16 + Word127 uint16 + Dlf uint16 + Csfo uint16 + Words130_155 [26]uint16 + Word156 uint16 + Words157_159 [3]uint16 + Cfa_power uint16 + Words161_175 [15]uint16 + Words176_205 [30]uint16 + Words206_254 [49]uint16 + Integrity_word uint16 +} + +type Statfs_t struct { + Type int64 + Bsize int64 + Blocks uint64 + Bfree uint64 + Bavail uint64 + Files uint64 + Ffree uint64 + Fsid Fsid + Namelen int64 + Frsize int64 + Flags int64 + Spare [4]int64 +} + +const ( + ST_MANDLOCK = 0x40 + ST_NOATIME = 0x400 + ST_NODEV = 0x4 + ST_NODIRATIME = 0x800 + ST_NOEXEC = 0x8 + ST_NOSUID = 0x2 + ST_RDONLY = 0x1 + ST_RELATIME = 0x1000 + ST_SYNCHRONOUS = 0x10 +) + +type TpacketHdr struct { + Status uint64 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Usec uint32 + _ [4]byte +} + +type Tpacket2Hdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Nsec uint32 + Vlan_tci uint16 + Vlan_tpid uint16 + _ [4]uint8 +} + +type Tpacket3Hdr struct { + Next_offset uint32 + Sec uint32 + Nsec uint32 + Snaplen uint32 + Len uint32 + Status uint32 + Mac uint16 + Net uint16 + Hv1 TpacketHdrVariant1 + _ [8]uint8 +} + +type TpacketHdrVariant1 struct { + Rxhash uint32 + Vlan_tci uint32 + Vlan_tpid uint16 + _ uint16 +} + +type TpacketBlockDesc struct { + Version uint32 + To_priv uint32 + Hdr [40]byte +} + +type TpacketReq struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 +} + +type TpacketReq3 struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 + Retire_blk_tov uint32 + Sizeof_priv uint32 + Feature_req_word uint32 +} + +type TpacketStats struct { + Packets uint32 + Drops uint32 +} + +type TpacketStatsV3 struct { + Packets uint32 + Drops uint32 + Freeze_q_cnt uint32 +} + +type TpacketAuxdata struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Vlan_tci uint16 + Vlan_tpid uint16 +} + +const ( + TPACKET_V1 = 0x0 + TPACKET_V2 = 0x1 + TPACKET_V3 = 0x2 +) + +const ( + SizeofTpacketHdr = 0x20 + SizeofTpacket2Hdr = 0x20 + SizeofTpacket3Hdr = 0x30 +) + +const ( + NF_INET_PRE_ROUTING = 0x0 + NF_INET_LOCAL_IN = 0x1 + NF_INET_FORWARD = 0x2 + NF_INET_LOCAL_OUT = 0x3 + NF_INET_POST_ROUTING = 0x4 + NF_INET_NUMHOOKS = 0x5 +) + +const ( + NF_NETDEV_INGRESS = 0x0 + NF_NETDEV_NUMHOOKS = 0x1 +) + +const ( + NFPROTO_UNSPEC = 0x0 + NFPROTO_INET = 0x1 + NFPROTO_IPV4 = 0x2 + NFPROTO_ARP = 0x3 + NFPROTO_NETDEV = 0x5 + NFPROTO_BRIDGE = 0x7 + NFPROTO_IPV6 = 0xa + NFPROTO_DECNET = 0xc + NFPROTO_NUMPROTO = 0xd +) + +type Nfgenmsg struct { + Nfgen_family uint8 + Version uint8 + Res_id uint16 +} + +const ( + NFNL_BATCH_UNSPEC = 0x0 + NFNL_BATCH_GENID = 0x1 +) + +const ( + NFT_REG_VERDICT = 0x0 + NFT_REG_1 = 0x1 + NFT_REG_2 = 0x2 + NFT_REG_3 = 0x3 + NFT_REG_4 = 0x4 + NFT_REG32_00 = 0x8 + NFT_REG32_01 = 0x9 + NFT_REG32_02 = 0xa + NFT_REG32_03 = 0xb + NFT_REG32_04 = 0xc + NFT_REG32_05 = 0xd + NFT_REG32_06 = 0xe + NFT_REG32_07 = 0xf + NFT_REG32_08 = 0x10 + NFT_REG32_09 = 0x11 + NFT_REG32_10 = 0x12 + NFT_REG32_11 = 0x13 + NFT_REG32_12 = 0x14 + NFT_REG32_13 = 0x15 + NFT_REG32_14 = 0x16 + NFT_REG32_15 = 0x17 + NFT_CONTINUE = -0x1 + NFT_BREAK = -0x2 + NFT_JUMP = -0x3 + NFT_GOTO = -0x4 + NFT_RETURN = -0x5 + NFT_MSG_NEWTABLE = 0x0 + NFT_MSG_GETTABLE = 0x1 + NFT_MSG_DELTABLE = 0x2 + NFT_MSG_NEWCHAIN = 0x3 + NFT_MSG_GETCHAIN = 0x4 + NFT_MSG_DELCHAIN = 0x5 + NFT_MSG_NEWRULE = 0x6 + NFT_MSG_GETRULE = 0x7 + NFT_MSG_DELRULE = 0x8 + NFT_MSG_NEWSET = 0x9 + NFT_MSG_GETSET = 0xa + NFT_MSG_DELSET = 0xb + NFT_MSG_NEWSETELEM = 0xc + NFT_MSG_GETSETELEM = 0xd + NFT_MSG_DELSETELEM = 0xe + NFT_MSG_NEWGEN = 0xf + NFT_MSG_GETGEN = 0x10 + NFT_MSG_TRACE = 0x11 + NFT_MSG_NEWOBJ = 0x12 + NFT_MSG_GETOBJ = 0x13 + NFT_MSG_DELOBJ = 0x14 + NFT_MSG_GETOBJ_RESET = 0x15 + NFT_MSG_MAX = 0x19 + NFTA_LIST_UNPEC = 0x0 + NFTA_LIST_ELEM = 0x1 + NFTA_HOOK_UNSPEC = 0x0 + NFTA_HOOK_HOOKNUM = 0x1 + NFTA_HOOK_PRIORITY = 0x2 + NFTA_HOOK_DEV = 0x3 + NFT_TABLE_F_DORMANT = 0x1 + NFTA_TABLE_UNSPEC = 0x0 + NFTA_TABLE_NAME = 0x1 + NFTA_TABLE_FLAGS = 0x2 + NFTA_TABLE_USE = 0x3 + NFTA_CHAIN_UNSPEC = 0x0 + NFTA_CHAIN_TABLE = 0x1 + NFTA_CHAIN_HANDLE = 0x2 + NFTA_CHAIN_NAME = 0x3 + NFTA_CHAIN_HOOK = 0x4 + NFTA_CHAIN_POLICY = 0x5 + NFTA_CHAIN_USE = 0x6 + NFTA_CHAIN_TYPE = 0x7 + NFTA_CHAIN_COUNTERS = 0x8 + NFTA_CHAIN_PAD = 0x9 + NFTA_RULE_UNSPEC = 0x0 + NFTA_RULE_TABLE = 0x1 + NFTA_RULE_CHAIN = 0x2 + NFTA_RULE_HANDLE = 0x3 + NFTA_RULE_EXPRESSIONS = 0x4 + NFTA_RULE_COMPAT = 0x5 + NFTA_RULE_POSITION = 0x6 + NFTA_RULE_USERDATA = 0x7 + NFTA_RULE_PAD = 0x8 + NFTA_RULE_ID = 0x9 + NFT_RULE_COMPAT_F_INV = 0x2 + NFT_RULE_COMPAT_F_MASK = 0x2 + NFTA_RULE_COMPAT_UNSPEC = 0x0 + NFTA_RULE_COMPAT_PROTO = 0x1 + NFTA_RULE_COMPAT_FLAGS = 0x2 + NFT_SET_ANONYMOUS = 0x1 + NFT_SET_CONSTANT = 0x2 + NFT_SET_INTERVAL = 0x4 + NFT_SET_MAP = 0x8 + NFT_SET_TIMEOUT = 0x10 + NFT_SET_EVAL = 0x20 + NFT_SET_OBJECT = 0x40 + NFT_SET_POL_PERFORMANCE = 0x0 + NFT_SET_POL_MEMORY = 0x1 + NFTA_SET_DESC_UNSPEC = 0x0 + NFTA_SET_DESC_SIZE = 0x1 + NFTA_SET_UNSPEC = 0x0 + NFTA_SET_TABLE = 0x1 + NFTA_SET_NAME = 0x2 + NFTA_SET_FLAGS = 0x3 + NFTA_SET_KEY_TYPE = 0x4 + NFTA_SET_KEY_LEN = 0x5 + NFTA_SET_DATA_TYPE = 0x6 + NFTA_SET_DATA_LEN = 0x7 + NFTA_SET_POLICY = 0x8 + NFTA_SET_DESC = 0x9 + NFTA_SET_ID = 0xa + NFTA_SET_TIMEOUT = 0xb + NFTA_SET_GC_INTERVAL = 0xc + NFTA_SET_USERDATA = 0xd + NFTA_SET_PAD = 0xe + NFTA_SET_OBJ_TYPE = 0xf + NFT_SET_ELEM_INTERVAL_END = 0x1 + NFTA_SET_ELEM_UNSPEC = 0x0 + NFTA_SET_ELEM_KEY = 0x1 + NFTA_SET_ELEM_DATA = 0x2 + NFTA_SET_ELEM_FLAGS = 0x3 + NFTA_SET_ELEM_TIMEOUT = 0x4 + NFTA_SET_ELEM_EXPIRATION = 0x5 + NFTA_SET_ELEM_USERDATA = 0x6 + NFTA_SET_ELEM_EXPR = 0x7 + NFTA_SET_ELEM_PAD = 0x8 + NFTA_SET_ELEM_OBJREF = 0x9 + NFTA_SET_ELEM_LIST_UNSPEC = 0x0 + NFTA_SET_ELEM_LIST_TABLE = 0x1 + NFTA_SET_ELEM_LIST_SET = 0x2 + NFTA_SET_ELEM_LIST_ELEMENTS = 0x3 + NFTA_SET_ELEM_LIST_SET_ID = 0x4 + NFT_DATA_VALUE = 0x0 + NFT_DATA_VERDICT = 0xffffff00 + NFTA_DATA_UNSPEC = 0x0 + NFTA_DATA_VALUE = 0x1 + NFTA_DATA_VERDICT = 0x2 + NFTA_VERDICT_UNSPEC = 0x0 + NFTA_VERDICT_CODE = 0x1 + NFTA_VERDICT_CHAIN = 0x2 + NFTA_EXPR_UNSPEC = 0x0 + NFTA_EXPR_NAME = 0x1 + NFTA_EXPR_DATA = 0x2 + NFTA_IMMEDIATE_UNSPEC = 0x0 + NFTA_IMMEDIATE_DREG = 0x1 + NFTA_IMMEDIATE_DATA = 0x2 + NFTA_BITWISE_UNSPEC = 0x0 + NFTA_BITWISE_SREG = 0x1 + NFTA_BITWISE_DREG = 0x2 + NFTA_BITWISE_LEN = 0x3 + NFTA_BITWISE_MASK = 0x4 + NFTA_BITWISE_XOR = 0x5 + NFT_BYTEORDER_NTOH = 0x0 + NFT_BYTEORDER_HTON = 0x1 + NFTA_BYTEORDER_UNSPEC = 0x0 + NFTA_BYTEORDER_SREG = 0x1 + NFTA_BYTEORDER_DREG = 0x2 + NFTA_BYTEORDER_OP = 0x3 + NFTA_BYTEORDER_LEN = 0x4 + NFTA_BYTEORDER_SIZE = 0x5 + NFT_CMP_EQ = 0x0 + NFT_CMP_NEQ = 0x1 + NFT_CMP_LT = 0x2 + NFT_CMP_LTE = 0x3 + NFT_CMP_GT = 0x4 + NFT_CMP_GTE = 0x5 + NFTA_CMP_UNSPEC = 0x0 + NFTA_CMP_SREG = 0x1 + NFTA_CMP_OP = 0x2 + NFTA_CMP_DATA = 0x3 + NFT_RANGE_EQ = 0x0 + NFT_RANGE_NEQ = 0x1 + NFTA_RANGE_UNSPEC = 0x0 + NFTA_RANGE_SREG = 0x1 + NFTA_RANGE_OP = 0x2 + NFTA_RANGE_FROM_DATA = 0x3 + NFTA_RANGE_TO_DATA = 0x4 + NFT_LOOKUP_F_INV = 0x1 + NFTA_LOOKUP_UNSPEC = 0x0 + NFTA_LOOKUP_SET = 0x1 + NFTA_LOOKUP_SREG = 0x2 + NFTA_LOOKUP_DREG = 0x3 + NFTA_LOOKUP_SET_ID = 0x4 + NFTA_LOOKUP_FLAGS = 0x5 + NFT_DYNSET_OP_ADD = 0x0 + NFT_DYNSET_OP_UPDATE = 0x1 + NFT_DYNSET_F_INV = 0x1 + NFTA_DYNSET_UNSPEC = 0x0 + NFTA_DYNSET_SET_NAME = 0x1 + NFTA_DYNSET_SET_ID = 0x2 + NFTA_DYNSET_OP = 0x3 + NFTA_DYNSET_SREG_KEY = 0x4 + NFTA_DYNSET_SREG_DATA = 0x5 + NFTA_DYNSET_TIMEOUT = 0x6 + NFTA_DYNSET_EXPR = 0x7 + NFTA_DYNSET_PAD = 0x8 + NFTA_DYNSET_FLAGS = 0x9 + NFT_PAYLOAD_LL_HEADER = 0x0 + NFT_PAYLOAD_NETWORK_HEADER = 0x1 + NFT_PAYLOAD_TRANSPORT_HEADER = 0x2 + NFT_PAYLOAD_CSUM_NONE = 0x0 + NFT_PAYLOAD_CSUM_INET = 0x1 + NFT_PAYLOAD_L4CSUM_PSEUDOHDR = 0x1 + NFTA_PAYLOAD_UNSPEC = 0x0 + NFTA_PAYLOAD_DREG = 0x1 + NFTA_PAYLOAD_BASE = 0x2 + NFTA_PAYLOAD_OFFSET = 0x3 + NFTA_PAYLOAD_LEN = 0x4 + NFTA_PAYLOAD_SREG = 0x5 + NFTA_PAYLOAD_CSUM_TYPE = 0x6 + NFTA_PAYLOAD_CSUM_OFFSET = 0x7 + NFTA_PAYLOAD_CSUM_FLAGS = 0x8 + NFT_EXTHDR_F_PRESENT = 0x1 + NFT_EXTHDR_OP_IPV6 = 0x0 + NFT_EXTHDR_OP_TCPOPT = 0x1 + NFTA_EXTHDR_UNSPEC = 0x0 + NFTA_EXTHDR_DREG = 0x1 + NFTA_EXTHDR_TYPE = 0x2 + NFTA_EXTHDR_OFFSET = 0x3 + NFTA_EXTHDR_LEN = 0x4 + NFTA_EXTHDR_FLAGS = 0x5 + NFTA_EXTHDR_OP = 0x6 + NFTA_EXTHDR_SREG = 0x7 + NFT_META_LEN = 0x0 + NFT_META_PROTOCOL = 0x1 + NFT_META_PRIORITY = 0x2 + NFT_META_MARK = 0x3 + NFT_META_IIF = 0x4 + NFT_META_OIF = 0x5 + NFT_META_IIFNAME = 0x6 + NFT_META_OIFNAME = 0x7 + NFT_META_IIFTYPE = 0x8 + NFT_META_OIFTYPE = 0x9 + NFT_META_SKUID = 0xa + NFT_META_SKGID = 0xb + NFT_META_NFTRACE = 0xc + NFT_META_RTCLASSID = 0xd + NFT_META_SECMARK = 0xe + NFT_META_NFPROTO = 0xf + NFT_META_L4PROTO = 0x10 + NFT_META_BRI_IIFNAME = 0x11 + NFT_META_BRI_OIFNAME = 0x12 + NFT_META_PKTTYPE = 0x13 + NFT_META_CPU = 0x14 + NFT_META_IIFGROUP = 0x15 + NFT_META_OIFGROUP = 0x16 + NFT_META_CGROUP = 0x17 + NFT_META_PRANDOM = 0x18 + NFT_RT_CLASSID = 0x0 + NFT_RT_NEXTHOP4 = 0x1 + NFT_RT_NEXTHOP6 = 0x2 + NFT_RT_TCPMSS = 0x3 + NFT_HASH_JENKINS = 0x0 + NFT_HASH_SYM = 0x1 + NFTA_HASH_UNSPEC = 0x0 + NFTA_HASH_SREG = 0x1 + NFTA_HASH_DREG = 0x2 + NFTA_HASH_LEN = 0x3 + NFTA_HASH_MODULUS = 0x4 + NFTA_HASH_SEED = 0x5 + NFTA_HASH_OFFSET = 0x6 + NFTA_HASH_TYPE = 0x7 + NFTA_META_UNSPEC = 0x0 + NFTA_META_DREG = 0x1 + NFTA_META_KEY = 0x2 + NFTA_META_SREG = 0x3 + NFTA_RT_UNSPEC = 0x0 + NFTA_RT_DREG = 0x1 + NFTA_RT_KEY = 0x2 + NFT_CT_STATE = 0x0 + NFT_CT_DIRECTION = 0x1 + NFT_CT_STATUS = 0x2 + NFT_CT_MARK = 0x3 + NFT_CT_SECMARK = 0x4 + NFT_CT_EXPIRATION = 0x5 + NFT_CT_HELPER = 0x6 + NFT_CT_L3PROTOCOL = 0x7 + NFT_CT_SRC = 0x8 + NFT_CT_DST = 0x9 + NFT_CT_PROTOCOL = 0xa + NFT_CT_PROTO_SRC = 0xb + NFT_CT_PROTO_DST = 0xc + NFT_CT_LABELS = 0xd + NFT_CT_PKTS = 0xe + NFT_CT_BYTES = 0xf + NFT_CT_AVGPKT = 0x10 + NFT_CT_ZONE = 0x11 + NFT_CT_EVENTMASK = 0x12 + NFTA_CT_UNSPEC = 0x0 + NFTA_CT_DREG = 0x1 + NFTA_CT_KEY = 0x2 + NFTA_CT_DIRECTION = 0x3 + NFTA_CT_SREG = 0x4 + NFT_LIMIT_PKTS = 0x0 + NFT_LIMIT_PKT_BYTES = 0x1 + NFT_LIMIT_F_INV = 0x1 + NFTA_LIMIT_UNSPEC = 0x0 + NFTA_LIMIT_RATE = 0x1 + NFTA_LIMIT_UNIT = 0x2 + NFTA_LIMIT_BURST = 0x3 + NFTA_LIMIT_TYPE = 0x4 + NFTA_LIMIT_FLAGS = 0x5 + NFTA_LIMIT_PAD = 0x6 + NFTA_COUNTER_UNSPEC = 0x0 + NFTA_COUNTER_BYTES = 0x1 + NFTA_COUNTER_PACKETS = 0x2 + NFTA_COUNTER_PAD = 0x3 + NFTA_LOG_UNSPEC = 0x0 + NFTA_LOG_GROUP = 0x1 + NFTA_LOG_PREFIX = 0x2 + NFTA_LOG_SNAPLEN = 0x3 + NFTA_LOG_QTHRESHOLD = 0x4 + NFTA_LOG_LEVEL = 0x5 + NFTA_LOG_FLAGS = 0x6 + NFTA_QUEUE_UNSPEC = 0x0 + NFTA_QUEUE_NUM = 0x1 + NFTA_QUEUE_TOTAL = 0x2 + NFTA_QUEUE_FLAGS = 0x3 + NFTA_QUEUE_SREG_QNUM = 0x4 + NFT_QUOTA_F_INV = 0x1 + NFT_QUOTA_F_DEPLETED = 0x2 + NFTA_QUOTA_UNSPEC = 0x0 + NFTA_QUOTA_BYTES = 0x1 + NFTA_QUOTA_FLAGS = 0x2 + NFTA_QUOTA_PAD = 0x3 + NFTA_QUOTA_CONSUMED = 0x4 + NFT_REJECT_ICMP_UNREACH = 0x0 + NFT_REJECT_TCP_RST = 0x1 + NFT_REJECT_ICMPX_UNREACH = 0x2 + NFT_REJECT_ICMPX_NO_ROUTE = 0x0 + NFT_REJECT_ICMPX_PORT_UNREACH = 0x1 + NFT_REJECT_ICMPX_HOST_UNREACH = 0x2 + NFT_REJECT_ICMPX_ADMIN_PROHIBITED = 0x3 + NFTA_REJECT_UNSPEC = 0x0 + NFTA_REJECT_TYPE = 0x1 + NFTA_REJECT_ICMP_CODE = 0x2 + NFT_NAT_SNAT = 0x0 + NFT_NAT_DNAT = 0x1 + NFTA_NAT_UNSPEC = 0x0 + NFTA_NAT_TYPE = 0x1 + NFTA_NAT_FAMILY = 0x2 + NFTA_NAT_REG_ADDR_MIN = 0x3 + NFTA_NAT_REG_ADDR_MAX = 0x4 + NFTA_NAT_REG_PROTO_MIN = 0x5 + NFTA_NAT_REG_PROTO_MAX = 0x6 + NFTA_NAT_FLAGS = 0x7 + NFTA_MASQ_UNSPEC = 0x0 + NFTA_MASQ_FLAGS = 0x1 + NFTA_MASQ_REG_PROTO_MIN = 0x2 + NFTA_MASQ_REG_PROTO_MAX = 0x3 + NFTA_REDIR_UNSPEC = 0x0 + NFTA_REDIR_REG_PROTO_MIN = 0x1 + NFTA_REDIR_REG_PROTO_MAX = 0x2 + NFTA_REDIR_FLAGS = 0x3 + NFTA_DUP_UNSPEC = 0x0 + NFTA_DUP_SREG_ADDR = 0x1 + NFTA_DUP_SREG_DEV = 0x2 + NFTA_FWD_UNSPEC = 0x0 + NFTA_FWD_SREG_DEV = 0x1 + NFTA_OBJREF_UNSPEC = 0x0 + NFTA_OBJREF_IMM_TYPE = 0x1 + NFTA_OBJREF_IMM_NAME = 0x2 + NFTA_OBJREF_SET_SREG = 0x3 + NFTA_OBJREF_SET_NAME = 0x4 + NFTA_OBJREF_SET_ID = 0x5 + NFTA_GEN_UNSPEC = 0x0 + NFTA_GEN_ID = 0x1 + NFTA_GEN_PROC_PID = 0x2 + NFTA_GEN_PROC_NAME = 0x3 + NFTA_FIB_UNSPEC = 0x0 + NFTA_FIB_DREG = 0x1 + NFTA_FIB_RESULT = 0x2 + NFTA_FIB_FLAGS = 0x3 + NFT_FIB_RESULT_UNSPEC = 0x0 + NFT_FIB_RESULT_OIF = 0x1 + NFT_FIB_RESULT_OIFNAME = 0x2 + NFT_FIB_RESULT_ADDRTYPE = 0x3 + NFTA_FIB_F_SADDR = 0x1 + NFTA_FIB_F_DADDR = 0x2 + NFTA_FIB_F_MARK = 0x4 + NFTA_FIB_F_IIF = 0x8 + NFTA_FIB_F_OIF = 0x10 + NFTA_FIB_F_PRESENT = 0x20 + NFTA_CT_HELPER_UNSPEC = 0x0 + NFTA_CT_HELPER_NAME = 0x1 + NFTA_CT_HELPER_L3PROTO = 0x2 + NFTA_CT_HELPER_L4PROTO = 0x3 + NFTA_OBJ_UNSPEC = 0x0 + NFTA_OBJ_TABLE = 0x1 + NFTA_OBJ_NAME = 0x2 + NFTA_OBJ_TYPE = 0x3 + NFTA_OBJ_DATA = 0x4 + NFTA_OBJ_USE = 0x5 + NFTA_TRACE_UNSPEC = 0x0 + NFTA_TRACE_TABLE = 0x1 + NFTA_TRACE_CHAIN = 0x2 + NFTA_TRACE_RULE_HANDLE = 0x3 + NFTA_TRACE_TYPE = 0x4 + NFTA_TRACE_VERDICT = 0x5 + NFTA_TRACE_ID = 0x6 + NFTA_TRACE_LL_HEADER = 0x7 + NFTA_TRACE_NETWORK_HEADER = 0x8 + NFTA_TRACE_TRANSPORT_HEADER = 0x9 + NFTA_TRACE_IIF = 0xa + NFTA_TRACE_IIFTYPE = 0xb + NFTA_TRACE_OIF = 0xc + NFTA_TRACE_OIFTYPE = 0xd + NFTA_TRACE_MARK = 0xe + NFTA_TRACE_NFPROTO = 0xf + NFTA_TRACE_POLICY = 0x10 + NFTA_TRACE_PAD = 0x11 + NFT_TRACETYPE_UNSPEC = 0x0 + NFT_TRACETYPE_POLICY = 0x1 + NFT_TRACETYPE_RETURN = 0x2 + NFT_TRACETYPE_RULE = 0x3 + NFTA_NG_UNSPEC = 0x0 + NFTA_NG_DREG = 0x1 + NFTA_NG_MODULUS = 0x2 + NFTA_NG_TYPE = 0x3 + NFTA_NG_OFFSET = 0x4 + NFT_NG_INCREMENTAL = 0x0 + NFT_NG_RANDOM = 0x1 +) + +type RTCTime struct { + Sec int32 + Min int32 + Hour int32 + Mday int32 + Mon int32 + Year int32 + Wday int32 + Yday int32 + Isdst int32 +} + +type RTCWkAlrm struct { + Enabled uint8 + Pending uint8 + _ [2]byte + Time RTCTime +} + +type RTCPLLInfo struct { + Ctrl int32 + Value int32 + Max int32 + Min int32 + Posmult int32 + Negmult int32 + Clock int64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go b/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go index 64952cb78f..932b655fed 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_s390x.go @@ -116,22 +116,6 @@ type Stat_t struct { _ [3]int64 } -type Statfs_t struct { - Type uint32 - Bsize uint32 - Blocks uint64 - Bfree uint64 - Bavail uint64 - Files uint64 - Ffree uint64 - Fsid Fsid - Namelen uint32 - Frsize uint32 - Flags uint32 - Spare [4]uint32 - _ [4]byte -} - type StatxTimestamp struct { Sec int64 Nsec uint32 @@ -172,7 +156,7 @@ type Dirent struct { } type Fsid struct { - _ [2]int32 + Val [2]int32 } type Flock_t struct { @@ -266,6 +250,13 @@ type RawSockaddrL2 struct { _ [1]byte } +type RawSockaddrRFCOMM struct { + Family uint16 + Bdaddr [6]uint8 + Channel uint8 + _ [1]byte +} + type RawSockaddrCAN struct { Family uint16 _ [2]byte @@ -421,6 +412,7 @@ const ( SizeofSockaddrNetlink = 0xc SizeofSockaddrHCI = 0x6 SizeofSockaddrL2 = 0xe + SizeofSockaddrRFCOMM = 0xa SizeofSockaddrCAN = 0x10 SizeofSockaddrALG = 0x58 SizeofSockaddrVM = 0x10 @@ -441,97 +433,123 @@ const ( ) const ( - IFA_UNSPEC = 0x0 - IFA_ADDRESS = 0x1 - IFA_LOCAL = 0x2 - IFA_LABEL = 0x3 - IFA_BROADCAST = 0x4 - IFA_ANYCAST = 0x5 - IFA_CACHEINFO = 0x6 - IFA_MULTICAST = 0x7 - IFLA_UNSPEC = 0x0 - IFLA_ADDRESS = 0x1 - IFLA_BROADCAST = 0x2 - IFLA_IFNAME = 0x3 - IFLA_MTU = 0x4 - IFLA_LINK = 0x5 - IFLA_QDISC = 0x6 - IFLA_STATS = 0x7 - IFLA_COST = 0x8 - IFLA_PRIORITY = 0x9 - IFLA_MASTER = 0xa - IFLA_WIRELESS = 0xb - IFLA_PROTINFO = 0xc - IFLA_TXQLEN = 0xd - IFLA_MAP = 0xe - IFLA_WEIGHT = 0xf - IFLA_OPERSTATE = 0x10 - IFLA_LINKMODE = 0x11 - IFLA_LINKINFO = 0x12 - IFLA_NET_NS_PID = 0x13 - IFLA_IFALIAS = 0x14 - IFLA_MAX = 0x2c - RT_SCOPE_UNIVERSE = 0x0 - RT_SCOPE_SITE = 0xc8 - RT_SCOPE_LINK = 0xfd - RT_SCOPE_HOST = 0xfe - RT_SCOPE_NOWHERE = 0xff - RT_TABLE_UNSPEC = 0x0 - RT_TABLE_COMPAT = 0xfc - RT_TABLE_DEFAULT = 0xfd - RT_TABLE_MAIN = 0xfe - RT_TABLE_LOCAL = 0xff - RT_TABLE_MAX = 0xffffffff - RTA_UNSPEC = 0x0 - RTA_DST = 0x1 - RTA_SRC = 0x2 - RTA_IIF = 0x3 - RTA_OIF = 0x4 - RTA_GATEWAY = 0x5 - RTA_PRIORITY = 0x6 - RTA_PREFSRC = 0x7 - RTA_METRICS = 0x8 - RTA_MULTIPATH = 0x9 - RTA_FLOW = 0xb - RTA_CACHEINFO = 0xc - RTA_TABLE = 0xf - RTN_UNSPEC = 0x0 - RTN_UNICAST = 0x1 - RTN_LOCAL = 0x2 - RTN_BROADCAST = 0x3 - RTN_ANYCAST = 0x4 - RTN_MULTICAST = 0x5 - RTN_BLACKHOLE = 0x6 - RTN_UNREACHABLE = 0x7 - RTN_PROHIBIT = 0x8 - RTN_THROW = 0x9 - RTN_NAT = 0xa - RTN_XRESOLVE = 0xb - RTNLGRP_NONE = 0x0 - RTNLGRP_LINK = 0x1 - RTNLGRP_NOTIFY = 0x2 - RTNLGRP_NEIGH = 0x3 - RTNLGRP_TC = 0x4 - RTNLGRP_IPV4_IFADDR = 0x5 - RTNLGRP_IPV4_MROUTE = 0x6 - RTNLGRP_IPV4_ROUTE = 0x7 - RTNLGRP_IPV4_RULE = 0x8 - RTNLGRP_IPV6_IFADDR = 0x9 - RTNLGRP_IPV6_MROUTE = 0xa - RTNLGRP_IPV6_ROUTE = 0xb - RTNLGRP_IPV6_IFINFO = 0xc - RTNLGRP_IPV6_PREFIX = 0x12 - RTNLGRP_IPV6_RULE = 0x13 - RTNLGRP_ND_USEROPT = 0x14 - SizeofNlMsghdr = 0x10 - SizeofNlMsgerr = 0x14 - SizeofRtGenmsg = 0x1 - SizeofNlAttr = 0x4 - SizeofRtAttr = 0x4 - SizeofIfInfomsg = 0x10 - SizeofIfAddrmsg = 0x8 - SizeofRtMsg = 0xc - SizeofRtNexthop = 0x8 + IFA_UNSPEC = 0x0 + IFA_ADDRESS = 0x1 + IFA_LOCAL = 0x2 + IFA_LABEL = 0x3 + IFA_BROADCAST = 0x4 + IFA_ANYCAST = 0x5 + IFA_CACHEINFO = 0x6 + IFA_MULTICAST = 0x7 + IFLA_UNSPEC = 0x0 + IFLA_ADDRESS = 0x1 + IFLA_BROADCAST = 0x2 + IFLA_IFNAME = 0x3 + IFLA_MTU = 0x4 + IFLA_LINK = 0x5 + IFLA_QDISC = 0x6 + IFLA_STATS = 0x7 + IFLA_COST = 0x8 + IFLA_PRIORITY = 0x9 + IFLA_MASTER = 0xa + IFLA_WIRELESS = 0xb + IFLA_PROTINFO = 0xc + IFLA_TXQLEN = 0xd + IFLA_MAP = 0xe + IFLA_WEIGHT = 0xf + IFLA_OPERSTATE = 0x10 + IFLA_LINKMODE = 0x11 + IFLA_LINKINFO = 0x12 + IFLA_NET_NS_PID = 0x13 + IFLA_IFALIAS = 0x14 + IFLA_NUM_VF = 0x15 + IFLA_VFINFO_LIST = 0x16 + IFLA_STATS64 = 0x17 + IFLA_VF_PORTS = 0x18 + IFLA_PORT_SELF = 0x19 + IFLA_AF_SPEC = 0x1a + IFLA_GROUP = 0x1b + IFLA_NET_NS_FD = 0x1c + IFLA_EXT_MASK = 0x1d + IFLA_PROMISCUITY = 0x1e + IFLA_NUM_TX_QUEUES = 0x1f + IFLA_NUM_RX_QUEUES = 0x20 + IFLA_CARRIER = 0x21 + IFLA_PHYS_PORT_ID = 0x22 + IFLA_CARRIER_CHANGES = 0x23 + IFLA_PHYS_SWITCH_ID = 0x24 + IFLA_LINK_NETNSID = 0x25 + IFLA_PHYS_PORT_NAME = 0x26 + IFLA_PROTO_DOWN = 0x27 + IFLA_GSO_MAX_SEGS = 0x28 + IFLA_GSO_MAX_SIZE = 0x29 + IFLA_PAD = 0x2a + IFLA_XDP = 0x2b + IFLA_EVENT = 0x2c + IFLA_NEW_NETNSID = 0x2d + IFLA_IF_NETNSID = 0x2e + IFLA_MAX = 0x31 + RT_SCOPE_UNIVERSE = 0x0 + RT_SCOPE_SITE = 0xc8 + RT_SCOPE_LINK = 0xfd + RT_SCOPE_HOST = 0xfe + RT_SCOPE_NOWHERE = 0xff + RT_TABLE_UNSPEC = 0x0 + RT_TABLE_COMPAT = 0xfc + RT_TABLE_DEFAULT = 0xfd + RT_TABLE_MAIN = 0xfe + RT_TABLE_LOCAL = 0xff + RT_TABLE_MAX = 0xffffffff + RTA_UNSPEC = 0x0 + RTA_DST = 0x1 + RTA_SRC = 0x2 + RTA_IIF = 0x3 + RTA_OIF = 0x4 + RTA_GATEWAY = 0x5 + RTA_PRIORITY = 0x6 + RTA_PREFSRC = 0x7 + RTA_METRICS = 0x8 + RTA_MULTIPATH = 0x9 + RTA_FLOW = 0xb + RTA_CACHEINFO = 0xc + RTA_TABLE = 0xf + RTN_UNSPEC = 0x0 + RTN_UNICAST = 0x1 + RTN_LOCAL = 0x2 + RTN_BROADCAST = 0x3 + RTN_ANYCAST = 0x4 + RTN_MULTICAST = 0x5 + RTN_BLACKHOLE = 0x6 + RTN_UNREACHABLE = 0x7 + RTN_PROHIBIT = 0x8 + RTN_THROW = 0x9 + RTN_NAT = 0xa + RTN_XRESOLVE = 0xb + RTNLGRP_NONE = 0x0 + RTNLGRP_LINK = 0x1 + RTNLGRP_NOTIFY = 0x2 + RTNLGRP_NEIGH = 0x3 + RTNLGRP_TC = 0x4 + RTNLGRP_IPV4_IFADDR = 0x5 + RTNLGRP_IPV4_MROUTE = 0x6 + RTNLGRP_IPV4_ROUTE = 0x7 + RTNLGRP_IPV4_RULE = 0x8 + RTNLGRP_IPV6_IFADDR = 0x9 + RTNLGRP_IPV6_MROUTE = 0xa + RTNLGRP_IPV6_ROUTE = 0xb + RTNLGRP_IPV6_IFINFO = 0xc + RTNLGRP_IPV6_PREFIX = 0x12 + RTNLGRP_IPV6_RULE = 0x13 + RTNLGRP_ND_USEROPT = 0x14 + SizeofNlMsghdr = 0x10 + SizeofNlMsgerr = 0x14 + SizeofRtGenmsg = 0x1 + SizeofNlAttr = 0x4 + SizeofRtAttr = 0x4 + SizeofIfInfomsg = 0x10 + SizeofIfAddrmsg = 0x8 + SizeofRtMsg = 0xc + SizeofRtNexthop = 0x8 ) type NlMsghdr struct { @@ -718,6 +736,8 @@ const ( AT_SYMLINK_FOLLOW = 0x400 AT_SYMLINK_NOFOLLOW = 0x100 + + AT_EACCESS = 0x200 ) type PollFd struct { @@ -737,7 +757,7 @@ const ( ) type Sigset_t struct { - _ [16]uint64 + Val [16]uint64 } const RNDGETENTCNT = 0x80045200 @@ -893,3 +913,968 @@ const ( BDADDR_LE_PUBLIC = 0x1 BDADDR_LE_RANDOM = 0x2 ) + +type PerfEventAttr struct { + Type uint32 + Size uint32 + Config uint64 + Sample uint64 + Sample_type uint64 + Read_format uint64 + Bits uint64 + Wakeup uint32 + Bp_type uint32 + Ext1 uint64 + Ext2 uint64 + Branch_sample_type uint64 + Sample_regs_user uint64 + Sample_stack_user uint32 + Clockid int32 + Sample_regs_intr uint64 + Aux_watermark uint32 + _ uint32 +} + +type PerfEventMmapPage struct { + Version uint32 + Compat_version uint32 + Lock uint32 + Index uint32 + Offset int64 + Time_enabled uint64 + Time_running uint64 + Capabilities uint64 + Pmc_width uint16 + Time_shift uint16 + Time_mult uint32 + Time_offset uint64 + Time_zero uint64 + Size uint32 + _ [948]uint8 + Data_head uint64 + Data_tail uint64 + Data_offset uint64 + Data_size uint64 + Aux_head uint64 + Aux_tail uint64 + Aux_offset uint64 + Aux_size uint64 +} + +const ( + PerfBitDisabled uint64 = CBitFieldMaskBit0 + PerfBitInherit = CBitFieldMaskBit1 + PerfBitPinned = CBitFieldMaskBit2 + PerfBitExclusive = CBitFieldMaskBit3 + PerfBitExcludeUser = CBitFieldMaskBit4 + PerfBitExcludeKernel = CBitFieldMaskBit5 + PerfBitExcludeHv = CBitFieldMaskBit6 + PerfBitExcludeIdle = CBitFieldMaskBit7 + PerfBitMmap = CBitFieldMaskBit8 + PerfBitComm = CBitFieldMaskBit9 + PerfBitFreq = CBitFieldMaskBit10 + PerfBitInheritStat = CBitFieldMaskBit11 + PerfBitEnableOnExec = CBitFieldMaskBit12 + PerfBitTask = CBitFieldMaskBit13 + PerfBitWatermark = CBitFieldMaskBit14 + PerfBitPreciseIPBit1 = CBitFieldMaskBit15 + PerfBitPreciseIPBit2 = CBitFieldMaskBit16 + PerfBitMmapData = CBitFieldMaskBit17 + PerfBitSampleIDAll = CBitFieldMaskBit18 + PerfBitExcludeHost = CBitFieldMaskBit19 + PerfBitExcludeGuest = CBitFieldMaskBit20 + PerfBitExcludeCallchainKernel = CBitFieldMaskBit21 + PerfBitExcludeCallchainUser = CBitFieldMaskBit22 + PerfBitMmap2 = CBitFieldMaskBit23 + PerfBitCommExec = CBitFieldMaskBit24 + PerfBitUseClockID = CBitFieldMaskBit25 + PerfBitContextSwitch = CBitFieldMaskBit26 +) + +const ( + PERF_TYPE_HARDWARE = 0x0 + PERF_TYPE_SOFTWARE = 0x1 + PERF_TYPE_TRACEPOINT = 0x2 + PERF_TYPE_HW_CACHE = 0x3 + PERF_TYPE_RAW = 0x4 + PERF_TYPE_BREAKPOINT = 0x5 + + PERF_COUNT_HW_CPU_CYCLES = 0x0 + PERF_COUNT_HW_INSTRUCTIONS = 0x1 + PERF_COUNT_HW_CACHE_REFERENCES = 0x2 + PERF_COUNT_HW_CACHE_MISSES = 0x3 + PERF_COUNT_HW_BRANCH_INSTRUCTIONS = 0x4 + PERF_COUNT_HW_BRANCH_MISSES = 0x5 + PERF_COUNT_HW_BUS_CYCLES = 0x6 + PERF_COUNT_HW_STALLED_CYCLES_FRONTEND = 0x7 + PERF_COUNT_HW_STALLED_CYCLES_BACKEND = 0x8 + PERF_COUNT_HW_REF_CPU_CYCLES = 0x9 + + PERF_COUNT_HW_CACHE_L1D = 0x0 + PERF_COUNT_HW_CACHE_L1I = 0x1 + PERF_COUNT_HW_CACHE_LL = 0x2 + PERF_COUNT_HW_CACHE_DTLB = 0x3 + PERF_COUNT_HW_CACHE_ITLB = 0x4 + PERF_COUNT_HW_CACHE_BPU = 0x5 + PERF_COUNT_HW_CACHE_NODE = 0x6 + + PERF_COUNT_HW_CACHE_OP_READ = 0x0 + PERF_COUNT_HW_CACHE_OP_WRITE = 0x1 + PERF_COUNT_HW_CACHE_OP_PREFETCH = 0x2 + + PERF_COUNT_HW_CACHE_RESULT_ACCESS = 0x0 + PERF_COUNT_HW_CACHE_RESULT_MISS = 0x1 + + PERF_COUNT_SW_CPU_CLOCK = 0x0 + PERF_COUNT_SW_TASK_CLOCK = 0x1 + PERF_COUNT_SW_PAGE_FAULTS = 0x2 + PERF_COUNT_SW_CONTEXT_SWITCHES = 0x3 + PERF_COUNT_SW_CPU_MIGRATIONS = 0x4 + PERF_COUNT_SW_PAGE_FAULTS_MIN = 0x5 + PERF_COUNT_SW_PAGE_FAULTS_MAJ = 0x6 + PERF_COUNT_SW_ALIGNMENT_FAULTS = 0x7 + PERF_COUNT_SW_EMULATION_FAULTS = 0x8 + PERF_COUNT_SW_DUMMY = 0x9 + + PERF_SAMPLE_IP = 0x1 + PERF_SAMPLE_TID = 0x2 + PERF_SAMPLE_TIME = 0x4 + PERF_SAMPLE_ADDR = 0x8 + PERF_SAMPLE_READ = 0x10 + PERF_SAMPLE_CALLCHAIN = 0x20 + PERF_SAMPLE_ID = 0x40 + PERF_SAMPLE_CPU = 0x80 + PERF_SAMPLE_PERIOD = 0x100 + PERF_SAMPLE_STREAM_ID = 0x200 + PERF_SAMPLE_RAW = 0x400 + PERF_SAMPLE_BRANCH_STACK = 0x800 + + PERF_SAMPLE_BRANCH_USER = 0x1 + PERF_SAMPLE_BRANCH_KERNEL = 0x2 + PERF_SAMPLE_BRANCH_HV = 0x4 + PERF_SAMPLE_BRANCH_ANY = 0x8 + PERF_SAMPLE_BRANCH_ANY_CALL = 0x10 + PERF_SAMPLE_BRANCH_ANY_RETURN = 0x20 + PERF_SAMPLE_BRANCH_IND_CALL = 0x40 + + PERF_FORMAT_TOTAL_TIME_ENABLED = 0x1 + PERF_FORMAT_TOTAL_TIME_RUNNING = 0x2 + PERF_FORMAT_ID = 0x4 + PERF_FORMAT_GROUP = 0x8 + + PERF_RECORD_MMAP = 0x1 + PERF_RECORD_LOST = 0x2 + PERF_RECORD_COMM = 0x3 + PERF_RECORD_EXIT = 0x4 + PERF_RECORD_THROTTLE = 0x5 + PERF_RECORD_UNTHROTTLE = 0x6 + PERF_RECORD_FORK = 0x7 + PERF_RECORD_READ = 0x8 + PERF_RECORD_SAMPLE = 0x9 + + PERF_CONTEXT_HV = -0x20 + PERF_CONTEXT_KERNEL = -0x80 + PERF_CONTEXT_USER = -0x200 + + PERF_CONTEXT_GUEST = -0x800 + PERF_CONTEXT_GUEST_KERNEL = -0x880 + PERF_CONTEXT_GUEST_USER = -0xa00 + + PERF_FLAG_FD_NO_GROUP = 0x1 + PERF_FLAG_FD_OUTPUT = 0x2 + PERF_FLAG_PID_CGROUP = 0x4 +) + +const ( + CBitFieldMaskBit0 = 0x8000000000000000 + CBitFieldMaskBit1 = 0x4000000000000000 + CBitFieldMaskBit2 = 0x2000000000000000 + CBitFieldMaskBit3 = 0x1000000000000000 + CBitFieldMaskBit4 = 0x800000000000000 + CBitFieldMaskBit5 = 0x400000000000000 + CBitFieldMaskBit6 = 0x200000000000000 + CBitFieldMaskBit7 = 0x100000000000000 + CBitFieldMaskBit8 = 0x80000000000000 + CBitFieldMaskBit9 = 0x40000000000000 + CBitFieldMaskBit10 = 0x20000000000000 + CBitFieldMaskBit11 = 0x10000000000000 + CBitFieldMaskBit12 = 0x8000000000000 + CBitFieldMaskBit13 = 0x4000000000000 + CBitFieldMaskBit14 = 0x2000000000000 + CBitFieldMaskBit15 = 0x1000000000000 + CBitFieldMaskBit16 = 0x800000000000 + CBitFieldMaskBit17 = 0x400000000000 + CBitFieldMaskBit18 = 0x200000000000 + CBitFieldMaskBit19 = 0x100000000000 + CBitFieldMaskBit20 = 0x80000000000 + CBitFieldMaskBit21 = 0x40000000000 + CBitFieldMaskBit22 = 0x20000000000 + CBitFieldMaskBit23 = 0x10000000000 + CBitFieldMaskBit24 = 0x8000000000 + CBitFieldMaskBit25 = 0x4000000000 + CBitFieldMaskBit26 = 0x2000000000 + CBitFieldMaskBit27 = 0x1000000000 + CBitFieldMaskBit28 = 0x800000000 + CBitFieldMaskBit29 = 0x400000000 + CBitFieldMaskBit30 = 0x200000000 + CBitFieldMaskBit31 = 0x100000000 + CBitFieldMaskBit32 = 0x80000000 + CBitFieldMaskBit33 = 0x40000000 + CBitFieldMaskBit34 = 0x20000000 + CBitFieldMaskBit35 = 0x10000000 + CBitFieldMaskBit36 = 0x8000000 + CBitFieldMaskBit37 = 0x4000000 + CBitFieldMaskBit38 = 0x2000000 + CBitFieldMaskBit39 = 0x1000000 + CBitFieldMaskBit40 = 0x800000 + CBitFieldMaskBit41 = 0x400000 + CBitFieldMaskBit42 = 0x200000 + CBitFieldMaskBit43 = 0x100000 + CBitFieldMaskBit44 = 0x80000 + CBitFieldMaskBit45 = 0x40000 + CBitFieldMaskBit46 = 0x20000 + CBitFieldMaskBit47 = 0x10000 + CBitFieldMaskBit48 = 0x8000 + CBitFieldMaskBit49 = 0x4000 + CBitFieldMaskBit50 = 0x2000 + CBitFieldMaskBit51 = 0x1000 + CBitFieldMaskBit52 = 0x800 + CBitFieldMaskBit53 = 0x400 + CBitFieldMaskBit54 = 0x200 + CBitFieldMaskBit55 = 0x100 + CBitFieldMaskBit56 = 0x80 + CBitFieldMaskBit57 = 0x40 + CBitFieldMaskBit58 = 0x20 + CBitFieldMaskBit59 = 0x10 + CBitFieldMaskBit60 = 0x8 + CBitFieldMaskBit61 = 0x4 + CBitFieldMaskBit62 = 0x2 + CBitFieldMaskBit63 = 0x1 +) + +type SockaddrStorage struct { + Family uint16 + _ [118]int8 + _ uint64 +} + +type TCPMD5Sig struct { + Addr SockaddrStorage + Flags uint8 + Prefixlen uint8 + Keylen uint16 + _ uint32 + Key [80]uint8 +} + +type HDDriveCmdHdr struct { + Command uint8 + Number uint8 + Feature uint8 + Count uint8 +} + +type HDGeometry struct { + Heads uint8 + Sectors uint8 + Cylinders uint16 + _ [4]byte + Start uint64 +} + +type HDDriveID struct { + Config uint16 + Cyls uint16 + Reserved2 uint16 + Heads uint16 + Track_bytes uint16 + Sector_bytes uint16 + Sectors uint16 + Vendor0 uint16 + Vendor1 uint16 + Vendor2 uint16 + Serial_no [20]uint8 + Buf_type uint16 + Buf_size uint16 + Ecc_bytes uint16 + Fw_rev [8]uint8 + Model [40]uint8 + Max_multsect uint8 + Vendor3 uint8 + Dword_io uint16 + Vendor4 uint8 + Capability uint8 + Reserved50 uint16 + Vendor5 uint8 + TPIO uint8 + Vendor6 uint8 + TDMA uint8 + Field_valid uint16 + Cur_cyls uint16 + Cur_heads uint16 + Cur_sectors uint16 + Cur_capacity0 uint16 + Cur_capacity1 uint16 + Multsect uint8 + Multsect_valid uint8 + Lba_capacity uint32 + Dma_1word uint16 + Dma_mword uint16 + Eide_pio_modes uint16 + Eide_dma_min uint16 + Eide_dma_time uint16 + Eide_pio uint16 + Eide_pio_iordy uint16 + Words69_70 [2]uint16 + Words71_74 [4]uint16 + Queue_depth uint16 + Words76_79 [4]uint16 + Major_rev_num uint16 + Minor_rev_num uint16 + Command_set_1 uint16 + Command_set_2 uint16 + Cfsse uint16 + Cfs_enable_1 uint16 + Cfs_enable_2 uint16 + Csf_default uint16 + Dma_ultra uint16 + Trseuc uint16 + TrsEuc uint16 + CurAPMvalues uint16 + Mprc uint16 + Hw_config uint16 + Acoustic uint16 + Msrqs uint16 + Sxfert uint16 + Sal uint16 + Spg uint32 + Lba_capacity_2 uint64 + Words104_125 [22]uint16 + Last_lun uint16 + Word127 uint16 + Dlf uint16 + Csfo uint16 + Words130_155 [26]uint16 + Word156 uint16 + Words157_159 [3]uint16 + Cfa_power uint16 + Words161_175 [15]uint16 + Words176_205 [30]uint16 + Words206_254 [49]uint16 + Integrity_word uint16 +} + +type Statfs_t struct { + Type uint32 + Bsize uint32 + Blocks uint64 + Bfree uint64 + Bavail uint64 + Files uint64 + Ffree uint64 + Fsid Fsid + Namelen uint32 + Frsize uint32 + Flags uint32 + Spare [4]uint32 + _ [4]byte +} + +const ( + ST_MANDLOCK = 0x40 + ST_NOATIME = 0x400 + ST_NODEV = 0x4 + ST_NODIRATIME = 0x800 + ST_NOEXEC = 0x8 + ST_NOSUID = 0x2 + ST_RDONLY = 0x1 + ST_RELATIME = 0x1000 + ST_SYNCHRONOUS = 0x10 +) + +type TpacketHdr struct { + Status uint64 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Usec uint32 + _ [4]byte +} + +type Tpacket2Hdr struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Sec uint32 + Nsec uint32 + Vlan_tci uint16 + Vlan_tpid uint16 + _ [4]uint8 +} + +type Tpacket3Hdr struct { + Next_offset uint32 + Sec uint32 + Nsec uint32 + Snaplen uint32 + Len uint32 + Status uint32 + Mac uint16 + Net uint16 + Hv1 TpacketHdrVariant1 + _ [8]uint8 +} + +type TpacketHdrVariant1 struct { + Rxhash uint32 + Vlan_tci uint32 + Vlan_tpid uint16 + _ uint16 +} + +type TpacketBlockDesc struct { + Version uint32 + To_priv uint32 + Hdr [40]byte +} + +type TpacketReq struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 +} + +type TpacketReq3 struct { + Block_size uint32 + Block_nr uint32 + Frame_size uint32 + Frame_nr uint32 + Retire_blk_tov uint32 + Sizeof_priv uint32 + Feature_req_word uint32 +} + +type TpacketStats struct { + Packets uint32 + Drops uint32 +} + +type TpacketStatsV3 struct { + Packets uint32 + Drops uint32 + Freeze_q_cnt uint32 +} + +type TpacketAuxdata struct { + Status uint32 + Len uint32 + Snaplen uint32 + Mac uint16 + Net uint16 + Vlan_tci uint16 + Vlan_tpid uint16 +} + +const ( + TPACKET_V1 = 0x0 + TPACKET_V2 = 0x1 + TPACKET_V3 = 0x2 +) + +const ( + SizeofTpacketHdr = 0x20 + SizeofTpacket2Hdr = 0x20 + SizeofTpacket3Hdr = 0x30 +) + +const ( + NF_INET_PRE_ROUTING = 0x0 + NF_INET_LOCAL_IN = 0x1 + NF_INET_FORWARD = 0x2 + NF_INET_LOCAL_OUT = 0x3 + NF_INET_POST_ROUTING = 0x4 + NF_INET_NUMHOOKS = 0x5 +) + +const ( + NF_NETDEV_INGRESS = 0x0 + NF_NETDEV_NUMHOOKS = 0x1 +) + +const ( + NFPROTO_UNSPEC = 0x0 + NFPROTO_INET = 0x1 + NFPROTO_IPV4 = 0x2 + NFPROTO_ARP = 0x3 + NFPROTO_NETDEV = 0x5 + NFPROTO_BRIDGE = 0x7 + NFPROTO_IPV6 = 0xa + NFPROTO_DECNET = 0xc + NFPROTO_NUMPROTO = 0xd +) + +type Nfgenmsg struct { + Nfgen_family uint8 + Version uint8 + Res_id uint16 +} + +const ( + NFNL_BATCH_UNSPEC = 0x0 + NFNL_BATCH_GENID = 0x1 +) + +const ( + NFT_REG_VERDICT = 0x0 + NFT_REG_1 = 0x1 + NFT_REG_2 = 0x2 + NFT_REG_3 = 0x3 + NFT_REG_4 = 0x4 + NFT_REG32_00 = 0x8 + NFT_REG32_01 = 0x9 + NFT_REG32_02 = 0xa + NFT_REG32_03 = 0xb + NFT_REG32_04 = 0xc + NFT_REG32_05 = 0xd + NFT_REG32_06 = 0xe + NFT_REG32_07 = 0xf + NFT_REG32_08 = 0x10 + NFT_REG32_09 = 0x11 + NFT_REG32_10 = 0x12 + NFT_REG32_11 = 0x13 + NFT_REG32_12 = 0x14 + NFT_REG32_13 = 0x15 + NFT_REG32_14 = 0x16 + NFT_REG32_15 = 0x17 + NFT_CONTINUE = -0x1 + NFT_BREAK = -0x2 + NFT_JUMP = -0x3 + NFT_GOTO = -0x4 + NFT_RETURN = -0x5 + NFT_MSG_NEWTABLE = 0x0 + NFT_MSG_GETTABLE = 0x1 + NFT_MSG_DELTABLE = 0x2 + NFT_MSG_NEWCHAIN = 0x3 + NFT_MSG_GETCHAIN = 0x4 + NFT_MSG_DELCHAIN = 0x5 + NFT_MSG_NEWRULE = 0x6 + NFT_MSG_GETRULE = 0x7 + NFT_MSG_DELRULE = 0x8 + NFT_MSG_NEWSET = 0x9 + NFT_MSG_GETSET = 0xa + NFT_MSG_DELSET = 0xb + NFT_MSG_NEWSETELEM = 0xc + NFT_MSG_GETSETELEM = 0xd + NFT_MSG_DELSETELEM = 0xe + NFT_MSG_NEWGEN = 0xf + NFT_MSG_GETGEN = 0x10 + NFT_MSG_TRACE = 0x11 + NFT_MSG_NEWOBJ = 0x12 + NFT_MSG_GETOBJ = 0x13 + NFT_MSG_DELOBJ = 0x14 + NFT_MSG_GETOBJ_RESET = 0x15 + NFT_MSG_MAX = 0x19 + NFTA_LIST_UNPEC = 0x0 + NFTA_LIST_ELEM = 0x1 + NFTA_HOOK_UNSPEC = 0x0 + NFTA_HOOK_HOOKNUM = 0x1 + NFTA_HOOK_PRIORITY = 0x2 + NFTA_HOOK_DEV = 0x3 + NFT_TABLE_F_DORMANT = 0x1 + NFTA_TABLE_UNSPEC = 0x0 + NFTA_TABLE_NAME = 0x1 + NFTA_TABLE_FLAGS = 0x2 + NFTA_TABLE_USE = 0x3 + NFTA_CHAIN_UNSPEC = 0x0 + NFTA_CHAIN_TABLE = 0x1 + NFTA_CHAIN_HANDLE = 0x2 + NFTA_CHAIN_NAME = 0x3 + NFTA_CHAIN_HOOK = 0x4 + NFTA_CHAIN_POLICY = 0x5 + NFTA_CHAIN_USE = 0x6 + NFTA_CHAIN_TYPE = 0x7 + NFTA_CHAIN_COUNTERS = 0x8 + NFTA_CHAIN_PAD = 0x9 + NFTA_RULE_UNSPEC = 0x0 + NFTA_RULE_TABLE = 0x1 + NFTA_RULE_CHAIN = 0x2 + NFTA_RULE_HANDLE = 0x3 + NFTA_RULE_EXPRESSIONS = 0x4 + NFTA_RULE_COMPAT = 0x5 + NFTA_RULE_POSITION = 0x6 + NFTA_RULE_USERDATA = 0x7 + NFTA_RULE_PAD = 0x8 + NFTA_RULE_ID = 0x9 + NFT_RULE_COMPAT_F_INV = 0x2 + NFT_RULE_COMPAT_F_MASK = 0x2 + NFTA_RULE_COMPAT_UNSPEC = 0x0 + NFTA_RULE_COMPAT_PROTO = 0x1 + NFTA_RULE_COMPAT_FLAGS = 0x2 + NFT_SET_ANONYMOUS = 0x1 + NFT_SET_CONSTANT = 0x2 + NFT_SET_INTERVAL = 0x4 + NFT_SET_MAP = 0x8 + NFT_SET_TIMEOUT = 0x10 + NFT_SET_EVAL = 0x20 + NFT_SET_OBJECT = 0x40 + NFT_SET_POL_PERFORMANCE = 0x0 + NFT_SET_POL_MEMORY = 0x1 + NFTA_SET_DESC_UNSPEC = 0x0 + NFTA_SET_DESC_SIZE = 0x1 + NFTA_SET_UNSPEC = 0x0 + NFTA_SET_TABLE = 0x1 + NFTA_SET_NAME = 0x2 + NFTA_SET_FLAGS = 0x3 + NFTA_SET_KEY_TYPE = 0x4 + NFTA_SET_KEY_LEN = 0x5 + NFTA_SET_DATA_TYPE = 0x6 + NFTA_SET_DATA_LEN = 0x7 + NFTA_SET_POLICY = 0x8 + NFTA_SET_DESC = 0x9 + NFTA_SET_ID = 0xa + NFTA_SET_TIMEOUT = 0xb + NFTA_SET_GC_INTERVAL = 0xc + NFTA_SET_USERDATA = 0xd + NFTA_SET_PAD = 0xe + NFTA_SET_OBJ_TYPE = 0xf + NFT_SET_ELEM_INTERVAL_END = 0x1 + NFTA_SET_ELEM_UNSPEC = 0x0 + NFTA_SET_ELEM_KEY = 0x1 + NFTA_SET_ELEM_DATA = 0x2 + NFTA_SET_ELEM_FLAGS = 0x3 + NFTA_SET_ELEM_TIMEOUT = 0x4 + NFTA_SET_ELEM_EXPIRATION = 0x5 + NFTA_SET_ELEM_USERDATA = 0x6 + NFTA_SET_ELEM_EXPR = 0x7 + NFTA_SET_ELEM_PAD = 0x8 + NFTA_SET_ELEM_OBJREF = 0x9 + NFTA_SET_ELEM_LIST_UNSPEC = 0x0 + NFTA_SET_ELEM_LIST_TABLE = 0x1 + NFTA_SET_ELEM_LIST_SET = 0x2 + NFTA_SET_ELEM_LIST_ELEMENTS = 0x3 + NFTA_SET_ELEM_LIST_SET_ID = 0x4 + NFT_DATA_VALUE = 0x0 + NFT_DATA_VERDICT = 0xffffff00 + NFTA_DATA_UNSPEC = 0x0 + NFTA_DATA_VALUE = 0x1 + NFTA_DATA_VERDICT = 0x2 + NFTA_VERDICT_UNSPEC = 0x0 + NFTA_VERDICT_CODE = 0x1 + NFTA_VERDICT_CHAIN = 0x2 + NFTA_EXPR_UNSPEC = 0x0 + NFTA_EXPR_NAME = 0x1 + NFTA_EXPR_DATA = 0x2 + NFTA_IMMEDIATE_UNSPEC = 0x0 + NFTA_IMMEDIATE_DREG = 0x1 + NFTA_IMMEDIATE_DATA = 0x2 + NFTA_BITWISE_UNSPEC = 0x0 + NFTA_BITWISE_SREG = 0x1 + NFTA_BITWISE_DREG = 0x2 + NFTA_BITWISE_LEN = 0x3 + NFTA_BITWISE_MASK = 0x4 + NFTA_BITWISE_XOR = 0x5 + NFT_BYTEORDER_NTOH = 0x0 + NFT_BYTEORDER_HTON = 0x1 + NFTA_BYTEORDER_UNSPEC = 0x0 + NFTA_BYTEORDER_SREG = 0x1 + NFTA_BYTEORDER_DREG = 0x2 + NFTA_BYTEORDER_OP = 0x3 + NFTA_BYTEORDER_LEN = 0x4 + NFTA_BYTEORDER_SIZE = 0x5 + NFT_CMP_EQ = 0x0 + NFT_CMP_NEQ = 0x1 + NFT_CMP_LT = 0x2 + NFT_CMP_LTE = 0x3 + NFT_CMP_GT = 0x4 + NFT_CMP_GTE = 0x5 + NFTA_CMP_UNSPEC = 0x0 + NFTA_CMP_SREG = 0x1 + NFTA_CMP_OP = 0x2 + NFTA_CMP_DATA = 0x3 + NFT_RANGE_EQ = 0x0 + NFT_RANGE_NEQ = 0x1 + NFTA_RANGE_UNSPEC = 0x0 + NFTA_RANGE_SREG = 0x1 + NFTA_RANGE_OP = 0x2 + NFTA_RANGE_FROM_DATA = 0x3 + NFTA_RANGE_TO_DATA = 0x4 + NFT_LOOKUP_F_INV = 0x1 + NFTA_LOOKUP_UNSPEC = 0x0 + NFTA_LOOKUP_SET = 0x1 + NFTA_LOOKUP_SREG = 0x2 + NFTA_LOOKUP_DREG = 0x3 + NFTA_LOOKUP_SET_ID = 0x4 + NFTA_LOOKUP_FLAGS = 0x5 + NFT_DYNSET_OP_ADD = 0x0 + NFT_DYNSET_OP_UPDATE = 0x1 + NFT_DYNSET_F_INV = 0x1 + NFTA_DYNSET_UNSPEC = 0x0 + NFTA_DYNSET_SET_NAME = 0x1 + NFTA_DYNSET_SET_ID = 0x2 + NFTA_DYNSET_OP = 0x3 + NFTA_DYNSET_SREG_KEY = 0x4 + NFTA_DYNSET_SREG_DATA = 0x5 + NFTA_DYNSET_TIMEOUT = 0x6 + NFTA_DYNSET_EXPR = 0x7 + NFTA_DYNSET_PAD = 0x8 + NFTA_DYNSET_FLAGS = 0x9 + NFT_PAYLOAD_LL_HEADER = 0x0 + NFT_PAYLOAD_NETWORK_HEADER = 0x1 + NFT_PAYLOAD_TRANSPORT_HEADER = 0x2 + NFT_PAYLOAD_CSUM_NONE = 0x0 + NFT_PAYLOAD_CSUM_INET = 0x1 + NFT_PAYLOAD_L4CSUM_PSEUDOHDR = 0x1 + NFTA_PAYLOAD_UNSPEC = 0x0 + NFTA_PAYLOAD_DREG = 0x1 + NFTA_PAYLOAD_BASE = 0x2 + NFTA_PAYLOAD_OFFSET = 0x3 + NFTA_PAYLOAD_LEN = 0x4 + NFTA_PAYLOAD_SREG = 0x5 + NFTA_PAYLOAD_CSUM_TYPE = 0x6 + NFTA_PAYLOAD_CSUM_OFFSET = 0x7 + NFTA_PAYLOAD_CSUM_FLAGS = 0x8 + NFT_EXTHDR_F_PRESENT = 0x1 + NFT_EXTHDR_OP_IPV6 = 0x0 + NFT_EXTHDR_OP_TCPOPT = 0x1 + NFTA_EXTHDR_UNSPEC = 0x0 + NFTA_EXTHDR_DREG = 0x1 + NFTA_EXTHDR_TYPE = 0x2 + NFTA_EXTHDR_OFFSET = 0x3 + NFTA_EXTHDR_LEN = 0x4 + NFTA_EXTHDR_FLAGS = 0x5 + NFTA_EXTHDR_OP = 0x6 + NFTA_EXTHDR_SREG = 0x7 + NFT_META_LEN = 0x0 + NFT_META_PROTOCOL = 0x1 + NFT_META_PRIORITY = 0x2 + NFT_META_MARK = 0x3 + NFT_META_IIF = 0x4 + NFT_META_OIF = 0x5 + NFT_META_IIFNAME = 0x6 + NFT_META_OIFNAME = 0x7 + NFT_META_IIFTYPE = 0x8 + NFT_META_OIFTYPE = 0x9 + NFT_META_SKUID = 0xa + NFT_META_SKGID = 0xb + NFT_META_NFTRACE = 0xc + NFT_META_RTCLASSID = 0xd + NFT_META_SECMARK = 0xe + NFT_META_NFPROTO = 0xf + NFT_META_L4PROTO = 0x10 + NFT_META_BRI_IIFNAME = 0x11 + NFT_META_BRI_OIFNAME = 0x12 + NFT_META_PKTTYPE = 0x13 + NFT_META_CPU = 0x14 + NFT_META_IIFGROUP = 0x15 + NFT_META_OIFGROUP = 0x16 + NFT_META_CGROUP = 0x17 + NFT_META_PRANDOM = 0x18 + NFT_RT_CLASSID = 0x0 + NFT_RT_NEXTHOP4 = 0x1 + NFT_RT_NEXTHOP6 = 0x2 + NFT_RT_TCPMSS = 0x3 + NFT_HASH_JENKINS = 0x0 + NFT_HASH_SYM = 0x1 + NFTA_HASH_UNSPEC = 0x0 + NFTA_HASH_SREG = 0x1 + NFTA_HASH_DREG = 0x2 + NFTA_HASH_LEN = 0x3 + NFTA_HASH_MODULUS = 0x4 + NFTA_HASH_SEED = 0x5 + NFTA_HASH_OFFSET = 0x6 + NFTA_HASH_TYPE = 0x7 + NFTA_META_UNSPEC = 0x0 + NFTA_META_DREG = 0x1 + NFTA_META_KEY = 0x2 + NFTA_META_SREG = 0x3 + NFTA_RT_UNSPEC = 0x0 + NFTA_RT_DREG = 0x1 + NFTA_RT_KEY = 0x2 + NFT_CT_STATE = 0x0 + NFT_CT_DIRECTION = 0x1 + NFT_CT_STATUS = 0x2 + NFT_CT_MARK = 0x3 + NFT_CT_SECMARK = 0x4 + NFT_CT_EXPIRATION = 0x5 + NFT_CT_HELPER = 0x6 + NFT_CT_L3PROTOCOL = 0x7 + NFT_CT_SRC = 0x8 + NFT_CT_DST = 0x9 + NFT_CT_PROTOCOL = 0xa + NFT_CT_PROTO_SRC = 0xb + NFT_CT_PROTO_DST = 0xc + NFT_CT_LABELS = 0xd + NFT_CT_PKTS = 0xe + NFT_CT_BYTES = 0xf + NFT_CT_AVGPKT = 0x10 + NFT_CT_ZONE = 0x11 + NFT_CT_EVENTMASK = 0x12 + NFTA_CT_UNSPEC = 0x0 + NFTA_CT_DREG = 0x1 + NFTA_CT_KEY = 0x2 + NFTA_CT_DIRECTION = 0x3 + NFTA_CT_SREG = 0x4 + NFT_LIMIT_PKTS = 0x0 + NFT_LIMIT_PKT_BYTES = 0x1 + NFT_LIMIT_F_INV = 0x1 + NFTA_LIMIT_UNSPEC = 0x0 + NFTA_LIMIT_RATE = 0x1 + NFTA_LIMIT_UNIT = 0x2 + NFTA_LIMIT_BURST = 0x3 + NFTA_LIMIT_TYPE = 0x4 + NFTA_LIMIT_FLAGS = 0x5 + NFTA_LIMIT_PAD = 0x6 + NFTA_COUNTER_UNSPEC = 0x0 + NFTA_COUNTER_BYTES = 0x1 + NFTA_COUNTER_PACKETS = 0x2 + NFTA_COUNTER_PAD = 0x3 + NFTA_LOG_UNSPEC = 0x0 + NFTA_LOG_GROUP = 0x1 + NFTA_LOG_PREFIX = 0x2 + NFTA_LOG_SNAPLEN = 0x3 + NFTA_LOG_QTHRESHOLD = 0x4 + NFTA_LOG_LEVEL = 0x5 + NFTA_LOG_FLAGS = 0x6 + NFTA_QUEUE_UNSPEC = 0x0 + NFTA_QUEUE_NUM = 0x1 + NFTA_QUEUE_TOTAL = 0x2 + NFTA_QUEUE_FLAGS = 0x3 + NFTA_QUEUE_SREG_QNUM = 0x4 + NFT_QUOTA_F_INV = 0x1 + NFT_QUOTA_F_DEPLETED = 0x2 + NFTA_QUOTA_UNSPEC = 0x0 + NFTA_QUOTA_BYTES = 0x1 + NFTA_QUOTA_FLAGS = 0x2 + NFTA_QUOTA_PAD = 0x3 + NFTA_QUOTA_CONSUMED = 0x4 + NFT_REJECT_ICMP_UNREACH = 0x0 + NFT_REJECT_TCP_RST = 0x1 + NFT_REJECT_ICMPX_UNREACH = 0x2 + NFT_REJECT_ICMPX_NO_ROUTE = 0x0 + NFT_REJECT_ICMPX_PORT_UNREACH = 0x1 + NFT_REJECT_ICMPX_HOST_UNREACH = 0x2 + NFT_REJECT_ICMPX_ADMIN_PROHIBITED = 0x3 + NFTA_REJECT_UNSPEC = 0x0 + NFTA_REJECT_TYPE = 0x1 + NFTA_REJECT_ICMP_CODE = 0x2 + NFT_NAT_SNAT = 0x0 + NFT_NAT_DNAT = 0x1 + NFTA_NAT_UNSPEC = 0x0 + NFTA_NAT_TYPE = 0x1 + NFTA_NAT_FAMILY = 0x2 + NFTA_NAT_REG_ADDR_MIN = 0x3 + NFTA_NAT_REG_ADDR_MAX = 0x4 + NFTA_NAT_REG_PROTO_MIN = 0x5 + NFTA_NAT_REG_PROTO_MAX = 0x6 + NFTA_NAT_FLAGS = 0x7 + NFTA_MASQ_UNSPEC = 0x0 + NFTA_MASQ_FLAGS = 0x1 + NFTA_MASQ_REG_PROTO_MIN = 0x2 + NFTA_MASQ_REG_PROTO_MAX = 0x3 + NFTA_REDIR_UNSPEC = 0x0 + NFTA_REDIR_REG_PROTO_MIN = 0x1 + NFTA_REDIR_REG_PROTO_MAX = 0x2 + NFTA_REDIR_FLAGS = 0x3 + NFTA_DUP_UNSPEC = 0x0 + NFTA_DUP_SREG_ADDR = 0x1 + NFTA_DUP_SREG_DEV = 0x2 + NFTA_FWD_UNSPEC = 0x0 + NFTA_FWD_SREG_DEV = 0x1 + NFTA_OBJREF_UNSPEC = 0x0 + NFTA_OBJREF_IMM_TYPE = 0x1 + NFTA_OBJREF_IMM_NAME = 0x2 + NFTA_OBJREF_SET_SREG = 0x3 + NFTA_OBJREF_SET_NAME = 0x4 + NFTA_OBJREF_SET_ID = 0x5 + NFTA_GEN_UNSPEC = 0x0 + NFTA_GEN_ID = 0x1 + NFTA_GEN_PROC_PID = 0x2 + NFTA_GEN_PROC_NAME = 0x3 + NFTA_FIB_UNSPEC = 0x0 + NFTA_FIB_DREG = 0x1 + NFTA_FIB_RESULT = 0x2 + NFTA_FIB_FLAGS = 0x3 + NFT_FIB_RESULT_UNSPEC = 0x0 + NFT_FIB_RESULT_OIF = 0x1 + NFT_FIB_RESULT_OIFNAME = 0x2 + NFT_FIB_RESULT_ADDRTYPE = 0x3 + NFTA_FIB_F_SADDR = 0x1 + NFTA_FIB_F_DADDR = 0x2 + NFTA_FIB_F_MARK = 0x4 + NFTA_FIB_F_IIF = 0x8 + NFTA_FIB_F_OIF = 0x10 + NFTA_FIB_F_PRESENT = 0x20 + NFTA_CT_HELPER_UNSPEC = 0x0 + NFTA_CT_HELPER_NAME = 0x1 + NFTA_CT_HELPER_L3PROTO = 0x2 + NFTA_CT_HELPER_L4PROTO = 0x3 + NFTA_OBJ_UNSPEC = 0x0 + NFTA_OBJ_TABLE = 0x1 + NFTA_OBJ_NAME = 0x2 + NFTA_OBJ_TYPE = 0x3 + NFTA_OBJ_DATA = 0x4 + NFTA_OBJ_USE = 0x5 + NFTA_TRACE_UNSPEC = 0x0 + NFTA_TRACE_TABLE = 0x1 + NFTA_TRACE_CHAIN = 0x2 + NFTA_TRACE_RULE_HANDLE = 0x3 + NFTA_TRACE_TYPE = 0x4 + NFTA_TRACE_VERDICT = 0x5 + NFTA_TRACE_ID = 0x6 + NFTA_TRACE_LL_HEADER = 0x7 + NFTA_TRACE_NETWORK_HEADER = 0x8 + NFTA_TRACE_TRANSPORT_HEADER = 0x9 + NFTA_TRACE_IIF = 0xa + NFTA_TRACE_IIFTYPE = 0xb + NFTA_TRACE_OIF = 0xc + NFTA_TRACE_OIFTYPE = 0xd + NFTA_TRACE_MARK = 0xe + NFTA_TRACE_NFPROTO = 0xf + NFTA_TRACE_POLICY = 0x10 + NFTA_TRACE_PAD = 0x11 + NFT_TRACETYPE_UNSPEC = 0x0 + NFT_TRACETYPE_POLICY = 0x1 + NFT_TRACETYPE_RETURN = 0x2 + NFT_TRACETYPE_RULE = 0x3 + NFTA_NG_UNSPEC = 0x0 + NFTA_NG_DREG = 0x1 + NFTA_NG_MODULUS = 0x2 + NFTA_NG_TYPE = 0x3 + NFTA_NG_OFFSET = 0x4 + NFT_NG_INCREMENTAL = 0x0 + NFT_NG_RANDOM = 0x1 +) + +type RTCTime struct { + Sec int32 + Min int32 + Hour int32 + Mday int32 + Mon int32 + Year int32 + Wday int32 + Yday int32 + Isdst int32 +} + +type RTCWkAlrm struct { + Enabled uint8 + Pending uint8 + _ [2]byte + Time RTCTime +} + +type RTCPLLInfo struct { + Ctrl int32 + Value int32 + Max int32 + Min int32 + Posmult int32 + Negmult int32 + Clock int64 +} diff --git a/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go b/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go index 9dbbb1ce52..8e7384b89c 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_linux_sparc64.go @@ -376,97 +376,123 @@ const ( ) const ( - IFA_UNSPEC = 0x0 - IFA_ADDRESS = 0x1 - IFA_LOCAL = 0x2 - IFA_LABEL = 0x3 - IFA_BROADCAST = 0x4 - IFA_ANYCAST = 0x5 - IFA_CACHEINFO = 0x6 - IFA_MULTICAST = 0x7 - IFLA_UNSPEC = 0x0 - IFLA_ADDRESS = 0x1 - IFLA_BROADCAST = 0x2 - IFLA_IFNAME = 0x3 - IFLA_MTU = 0x4 - IFLA_LINK = 0x5 - IFLA_QDISC = 0x6 - IFLA_STATS = 0x7 - IFLA_COST = 0x8 - IFLA_PRIORITY = 0x9 - IFLA_MASTER = 0xa - IFLA_WIRELESS = 0xb - IFLA_PROTINFO = 0xc - IFLA_TXQLEN = 0xd - IFLA_MAP = 0xe - IFLA_WEIGHT = 0xf - IFLA_OPERSTATE = 0x10 - IFLA_LINKMODE = 0x11 - IFLA_LINKINFO = 0x12 - IFLA_NET_NS_PID = 0x13 - IFLA_IFALIAS = 0x14 - IFLA_MAX = 0x2a - RT_SCOPE_UNIVERSE = 0x0 - RT_SCOPE_SITE = 0xc8 - RT_SCOPE_LINK = 0xfd - RT_SCOPE_HOST = 0xfe - RT_SCOPE_NOWHERE = 0xff - RT_TABLE_UNSPEC = 0x0 - RT_TABLE_COMPAT = 0xfc - RT_TABLE_DEFAULT = 0xfd - RT_TABLE_MAIN = 0xfe - RT_TABLE_LOCAL = 0xff - RT_TABLE_MAX = 0xffffffff - RTA_UNSPEC = 0x0 - RTA_DST = 0x1 - RTA_SRC = 0x2 - RTA_IIF = 0x3 - RTA_OIF = 0x4 - RTA_GATEWAY = 0x5 - RTA_PRIORITY = 0x6 - RTA_PREFSRC = 0x7 - RTA_METRICS = 0x8 - RTA_MULTIPATH = 0x9 - RTA_FLOW = 0xb - RTA_CACHEINFO = 0xc - RTA_TABLE = 0xf - RTN_UNSPEC = 0x0 - RTN_UNICAST = 0x1 - RTN_LOCAL = 0x2 - RTN_BROADCAST = 0x3 - RTN_ANYCAST = 0x4 - RTN_MULTICAST = 0x5 - RTN_BLACKHOLE = 0x6 - RTN_UNREACHABLE = 0x7 - RTN_PROHIBIT = 0x8 - RTN_THROW = 0x9 - RTN_NAT = 0xa - RTN_XRESOLVE = 0xb - RTNLGRP_NONE = 0x0 - RTNLGRP_LINK = 0x1 - RTNLGRP_NOTIFY = 0x2 - RTNLGRP_NEIGH = 0x3 - RTNLGRP_TC = 0x4 - RTNLGRP_IPV4_IFADDR = 0x5 - RTNLGRP_IPV4_MROUTE = 0x6 - RTNLGRP_IPV4_ROUTE = 0x7 - RTNLGRP_IPV4_RULE = 0x8 - RTNLGRP_IPV6_IFADDR = 0x9 - RTNLGRP_IPV6_MROUTE = 0xa - RTNLGRP_IPV6_ROUTE = 0xb - RTNLGRP_IPV6_IFINFO = 0xc - RTNLGRP_IPV6_PREFIX = 0x12 - RTNLGRP_IPV6_RULE = 0x13 - RTNLGRP_ND_USEROPT = 0x14 - SizeofNlMsghdr = 0x10 - SizeofNlMsgerr = 0x14 - SizeofRtGenmsg = 0x1 - SizeofNlAttr = 0x4 - SizeofRtAttr = 0x4 - SizeofIfInfomsg = 0x10 - SizeofIfAddrmsg = 0x8 - SizeofRtMsg = 0xc - SizeofRtNexthop = 0x8 + IFA_UNSPEC = 0x0 + IFA_ADDRESS = 0x1 + IFA_LOCAL = 0x2 + IFA_LABEL = 0x3 + IFA_BROADCAST = 0x4 + IFA_ANYCAST = 0x5 + IFA_CACHEINFO = 0x6 + IFA_MULTICAST = 0x7 + IFLA_UNSPEC = 0x0 + IFLA_ADDRESS = 0x1 + IFLA_BROADCAST = 0x2 + IFLA_IFNAME = 0x3 + IFLA_MTU = 0x4 + IFLA_LINK = 0x5 + IFLA_QDISC = 0x6 + IFLA_STATS = 0x7 + IFLA_COST = 0x8 + IFLA_PRIORITY = 0x9 + IFLA_MASTER = 0xa + IFLA_WIRELESS = 0xb + IFLA_PROTINFO = 0xc + IFLA_TXQLEN = 0xd + IFLA_MAP = 0xe + IFLA_WEIGHT = 0xf + IFLA_OPERSTATE = 0x10 + IFLA_LINKMODE = 0x11 + IFLA_LINKINFO = 0x12 + IFLA_NET_NS_PID = 0x13 + IFLA_IFALIAS = 0x14 + IFLA_NUM_VF = 0x15 + IFLA_VFINFO_LIST = 0x16 + IFLA_STATS64 = 0x17 + IFLA_VF_PORTS = 0x18 + IFLA_PORT_SELF = 0x19 + IFLA_AF_SPEC = 0x1a + IFLA_GROUP = 0x1b + IFLA_NET_NS_FD = 0x1c + IFLA_EXT_MASK = 0x1d + IFLA_PROMISCUITY = 0x1e + IFLA_NUM_TX_QUEUES = 0x1f + IFLA_NUM_RX_QUEUES = 0x20 + IFLA_CARRIER = 0x21 + IFLA_PHYS_PORT_ID = 0x22 + IFLA_CARRIER_CHANGES = 0x23 + IFLA_PHYS_SWITCH_ID = 0x24 + IFLA_LINK_NETNSID = 0x25 + IFLA_PHYS_PORT_NAME = 0x26 + IFLA_PROTO_DOWN = 0x27 + IFLA_GSO_MAX_SEGS = 0x28 + IFLA_GSO_MAX_SIZE = 0x29 + IFLA_PAD = 0x2a + IFLA_XDP = 0x2b + IFLA_EVENT = 0x2c + IFLA_NEW_NETNSID = 0x2d + IFLA_IF_NETNSID = 0x2e + IFLA_MAX = 0x2e + RT_SCOPE_UNIVERSE = 0x0 + RT_SCOPE_SITE = 0xc8 + RT_SCOPE_LINK = 0xfd + RT_SCOPE_HOST = 0xfe + RT_SCOPE_NOWHERE = 0xff + RT_TABLE_UNSPEC = 0x0 + RT_TABLE_COMPAT = 0xfc + RT_TABLE_DEFAULT = 0xfd + RT_TABLE_MAIN = 0xfe + RT_TABLE_LOCAL = 0xff + RT_TABLE_MAX = 0xffffffff + RTA_UNSPEC = 0x0 + RTA_DST = 0x1 + RTA_SRC = 0x2 + RTA_IIF = 0x3 + RTA_OIF = 0x4 + RTA_GATEWAY = 0x5 + RTA_PRIORITY = 0x6 + RTA_PREFSRC = 0x7 + RTA_METRICS = 0x8 + RTA_MULTIPATH = 0x9 + RTA_FLOW = 0xb + RTA_CACHEINFO = 0xc + RTA_TABLE = 0xf + RTN_UNSPEC = 0x0 + RTN_UNICAST = 0x1 + RTN_LOCAL = 0x2 + RTN_BROADCAST = 0x3 + RTN_ANYCAST = 0x4 + RTN_MULTICAST = 0x5 + RTN_BLACKHOLE = 0x6 + RTN_UNREACHABLE = 0x7 + RTN_PROHIBIT = 0x8 + RTN_THROW = 0x9 + RTN_NAT = 0xa + RTN_XRESOLVE = 0xb + RTNLGRP_NONE = 0x0 + RTNLGRP_LINK = 0x1 + RTNLGRP_NOTIFY = 0x2 + RTNLGRP_NEIGH = 0x3 + RTNLGRP_TC = 0x4 + RTNLGRP_IPV4_IFADDR = 0x5 + RTNLGRP_IPV4_MROUTE = 0x6 + RTNLGRP_IPV4_ROUTE = 0x7 + RTNLGRP_IPV4_RULE = 0x8 + RTNLGRP_IPV6_IFADDR = 0x9 + RTNLGRP_IPV6_MROUTE = 0xa + RTNLGRP_IPV6_ROUTE = 0xb + RTNLGRP_IPV6_IFINFO = 0xc + RTNLGRP_IPV6_PREFIX = 0x12 + RTNLGRP_IPV6_RULE = 0x13 + RTNLGRP_ND_USEROPT = 0x14 + SizeofNlMsghdr = 0x10 + SizeofNlMsgerr = 0x14 + SizeofRtGenmsg = 0x1 + SizeofNlAttr = 0x4 + SizeofRtAttr = 0x4 + SizeofIfInfomsg = 0x10 + SizeofIfAddrmsg = 0x8 + SizeofRtMsg = 0xc + SizeofRtNexthop = 0x8 ) type NlMsghdr struct { diff --git a/vendor/golang.org/x/sys/unix/ztypes_netbsd_386.go b/vendor/golang.org/x/sys/unix/ztypes_netbsd_386.go index da70faa82d..4b86fb2b33 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_netbsd_386.go +++ b/vendor/golang.org/x/sys/unix/ztypes_netbsd_386.go @@ -103,6 +103,15 @@ const ( PathMax = 0x400 ) +const ( + FADV_NORMAL = 0x0 + FADV_RANDOM = 0x1 + FADV_SEQUENTIAL = 0x2 + FADV_WILLNEED = 0x3 + FADV_DONTNEED = 0x4 + FADV_NOREUSE = 0x5 +) + type RawSockaddrInet4 struct { Len uint8 Family uint8 diff --git a/vendor/golang.org/x/sys/unix/ztypes_netbsd_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_netbsd_amd64.go index 0963ab8c43..9048a509d0 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_netbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_netbsd_amd64.go @@ -107,6 +107,15 @@ const ( PathMax = 0x400 ) +const ( + FADV_NORMAL = 0x0 + FADV_RANDOM = 0x1 + FADV_SEQUENTIAL = 0x2 + FADV_WILLNEED = 0x3 + FADV_DONTNEED = 0x4 + FADV_NOREUSE = 0x5 +) + type RawSockaddrInet4 struct { Len uint8 Family uint8 diff --git a/vendor/golang.org/x/sys/unix/ztypes_netbsd_arm.go b/vendor/golang.org/x/sys/unix/ztypes_netbsd_arm.go index 211f641934..00525e7b02 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_netbsd_arm.go +++ b/vendor/golang.org/x/sys/unix/ztypes_netbsd_arm.go @@ -108,6 +108,15 @@ const ( PathMax = 0x400 ) +const ( + FADV_NORMAL = 0x0 + FADV_RANDOM = 0x1 + FADV_SEQUENTIAL = 0x2 + FADV_WILLNEED = 0x3 + FADV_DONTNEED = 0x4 + FADV_NOREUSE = 0x5 +) + type RawSockaddrInet4 struct { Len uint8 Family uint8 diff --git a/vendor/golang.org/x/sys/unix/ztypes_openbsd_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_openbsd_amd64.go index d53141085a..5a9c818485 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_openbsd_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_openbsd_amd64.go @@ -74,30 +74,30 @@ const ( ) type Stat_t struct { - Mode uint32 - Dev int32 - Ino uint64 - Nlink uint32 - Uid uint32 - Gid uint32 - Rdev int32 - Atim Timespec - Mtim Timespec - Ctim Timespec - Size int64 - Blocks int64 - Blksize uint32 - Flags uint32 - Gen uint32 - Pad_cgo_0 [4]byte - X__st_birthtim Timespec + Mode uint32 + Dev int32 + Ino uint64 + Nlink uint32 + Uid uint32 + Gid uint32 + Rdev int32 + Atim Timespec + Mtim Timespec + Ctim Timespec + Size int64 + Blocks int64 + Blksize int32 + Flags uint32 + Gen uint32 + _ [4]byte + _ Timespec } type Statfs_t struct { F_flags uint32 F_bsize uint32 F_iosize uint32 - Pad_cgo_0 [4]byte + _ [4]byte F_blocks uint64 F_bfree uint64 F_bavail int64 @@ -116,7 +116,7 @@ type Statfs_t struct { F_mntonname [90]int8 F_mntfromname [90]int8 F_mntfromspec [90]int8 - Pad_cgo_1 [2]byte + _ [2]byte Mount_info [160]byte } @@ -129,13 +129,13 @@ type Flock_t struct { } type Dirent struct { - Fileno uint64 - Off int64 - Reclen uint16 - Type uint8 - Namlen uint8 - X__d_padding [4]uint8 - Name [256]int8 + Fileno uint64 + Off int64 + Reclen uint16 + Type uint8 + Namlen uint8 + _ [4]uint8 + Name [256]int8 } type Fsid struct { @@ -216,10 +216,10 @@ type IPv6Mreq struct { type Msghdr struct { Name *byte Namelen uint32 - Pad_cgo_0 [4]byte + _ [4]byte Iov *Iovec Iovlen uint32 - Pad_cgo_1 [4]byte + _ [4]byte Control *byte Controllen uint32 Flags int32 @@ -281,8 +281,8 @@ type FdSet struct { } const ( - SizeofIfMsghdr = 0xf8 - SizeofIfData = 0xe0 + SizeofIfMsghdr = 0xa8 + SizeofIfData = 0x90 SizeofIfaMsghdr = 0x18 SizeofIfAnnounceMsghdr = 0x1a SizeofRtMsghdr = 0x60 @@ -311,7 +311,7 @@ type IfData struct { Link_state uint8 Mtu uint32 Metric uint32 - Pad uint32 + Rdomain uint32 Baudrate uint64 Ipackets uint64 Ierrors uint64 @@ -323,12 +323,11 @@ type IfData struct { Imcasts uint64 Omcasts uint64 Iqdrops uint64 + Oqdrops uint64 Noproto uint64 Capabilities uint32 - Pad_cgo_0 [4]byte + _ [4]byte Lastchange Timeval - Mclpool [7]Mclpool - Pad_cgo_1 [4]byte } type IfaMsghdr struct { @@ -389,13 +388,7 @@ type RtMetrics struct { Pad uint32 } -type Mclpool struct { - Grown int32 - Alive uint16 - Hwm uint16 - Cwm uint16 - Lwm uint16 -} +type Mclpool struct{} const ( SizeofBpfVersion = 0x4 @@ -416,9 +409,9 @@ type BpfStat struct { } type BpfProgram struct { - Len uint32 - Pad_cgo_0 [4]byte - Insns *BpfInsn + Len uint32 + _ [4]byte + Insns *BpfInsn } type BpfInsn struct { @@ -429,11 +422,11 @@ type BpfInsn struct { } type BpfHdr struct { - Tstamp BpfTimeval - Caplen uint32 - Datalen uint32 - Hdrlen uint16 - Pad_cgo_0 [2]byte + Tstamp BpfTimeval + Caplen uint32 + Datalen uint32 + Hdrlen uint16 + _ [2]byte } type BpfTimeval struct { diff --git a/vendor/golang.org/x/sys/unix/ztypes_solaris_amd64.go b/vendor/golang.org/x/sys/unix/ztypes_solaris_amd64.go index d445452486..2248598d03 100644 --- a/vendor/golang.org/x/sys/unix/ztypes_solaris_amd64.go +++ b/vendor/golang.org/x/sys/unix/ztypes_solaris_amd64.go @@ -93,40 +93,40 @@ const ( ) type Stat_t struct { - Dev uint64 - Ino uint64 - Mode uint32 - Nlink uint32 - Uid uint32 - Gid uint32 - Rdev uint64 - Size int64 - Atim Timespec - Mtim Timespec - Ctim Timespec - Blksize int32 - Pad_cgo_0 [4]byte - Blocks int64 - Fstype [16]int8 + Dev uint64 + Ino uint64 + Mode uint32 + Nlink uint32 + Uid uint32 + Gid uint32 + Rdev uint64 + Size int64 + Atim Timespec + Mtim Timespec + Ctim Timespec + Blksize int32 + _ [4]byte + Blocks int64 + Fstype [16]int8 } type Flock_t struct { - Type int16 - Whence int16 - Pad_cgo_0 [4]byte - Start int64 - Len int64 - Sysid int32 - Pid int32 - Pad [4]int64 + Type int16 + Whence int16 + _ [4]byte + Start int64 + Len int64 + Sysid int32 + Pid int32 + Pad [4]int64 } type Dirent struct { - Ino uint64 - Off int64 - Reclen uint16 - Name [1]int8 - Pad_cgo_0 [5]byte + Ino uint64 + Off int64 + Reclen uint16 + Name [1]int8 + _ [5]byte } type _Fsblkcnt_t uint64 @@ -213,13 +213,13 @@ type IPv6Mreq struct { type Msghdr struct { Name *byte Namelen uint32 - Pad_cgo_0 [4]byte + _ [4]byte Iov *Iovec Iovlen int32 - Pad_cgo_1 [4]byte + _ [4]byte Accrights *int8 Accrightslen int32 - Pad_cgo_2 [4]byte + _ [4]byte } type Cmsghdr struct { @@ -271,11 +271,11 @@ type Utsname struct { } type Ustat_t struct { - Tfree int64 - Tinode uint64 - Fname [6]int8 - Fpack [6]int8 - Pad_cgo_0 [4]byte + Tfree int64 + Tinode uint64 + Fname [6]int8 + Fpack [6]int8 + _ [4]byte } const ( @@ -295,21 +295,21 @@ const ( ) type IfMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Data IfData + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Data IfData } type IfData struct { Type uint8 Addrlen uint8 Hdrlen uint8 - Pad_cgo_0 [1]byte + _ [1]byte Mtu uint32 Metric uint32 Baudrate uint32 @@ -328,30 +328,30 @@ type IfData struct { } type IfaMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Addrs int32 - Flags int32 - Index uint16 - Pad_cgo_0 [2]byte - Metric int32 + Msglen uint16 + Version uint8 + Type uint8 + Addrs int32 + Flags int32 + Index uint16 + _ [2]byte + Metric int32 } type RtMsghdr struct { - Msglen uint16 - Version uint8 - Type uint8 - Index uint16 - Pad_cgo_0 [2]byte - Flags int32 - Addrs int32 - Pid int32 - Seq int32 - Errno int32 - Use int32 - Inits uint32 - Rmx RtMetrics + Msglen uint16 + Version uint8 + Type uint8 + Index uint16 + _ [2]byte + Flags int32 + Addrs int32 + Pid int32 + Seq int32 + Errno int32 + Use int32 + Inits uint32 + Rmx RtMetrics } type RtMetrics struct { @@ -388,9 +388,9 @@ type BpfStat struct { } type BpfProgram struct { - Len uint32 - Pad_cgo_0 [4]byte - Insns *BpfInsn + Len uint32 + _ [4]byte + Insns *BpfInsn } type BpfInsn struct { @@ -406,30 +406,30 @@ type BpfTimeval struct { } type BpfHdr struct { - Tstamp BpfTimeval - Caplen uint32 - Datalen uint32 - Hdrlen uint16 - Pad_cgo_0 [2]byte + Tstamp BpfTimeval + Caplen uint32 + Datalen uint32 + Hdrlen uint16 + _ [2]byte } type Termios struct { - Iflag uint32 - Oflag uint32 - Cflag uint32 - Lflag uint32 - Cc [19]uint8 - Pad_cgo_0 [1]byte + Iflag uint32 + Oflag uint32 + Cflag uint32 + Lflag uint32 + Cc [19]uint8 + _ [1]byte } type Termio struct { - Iflag uint16 - Oflag uint16 - Cflag uint16 - Lflag uint16 - Line int8 - Cc [8]uint8 - Pad_cgo_0 [1]byte + Iflag uint16 + Oflag uint16 + Cflag uint16 + Lflag uint16 + Line int8 + Cc [8]uint8 + _ [1]byte } type Winsize struct { diff --git a/vendor/golang.org/x/sys/windows/asm_windows_386.s b/vendor/golang.org/x/sys/windows/asm_windows_386.s index 1c20dd2f89..21d994d318 100644 --- a/vendor/golang.org/x/sys/windows/asm_windows_386.s +++ b/vendor/golang.org/x/sys/windows/asm_windows_386.s @@ -6,8 +6,8 @@ // System calls for 386, Windows are implemented in runtime/syscall_windows.goc // -TEXT ·getprocaddress(SB), 7, $0-8 +TEXT ·getprocaddress(SB), 7, $0-16 JMP syscall·getprocaddress(SB) -TEXT ·loadlibrary(SB), 7, $0-4 +TEXT ·loadlibrary(SB), 7, $0-12 JMP syscall·loadlibrary(SB) diff --git a/vendor/golang.org/x/sys/windows/asm_windows_amd64.s b/vendor/golang.org/x/sys/windows/asm_windows_amd64.s index 4d025ab556..5bfdf79741 100644 --- a/vendor/golang.org/x/sys/windows/asm_windows_amd64.s +++ b/vendor/golang.org/x/sys/windows/asm_windows_amd64.s @@ -9,5 +9,5 @@ TEXT ·getprocaddress(SB), 7, $0-32 JMP syscall·getprocaddress(SB) -TEXT ·loadlibrary(SB), 7, $0-8 +TEXT ·loadlibrary(SB), 7, $0-24 JMP syscall·loadlibrary(SB) diff --git a/vendor/golang.org/x/sys/windows/registry/key.go b/vendor/golang.org/x/sys/windows/registry/key.go index d0beb19564..c256483434 100644 --- a/vendor/golang.org/x/sys/windows/registry/key.go +++ b/vendor/golang.org/x/sys/windows/registry/key.go @@ -113,12 +113,10 @@ func OpenRemoteKey(pcname string, k Key) (Key, error) { // The parameter n controls the number of returned names, // analogous to the way os.File.Readdirnames works. func (k Key) ReadSubKeyNames(n int) ([]string, error) { - ki, err := k.Stat() - if err != nil { - return nil, err - } - names := make([]string, 0, ki.SubKeyCount) - buf := make([]uint16, ki.MaxSubKeyLen+1) // extra room for terminating zero byte + names := make([]string, 0) + // Registry key size limit is 255 bytes and described there: + // https://msdn.microsoft.com/library/windows/desktop/ms724872.aspx + buf := make([]uint16, 256) //plus extra room for terminating zero byte loopItems: for i := uint32(0); ; i++ { if n > 0 { diff --git a/vendor/golang.org/x/sys/windows/registry/zsyscall_windows.go b/vendor/golang.org/x/sys/windows/registry/zsyscall_windows.go index ceebdd7726..3778075da0 100644 --- a/vendor/golang.org/x/sys/windows/registry/zsyscall_windows.go +++ b/vendor/golang.org/x/sys/windows/registry/zsyscall_windows.go @@ -1,4 +1,4 @@ -// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT +// Code generated by 'go generate'; DO NOT EDIT. package registry diff --git a/vendor/golang.org/x/sys/windows/security_windows.go b/vendor/golang.org/x/sys/windows/security_windows.go index f1ec5dc4ee..4f17a3331f 100644 --- a/vendor/golang.org/x/sys/windows/security_windows.go +++ b/vendor/golang.org/x/sys/windows/security_windows.go @@ -296,6 +296,7 @@ const ( TOKEN_ADJUST_PRIVILEGES TOKEN_ADJUST_GROUPS TOKEN_ADJUST_DEFAULT + TOKEN_ADJUST_SESSIONID TOKEN_ALL_ACCESS = STANDARD_RIGHTS_REQUIRED | TOKEN_ASSIGN_PRIMARY | @@ -305,7 +306,8 @@ const ( TOKEN_QUERY_SOURCE | TOKEN_ADJUST_PRIVILEGES | TOKEN_ADJUST_GROUPS | - TOKEN_ADJUST_DEFAULT + TOKEN_ADJUST_DEFAULT | + TOKEN_ADJUST_SESSIONID TOKEN_READ = STANDARD_RIGHTS_READ | TOKEN_QUERY TOKEN_WRITE = STANDARD_RIGHTS_WRITE | TOKEN_ADJUST_PRIVILEGES | diff --git a/vendor/golang.org/x/sys/windows/service.go b/vendor/golang.org/x/sys/windows/service.go index a500dd7dfc..62fc31b40b 100644 --- a/vendor/golang.org/x/sys/windows/service.go +++ b/vendor/golang.org/x/sys/windows/service.go @@ -43,6 +43,11 @@ const ( SC_STATUS_PROCESS_INFO = 0 + SC_ACTION_NONE = 0 + SC_ACTION_RESTART = 1 + SC_ACTION_REBOOT = 2 + SC_ACTION_RUN_COMMAND = 3 + SERVICE_STOPPED = 1 SERVICE_START_PENDING = 2 SERVICE_STOP_PENDING = 3 @@ -148,6 +153,19 @@ type ENUM_SERVICE_STATUS_PROCESS struct { ServiceStatusProcess SERVICE_STATUS_PROCESS } +type SERVICE_FAILURE_ACTIONS struct { + ResetPeriod uint32 + RebootMsg *uint16 + Command *uint16 + ActionsCount uint32 + Actions *SC_ACTION +} + +type SC_ACTION struct { + Type uint32 + Delay uint32 +} + //sys CloseServiceHandle(handle Handle) (err error) = advapi32.CloseServiceHandle //sys CreateService(mgr Handle, serviceName *uint16, displayName *uint16, access uint32, srvType uint32, startType uint32, errCtl uint32, pathName *uint16, loadOrderGroup *uint16, tagId *uint32, dependencies *uint16, serviceStartName *uint16, password *uint16) (handle Handle, err error) [failretval==0] = advapi32.CreateServiceW //sys OpenService(mgr Handle, serviceName *uint16, access uint32) (handle Handle, err error) [failretval==0] = advapi32.OpenServiceW @@ -162,3 +180,4 @@ type ENUM_SERVICE_STATUS_PROCESS struct { //sys ChangeServiceConfig2(service Handle, infoLevel uint32, info *byte) (err error) = advapi32.ChangeServiceConfig2W //sys QueryServiceConfig2(service Handle, infoLevel uint32, buff *byte, buffSize uint32, bytesNeeded *uint32) (err error) = advapi32.QueryServiceConfig2W //sys EnumServicesStatusEx(mgr Handle, infoLevel uint32, serviceType uint32, serviceState uint32, services *byte, bufSize uint32, bytesNeeded *uint32, servicesReturned *uint32, resumeHandle *uint32, groupName *uint16) (err error) = advapi32.EnumServicesStatusExW +//sys QueryServiceStatusEx(service Handle, infoLevel uint32, buff *byte, buffSize uint32, bytesNeeded *uint32) (err error) = advapi32.QueryServiceStatusEx diff --git a/vendor/golang.org/x/sys/windows/svc/event.go b/vendor/golang.org/x/sys/windows/svc/event.go new file mode 100644 index 0000000000..0508e22881 --- /dev/null +++ b/vendor/golang.org/x/sys/windows/svc/event.go @@ -0,0 +1,48 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build windows + +package svc + +import ( + "errors" + + "golang.org/x/sys/windows" +) + +// event represents auto-reset, initially non-signaled Windows event. +// It is used to communicate between go and asm parts of this package. +type event struct { + h windows.Handle +} + +func newEvent() (*event, error) { + h, err := windows.CreateEvent(nil, 0, 0, nil) + if err != nil { + return nil, err + } + return &event{h: h}, nil +} + +func (e *event) Close() error { + return windows.CloseHandle(e.h) +} + +func (e *event) Set() error { + return windows.SetEvent(e.h) +} + +func (e *event) Wait() error { + s, err := windows.WaitForSingleObject(e.h, windows.INFINITE) + switch s { + case windows.WAIT_OBJECT_0: + break + case windows.WAIT_FAILED: + return err + default: + return errors.New("unexpected result from WaitForSingleObject") + } + return nil +} diff --git a/vendor/golang.org/x/sys/windows/svc/go12.c b/vendor/golang.org/x/sys/windows/svc/go12.c new file mode 100644 index 0000000000..6f1be1fa3b --- /dev/null +++ b/vendor/golang.org/x/sys/windows/svc/go12.c @@ -0,0 +1,24 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build windows +// +build !go1.3 + +// copied from pkg/runtime +typedef unsigned int uint32; +typedef unsigned long long int uint64; +#ifdef _64BIT +typedef uint64 uintptr; +#else +typedef uint32 uintptr; +#endif + +// from sys_386.s or sys_amd64.s +void ·servicemain(void); + +void +·getServiceMain(uintptr *r) +{ + *r = (uintptr)·servicemain; +} diff --git a/vendor/golang.org/x/sys/windows/svc/go12.go b/vendor/golang.org/x/sys/windows/svc/go12.go new file mode 100644 index 0000000000..cd8b913c99 --- /dev/null +++ b/vendor/golang.org/x/sys/windows/svc/go12.go @@ -0,0 +1,11 @@ +// Copyright 2014 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build windows +// +build !go1.3 + +package svc + +// from go12.c +func getServiceMain(r *uintptr) diff --git a/vendor/golang.org/x/sys/windows/svc/go13.go b/vendor/golang.org/x/sys/windows/svc/go13.go new file mode 100644 index 0000000000..9d7f3cec54 --- /dev/null +++ b/vendor/golang.org/x/sys/windows/svc/go13.go @@ -0,0 +1,31 @@ +// Copyright 2014 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build windows +// +build go1.3 + +package svc + +import "unsafe" + +const ptrSize = 4 << (^uintptr(0) >> 63) // unsafe.Sizeof(uintptr(0)) but an ideal const + +// Should be a built-in for unsafe.Pointer? +func add(p unsafe.Pointer, x uintptr) unsafe.Pointer { + return unsafe.Pointer(uintptr(p) + x) +} + +// funcPC returns the entry PC of the function f. +// It assumes that f is a func value. Otherwise the behavior is undefined. +func funcPC(f interface{}) uintptr { + return **(**uintptr)(add(unsafe.Pointer(&f), ptrSize)) +} + +// from sys_386.s and sys_amd64.s +func servicectlhandler(ctl uint32) uintptr +func servicemain(argc uint32, argv **uint16) + +func getServiceMain(r *uintptr) { + *r = funcPC(servicemain) +} diff --git a/vendor/golang.org/x/sys/windows/svc/security.go b/vendor/golang.org/x/sys/windows/svc/security.go new file mode 100644 index 0000000000..6fbc9236ed --- /dev/null +++ b/vendor/golang.org/x/sys/windows/svc/security.go @@ -0,0 +1,62 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build windows + +package svc + +import ( + "unsafe" + + "golang.org/x/sys/windows" +) + +func allocSid(subAuth0 uint32) (*windows.SID, error) { + var sid *windows.SID + err := windows.AllocateAndInitializeSid(&windows.SECURITY_NT_AUTHORITY, + 1, subAuth0, 0, 0, 0, 0, 0, 0, 0, &sid) + if err != nil { + return nil, err + } + return sid, nil +} + +// IsAnInteractiveSession determines if calling process is running interactively. +// It queries the process token for membership in the Interactive group. +// http://stackoverflow.com/questions/2668851/how-do-i-detect-that-my-application-is-running-as-service-or-in-an-interactive-s +func IsAnInteractiveSession() (bool, error) { + interSid, err := allocSid(windows.SECURITY_INTERACTIVE_RID) + if err != nil { + return false, err + } + defer windows.FreeSid(interSid) + + serviceSid, err := allocSid(windows.SECURITY_SERVICE_RID) + if err != nil { + return false, err + } + defer windows.FreeSid(serviceSid) + + t, err := windows.OpenCurrentProcessToken() + if err != nil { + return false, err + } + defer t.Close() + + gs, err := t.GetTokenGroups() + if err != nil { + return false, err + } + p := unsafe.Pointer(&gs.Groups[0]) + groups := (*[2 << 20]windows.SIDAndAttributes)(p)[:gs.GroupCount] + for _, g := range groups { + if windows.EqualSid(g.Sid, interSid) { + return true, nil + } + if windows.EqualSid(g.Sid, serviceSid) { + return false, nil + } + } + return false, nil +} diff --git a/vendor/golang.org/x/sys/windows/svc/service.go b/vendor/golang.org/x/sys/windows/svc/service.go new file mode 100644 index 0000000000..cda26b54b3 --- /dev/null +++ b/vendor/golang.org/x/sys/windows/svc/service.go @@ -0,0 +1,363 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build windows + +// Package svc provides everything required to build Windows service. +// +package svc + +import ( + "errors" + "runtime" + "syscall" + "unsafe" + + "golang.org/x/sys/windows" +) + +// State describes service execution state (Stopped, Running and so on). +type State uint32 + +const ( + Stopped = State(windows.SERVICE_STOPPED) + StartPending = State(windows.SERVICE_START_PENDING) + StopPending = State(windows.SERVICE_STOP_PENDING) + Running = State(windows.SERVICE_RUNNING) + ContinuePending = State(windows.SERVICE_CONTINUE_PENDING) + PausePending = State(windows.SERVICE_PAUSE_PENDING) + Paused = State(windows.SERVICE_PAUSED) +) + +// Cmd represents service state change request. It is sent to a service +// by the service manager, and should be actioned upon by the service. +type Cmd uint32 + +const ( + Stop = Cmd(windows.SERVICE_CONTROL_STOP) + Pause = Cmd(windows.SERVICE_CONTROL_PAUSE) + Continue = Cmd(windows.SERVICE_CONTROL_CONTINUE) + Interrogate = Cmd(windows.SERVICE_CONTROL_INTERROGATE) + Shutdown = Cmd(windows.SERVICE_CONTROL_SHUTDOWN) + ParamChange = Cmd(windows.SERVICE_CONTROL_PARAMCHANGE) + NetBindAdd = Cmd(windows.SERVICE_CONTROL_NETBINDADD) + NetBindRemove = Cmd(windows.SERVICE_CONTROL_NETBINDREMOVE) + NetBindEnable = Cmd(windows.SERVICE_CONTROL_NETBINDENABLE) + NetBindDisable = Cmd(windows.SERVICE_CONTROL_NETBINDDISABLE) + DeviceEvent = Cmd(windows.SERVICE_CONTROL_DEVICEEVENT) + HardwareProfileChange = Cmd(windows.SERVICE_CONTROL_HARDWAREPROFILECHANGE) + PowerEvent = Cmd(windows.SERVICE_CONTROL_POWEREVENT) + SessionChange = Cmd(windows.SERVICE_CONTROL_SESSIONCHANGE) +) + +// Accepted is used to describe commands accepted by the service. +// Note that Interrogate is always accepted. +type Accepted uint32 + +const ( + AcceptStop = Accepted(windows.SERVICE_ACCEPT_STOP) + AcceptShutdown = Accepted(windows.SERVICE_ACCEPT_SHUTDOWN) + AcceptPauseAndContinue = Accepted(windows.SERVICE_ACCEPT_PAUSE_CONTINUE) + AcceptParamChange = Accepted(windows.SERVICE_ACCEPT_PARAMCHANGE) + AcceptNetBindChange = Accepted(windows.SERVICE_ACCEPT_NETBINDCHANGE) + AcceptHardwareProfileChange = Accepted(windows.SERVICE_ACCEPT_HARDWAREPROFILECHANGE) + AcceptPowerEvent = Accepted(windows.SERVICE_ACCEPT_POWEREVENT) + AcceptSessionChange = Accepted(windows.SERVICE_ACCEPT_SESSIONCHANGE) +) + +// Status combines State and Accepted commands to fully describe running service. +type Status struct { + State State + Accepts Accepted + CheckPoint uint32 // used to report progress during a lengthy operation + WaitHint uint32 // estimated time required for a pending operation, in milliseconds +} + +// ChangeRequest is sent to the service Handler to request service status change. +type ChangeRequest struct { + Cmd Cmd + EventType uint32 + EventData uintptr + CurrentStatus Status +} + +// Handler is the interface that must be implemented to build Windows service. +type Handler interface { + + // Execute will be called by the package code at the start of + // the service, and the service will exit once Execute completes. + // Inside Execute you must read service change requests from r and + // act accordingly. You must keep service control manager up to date + // about state of your service by writing into s as required. + // args contains service name followed by argument strings passed + // to the service. + // You can provide service exit code in exitCode return parameter, + // with 0 being "no error". You can also indicate if exit code, + // if any, is service specific or not by using svcSpecificEC + // parameter. + Execute(args []string, r <-chan ChangeRequest, s chan<- Status) (svcSpecificEC bool, exitCode uint32) +} + +var ( + // These are used by asm code. + goWaitsH uintptr + cWaitsH uintptr + ssHandle uintptr + sName *uint16 + sArgc uintptr + sArgv **uint16 + ctlHandlerExProc uintptr + cSetEvent uintptr + cWaitForSingleObject uintptr + cRegisterServiceCtrlHandlerExW uintptr +) + +func init() { + k := syscall.MustLoadDLL("kernel32.dll") + cSetEvent = k.MustFindProc("SetEvent").Addr() + cWaitForSingleObject = k.MustFindProc("WaitForSingleObject").Addr() + a := syscall.MustLoadDLL("advapi32.dll") + cRegisterServiceCtrlHandlerExW = a.MustFindProc("RegisterServiceCtrlHandlerExW").Addr() +} + +// The HandlerEx prototype also has a context pointer but since we don't use +// it at start-up time we don't have to pass it over either. +type ctlEvent struct { + cmd Cmd + eventType uint32 + eventData uintptr + errno uint32 +} + +// service provides access to windows service api. +type service struct { + name string + h windows.Handle + cWaits *event + goWaits *event + c chan ctlEvent + handler Handler +} + +func newService(name string, handler Handler) (*service, error) { + var s service + var err error + s.name = name + s.c = make(chan ctlEvent) + s.handler = handler + s.cWaits, err = newEvent() + if err != nil { + return nil, err + } + s.goWaits, err = newEvent() + if err != nil { + s.cWaits.Close() + return nil, err + } + return &s, nil +} + +func (s *service) close() error { + s.cWaits.Close() + s.goWaits.Close() + return nil +} + +type exitCode struct { + isSvcSpecific bool + errno uint32 +} + +func (s *service) updateStatus(status *Status, ec *exitCode) error { + if s.h == 0 { + return errors.New("updateStatus with no service status handle") + } + var t windows.SERVICE_STATUS + t.ServiceType = windows.SERVICE_WIN32_OWN_PROCESS + t.CurrentState = uint32(status.State) + if status.Accepts&AcceptStop != 0 { + t.ControlsAccepted |= windows.SERVICE_ACCEPT_STOP + } + if status.Accepts&AcceptShutdown != 0 { + t.ControlsAccepted |= windows.SERVICE_ACCEPT_SHUTDOWN + } + if status.Accepts&AcceptPauseAndContinue != 0 { + t.ControlsAccepted |= windows.SERVICE_ACCEPT_PAUSE_CONTINUE + } + if status.Accepts&AcceptParamChange != 0 { + t.ControlsAccepted |= windows.SERVICE_ACCEPT_PARAMCHANGE + } + if status.Accepts&AcceptNetBindChange != 0 { + t.ControlsAccepted |= windows.SERVICE_ACCEPT_NETBINDCHANGE + } + if status.Accepts&AcceptHardwareProfileChange != 0 { + t.ControlsAccepted |= windows.SERVICE_ACCEPT_HARDWAREPROFILECHANGE + } + if status.Accepts&AcceptPowerEvent != 0 { + t.ControlsAccepted |= windows.SERVICE_ACCEPT_POWEREVENT + } + if status.Accepts&AcceptSessionChange != 0 { + t.ControlsAccepted |= windows.SERVICE_ACCEPT_SESSIONCHANGE + } + if ec.errno == 0 { + t.Win32ExitCode = windows.NO_ERROR + t.ServiceSpecificExitCode = windows.NO_ERROR + } else if ec.isSvcSpecific { + t.Win32ExitCode = uint32(windows.ERROR_SERVICE_SPECIFIC_ERROR) + t.ServiceSpecificExitCode = ec.errno + } else { + t.Win32ExitCode = ec.errno + t.ServiceSpecificExitCode = windows.NO_ERROR + } + t.CheckPoint = status.CheckPoint + t.WaitHint = status.WaitHint + return windows.SetServiceStatus(s.h, &t) +} + +const ( + sysErrSetServiceStatusFailed = uint32(syscall.APPLICATION_ERROR) + iota + sysErrNewThreadInCallback +) + +func (s *service) run() { + s.goWaits.Wait() + s.h = windows.Handle(ssHandle) + argv := (*[100]*int16)(unsafe.Pointer(sArgv))[:sArgc] + args := make([]string, len(argv)) + for i, a := range argv { + args[i] = syscall.UTF16ToString((*[1 << 20]uint16)(unsafe.Pointer(a))[:]) + } + + cmdsToHandler := make(chan ChangeRequest) + changesFromHandler := make(chan Status) + exitFromHandler := make(chan exitCode) + + go func() { + ss, errno := s.handler.Execute(args, cmdsToHandler, changesFromHandler) + exitFromHandler <- exitCode{ss, errno} + }() + + status := Status{State: Stopped} + ec := exitCode{isSvcSpecific: true, errno: 0} + var outch chan ChangeRequest + inch := s.c + var cmd Cmd + var evtype uint32 + var evdata uintptr +loop: + for { + select { + case r := <-inch: + if r.errno != 0 { + ec.errno = r.errno + break loop + } + inch = nil + outch = cmdsToHandler + cmd = r.cmd + evtype = r.eventType + evdata = r.eventData + case outch <- ChangeRequest{cmd, evtype, evdata, status}: + inch = s.c + outch = nil + case c := <-changesFromHandler: + err := s.updateStatus(&c, &ec) + if err != nil { + // best suitable error number + ec.errno = sysErrSetServiceStatusFailed + if err2, ok := err.(syscall.Errno); ok { + ec.errno = uint32(err2) + } + break loop + } + status = c + case ec = <-exitFromHandler: + break loop + } + } + + s.updateStatus(&Status{State: Stopped}, &ec) + s.cWaits.Set() +} + +func newCallback(fn interface{}) (cb uintptr, err error) { + defer func() { + r := recover() + if r == nil { + return + } + cb = 0 + switch v := r.(type) { + case string: + err = errors.New(v) + case error: + err = v + default: + err = errors.New("unexpected panic in syscall.NewCallback") + } + }() + return syscall.NewCallback(fn), nil +} + +// BUG(brainman): There is no mechanism to run multiple services +// inside one single executable. Perhaps, it can be overcome by +// using RegisterServiceCtrlHandlerEx Windows api. + +// Run executes service name by calling appropriate handler function. +func Run(name string, handler Handler) error { + runtime.LockOSThread() + + tid := windows.GetCurrentThreadId() + + s, err := newService(name, handler) + if err != nil { + return err + } + + ctlHandler := func(ctl uint32, evtype uint32, evdata uintptr, context uintptr) uintptr { + e := ctlEvent{cmd: Cmd(ctl), eventType: evtype, eventData: evdata} + // We assume that this callback function is running on + // the same thread as Run. Nowhere in MS documentation + // I could find statement to guarantee that. So putting + // check here to verify, otherwise things will go bad + // quickly, if ignored. + i := windows.GetCurrentThreadId() + if i != tid { + e.errno = sysErrNewThreadInCallback + } + s.c <- e + // Always return NO_ERROR (0) for now. + return 0 + } + + var svcmain uintptr + getServiceMain(&svcmain) + t := []windows.SERVICE_TABLE_ENTRY{ + {ServiceName: syscall.StringToUTF16Ptr(s.name), ServiceProc: svcmain}, + {ServiceName: nil, ServiceProc: 0}, + } + + goWaitsH = uintptr(s.goWaits.h) + cWaitsH = uintptr(s.cWaits.h) + sName = t[0].ServiceName + ctlHandlerExProc, err = newCallback(ctlHandler) + if err != nil { + return err + } + + go s.run() + + err = windows.StartServiceCtrlDispatcher(&t[0]) + if err != nil { + return err + } + return nil +} + +// StatusHandle returns service status handle. It is safe to call this function +// from inside the Handler.Execute because then it is guaranteed to be set. +// This code will have to change once multiple services are possible per process. +func StatusHandle() windows.Handle { + return windows.Handle(ssHandle) +} diff --git a/vendor/golang.org/x/sys/windows/svc/sys_386.s b/vendor/golang.org/x/sys/windows/svc/sys_386.s new file mode 100644 index 0000000000..2c82a9d91d --- /dev/null +++ b/vendor/golang.org/x/sys/windows/svc/sys_386.s @@ -0,0 +1,68 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build windows + +// func servicemain(argc uint32, argv **uint16) +TEXT ·servicemain(SB),7,$0 + MOVL argc+0(FP), AX + MOVL AX, ·sArgc(SB) + MOVL argv+4(FP), AX + MOVL AX, ·sArgv(SB) + + PUSHL BP + PUSHL BX + PUSHL SI + PUSHL DI + + SUBL $12, SP + + MOVL ·sName(SB), AX + MOVL AX, (SP) + MOVL $·servicectlhandler(SB), AX + MOVL AX, 4(SP) + MOVL $0, 8(SP) + MOVL ·cRegisterServiceCtrlHandlerExW(SB), AX + MOVL SP, BP + CALL AX + MOVL BP, SP + CMPL AX, $0 + JE exit + MOVL AX, ·ssHandle(SB) + + MOVL ·goWaitsH(SB), AX + MOVL AX, (SP) + MOVL ·cSetEvent(SB), AX + MOVL SP, BP + CALL AX + MOVL BP, SP + + MOVL ·cWaitsH(SB), AX + MOVL AX, (SP) + MOVL $-1, AX + MOVL AX, 4(SP) + MOVL ·cWaitForSingleObject(SB), AX + MOVL SP, BP + CALL AX + MOVL BP, SP + +exit: + ADDL $12, SP + + POPL DI + POPL SI + POPL BX + POPL BP + + MOVL 0(SP), CX + ADDL $12, SP + JMP CX + +// I do not know why, but this seems to be the only way to call +// ctlHandlerProc on Windows 7. + +// func servicectlhandler(ctl uint32, evtype uint32, evdata uintptr, context uintptr) uintptr { +TEXT ·servicectlhandler(SB),7,$0 + MOVL ·ctlHandlerExProc(SB), CX + JMP CX diff --git a/vendor/golang.org/x/sys/windows/svc/sys_amd64.s b/vendor/golang.org/x/sys/windows/svc/sys_amd64.s new file mode 100644 index 0000000000..bde25e9c48 --- /dev/null +++ b/vendor/golang.org/x/sys/windows/svc/sys_amd64.s @@ -0,0 +1,42 @@ +// Copyright 2012 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// +build windows + +// func servicemain(argc uint32, argv **uint16) +TEXT ·servicemain(SB),7,$0 + MOVL CX, ·sArgc(SB) + MOVQ DX, ·sArgv(SB) + + SUBQ $32, SP // stack for the first 4 syscall params + + MOVQ ·sName(SB), CX + MOVQ $·servicectlhandler(SB), DX + // BUG(pastarmovj): Figure out a way to pass in context in R8. + MOVQ ·cRegisterServiceCtrlHandlerExW(SB), AX + CALL AX + CMPQ AX, $0 + JE exit + MOVQ AX, ·ssHandle(SB) + + MOVQ ·goWaitsH(SB), CX + MOVQ ·cSetEvent(SB), AX + CALL AX + + MOVQ ·cWaitsH(SB), CX + MOVQ $4294967295, DX + MOVQ ·cWaitForSingleObject(SB), AX + CALL AX + +exit: + ADDQ $32, SP + RET + +// I do not know why, but this seems to be the only way to call +// ctlHandlerProc on Windows 7. + +// func ·servicectlhandler(ctl uint32, evtype uint32, evdata uintptr, context uintptr) uintptr { +TEXT ·servicectlhandler(SB),7,$0 + MOVQ ·ctlHandlerExProc(SB), AX + JMP AX diff --git a/vendor/golang.org/x/sys/windows/syscall.go b/vendor/golang.org/x/sys/windows/syscall.go index b07bc2305d..af828a91bc 100644 --- a/vendor/golang.org/x/sys/windows/syscall.go +++ b/vendor/golang.org/x/sys/windows/syscall.go @@ -11,11 +11,14 @@ // system, set $GOOS and $GOARCH to the desired system. For example, if // you want to view documentation for freebsd/arm on linux/amd64, set $GOOS // to freebsd and $GOARCH to arm. +// // The primary use of this package is inside other packages that provide a more // portable interface to the system, such as "os", "time" and "net". Use // those packages rather than this one if you can. +// // For details of the functions and data types in this package consult // the manuals for the appropriate operating system. +// // These calls return err == nil to indicate success; otherwise // err represents an operating system error describing the failure and // holds a value of type syscall.Errno. diff --git a/vendor/golang.org/x/sys/windows/types_windows.go b/vendor/golang.org/x/sys/windows/types_windows.go index 52c2037b68..7d2a6794db 100644 --- a/vendor/golang.org/x/sys/windows/types_windows.go +++ b/vendor/golang.org/x/sys/windows/types_windows.go @@ -94,16 +94,29 @@ const ( FILE_APPEND_DATA = 0x00000004 FILE_WRITE_ATTRIBUTES = 0x00000100 - FILE_SHARE_READ = 0x00000001 - FILE_SHARE_WRITE = 0x00000002 - FILE_SHARE_DELETE = 0x00000004 - FILE_ATTRIBUTE_READONLY = 0x00000001 - FILE_ATTRIBUTE_HIDDEN = 0x00000002 - FILE_ATTRIBUTE_SYSTEM = 0x00000004 - FILE_ATTRIBUTE_DIRECTORY = 0x00000010 - FILE_ATTRIBUTE_ARCHIVE = 0x00000020 - FILE_ATTRIBUTE_NORMAL = 0x00000080 - FILE_ATTRIBUTE_REPARSE_POINT = 0x00000400 + FILE_SHARE_READ = 0x00000001 + FILE_SHARE_WRITE = 0x00000002 + FILE_SHARE_DELETE = 0x00000004 + + FILE_ATTRIBUTE_READONLY = 0x00000001 + FILE_ATTRIBUTE_HIDDEN = 0x00000002 + FILE_ATTRIBUTE_SYSTEM = 0x00000004 + FILE_ATTRIBUTE_DIRECTORY = 0x00000010 + FILE_ATTRIBUTE_ARCHIVE = 0x00000020 + FILE_ATTRIBUTE_DEVICE = 0x00000040 + FILE_ATTRIBUTE_NORMAL = 0x00000080 + FILE_ATTRIBUTE_TEMPORARY = 0x00000100 + FILE_ATTRIBUTE_SPARSE_FILE = 0x00000200 + FILE_ATTRIBUTE_REPARSE_POINT = 0x00000400 + FILE_ATTRIBUTE_COMPRESSED = 0x00000800 + FILE_ATTRIBUTE_OFFLINE = 0x00001000 + FILE_ATTRIBUTE_NOT_CONTENT_INDEXED = 0x00002000 + FILE_ATTRIBUTE_ENCRYPTED = 0x00004000 + FILE_ATTRIBUTE_INTEGRITY_STREAM = 0x00008000 + FILE_ATTRIBUTE_VIRTUAL = 0x00010000 + FILE_ATTRIBUTE_NO_SCRUB_DATA = 0x00020000 + FILE_ATTRIBUTE_RECALL_ON_OPEN = 0x00040000 + FILE_ATTRIBUTE_RECALL_ON_DATA_ACCESS = 0x00400000 INVALID_FILE_ATTRIBUTES = 0xffffffff @@ -312,6 +325,14 @@ var ( OID_SGC_NETSCAPE = []byte("2.16.840.1.113730.4.1\x00") ) +// Pointer represents a pointer to an arbitrary Windows type. +// +// Pointer-typed fields may point to one of many different types. It's +// up to the caller to provide a pointer to the appropriate type, cast +// to Pointer. The caller must obey the unsafe.Pointer rules while +// doing so. +type Pointer *struct{} + // Invented values to support what package os expects. type Timeval struct { Sec int32 @@ -880,11 +901,15 @@ type MibIfRow struct { Descr [MAXLEN_IFDESCR]byte } +type CertInfo struct { + // Not implemented +} + type CertContext struct { EncodingType uint32 EncodedCert *byte Length uint32 - CertInfo uintptr + CertInfo *CertInfo Store Handle } @@ -899,12 +924,16 @@ type CertChainContext struct { RevocationFreshnessTime uint32 } +type CertTrustListInfo struct { + // Not implemented +} + type CertSimpleChain struct { Size uint32 TrustStatus CertTrustStatus NumElements uint32 Elements **CertChainElement - TrustListInfo uintptr + TrustListInfo *CertTrustListInfo HasRevocationFreshnessTime uint32 RevocationFreshnessTime uint32 } @@ -919,14 +948,18 @@ type CertChainElement struct { ExtendedErrorInfo *uint16 } +type CertRevocationCrlInfo struct { + // Not implemented +} + type CertRevocationInfo struct { Size uint32 RevocationResult uint32 RevocationOid *byte - OidSpecificInfo uintptr + OidSpecificInfo Pointer HasFreshnessTime uint32 FreshnessTime uint32 - CrlInfo uintptr // *CertRevocationCrlInfo + CrlInfo *CertRevocationCrlInfo } type CertTrustStatus struct { @@ -957,7 +990,7 @@ type CertChainPara struct { type CertChainPolicyPara struct { Size uint32 Flags uint32 - ExtraPolicyPara uintptr + ExtraPolicyPara Pointer } type SSLExtraCertChainPolicyPara struct { @@ -972,7 +1005,7 @@ type CertChainPolicyStatus struct { Error uint32 ChainIndex uint32 ElementIndex uint32 - ExtraPolicyStatus uintptr + ExtraPolicyStatus Pointer } const ( diff --git a/vendor/golang.org/x/sys/windows/zsyscall_windows.go b/vendor/golang.org/x/sys/windows/zsyscall_windows.go index c7b3b15ead..fc56aec035 100644 --- a/vendor/golang.org/x/sys/windows/zsyscall_windows.go +++ b/vendor/golang.org/x/sys/windows/zsyscall_windows.go @@ -1,4 +1,4 @@ -// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT +// Code generated by 'go generate'; DO NOT EDIT. package windows @@ -65,6 +65,7 @@ var ( procChangeServiceConfig2W = modadvapi32.NewProc("ChangeServiceConfig2W") procQueryServiceConfig2W = modadvapi32.NewProc("QueryServiceConfig2W") procEnumServicesStatusExW = modadvapi32.NewProc("EnumServicesStatusExW") + procQueryServiceStatusEx = modadvapi32.NewProc("QueryServiceStatusEx") procGetLastError = modkernel32.NewProc("GetLastError") procLoadLibraryW = modkernel32.NewProc("LoadLibraryW") procLoadLibraryExW = modkernel32.NewProc("LoadLibraryExW") @@ -472,6 +473,18 @@ func EnumServicesStatusEx(mgr Handle, infoLevel uint32, serviceType uint32, serv return } +func QueryServiceStatusEx(service Handle, infoLevel uint32, buff *byte, buffSize uint32, bytesNeeded *uint32) (err error) { + r1, _, e1 := syscall.Syscall6(procQueryServiceStatusEx.Addr(), 5, uintptr(service), uintptr(infoLevel), uintptr(unsafe.Pointer(buff)), uintptr(buffSize), uintptr(unsafe.Pointer(bytesNeeded)), 0) + if r1 == 0 { + if e1 != 0 { + err = errnoErr(e1) + } else { + err = syscall.EINVAL + } + } + return +} + func GetLastError() (lasterr error) { r0, _, _ := syscall.Syscall(procGetLastError.Addr(), 0, 0, 0, 0) if r0 != 0 {